`
// and attach a portal programmatically in the parent component. When Angular does the first CD
// round, it will fire the setter with empty string, causing the user's content to be cleared.
if (this.hasAttached() && !portal && !this._isInitialized) {
return;
}
if (this.hasAttached()) {
super.detach();
}
if (portal) {
super.attach(portal);
}
this._attachedPortal = portal;
}
/**
* Component or view reference that is attached to the portal.
* @return {?}
*/
get attachedRef() {
return this._attachedRef;
}
/**
* @return {?}
*/
ngOnInit() {
this._isInitialized = true;
}
/**
* @return {?}
*/
ngOnDestroy() {
super.dispose();
this._attachedPortal = null;
this._attachedRef = null;
}
/**
* Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.
*
* @template T
* @param {?} portal Portal to be attached to the portal outlet.
* @return {?} Reference to the created component.
*/
attachComponentPortal(portal) {
portal.setAttachedHost(this);
// If the portal specifies an origin, use that as the logical location of the component
// in the application tree. Otherwise use the location of this PortalOutlet.
/** @type {?} */
const viewContainerRef = portal.viewContainerRef != null ?
portal.viewContainerRef :
this._viewContainerRef;
/** @type {?} */
const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;
/** @type {?} */
const componentFactory = resolver.resolveComponentFactory(portal.component);
/** @type {?} */
const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector);
super.setDisposeFn(( /**
* @return {?}
*/() => ref.destroy()));
this._attachedPortal = portal;
this._attachedRef = ref;
this.attached.emit(ref);
return ref;
}
/**
* Attach the given TemplatePortal to this PortlHost as an embedded View.
* @template C
* @param {?} portal Portal to be attached.
* @return {?} Reference to the created embedded view.
*/
attachTemplatePortal(portal) {
portal.setAttachedHost(this);
/** @type {?} */
const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context);
super.setDisposeFn(( /**
* @return {?}
*/() => this._viewContainerRef.clear()));
this._attachedPortal = portal;
this._attachedRef = viewRef;
this.attached.emit(viewRef);
return viewRef;
}
}
CdkPortalOutlet.ɵfac = function CdkPortalOutlet_Factory(t) { return new (t || CdkPortalOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); };
CdkPortalOutlet.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkPortalOutlet, selectors: [["", "cdkPortalOutlet", ""]], inputs: { portal: ["cdkPortalOutlet", "portal"] }, outputs: { attached: "attached" }, exportAs: ["cdkPortalOutlet"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] });
return CdkPortalOutlet;
})();
let PortalHostDirective = /*@__PURE__*/ (() => {
class PortalHostDirective extends CdkPortalOutlet {
}
PortalHostDirective.ɵfac = function PortalHostDirective_Factory(t) { return ɵPortalHostDirective_BaseFactory(t || PortalHostDirective); };
PortalHostDirective.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: PortalHostDirective, selectors: [["", "cdkPortalHost", ""], ["", "portalHost", ""]], inputs: { portal: ["cdkPortalHost", "portal"] }, exportAs: ["cdkPortalHost"], features: [/*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{
provide: CdkPortalOutlet,
useExisting: PortalHostDirective
}]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] });
return PortalHostDirective;
})();
const ɵPortalHostDirective_BaseFactory = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵgetInheritedFactory"](PortalHostDirective);
let PortalModule = /*@__PURE__*/ (() => {
class PortalModule {
}
PortalModule.ɵmod = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: PortalModule });
PortalModule.ɵinj = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function PortalModule_Factory(t) { return new (t || PortalModule)(); } });
return PortalModule;
})();
/*@__PURE__*/ (function () {
(typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](PortalModule, { declarations: [CdkPortal,
CdkPortalOutlet,
TemplatePortalDirective,
PortalHostDirective], exports: [CdkPortal,
CdkPortalOutlet,
TemplatePortalDirective,
PortalHostDirective] });
})();
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Custom injector to be used when providing custom
* injection tokens to components inside a portal.
* \@docs-private
*/
class PortalInjector {
/**
* @param {?} _parentInjector
* @param {?} _customTokens
*/
constructor(_parentInjector, _customTokens) {
this._parentInjector = _parentInjector;
this._customTokens = _customTokens;
}
/**
* @param {?} token
* @param {?=} notFoundValue
* @return {?}
*/
get(token, notFoundValue) {
/** @type {?} */
const value = this._customTokens.get(token);
if (typeof value !== 'undefined') {
return value;
}
return this._parentInjector.get(token, notFoundValue);
}
}
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/***/ }),
/***/ "./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/scrolling.js":
/*!*********************************************************************!*\
!*** ./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/scrolling.js ***!
\*********************************************************************/
/*! exports provided: _fixedSizeVirtualScrollStrategyFactory, FixedSizeVirtualScrollStrategy, CdkFixedSizeVirtualScroll, SCROLL_DISPATCHER_PROVIDER_FACTORY, DEFAULT_SCROLL_TIME, ScrollDispatcher, SCROLL_DISPATCHER_PROVIDER, CdkScrollable, ScrollingModule, ScrollDispatchModule, VIEWPORT_RULER_PROVIDER_FACTORY, DEFAULT_RESIZE_TIME, ViewportRuler, VIEWPORT_RULER_PROVIDER, CdkVirtualForOf, VIRTUAL_SCROLL_STRATEGY, CdkVirtualScrollViewport */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_fixedSizeVirtualScrollStrategyFactory", function() { return _fixedSizeVirtualScrollStrategyFactory; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FixedSizeVirtualScrollStrategy", function() { return FixedSizeVirtualScrollStrategy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFixedSizeVirtualScroll", function() { return CdkFixedSizeVirtualScroll; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SCROLL_DISPATCHER_PROVIDER_FACTORY", function() { return SCROLL_DISPATCHER_PROVIDER_FACTORY; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_SCROLL_TIME", function() { return DEFAULT_SCROLL_TIME; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollDispatcher", function() { return ScrollDispatcher; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SCROLL_DISPATCHER_PROVIDER", function() { return SCROLL_DISPATCHER_PROVIDER; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkScrollable", function() { return CdkScrollable; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollingModule", function() { return ScrollingModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollDispatchModule", function() { return ScrollDispatchModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VIEWPORT_RULER_PROVIDER_FACTORY", function() { return VIEWPORT_RULER_PROVIDER_FACTORY; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_RESIZE_TIME", function() { return DEFAULT_RESIZE_TIME; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ViewportRuler", function() { return ViewportRuler; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VIEWPORT_RULER_PROVIDER", function() { return VIEWPORT_RULER_PROVIDER; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkVirtualForOf", function() { return CdkVirtualForOf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VIRTUAL_SCROLL_STRATEGY", function() { return VIRTUAL_SCROLL_STRATEGY; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkVirtualScrollViewport", function() { return CdkVirtualScrollViewport; });
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js");
/* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/coercion.js");
/* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js");
/* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js");
/* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/platform.js");
/* harmony import */ var _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/cdk/bidi */ "./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/bidi.js");
/* harmony import */ var _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/cdk/collections */ "./node_modules/@angular/cdk/__ivy_ngcc__/esm2015/collections.js");
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* The injection token used to specify the virtual scrolling strategy.
* @type {?}
*/
const _c0 = ["contentWrapper"];
const _c1 = ["*"];
const VIRTUAL_SCROLL_STRATEGY = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('VIRTUAL_SCROLL_STRATEGY');
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Virtual scrolling strategy for lists with items of known fixed size.
*/
class FixedSizeVirtualScrollStrategy {
/**
* @param {?} itemSize The size of the items in the virtually scrolling list.
* @param {?} minBufferPx The minimum amount of buffer (in pixels) before needing to render more
* @param {?} maxBufferPx The amount of buffer (in pixels) to render when rendering more.
*/
constructor(itemSize, minBufferPx, maxBufferPx) {
this._scrolledIndexChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
/**
* \@docs-private Implemented as part of VirtualScrollStrategy.
*/
this.scrolledIndexChange = this._scrolledIndexChange.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["distinctUntilChanged"])());
/**
* The attached viewport.
*/
this._viewport = null;
this._itemSize = itemSize;
this._minBufferPx = minBufferPx;
this._maxBufferPx = maxBufferPx;
}
/**
* Attaches this scroll strategy to a viewport.
* @param {?} viewport The viewport to attach this strategy to.
* @return {?}
*/
attach(viewport) {
this._viewport = viewport;
this._updateTotalContentSize();
this._updateRenderedRange();
}
/**
* Detaches this scroll strategy from the currently attached viewport.
* @return {?}
*/
detach() {
this._scrolledIndexChange.complete();
this._viewport = null;
}
/**
* Update the item size and buffer size.
* @param {?} itemSize The size of the items in the virtually scrolling list.
* @param {?} minBufferPx The minimum amount of buffer (in pixels) before needing to render more
* @param {?} maxBufferPx The amount of buffer (in pixels) to render when rendering more.
* @return {?}
*/
updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {
if (maxBufferPx < minBufferPx) {
throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');
}
this._itemSize = itemSize;
this._minBufferPx = minBufferPx;
this._maxBufferPx = maxBufferPx;
this._updateTotalContentSize();
this._updateRenderedRange();
}
/**
* \@docs-private Implemented as part of VirtualScrollStrategy.
* @return {?}
*/
onContentScrolled() {
this._updateRenderedRange();
}
/**
* \@docs-private Implemented as part of VirtualScrollStrategy.
* @return {?}
*/
onDataLengthChanged() {
this._updateTotalContentSize();
this._updateRenderedRange();
}
/**
* \@docs-private Implemented as part of VirtualScrollStrategy.
* @return {?}
*/
onContentRendered() { }
/**
* \@docs-private Implemented as part of VirtualScrollStrategy.
* @return {?}
*/
onRenderedOffsetChanged() { }
/**
* Scroll to the offset for the given index.
* @param {?} index The index of the element to scroll to.
* @param {?} behavior The ScrollBehavior to use when scrolling.
* @return {?}
*/
scrollToIndex(index, behavior) {
if (this._viewport) {
this._viewport.scrollToOffset(index * this._itemSize, behavior);
}
}
/**
* Update the viewport's total content size.
* @private
* @return {?}
*/
_updateTotalContentSize() {
if (!this._viewport) {
return;
}
this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);
}
/**
* Update the viewport's rendered range.
* @private
* @return {?}
*/
_updateRenderedRange() {
if (!this._viewport) {
return;
}
/** @type {?} */
const scrollOffset = this._viewport.measureScrollOffset();
/** @type {?} */
const firstVisibleIndex = scrollOffset / this._itemSize;
/** @type {?} */
const renderedRange = this._viewport.getRenderedRange();
/** @type {?} */
const newRange = { start: renderedRange.start, end: renderedRange.end };
/** @type {?} */
const viewportSize = this._viewport.getViewportSize();
/** @type {?} */
const dataLength = this._viewport.getDataLength();
/** @type {?} */
const startBuffer = scrollOffset - newRange.start * this._itemSize;
if (startBuffer < this._minBufferPx && newRange.start != 0) {
/** @type {?} */
const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);
newRange.start = Math.max(0, newRange.start - expandStart);
newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));
}
else {
/** @type {?} */
const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);
if (endBuffer < this._minBufferPx && newRange.end != dataLength) {
/** @type {?} */
const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);
if (expandEnd > 0) {
newRange.end = Math.min(dataLength, newRange.end + expandEnd);
newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));
}
}
}
this._viewport.setRenderedRange(newRange);
this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);
this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));
}
}
/**
* Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created
* `FixedSizeVirtualScrollStrategy` from the given directive.
* @param {?} fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the
* `FixedSizeVirtualScrollStrategy` from.
* @return {?}
*/
function _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {
return fixedSizeDir._scrollStrategy;
}
let CdkFixedSizeVirtualScroll = /*@__PURE__*/ (() => {
class CdkFixedSizeVirtualScroll {
constructor() {
this._itemSize = 20;
this._minBufferPx = 100;
this._maxBufferPx = 200;
/**
* The scroll strategy used by this directive.
*/
this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);
}
/**
* The size of the items in the list (in pixels).
* @return {?}
*/
get itemSize() { return this._itemSize; }
/**
* @param {?} value
* @return {?}
*/
set itemSize(value) { this._itemSize = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceNumberProperty"])(value); }
/**
* The minimum amount of buffer rendered beyond the viewport (in pixels).
* If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.
* @return {?}
*/
get minBufferPx() { return this._minBufferPx; }
/**
* @param {?} value
* @return {?}
*/
set minBufferPx(value) { this._minBufferPx = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceNumberProperty"])(value); }
/**
* The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.
* @return {?}
*/
get maxBufferPx() { return this._maxBufferPx; }
/**
* @param {?} value
* @return {?}
*/
set maxBufferPx(value) { this._maxBufferPx = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceNumberProperty"])(value); }
/**
* @return {?}
*/
ngOnChanges() {
this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);
}
}
CdkFixedSizeVirtualScroll.ɵfac = function CdkFixedSizeVirtualScroll_Factory(t) { return new (t || CdkFixedSizeVirtualScroll)(); };
CdkFixedSizeVirtualScroll.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkFixedSizeVirtualScroll, selectors: [["cdk-virtual-scroll-viewport", "itemSize", ""]], inputs: { itemSize: "itemSize", minBufferPx: "minBufferPx", maxBufferPx: "maxBufferPx" }, features: [/*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{
provide: VIRTUAL_SCROLL_STRATEGY,
useFactory: _fixedSizeVirtualScrollStrategyFactory,
deps: [/*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["forwardRef"])(( /**
* @return {?}
*/() => CdkFixedSizeVirtualScroll))]
}]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] });
return CdkFixedSizeVirtualScroll;
})();
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Time in ms to throttle the scrolling events by default.
* @type {?}
*/
const DEFAULT_SCROLL_TIME = 20;
let ScrollDispatcher = /*@__PURE__*/ (() => {
class ScrollDispatcher {
/**
* @param {?} _ngZone
* @param {?} _platform
*/
constructor(_ngZone, _platform) {
this._ngZone = _ngZone;
this._platform = _platform;
/**
* Subject for notifying that a registered scrollable reference element has been scrolled.
*/
this._scrolled = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
/**
* Keeps track of the global `scroll` and `resize` subscriptions.
*/
this._globalSubscription = null;
/**
* Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards.
*/
this._scrolledCount = 0;
/**
* Map of all the scrollable references that are registered with the service and their
* scroll event subscriptions.
*/
this.scrollContainers = new Map();
}
/**
* Registers a scrollable instance with the service and listens for its scrolled events. When the
* scrollable is scrolled, the service emits the event to its scrolled observable.
* @param {?} scrollable Scrollable instance to be registered.
* @return {?}
*/
register(scrollable) {
if (!this.scrollContainers.has(scrollable)) {
this.scrollContainers.set(scrollable, scrollable.elementScrolled()
.subscribe(( /**
* @return {?}
*/() => this._scrolled.next(scrollable))));
}
}
/**
* Deregisters a Scrollable reference and unsubscribes from its scroll event observable.
* @param {?} scrollable Scrollable instance to be deregistered.
* @return {?}
*/
deregister(scrollable) {
/** @type {?} */
const scrollableReference = this.scrollContainers.get(scrollable);
if (scrollableReference) {
scrollableReference.unsubscribe();
this.scrollContainers.delete(scrollable);
}
}
/**
* Returns an observable that emits an event whenever any of the registered Scrollable
* references (or window, document, or body) fire a scrolled event. Can provide a time in ms
* to override the default "throttle" time.
*
* **Note:** in order to avoid hitting change detection for every scroll event,
* all of the events emitted from this stream will be run outside the Angular zone.
* If you need to update any data bindings as a result of a scroll event, you have
* to run the callback using `NgZone.run`.
* @param {?=} auditTimeInMs
* @return {?}
*/
scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {
if (!this._platform.isBrowser) {
return Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["of"])();
}
return new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"](( /**
* @param {?} observer
* @return {?}
*/(observer) => {
if (!this._globalSubscription) {
this._addGlobalListener();
}
// In the case of a 0ms delay, use an observable without auditTime
// since it does add a perceptible delay in processing overhead.
/** @type {?} */
const subscription = auditTimeInMs > 0 ?
this._scrolled.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(auditTimeInMs)).subscribe(observer) :
this._scrolled.subscribe(observer);
this._scrolledCount++;
return ( /**
* @return {?}
*/() => {
subscription.unsubscribe();
this._scrolledCount--;
if (!this._scrolledCount) {
this._removeGlobalListener();
}
});
}));
}
/**
* @return {?}
*/
ngOnDestroy() {
this._removeGlobalListener();
this.scrollContainers.forEach(( /**
* @param {?} _
* @param {?} container
* @return {?}
*/(_, container) => this.deregister(container)));
this._scrolled.complete();
}
/**
* Returns an observable that emits whenever any of the
* scrollable ancestors of an element are scrolled.
* @param {?} elementRef Element whose ancestors to listen for.
* @param {?=} auditTimeInMs Time to throttle the scroll events.
* @return {?}
*/
ancestorScrolled(elementRef, auditTimeInMs) {
/** @type {?} */
const ancestors = this.getAncestorScrollContainers(elementRef);
return this.scrolled(auditTimeInMs).pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["filter"])(( /**
* @param {?} target
* @return {?}
*//**
* @param {?} target
* @return {?}
*/ target => {
return !target || ancestors.indexOf(target) > -1;
})));
}
/**
* Returns all registered Scrollables that contain the provided element.
* @param {?} elementRef
* @return {?}
*/
getAncestorScrollContainers(elementRef) {
/** @type {?} */
const scrollingContainers = [];
this.scrollContainers.forEach(( /**
* @param {?} _subscription
* @param {?} scrollable
* @return {?}
*/(_subscription, scrollable) => {
if (this._scrollableContainsElement(scrollable, elementRef)) {
scrollingContainers.push(scrollable);
}
}));
return scrollingContainers;
}
/**
* Returns true if the element is contained within the provided Scrollable.
* @private
* @param {?} scrollable
* @param {?} elementRef
* @return {?}
*/
_scrollableContainsElement(scrollable, elementRef) {
/** @type {?} */
let element = elementRef.nativeElement;
/** @type {?} */
let scrollableElement = scrollable.getElementRef().nativeElement;
// Traverse through the element parents until we reach null, checking if any of the elements
// are the scrollable's element.
do {
if (element == scrollableElement) {
return true;
}
} while (element = ( /** @type {?} */(element)).parentElement);
return false;
}
/**
* Sets up the global scroll listeners.
* @private
* @return {?}
*/
_addGlobalListener() {
this._globalSubscription = this._ngZone.runOutsideAngular(( /**
* @return {?}
*/() => {
return Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(window.document, 'scroll').subscribe(( /**
* @return {?}
*/() => this._scrolled.next()));
}));
}
/**
* Cleans up the global scroll listener.
* @private
* @return {?}
*/
_removeGlobalListener() {
if (this._globalSubscription) {
this._globalSubscription.unsubscribe();
this._globalSubscription = null;
}
}
}
ScrollDispatcher.ɵfac = function ScrollDispatcher_Factory(t) { return new (t || ScrollDispatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"])); };
ScrollDispatcher.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: ScrollDispatcher, factory: ScrollDispatcher.ɵfac, providedIn: 'root' });
/** @nocollapse */ ScrollDispatcher.ngInjectableDef = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function ScrollDispatcher_Factory() { return new ScrollDispatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"])); }, token: ScrollDispatcher, providedIn: "root" });
return ScrollDispatcher;
})();
/**
* \@docs-private \@deprecated \@breaking-change 8.0.0
* @param {?} parentDispatcher
* @param {?} ngZone
* @param {?} platform
* @return {?}
*/
function SCROLL_DISPATCHER_PROVIDER_FACTORY(parentDispatcher, ngZone, platform) {
return parentDispatcher || new ScrollDispatcher(ngZone, platform);
}
/**
* \@docs-private \@deprecated \@breaking-change 8.0.0
* @type {?}
*/
const SCROLL_DISPATCHER_PROVIDER = {
// If there is already a ScrollDispatcher available, use that. Otherwise, provide a new one.
provide: ScrollDispatcher,
deps: [[/*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"](), /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["SkipSelf"](), ScrollDispatcher], _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]],
useFactory: SCROLL_DISPATCHER_PROVIDER_FACTORY
};
let CdkScrollable = /*@__PURE__*/ (() => {
class CdkScrollable {
/**
* @param {?} elementRef
* @param {?} scrollDispatcher
* @param {?} ngZone
* @param {?=} dir
*/
constructor(elementRef, scrollDispatcher, ngZone, dir) {
this.elementRef = elementRef;
this.scrollDispatcher = scrollDispatcher;
this.ngZone = ngZone;
this.dir = dir;
this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
this._elementScrolled = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"](( /**
* @param {?} observer
* @return {?}
*/(observer) => this.ngZone.runOutsideAngular(( /**
* @return {?}
*/() => Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(this.elementRef.nativeElement, 'scroll').pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._destroyed))
.subscribe(observer)))));
}
/**
* @return {?}
*/
ngOnInit() {
this.scrollDispatcher.register(this);
}
/**
* @return {?}
*/
ngOnDestroy() {
this.scrollDispatcher.deregister(this);
this._destroyed.next();
this._destroyed.complete();
}
/**
* Returns observable that emits when a scroll event is fired on the host element.
* @return {?}
*/
elementScrolled() {
return this._elementScrolled;
}
/**
* Gets the ElementRef for the viewport.
* @return {?}
*/
getElementRef() {
return this.elementRef;
}
/**
* Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo
* method, since browsers are not consistent about what scrollLeft means in RTL. For this method
* left and right always refer to the left and right side of the scrolling container irrespective
* of the layout direction. start and end refer to left and right in an LTR context and vice-versa
* in an RTL context.
* @param {?} options specified the offsets to scroll to.
* @return {?}
*/
scrollTo(options) {
/** @type {?} */
const el = this.elementRef.nativeElement;
/** @type {?} */
const isRtl = this.dir && this.dir.value == 'rtl';
// Rewrite start & end offsets as right or left offsets.
options.left = options.left == null ? (isRtl ? options.end : options.start) : options.left;
options.right = options.right == null ? (isRtl ? options.start : options.end) : options.right;
// Rewrite the bottom offset as a top offset.
if (options.bottom != null) {
(( /** @type {?} */(options))).top =
el.scrollHeight - el.clientHeight - options.bottom;
}
// Rewrite the right offset as a left offset.
if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() != _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["RtlScrollAxisType"].NORMAL) {
if (options.left != null) {
(( /** @type {?} */(options))).right =
el.scrollWidth - el.clientWidth - options.left;
}
if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["RtlScrollAxisType"].INVERTED) {
options.left = options.right;
}
else if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["RtlScrollAxisType"].NEGATED) {
options.left = options.right ? -options.right : options.right;
}
}
else {
if (options.right != null) {
(( /** @type {?} */(options))).left =
el.scrollWidth - el.clientWidth - options.right;
}
}
this._applyScrollToOptions(options);
}
/**
* @private
* @param {?} options
* @return {?}
*/
_applyScrollToOptions(options) {
/** @type {?} */
const el = this.elementRef.nativeElement;
if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["supportsScrollBehavior"])()) {
el.scrollTo(options);
}
else {
if (options.top != null) {
el.scrollTop = options.top;
}
if (options.left != null) {
el.scrollLeft = options.left;
}
}
}
/**
* Measures the scroll offset relative to the specified edge of the viewport. This method can be
* used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent
* about what scrollLeft means in RTL. The values returned by this method are normalized such that
* left and right always refer to the left and right side of the scrolling container irrespective
* of the layout direction. start and end refer to left and right in an LTR context and vice-versa
* in an RTL context.
* @param {?} from The edge to measure from.
* @return {?}
*/
measureScrollOffset(from) {
/** @type {?} */
const LEFT = 'left';
/** @type {?} */
const RIGHT = 'right';
/** @type {?} */
const el = this.elementRef.nativeElement;
if (from == 'top') {
return el.scrollTop;
}
if (from == 'bottom') {
return el.scrollHeight - el.clientHeight - el.scrollTop;
}
// Rewrite start & end as left or right offsets.
/** @type {?} */
const isRtl = this.dir && this.dir.value == 'rtl';
if (from == 'start') {
from = isRtl ? RIGHT : LEFT;
}
else if (from == 'end') {
from = isRtl ? LEFT : RIGHT;
}
if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["RtlScrollAxisType"].INVERTED) {
// For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and
// 0 when scrolled all the way right.
if (from == LEFT) {
return el.scrollWidth - el.clientWidth - el.scrollLeft;
}
else {
return el.scrollLeft;
}
}
else if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["RtlScrollAxisType"].NEGATED) {
// For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and
// 0 when scrolled all the way right.
if (from == LEFT) {
return el.scrollLeft + el.scrollWidth - el.clientWidth;
}
else {
return -el.scrollLeft;
}
}
else {
// For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and
// (scrollWidth - clientWidth) when scrolled all the way right.
if (from == LEFT) {
return el.scrollLeft;
}
else {
return el.scrollWidth - el.clientWidth - el.scrollLeft;
}
}
}
}
CdkScrollable.ɵfac = function CdkScrollable_Factory(t) { return new (t || CdkScrollable)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](ScrollDispatcher), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["Directionality"], 8)); };
CdkScrollable.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkScrollable, selectors: [["", "cdk-scrollable", ""], ["", "cdkScrollable", ""]] });
return CdkScrollable;
})();
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Checks if the given ranges are equal.
* @param {?} r1
* @param {?} r2
* @return {?}
*/
function rangesEqual(r1, r2) {
return r1.start == r2.start && r1.end == r2.end;
}
/**
* Scheduler to be used for scroll events. Needs to fall back to
* something that doesn't rely on requestAnimationFrame on environments
* that don't support it (e.g. server-side rendering).
* @type {?}
*/
const SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? rxjs__WEBPACK_IMPORTED_MODULE_2__["animationFrameScheduler"] : rxjs__WEBPACK_IMPORTED_MODULE_2__["asapScheduler"];
let CdkVirtualScrollViewport = /*@__PURE__*/ (() => {
class CdkVirtualScrollViewport extends CdkScrollable {
/**
* @param {?} elementRef
* @param {?} _changeDetectorRef
* @param {?} ngZone
* @param {?} _scrollStrategy
* @param {?} dir
* @param {?} scrollDispatcher
*/
constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher) {
super(elementRef, scrollDispatcher, ngZone, dir);
this.elementRef = elementRef;
this._changeDetectorRef = _changeDetectorRef;
this._scrollStrategy = _scrollStrategy;
/**
* Emits when the viewport is detached from a CdkVirtualForOf.
*/
this._detachedSubject = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
/**
* Emits when the rendered range changes.
*/
this._renderedRangeSubject = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
this._orientation = 'vertical';
// Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll
// strategy lazily (i.e. only if the user is actually listening to the events). We do this because
// depending on how the strategy calculates the scrolled index, it may come at a cost to
// performance.
/**
* Emits when the index of the first element visible in the viewport changes.
*/
this.scrolledIndexChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"](( /**
* @param {?} observer
* @return {?}
*/(observer) => this._scrollStrategy.scrolledIndexChange.subscribe(( /**
* @param {?} index
* @return {?}
*//**
* @param {?} index
* @return {?}
*/ index => Promise.resolve().then(( /**
* @return {?}
*/() => this.ngZone.run(( /**
* @return {?}
*/() => observer.next(index)))))))));
/**
* A stream that emits whenever the rendered range changes.
*/
this.renderedRangeStream = this._renderedRangeSubject.asObservable();
/**
* The total size of all content (in pixels), including content that is not currently rendered.
*/
this._totalContentSize = 0;
/**
* A string representing the `style.width` property value to be used for the spacer element.
*/
this._totalContentWidth = '';
/**
* A string representing the `style.height` property value to be used for the spacer element.
*/
this._totalContentHeight = '';
/**
* The currently rendered range of indices.
*/
this._renderedRange = { start: 0, end: 0 };
/**
* The length of the data bound to this viewport (in number of items).
*/
this._dataLength = 0;
/**
* The size of the viewport (in pixels).
*/
this._viewportSize = 0;
/**
* The last rendered content offset that was set.
*/
this._renderedContentOffset = 0;
/**
* Whether the last rendered content offset was to the end of the content (and therefore needs to
* be rewritten as an offset to the start of the content).
*/
this._renderedContentOffsetNeedsRewrite = false;
/**
* Whether there is a pending change detection cycle.
*/
this._isChangeDetectionPending = false;
/**
* A list of functions to run after the next change detection cycle.
*/
this._runAfterChangeDetection = [];
if (!_scrollStrategy) {
throw Error('Error: cdk-virtual-scroll-viewport requires the "itemSize" property to be set.');
}
}
/**
* The direction the viewport scrolls.
* @return {?}
*/
get orientation() {
return this._orientation;
}
/**
* @param {?} orientation
* @return {?}
*/
set orientation(orientation) {
if (this._orientation !== orientation) {
this._orientation = orientation;
this._calculateSpacerSize();
}
}
/**
* @return {?}
*/
ngOnInit() {
super.ngOnInit();
// It's still too early to measure the viewport at this point. Deferring with a promise allows
// the Viewport to be rendered with the correct size before we measure. We run this outside the
// zone to avoid causing more change detection cycles. We handle the change detection loop
// ourselves instead.
this.ngZone.runOutsideAngular(( /**
* @return {?}
*/() => Promise.resolve().then(( /**
* @return {?}
*/() => {
this._measureViewportSize();
this._scrollStrategy.attach(this);
this.elementScrolled()
.pipe(
// Start off with a fake scroll event so we properly detect our initial position.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["startWith"])(( /** @type {?} */(null))),
// Collect multiple events into one until the next animation frame. This way if
// there are multiple scroll events in the same frame we only need to recheck
// our layout once.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(0, SCROLL_SCHEDULER))
.subscribe(( /**
* @return {?}
*/() => this._scrollStrategy.onContentScrolled()));
this._markChangeDetectionNeeded();
}))));
}
/**
* @return {?}
*/
ngOnDestroy() {
this.detach();
this._scrollStrategy.detach();
// Complete all subjects
this._renderedRangeSubject.complete();
this._detachedSubject.complete();
super.ngOnDestroy();
}
/**
* Attaches a `CdkVirtualForOf` to this viewport.
* @param {?} forOf
* @return {?}
*/
attach(forOf) {
if (this._forOf) {
throw Error('CdkVirtualScrollViewport is already attached.');
}
// Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length
// changes. Run outside the zone to avoid triggering change detection, since we're managing the
// change detection loop ourselves.
this.ngZone.runOutsideAngular(( /**
* @return {?}
*/() => {
this._forOf = forOf;
this._forOf.dataStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._detachedSubject)).subscribe(( /**
* @param {?} data
* @return {?}
*//**
* @param {?} data
* @return {?}
*/ data => {
/** @type {?} */
const newLength = data.length;
if (newLength !== this._dataLength) {
this._dataLength = newLength;
this._scrollStrategy.onDataLengthChanged();
}
this._doChangeDetection();
}));
}));
}
/**
* Detaches the current `CdkVirtualForOf`.
* @return {?}
*/
detach() {
this._forOf = null;
this._detachedSubject.next();
}
/**
* Gets the length of the data bound to this viewport (in number of items).
* @return {?}
*/
getDataLength() {
return this._dataLength;
}
/**
* Gets the size of the viewport (in pixels).
* @return {?}
*/
getViewportSize() {
return this._viewportSize;
}
// TODO(mmalerba): This is technically out of sync with what's really rendered until a render
// cycle happens. I'm being careful to only call it after the render cycle is complete and before
// setting it to something else, but its error prone and should probably be split into
// `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.
/**
* Get the current rendered range of items.
* @return {?}
*/
getRenderedRange() {
return this._renderedRange;
}
/**
* Sets the total size of all content (in pixels), including content that is not currently
* rendered.
* @param {?} size
* @return {?}
*/
setTotalContentSize(size) {
if (this._totalContentSize !== size) {
this._totalContentSize = size;
this._calculateSpacerSize();
this._markChangeDetectionNeeded();
}
}
/**
* Sets the currently rendered range of indices.
* @param {?} range
* @return {?}
*/
setRenderedRange(range) {
if (!rangesEqual(this._renderedRange, range)) {
this._renderedRangeSubject.next(this._renderedRange = range);
this._markChangeDetectionNeeded(( /**
* @return {?}
*/() => this._scrollStrategy.onContentRendered()));
}
}
/**
* Gets the offset from the start of the viewport to the start of the rendered data (in pixels).
* @return {?}
*/
getOffsetToRenderedContentStart() {
return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;
}
/**
* Sets the offset from the start of the viewport to either the start or end of the rendered data
* (in pixels).
* @param {?} offset
* @param {?=} to
* @return {?}
*/
setRenderedContentOffset(offset, to = 'to-start') {
// For a horizontal viewport in a right-to-left language we need to translate along the x-axis
// in the negative direction.
/** @type {?} */
const isRtl = this.dir && this.dir.value == 'rtl';
/** @type {?} */
const isHorizontal = this.orientation == 'horizontal';
/** @type {?} */
const axis = isHorizontal ? 'X' : 'Y';
/** @type {?} */
const axisDirection = isHorizontal && isRtl ? -1 : 1;
/** @type {?} */
let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;
this._renderedContentOffset = offset;
if (to === 'to-end') {
transform += ` translate${axis}(-100%)`;
// The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise
// elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would
// expand upward).
this._renderedContentOffsetNeedsRewrite = true;
}
if (this._renderedContentTransform != transform) {
// We know this value is safe because we parse `offset` with `Number()` before passing it
// into the string.
this._renderedContentTransform = transform;
this._markChangeDetectionNeeded(( /**
* @return {?}
*/() => {
if (this._renderedContentOffsetNeedsRewrite) {
this._renderedContentOffset -= this.measureRenderedContentSize();
this._renderedContentOffsetNeedsRewrite = false;
this.setRenderedContentOffset(this._renderedContentOffset);
}
else {
this._scrollStrategy.onRenderedOffsetChanged();
}
}));
}
}
/**
* Scrolls to the given offset from the start of the viewport. Please note that this is not always
* the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left
* direction, this would be the equivalent of setting a fictional `scrollRight` property.
* @param {?} offset The offset to scroll to.
* @param {?=} behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.
* @return {?}
*/
scrollToOffset(offset, behavior = 'auto') {
/** @type {?} */
const options = { behavior };
if (this.orientation === 'horizontal') {
options.start = offset;
}
else {
options.top = offset;
}
this.scrollTo(options);
}
/**
* Scrolls to the offset for the given index.
* @param {?} index The index of the element to scroll to.
* @param {?=} behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.
* @return {?}
*/
scrollToIndex(index, behavior = 'auto') {
this._scrollStrategy.scrollToIndex(index, behavior);
}
/**
* Gets the current scroll offset from the start of the viewport (in pixels).
* @param {?=} from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'
* in horizontal mode.
* @return {?}
*/
measureScrollOffset(from) {
return super.measureScrollOffset(from ? from : this.orientation === 'horizontal' ? 'start' : 'top');
}
/**
* Measure the combined size of all of the rendered items.
* @return {?}
*/
measureRenderedContentSize() {
/** @type {?} */
const contentEl = this._contentWrapper.nativeElement;
return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;
}
/**
* Measure the total combined size of the given range. Throws if the range includes items that are
* not rendered.
* @param {?} range
* @return {?}
*/
measureRangeSize(range) {
if (!this._forOf) {
return 0;
}
return this._forOf.measureRangeSize(range, this.orientation);
}
/**
* Update the viewport dimensions and re-render.
* @return {?}
*/
checkViewportSize() {
// TODO: Cleanup later when add logic for handling content resize
this._measureViewportSize();
this._scrollStrategy.onDataLengthChanged();
}
/**
* Measure the viewport size.
* @private
* @return {?}
*/
_measureViewportSize() {
/** @type {?} */
const viewportEl = this.elementRef.nativeElement;
this._viewportSize = this.orientation === 'horizontal' ?
viewportEl.clientWidth : viewportEl.clientHeight;
}
/**
* Queue up change detection to run.
* @private
* @param {?=} runAfter
* @return {?}
*/
_markChangeDetectionNeeded(runAfter) {
if (runAfter) {
this._runAfterChangeDetection.push(runAfter);
}
// Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of
// properties sequentially we only have to run `_doChangeDetection` once at the end.
if (!this._isChangeDetectionPending) {
this._isChangeDetectionPending = true;
this.ngZone.runOutsideAngular(( /**
* @return {?}
*/() => Promise.resolve().then(( /**
* @return {?}
*/() => {
this._doChangeDetection();
}))));
}
}
/**
* Run change detection.
* @private
* @return {?}
*/
_doChangeDetection() {
this._isChangeDetectionPending = false;
// Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection
// from the root, since the repeated items are content projected in. Calling `detectChanges`
// instead does not properly check the projected content.
this.ngZone.run(( /**
* @return {?}
*/() => this._changeDetectorRef.markForCheck()));
// Apply the content transform. The transform can't be set via an Angular binding because
// bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of
// string literals, a variable that can only be 'X' or 'Y', and user input that is run through
// the `Number` function first to coerce it to a numeric value.
this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;
/** @type {?} */
const runAfterChangeDetection = this._runAfterChangeDetection;
this._runAfterChangeDetection = [];
for (const fn of runAfterChangeDetection) {
fn();
}
}
/**
* Calculates the `style.width` and `style.height` for the spacer element.
* @private
* @return {?}
*/
_calculateSpacerSize() {
this._totalContentHeight =
this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;
this._totalContentWidth =
this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';
}
}
CdkVirtualScrollViewport.ɵfac = function CdkVirtualScrollViewport_Factory(t) { return new (t || CdkVirtualScrollViewport)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ChangeDetectorRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](VIRTUAL_SCROLL_STRATEGY, 8), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["Directionality"], 8), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](ScrollDispatcher)); };
CdkVirtualScrollViewport.ɵcmp = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineComponent"]({ type: CdkVirtualScrollViewport, selectors: [["cdk-virtual-scroll-viewport"]], viewQuery: function CdkVirtualScrollViewport_Query(rf, ctx) {
if (rf & 1) {
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵstaticViewQuery"](_c0, true);
}
if (rf & 2) {
var _t;
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵloadQuery"]()) && (ctx._contentWrapper = _t.first);
}
}, hostAttrs: [1, "cdk-virtual-scroll-viewport"], hostVars: 4, hostBindings: function CdkVirtualScrollViewport_HostBindings(rf, ctx) {
if (rf & 2) {
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵclassProp"]("cdk-virtual-scroll-orientation-horizontal", ctx.orientation === "horizontal")("cdk-virtual-scroll-orientation-vertical", ctx.orientation !== "horizontal");
}
}, inputs: { orientation: "orientation" }, outputs: { scrolledIndexChange: "scrolledIndexChange" }, features: [/*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{
provide: CdkScrollable,
useExisting: CdkVirtualScrollViewport
}]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]], ngContentSelectors: _c1, decls: 4, vars: 4, consts: [[1, "cdk-virtual-scroll-content-wrapper"], ["contentWrapper", ""], [1, "cdk-virtual-scroll-spacer"]], template: function CdkVirtualScrollViewport_Template(rf, ctx) {
if (rf & 1) {
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵprojectionDef"]();
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 0, 1);
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵprojection"](2);
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"]();
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](3, "div", 2);
}
if (rf & 2) {
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](3);
_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵstyleProp"]("width", ctx._totalContentWidth)("height", ctx._totalContentHeight);
}
}, styles: ["cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:0}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:0}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}"], encapsulation: 2, changeDetection: 0 });
return CdkVirtualScrollViewport;
})();
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Helper to extract size from a DOM Node.
* @param {?} orientation
* @param {?} node
* @return {?}
*/
function getSize(orientation, node) {
/** @type {?} */
const el = ( /** @type {?} */(node));
if (!el.getBoundingClientRect) {
return 0;
}
/** @type {?} */
const rect = el.getBoundingClientRect();
return orientation == 'horizontal' ? rect.width : rect.height;
}
let CdkVirtualForOf = /*@__PURE__*/ (() => {
class CdkVirtualForOf {
/**
* @param {?} _viewContainerRef
* @param {?} _template
* @param {?} _differs
* @param {?} _viewport
* @param {?} ngZone
*/
constructor(_viewContainerRef, _template, _differs, _viewport, ngZone) {
this._viewContainerRef = _viewContainerRef;
this._template = _template;
this._differs = _differs;
this._viewport = _viewport;
/**
* Emits when the rendered view of the data changes.
*/
this.viewChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
/**
* Subject that emits when a new DataSource instance is given.
*/
this._dataSourceChanges = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
/**
* The size of the cache used to store templates that are not being used for re-use later.
* Setting the cache size to `0` will disable caching. Defaults to 20 templates.
*/
this.cdkVirtualForTemplateCacheSize = 20;
/**
* Emits whenever the data in the current DataSource changes.
*/
this.dataStream = this._dataSourceChanges
.pipe(
// Start off with null `DataSource`.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["startWith"])(( /** @type {?} */(null))),
// Bundle up the previous and current data sources so we can work with both.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["pairwise"])(),
// Use `_changeDataSource` to disconnect from the previous data source and connect to the
// new one, passing back a stream of data changes which we run through `switchMap` to give
// us a data stream that emits the latest data from whatever the current `DataSource` is.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["switchMap"])(( /**
* @param {?} __0
* @return {?}
*/([prev, cur]) => this._changeDataSource(prev, cur))),
// Replay the last emitted data when someone subscribes.
Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["shareReplay"])(1));
/**
* The differ used to calculate changes to the data.
*/
this._differ = null;
/**
* The template cache used to hold on ot template instancess that have been stamped out, but don't
* currently need to be rendered. These instances will be reused in the future rather than
* stamping out brand new ones.
*/
this._templateCache = [];
/**
* Whether the rendered data should be updated during the next ngDoCheck cycle.
*/
this._needsUpdate = false;
this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"]();
this.dataStream.subscribe(( /**
* @param {?} data
* @return {?}
*//**
* @param {?} data
* @return {?}
*/ data => {
this._data = data;
this._onRenderedDataChange();
}));
this._viewport.renderedRangeStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._destroyed)).subscribe(( /**
* @param {?} range
* @return {?}
*//**
* @param {?} range
* @return {?}
*/ range => {
this._renderedRange = range;
ngZone.run(( /**
* @return {?}
*/() => this.viewChange.next(this._renderedRange)));
this._onRenderedDataChange();
}));
this._viewport.attach(this);
}
/**
* The DataSource to display.
* @return {?}
*/
get cdkVirtualForOf() {
return this._cdkVirtualForOf;
}
/**
* @param {?} value
* @return {?}
*/
set cdkVirtualForOf(value) {
this._cdkVirtualForOf = value;
/** @type {?} */
const ds = Object(_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_6__["isDataSource"])(value) ? value :
// Slice the value if its an NgIterable to ensure we're working with an array.
new _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_6__["ArrayDataSource"](value instanceof rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"] ? value : Array.prototype.slice.call(value || []));
this._dataSourceChanges.next(ds);
}
/**
* The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and
* the item and produces a value to be used as the item's identity when tracking changes.
* @return {?}
*/
get cdkVirtualForTrackBy() {
return this._cdkVirtualForTrackBy;
}
/**
* @param {?} fn
* @return {?}
*/
set cdkVirtualForTrackBy(fn) {
this._needsUpdate = true;
this._cdkVirtualForTrackBy = fn ?
( /**
* @param {?} index
* @param {?} item
* @return {?}
*/(index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)) :
undefined;
}
/**
* The template used to stamp out new elements.
* @param {?} value
* @return {?}
*/
set cdkVirtualForTemplate(value) {
if (value) {
this._needsUpdate = true;
this._template = value;
}
}
/**
* Measures the combined size (width for horizontal orientation, height for vertical) of all items
* in the specified range. Throws an error if the range includes items that are not currently
* rendered.
* @param {?} range
* @param {?} orientation
* @return {?}
*/
measureRangeSize(range, orientation) {
if (range.start >= range.end) {
return 0;
}
if (range.start < this._renderedRange.start || range.end > this._renderedRange.end) {
throw Error(`Error: attempted to measure an item that isn't rendered.`);
}
// The index into the list of rendered views for the first item in the range.
/** @type {?} */
const renderedStartIndex = range.start - this._renderedRange.start;
// The length of the range we're measuring.
/** @type {?} */
const rangeLen = range.end - range.start;
// Loop over all root nodes for all items in the range and sum up their size.
/** @type {?} */
let totalSize = 0;
/** @type {?} */
let i = rangeLen;
while (i--) {
/** @type {?} */
const view = ( /** @type {?} */(this._viewContainerRef.get(i + renderedStartIndex)));
/** @type {?} */
let j = view ? view.rootNodes.length : 0;
while (j--) {
totalSize += getSize(orientation, ( /** @type {?} */(view)).rootNodes[j]);
}
}
return totalSize;
}
/**
* @return {?}
*/
ngDoCheck() {
if (this._differ && this._needsUpdate) {
// TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of
// this list being rendered (can use simpler algorithm) vs needs update due to data actually
// changing (need to do this diff).
/** @type {?} */
const changes = this._differ.diff(this._renderedItems);
if (!changes) {
this._updateContext();
}
else {
this._applyChanges(changes);
}
this._needsUpdate = false;
}
}
/**
* @return {?}
*/
ngOnDestroy() {
this._viewport.detach();
this._dataSourceChanges.next();
this._dataSourceChanges.complete();
this.viewChange.complete();
this._destroyed.next();
this._destroyed.complete();
for (let view of this._templateCache) {
view.destroy();
}
}
/**
* React to scroll state changes in the viewport.
* @private
* @return {?}
*/
_onRenderedDataChange() {
if (!this._renderedRange) {
return;
}
this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);
if (!this._differ) {
this._differ = this._differs.find(this._renderedItems).create(this.cdkVirtualForTrackBy);
}
this._needsUpdate = true;
}
/**
* Swap out one `DataSource` for another.
* @private
* @param {?} oldDs
* @param {?} newDs
* @return {?}
*/
_changeDataSource(oldDs, newDs) {
if (oldDs) {
oldDs.disconnect(this);
}
this._needsUpdate = true;
return newDs ? newDs.connect(this) : Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["of"])();
}
/**
* Update the `CdkVirtualForOfContext` for all views.
* @private
* @return {?}
*/
_updateContext() {
/** @type {?} */
const count = this._data.length;
/** @type {?} */
let i = this._viewContainerRef.length;
while (i--) {
/** @type {?} */
let view = ( /** @type {?} */(this._viewContainerRef.get(i)));
view.context.index = this._renderedRange.start + i;
view.context.count = count;
this._updateComputedContextProperties(view.context);
view.detectChanges();
}
}
/**
* Apply changes to the DOM.
* @private
* @param {?} changes
* @return {?}
*/
_applyChanges(changes) {
// Rearrange the views to put them in the right location.
changes.forEachOperation(( /**
* @param {?} record
* @param {?} adjustedPreviousIndex
* @param {?} currentIndex
* @return {?}
*/(record, adjustedPreviousIndex, currentIndex) => {
if (record.previousIndex == null) { // Item added.
// Item added.
/** @type {?} */
const view = this._insertViewForNewItem(( /** @type {?} */(currentIndex)));
view.context.$implicit = record.item;
}
else if (currentIndex == null) { // Item removed.
this._cacheView(this._detachView(( /** @type {?} */(adjustedPreviousIndex))));
}
else { // Item moved.
// Item moved.
/** @type {?} */
const view = ( /** @type {?} */(this._viewContainerRef.get(( /** @type {?} */(adjustedPreviousIndex)))));
this._viewContainerRef.move(view, currentIndex);
view.context.$implicit = record.item;
}
}));
// Update $implicit for any items that had an identity change.
changes.forEachIdentityChange(( /**
* @param {?} record
* @return {?}
*/(record) => {
/** @type {?} */
const view = ( /** @type {?} */(this._viewContainerRef.get(( /** @type {?} */(record.currentIndex)))));
view.context.$implicit = record.item;
}));
// Update the context variables on all items.
/** @type {?} */
const count = this._data.length;
/** @type {?} */
let i = this._viewContainerRef.length;
while (i--) {
/** @type {?} */
const view = ( /** @type {?} */(this._viewContainerRef.get(i)));
view.context.index = this._renderedRange.start + i;
view.context.count = count;
this._updateComputedContextProperties(view.context);
}
}
/**
* Cache the given detached view.
* @private
* @param {?} view
* @return {?}
*/
_cacheView(view) {
if (this._templateCache.length < this.cdkVirtualForTemplateCacheSize) {
this._templateCache.push(view);
}
else {
/** @type {?} */
const index = this._viewContainerRef.indexOf(view);
// It's very unlikely that the index will ever be -1, but just in case,
// destroy the view on its own, otherwise destroy it through the
// container to ensure that all the references are removed.
if (index === -1) {
view.destroy();
}
else {
this._viewContainerRef.remove(index);
}
}
}
/**
* Inserts a view for a new item, either from the cache or by creating a new one.
* @private
* @param {?} index
* @return {?}
*/
_insertViewForNewItem(index) {
return this._insertViewFromCache(index) || this._createEmbeddedViewAt(index);
}
/**
* Update the computed properties on the `CdkVirtualForOfContext`.
* @private
* @param {?} context
* @return {?}
*/
_updateComputedContextProperties(context) {
context.first = context.index === 0;
context.last = context.index === context.count - 1;
context.even = context.index % 2 === 0;
context.odd = !context.even;
}
/**
* Creates a new embedded view and moves it to the given index
* @private
* @param {?} index
* @return {?}
*/
_createEmbeddedViewAt(index) {
// Note that it's important that we insert the item directly at the proper index,
// rather than inserting it and the moving it in place, because if there's a directive
// on the same node that injects the `ViewContainerRef`, Angular will insert another
// comment node which can throw off the move when it's being repeated for all items.
return this._viewContainerRef.createEmbeddedView(this._template, {
$implicit: ( /** @type {?} */(null)),
cdkVirtualForOf: this._cdkVirtualForOf,
index: -1,
count: -1,
first: false,
last: false,
odd: false,
even: false
}, index);
}
/**
* Inserts a recycled view from the cache at the given index.
* @private
* @param {?} index
* @return {?}
*/
_insertViewFromCache(index) {
/** @type {?} */
const cachedView = this._templateCache.pop();
if (cachedView) {
this._viewContainerRef.insert(cachedView, index);
}
return cachedView || null;
}
/**
* Detaches the embedded view at the given index.
* @private
* @param {?} index
* @return {?}
*/
_detachView(index) {
return ( /** @type {?} */(this._viewContainerRef.detach(index)));
}
}
CdkVirtualForOf.ɵfac = function CdkVirtualForOf_Factory(t) { return new (t || CdkVirtualForOf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](CdkVirtualScrollViewport, 4), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"])); };
CdkVirtualForOf.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkVirtualForOf, selectors: [["", "cdkVirtualFor", "", "cdkVirtualForOf", ""]], inputs: { cdkVirtualForTemplateCacheSize: "cdkVirtualForTemplateCacheSize", cdkVirtualForOf: "cdkVirtualForOf", cdkVirtualForTrackBy: "cdkVirtualForTrackBy", cdkVirtualForTemplate: "cdkVirtualForTemplate" } });
return CdkVirtualForOf;
})();
let ScrollingModule = /*@__PURE__*/ (() => {
class ScrollingModule {
}
ScrollingModule.ɵmod = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: ScrollingModule });
ScrollingModule.ɵinj = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function ScrollingModule_Factory(t) { return new (t || ScrollingModule)(); }, imports: [[_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["BidiModule"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["PlatformModule"]],
_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["BidiModule"]] });
return ScrollingModule;
})();
/*@__PURE__*/ (function () {
(typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](ScrollingModule, { declarations: function () {
return [CdkFixedSizeVirtualScroll,
CdkScrollable,
CdkVirtualForOf,
CdkVirtualScrollViewport];
}, imports: function () { return [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["BidiModule"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["PlatformModule"]]; }, exports: function () {
return [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_5__["BidiModule"],
CdkFixedSizeVirtualScroll,
CdkScrollable,
CdkVirtualForOf,
CdkVirtualScrollViewport];
} });
})();
let ScrollDispatchModule = /*@__PURE__*/ (() => {
class ScrollDispatchModule {
}
ScrollDispatchModule.ɵmod = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: ScrollDispatchModule });
ScrollDispatchModule.ɵinj = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function ScrollDispatchModule_Factory(t) { return new (t || ScrollDispatchModule)(); }, imports: [[ScrollingModule],
ScrollingModule] });
return ScrollDispatchModule;
})();
/*@__PURE__*/ (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](ScrollDispatchModule, { imports: [ScrollingModule], exports: [ScrollingModule] }); })();
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Time in ms to throttle the resize events by default.
* @type {?}
*/
const DEFAULT_RESIZE_TIME = 20;
let ViewportRuler = /*@__PURE__*/ (() => {
class ViewportRuler {
/**
* @param {?} _platform
* @param {?} ngZone
*/
constructor(_platform, ngZone) {
this._platform = _platform;
ngZone.runOutsideAngular(( /**
* @return {?}
*/() => {
this._change = _platform.isBrowser ?
Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["merge"])(Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(window, 'resize'), Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(window, 'orientationchange')) :
Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["of"])();
// Note that we need to do the subscription inside `runOutsideAngular`
// since subscribing is what causes the event listener to be added.
this._invalidateCache = this.change().subscribe(( /**
* @return {?}
*/() => this._updateViewportSize()));
}));
}
/**
* @return {?}
*/
ngOnDestroy() {
this._invalidateCache.unsubscribe();
}
/**
* Returns the viewport's width and height.
* @return {?}
*/
getViewportSize() {
if (!this._viewportSize) {
this._updateViewportSize();
}
/** @type {?} */
const output = { width: this._viewportSize.width, height: this._viewportSize.height };
// If we're not on a browser, don't cache the size since it'll be mocked out anyway.
if (!this._platform.isBrowser) {
this._viewportSize = ( /** @type {?} */(null));
}
return output;
}
/**
* Gets a ClientRect for the viewport's bounds.
* @return {?}
*/
getViewportRect() {
// Use the document element's bounding rect rather than the window scroll properties
// (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll
// properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different
// conceptual viewports. Under most circumstances these viewports are equivalent, but they
// can disagree when the page is pinch-zoomed (on devices that support touch).
// See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4
// We use the documentElement instead of the body because, by default (without a css reset)
// browsers typically give the document body an 8px margin, which is not included in
// getBoundingClientRect().
/** @type {?} */
const scrollPosition = this.getViewportScrollPosition();
const { width, height } = this.getViewportSize();
return {
top: scrollPosition.top,
left: scrollPosition.left,
bottom: scrollPosition.top + height,
right: scrollPosition.left + width,
height,
width,
};
}
/**
* Gets the (top, left) scroll position of the viewport.
* @return {?}
*/
getViewportScrollPosition() {
// While we can get a reference to the fake document
// during SSR, it doesn't have getBoundingClientRect.
if (!this._platform.isBrowser) {
return { top: 0, left: 0 };
}
// The top-left-corner of the viewport is determined by the scroll position of the document
// body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about
// whether `document.body` or `document.documentElement` is the scrolled element, so reading
// `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of
// `document.documentElement` works consistently, where the `top` and `left` values will
// equal negative the scroll position.
/** @type {?} */
const documentElement = ( /** @type {?} */(document.documentElement));
/** @type {?} */
const documentRect = documentElement.getBoundingClientRect();
/** @type {?} */
const top = -documentRect.top || document.body.scrollTop || window.scrollY ||
documentElement.scrollTop || 0;
/** @type {?} */
const left = -documentRect.left || document.body.scrollLeft || window.scrollX ||
documentElement.scrollLeft || 0;
return { top, left };
}
/**
* Returns a stream that emits whenever the size of the viewport changes.
* @param {?=} throttleTime Time in milliseconds to throttle the stream.
* @return {?}
*/
change(throttleTime = DEFAULT_RESIZE_TIME) {
return throttleTime > 0 ? this._change.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(throttleTime)) : this._change;
}
/**
* Updates the cached viewport size.
* @private
* @return {?}
*/
_updateViewportSize() {
this._viewportSize = this._platform.isBrowser ?
{ width: window.innerWidth, height: window.innerHeight } :
{ width: 0, height: 0 };
}
}
ViewportRuler.ɵfac = function ViewportRuler_Factory(t) { return new (t || ViewportRuler)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"])); };
ViewportRuler.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: ViewportRuler, factory: ViewportRuler.ɵfac, providedIn: 'root' });
/** @nocollapse */ ViewportRuler.ngInjectableDef = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function ViewportRuler_Factory() { return new ViewportRuler(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"])); }, token: ViewportRuler, providedIn: "root" });
return ViewportRuler;
})();
/**
* \@docs-private \@deprecated \@breaking-change 8.0.0
* @param {?} parentRuler
* @param {?} platform
* @param {?} ngZone
* @return {?}
*/
function VIEWPORT_RULER_PROVIDER_FACTORY(parentRuler, platform, ngZone) {
return parentRuler || new ViewportRuler(platform, ngZone);
}
/**
* \@docs-private \@deprecated \@breaking-change 8.0.0
* @type {?}
*/
const VIEWPORT_RULER_PROVIDER = {
// If there is already a ViewportRuler available, use that. Otherwise, provide a new one.
provide: ViewportRuler,
deps: [[/*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"](), /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["SkipSelf"](), ViewportRuler], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"], _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"]],
useFactory: VIEWPORT_RULER_PROVIDER_FACTORY
};
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* @suppress {checkTypes,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/***/ }),
/***/ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js":
/*!**********************************************************************!*\
!*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js ***!
\**********************************************************************/
/*! exports provided: APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, ɵBrowserPlatformLocation, ɵDomAdapter, ɵNullViewportScroller, ɵPLATFORM_BROWSER_ID, ɵPLATFORM_SERVER_ID, ɵPLATFORM_WORKER_APP_ID, ɵPLATFORM_WORKER_UI_ID, ɵangular_packages_common_common_a, ɵangular_packages_common_common_b, ɵangular_packages_common_common_c, ɵangular_packages_common_common_d, ɵangular_packages_common_common_e, ɵangular_packages_common_common_f, ɵgetDOM, ɵparseCookieValue, ɵsetRootDomAdapter */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "APP_BASE_HREF", function() { return APP_BASE_HREF; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AsyncPipe", function() { return AsyncPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CommonModule", function() { return CommonModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CurrencyPipe", function() { return CurrencyPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DOCUMENT", function() { return DOCUMENT; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DatePipe", function() { return DatePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DecimalPipe", function() { return DecimalPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FormStyle", function() { return FormStyle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FormatWidth", function() { return FormatWidth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HashLocationStrategy", function() { return HashLocationStrategy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "I18nPluralPipe", function() { return I18nPluralPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "I18nSelectPipe", function() { return I18nSelectPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonPipe", function() { return JsonPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "KeyValuePipe", function() { return KeyValuePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LOCATION_INITIALIZED", function() { return LOCATION_INITIALIZED; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Location", function() { return Location; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LocationStrategy", function() { return LocationStrategy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LowerCasePipe", function() { return LowerCasePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgClass", function() { return NgClass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgComponentOutlet", function() { return NgComponentOutlet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgForOf", function() { return NgForOf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgForOfContext", function() { return NgForOfContext; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgIf", function() { return NgIf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgIfContext", function() { return NgIfContext; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgLocaleLocalization", function() { return NgLocaleLocalization; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgLocalization", function() { return NgLocalization; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgPlural", function() { return NgPlural; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgPluralCase", function() { return NgPluralCase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgStyle", function() { return NgStyle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitch", function() { return NgSwitch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitchCase", function() { return NgSwitchCase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitchDefault", function() { return NgSwitchDefault; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgTemplateOutlet", function() { return NgTemplateOutlet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NumberFormatStyle", function() { return NumberFormatStyle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NumberSymbol", function() { return NumberSymbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PathLocationStrategy", function() { return PathLocationStrategy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PercentPipe", function() { return PercentPipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PlatformLocation", function() { return PlatformLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Plural", function() { return Plural; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SlicePipe", function() { return SlicePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TitleCasePipe", function() { return TitleCasePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TranslationWidth", function() { return TranslationWidth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "UpperCasePipe", function() { return UpperCasePipe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VERSION", function() { return VERSION; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ViewportScroller", function() { return ViewportScroller; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "WeekDay", function() { return WeekDay; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatCurrency", function() { return formatCurrency; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatDate", function() { return formatDate; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatNumber", function() { return formatNumber; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatPercent", function() { return formatPercent; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getCurrencySymbol", function() { return getCurrencySymbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencyCode", function() { return getLocaleCurrencyCode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencyName", function() { return getLocaleCurrencyName; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencySymbol", function() { return getLocaleCurrencySymbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDateFormat", function() { return getLocaleDateFormat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDateTimeFormat", function() { return getLocaleDateTimeFormat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDayNames", function() { return getLocaleDayNames; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDayPeriods", function() { return getLocaleDayPeriods; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleEraNames", function() { return getLocaleEraNames; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleExtraDayPeriodRules", function() { return getLocaleExtraDayPeriodRules; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleExtraDayPeriods", function() { return getLocaleExtraDayPeriods; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleFirstDayOfWeek", function() { return getLocaleFirstDayOfWeek; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleId", function() { return getLocaleId; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleMonthNames", function() { return getLocaleMonthNames; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleNumberFormat", function() { return getLocaleNumberFormat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleNumberSymbol", function() { return getLocaleNumberSymbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocalePluralCase", function() { return getLocalePluralCase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleTimeFormat", function() { return getLocaleTimeFormat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleWeekEndRange", function() { return getLocaleWeekEndRange; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getNumberOfCurrencyDigits", function() { return getNumberOfCurrencyDigits; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformBrowser", function() { return isPlatformBrowser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformServer", function() { return isPlatformServer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformWorkerApp", function() { return isPlatformWorkerApp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformWorkerUi", function() { return isPlatformWorkerUi; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "registerLocaleData", function() { return registerLocaleData; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵBrowserPlatformLocation", function() { return BrowserPlatformLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵDomAdapter", function() { return DomAdapter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵNullViewportScroller", function() { return NullViewportScroller; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_BROWSER_ID", function() { return PLATFORM_BROWSER_ID; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_SERVER_ID", function() { return PLATFORM_SERVER_ID; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_WORKER_APP_ID", function() { return PLATFORM_WORKER_APP_ID; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_WORKER_UI_ID", function() { return PLATFORM_WORKER_UI_ID; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_a", function() { return useBrowserPlatformLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_b", function() { return createBrowserPlatformLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_c", function() { return createLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_d", function() { return provideLocationStrategy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_e", function() { return COMMON_DIRECTIVES; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_f", function() { return COMMON_PIPES; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵgetDOM", function() { return getDOM; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵparseCookieValue", function() { return parseCookieValue; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵsetRootDomAdapter", function() { return setRootDomAdapter; });
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js");
/**
* @license Angular v9.0.7
* (c) 2010-2020 Google LLC. https://angular.io/
* License: MIT
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/dom_adapter.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/** @type {?} */
let _DOM = ( /** @type {?} */(null));
/**
* @return {?}
*/
function getDOM() {
return _DOM;
}
/**
* @param {?} adapter
* @return {?}
*/
function setDOM(adapter) {
_DOM = adapter;
}
/**
* @param {?} adapter
* @return {?}
*/
function setRootDomAdapter(adapter) {
if (!_DOM) {
_DOM = adapter;
}
}
/* tslint:disable:requireParameterType */
/**
* Provides DOM operations in an environment-agnostic way.
*
* \@security Tread carefully! Interacting with the DOM directly is dangerous and
* can introduce XSS risks.
* @abstract
*/
class DomAdapter {
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/dom_tokens.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* A DI Token representing the main rendering context. In a browser this is the DOM Document.
*
* Note: Document might not be available in the Application Context when Application and Rendering
* Contexts are not the same (e.g. when running the application in a Web Worker).
*
* \@publicApi
* @type {?}
*/
const DOCUMENT = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('DocumentToken');
let PlatformLocation = /*@__PURE__*/ (() => {
class PlatformLocation {
}
PlatformLocation.ɵfac = function PlatformLocation_Factory(t) { return new (t || PlatformLocation)(); };
/** @nocollapse */ PlatformLocation.ɵprov = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: useBrowserPlatformLocation, token: PlatformLocation, providedIn: "platform" });
return PlatformLocation;
})();
if (false) {}
/**
* @return {?}
*/
function useBrowserPlatformLocation() {
return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(BrowserPlatformLocation);
}
/**
* \@description
* Indicates when a location is initialized.
*
* \@publicApi
* @type {?}
*/
const LOCATION_INITIALIZED = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('Location Initialized');
/**
* \@description
* A serializable version of the event from `onPopState` or `onHashChange`
*
* \@publicApi
* @record
*/
function LocationChangeEvent() { }
if (false) {}
/**
* \@publicApi
* @record
*/
function LocationChangeListener() { }
let BrowserPlatformLocation = /*@__PURE__*/ (() => {
class BrowserPlatformLocation extends PlatformLocation {
/**
* @param {?} _doc
*/
constructor(_doc) {
super();
this._doc = _doc;
this._init();
}
// This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it
/**
* \@internal
* @return {?}
*/
_init() {
(( /** @type {?} */(this))).location = getDOM().getLocation();
this._history = getDOM().getHistory();
}
/**
* @return {?}
*/
getBaseHrefFromDOM() { return ( /** @type {?} */(getDOM().getBaseHref(this._doc))); }
/**
* @param {?} fn
* @return {?}
*/
onPopState(fn) {
getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('popstate', fn, false);
}
/**
* @param {?} fn
* @return {?}
*/
onHashChange(fn) {
getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('hashchange', fn, false);
}
/**
* @return {?}
*/
get href() { return this.location.href; }
/**
* @return {?}
*/
get protocol() { return this.location.protocol; }
/**
* @return {?}
*/
get hostname() { return this.location.hostname; }
/**
* @return {?}
*/
get port() { return this.location.port; }
/**
* @return {?}
*/
get pathname() { return this.location.pathname; }
/**
* @return {?}
*/
get search() { return this.location.search; }
/**
* @return {?}
*/
get hash() { return this.location.hash; }
/**
* @param {?} newPath
* @return {?}
*/
set pathname(newPath) { this.location.pathname = newPath; }
/**
* @param {?} state
* @param {?} title
* @param {?} url
* @return {?}
*/
pushState(state, title, url) {
if (supportsState()) {
this._history.pushState(state, title, url);
}
else {
this.location.hash = url;
}
}
/**
* @param {?} state
* @param {?} title
* @param {?} url
* @return {?}
*/
replaceState(state, title, url) {
if (supportsState()) {
this._history.replaceState(state, title, url);
}
else {
this.location.hash = url;
}
}
/**
* @return {?}
*/
forward() { this._history.forward(); }
/**
* @return {?}
*/
back() { this._history.back(); }
/**
* @return {?}
*/
getState() { return this._history.state; }
}
BrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) { return new (t || BrowserPlatformLocation)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](DOCUMENT)); };
/** @nocollapse */ BrowserPlatformLocation.ɵprov = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createBrowserPlatformLocation, token: BrowserPlatformLocation, providedIn: "platform" });
return BrowserPlatformLocation;
})();
if (false) {}
/**
* @return {?}
*/
function supportsState() {
return !!window.history.pushState;
}
/**
* @return {?}
*/
function createBrowserPlatformLocation() {
return new BrowserPlatformLocation(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT));
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/private_export.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/location/util.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Joins two parts of a URL with a slash if needed.
*
* @param {?} start URL string
* @param {?} end URL string
*
*
* @return {?} The joined URL string.
*/
function joinWithSlash(start, end) {
if (start.length == 0) {
return end;
}
if (end.length == 0) {
return start;
}
/** @type {?} */
let slashes = 0;
if (start.endsWith('/')) {
slashes++;
}
if (end.startsWith('/')) {
slashes++;
}
if (slashes == 2) {
return start + end.substring(1);
}
if (slashes == 1) {
return start + end;
}
return start + '/' + end;
}
/**
* Removes a trailing slash from a URL string if needed.
* Looks for the first occurrence of either `#`, `?`, or the end of the
* line as `/` characters and removes the trailing slash if one exists.
*
* @param {?} url URL string.
*
* @return {?} The URL string, modified if needed.
*/
function stripTrailingSlash(url) {
/** @type {?} */
const match = url.match(/#|\?|$/);
/** @type {?} */
const pathEndIdx = match && match.index || url.length;
/** @type {?} */
const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);
return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);
}
/**
* Normalizes URL parameters by prepending with `?` if needed.
*
* @param {?} params String of URL parameters.
*
* @return {?} The normalized URL parameters string.
*/
function normalizeQueryParams(params) {
return params && params[0] !== '?' ? '?' + params : params;
}
let LocationStrategy = /*@__PURE__*/ (() => {
class LocationStrategy {
}
LocationStrategy.ɵfac = function LocationStrategy_Factory(t) { return new (t || LocationStrategy)(); };
/** @nocollapse */ LocationStrategy.ɵprov = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: provideLocationStrategy, token: LocationStrategy, providedIn: "root" });
return LocationStrategy;
})();
if (false) {}
/**
* @param {?} platformLocation
* @return {?}
*/
function provideLocationStrategy(platformLocation) {
// See #23917
/** @type {?} */
const location = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT).location;
return new PathLocationStrategy(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(( /** @type {?} */(PlatformLocation))), location && location.origin || '');
}
/**
* A predefined [DI token](guide/glossary#di-token) for the base href
* to be used with the `PathLocationStrategy`.
* The base href is the URL prefix that should be preserved when generating
* and recognizing URLs.
*
* \@usageNotes
*
* The following example shows how to use this token to configure the root app injector
* with a base href value, so that the DI framework can supply the dependency anywhere in the app.
*
* ```typescript
* import {Component, NgModule} from '\@angular/core';
* import {APP_BASE_HREF} from '\@angular/common';
*
* \@NgModule({
* providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]
* })
* class AppModule {}
* ```
*
* \@publicApi
* @type {?}
*/
const APP_BASE_HREF = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('appBaseHref');
let PathLocationStrategy = /*@__PURE__*/ (() => {
class PathLocationStrategy extends LocationStrategy {
/**
* @param {?} _platformLocation
* @param {?=} href
*/
constructor(_platformLocation, href) {
super();
this._platformLocation = _platformLocation;
if (href == null) {
href = this._platformLocation.getBaseHrefFromDOM();
}
if (href == null) {
throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);
}
this._baseHref = href;
}
/**
* @param {?} fn
* @return {?}
*/
onPopState(fn) {
this._platformLocation.onPopState(fn);
this._platformLocation.onHashChange(fn);
}
/**
* @return {?}
*/
getBaseHref() { return this._baseHref; }
/**
* @param {?} internal
* @return {?}
*/
prepareExternalUrl(internal) { return joinWithSlash(this._baseHref, internal); }
/**
* @param {?=} includeHash
* @return {?}
*/
path(includeHash = false) {
/** @type {?} */
const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);
/** @type {?} */
const hash = this._platformLocation.hash;
return hash && includeHash ? `${pathname}${hash}` : pathname;
}
/**
* @param {?} state
* @param {?} title
* @param {?} url
* @param {?} queryParams
* @return {?}
*/
pushState(state, title, url, queryParams) {
/** @type {?} */
const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
this._platformLocation.pushState(state, title, externalUrl);
}
/**
* @param {?} state
* @param {?} title
* @param {?} url
* @param {?} queryParams
* @return {?}
*/
replaceState(state, title, url, queryParams) {
/** @type {?} */
const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
this._platformLocation.replaceState(state, title, externalUrl);
}
/**
* @return {?}
*/
forward() { this._platformLocation.forward(); }
/**
* @return {?}
*/
back() { this._platformLocation.back(); }
}
PathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) { return new (t || PathLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); };
PathLocationStrategy.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: PathLocationStrategy, factory: PathLocationStrategy.ɵfac });
return PathLocationStrategy;
})();
if (false) {}
let HashLocationStrategy = /*@__PURE__*/ (() => {
class HashLocationStrategy extends LocationStrategy {
/**
* @param {?} _platformLocation
* @param {?=} _baseHref
*/
constructor(_platformLocation, _baseHref) {
super();
this._platformLocation = _platformLocation;
this._baseHref = '';
if (_baseHref != null) {
this._baseHref = _baseHref;
}
}
/**
* @param {?} fn
* @return {?}
*/
onPopState(fn) {
this._platformLocation.onPopState(fn);
this._platformLocation.onHashChange(fn);
}
/**
* @return {?}
*/
getBaseHref() { return this._baseHref; }
/**
* @param {?=} includeHash
* @return {?}
*/
path(includeHash = false) {
// the hash value is always prefixed with a `#`
// and if it is empty then it will stay empty
/** @type {?} */
let path = this._platformLocation.hash;
if (path == null)
path = '#';
return path.length > 0 ? path.substring(1) : path;
}
/**
* @param {?} internal
* @return {?}
*/
prepareExternalUrl(internal) {
/** @type {?} */
const url = joinWithSlash(this._baseHref, internal);
return url.length > 0 ? ('#' + url) : url;
}
/**
* @param {?} state
* @param {?} title
* @param {?} path
* @param {?} queryParams
* @return {?}
*/
pushState(state, title, path, queryParams) {
/** @type {?} */
let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
if (url.length == 0) {
url = this._platformLocation.pathname;
}
this._platformLocation.pushState(state, title, url);
}
/**
* @param {?} state
* @param {?} title
* @param {?} path
* @param {?} queryParams
* @return {?}
*/
replaceState(state, title, path, queryParams) {
/** @type {?} */
let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
if (url.length == 0) {
url = this._platformLocation.pathname;
}
this._platformLocation.replaceState(state, title, url);
}
/**
* @return {?}
*/
forward() { this._platformLocation.forward(); }
/**
* @return {?}
*/
back() { this._platformLocation.back(); }
}
HashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) { return new (t || HashLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); };
HashLocationStrategy.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: HashLocationStrategy, factory: HashLocationStrategy.ɵfac });
return HashLocationStrategy;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/location/location.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* \@publicApi
* @record
*/
function PopStateEvent() { }
if (false) {}
let Location = /*@__PURE__*/ (() => {
class Location {
/**
* @param {?} platformStrategy
* @param {?} platformLocation
*/
constructor(platformStrategy, platformLocation) {
/**
* \@internal
*/
this._subject = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"]();
/**
* \@internal
*/
this._urlChangeListeners = [];
this._platformStrategy = platformStrategy;
/** @type {?} */
const browserBaseHref = this._platformStrategy.getBaseHref();
this._platformLocation = platformLocation;
this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));
this._platformStrategy.onPopState(( /**
* @param {?} ev
* @return {?}
*/(ev) => {
this._subject.emit({
'url': this.path(true),
'pop': true,
'state': ev.state,
'type': ev.type,
});
}));
}
/**
* Normalizes the URL path for this location.
*
* @param {?=} includeHash True to include an anchor fragment in the path.
*
* @return {?} The normalized URL path.
*/
// TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is
// removed.
path(includeHash = false) {
return this.normalize(this._platformStrategy.path(includeHash));
}
/**
* Reports the current state of the location history.
* @return {?} The current value of the `history.state` object.
*/
getState() { return this._platformLocation.getState(); }
/**
* Normalizes the given path and compares to the current normalized path.
*
* @param {?} path The given URL path.
* @param {?=} query Query parameters.
*
* @return {?} True if the given URL path is equal to the current normalized path, false
* otherwise.
*/
isCurrentPathEqualTo(path, query = '') {
return this.path() == this.normalize(path + normalizeQueryParams(query));
}
/**
* Normalizes a URL path by stripping any trailing slashes.
*
* @param {?} url String representing a URL.
*
* @return {?} The normalized URL string.
*/
normalize(url) {
return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));
}
/**
* Normalizes an external URL path.
* If the given URL doesn't begin with a leading slash (`'/'`), adds one
* before normalizing. Adds a hash if `HashLocationStrategy` is
* in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.
*
* @param {?} url String representing a URL.
*
* @return {?} A normalized platform-specific URL.
*/
prepareExternalUrl(url) {
if (url && url[0] !== '/') {
url = '/' + url;
}
return this._platformStrategy.prepareExternalUrl(url);
}
// TODO: rename this method to pushState
/**
* Changes the browser's URL to a normalized version of a given URL, and pushes a
* new item onto the platform's history.
*
* @param {?} path URL path to normalize.
* @param {?=} query Query parameters.
* @param {?=} state Location history state.
*
* @return {?}
*/
go(path, query = '', state = null) {
this._platformStrategy.pushState(state, '', path, query);
this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
}
/**
* Changes the browser's URL to a normalized version of the given URL, and replaces
* the top item on the platform's history stack.
*
* @param {?} path URL path to normalize.
* @param {?=} query Query parameters.
* @param {?=} state Location history state.
* @return {?}
*/
replaceState(path, query = '', state = null) {
this._platformStrategy.replaceState(state, '', path, query);
this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
}
/**
* Navigates forward in the platform's history.
* @return {?}
*/
forward() { this._platformStrategy.forward(); }
/**
* Navigates back in the platform's history.
* @return {?}
*/
back() { this._platformStrategy.back(); }
/**
* Registers a URL change listener. Use to catch updates performed by the Angular
* framework that are not detectible through "popstate" or "hashchange" events.
*
* @param {?} fn The change handler function, which take a URL and a location history state.
* @return {?}
*/
onUrlChange(fn) {
this._urlChangeListeners.push(fn);
this.subscribe(( /**
* @param {?} v
* @return {?}
*//**
* @param {?} v
* @return {?}
*/ v => { this._notifyUrlChangeListeners(v.url, v.state); }));
}
/**
* \@internal
* @param {?=} url
* @param {?=} state
* @return {?}
*/
_notifyUrlChangeListeners(url = '', state) {
this._urlChangeListeners.forEach(( /**
* @param {?} fn
* @return {?}
*//**
* @param {?} fn
* @return {?}
*/ fn => fn(url, state)));
}
/**
* Subscribes to the platform's `popState` events.
*
* @param {?} onNext
* @param {?=} onThrow
* @param {?=} onReturn
* @return {?} Subscribed events.
*/
subscribe(onNext, onThrow, onReturn) {
return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });
}
}
Location.ɵfac = function Location_Factory(t) { return new (t || Location)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](LocationStrategy), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation)); };
/**
* Normalizes URL parameters by prepending with `?` if needed.
*
* @param params String of URL parameters.
*
* @return The normalized URL parameters string.
*/
Location.normalizeQueryParams = normalizeQueryParams;
/**
* Joins two parts of a URL with a slash if needed.
*
* @param start URL string
* @param end URL string
*
*
* @return The joined URL string.
*/
Location.joinWithSlash = joinWithSlash;
/**
* Removes a trailing slash from a URL string if needed.
* Looks for the first occurrence of either `#`, `?`, or the end of the
* line as `/` characters and removes the trailing slash if one exists.
*
* @param url URL string.
*
* @return The URL string, modified if needed.
*/
Location.stripTrailingSlash = stripTrailingSlash;
/** @nocollapse */ Location.ɵprov = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createLocation, token: Location, providedIn: "root" });
return Location;
})();
if (false) {}
/**
* @return {?}
*/
function createLocation() {
return new Location(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(( /** @type {?} */(LocationStrategy))), Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(( /** @type {?} */(PlatformLocation))));
}
/**
* @param {?} baseHref
* @param {?} url
* @return {?}
*/
function _stripBaseHref(baseHref, url) {
return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;
}
/**
* @param {?} url
* @return {?}
*/
function _stripIndexHtml(url) {
return url.replace(/\/index.html$/, '');
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/location/index.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/currencies.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
// THIS CODE IS GENERATED - DO NOT MODIFY
// See angular/tools/gulp-tasks/cldr/extract.js
/**
* \@internal
* @type {?}
*/
const CURRENCIES_EN = {
'ADP': [undefined, undefined, 0],
'AFN': [undefined, undefined, 0],
'ALL': [undefined, undefined, 0],
'AMD': [undefined, undefined, 2],
'AOA': [undefined, 'Kz'],
'ARS': [undefined, '$'],
'AUD': ['A$', '$'],
'BAM': [undefined, 'KM'],
'BBD': [undefined, '$'],
'BDT': [undefined, '৳'],
'BHD': [undefined, undefined, 3],
'BIF': [undefined, undefined, 0],
'BMD': [undefined, '$'],
'BND': [undefined, '$'],
'BOB': [undefined, 'Bs'],
'BRL': ['R$'],
'BSD': [undefined, '$'],
'BWP': [undefined, 'P'],
'BYN': [undefined, 'р.', 2],
'BYR': [undefined, undefined, 0],
'BZD': [undefined, '$'],
'CAD': ['CA$', '$', 2],
'CHF': [undefined, undefined, 2],
'CLF': [undefined, undefined, 4],
'CLP': [undefined, '$', 0],
'CNY': ['CN¥', '¥'],
'COP': [undefined, '$', 2],
'CRC': [undefined, '₡', 2],
'CUC': [undefined, '$'],
'CUP': [undefined, '$'],
'CZK': [undefined, 'Kč', 2],
'DJF': [undefined, undefined, 0],
'DKK': [undefined, 'kr', 2],
'DOP': [undefined, '$'],
'EGP': [undefined, 'E£'],
'ESP': [undefined, '₧', 0],
'EUR': ['€'],
'FJD': [undefined, '$'],
'FKP': [undefined, '£'],
'GBP': ['£'],
'GEL': [undefined, '₾'],
'GIP': [undefined, '£'],
'GNF': [undefined, 'FG', 0],
'GTQ': [undefined, 'Q'],
'GYD': [undefined, '$', 2],
'HKD': ['HK$', '$'],
'HNL': [undefined, 'L'],
'HRK': [undefined, 'kn'],
'HUF': [undefined, 'Ft', 2],
'IDR': [undefined, 'Rp', 2],
'ILS': ['₪'],
'INR': ['₹'],
'IQD': [undefined, undefined, 0],
'IRR': [undefined, undefined, 0],
'ISK': [undefined, 'kr', 0],
'ITL': [undefined, undefined, 0],
'JMD': [undefined, '$'],
'JOD': [undefined, undefined, 3],
'JPY': ['¥', undefined, 0],
'KHR': [undefined, '៛'],
'KMF': [undefined, 'CF', 0],
'KPW': [undefined, '₩', 0],
'KRW': ['₩', undefined, 0],
'KWD': [undefined, undefined, 3],
'KYD': [undefined, '$'],
'KZT': [undefined, '₸'],
'LAK': [undefined, '₭', 0],
'LBP': [undefined, 'L£', 0],
'LKR': [undefined, 'Rs'],
'LRD': [undefined, '$'],
'LTL': [undefined, 'Lt'],
'LUF': [undefined, undefined, 0],
'LVL': [undefined, 'Ls'],
'LYD': [undefined, undefined, 3],
'MGA': [undefined, 'Ar', 0],
'MGF': [undefined, undefined, 0],
'MMK': [undefined, 'K', 0],
'MNT': [undefined, '₮', 2],
'MRO': [undefined, undefined, 0],
'MUR': [undefined, 'Rs', 2],
'MXN': ['MX$', '$'],
'MYR': [undefined, 'RM'],
'NAD': [undefined, '$'],
'NGN': [undefined, '₦'],
'NIO': [undefined, 'C$'],
'NOK': [undefined, 'kr', 2],
'NPR': [undefined, 'Rs'],
'NZD': ['NZ$', '$'],
'OMR': [undefined, undefined, 3],
'PHP': [undefined, '₱'],
'PKR': [undefined, 'Rs', 2],
'PLN': [undefined, 'zł'],
'PYG': [undefined, '₲', 0],
'RON': [undefined, 'lei'],
'RSD': [undefined, undefined, 0],
'RUB': [undefined, '₽'],
'RUR': [undefined, 'р.'],
'RWF': [undefined, 'RF', 0],
'SBD': [undefined, '$'],
'SEK': [undefined, 'kr', 2],
'SGD': [undefined, '$'],
'SHP': [undefined, '£'],
'SLL': [undefined, undefined, 0],
'SOS': [undefined, undefined, 0],
'SRD': [undefined, '$'],
'SSP': [undefined, '£'],
'STD': [undefined, undefined, 0],
'STN': [undefined, 'Db'],
'SYP': [undefined, '£', 0],
'THB': [undefined, '฿'],
'TMM': [undefined, undefined, 0],
'TND': [undefined, undefined, 3],
'TOP': [undefined, 'T$'],
'TRL': [undefined, undefined, 0],
'TRY': [undefined, '₺'],
'TTD': [undefined, '$'],
'TWD': ['NT$', '$', 2],
'TZS': [undefined, undefined, 2],
'UAH': [undefined, '₴'],
'UGX': [undefined, undefined, 0],
'USD': ['$'],
'UYI': [undefined, undefined, 0],
'UYU': [undefined, '$'],
'UYW': [undefined, undefined, 4],
'UZS': [undefined, undefined, 2],
'VEF': [undefined, 'Bs', 2],
'VND': ['₫', undefined, 0],
'VUV': [undefined, undefined, 0],
'XAF': ['FCFA', undefined, 0],
'XCD': ['EC$', '$'],
'XOF': ['CFA', undefined, 0],
'XPF': ['CFPF', undefined, 0],
'XXX': ['¤'],
'YER': [undefined, undefined, 0],
'ZAR': [undefined, 'R'],
'ZMK': [undefined, undefined, 0],
'ZMW': [undefined, 'ZK'],
'ZWD': [undefined, undefined, 0]
};
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/locale_data_api.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/** @enum {number} */
const NumberFormatStyle = /*@__PURE__*/ (function () {
var NumberFormatStyle = {
Decimal: 0,
Percent: 1,
Currency: 2,
Scientific: 3,
};
NumberFormatStyle[NumberFormatStyle.Decimal] = 'Decimal';
NumberFormatStyle[NumberFormatStyle.Percent] = 'Percent';
NumberFormatStyle[NumberFormatStyle.Currency] = 'Currency';
NumberFormatStyle[NumberFormatStyle.Scientific] = 'Scientific';
return NumberFormatStyle;
}());
/** @enum {number} */
const Plural = /*@__PURE__*/ (function () {
var Plural = {
Zero: 0,
One: 1,
Two: 2,
Few: 3,
Many: 4,
Other: 5,
};
Plural[Plural.Zero] = 'Zero';
Plural[Plural.One] = 'One';
Plural[Plural.Two] = 'Two';
Plural[Plural.Few] = 'Few';
Plural[Plural.Many] = 'Many';
Plural[Plural.Other] = 'Other';
return Plural;
}());
/** @enum {number} */
const FormStyle = /*@__PURE__*/ (function () {
var FormStyle = {
Format: 0,
Standalone: 1,
};
FormStyle[FormStyle.Format] = 'Format';
FormStyle[FormStyle.Standalone] = 'Standalone';
return FormStyle;
}());
/** @enum {number} */
const TranslationWidth = /*@__PURE__*/ (function () {
var TranslationWidth = {
/** 1 character for `en-US`. For example: 'S' */
Narrow: 0,
/** 3 characters for `en-US`. For example: 'Sun' */
Abbreviated: 1,
/** Full length for `en-US`. For example: "Sunday" */
Wide: 2,
/** 2 characters for `en-US`, For example: "Su" */
Short: 3,
};
TranslationWidth[TranslationWidth.Narrow] = 'Narrow';
TranslationWidth[TranslationWidth.Abbreviated] = 'Abbreviated';
TranslationWidth[TranslationWidth.Wide] = 'Wide';
TranslationWidth[TranslationWidth.Short] = 'Short';
return TranslationWidth;
}());
/** @enum {number} */
const FormatWidth = /*@__PURE__*/ (function () {
var FormatWidth = {
/**
* For `en-US`, 'M/d/yy, h:mm a'`
* (Example: `6/15/15, 9:03 AM`)
*/
Short: 0,
/**
* For `en-US`, `'MMM d, y, h:mm:ss a'`
* (Example: `Jun 15, 2015, 9:03:01 AM`)
*/
Medium: 1,
/**
* For `en-US`, `'MMMM d, y, h:mm:ss a z'`
* (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)
*/
Long: 2,
/**
* For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`
* (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)
*/
Full: 3,
};
FormatWidth[FormatWidth.Short] = 'Short';
FormatWidth[FormatWidth.Medium] = 'Medium';
FormatWidth[FormatWidth.Long] = 'Long';
FormatWidth[FormatWidth.Full] = 'Full';
return FormatWidth;
}());
/** @enum {number} */
const NumberSymbol = /*@__PURE__*/ (function () {
var NumberSymbol = {
/**
* Decimal separator.
* For `en-US`, the dot character.
* Example : 2,345`.`67
*/
Decimal: 0,
/**
* Grouping separator, typically for thousands.
* For `en-US`, the comma character.
* Example: 2`,`345.67
*/
Group: 1,
/**
* List-item separator.
* Example: "one, two, and three"
*/
List: 2,
/**
* Sign for percentage (out of 100).
* Example: 23.4%
*/
PercentSign: 3,
/**
* Sign for positive numbers.
* Example: +23
*/
PlusSign: 4,
/**
* Sign for negative numbers.
* Example: -23
*/
MinusSign: 5,
/**
* Computer notation for exponential value (n times a power of 10).
* Example: 1.2E3
*/
Exponential: 6,
/**
* Human-readable format of exponential.
* Example: 1.2x103
*/
SuperscriptingExponent: 7,
/**
* Sign for permille (out of 1000).
* Example: 23.4‰
*/
PerMille: 8,
/**
* Infinity, can be used with plus and minus.
* Example: ∞, +∞, -∞
*/
Infinity: 9,
/**
* Not a number.
* Example: NaN
*/
NaN: 10,
/**
* Symbol used between time units.
* Example: 10:52
*/
TimeSeparator: 11,
/**
* Decimal separator for currency values (fallback to `Decimal`).
* Example: $2,345.67
*/
CurrencyDecimal: 12,
/**
* Group separator for currency values (fallback to `Group`).
* Example: $2,345.67
*/
CurrencyGroup: 13,
};
NumberSymbol[NumberSymbol.Decimal] = 'Decimal';
NumberSymbol[NumberSymbol.Group] = 'Group';
NumberSymbol[NumberSymbol.List] = 'List';
NumberSymbol[NumberSymbol.PercentSign] = 'PercentSign';
NumberSymbol[NumberSymbol.PlusSign] = 'PlusSign';
NumberSymbol[NumberSymbol.MinusSign] = 'MinusSign';
NumberSymbol[NumberSymbol.Exponential] = 'Exponential';
NumberSymbol[NumberSymbol.SuperscriptingExponent] = 'SuperscriptingExponent';
NumberSymbol[NumberSymbol.PerMille] = 'PerMille';
NumberSymbol[NumberSymbol.Infinity] = 'Infinity';
NumberSymbol[NumberSymbol.NaN] = 'NaN';
NumberSymbol[NumberSymbol.TimeSeparator] = 'TimeSeparator';
NumberSymbol[NumberSymbol.CurrencyDecimal] = 'CurrencyDecimal';
NumberSymbol[NumberSymbol.CurrencyGroup] = 'CurrencyGroup';
return NumberSymbol;
}());
/** @enum {number} */
const WeekDay = /*@__PURE__*/ (function () {
var WeekDay = {
Sunday: 0,
Monday: 1,
Tuesday: 2,
Wednesday: 3,
Thursday: 4,
Friday: 5,
Saturday: 6,
};
WeekDay[WeekDay.Sunday] = 'Sunday';
WeekDay[WeekDay.Monday] = 'Monday';
WeekDay[WeekDay.Tuesday] = 'Tuesday';
WeekDay[WeekDay.Wednesday] = 'Wednesday';
WeekDay[WeekDay.Thursday] = 'Thursday';
WeekDay[WeekDay.Friday] = 'Friday';
WeekDay[WeekDay.Saturday] = 'Saturday';
return WeekDay;
}());
/**
* Retrieves the locale ID from the currently loaded locale.
* The loaded locale could be, for example, a global one rather than a regional one.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code, such as `fr-FR`.
* @return {?} The locale code. For example, `fr`.
*/
function getLocaleId(locale) {
return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale)[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].LocaleId];
}
/**
* Retrieves day period strings for the given locale.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} formStyle The required grammatical form.
* @param {?} width The required character width.
* @return {?} An array of localized period strings. For example, `[AM, PM]` for `en-US`.
*/
function getLocaleDayPeriods(locale, formStyle, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const amPmData = ( /** @type {?} */([data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsStandalone]]));
/** @type {?} */
const amPm = getLastDefinedValue(amPmData, formStyle);
return getLastDefinedValue(amPm, width);
}
/**
* Retrieves days of the week for the given locale, using the Gregorian calendar.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} formStyle The required grammatical form.
* @param {?} width The required character width.
* @return {?} An array of localized name strings.
* For example,`[Sunday, Monday, ... Saturday]` for `en-US`.
*/
function getLocaleDayNames(locale, formStyle, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const daysData = ( /** @type {?} */([data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysStandalone]]));
/** @type {?} */
const days = getLastDefinedValue(daysData, formStyle);
return getLastDefinedValue(days, width);
}
/**
* Retrieves months of the year for the given locale, using the Gregorian calendar.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} formStyle The required grammatical form.
* @param {?} width The required character width.
* @return {?} An array of localized name strings.
* For example, `[January, February, ...]` for `en-US`.
*/
function getLocaleMonthNames(locale, formStyle, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const monthsData = ( /** @type {?} */([data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsStandalone]]));
/** @type {?} */
const months = getLastDefinedValue(monthsData, formStyle);
return getLastDefinedValue(months, width);
}
/**
* Retrieves Gregorian-calendar eras for the given locale.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} width The required character width.
* @return {?} An array of localized era strings.
* For example, `[AD, BC]` for `en-US`.
*/
function getLocaleEraNames(locale, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const erasData = ( /** @type {?} */(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Eras]));
return getLastDefinedValue(erasData, width);
}
/**
* Retrieves the first day of the week for the given locale.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} A day index number, using the 0-based week-day index for `en-US`
* (Sunday = 0, Monday = 1, ...).
* For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.
*/
function getLocaleFirstDayOfWeek(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].FirstDayOfWeek];
}
/**
* Range of week days that are considered the week-end for the given locale.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} The range of day values, `[startDay, endDay]`.
*/
function getLocaleWeekEndRange(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].WeekendRange];
}
/**
* Retrieves a localized date-value formating string.
*
* @see `FormatWidth` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} width The format type.
* @return {?} The localized formating string.
*/
function getLocaleDateFormat(locale, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateFormat], width);
}
/**
* Retrieves a localized time-value formatting string.
*
* @see `FormatWidth` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} width The format type.
* @return {?} The localized formatting string.
*/
function getLocaleTimeFormat(locale, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].TimeFormat], width);
}
/**
* Retrieves a localized date-time formatting string.
*
* @see `FormatWidth` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} width The format type.
* @return {?} The localized formatting string.
*/
function getLocaleDateTimeFormat(locale, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const dateTimeFormatData = ( /** @type {?} */(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateTimeFormat]));
return getLastDefinedValue(dateTimeFormatData, width);
}
/**
* Retrieves a localized number symbol that can be used to replace placeholders in number formats.
* @see `NumberSymbol` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale The locale code.
* @param {?} symbol The symbol to localize.
* @return {?} The character for the localized symbol.
*/
function getLocaleNumberSymbol(locale, symbol) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
/** @type {?} */
const res = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][symbol];
if (typeof res === 'undefined') {
if (symbol === NumberSymbol.CurrencyDecimal) {
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Decimal];
}
else if (symbol === NumberSymbol.CurrencyGroup) {
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Group];
}
}
return res;
}
/**
* Retrieves a number format for a given locale.
*
* Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`
* when used to format the number 12345.678 could result in "12'345,678". That would happen if the
* grouping separator for your language is an apostrophe, and the decimal separator is a comma.
*
*
Important: The characters `.` `,` `0` `#` (and others below) are special placeholders
* that stand for the decimal separator, and so on, and are NOT real characters.
* You must NOT "translate" the placeholders. For example, don't change `.` to `,` even though in
* your language the decimal point is written with a comma. The symbols should be replaced by the
* local equivalents, using the appropriate `NumberSymbol` for your language.
*
* Here are the special characters used in number patterns:
*
* | Symbol | Meaning |
* |--------|---------|
* | . | Replaced automatically by the character used for the decimal point. |
* | , | Replaced by the "grouping" (thousands) separator. |
* | 0 | Replaced by a digit (or zero if there aren't enough digits). |
* | # | Replaced by a digit (or nothing if there aren't enough). |
* | ¤ | Replaced by a currency symbol, such as $ or USD. |
* | % | Marks a percent format. The % symbol may change position, but must be retained. |
* | E | Marks a scientific format. The E symbol may change position, but must be retained. |
* | ' | Special characters used as literal characters are quoted with ASCII single quotes. |
*
* @see `NumberFormatStyle` / [CLDR website](http://cldr.unicode.org/translation/number-patterns) / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)
* @return {?} The localized format string.
*/
function getLocaleNumberFormat(locale, type) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberFormats][type];
}
/**
* Retrieves the symbol used to represent the currency for the main country
* corresponding to a given locale. For example, '$' for `en-US`.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} The localized symbol character,
* or `null` if the main country cannot be determined.
*/
function getLocaleCurrencySymbol(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencySymbol] || null;
}
/**
* Retrieves the name of the currency for the main country corresponding
* to a given locale. For example, 'US Dollar' for `en-US`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} The currency name,
* or `null` if the main country cannot be determined.
*/
function getLocaleCurrencyName(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencyName] || null;
}
/**
* Retrieves the default currency code for the given locale.
*
* The default is defined as the first currency which is still in use.
*
* \@publicApi
* @param {?} locale The code of the locale whose currency code we want.
* @return {?} The code of the default currency for the given locale.
*
*/
function getLocaleCurrencyCode(locale) {
return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocaleCurrencyCode"])(locale);
}
/**
* Retrieves the currency values for a given locale.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} The currency values.
*/
function getLocaleCurrencies(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Currencies];
}
/**
* \@alias core/ɵgetLocalePluralCase
* \@publicApi
* @type {?}
*/
const getLocalePluralCase = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocalePluralCase"];
/**
* @param {?} data
* @return {?}
*/
function checkFullData(data) {
if (!data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData]) {
throw new Error(`Missing extra locale data for the locale "${data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].LocaleId]}". Use "registerLocaleData" to load new data. See the "I18n guide" on angular.io to know more.`);
}
}
/**
* Retrieves locale-specific rules used to determine which day period to use
* when more than one period is defined for a locale.
*
* There is a rule for each defined day period. The
* first rule is applied to the first day period and so on.
* Fall back to AM/PM when no rules are available.
*
* A rule can specify a period as time range, or as a single time value.
*
* This functionality is only available when you have loaded the full locale data.
* See the ["I18n guide"](guide/i18n#i18n-pipes).
*
* @see `getLocaleExtraDayPeriods()` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @return {?} The rules for the locale, a single time value or array of *from-time, to-time*,
* or null if no periods are available.
*
*/
function getLocaleExtraDayPeriodRules(locale) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
checkFullData(data);
/** @type {?} */
const rules = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][2 /* ExtraDayPeriodsRules */] || [];
return rules.map(( /**
* @param {?} rule
* @return {?}
*/(rule) => {
if (typeof rule === 'string') {
return extractTime(rule);
}
return [extractTime(rule[0]), extractTime(rule[1])];
}));
}
/**
* Retrieves locale-specific day periods, which indicate roughly how a day is broken up
* in different languages.
* For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.
*
* This functionality is only available when you have loaded the full locale data.
* See the ["I18n guide"](guide/i18n#i18n-pipes).
*
* @see `getLocaleExtraDayPeriodRules()` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} formStyle The required grammatical form.
* @param {?} width The required character width.
* @return {?} The translated day-period strings.
*/
function getLocaleExtraDayPeriods(locale, formStyle, width) {
/** @type {?} */
const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
checkFullData(data);
/** @type {?} */
const dayPeriodsData = ( /** @type {?} */([
data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][0 /* ExtraDayPeriodFormats */],
data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][1 /* ExtraDayPeriodStandalone */]
]));
/** @type {?} */
const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];
return getLastDefinedValue(dayPeriods, width) || [];
}
/**
* Retrieves the first value that is defined in an array, going backwards from an index position.
*
* To avoid repeating the same data (as when the "format" and "standalone" forms are the same)
* add the first value to the locale data arrays, and add other values only if they are different.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @template T
* @param {?} data The data array to retrieve from.
* @param {?} index A 0-based index into the array to start from.
* @return {?} The value immediately before the given index position.
*/
function getLastDefinedValue(data, index) {
for (let i = index; i > -1; i--) {
if (typeof data[i] !== 'undefined') {
return data[i];
}
}
throw new Error('Locale data API: locale data undefined');
}
/**
* Extracts the hours and minutes from a string like "15:45"
* @param {?} time
* @return {?}
*/
function extractTime(time) {
const [h, m] = time.split(':');
return { hours: +h, minutes: +m };
}
/**
* Retrieves the currency symbol for a given currency code.
*
* For example, for the default `en-US` locale, the code `USD` can
* be represented by the narrow symbol `$` or the wide symbol `US$`.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} code The currency code.
* @param {?} format The format, `wide` or `narrow`.
* @param {?=} locale A locale code for the locale format rules to use.
*
* @return {?} The symbol, or the currency code if no symbol is available.
*/
function getCurrencySymbol(code, format, locale = 'en') {
/** @type {?} */
const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];
/** @type {?} */
const symbolNarrow = currency[1 /* SymbolNarrow */];
if (format === 'narrow' && typeof symbolNarrow === 'string') {
return symbolNarrow;
}
return currency[0 /* Symbol */] || code;
}
// Most currencies have cents, that's why the default is 2
/** @type {?} */
const DEFAULT_NB_OF_CURRENCY_DIGITS = 2;
/**
* Reports the number of decimal digits for a given currency.
* The value depends upon the presence of cents in that particular currency.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} code The currency code.
* @return {?} The number of decimal digits, typically 0 or 2.
*/
function getNumberOfCurrencyDigits(code) {
/** @type {?} */
let digits;
/** @type {?} */
const currency = CURRENCIES_EN[code];
if (currency) {
digits = currency[2 /* NbOfDigits */];
}
return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/format_date.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/** @type {?} */
const ISO8601_DATE_REGEX = /^(\d{4})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/;
// 1 2 3 4 5 6 7 8 9 10 11
/** @type {?} */
const NAMED_FORMATS = {};
/** @type {?} */
const DATE_FORMATS_SPLIT = /((?:[^GyMLwWdEabBhHmsSzZO']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\s\S]*)/;
/** @enum {number} */
const ZoneWidth = /*@__PURE__*/ (function () {
var ZoneWidth = {
Short: 0,
ShortGMT: 1,
Long: 2,
Extended: 3,
};
ZoneWidth[ZoneWidth.Short] = 'Short';
ZoneWidth[ZoneWidth.ShortGMT] = 'ShortGMT';
ZoneWidth[ZoneWidth.Long] = 'Long';
ZoneWidth[ZoneWidth.Extended] = 'Extended';
return ZoneWidth;
}());
/** @enum {number} */
const DateType = /*@__PURE__*/ (function () {
var DateType = {
FullYear: 0,
Month: 1,
Date: 2,
Hours: 3,
Minutes: 4,
Seconds: 5,
FractionalSeconds: 6,
Day: 7,
};
DateType[DateType.FullYear] = 'FullYear';
DateType[DateType.Month] = 'Month';
DateType[DateType.Date] = 'Date';
DateType[DateType.Hours] = 'Hours';
DateType[DateType.Minutes] = 'Minutes';
DateType[DateType.Seconds] = 'Seconds';
DateType[DateType.FractionalSeconds] = 'FractionalSeconds';
DateType[DateType.Day] = 'Day';
return DateType;
}());
/** @enum {number} */
const TranslationType = /*@__PURE__*/ (function () {
var TranslationType = {
DayPeriods: 0,
Days: 1,
Months: 2,
Eras: 3,
};
TranslationType[TranslationType.DayPeriods] = 'DayPeriods';
TranslationType[TranslationType.Days] = 'Days';
TranslationType[TranslationType.Months] = 'Months';
TranslationType[TranslationType.Eras] = 'Eras';
return TranslationType;
}());
/**
* \@ngModule CommonModule
* \@description
*
* Formats a date according to locale rules.
*
* @see `DatePipe` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} value The date to format, as a Date, or a number (milliseconds since UTC epoch)
* or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).
* @param {?} format The date-time components to include. See `DatePipe` for details.
* @param {?} locale A locale code for the locale format rules to use.
* @param {?=} timezone The time zone. A time zone offset from GMT (such as `'+0430'`),
* or a standard UTC/GMT or continental US time zone abbreviation.
* If not specified, uses host system settings.
*
* @return {?} The formatted date string.
*
*/
function formatDate(value, format, locale, timezone) {
/** @type {?} */
let date = toDate(value);
/** @type {?} */
const namedFormat = getNamedFormat(locale, format);
format = namedFormat || format;
/** @type {?} */
let parts = [];
/** @type {?} */
let match;
while (format) {
match = DATE_FORMATS_SPLIT.exec(format);
if (match) {
parts = parts.concat(match.slice(1));
/** @type {?} */
const part = parts.pop();
if (!part) {
break;
}
format = part;
}
else {
parts.push(format);
break;
}
}
/** @type {?} */
let dateTimezoneOffset = date.getTimezoneOffset();
if (timezone) {
dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
date = convertTimezoneToLocal(date, timezone, true);
}
/** @type {?} */
let text = '';
parts.forEach(( /**
* @param {?} value
* @return {?}
*//**
* @param {?} value
* @return {?}
*/ value => {
/** @type {?} */
const dateFormatter = getDateFormatter(value);
text += dateFormatter ?
dateFormatter(date, locale, dateTimezoneOffset) :
value === '\'\'' ? '\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\'');
}));
return text;
}
/**
* @param {?} locale
* @param {?} format
* @return {?}
*/
function getNamedFormat(locale, format) {
/** @type {?} */
const localeId = getLocaleId(locale);
NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};
if (NAMED_FORMATS[localeId][format]) {
return NAMED_FORMATS[localeId][format];
}
/** @type {?} */
let formatValue = '';
switch (format) {
case 'shortDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Short);
break;
case 'mediumDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);
break;
case 'longDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Long);
break;
case 'fullDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Full);
break;
case 'shortTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);
break;
case 'mediumTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);
break;
case 'longTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);
break;
case 'fullTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);
break;
case 'short':
/** @type {?} */
const shortTime = getNamedFormat(locale, 'shortTime');
/** @type {?} */
const shortDate = getNamedFormat(locale, 'shortDate');
formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);
break;
case 'medium':
/** @type {?} */
const mediumTime = getNamedFormat(locale, 'mediumTime');
/** @type {?} */
const mediumDate = getNamedFormat(locale, 'mediumDate');
formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);
break;
case 'long':
/** @type {?} */
const longTime = getNamedFormat(locale, 'longTime');
/** @type {?} */
const longDate = getNamedFormat(locale, 'longDate');
formatValue =
formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);
break;
case 'full':
/** @type {?} */
const fullTime = getNamedFormat(locale, 'fullTime');
/** @type {?} */
const fullDate = getNamedFormat(locale, 'fullDate');
formatValue =
formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);
break;
}
if (formatValue) {
NAMED_FORMATS[localeId][format] = formatValue;
}
return formatValue;
}
/**
* @param {?} str
* @param {?} opt_values
* @return {?}
*/
function formatDateTime(str, opt_values) {
if (opt_values) {
str = str.replace(/\{([^}]+)}/g, ( /**
* @param {?} match
* @param {?} key
* @return {?}
*/function (match, key) {
return (opt_values != null && key in opt_values) ? opt_values[key] : match;
}));
}
return str;
}
/**
* @param {?} num
* @param {?} digits
* @param {?=} minusSign
* @param {?=} trim
* @param {?=} negWrap
* @return {?}
*/
function padNumber(num, digits, minusSign = '-', trim, negWrap) {
/** @type {?} */
let neg = '';
if (num < 0 || (negWrap && num <= 0)) {
if (negWrap) {
num = -num + 1;
}
else {
num = -num;
neg = minusSign;
}
}
/** @type {?} */
let strNum = String(num);
while (strNum.length < digits) {
strNum = '0' + strNum;
}
if (trim) {
strNum = strNum.substr(strNum.length - digits);
}
return neg + strNum;
}
/**
* @param {?} milliseconds
* @param {?} digits
* @return {?}
*/
function formatFractionalSeconds(milliseconds, digits) {
/** @type {?} */
const strMs = padNumber(milliseconds, 3);
return strMs.substr(0, digits);
}
/**
* Returns a date formatter that transforms a date into its locale digit representation
* @param {?} name
* @param {?} size
* @param {?=} offset
* @param {?=} trim
* @param {?=} negWrap
* @return {?}
*/
function dateGetter(name, size, offset = 0, trim = false, negWrap = false) {
return ( /**
* @param {?} date
* @param {?} locale
* @return {?}
*/function (date, locale) {
/** @type {?} */
let part = getDatePart(name, date);
if (offset > 0 || part > -offset) {
part += offset;
}
if (name === DateType.Hours) {
if (part === 0 && offset === -12) {
part = 12;
}
}
else if (name === DateType.FractionalSeconds) {
return formatFractionalSeconds(part, size);
}
/** @type {?} */
const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
return padNumber(part, size, localeMinus, trim, negWrap);
});
}
/**
* @param {?} part
* @param {?} date
* @return {?}
*/
function getDatePart(part, date) {
switch (part) {
case DateType.FullYear:
return date.getFullYear();
case DateType.Month:
return date.getMonth();
case DateType.Date:
return date.getDate();
case DateType.Hours:
return date.getHours();
case DateType.Minutes:
return date.getMinutes();
case DateType.Seconds:
return date.getSeconds();
case DateType.FractionalSeconds:
return date.getMilliseconds();
case DateType.Day:
return date.getDay();
default:
throw new Error(`Unknown DateType value "${part}".`);
}
}
/**
* Returns a date formatter that transforms a date into its locale string representation
* @param {?} name
* @param {?} width
* @param {?=} form
* @param {?=} extended
* @return {?}
*/
function dateStrGetter(name, width, form = FormStyle.Format, extended = false) {
return ( /**
* @param {?} date
* @param {?} locale
* @return {?}
*/function (date, locale) {
return getDateTranslation(date, locale, name, width, form, extended);
});
}
/**
* Returns the locale translation of a date for a given form, type and width
* @param {?} date
* @param {?} locale
* @param {?} name
* @param {?} width
* @param {?} form
* @param {?} extended
* @return {?}
*/
function getDateTranslation(date, locale, name, width, form, extended) {
switch (name) {
case TranslationType.Months:
return getLocaleMonthNames(locale, form, width)[date.getMonth()];
case TranslationType.Days:
return getLocaleDayNames(locale, form, width)[date.getDay()];
case TranslationType.DayPeriods:
/** @type {?} */
const currentHours = date.getHours();
/** @type {?} */
const currentMinutes = date.getMinutes();
if (extended) {
/** @type {?} */
const rules = getLocaleExtraDayPeriodRules(locale);
/** @type {?} */
const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);
/** @type {?} */
let result;
rules.forEach(( /**
* @param {?} rule
* @param {?} index
* @return {?}
*/(rule, index) => {
if (Array.isArray(rule)) {
// morning, afternoon, evening, night
const { hours: hoursFrom, minutes: minutesFrom } = rule[0];
const { hours: hoursTo, minutes: minutesTo } = rule[1];
if (currentHours >= hoursFrom && currentMinutes >= minutesFrom &&
(currentHours < hoursTo ||
(currentHours === hoursTo && currentMinutes < minutesTo))) {
result = dayPeriods[index];
}
}
else { // noon or midnight
// noon or midnight
const { hours, minutes } = rule;
if (hours === currentHours && minutes === currentMinutes) {
result = dayPeriods[index];
}
}
}));
if (result) {
return result;
}
}
// if no rules for the day periods, we use am/pm by default
return getLocaleDayPeriods(locale, form, ( /** @type {?} */(width)))[currentHours < 12 ? 0 : 1];
case TranslationType.Eras:
return getLocaleEraNames(locale, ( /** @type {?} */(width)))[date.getFullYear() <= 0 ? 0 : 1];
default:
// This default case is not needed by TypeScript compiler, as the switch is exhaustive.
// However Closure Compiler does not understand that and reports an error in typed mode.
// The `throw new Error` below works around the problem, and the unexpected: never variable
// makes sure tsc still checks this code is unreachable.
/** @type {?} */
const unexpected = name;
throw new Error(`unexpected translation type ${unexpected}`);
}
}
/**
* Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or
* GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,
* extended = +04:30)
* @param {?} width
* @return {?}
*/
function timeZoneGetter(width) {
return ( /**
* @param {?} date
* @param {?} locale
* @param {?} offset
* @return {?}
*/function (date, locale, offset) {
/** @type {?} */
const zone = -1 * offset;
/** @type {?} */
const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
/** @type {?} */
const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);
switch (width) {
case ZoneWidth.Short:
return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +
padNumber(Math.abs(zone % 60), 2, minusSign);
case ZoneWidth.ShortGMT:
return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);
case ZoneWidth.Long:
return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +
padNumber(Math.abs(zone % 60), 2, minusSign);
case ZoneWidth.Extended:
if (offset === 0) {
return 'Z';
}
else {
return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +
padNumber(Math.abs(zone % 60), 2, minusSign);
}
default:
throw new Error(`Unknown zone width "${width}"`);
}
});
}
/** @type {?} */
const JANUARY = 0;
/** @type {?} */
const THURSDAY = 4;
/**
* @param {?} year
* @return {?}
*/
function getFirstThursdayOfYear(year) {
/** @type {?} */
const firstDayOfYear = (new Date(year, JANUARY, 1)).getDay();
return new Date(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);
}
/**
* @param {?} datetime
* @return {?}
*/
function getThursdayThisWeek(datetime) {
return new Date(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));
}
/**
* @param {?} size
* @param {?=} monthBased
* @return {?}
*/
function weekGetter(size, monthBased = false) {
return ( /**
* @param {?} date
* @param {?} locale
* @return {?}
*/function (date, locale) {
/** @type {?} */
let result;
if (monthBased) {
/** @type {?} */
const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;
/** @type {?} */
const today = date.getDate();
result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);
}
else {
/** @type {?} */
const firstThurs = getFirstThursdayOfYear(date.getFullYear());
/** @type {?} */
const thisThurs = getThursdayThisWeek(date);
/** @type {?} */
const diff = thisThurs.getTime() - firstThurs.getTime();
result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week
}
return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
});
}
/** @type {?} */
const DATE_FORMATS = {};
// Based on CLDR formats:
// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table
// See also explanations: http://cldr.unicode.org/translation/date-time
// TODO(ocombe): support all missing cldr formats: Y, U, Q, D, F, e, c, j, J, C, A, v, V, X, x
/**
* @param {?} format
* @return {?}
*/
function getDateFormatter(format) {
if (DATE_FORMATS[format]) {
return DATE_FORMATS[format];
}
/** @type {?} */
let formatter;
switch (format) {
// Era name (AD/BC)
case 'G':
case 'GG':
case 'GGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);
break;
case 'GGGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);
break;
case 'GGGGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);
break;
// 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)
case 'y':
formatter = dateGetter(DateType.FullYear, 1, 0, false, true);
break;
// 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)
case 'yy':
formatter = dateGetter(DateType.FullYear, 2, 0, true, true);
break;
// 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)
case 'yyy':
formatter = dateGetter(DateType.FullYear, 3, 0, false, true);
break;
// 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)
case 'yyyy':
formatter = dateGetter(DateType.FullYear, 4, 0, false, true);
break;
// Month of the year (1-12), numeric
case 'M':
case 'L':
formatter = dateGetter(DateType.Month, 1, 1);
break;
case 'MM':
case 'LL':
formatter = dateGetter(DateType.Month, 2, 1);
break;
// Month of the year (January, ...), string, format
case 'MMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);
break;
case 'MMMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);
break;
case 'MMMMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);
break;
// Month of the year (January, ...), string, standalone
case 'LLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);
break;
case 'LLLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);
break;
case 'LLLLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);
break;
// Week of the year (1, ... 52)
case 'w':
formatter = weekGetter(1);
break;
case 'ww':
formatter = weekGetter(2);
break;
// Week of the month (1, ...)
case 'W':
formatter = weekGetter(1, true);
break;
// Day of the month (1-31)
case 'd':
formatter = dateGetter(DateType.Date, 1);
break;
case 'dd':
formatter = dateGetter(DateType.Date, 2);
break;
// Day of the Week
case 'E':
case 'EE':
case 'EEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);
break;
case 'EEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);
break;
case 'EEEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);
break;
case 'EEEEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);
break;
// Generic period of the day (am-pm)
case 'a':
case 'aa':
case 'aaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);
break;
case 'aaaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);
break;
case 'aaaaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);
break;
// Extended period of the day (midnight, at night, ...), standalone
case 'b':
case 'bb':
case 'bbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);
break;
case 'bbbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);
break;
case 'bbbbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);
break;
// Extended period of the day (midnight, night, ...), standalone
case 'B':
case 'BB':
case 'BBB':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);
break;
case 'BBBB':
formatter =
dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);
break;
case 'BBBBB':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);
break;
// Hour in AM/PM, (1-12)
case 'h':
formatter = dateGetter(DateType.Hours, 1, -12);
break;
case 'hh':
formatter = dateGetter(DateType.Hours, 2, -12);
break;
// Hour of the day (0-23)
case 'H':
formatter = dateGetter(DateType.Hours, 1);
break;
// Hour in day, padded (00-23)
case 'HH':
formatter = dateGetter(DateType.Hours, 2);
break;
// Minute of the hour (0-59)
case 'm':
formatter = dateGetter(DateType.Minutes, 1);
break;
case 'mm':
formatter = dateGetter(DateType.Minutes, 2);
break;
// Second of the minute (0-59)
case 's':
formatter = dateGetter(DateType.Seconds, 1);
break;
case 'ss':
formatter = dateGetter(DateType.Seconds, 2);
break;
// Fractional second
case 'S':
formatter = dateGetter(DateType.FractionalSeconds, 1);
break;
case 'SS':
formatter = dateGetter(DateType.FractionalSeconds, 2);
break;
case 'SSS':
formatter = dateGetter(DateType.FractionalSeconds, 3);
break;
// Timezone ISO8601 short format (-0430)
case 'Z':
case 'ZZ':
case 'ZZZ':
formatter = timeZoneGetter(ZoneWidth.Short);
break;
// Timezone ISO8601 extended format (-04:30)
case 'ZZZZZ':
formatter = timeZoneGetter(ZoneWidth.Extended);
break;
// Timezone GMT short format (GMT+4)
case 'O':
case 'OO':
case 'OOO':
// Should be location, but fallback to format O instead because we don't have the data yet
case 'z':
case 'zz':
case 'zzz':
formatter = timeZoneGetter(ZoneWidth.ShortGMT);
break;
// Timezone GMT long format (GMT+0430)
case 'OOOO':
case 'ZZZZ':
// Should be location, but fallback to format O instead because we don't have the data yet
case 'zzzz':
formatter = timeZoneGetter(ZoneWidth.Long);
break;
default:
return null;
}
DATE_FORMATS[format] = formatter;
return formatter;
}
/**
* @param {?} timezone
* @param {?} fallback
* @return {?}
*/
function timezoneToOffset(timezone, fallback) {
// Support: IE 9-11 only, Edge 13-15+
// IE/Edge do not "understand" colon (`:`) in timezone
timezone = timezone.replace(/:/g, '');
/** @type {?} */
const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;
return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;
}
/**
* @param {?} date
* @param {?} minutes
* @return {?}
*/
function addDateMinutes(date, minutes) {
date = new Date(date.getTime());
date.setMinutes(date.getMinutes() + minutes);
return date;
}
/**
* @param {?} date
* @param {?} timezone
* @param {?} reverse
* @return {?}
*/
function convertTimezoneToLocal(date, timezone, reverse) {
/** @type {?} */
const reverseValue = reverse ? -1 : 1;
/** @type {?} */
const dateTimezoneOffset = date.getTimezoneOffset();
/** @type {?} */
const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));
}
/**
* Converts a value to date.
*
* Supported input formats:
* - `Date`
* - number: timestamp
* - string: numeric (e.g. "1234"), ISO and date strings in a format supported by
* [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).
* Note: ISO strings without time return a date without timeoffset.
*
* Throws if unable to convert to a date.
* @param {?} value
* @return {?}
*/
function toDate(value) {
if (isDate(value)) {
return value;
}
if (typeof value === 'number' && !isNaN(value)) {
return new Date(value);
}
if (typeof value === 'string') {
value = value.trim();
/** @type {?} */
const parsedNb = parseFloat(value);
// any string that only contains numbers, like "1234" but not like "1234hello"
if (!isNaN(( /** @type {?} */(value)) - parsedNb)) {
return new Date(parsedNb);
}
if (/^(\d{4}-\d{1,2}-\d{1,2})$/.test(value)) {
/* For ISO Strings without time the day, month and year must be extracted from the ISO String
before Date creation to avoid time offset and errors in the new Date.
If we only replace '-' with ',' in the ISO String ("2015,01,01"), and try to create a new
date, some browsers (e.g. IE 9) will throw an invalid Date error.
If we leave the '-' ("2015-01-01") and try to create a new Date("2015-01-01") the timeoffset
is applied.
Note: ISO months are 0 for January, 1 for February, ... */
const [y, m, d] = value.split('-').map(( /**
* @param {?} val
* @return {?}
*/(val) => +val));
return new Date(y, m - 1, d);
}
/** @type {?} */
let match;
if (match = value.match(ISO8601_DATE_REGEX)) {
return isoStringToDate(match);
}
}
/** @type {?} */
const date = new Date(( /** @type {?} */(value)));
if (!isDate(date)) {
throw new Error(`Unable to convert "${value}" into a date`);
}
return date;
}
/**
* Converts a date in ISO8601 to a Date.
* Used instead of `Date.parse` because of browser discrepancies.
* @param {?} match
* @return {?}
*/
function isoStringToDate(match) {
/** @type {?} */
const date = new Date(0);
/** @type {?} */
let tzHour = 0;
/** @type {?} */
let tzMin = 0;
// match[8] means that the string contains "Z" (UTC) or a timezone like "+01:00" or "+0100"
/** @type {?} */
const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;
/** @type {?} */
const timeSetter = match[8] ? date.setUTCHours : date.setHours;
// if there is a timezone defined like "+01:00" or "+0100"
if (match[9]) {
tzHour = Number(match[9] + match[10]);
tzMin = Number(match[9] + match[11]);
}
dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));
/** @type {?} */
const h = Number(match[4] || 0) - tzHour;
/** @type {?} */
const m = Number(match[5] || 0) - tzMin;
/** @type {?} */
const s = Number(match[6] || 0);
/** @type {?} */
const ms = Math.round(parseFloat('0.' + (match[7] || 0)) * 1000);
timeSetter.call(date, h, m, s, ms);
return date;
}
/**
* @param {?} value
* @return {?}
*/
function isDate(value) {
return value instanceof Date && !isNaN(value.valueOf());
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/format_number.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/** @type {?} */
const NUMBER_FORMAT_REGEXP = /^(\d+)?\.((\d+)(-(\d+))?)?$/;
/** @type {?} */
const MAX_DIGITS = 22;
/** @type {?} */
const DECIMAL_SEP = '.';
/** @type {?} */
const ZERO_CHAR = '0';
/** @type {?} */
const PATTERN_SEP = ';';
/** @type {?} */
const GROUP_SEP = ',';
/** @type {?} */
const DIGIT_CHAR = '#';
/** @type {?} */
const CURRENCY_CHAR = '¤';
/** @type {?} */
const PERCENT_CHAR = '%';
/**
* Transforms a number to a locale string based on a style and a format.
* @param {?} value
* @param {?} pattern
* @param {?} locale
* @param {?} groupSymbol
* @param {?} decimalSymbol
* @param {?=} digitsInfo
* @param {?=} isPercent
* @return {?}
*/
function formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {
/** @type {?} */
let formattedText = '';
/** @type {?} */
let isZero = false;
if (!isFinite(value)) {
formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);
}
else {
/** @type {?} */
let parsedNumber = parseNumber(value);
if (isPercent) {
parsedNumber = toPercent(parsedNumber);
}
/** @type {?} */
let minInt = pattern.minInt;
/** @type {?} */
let minFraction = pattern.minFrac;
/** @type {?} */
let maxFraction = pattern.maxFrac;
if (digitsInfo) {
/** @type {?} */
const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);
if (parts === null) {
throw new Error(`${digitsInfo} is not a valid digit info`);
}
/** @type {?} */
const minIntPart = parts[1];
/** @type {?} */
const minFractionPart = parts[3];
/** @type {?} */
const maxFractionPart = parts[5];
if (minIntPart != null) {
minInt = parseIntAutoRadix(minIntPart);
}
if (minFractionPart != null) {
minFraction = parseIntAutoRadix(minFractionPart);
}
if (maxFractionPart != null) {
maxFraction = parseIntAutoRadix(maxFractionPart);
}
else if (minFractionPart != null && minFraction > maxFraction) {
maxFraction = minFraction;
}
}
roundNumber(parsedNumber, minFraction, maxFraction);
/** @type {?} */
let digits = parsedNumber.digits;
/** @type {?} */
let integerLen = parsedNumber.integerLen;
/** @type {?} */
const exponent = parsedNumber.exponent;
/** @type {?} */
let decimals = [];
isZero = digits.every(( /**
* @param {?} d
* @return {?}
*//**
* @param {?} d
* @return {?}
*/ d => !d));
// pad zeros for small numbers
for (; integerLen < minInt; integerLen++) {
digits.unshift(0);
}
// pad zeros for small numbers
for (; integerLen < 0; integerLen++) {
digits.unshift(0);
}
// extract decimals digits
if (integerLen > 0) {
decimals = digits.splice(integerLen, digits.length);
}
else {
decimals = digits;
digits = [0];
}
// format the integer digits with grouping separators
/** @type {?} */
const groups = [];
if (digits.length >= pattern.lgSize) {
groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));
}
while (digits.length > pattern.gSize) {
groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));
}
if (digits.length) {
groups.unshift(digits.join(''));
}
formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));
// append the decimal digits
if (decimals.length) {
formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');
}
if (exponent) {
formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;
}
}
if (value < 0 && !isZero) {
formattedText = pattern.negPre + formattedText + pattern.negSuf;
}
else {
formattedText = pattern.posPre + formattedText + pattern.posSuf;
}
return formattedText;
}
/**
* \@ngModule CommonModule
* \@description
*
* Formats a number as currency using locale rules.
*
* @see `formatNumber()` / `DecimalPipe` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} value The number to format.
* @param {?} locale A locale code for the locale format rules to use.
* @param {?} currency A string containing the currency symbol or its name,
* such as "$" or "Canadian Dollar". Used in output string, but does not affect the operation
* of the function.
* @param {?=} currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)
* currency code, such as `USD` for the US dollar and `EUR` for the euro.
* Used to determine the number of digits in the decimal part.
* @param {?=} digitsInfo
* @return {?} The formatted currency value.
*
*/
function formatCurrency(value, locale, currency, currencyCode, digitsInfo) {
/** @type {?} */
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);
/** @type {?} */
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
pattern.minFrac = getNumberOfCurrencyDigits(( /** @type {?} */(currencyCode)));
pattern.maxFrac = pattern.minFrac;
/** @type {?} */
const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);
return res
.replace(CURRENCY_CHAR, currency)
// if we have 2 time the currency character, the second one is ignored
.replace(CURRENCY_CHAR, '')
// If there is a spacing between currency character and the value and
// the currency character is supressed by passing an empty string, the
// spacing character would remain as part of the string. Then we
// should remove it.
.trim();
}
/**
* \@ngModule CommonModule
* \@description
*
* Formats a number as a percentage according to locale rules.
*
* @see `formatNumber()` / `DecimalPipe` / [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* \@publicApi
*
* @param {?} value The number to format.
* @param {?} locale A locale code for the locale format rules to use.
* @param {?=} digitsInfo
* @return {?} The formatted percentage value.
*
*/
function formatPercent(value, locale, digitsInfo) {
/** @type {?} */
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);
/** @type {?} */
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
/** @type {?} */
const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);
return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));
}
/**
* \@ngModule CommonModule
* \@description
*
* Formats a number as text, with group sizing, separator, and other
* parameters based on the locale.
*
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* \@publicApi
* @param {?} value The number to format.
* @param {?} locale A locale code for the locale format rules to use.
* @param {?=} digitsInfo
* @return {?} The formatted text string.
*/
function formatNumber(value, locale, digitsInfo) {
/** @type {?} */
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);
/** @type {?} */
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);
}
/**
* @record
*/
function ParsedNumberFormat() { }
if (false) {}
/**
* @param {?} format
* @param {?=} minusSign
* @return {?}
*/
function parseNumberFormat(format, minusSign = '-') {
/** @type {?} */
const p = {
minInt: 1,
minFrac: 0,
maxFrac: 0,
posPre: '',
posSuf: '',
negPre: '',
negSuf: '',
gSize: 0,
lgSize: 0
};
/** @type {?} */
const patternParts = format.split(PATTERN_SEP);
/** @type {?} */
const positive = patternParts[0];
/** @type {?} */
const negative = patternParts[1];
/** @type {?} */
const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?
positive.split(DECIMAL_SEP) :
[
positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),
positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)
];
/** @type {?} */
const integer = positiveParts[0];
/** @type {?} */
const fraction = positiveParts[1] || '';
p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));
for (let i = 0; i < fraction.length; i++) {
/** @type {?} */
const ch = fraction.charAt(i);
if (ch === ZERO_CHAR) {
p.minFrac = p.maxFrac = i + 1;
}
else if (ch === DIGIT_CHAR) {
p.maxFrac = i + 1;
}
else {
p.posSuf += ch;
}
}
/** @type {?} */
const groups = integer.split(GROUP_SEP);
p.gSize = groups[1] ? groups[1].length : 0;
p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;
if (negative) {
/** @type {?} */
const trunkLen = positive.length - p.posPre.length - p.posSuf.length;
/** @type {?} */
const pos = negative.indexOf(DIGIT_CHAR);
p.negPre = negative.substr(0, pos).replace(/'/g, '');
p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');
}
else {
p.negPre = minusSign + p.posPre;
p.negSuf = p.posSuf;
}
return p;
}
/**
* @record
*/
function ParsedNumber() { }
if (false) {}
// Transforms a parsed number into a percentage by multiplying it by 100
/**
* @param {?} parsedNumber
* @return {?}
*/
function toPercent(parsedNumber) {
// if the number is 0, don't do anything
if (parsedNumber.digits[0] === 0) {
return parsedNumber;
}
// Getting the current number of decimals
/** @type {?} */
const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;
if (parsedNumber.exponent) {
parsedNumber.exponent += 2;
}
else {
if (fractionLen === 0) {
parsedNumber.digits.push(0, 0);
}
else if (fractionLen === 1) {
parsedNumber.digits.push(0);
}
parsedNumber.integerLen += 2;
}
return parsedNumber;
}
/**
* Parses a number.
* Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/
* @param {?} num
* @return {?}
*/
function parseNumber(num) {
/** @type {?} */
let numStr = Math.abs(num) + '';
/** @type {?} */
let exponent = 0;
/** @type {?} */
let digits;
/** @type {?} */
let integerLen;
/** @type {?} */
let i;
/** @type {?} */
let j;
/** @type {?} */
let zeros;
// Decimal point?
if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {
numStr = numStr.replace(DECIMAL_SEP, '');
}
// Exponential form?
if ((i = numStr.search(/e/i)) > 0) {
// Work out the exponent.
if (integerLen < 0)
integerLen = i;
integerLen += +numStr.slice(i + 1);
numStr = numStr.substring(0, i);
}
else if (integerLen < 0) {
// There was no decimal point or exponent so it is an integer.
integerLen = numStr.length;
}
// Count the number of leading zeros.
for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */
}
if (i === (zeros = numStr.length)) {
// The digits are all zero.
digits = [0];
integerLen = 1;
}
else {
// Count the number of trailing zeros
zeros--;
while (numStr.charAt(zeros) === ZERO_CHAR)
zeros--;
// Trailing zeros are insignificant so ignore them
integerLen -= i;
digits = [];
// Convert string to array of digits without leading/trailing zeros.
for (j = 0; i <= zeros; i++, j++) {
digits[j] = Number(numStr.charAt(i));
}
}
// If the number overflows the maximum allowed digits then use an exponent.
if (integerLen > MAX_DIGITS) {
digits = digits.splice(0, MAX_DIGITS - 1);
exponent = integerLen - 1;
integerLen = 1;
}
return { digits, exponent, integerLen };
}
/**
* Round the parsed number to the specified number of decimal places
* This function changes the parsedNumber in-place
* @param {?} parsedNumber
* @param {?} minFrac
* @param {?} maxFrac
* @return {?}
*/
function roundNumber(parsedNumber, minFrac, maxFrac) {
if (minFrac > maxFrac) {
throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);
}
/** @type {?} */
let digits = parsedNumber.digits;
/** @type {?} */
let fractionLen = digits.length - parsedNumber.integerLen;
/** @type {?} */
const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);
// The index of the digit to where rounding is to occur
/** @type {?} */
let roundAt = fractionSize + parsedNumber.integerLen;
/** @type {?} */
let digit = digits[roundAt];
if (roundAt > 0) {
// Drop fractional digits beyond `roundAt`
digits.splice(Math.max(parsedNumber.integerLen, roundAt));
// Set non-fractional digits beyond `roundAt` to 0
for (let j = roundAt; j < digits.length; j++) {
digits[j] = 0;
}
}
else {
// We rounded to zero so reset the parsedNumber
fractionLen = Math.max(0, fractionLen);
parsedNumber.integerLen = 1;
digits.length = Math.max(1, roundAt = fractionSize + 1);
digits[0] = 0;
for (let i = 1; i < roundAt; i++)
digits[i] = 0;
}
if (digit >= 5) {
if (roundAt - 1 < 0) {
for (let k = 0; k > roundAt; k--) {
digits.unshift(0);
parsedNumber.integerLen++;
}
digits.unshift(1);
parsedNumber.integerLen++;
}
else {
digits[roundAt - 1]++;
}
}
// Pad out with zeros to get the required fraction length
for (; fractionLen < Math.max(0, fractionSize); fractionLen++)
digits.push(0);
/** @type {?} */
let dropTrailingZeros = fractionSize !== 0;
// Minimal length = nb of decimals required + current nb of integers
// Any number besides that is optional and can be removed if it's a trailing 0
/** @type {?} */
const minLen = minFrac + parsedNumber.integerLen;
// Do any carrying, e.g. a digit was rounded up to 10
/** @type {?} */
const carry = digits.reduceRight(( /**
* @param {?} carry
* @param {?} d
* @param {?} i
* @param {?} digits
* @return {?}
*/function (carry, d, i, digits) {
d = d + carry;
digits[i] = d < 10 ? d : d - 10; // d % 10
if (dropTrailingZeros) {
// Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)
if (digits[i] === 0 && i >= minLen) {
digits.pop();
}
else {
dropTrailingZeros = false;
}
}
return d >= 10 ? 1 : 0; // Math.floor(d / 10);
}), 0);
if (carry) {
digits.unshift(carry);
parsedNumber.integerLen++;
}
}
/**
* @param {?} text
* @return {?}
*/
function parseIntAutoRadix(text) {
/** @type {?} */
const result = parseInt(text);
if (isNaN(result)) {
throw new Error('Invalid integer literal when parsing ' + text);
}
return result;
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/localization.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* \@publicApi
* @abstract
*/
class NgLocalization {
}
if (false) {}
/**
* Returns the plural category for a given value.
* - "=value" when the case exists,
* - the plural category otherwise
* @param {?} value
* @param {?} cases
* @param {?} ngLocalization
* @param {?=} locale
* @return {?}
*/
function getPluralCategory(value, cases, ngLocalization, locale) {
/** @type {?} */
let key = `=${value}`;
if (cases.indexOf(key) > -1) {
return key;
}
key = ngLocalization.getPluralCategory(value, locale);
if (cases.indexOf(key) > -1) {
return key;
}
if (cases.indexOf('other') > -1) {
return 'other';
}
throw new Error(`No plural message found for value "${value}"`);
}
let NgLocaleLocalization = /*@__PURE__*/ (() => {
class NgLocaleLocalization extends NgLocalization {
/**
* @param {?} locale
*/
constructor(locale) {
super();
this.locale = locale;
}
/**
* @param {?} value
* @param {?=} locale
* @return {?}
*/
getPluralCategory(value, locale) {
/** @type {?} */
const plural = getLocalePluralCase(locale || this.locale)(value);
switch (plural) {
case Plural.Zero:
return 'zero';
case Plural.One:
return 'one';
case Plural.Two:
return 'two';
case Plural.Few:
return 'few';
case Plural.Many:
return 'many';
default:
return 'other';
}
}
}
NgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) { return new (t || NgLocaleLocalization)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); };
NgLocaleLocalization.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: NgLocaleLocalization, factory: NgLocaleLocalization.ɵfac });
return NgLocaleLocalization;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/i18n/locale_data.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Register global data to be used internally by Angular. See the
* ["I18n guide"](guide/i18n#i18n-pipes) to know how to import additional locale data.
*
* The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1
*
* \@publicApi
* @param {?} data
* @param {?=} localeId
* @param {?=} extraData
* @return {?}
*/
function registerLocaleData(data, localeId, extraData) {
return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵregisterLocaleData"])(data, localeId, extraData);
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/cookie.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @param {?} cookieStr
* @param {?} name
* @return {?}
*/
function parseCookieValue(cookieStr, name) {
name = encodeURIComponent(name);
for (const cookie of cookieStr.split(';')) {
/** @type {?} */
const eqIndex = cookie.indexOf('=');
const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];
if (cookieName.trim() === name) {
return decodeURIComponent(cookieValue);
}
}
return null;
}
let NgClass = /*@__PURE__*/ (() => {
class NgClass {
/**
* @param {?} _iterableDiffers
* @param {?} _keyValueDiffers
* @param {?} _ngEl
* @param {?} _renderer
*/
constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {
this._iterableDiffers = _iterableDiffers;
this._keyValueDiffers = _keyValueDiffers;
this._ngEl = _ngEl;
this._renderer = _renderer;
this._iterableDiffer = null;
this._keyValueDiffer = null;
this._initialClasses = [];
this._rawClass = null;
}
/**
* @param {?} value
* @return {?}
*/
set klass(value) {
this._removeClasses(this._initialClasses);
this._initialClasses = typeof value === 'string' ? value.split(/\s+/) : [];
this._applyClasses(this._initialClasses);
this._applyClasses(this._rawClass);
}
/**
* @param {?} value
* @return {?}
*/
set ngClass(value) {
this._removeClasses(this._rawClass);
this._applyClasses(this._initialClasses);
this._iterableDiffer = null;
this._keyValueDiffer = null;
this._rawClass = typeof value === 'string' ? value.split(/\s+/) : value;
if (this._rawClass) {
if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisListLikeIterable"])(this._rawClass)) {
this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();
}
else {
this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();
}
}
}
/**
* @return {?}
*/
ngDoCheck() {
if (this._iterableDiffer) {
/** @type {?} */
const iterableChanges = this._iterableDiffer.diff(( /** @type {?} */(this._rawClass)));
if (iterableChanges) {
this._applyIterableChanges(iterableChanges);
}
}
else if (this._keyValueDiffer) {
/** @type {?} */
const keyValueChanges = this._keyValueDiffer.diff(( /** @type {?} */(this._rawClass)));
if (keyValueChanges) {
this._applyKeyValueChanges(keyValueChanges);
}
}
}
/**
* @private
* @param {?} changes
* @return {?}
*/
_applyKeyValueChanges(changes) {
changes.forEachAddedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._toggleClass(record.key, record.currentValue)));
changes.forEachChangedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._toggleClass(record.key, record.currentValue)));
changes.forEachRemovedItem(( /**
* @param {?} record
* @return {?}
*/(record) => {
if (record.previousValue) {
this._toggleClass(record.key, false);
}
}));
}
/**
* @private
* @param {?} changes
* @return {?}
*/
_applyIterableChanges(changes) {
changes.forEachAddedItem(( /**
* @param {?} record
* @return {?}
*/(record) => {
if (typeof record.item === 'string') {
this._toggleClass(record.item, true);
}
else {
throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(record.item)}`);
}
}));
changes.forEachRemovedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._toggleClass(record.item, false)));
}
/**
* Applies a collection of CSS classes to the DOM element.
*
* For argument of type Set and Array CSS class names contained in those collections are always
* added.
* For argument of type Map CSS class name in the map's key is toggled based on the value (added
* for truthy and removed for falsy).
* @private
* @param {?} rawClassVal
* @return {?}
*/
_applyClasses(rawClassVal) {
if (rawClassVal) {
if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {
(( /** @type {?} */(rawClassVal))).forEach(( /**
* @param {?} klass
* @return {?}
*/(klass) => this._toggleClass(klass, true)));
}
else {
Object.keys(rawClassVal).forEach(( /**
* @param {?} klass
* @return {?}
*//**
* @param {?} klass
* @return {?}
*/ klass => this._toggleClass(klass, !!rawClassVal[klass])));
}
}
}
/**
* Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup
* purposes.
* @private
* @param {?} rawClassVal
* @return {?}
*/
_removeClasses(rawClassVal) {
if (rawClassVal) {
if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {
(( /** @type {?} */(rawClassVal))).forEach(( /**
* @param {?} klass
* @return {?}
*/(klass) => this._toggleClass(klass, false)));
}
else {
Object.keys(rawClassVal).forEach(( /**
* @param {?} klass
* @return {?}
*//**
* @param {?} klass
* @return {?}
*/ klass => this._toggleClass(klass, false)));
}
}
}
/**
* @private
* @param {?} klass
* @param {?} enabled
* @return {?}
*/
_toggleClass(klass, enabled) {
klass = klass.trim();
if (klass) {
klass.split(/\s+/g).forEach(( /**
* @param {?} klass
* @return {?}
*//**
* @param {?} klass
* @return {?}
*/ klass => {
if (enabled) {
this._renderer.addClass(this._ngEl.nativeElement, klass);
}
else {
this._renderer.removeClass(this._ngEl.nativeElement, klass);
}
}));
}
}
}
NgClass.ɵfac = function NgClass_Factory(t) { return new (t || NgClass)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"])); };
NgClass.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgClass, selectors: [["", "ngClass", ""]], inputs: { klass: ["class", "klass"], ngClass: "ngClass" } });
return NgClass;
})();
if (false) {}
let NgComponentOutlet = /*@__PURE__*/ (() => {
class NgComponentOutlet {
/**
* @param {?} _viewContainerRef
*/
constructor(_viewContainerRef) {
this._viewContainerRef = _viewContainerRef;
this._componentRef = null;
this._moduleRef = null;
}
/**
* @param {?} changes
* @return {?}
*/
ngOnChanges(changes) {
this._viewContainerRef.clear();
this._componentRef = null;
if (this.ngComponentOutlet) {
/** @type {?} */
const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;
if (changes['ngComponentOutletNgModuleFactory']) {
if (this._moduleRef)
this._moduleRef.destroy();
if (this.ngComponentOutletNgModuleFactory) {
/** @type {?} */
const parentModule = elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModuleRef"]);
this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);
}
else {
this._moduleRef = null;
}
}
/** @type {?} */
const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :
elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"]);
/** @type {?} */
const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);
this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);
}
}
/**
* @return {?}
*/
ngOnDestroy() {
if (this._moduleRef)
this._moduleRef.destroy();
}
}
NgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) { return new (t || NgComponentOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); };
NgComponentOutlet.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgComponentOutlet, selectors: [["", "ngComponentOutlet", ""]], inputs: { ngComponentOutlet: "ngComponentOutlet", ngComponentOutletInjector: "ngComponentOutletInjector", ngComponentOutletContent: "ngComponentOutletContent", ngComponentOutletNgModuleFactory: "ngComponentOutletNgModuleFactory" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] });
return NgComponentOutlet;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/directives/ng_for_of.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* \@publicApi
* @template T, U
*/
class NgForOfContext {
/**
* @param {?} $implicit
* @param {?} ngForOf
* @param {?} index
* @param {?} count
*/
constructor($implicit, ngForOf, index, count) {
this.$implicit = $implicit;
this.ngForOf = ngForOf;
this.index = index;
this.count = count;
}
/**
* @return {?}
*/
get first() { return this.index === 0; }
/**
* @return {?}
*/
get last() { return this.index === this.count - 1; }
/**
* @return {?}
*/
get even() { return this.index % 2 === 0; }
/**
* @return {?}
*/
get odd() { return !this.even; }
}
if (false) {}
let NgForOf = /*@__PURE__*/ (() => {
class NgForOf {
/**
* @param {?} _viewContainer
* @param {?} _template
* @param {?} _differs
*/
constructor(_viewContainer, _template, _differs) {
this._viewContainer = _viewContainer;
this._template = _template;
this._differs = _differs;
this._ngForOf = null;
this._ngForOfDirty = true;
this._differ = null;
}
/**
* The value of the iterable expression, which can be used as a
* [template input variable](guide/structural-directives#template-input-variable).
* @param {?} ngForOf
* @return {?}
*/
set ngForOf(ngForOf) {
this._ngForOf = ngForOf;
this._ngForOfDirty = true;
}
/**
* A function that defines how to track changes for items in the iterable.
*
* When items are added, moved, or removed in the iterable,
* the directive must re-render the appropriate DOM nodes.
* To minimize churn in the DOM, only nodes that have changed
* are re-rendered.
*
* By default, the change detector assumes that
* the object instance identifies the node in the iterable.
* When this function is supplied, the directive uses
* the result of calling this function to identify the item node,
* rather than the identity of the object itself.
*
* The function receives two inputs,
* the iteration index and the node object ID.
* @param {?} fn
* @return {?}
*/
set ngForTrackBy(fn) {
if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["isDevMode"])() && fn != null && typeof fn !== 'function') {
// TODO(vicb): use a log service once there is a public one available
if (( /** @type {?} */(console)) && ( /** @type {?} */(console.warn))) {
console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +
`See https://angular.io/api/common/NgForOf#change-propagation for more information.`);
}
}
this._trackByFn = fn;
}
/**
* @return {?}
*/
get ngForTrackBy() { return this._trackByFn; }
/**
* A reference to the template that is stamped out for each item in the iterable.
* @see [template reference variable](guide/template-syntax#template-reference-variables--var-)
* @param {?} value
* @return {?}
*/
set ngForTemplate(value) {
// TODO(TS2.1): make TemplateRef
>> once we move to TS v2.1
// The current type is too restrictive; a template that just uses index, for example,
// should be acceptable.
if (value) {
this._template = value;
}
}
/**
* Applies the changes when needed.
* @return {?}
*/
ngDoCheck() {
if (this._ngForOfDirty) {
this._ngForOfDirty = false;
// React on ngForOf changes only once all inputs have been initialized
/** @type {?} */
const value = this._ngForOf;
if (!this._differ && value) {
try {
this._differ = this._differs.find(value).create(this.ngForTrackBy);
}
catch (_a) {
throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);
}
}
}
if (this._differ) {
/** @type {?} */
const changes = this._differ.diff(this._ngForOf);
if (changes)
this._applyChanges(changes);
}
}
/**
* @private
* @param {?} changes
* @return {?}
*/
_applyChanges(changes) {
/** @type {?} */
const insertTuples = [];
changes.forEachOperation(( /**
* @param {?} item
* @param {?} adjustedPreviousIndex
* @param {?} currentIndex
* @return {?}
*/(item, adjustedPreviousIndex, currentIndex) => {
if (item.previousIndex == null) {
// NgForOf is never "null" or "undefined" here because the differ detected
// that a new item needs to be inserted from the iterable. This implies that
// there is an iterable value for "_ngForOf".
/** @type {?} */
const view = this._viewContainer.createEmbeddedView(this._template, new NgForOfContext(( /** @type {?} */(null)), ( /** @type {?} */(this._ngForOf)), -1, -1), currentIndex === null ? undefined : currentIndex);
/** @type {?} */
const tuple = new RecordViewTuple(item, view);
insertTuples.push(tuple);
}
else if (currentIndex == null) {
this._viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);
}
else if (adjustedPreviousIndex !== null) {
/** @type {?} */
const view = ( /** @type {?} */(this._viewContainer.get(adjustedPreviousIndex)));
this._viewContainer.move(view, currentIndex);
/** @type {?} */
const tuple = new RecordViewTuple(item, ( /** @type {?} */(view)));
insertTuples.push(tuple);
}
}));
for (let i = 0; i < insertTuples.length; i++) {
this._perViewChange(insertTuples[i].view, insertTuples[i].record);
}
for (let i = 0, ilen = this._viewContainer.length; i < ilen; i++) {
/** @type {?} */
const viewRef = ( /** @type {?} */(this._viewContainer.get(i)));
viewRef.context.index = i;
viewRef.context.count = ilen;
viewRef.context.ngForOf = ( /** @type {?} */(this._ngForOf));
}
changes.forEachIdentityChange(( /**
* @param {?} record
* @return {?}
*/(record) => {
/** @type {?} */
const viewRef = ( /** @type {?} */(this._viewContainer.get(record.currentIndex)));
viewRef.context.$implicit = record.item;
}));
}
/**
* @private
* @param {?} view
* @param {?} record
* @return {?}
*/
_perViewChange(view, record) {
view.context.$implicit = record.item;
}
/**
* Asserts the correct type of the context for the template that `NgForOf` will render.
*
* The presence of this method is a signal to the Ivy template type-check compiler that the
* `NgForOf` structural directive renders its template with a specific context type.
* @template T, U
* @param {?} dir
* @param {?} ctx
* @return {?}
*/
static ngTemplateContextGuard(dir, ctx) {
return true;
}
}
NgForOf.ɵfac = function NgForOf_Factory(t) { return new (t || NgForOf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"])); };
NgForOf.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgForOf, selectors: [["", "ngFor", "", "ngForOf", ""]], inputs: { ngForOf: "ngForOf", ngForTrackBy: "ngForTrackBy", ngForTemplate: "ngForTemplate" } });
return NgForOf;
})();
if (false) {}
/**
* @template T, U
*/
class RecordViewTuple {
/**
* @param {?} record
* @param {?} view
*/
constructor(record, view) {
this.record = record;
this.view = view;
}
}
if (false) {}
/**
* @param {?} type
* @return {?}
*/
function getTypeName(type) {
return type['name'] || typeof type;
}
let NgIf = /*@__PURE__*/ (() => {
class NgIf {
/**
* @param {?} _viewContainer
* @param {?} templateRef
*/
constructor(_viewContainer, templateRef) {
this._viewContainer = _viewContainer;
this._context = new NgIfContext();
this._thenTemplateRef = null;
this._elseTemplateRef = null;
this._thenViewRef = null;
this._elseViewRef = null;
this._thenTemplateRef = templateRef;
}
/**
* The Boolean expression to evaluate as the condition for showing a template.
* @param {?} condition
* @return {?}
*/
set ngIf(condition) {
this._context.$implicit = this._context.ngIf = condition;
this._updateView();
}
/**
* A template to show if the condition expression evaluates to true.
* @param {?} templateRef
* @return {?}
*/
set ngIfThen(templateRef) {
assertTemplate('ngIfThen', templateRef);
this._thenTemplateRef = templateRef;
this._thenViewRef = null; // clear previous view if any.
this._updateView();
}
/**
* A template to show if the condition expression evaluates to false.
* @param {?} templateRef
* @return {?}
*/
set ngIfElse(templateRef) {
assertTemplate('ngIfElse', templateRef);
this._elseTemplateRef = templateRef;
this._elseViewRef = null; // clear previous view if any.
this._updateView();
}
/**
* @private
* @return {?}
*/
_updateView() {
if (this._context.$implicit) {
if (!this._thenViewRef) {
this._viewContainer.clear();
this._elseViewRef = null;
if (this._thenTemplateRef) {
this._thenViewRef =
this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);
}
}
}
else {
if (!this._elseViewRef) {
this._viewContainer.clear();
this._thenViewRef = null;
if (this._elseTemplateRef) {
this._elseViewRef =
this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);
}
}
}
}
/**
* Asserts the correct type of the context for the template that `NgIf` will render.
*
* The presence of this method is a signal to the Ivy template type-check compiler that the
* `NgIf` structural directive renders its template with a specific context type.
* @template T
* @param {?} dir
* @param {?} ctx
* @return {?}
*/
static ngTemplateContextGuard(dir, ctx) {
return true;
}
}
NgIf.ɵfac = function NgIf_Factory(t) { return new (t || NgIf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"])); };
NgIf.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgIf, selectors: [["", "ngIf", ""]], inputs: { ngIf: "ngIf", ngIfThen: "ngIfThen", ngIfElse: "ngIfElse" } });
return NgIf;
})();
if (false) {}
/**
* \@publicApi
* @template T
*/
class NgIfContext {
constructor() {
this.$implicit = ( /** @type {?} */(null));
this.ngIf = ( /** @type {?} */(null));
}
}
if (false) {}
/**
* @param {?} property
* @param {?} templateRef
* @return {?}
*/
function assertTemplate(property, templateRef) {
/** @type {?} */
const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);
if (!isTemplateRefOrNull) {
throw new Error(`${property} must be a TemplateRef, but received '${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(templateRef)}'.`);
}
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/directives/ng_switch.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
class SwitchView {
/**
* @param {?} _viewContainerRef
* @param {?} _templateRef
*/
constructor(_viewContainerRef, _templateRef) {
this._viewContainerRef = _viewContainerRef;
this._templateRef = _templateRef;
this._created = false;
}
/**
* @return {?}
*/
create() {
this._created = true;
this._viewContainerRef.createEmbeddedView(this._templateRef);
}
/**
* @return {?}
*/
destroy() {
this._created = false;
this._viewContainerRef.clear();
}
/**
* @param {?} created
* @return {?}
*/
enforceState(created) {
if (created && !this._created) {
this.create();
}
else if (!created && this._created) {
this.destroy();
}
}
}
if (false) {}
let NgSwitch = /*@__PURE__*/ (() => {
class NgSwitch {
constructor() {
this._defaultUsed = false;
this._caseCount = 0;
this._lastCaseCheckIndex = 0;
this._lastCasesMatched = false;
}
/**
* @param {?} newValue
* @return {?}
*/
set ngSwitch(newValue) {
this._ngSwitch = newValue;
if (this._caseCount === 0) {
this._updateDefaultCases(true);
}
}
/**
* \@internal
* @return {?}
*/
_addCase() { return this._caseCount++; }
/**
* \@internal
* @param {?} view
* @return {?}
*/
_addDefault(view) {
if (!this._defaultViews) {
this._defaultViews = [];
}
this._defaultViews.push(view);
}
/**
* \@internal
* @param {?} value
* @return {?}
*/
_matchCase(value) {
/** @type {?} */
const matched = value == this._ngSwitch;
this._lastCasesMatched = this._lastCasesMatched || matched;
this._lastCaseCheckIndex++;
if (this._lastCaseCheckIndex === this._caseCount) {
this._updateDefaultCases(!this._lastCasesMatched);
this._lastCaseCheckIndex = 0;
this._lastCasesMatched = false;
}
return matched;
}
/**
* @private
* @param {?} useDefault
* @return {?}
*/
_updateDefaultCases(useDefault) {
if (this._defaultViews && useDefault !== this._defaultUsed) {
this._defaultUsed = useDefault;
for (let i = 0; i < this._defaultViews.length; i++) {
/** @type {?} */
const defaultView = this._defaultViews[i];
defaultView.enforceState(useDefault);
}
}
}
}
NgSwitch.ɵfac = function NgSwitch_Factory(t) { return new (t || NgSwitch)(); };
NgSwitch.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitch, selectors: [["", "ngSwitch", ""]], inputs: { ngSwitch: "ngSwitch" } });
return NgSwitch;
})();
if (false) {}
let NgSwitchCase = /*@__PURE__*/ (() => {
class NgSwitchCase {
/**
* @param {?} viewContainer
* @param {?} templateRef
* @param {?} ngSwitch
*/
constructor(viewContainer, templateRef, ngSwitch) {
this.ngSwitch = ngSwitch;
ngSwitch._addCase();
this._view = new SwitchView(viewContainer, templateRef);
}
/**
* Performs case matching. For internal use only.
* @return {?}
*/
ngDoCheck() { this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase)); }
}
NgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) { return new (t || NgSwitchCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 1)); };
NgSwitchCase.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchCase, selectors: [["", "ngSwitchCase", ""]], inputs: { ngSwitchCase: "ngSwitchCase" } });
return NgSwitchCase;
})();
if (false) {}
let NgSwitchDefault = /*@__PURE__*/ (() => {
class NgSwitchDefault {
/**
* @param {?} viewContainer
* @param {?} templateRef
* @param {?} ngSwitch
*/
constructor(viewContainer, templateRef, ngSwitch) {
ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));
}
}
NgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) { return new (t || NgSwitchDefault)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 1)); };
NgSwitchDefault.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchDefault, selectors: [["", "ngSwitchDefault", ""]] });
return NgSwitchDefault;
})();
let NgPlural = /*@__PURE__*/ (() => {
class NgPlural {
/**
* @param {?} _localization
*/
constructor(_localization) {
this._localization = _localization;
this._caseViews = {};
}
/**
* @param {?} value
* @return {?}
*/
set ngPlural(value) {
this._switchValue = value;
this._updateView();
}
/**
* @param {?} value
* @param {?} switchView
* @return {?}
*/
addCase(value, switchView) { this._caseViews[value] = switchView; }
/**
* @private
* @return {?}
*/
_updateView() {
this._clearViews();
/** @type {?} */
const cases = Object.keys(this._caseViews);
/** @type {?} */
const key = getPluralCategory(this._switchValue, cases, this._localization);
this._activateView(this._caseViews[key]);
}
/**
* @private
* @return {?}
*/
_clearViews() {
if (this._activeView)
this._activeView.destroy();
}
/**
* @private
* @param {?} view
* @return {?}
*/
_activateView(view) {
if (view) {
this._activeView = view;
this._activeView.create();
}
}
}
NgPlural.ɵfac = function NgPlural_Factory(t) { return new (t || NgPlural)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization)); };
NgPlural.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPlural, selectors: [["", "ngPlural", ""]], inputs: { ngPlural: "ngPlural" } });
return NgPlural;
})();
if (false) {}
let NgPluralCase = /*@__PURE__*/ (() => {
class NgPluralCase {
/**
* @param {?} value
* @param {?} template
* @param {?} viewContainer
* @param {?} ngPlural
*/
constructor(value, template, viewContainer, ngPlural) {
this.value = value;
/** @type {?} */
const isANumber = !isNaN(Number(value));
ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));
}
}
NgPluralCase.ɵfac = function NgPluralCase_Factory(t) { return new (t || NgPluralCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinjectAttribute"]('ngPluralCase'), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgPlural, 1)); };
NgPluralCase.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPluralCase, selectors: [["", "ngPluralCase", ""]] });
return NgPluralCase;
})();
if (false) {}
let NgStyle = /*@__PURE__*/ (() => {
class NgStyle {
/**
* @param {?} _ngEl
* @param {?} _differs
* @param {?} _renderer
*/
constructor(_ngEl, _differs, _renderer) {
this._ngEl = _ngEl;
this._differs = _differs;
this._renderer = _renderer;
this._ngStyle = null;
this._differ = null;
}
/**
* @param {?} values
* @return {?}
*/
set ngStyle(values) {
this._ngStyle = values;
if (!this._differ && values) {
this._differ = this._differs.find(values).create();
}
}
/**
* @return {?}
*/
ngDoCheck() {
if (this._differ) {
/** @type {?} */
const changes = this._differ.diff(( /** @type {?} */(this._ngStyle)));
if (changes) {
this._applyChanges(changes);
}
}
}
/**
* @private
* @param {?} nameAndUnit
* @param {?} value
* @return {?}
*/
_setStyle(nameAndUnit, value) {
const [name, unit] = nameAndUnit.split('.');
value = value != null && unit ? `${value}${unit}` : value;
if (value != null) {
this._renderer.setStyle(this._ngEl.nativeElement, name, ( /** @type {?} */(value)));
}
else {
this._renderer.removeStyle(this._ngEl.nativeElement, name);
}
}
/**
* @private
* @param {?} changes
* @return {?}
*/
_applyChanges(changes) {
changes.forEachRemovedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._setStyle(record.key, null)));
changes.forEachAddedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._setStyle(record.key, record.currentValue)));
changes.forEachChangedItem(( /**
* @param {?} record
* @return {?}
*/(record) => this._setStyle(record.key, record.currentValue)));
}
}
NgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"])); };
NgStyle.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgStyle, selectors: [["", "ngStyle", ""]], inputs: { ngStyle: "ngStyle" } });
return NgStyle;
})();
if (false) {}
let NgTemplateOutlet = /*@__PURE__*/ (() => {
class NgTemplateOutlet {
/**
* @param {?} _viewContainerRef
*/
constructor(_viewContainerRef) {
this._viewContainerRef = _viewContainerRef;
this._viewRef = null;
/**
* A context object to attach to the {\@link EmbeddedViewRef}. This should be an
* object, the object's keys will be available for binding by the local template `let`
* declarations.
* Using the key `$implicit` in the context object will set its value as default.
*/
this.ngTemplateOutletContext = null;
/**
* A string defining the template reference and optionally the context object for the template.
*/
this.ngTemplateOutlet = null;
}
/**
* @param {?} changes
* @return {?}
*/
ngOnChanges(changes) {
/** @type {?} */
const recreateView = this._shouldRecreateView(changes);
if (recreateView) {
/** @type {?} */
const viewContainerRef = this._viewContainerRef;
if (this._viewRef) {
viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));
}
this._viewRef = this.ngTemplateOutlet ?
viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :
null;
}
else if (this._viewRef && this.ngTemplateOutletContext) {
this._updateExistingContext(this.ngTemplateOutletContext);
}
}
/**
* We need to re-create existing embedded view if:
* - templateRef has changed
* - context has changes
*
* We mark context object as changed when the corresponding object
* shape changes (new properties are added or existing properties are removed).
* In other words we consider context with the same properties as "the same" even
* if object reference changes (see https://github.com/angular/angular/issues/13407).
* @private
* @param {?} changes
* @return {?}
*/
_shouldRecreateView(changes) {
/** @type {?} */
const ctxChange = changes['ngTemplateOutletContext'];
return !!changes['ngTemplateOutlet'] || (ctxChange && this._hasContextShapeChanged(ctxChange));
}
/**
* @private
* @param {?} ctxChange
* @return {?}
*/
_hasContextShapeChanged(ctxChange) {
/** @type {?} */
const prevCtxKeys = Object.keys(ctxChange.previousValue || {});
/** @type {?} */
const currCtxKeys = Object.keys(ctxChange.currentValue || {});
if (prevCtxKeys.length === currCtxKeys.length) {
for (let propName of currCtxKeys) {
if (prevCtxKeys.indexOf(propName) === -1) {
return true;
}
}
return false;
}
return true;
}
/**
* @private
* @param {?} ctx
* @return {?}
*/
_updateExistingContext(ctx) {
for (let propName of Object.keys(ctx)) {
(( /** @type {?} */(( /** @type {?} */(this._viewRef)).context)))[propName] = (( /** @type {?} */(this.ngTemplateOutletContext)))[propName];
}
}
}
NgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); };
NgTemplateOutlet.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgTemplateOutlet, selectors: [["", "ngTemplateOutlet", ""]], inputs: { ngTemplateOutletContext: "ngTemplateOutletContext", ngTemplateOutlet: "ngTemplateOutlet" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] });
return NgTemplateOutlet;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/directives/index.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* A collection of Angular directives that are likely to be used in each and every Angular
* application.
* @type {?}
*/
const COMMON_DIRECTIVES = [
NgClass,
NgComponentOutlet,
NgForOf,
NgIf,
NgTemplateOutlet,
NgStyle,
NgSwitch,
NgSwitchCase,
NgSwitchDefault,
NgPlural,
NgPluralCase,
];
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/pipes/invalid_pipe_argument_error.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @param {?} type
* @param {?} value
* @return {?}
*/
function invalidPipeArgumentError(type, value) {
return Error(`InvalidPipeArgument: '${value}' for pipe '${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(type)}'`);
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/pipes/async_pipe.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @record
*/
function SubscriptionStrategy() { }
if (false) {}
class ObservableStrategy {
/**
* @param {?} async
* @param {?} updateLatestValue
* @return {?}
*/
createSubscription(async, updateLatestValue) {
return async.subscribe({ next: updateLatestValue, error: ( /**
* @param {?} e
* @return {?}
*/(e) => { throw e; }) });
}
/**
* @param {?} subscription
* @return {?}
*/
dispose(subscription) { subscription.unsubscribe(); }
/**
* @param {?} subscription
* @return {?}
*/
onDestroy(subscription) { subscription.unsubscribe(); }
}
class PromiseStrategy {
/**
* @param {?} async
* @param {?} updateLatestValue
* @return {?}
*/
createSubscription(async, updateLatestValue) {
return async.then(updateLatestValue, ( /**
* @param {?} e
* @return {?}
*//**
* @param {?} e
* @return {?}
*/ e => { throw e; }));
}
/**
* @param {?} subscription
* @return {?}
*/
dispose(subscription) { }
/**
* @param {?} subscription
* @return {?}
*/
onDestroy(subscription) { }
}
/** @type {?} */
const _promiseStrategy = /*@__PURE__*/ new PromiseStrategy();
/** @type {?} */
const _observableStrategy = /*@__PURE__*/ new ObservableStrategy();
let AsyncPipe = /*@__PURE__*/ (() => {
class AsyncPipe {
/**
* @param {?} _ref
*/
constructor(_ref) {
this._ref = _ref;
this._latestValue = null;
this._latestReturnedValue = null;
this._subscription = null;
this._obj = null;
this._strategy = ( /** @type {?} */(null));
}
/**
* @return {?}
*/
ngOnDestroy() {
if (this._subscription) {
this._dispose();
}
}
/**
* @param {?} obj
* @return {?}
*/
transform(obj) {
if (!this._obj) {
if (obj) {
this._subscribe(obj);
}
this._latestReturnedValue = this._latestValue;
return this._latestValue;
}
if (obj !== this._obj) {
this._dispose();
return this.transform(( /** @type {?} */(obj)));
}
if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵlooseIdentical"])(this._latestValue, this._latestReturnedValue)) {
return this._latestReturnedValue;
}
this._latestReturnedValue = this._latestValue;
return _angular_core__WEBPACK_IMPORTED_MODULE_0__["WrappedValue"].wrap(this._latestValue);
}
/**
* @private
* @param {?} obj
* @return {?}
*/
_subscribe(obj) {
this._obj = obj;
this._strategy = this._selectStrategy(obj);
this._subscription = this._strategy.createSubscription(obj, ( /**
* @param {?} value
* @return {?}
*/(value) => this._updateLatestValue(obj, value)));
}
/**
* @private
* @param {?} obj
* @return {?}
*/
_selectStrategy(obj) {
if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisPromise"])(obj)) {
return _promiseStrategy;
}
if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisObservable"])(obj)) {
return _observableStrategy;
}
throw invalidPipeArgumentError(AsyncPipe, obj);
}
/**
* @private
* @return {?}
*/
_dispose() {
this._strategy.dispose(( /** @type {?} */(this._subscription)));
this._latestValue = null;
this._latestReturnedValue = null;
this._subscription = null;
this._obj = null;
}
/**
* @private
* @param {?} async
* @param {?} value
* @return {?}
*/
_updateLatestValue(async, value) {
if (async === this._obj) {
this._latestValue = value;
this._ref.markForCheck();
}
}
}
AsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinjectPipeChangeDetectorRef"]()); };
AsyncPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "async", type: AsyncPipe, pure: false });
return AsyncPipe;
})();
if (false) {}
let LowerCasePipe = /*@__PURE__*/ (() => {
class LowerCasePipe {
/**
* @param {?} value The string to transform to lower case.
* @return {?}
*/
transform(value) {
if (!value)
return value;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(LowerCasePipe, value);
}
return value.toLowerCase();
}
}
LowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); };
LowerCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "lowercase", type: LowerCasePipe, pure: true });
return LowerCasePipe;
})();
//
// Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result
// can be achieved by using /\p{L}\S*/gu and also known as Unicode Property Escapes
// (http://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no
// transpilation of this functionality down to ES5 without external tool, the only solution is
// to use already transpiled form. Example can be found here -
// https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1
//
/** @type {?} */
const unicodeWordMatch = /(?:[A-Za-z\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0561-\u0587\u05D0-\u05EA\u05F0-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u0860-\u086A\u08A0-\u08B4\u08B6-\u08BD\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u09FC\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C60\u0C61\u0C80\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D05-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D54-\u0D56\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E87\u0E88\u0E8A\u0E8D\u0E94-\u0E97\u0E99-\u0E9F\u0EA1-\u0EA3\u0EA5\u0EA7\u0EAA\u0EAB\u0EAD-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16F1-\u16F8\u1700-\u170C\u170E-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1877\u1880-\u1884\u1887-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4B\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1C80-\u1C88\u1CE9-\u1CEC\u1CEE-\u1CF1\u1CF5\u1CF6\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2119-\u211D\u2124\u2126\u2128\u212A-\u212D\u212F-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2183\u2184\u2C00-\u2C2E\u2C30-\u2C5E\u2C60-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2E2F\u3005\u3006\u3031-\u3035\u303B\u303C\u3041-\u3096\u309D-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312E\u3131-\u318E\u31A0-\u31BA\u31F0-\u31FF\u3400-\u4DB5\u4E00-\u9FEA\uA000-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6E5\uA717-\uA71F\uA722-\uA788\uA78B-\uA7AE\uA7B0-\uA7B7\uA7F7-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB65\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE70-\uFE74\uFE76-\uFEFC\uFF21-\uFF3A\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDE80-\uDE9C\uDEA0-\uDED0\uDF00-\uDF1F\uDF2D-\uDF40\uDF42-\uDF49\uDF50-\uDF75\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF]|\uD801[\uDC00-\uDC9D\uDCB0-\uDCD3\uDCD8-\uDCFB\uDD00-\uDD27\uDD30-\uDD63\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00\uDE10-\uDE13\uDE15-\uDE17\uDE19-\uDE33\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE4\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2]|\uD804[\uDC03-\uDC37\uDC83-\uDCAF\uDCD0-\uDCE8\uDD03-\uDD26\uDD50-\uDD72\uDD76\uDD83-\uDDB2\uDDC1-\uDDC4\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE2B\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEDE\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3D\uDF50\uDF5D-\uDF61]|\uD805[\uDC00-\uDC34\uDC47-\uDC4A\uDC80-\uDCAF\uDCC4\uDCC5\uDCC7\uDD80-\uDDAE\uDDD8-\uDDDB\uDE00-\uDE2F\uDE44\uDE80-\uDEAA\uDF00-\uDF19]|\uD806[\uDCA0-\uDCDF\uDCFF\uDE00\uDE0B-\uDE32\uDE3A\uDE50\uDE5C-\uDE83\uDE86-\uDE89\uDEC0-\uDEF8]|\uD807[\uDC00-\uDC08\uDC0A-\uDC2E\uDC40\uDC72-\uDC8F\uDD00-\uDD06\uDD08\uDD09\uDD0B-\uDD30\uDD46]|\uD808[\uDC00-\uDF99]|\uD809[\uDC80-\uDD43]|[\uD80C\uD81C-\uD820\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872\uD874-\uD879][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDED0-\uDEED\uDF00-\uDF2F\uDF40-\uDF43\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDF00-\uDF44\uDF50\uDF93-\uDF9F\uDFE0\uDFE1]|\uD821[\uDC00-\uDFEC]|\uD822[\uDC00-\uDEF2]|\uD82C[\uDC00-\uDD1E\uDD70-\uDEFB]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB]|\uD83A[\uDC00-\uDCC4\uDD00-\uDD43]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDED6\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF34\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1\uDEB0-\uDFFF]|\uD87A[\uDC00-\uDFE0]|\uD87E[\uDC00-\uDE1D])\S*/g;
let TitleCasePipe = /*@__PURE__*/ (() => {
class TitleCasePipe {
/**
* @param {?} value The string to transform to title case.
* @return {?}
*/
transform(value) {
if (!value)
return value;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(TitleCasePipe, value);
}
return value.replace(unicodeWordMatch, (( /**
* @param {?} txt
* @return {?}
*//**
* @param {?} txt
* @return {?}
*/ txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase())));
}
}
TitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); };
TitleCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "titlecase", type: TitleCasePipe, pure: true });
return TitleCasePipe;
})();
let UpperCasePipe = /*@__PURE__*/ (() => {
class UpperCasePipe {
/**
* @param {?} value The string to transform to upper case.
* @return {?}
*/
transform(value) {
if (!value)
return value;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(UpperCasePipe, value);
}
return value.toUpperCase();
}
}
UpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); };
UpperCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "uppercase", type: UpperCasePipe, pure: true });
return UpperCasePipe;
})();
let DatePipe = /*@__PURE__*/ (() => {
class DatePipe {
/**
* @param {?} locale
*/
constructor(locale) {
this.locale = locale;
}
/**
* @param {?} value The date expression: a `Date` object, a number
* (milliseconds since UTC epoch), or an ISO string (https://www.w3.org/TR/NOTE-datetime).
* @param {?=} format The date/time components to include, using predefined options or a
* custom format string.
* @param {?=} timezone A timezone offset (such as `'+0430'`), or a standard
* UTC/GMT or continental US timezone abbreviation.
* When not supplied, uses the end-user's local system timezone.
* @param {?=} locale A locale code for the locale format rules to use.
* When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
* See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).
* @return {?} A date string in the desired format.
*/
transform(value, format = 'mediumDate', timezone, locale) {
if (value == null || value === '' || value !== value)
return null;
try {
return formatDate(value, format, locale || this.locale, timezone);
}
catch (error) {
throw invalidPipeArgumentError(DatePipe, error.message);
}
}
}
DatePipe.ɵfac = function DatePipe_Factory(t) { return new (t || DatePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); };
DatePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "date", type: DatePipe, pure: true });
return DatePipe;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/pipes/i18n_plural_pipe.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/** @type {?} */
const _INTERPOLATION_REGEXP = /#/g;
let I18nPluralPipe = /*@__PURE__*/ (() => {
class I18nPluralPipe {
/**
* @param {?} _localization
*/
constructor(_localization) {
this._localization = _localization;
}
/**
* @param {?} value the number to be formatted
* @param {?} pluralMap an object that mimics the ICU format, see
* http://userguide.icu-project.org/formatparse/messages.
* @param {?=} locale a `string` defining the locale to use (uses the current {\@link LOCALE_ID} by
* default).
* @return {?}
*/
transform(value, pluralMap, locale) {
if (value == null)
return '';
if (typeof pluralMap !== 'object' || pluralMap === null) {
throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);
}
/** @type {?} */
const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);
return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());
}
}
I18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) { return new (t || I18nPluralPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization)); };
I18nPluralPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nPlural", type: I18nPluralPipe, pure: true });
return I18nPluralPipe;
})();
if (false) {}
let I18nSelectPipe = /*@__PURE__*/ (() => {
class I18nSelectPipe {
/**
* @param {?} value a string to be internationalized.
* @param {?} mapping an object that indicates the text that should be displayed
* for different values of the provided `value`.
* @return {?}
*/
transform(value, mapping) {
if (value == null)
return '';
if (typeof mapping !== 'object' || typeof value !== 'string') {
throw invalidPipeArgumentError(I18nSelectPipe, mapping);
}
if (mapping.hasOwnProperty(value)) {
return mapping[value];
}
if (mapping.hasOwnProperty('other')) {
return mapping['other'];
}
return '';
}
}
I18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) { return new (t || I18nSelectPipe)(); };
I18nSelectPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nSelect", type: I18nSelectPipe, pure: true });
return I18nSelectPipe;
})();
let JsonPipe = /*@__PURE__*/ (() => {
class JsonPipe {
/**
* @param {?} value A value of any type to convert into a JSON-format string.
* @return {?}
*/
transform(value) { return JSON.stringify(value, null, 2); }
}
JsonPipe.ɵfac = function JsonPipe_Factory(t) { return new (t || JsonPipe)(); };
JsonPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "json", type: JsonPipe, pure: false });
return JsonPipe;
})();
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/pipes/keyvalue_pipe.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @template K, V
* @param {?} key
* @param {?} value
* @return {?}
*/
function makeKeyValuePair(key, value) {
return { key: key, value: value };
}
/**
* A key value pair.
* Usually used to represent the key value pairs from a Map or Object.
*
* \@publicApi
* @record
* @template K, V
*/
function KeyValue() { }
if (false) {}
let KeyValuePipe = /*@__PURE__*/ (() => {
class KeyValuePipe {
/**
* @param {?} differs
*/
constructor(differs) {
this.differs = differs;
this.keyValues = [];
}
/**
* @template K, V
* @param {?} input
* @param {?=} compareFn
* @return {?}
*/
transform(input, compareFn = defaultComparator) {
if (!input || (!(input instanceof Map) && typeof input !== 'object')) {
return null;
}
if (!this.differ) {
// make a differ for whatever type we've been passed in
this.differ = this.differs.find(input).create();
}
/** @type {?} */
const differChanges = this.differ.diff(( /** @type {?} */(input)));
if (differChanges) {
this.keyValues = [];
differChanges.forEachItem(( /**
* @param {?} r
* @return {?}
*/(r) => {
this.keyValues.push(makeKeyValuePair(r.key, ( /** @type {?} */(r.currentValue))));
}));
this.keyValues.sort(compareFn);
}
return this.keyValues;
}
}
KeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) { return new (t || KeyValuePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"])); };
KeyValuePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "keyvalue", type: KeyValuePipe, pure: false });
return KeyValuePipe;
})();
if (false) {}
/**
* @template K, V
* @param {?} keyValueA
* @param {?} keyValueB
* @return {?}
*/
function defaultComparator(keyValueA, keyValueB) {
/** @type {?} */
const a = keyValueA.key;
/** @type {?} */
const b = keyValueB.key;
// if same exit with 0;
if (a === b)
return 0;
// make sure that undefined are at the end of the sort.
if (a === undefined)
return 1;
if (b === undefined)
return -1;
// make sure that nulls are at the end of the sort.
if (a === null)
return 1;
if (b === null)
return -1;
if (typeof a == 'string' && typeof b == 'string') {
return a < b ? -1 : 1;
}
if (typeof a == 'number' && typeof b == 'number') {
return a - b;
}
if (typeof a == 'boolean' && typeof b == 'boolean') {
return a < b ? -1 : 1;
}
// `a` and `b` are of different types. Compare their string values.
/** @type {?} */
const aString = String(a);
/** @type {?} */
const bString = String(b);
return aString == bString ? 0 : aString < bString ? -1 : 1;
}
let DecimalPipe = /*@__PURE__*/ (() => {
class DecimalPipe {
/**
* @param {?} _locale
*/
constructor(_locale) {
this._locale = _locale;
}
/**
* @param {?} value The number to be formatted.
* @param {?=} digitsInfo Decimal representation options, specified by a string
* in the following format:
* {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.
* - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
* Default is `1`.
* - `minFractionDigits`: The minimum number of digits after the decimal point.
* Default is `0`.
* - `maxFractionDigits`: The maximum number of digits after the decimal point.
* Default is `3`.
* @param {?=} locale A locale code for the locale format rules to use.
* When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
* See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).
* @return {?}
*/
transform(value, digitsInfo, locale) {
if (isEmpty(value))
return null;
locale = locale || this._locale;
try {
/** @type {?} */
const num = strToNumber(value);
return formatNumber(num, locale, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(DecimalPipe, error.message);
}
}
}
DecimalPipe.ɵfac = function DecimalPipe_Factory(t) { return new (t || DecimalPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); };
DecimalPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "number", type: DecimalPipe, pure: true });
return DecimalPipe;
})();
if (false) {}
let PercentPipe = /*@__PURE__*/ (() => {
class PercentPipe {
/**
* @param {?} _locale
*/
constructor(_locale) {
this._locale = _locale;
}
/**
*
* @param {?} value The number to be formatted as a percentage.
* @param {?=} digitsInfo Decimal representation options, specified by a string
* in the following format:
* {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.
* - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
* Default is `1`.
* - `minFractionDigits`: The minimum number of digits after the decimal point.
* Default is `0`.
* - `maxFractionDigits`: The maximum number of digits after the decimal point.
* Default is `0`.
* @param {?=} locale A locale code for the locale format rules to use.
* When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
* See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).
* @return {?}
*/
transform(value, digitsInfo, locale) {
if (isEmpty(value))
return null;
locale = locale || this._locale;
try {
/** @type {?} */
const num = strToNumber(value);
return formatPercent(num, locale, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(PercentPipe, error.message);
}
}
}
PercentPipe.ɵfac = function PercentPipe_Factory(t) { return new (t || PercentPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); };
PercentPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "percent", type: PercentPipe, pure: true });
return PercentPipe;
})();
if (false) {}
let CurrencyPipe = /*@__PURE__*/ (() => {
class CurrencyPipe {
/**
* @param {?} _locale
* @param {?=} _defaultCurrencyCode
*/
constructor(_locale, _defaultCurrencyCode = 'USD') {
this._locale = _locale;
this._defaultCurrencyCode = _defaultCurrencyCode;
}
/**
*
* @param {?} value The number to be formatted as currency.
* @param {?=} currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,
* such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be
* configured using the `DEFAULT_CURRENCY_CODE` injection token.
* @param {?=} display The format for the currency indicator. One of the following:
* - `code`: Show the code (such as `USD`).
* - `symbol`(default): Show the symbol (such as `$`).
* - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their
* currency.
* For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the
* locale has no narrow symbol, uses the standard symbol for the locale.
* - String: Use the given string value instead of a code or a symbol.
* For example, an empty string will suppress the currency & symbol.
* - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.
*
* @param {?=} digitsInfo Decimal representation options, specified by a string
* in the following format:
* {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
.
* - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
* Default is `1`.
* - `minFractionDigits`: The minimum number of digits after the decimal point.
* Default is `2`.
* - `maxFractionDigits`: The maximum number of digits after the decimal point.
* Default is `2`.
* If not provided, the number will be formatted with the proper amount of digits,
* depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.
* For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.
* @param {?=} locale A locale code for the locale format rules to use.
* When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
* See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).
* @return {?}
*/
transform(value, currencyCode, display = 'symbol', digitsInfo, locale) {
if (isEmpty(value))
return null;
locale = locale || this._locale;
if (typeof display === 'boolean') {
if (( /** @type {?} */(console)) && ( /** @type {?} */(console.warn))) {
console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are "code", "symbol" or "symbol-narrow".`);
}
display = display ? 'symbol' : 'code';
}
/** @type {?} */
let currency = currencyCode || this._defaultCurrencyCode;
if (display !== 'code') {
if (display === 'symbol' || display === 'symbol-narrow') {
currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);
}
else {
currency = display;
}
}
try {
/** @type {?} */
const num = strToNumber(value);
return formatCurrency(num, locale, currency, currencyCode, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(CurrencyPipe, error.message);
}
}
}
CurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["DEFAULT_CURRENCY_CODE"])); };
CurrencyPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "currency", type: CurrencyPipe, pure: true });
return CurrencyPipe;
})();
if (false) {}
/**
* @param {?} value
* @return {?}
*/
function isEmpty(value) {
return value == null || value === '' || value !== value;
}
/**
* Transforms a string into a number (if needed).
* @param {?} value
* @return {?}
*/
function strToNumber(value) {
// Convert strings to numbers
if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {
return Number(value);
}
if (typeof value !== 'number') {
throw new Error(`${value} is not a number`);
}
return value;
}
let SlicePipe = /*@__PURE__*/ (() => {
class SlicePipe {
/**
* @param {?} value
* @param {?} start
* @param {?=} end
* @return {?}
*/
transform(value, start, end) {
if (value == null)
return value;
if (!this.supports(value)) {
throw invalidPipeArgumentError(SlicePipe, value);
}
return value.slice(start, end);
}
/**
* @private
* @param {?} obj
* @return {?}
*/
supports(obj) { return typeof obj === 'string' || Array.isArray(obj); }
}
SlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); };
SlicePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "slice", type: SlicePipe, pure: false });
return SlicePipe;
})();
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/pipes/index.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* A collection of Angular pipes that are likely to be used in each and every application.
* @type {?}
*/
const COMMON_PIPES = [
AsyncPipe,
UpperCasePipe,
LowerCasePipe,
JsonPipe,
SlicePipe,
DecimalPipe,
PercentPipe,
TitleCasePipe,
CurrencyPipe,
DatePipe,
I18nPluralPipe,
I18nSelectPipe,
KeyValuePipe,
];
let CommonModule = /*@__PURE__*/ (() => {
class CommonModule {
}
CommonModule.ɵmod = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: CommonModule });
CommonModule.ɵinj = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function CommonModule_Factory(t) { return new (t || CommonModule)(); }, providers: [
{ provide: NgLocalization, useClass: NgLocaleLocalization },
] });
return CommonModule;
})();
/*@__PURE__*/ (function () {
(typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](CommonModule, { declarations: [NgClass,
NgComponentOutlet,
NgForOf,
NgIf,
NgTemplateOutlet,
NgStyle,
NgSwitch,
NgSwitchCase,
NgSwitchDefault,
NgPlural,
NgPluralCase,
AsyncPipe,
UpperCasePipe,
LowerCasePipe,
JsonPipe,
SlicePipe,
DecimalPipe,
PercentPipe,
TitleCasePipe,
CurrencyPipe,
DatePipe,
I18nPluralPipe,
I18nSelectPipe,
KeyValuePipe], exports: [NgClass,
NgComponentOutlet,
NgForOf,
NgIf,
NgTemplateOutlet,
NgStyle,
NgSwitch,
NgSwitchCase,
NgSwitchDefault,
NgPlural,
NgPluralCase,
AsyncPipe,
UpperCasePipe,
LowerCasePipe,
JsonPipe,
SlicePipe,
DecimalPipe,
PercentPipe,
TitleCasePipe,
CurrencyPipe,
DatePipe,
I18nPluralPipe,
I18nSelectPipe,
KeyValuePipe] });
})();
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/platform_id.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/** @type {?} */
const PLATFORM_BROWSER_ID = 'browser';
/** @type {?} */
const PLATFORM_SERVER_ID = 'server';
/** @type {?} */
const PLATFORM_WORKER_APP_ID = 'browserWorkerApp';
/** @type {?} */
const PLATFORM_WORKER_UI_ID = 'browserWorkerUi';
/**
* Returns whether a platform id represents a browser platform.
* \@publicApi
* @param {?} platformId
* @return {?}
*/
function isPlatformBrowser(platformId) {
return platformId === PLATFORM_BROWSER_ID;
}
/**
* Returns whether a platform id represents a server platform.
* \@publicApi
* @param {?} platformId
* @return {?}
*/
function isPlatformServer(platformId) {
return platformId === PLATFORM_SERVER_ID;
}
/**
* Returns whether a platform id represents a web worker app platform.
* \@publicApi
* @param {?} platformId
* @return {?}
*/
function isPlatformWorkerApp(platformId) {
return platformId === PLATFORM_WORKER_APP_ID;
}
/**
* Returns whether a platform id represents a web worker UI platform.
* \@publicApi
* @param {?} platformId
* @return {?}
*/
function isPlatformWorkerUi(platformId) {
return platformId === PLATFORM_WORKER_UI_ID;
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/version.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* \@publicApi
* @type {?}
*/
const VERSION = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["Version"]('9.0.7');
let ViewportScroller = /*@__PURE__*/ (() => {
class ViewportScroller {
}
// De-sugared tree-shakable injection
// See #23917
/** @nocollapse */
/** @nocollapse */ ViewportScroller.ɵprov = /*@__PURE__*/ Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({
token: ViewportScroller,
providedIn: 'root',
factory: ( /**
* @nocollapse @return {?}
*/() => new BrowserViewportScroller(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT), window, Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ErrorHandler"])))
});
return ViewportScroller;
})();
if (false) {}
/**
* Manages the scroll position for a browser window.
*/
class BrowserViewportScroller {
/**
* @param {?} document
* @param {?} window
* @param {?} errorHandler
*/
constructor(document, window, errorHandler) {
this.document = document;
this.window = window;
this.errorHandler = errorHandler;
this.offset = ( /**
* @return {?}
*/() => [0, 0]);
}
/**
* Configures the top offset used when scrolling to an anchor.
* @param {?} offset A position in screen coordinates (a tuple with x and y values)
* or a function that returns the top offset position.
*
* @return {?}
*/
setOffset(offset) {
if (Array.isArray(offset)) {
this.offset = ( /**
* @return {?}
*/() => offset);
}
else {
this.offset = offset;
}
}
/**
* Retrieves the current scroll position.
* @return {?} The position in screen coordinates.
*/
getScrollPosition() {
if (this.supportScrollRestoration()) {
return [this.window.scrollX, this.window.scrollY];
}
else {
return [0, 0];
}
}
/**
* Sets the scroll position.
* @param {?} position The new position in screen coordinates.
* @return {?}
*/
scrollToPosition(position) {
if (this.supportScrollRestoration()) {
this.window.scrollTo(position[0], position[1]);
}
}
/**
* Scrolls to an anchor element.
* @param {?} anchor The ID of the anchor element.
* @return {?}
*/
scrollToAnchor(anchor) {
if (this.supportScrollRestoration()) {
// Escape anything passed to `querySelector` as it can throw errors and stop the application
// from working if invalid values are passed.
if (this.window.CSS && this.window.CSS.escape) {
anchor = this.window.CSS.escape(anchor);
}
else {
anchor = anchor.replace(/(\"|\'\ |:|\.|\[|\]|,|=)/g, '\\$1');
}
try {
/** @type {?} */
const elSelectedById = this.document.querySelector(`#${anchor}`);
if (elSelectedById) {
this.scrollToElement(elSelectedById);
return;
}
/** @type {?} */
const elSelectedByName = this.document.querySelector(`[name='${anchor}']`);
if (elSelectedByName) {
this.scrollToElement(elSelectedByName);
return;
}
}
catch (e) {
this.errorHandler.handleError(e);
}
}
}
/**
* Disables automatic scroll restoration provided by the browser.
* @param {?} scrollRestoration
* @return {?}
*/
setHistoryScrollRestoration(scrollRestoration) {
if (this.supportScrollRestoration()) {
/** @type {?} */
const history = this.window.history;
if (history && history.scrollRestoration) {
history.scrollRestoration = scrollRestoration;
}
}
}
/**
* @private
* @param {?} el
* @return {?}
*/
scrollToElement(el) {
/** @type {?} */
const rect = el.getBoundingClientRect();
/** @type {?} */
const left = rect.left + this.window.pageXOffset;
/** @type {?} */
const top = rect.top + this.window.pageYOffset;
/** @type {?} */
const offset = this.offset();
this.window.scrollTo(left - offset[0], top - offset[1]);
}
/**
* We only support scroll restoration when we can get a hold of window.
* This means that we do not support this behavior when running in a web worker.
*
* Lifting this restriction right now would require more changes in the dom adapter.
* Since webworkers aren't widely used, we will lift it once RouterScroller is
* battle-tested.
* @private
* @return {?}
*/
supportScrollRestoration() {
try {
return !!this.window && !!this.window.scrollTo;
}
catch (_a) {
return false;
}
}
}
if (false) {}
/**
* Provides an empty implementation of the viewport scroller. This will
* live in \@angular/common as it will be used by both platform-server and platform-webworker.
*/
class NullViewportScroller {
/**
* Empty implementation
* @param {?} offset
* @return {?}
*/
setOffset(offset) { }
/**
* Empty implementation
* @return {?}
*/
getScrollPosition() { return [0, 0]; }
/**
* Empty implementation
* @param {?} position
* @return {?}
*/
scrollToPosition(position) { }
/**
* Empty implementation
* @param {?} anchor
* @return {?}
*/
scrollToAnchor(anchor) { }
/**
* Empty implementation
* @param {?} scrollRestoration
* @return {?}
*/
setHistoryScrollRestoration(scrollRestoration) { }
}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/src/common.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/public_api.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/index.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Generated bundle index. Do not edit.
*/
/***/ }),
/***/ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/http.js":
/*!********************************************************************!*\
!*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/http.js ***!
\********************************************************************/
/*! exports provided: HTTP_INTERCEPTORS, HttpBackend, HttpClient, HttpClientJsonpModule, HttpClientModule, HttpClientXsrfModule, HttpErrorResponse, HttpEventType, HttpHandler, HttpHeaderResponse, HttpHeaders, HttpParams, HttpRequest, HttpResponse, HttpResponseBase, HttpUrlEncodingCodec, HttpXhrBackend, HttpXsrfTokenExtractor, JsonpClientBackend, JsonpInterceptor, XhrFactory, ɵHttpInterceptingHandler, ɵangular_packages_common_http_http_a, ɵangular_packages_common_http_http_b, ɵangular_packages_common_http_http_c, ɵangular_packages_common_http_http_d, ɵangular_packages_common_http_http_e, ɵangular_packages_common_http_http_f, ɵangular_packages_common_http_http_g, ɵangular_packages_common_http_http_h */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HTTP_INTERCEPTORS", function() { return HTTP_INTERCEPTORS; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpBackend", function() { return HttpBackend; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClient", function() { return HttpClient; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientJsonpModule", function() { return HttpClientJsonpModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientModule", function() { return HttpClientModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientXsrfModule", function() { return HttpClientXsrfModule; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpErrorResponse", function() { return HttpErrorResponse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpEventType", function() { return HttpEventType; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHandler", function() { return HttpHandler; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHeaderResponse", function() { return HttpHeaderResponse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHeaders", function() { return HttpHeaders; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpParams", function() { return HttpParams; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpRequest", function() { return HttpRequest; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpResponse", function() { return HttpResponse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpResponseBase", function() { return HttpResponseBase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpUrlEncodingCodec", function() { return HttpUrlEncodingCodec; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpXhrBackend", function() { return HttpXhrBackend; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpXsrfTokenExtractor", function() { return HttpXsrfTokenExtractor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonpClientBackend", function() { return JsonpClientBackend; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonpInterceptor", function() { return JsonpInterceptor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "XhrFactory", function() { return XhrFactory; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵHttpInterceptingHandler", function() { return HttpInterceptingHandler; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_a", function() { return NoopInterceptor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_b", function() { return JsonpCallbackContext; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_c", function() { return jsonpCallbackContext; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_d", function() { return BrowserXhr; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_e", function() { return XSRF_COOKIE_NAME; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_f", function() { return XSRF_HEADER_NAME; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_g", function() { return HttpXsrfCookieExtractor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_h", function() { return HttpXsrfInterceptor; });
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js");
/* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js");
/* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js");
/* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js");
/**
* @license Angular v9.0.7
* (c) 2010-2020 Google LLC. https://angular.io/
* License: MIT
*/
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/backend.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a
* `HttpResponse`.
*
* `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the
* first interceptor in the chain, which dispatches to the second, etc, eventually reaching the
* `HttpBackend`.
*
* In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.
*
* \@publicApi
* @abstract
*/
class HttpHandler {
}
if (false) {}
/**
* A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.
*
* Interceptors sit between the `HttpClient` interface and the `HttpBackend`.
*
* When injected, `HttpBackend` dispatches requests directly to the backend, without going
* through the interceptor chain.
*
* \@publicApi
* @abstract
*/
class HttpBackend {
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/headers.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @record
*/
function Update() { }
if (false) {}
/**
* Represents the header configuration options for an HTTP request.
* Instances are immutable. Modifying methods return a cloned
* instance with the change. The original object is never changed.
*
* \@publicApi
*/
class HttpHeaders {
/**
* Constructs a new HTTP header object with the given values.
* @param {?=} headers
*/
constructor(headers) {
/**
* Internal map of lowercased header names to the normalized
* form of the name (the form seen first).
*/
this.normalizedNames = new Map();
/**
* Queued updates to be materialized the next initialization.
*/
this.lazyUpdate = null;
if (!headers) {
this.headers = new Map();
}
else if (typeof headers === 'string') {
this.lazyInit = ( /**
* @return {?}
*/() => {
this.headers = new Map();
headers.split('\n').forEach(( /**
* @param {?} line
* @return {?}
*//**
* @param {?} line
* @return {?}
*/ line => {
/** @type {?} */
const index = line.indexOf(':');
if (index > 0) {
/** @type {?} */
const name = line.slice(0, index);
/** @type {?} */
const key = name.toLowerCase();
/** @type {?} */
const value = line.slice(index + 1).trim();
this.maybeSetNormalizedName(name, key);
if (this.headers.has(key)) {
( /** @type {?} */(this.headers.get(key))).push(value);
}
else {
this.headers.set(key, [value]);
}
}
}));
});
}
else {
this.lazyInit = ( /**
* @return {?}
*/() => {
this.headers = new Map();
Object.keys(headers).forEach(( /**
* @param {?} name
* @return {?}
*//**
* @param {?} name
* @return {?}
*/ name => {
/** @type {?} */
let values = headers[name];
/** @type {?} */
const key = name.toLowerCase();
if (typeof values === 'string') {
values = [values];
}
if (values.length > 0) {
this.headers.set(key, values);
this.maybeSetNormalizedName(name, key);
}
}));
});
}
}
/**
* Checks for existence of a given header.
*
* @param {?} name The header name to check for existence.
*
* @return {?} True if the header exists, false otherwise.
*/
has(name) {
this.init();
return this.headers.has(name.toLowerCase());
}
/**
* Retrieves the first value of a given header.
*
* @param {?} name The header name.
*
* @return {?} The value string if the header exists, null otherwise
*/
get(name) {
this.init();
/** @type {?} */
const values = this.headers.get(name.toLowerCase());
return values && values.length > 0 ? values[0] : null;
}
/**
* Retrieves the names of the headers.
*
* @return {?} A list of header names.
*/
keys() {
this.init();
return Array.from(this.normalizedNames.values());
}
/**
* Retrieves a list of values for a given header.
*
* @param {?} name The header name from which to retrieve values.
*
* @return {?} A string of values if the header exists, null otherwise.
*/
getAll(name) {
this.init();
return this.headers.get(name.toLowerCase()) || null;
}
/**
* Appends a new value to the existing set of values for a header
* and returns them in a clone of the original instance.
*
* @param {?} name The header name for which to append the values.
* @param {?} value The value to append.
*
* @return {?} A clone of the HTTP headers object with the value appended to the given header.
*/
append(name, value) {
return this.clone({ name, value, op: 'a' });
}
/**
* Sets or modifies a value for a given header in a clone of the original instance.
* If the header already exists, its value is replaced with the given value
* in the returned object.
*
* @param {?} name The header name.
* @param {?} value The value or values to set or overide for the given header.
*
* @return {?} A clone of the HTTP headers object with the newly set header value.
*/
set(name, value) {
return this.clone({ name, value, op: 's' });
}
/**
* Deletes values for a given header in a clone of the original instance.
*
* @param {?} name The header name.
* @param {?=} value The value or values to delete for the given header.
*
* @return {?} A clone of the HTTP headers object with the given value deleted.
*/
delete(name, value) {
return this.clone({ name, value, op: 'd' });
}
/**
* @private
* @param {?} name
* @param {?} lcName
* @return {?}
*/
maybeSetNormalizedName(name, lcName) {
if (!this.normalizedNames.has(lcName)) {
this.normalizedNames.set(lcName, name);
}
}
/**
* @private
* @return {?}
*/
init() {
if (!!this.lazyInit) {
if (this.lazyInit instanceof HttpHeaders) {
this.copyFrom(this.lazyInit);
}
else {
this.lazyInit();
}
this.lazyInit = null;
if (!!this.lazyUpdate) {
this.lazyUpdate.forEach(( /**
* @param {?} update
* @return {?}
*//**
* @param {?} update
* @return {?}
*/ update => this.applyUpdate(update)));
this.lazyUpdate = null;
}
}
}
/**
* @private
* @param {?} other
* @return {?}
*/
copyFrom(other) {
other.init();
Array.from(other.headers.keys()).forEach(( /**
* @param {?} key
* @return {?}
*//**
* @param {?} key
* @return {?}
*/ key => {
this.headers.set(key, ( /** @type {?} */(other.headers.get(key))));
this.normalizedNames.set(key, ( /** @type {?} */(other.normalizedNames.get(key))));
}));
}
/**
* @private
* @param {?} update
* @return {?}
*/
clone(update) {
/** @type {?} */
const clone = new HttpHeaders();
clone.lazyInit =
(!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;
clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);
return clone;
}
/**
* @private
* @param {?} update
* @return {?}
*/
applyUpdate(update) {
/** @type {?} */
const key = update.name.toLowerCase();
switch (update.op) {
case 'a':
case 's':
/** @type {?} */
let value = ( /** @type {?} */(update.value));
if (typeof value === 'string') {
value = [value];
}
if (value.length === 0) {
return;
}
this.maybeSetNormalizedName(update.name, key);
/** @type {?} */
const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];
base.push(...value);
this.headers.set(key, base);
break;
case 'd':
/** @type {?} */
const toDelete = ( /** @type {?} */(update.value));
if (!toDelete) {
this.headers.delete(key);
this.normalizedNames.delete(key);
}
else {
/** @type {?} */
let existing = this.headers.get(key);
if (!existing) {
return;
}
existing = existing.filter(( /**
* @param {?} value
* @return {?}
*//**
* @param {?} value
* @return {?}
*/ value => toDelete.indexOf(value) === -1));
if (existing.length === 0) {
this.headers.delete(key);
this.normalizedNames.delete(key);
}
else {
this.headers.set(key, existing);
}
}
break;
}
}
/**
* \@internal
* @param {?} fn
* @return {?}
*/
forEach(fn) {
this.init();
Array.from(this.normalizedNames.keys())
.forEach(( /**
* @param {?} key
* @return {?}
*//**
* @param {?} key
* @return {?}
*/ key => fn(( /** @type {?} */(this.normalizedNames.get(key))), ( /** @type {?} */(this.headers.get(key))))));
}
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/params.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* @license
* Copyright Google Inc. All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A codec for encoding and decoding parameters in URLs.
*
* Used by `HttpParams`.
*
* \@publicApi
*
* @record
*/
function HttpParameterCodec() { }
if (false) {}
/**
* Provides encoding and decoding of URL parameter and query-string values.
*
* Serializes and parses URL parameter keys and values to encode and decode them.
* If you pass URL query parameters without encoding,
* the query parameters can be misinterpreted at the receiving end.
*
*
* \@publicApi
*/
class HttpUrlEncodingCodec {
/**
* Encodes a key name for a URL parameter or query-string.
* @param {?} key The key name.
* @return {?} The encoded key name.
*/
encodeKey(key) { return standardEncoding(key); }
/**
* Encodes the value of a URL parameter or query-string.
* @param {?} value The value.
* @return {?} The encoded value.
*/
encodeValue(value) { return standardEncoding(value); }
/**
* Decodes an encoded URL parameter or query-string key.
* @param {?} key The encoded key name.
* @return {?} The decoded key name.
*/
decodeKey(key) { return decodeURIComponent(key); }
/**
* Decodes an encoded URL parameter or query-string value.
* @param {?} value The encoded value.
* @return {?} The decoded value.
*/
decodeValue(value) { return decodeURIComponent(value); }
}
/**
* @param {?} rawParams
* @param {?} codec
* @return {?}
*/
function paramParser(rawParams, codec) {
/** @type {?} */
const map = new Map();
if (rawParams.length > 0) {
/** @type {?} */
const params = rawParams.split('&');
params.forEach(( /**
* @param {?} param
* @return {?}
*/(param) => {
/** @type {?} */
const eqIdx = param.indexOf('=');
const [key, val] = eqIdx == -1 ?
[codec.decodeKey(param), ''] :
[codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];
/** @type {?} */
const list = map.get(key) || [];
list.push(val);
map.set(key, list);
}));
}
return map;
}
/**
* @param {?} v
* @return {?}
*/
function standardEncoding(v) {
return encodeURIComponent(v)
.replace(/%40/gi, '@')
.replace(/%3A/gi, ':')
.replace(/%24/gi, '$')
.replace(/%2C/gi, ',')
.replace(/%3B/gi, ';')
.replace(/%2B/gi, '+')
.replace(/%3D/gi, '=')
.replace(/%3F/gi, '?')
.replace(/%2F/gi, '/');
}
/**
* @record
*/
function Update$1() { }
if (false) {}
/**
* Options used to construct an `HttpParams` instance.
*
* \@publicApi
* @record
*/
function HttpParamsOptions() { }
if (false) {}
/**
* An HTTP request/response body that represents serialized parameters,
* per the MIME type `application/x-www-form-urlencoded`.
*
* This class is immutable; all mutation operations return a new instance.
*
* \@publicApi
*/
class HttpParams {
/**
* @param {?=} options
*/
constructor(options = ( /** @type {?} */({}))) {
this.updates = null;
this.cloneFrom = null;
this.encoder = options.encoder || new HttpUrlEncodingCodec();
if (!!options.fromString) {
if (!!options.fromObject) {
throw new Error(`Cannot specify both fromString and fromObject.`);
}
this.map = paramParser(options.fromString, this.encoder);
}
else if (!!options.fromObject) {
this.map = new Map();
Object.keys(options.fromObject).forEach(( /**
* @param {?} key
* @return {?}
*//**
* @param {?} key
* @return {?}
*/ key => {
/** @type {?} */
const value = (( /** @type {?} */(options.fromObject)))[key];
( /** @type {?} */(this.map)).set(key, Array.isArray(value) ? value : [value]);
}));
}
else {
this.map = null;
}
}
/**
* Reports whether the body includes one or more values for a given parameter.
* @param {?} param The parameter name.
* @return {?} True if the parameter has one or more values,
* false if it has no value or is not present.
*/
has(param) {
this.init();
return ( /** @type {?} */(this.map)).has(param);
}
/**
* Retrieves the first value for a parameter.
* @param {?} param The parameter name.
* @return {?} The first value of the given parameter,
* or `null` if the parameter is not present.
*/
get(param) {
this.init();
/** @type {?} */
const res = ( /** @type {?} */(this.map)).get(param);
return !!res ? res[0] : null;
}
/**
* Retrieves all values for a parameter.
* @param {?} param The parameter name.
* @return {?} All values in a string array,
* or `null` if the parameter not present.
*/
getAll(param) {
this.init();
return ( /** @type {?} */(this.map)).get(param) || null;
}
/**
* Retrieves all the parameters for this body.
* @return {?} The parameter names in a string array.
*/
keys() {
this.init();
return Array.from(( /** @type {?} */(this.map)).keys());
}
/**
* Appends a new value to existing values for a parameter.
* @param {?} param The parameter name.
* @param {?} value The new value to add.
* @return {?} A new body with the appended value.
*/
append(param, value) { return this.clone({ param, value, op: 'a' }); }
/**
* Replaces the value for a parameter.
* @param {?} param The parameter name.
* @param {?} value The new value.
* @return {?} A new body with the new value.
*/
set(param, value) { return this.clone({ param, value, op: 's' }); }
/**
* Removes a given value or all values from a parameter.
* @param {?} param The parameter name.
* @param {?=} value The value to remove, if provided.
* @return {?} A new body with the given value removed, or with all values
* removed if no value is specified.
*/
delete(param, value) { return this.clone({ param, value, op: 'd' }); }
/**
* Serializes the body to an encoded string, where key-value pairs (separated by `=`) are
* separated by `&`s.
* @return {?}
*/
toString() {
this.init();
return this.keys()
.map(( /**
* @param {?} key
* @return {?}
*//**
* @param {?} key
* @return {?}
*/ key => {
/** @type {?} */
const eKey = this.encoder.encodeKey(key);
// `a: ['1']` produces `'a=1'`
// `b: []` produces `''`
// `c: ['1', '2']` produces `'c=1&c=2'`
return ( /** @type {?} */(( /** @type {?} */(this.map)).get(key))).map(( /**
* @param {?} value
* @return {?}
*//**
* @param {?} value
* @return {?}
*/ value => eKey + '=' + this.encoder.encodeValue(value)))
.join('&');
}))
// filter out empty values because `b: []` produces `''`
// which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't
.filter(( /**
* @param {?} param
* @return {?}
*//**
* @param {?} param
* @return {?}
*/ param => param !== ''))
.join('&');
}
/**
* @private
* @param {?} update
* @return {?}
*/
clone(update) {
/** @type {?} */
const clone = new HttpParams(( /** @type {?} */({ encoder: this.encoder })));
clone.cloneFrom = this.cloneFrom || this;
clone.updates = (this.updates || []).concat([update]);
return clone;
}
/**
* @private
* @return {?}
*/
init() {
if (this.map === null) {
this.map = new Map();
}
if (this.cloneFrom !== null) {
this.cloneFrom.init();
this.cloneFrom.keys().forEach(( /**
* @param {?} key
* @return {?}
*//**
* @param {?} key
* @return {?}
*/ key => ( /** @type {?} */(this.map)).set(key, ( /** @type {?} */(( /** @type {?} */(( /** @type {?} */(this.cloneFrom)).map)).get(key))))));
( /** @type {?} */(this.updates)).forEach(( /**
* @param {?} update
* @return {?}
*//**
* @param {?} update
* @return {?}
*/ update => {
switch (update.op) {
case 'a':
case 's':
/** @type {?} */
const base = (update.op === 'a' ? ( /** @type {?} */(this.map)).get(update.param) : undefined) || [];
base.push(( /** @type {?} */(update.value)));
( /** @type {?} */(this.map)).set(update.param, base);
break;
case 'd':
if (update.value !== undefined) {
/** @type {?} */
let base = ( /** @type {?} */(this.map)).get(update.param) || [];
/** @type {?} */
const idx = base.indexOf(update.value);
if (idx !== -1) {
base.splice(idx, 1);
}
if (base.length > 0) {
( /** @type {?} */(this.map)).set(update.param, base);
}
else {
( /** @type {?} */(this.map)).delete(update.param);
}
}
else {
( /** @type {?} */(this.map)).delete(update.param);
break;
}
}
}));
this.cloneFrom = this.updates = null;
}
}
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/request.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Construction interface for `HttpRequest`s.
*
* All values are optional and will override default values if provided.
* @record
*/
function HttpRequestInit() { }
if (false) {}
/**
* Determine whether the given HTTP method may include a body.
* @param {?} method
* @return {?}
*/
function mightHaveBody(method) {
switch (method) {
case 'DELETE':
case 'GET':
case 'HEAD':
case 'OPTIONS':
case 'JSONP':
return false;
default:
return true;
}
}
/**
* Safely assert whether the given value is an ArrayBuffer.
*
* In some execution environments ArrayBuffer is not defined.
* @param {?} value
* @return {?}
*/
function isArrayBuffer(value) {
return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;
}
/**
* Safely assert whether the given value is a Blob.
*
* In some execution environments Blob is not defined.
* @param {?} value
* @return {?}
*/
function isBlob(value) {
return typeof Blob !== 'undefined' && value instanceof Blob;
}
/**
* Safely assert whether the given value is a FormData instance.
*
* In some execution environments FormData is not defined.
* @param {?} value
* @return {?}
*/
function isFormData(value) {
return typeof FormData !== 'undefined' && value instanceof FormData;
}
/**
* An outgoing HTTP request with an optional typed body.
*
* `HttpRequest` represents an outgoing request, including URL, method,
* headers, body, and other request configuration options. Instances should be
* assumed to be immutable. To modify a `HttpRequest`, the `clone`
* method should be used.
*
* \@publicApi
* @template T
*/
class HttpRequest {
/**
* @param {?} method
* @param {?} url
* @param {?=} third
* @param {?=} fourth
*/
constructor(method, url, third, fourth) {
this.url = url;
/**
* The request body, or `null` if one isn't set.
*
* Bodies are not enforced to be immutable, as they can include a reference to any
* user-defined data type. However, interceptors should take care to preserve
* idempotence by treating them as such.
*/
this.body = null;
/**
* Whether this request should be made in a way that exposes progress events.
*
* Progress events are expensive (change detection runs on each event) and so
* they should only be requested if the consumer intends to monitor them.
*/
this.reportProgress = false;
/**
* Whether this request should be sent with outgoing credentials (cookies).
*/
this.withCredentials = false;
/**
* The expected response type of the server.
*
* This is used to parse the response appropriately before returning it to
* the requestee.
*/
this.responseType = 'json';
this.method = method.toUpperCase();
// Next, need to figure out which argument holds the HttpRequestInit
// options, if any.
/** @type {?} */
let options;
// Check whether a body argument is expected. The only valid way to omit
// the body argument is to use a known no-body method like GET.
if (mightHaveBody(this.method) || !!fourth) {
// Body is the third argument, options are the fourth.
this.body = (third !== undefined) ? ( /** @type {?} */(third)) : null;
options = fourth;
}
else {
// No body required, options are the third argument. The body stays null.
options = ( /** @type {?} */(third));
}
// If options have been passed, interpret them.
if (options) {
// Normalize reportProgress and withCredentials.
this.reportProgress = !!options.reportProgress;
this.withCredentials = !!options.withCredentials;
// Override default response type of 'json' if one is provided.
if (!!options.responseType) {
this.responseType = options.responseType;
}
// Override headers if they're provided.
if (!!options.headers) {
this.headers = options.headers;
}
if (!!options.params) {
this.params = options.params;
}
}
// If no headers have been passed in, construct a new HttpHeaders instance.
if (!this.headers) {
this.headers = new HttpHeaders();
}
// If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.
if (!this.params) {
this.params = new HttpParams();
this.urlWithParams = url;
}
else {
// Encode the parameters to a string in preparation for inclusion in the URL.
/** @type {?} */
const params = this.params.toString();
if (params.length === 0) {
// No parameters, the visible URL is just the URL given at creation time.
this.urlWithParams = url;
}
else {
// Does the URL already have query parameters? Look for '?'.
/** @type {?} */
const qIdx = url.indexOf('?');
// There are 3 cases to handle:
// 1) No existing parameters -> append '?' followed by params.
// 2) '?' exists and is followed by existing query string ->
// append '&' followed by params.
// 3) '?' exists at the end of the url -> append params directly.
// This basically amounts to determining the character, if any, with
// which to join the URL and parameters.
/** @type {?} */
const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');
this.urlWithParams = url + sep + params;
}
}
}
/**
* Transform the free-form body into a serialized format suitable for
* transmission to the server.
* @return {?}
*/
serializeBody() {
// If no body is present, no need to serialize it.
if (this.body === null) {
return null;
}
// Check whether the body is already in a serialized form. If so,
// it can just be returned directly.
if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||
typeof this.body === 'string') {
return this.body;
}
// Check whether the body is an instance of HttpUrlEncodedParams.
if (this.body instanceof HttpParams) {
return this.body.toString();
}
// Check whether the body is an object or array, and serialize with JSON if so.
if (typeof this.body === 'object' || typeof this.body === 'boolean' ||
Array.isArray(this.body)) {
return JSON.stringify(this.body);
}
// Fall back on toString() for everything else.
return (( /** @type {?} */(this.body))).toString();
}
/**
* Examine the body and attempt to infer an appropriate MIME type
* for it.
*
* If no such type can be inferred, this method will return `null`.
* @return {?}
*/
detectContentTypeHeader() {
// An empty body has no content type.
if (this.body === null) {
return null;
}
// FormData bodies rely on the browser's content type assignment.
if (isFormData(this.body)) {
return null;
}
// Blobs usually have their own content type. If it doesn't, then
// no type can be inferred.
if (isBlob(this.body)) {
return this.body.type || null;
}
// Array buffers have unknown contents and thus no type can be inferred.
if (isArrayBuffer(this.body)) {
return null;
}
// Technically, strings could be a form of JSON data, but it's safe enough
// to assume they're plain strings.
if (typeof this.body === 'string') {
return 'text/plain';
}
// `HttpUrlEncodedParams` has its own content-type.
if (this.body instanceof HttpParams) {
return 'application/x-www-form-urlencoded;charset=UTF-8';
}
// Arrays, objects, and numbers will be encoded as JSON.
if (typeof this.body === 'object' || typeof this.body === 'number' ||
Array.isArray(this.body)) {
return 'application/json';
}
// No type could be inferred.
return null;
}
/**
* @param {?=} update
* @return {?}
*/
clone(update = {}) {
// For method, url, and responseType, take the current value unless
// it is overridden in the update hash.
/** @type {?} */
const method = update.method || this.method;
/** @type {?} */
const url = update.url || this.url;
/** @type {?} */
const responseType = update.responseType || this.responseType;
// The body is somewhat special - a `null` value in update.body means
// whatever current body is present is being overridden with an empty
// body, whereas an `undefined` value in update.body implies no
// override.
/** @type {?} */
const body = (update.body !== undefined) ? update.body : this.body;
// Carefully handle the boolean options to differentiate between
// `false` and `undefined` in the update args.
/** @type {?} */
const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;
/** @type {?} */
const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;
// Headers and params may be appended to if `setHeaders` or
// `setParams` are used.
/** @type {?} */
let headers = update.headers || this.headers;
/** @type {?} */
let params = update.params || this.params;
// Check whether the caller has asked to add headers.
if (update.setHeaders !== undefined) {
// Set every requested header.
headers =
Object.keys(update.setHeaders)
.reduce(( /**
* @param {?} headers
* @param {?} name
* @return {?}
*/(headers, name) => headers.set(name, ( /** @type {?} */(update.setHeaders))[name])), headers);
}
// Check whether the caller has asked to set params.
if (update.setParams) {
// Set every requested param.
params = Object.keys(update.setParams)
.reduce(( /**
* @param {?} params
* @param {?} param
* @return {?}
*/(params, param) => params.set(param, ( /** @type {?} */(update.setParams))[param])), params);
}
// Finally, construct the new HttpRequest using the pieces from above.
return new HttpRequest(method, url, body, {
params, headers, reportProgress, responseType, withCredentials,
});
}
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/response.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/** @enum {number} */
const HttpEventType = /*@__PURE__*/ (function () {
var HttpEventType = {
/**
* The request was sent out over the wire.
*/
Sent: 0,
/**
* An upload progress event was received.
*/
UploadProgress: 1,
/**
* The response status code and headers were received.
*/
ResponseHeader: 2,
/**
* A download progress event was received.
*/
DownloadProgress: 3,
/**
* The full response including the body was received.
*/
Response: 4,
/**
* A custom event from an interceptor or a backend.
*/
User: 5,
};
HttpEventType[HttpEventType.Sent] = 'Sent';
HttpEventType[HttpEventType.UploadProgress] = 'UploadProgress';
HttpEventType[HttpEventType.ResponseHeader] = 'ResponseHeader';
HttpEventType[HttpEventType.DownloadProgress] = 'DownloadProgress';
HttpEventType[HttpEventType.Response] = 'Response';
HttpEventType[HttpEventType.User] = 'User';
return HttpEventType;
}());
/**
* Base interface for progress events.
*
* \@publicApi
* @record
*/
function HttpProgressEvent() { }
if (false) {}
/**
* A download progress event.
*
* \@publicApi
* @record
*/
function HttpDownloadProgressEvent() { }
if (false) {}
/**
* An upload progress event.
*
* \@publicApi
* @record
*/
function HttpUploadProgressEvent() { }
if (false) {}
/**
* An event indicating that the request was sent to the server. Useful
* when a request may be retried multiple times, to distinguish between
* retries on the final event stream.
*
* \@publicApi
* @record
*/
function HttpSentEvent() { }
if (false) {}
/**
* A user-defined event.
*
* Grouping all custom events under this type ensures they will be handled
* and forwarded by all implementations of interceptors.
*
* \@publicApi
* @record
* @template T
*/
function HttpUserEvent() { }
if (false) {}
/**
* An error that represents a failed attempt to JSON.parse text coming back
* from the server.
*
* It bundles the Error object with the actual response body that failed to parse.
*
*
* @record
*/
function HttpJsonParseError() { }
if (false) {}
/**
* Base class for both `HttpResponse` and `HttpHeaderResponse`.
*
* \@publicApi
* @abstract
*/
class HttpResponseBase {
/**
* Super-constructor for all responses.
*
* The single parameter accepted is an initialization hash. Any properties
* of the response passed there will override the default values.
* @param {?} init
* @param {?=} defaultStatus
* @param {?=} defaultStatusText
*/
constructor(init, defaultStatus = 200, defaultStatusText = 'OK') {
// If the hash has values passed, use them to initialize the response.
// Otherwise use the default values.
this.headers = init.headers || new HttpHeaders();
this.status = init.status !== undefined ? init.status : defaultStatus;
this.statusText = init.statusText || defaultStatusText;
this.url = init.url || null;
// Cache the ok value to avoid defining a getter.
this.ok = this.status >= 200 && this.status < 300;
}
}
if (false) {}
/**
* A partial HTTP response which only includes the status and header data,
* but no response body.
*
* `HttpHeaderResponse` is a `HttpEvent` available on the response
* event stream, only when progress events are requested.
*
* \@publicApi
*/
class HttpHeaderResponse extends HttpResponseBase {
/**
* Create a new `HttpHeaderResponse` with the given parameters.
* @param {?=} init
*/
constructor(init = {}) {
super(init);
this.type = HttpEventType.ResponseHeader;
}
/**
* Copy this `HttpHeaderResponse`, overriding its contents with the
* given parameter hash.
* @param {?=} update
* @return {?}
*/
clone(update = {}) {
// Perform a straightforward initialization of the new HttpHeaderResponse,
// overriding the current parameters with new ones if given.
return new HttpHeaderResponse({
headers: update.headers || this.headers,
status: update.status !== undefined ? update.status : this.status,
statusText: update.statusText || this.statusText,
url: update.url || this.url || undefined,
});
}
}
if (false) {}
/**
* A full HTTP response, including a typed response body (which may be `null`
* if one was not returned).
*
* `HttpResponse` is a `HttpEvent` available on the response event
* stream.
*
* \@publicApi
* @template T
*/
class HttpResponse extends HttpResponseBase {
/**
* Construct a new `HttpResponse`.
* @param {?=} init
*/
constructor(init = {}) {
super(init);
this.type = HttpEventType.Response;
this.body = init.body !== undefined ? init.body : null;
}
/**
* @param {?=} update
* @return {?}
*/
clone(update = {}) {
return new HttpResponse({
body: (update.body !== undefined) ? update.body : this.body,
headers: update.headers || this.headers,
status: (update.status !== undefined) ? update.status : this.status,
statusText: update.statusText || this.statusText,
url: update.url || this.url || undefined,
});
}
}
if (false) {}
/**
* A response that represents an error or failure, either from a
* non-successful HTTP status, an error while executing the request,
* or some other failure which occurred during the parsing of the response.
*
* Any error returned on the `Observable` response stream will be
* wrapped in an `HttpErrorResponse` to provide additional context about
* the state of the HTTP layer when the error occurred. The error property
* will contain either a wrapped Error object or the error response returned
* from the server.
*
* \@publicApi
*/
class HttpErrorResponse extends HttpResponseBase {
/**
* @param {?} init
*/
constructor(init) {
// Initialize with a default status of 0 / Unknown Error.
super(init, 0, 'Unknown Error');
this.name = 'HttpErrorResponse';
/**
* Errors are never okay, even when the status code is in the 2xx success range.
*/
this.ok = false;
// If the response was successful, then this was a parse error. Otherwise, it was
// a protocol-level failure of some sort. Either the request failed in transit
// or the server returned an unsuccessful status code.
if (this.status >= 200 && this.status < 300) {
this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;
}
else {
this.message =
`Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;
}
this.error = init.error || null;
}
}
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/client.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and
* the given `body`. This function clones the object and adds the body.
*
* Note that the `responseType` *options* value is a String that identifies the
* single data type of the response.
* A single overload version of the method handles each response type.
* The value of `responseType` cannot be a union, as the combined signature could imply.
*
* @template T
* @param {?} options
* @param {?} body
* @return {?}
*/
function addBody(options, body) {
return {
body,
headers: options.headers,
observe: options.observe,
params: options.params,
reportProgress: options.reportProgress,
responseType: options.responseType,
withCredentials: options.withCredentials,
};
}
let HttpClient = /*@__PURE__*/ (() => {
class HttpClient {
/**
* @param {?} handler
*/
constructor(handler) {
this.handler = handler;
}
/**
* Constructs an observable for a generic HTTP request that, when subscribed,
* fires the request through the chain of registered interceptors and on to the
* server.
*
* You can pass an `HttpRequest` directly as the only parameter. In this case,
* the call returns an observable of the raw `HttpEvent` stream.
*
* Alternatively you can pass an HTTP method as the first parameter,
* a URL string as the second, and an options hash containing the request body as the third.
* See `addBody()`. In this case, the specified `responseType` and `observe` options determine the
* type of returned observable.
* * The `responseType` value determines how a successful response body is parsed.
* * If `responseType` is the default `json`, you can pass a type interface for the resulting
* object as a type parameter to the call.
*
* The `observe` value determines the return type, according to what you are interested in
* observing.
* * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including
* progress events by default.
* * An `observe` value of response returns an observable of `HttpResponse`,
* where the `T` parameter depends on the `responseType` and any optionally provided type
* parameter.
* * An `observe` value of body returns an observable of `` with the same `T` body type.
*
* @param {?} first
* @param {?=} url
* @param {?=} options
* @return {?}
*/
request(first, url, options = {}) {
/** @type {?} */
let req;
// First, check whether the primary argument is an instance of `HttpRequest`.
if (first instanceof HttpRequest) {
// It is. The other arguments must be undefined (per the signatures) and can be
// ignored.
req = first;
}
else {
// It's a string, so it represents a URL. Construct a request based on it,
// and incorporate the remaining arguments (assuming `GET` unless a method is
// provided.
// Figure out the headers.
/** @type {?} */
let headers = undefined;
if (options.headers instanceof HttpHeaders) {
headers = options.headers;
}
else {
headers = new HttpHeaders(options.headers);
}
// Sort out parameters.
/** @type {?} */
let params = undefined;
if (!!options.params) {
if (options.params instanceof HttpParams) {
params = options.params;
}
else {
params = new HttpParams(( /** @type {?} */({ fromObject: options.params })));
}
}
// Construct the request.
req = new HttpRequest(first, ( /** @type {?} */(url)), (options.body !== undefined ? options.body : null), {
headers,
params,
reportProgress: options.reportProgress,
// By default, JSON is assumed to be returned for all calls.
responseType: options.responseType || 'json',
withCredentials: options.withCredentials,
});
}
// Start with an Observable.of() the initial request, and run the handler (which
// includes all interceptors) inside a concatMap(). This way, the handler runs
// inside an Observable chain, which causes interceptors to be re-run on every
// subscription (this also makes retries re-run the handler, including interceptors).
/** @type {?} */
const events$ = Object(rxjs__WEBPACK_IMPORTED_MODULE_1__["of"])(req).pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["concatMap"])(( /**
* @param {?} req
* @return {?}
*/(req) => this.handler.handle(req))));
// If coming via the API signature which accepts a previously constructed HttpRequest,
// the only option is to get the event stream. Otherwise, return the event stream if
// that is what was requested.
if (first instanceof HttpRequest || options.observe === 'events') {
return events$;
}
// The requested stream contains either the full response or the body. In either
// case, the first step is to filter the event stream to extract a stream of
// responses(s).
/** @type {?} */
const res$ = ( /** @type {?} */(events$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["filter"])(( /**
* @param {?} event
* @return {?}
*/(event) => event instanceof HttpResponse)))));
// Decide which stream to return.
switch (options.observe || 'body') {
case 'body':
// The requested stream is the body. Map the response stream to the response
// body. This could be done more simply, but a misbehaving interceptor might
// transform the response body into a different format and ignore the requested
// responseType. Guard against this by validating that the response is of the
// requested type.
switch (req.responseType) {
case 'arraybuffer':
return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])(( /**
* @param {?} res
* @return {?}
*/(res) => {
// Validate that the body is an ArrayBuffer.
if (res.body !== null && !(res.body instanceof ArrayBuffer)) {
throw new Error('Response is not an ArrayBuffer.');
}
return res.body;
})));
case 'blob':
return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])(( /**
* @param {?} res
* @return {?}
*/(res) => {
// Validate that the body is a Blob.
if (res.body !== null && !(res.body instanceof Blob)) {
throw new Error('Response is not a Blob.');
}
return res.body;
})));
case 'text':
return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])(( /**
* @param {?} res
* @return {?}
*/(res) => {
// Validate that the body is a string.
if (res.body !== null && typeof res.body !== 'string') {
throw new Error('Response is not a string.');
}
return res.body;
})));
case 'json':
default:
// No validation needed for JSON responses, as they can be of any type.
return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])(( /**
* @param {?} res
* @return {?}
*/(res) => res.body)));
}
case 'response':
// The response stream was requested directly, so return it.
return res$;
default:
// Guard against new future observe types being added.
throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);
}
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `DELETE` request to execute on the server. See the individual overloads for
* details on the return type.
*
* @param {?} url The endpoint URL.
* @param {?=} options The HTTP options to send with the request.
*
* @return {?}
*/
delete(url, options = {}) {
return this.request('DELETE', url, ( /** @type {?} */(options)));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `GET` request to execute on the server. See the individual overloads for
* details on the return type.
* @param {?} url
* @param {?=} options
* @return {?}
*/
get(url, options = {}) {
return this.request('GET', url, ( /** @type {?} */(options)));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `HEAD` request to execute on the server. The `HEAD` method returns
* meta information about the resource without transferring the
* resource itself. See the individual overloads for
* details on the return type.
* @param {?} url
* @param {?=} options
* @return {?}
*/
head(url, options = {}) {
return this.request('HEAD', url, ( /** @type {?} */(options)));
}
/**
* Constructs an `Observable` that, when subscribed, causes a request with the special method
* `JSONP` to be dispatched via the interceptor pipeline.
* The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain
* API endpoints that don't support newer,
* and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.
* JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the
* requests even if the API endpoint is not located on the same domain (origin) as the client-side
* application making the request.
* The endpoint API must support JSONP callback for JSONP requests to work.
* The resource API returns the JSON response wrapped in a callback function.
* You can pass the callback function name as one of the query parameters.
* Note that JSONP requests can only be used with `GET` requests.
*
* @template T
* @param {?} url The resource URL.
* @param {?} callbackParam The callback function name.
*
* @return {?}
*/
jsonp(url, callbackParam) {
return this.request('JSONP', url, {
params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),
observe: 'body',
responseType: 'json',
});
}
/**
* Constructs an `Observable` that, when subscribed, causes the configured
* `OPTIONS` request to execute on the server. This method allows the client
* to determine the supported HTTP methods and other capabilites of an endpoint,
* without implying a resource action. See the individual overloads for
* details on the return type.
* @param {?} url
* @param {?=} options
* @return {?}
*/
options(url, options = {}) {
return this.request('OPTIONS', url, ( /** @type {?} */(options)));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `PATCH` request to execute on the server. See the individual overloads for
* details on the return type.
* @param {?} url
* @param {?} body
* @param {?=} options
* @return {?}
*/
patch(url, body, options = {}) {
return this.request('PATCH', url, addBody(options, body));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `POST` request to execute on the server. The server responds with the location of
* the replaced resource. See the individual overloads for
* details on the return type.
* @param {?} url
* @param {?} body
* @param {?=} options
* @return {?}
*/
post(url, body, options = {}) {
return this.request('POST', url, addBody(options, body));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `PUT` request to execute on the server. The `PUT` method replaces an existing resource
* with a new set of values.
* See the individual overloads for details on the return type.
* @param {?} url
* @param {?} body
* @param {?=} options
* @return {?}
*/
put(url, body, options = {}) {
return this.request('PUT', url, addBody(options, body));
}
}
HttpClient.ɵfac = function HttpClient_Factory(t) { return new (t || HttpClient)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](HttpHandler)); };
HttpClient.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: HttpClient, factory: HttpClient.ɵfac });
return HttpClient;
})();
if (false) {}
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/interceptor.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
/**
* Intercepts and handles an `HttpRequest` or `HttpResponse`.
*
* Most interceptors transform the outgoing request before passing it to the
* next interceptor in the chain, by calling `next.handle(transformedReq)`.
* An interceptor may transform the
* response event stream as well, by applying additional RxJS operators on the stream
* returned by `next.handle()`.
*
* More rarely, an interceptor may handle the request entirely,
* and compose a new event stream instead of invoking `next.handle()`. This is an
* acceptable behavior, but keep in mind that further interceptors will be skipped entirely.
*
* It is also rare but valid for an interceptor to return multiple responses on the
* event stream for a single request.
*
* \@publicApi
*
* @see [HTTP Guide](guide/http#intercepting-requests-and-responses)
*
* \@usageNotes
*
* To use the same instance of `HttpInterceptors` for the entire app, import the `HttpClientModule`
* only in your `AppModule`, and add the interceptors to the root application injector .
* If you import `HttpClientModule` multiple times across different modules (for example, in lazy
* loading modules), each import creates a new copy of the `HttpClientModule`, which overwrites the interceptors
* provided in the root module.
*
* @record
*/
function HttpInterceptor() { }
if (false) {}
/**
* `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.
*
*
*/
class HttpInterceptorHandler {
/**
* @param {?} next
* @param {?} interceptor
*/
constructor(next, interceptor) {
this.next = next;
this.interceptor = interceptor;
}
/**
* @param {?} req
* @return {?}
*/
handle(req) {
return this.interceptor.intercept(req, this.next);
}
}
if (false) {}
/**
* A multi-provider token that represents the array of registered
* `HttpInterceptor` objects.
*
* \@publicApi
* @type {?}
*/
const HTTP_INTERCEPTORS = /*@__PURE__*/ new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('HTTP_INTERCEPTORS');
let NoopInterceptor = /*@__PURE__*/ (() => {
class NoopInterceptor {
/**
* @param {?} req
* @param {?} next
* @return {?}
*/
intercept(req, next) {
return next.handle(req);
}
}
NoopInterceptor.ɵfac = function NoopInterceptor_Factory(t) { return new (t || NoopInterceptor)(); };
NoopInterceptor.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: NoopInterceptor, factory: NoopInterceptor.ɵfac });
return NoopInterceptor;
})();
/**
* @fileoverview added by tsickle
* Generated from: packages/common/http/src/jsonp.ts
* @suppress {checkTypes,constantProperty,extraRequire,missingOverride,missingReturn,unusedPrivateMembers,uselessCode} checked by tsc
*/
// Every request made through JSONP needs a callback name that's unique across the
// whole page. Each request is assigned an id and the callback name is constructed
// from that. The next id to be assigned is tracked in a global variable here that
// is shared among all applications on the page.
/** @type {?} */
let nextRequestId = 0;
// Error text given when a JSONP script is injected, but doesn't invoke the callback
// passed in its URL.
/** @type {?} */
const JSONP_ERR_NO_CALLBACK = 'JSONP injected script did not invoke callback.';
// Error text given when a request is passed to the JsonpClientBackend that doesn't
// have a request method JSONP.
/** @type {?} */
const JSONP_ERR_WRONG_METHOD = 'JSONP requests must use JSONP request method.';
/** @type {?} */
const JSONP_ERR_WRONG_RESPONSE_TYPE = 'JSONP requests must use Json response type.';
/**
* DI token/abstract type representing a map of JSONP callbacks.
*
* In the browser, this should always be the `window` object.
*
*
* @abstract
*/
class JsonpCallbackContext {
}
let JsonpClientBackend = /*@__PURE__*/ (() => {
class JsonpClientBackend {
/**
* @param {?} callbackMap
* @param {?} document
*/
constructor(callbackMap, document) {
this.callbackMap = callbackMap;
this.document = document;
}
/**
* Get the name of the next callback method, by incrementing the global `nextRequestId`.
* @private
* @return {?}
*/
nextCallback() { return `ng_jsonp_callback_${nextRequestId++}`; }
/**
* Processes a JSONP request and returns an event stream of the results.
* @param {?} req The request object.
* @return {?} An observable of the response events.
*
*/
handle(req) {
// Firstly, check both the method and response type. If either doesn't match
// then the request was improperly routed here and cannot be handled.
if (req.method !== 'JSONP') {
throw new Error(JSONP_ERR_WRONG_METHOD);
}
else if (req.responseType !== 'json') {
throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE);
}
// Everything else happens inside the Observable boundary.
return new rxjs__WEBPACK_IMPORTED_MODULE_1__["Observable"](( /**
* @param {?} observer
* @return {?}
*/(observer) => {
// The first step to make a request is to generate the callback name, and replace the
// callback placeholder in the URL with the name. Care has to be taken here to ensure
// a trailing &, if matched, gets inserted back into the URL in the correct place.
/** @type {?} */
const callback = this.nextCallback();
/** @type {?} */
const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);
// Construct the
if (val === '') return true;
if (val === 'false') return false;
if (val === 'true') return true;
return val;
}
if (DOCUMENT && typeof DOCUMENT.querySelector === 'function') {
var attrs = [['data-family-prefix', 'familyPrefix'], ['data-replacement-class', 'replacementClass'], ['data-auto-replace-svg', 'autoReplaceSvg'], ['data-auto-add-css', 'autoAddCss'], ['data-auto-a11y', 'autoA11y'], ['data-search-pseudo-elements', 'searchPseudoElements'], ['data-observe-mutations', 'observeMutations'], ['data-mutate-approach', 'mutateApproach'], ['data-keep-original-source', 'keepOriginalSource'], ['data-measure-performance', 'measurePerformance'], ['data-show-missing-icons', 'showMissingIcons']];
attrs.forEach(function (_ref) {
var _ref2 = _slicedToArray(_ref, 2),
attr = _ref2[0],
key = _ref2[1];
var val = coerce(getAttrConfig(attr));
if (val !== undefined && val !== null) {
initial[key] = val;
}
});
}
var _default = {
familyPrefix: DEFAULT_FAMILY_PREFIX,
replacementClass: DEFAULT_REPLACEMENT_CLASS,
autoReplaceSvg: true,
autoAddCss: true,
autoA11y: true,
searchPseudoElements: false,
observeMutations: true,
mutateApproach: 'async',
keepOriginalSource: true,
measurePerformance: false,
showMissingIcons: true
};
var _config = _objectSpread({}, _default, initial);
if (!_config.autoReplaceSvg) _config.observeMutations = false;
var config = _objectSpread({}, _config);
WINDOW.FontAwesomeConfig = config;
var w = WINDOW || {};
if (!w[NAMESPACE_IDENTIFIER]) w[NAMESPACE_IDENTIFIER] = {};
if (!w[NAMESPACE_IDENTIFIER].styles) w[NAMESPACE_IDENTIFIER].styles = {};
if (!w[NAMESPACE_IDENTIFIER].hooks) w[NAMESPACE_IDENTIFIER].hooks = {};
if (!w[NAMESPACE_IDENTIFIER].shims) w[NAMESPACE_IDENTIFIER].shims = [];
var namespace = w[NAMESPACE_IDENTIFIER];
var functions = [];
var listener = function listener() {
DOCUMENT.removeEventListener('DOMContentLoaded', listener);
loaded = 1;
functions.map(function (fn) {
return fn();
});
};
var loaded = false;
if (IS_DOM) {
loaded = (DOCUMENT.documentElement.doScroll ? /^loaded|^c/ : /^loaded|^i|^c/).test(DOCUMENT.readyState);
if (!loaded) DOCUMENT.addEventListener('DOMContentLoaded', listener);
}
function domready (fn) {
if (!IS_DOM) return;
loaded ? setTimeout(fn, 0) : functions.push(fn);
}
var PENDING = 'pending';
var SETTLED = 'settled';
var FULFILLED = 'fulfilled';
var REJECTED = 'rejected';
var NOOP = function NOOP() {};
var isNode = typeof global !== 'undefined' && typeof global.process !== 'undefined' && typeof global.process.emit === 'function';
var asyncSetTimer = typeof setImmediate === 'undefined' ? setTimeout : setImmediate;
var asyncQueue = [];
var asyncTimer;
function asyncFlush() {
// run promise callbacks
for (var i = 0; i < asyncQueue.length; i++) {
asyncQueue[i][0](asyncQueue[i][1]);
} // reset async asyncQueue
asyncQueue = [];
asyncTimer = false;
}
function asyncCall(callback, arg) {
asyncQueue.push([callback, arg]);
if (!asyncTimer) {
asyncTimer = true;
asyncSetTimer(asyncFlush, 0);
}
}
function invokeResolver(resolver, promise) {
function resolvePromise(value) {
resolve(promise, value);
}
function rejectPromise(reason) {
reject(promise, reason);
}
try {
resolver(resolvePromise, rejectPromise);
} catch (e) {
rejectPromise(e);
}
}
function invokeCallback(subscriber) {
var owner = subscriber.owner;
var settled = owner._state;
var value = owner._data;
var callback = subscriber[settled];
var promise = subscriber.then;
if (typeof callback === 'function') {
settled = FULFILLED;
try {
value = callback(value);
} catch (e) {
reject(promise, e);
}
}
if (!handleThenable(promise, value)) {
if (settled === FULFILLED) {
resolve(promise, value);
}
if (settled === REJECTED) {
reject(promise, value);
}
}
}
function handleThenable(promise, value) {
var resolved;
try {
if (promise === value) {
throw new TypeError('A promises callback cannot return that same promise.');
}
if (value && (typeof value === 'function' || _typeof(value) === 'object')) {
// then should be retrieved only once
var then = value.then;
if (typeof then === 'function') {
then.call(value, function (val) {
if (!resolved) {
resolved = true;
if (value === val) {
fulfill(promise, val);
} else {
resolve(promise, val);
}
}
}, function (reason) {
if (!resolved) {
resolved = true;
reject(promise, reason);
}
});
return true;
}
}
} catch (e) {
if (!resolved) {
reject(promise, e);
}
return true;
}
return false;
}
function resolve(promise, value) {
if (promise === value || !handleThenable(promise, value)) {
fulfill(promise, value);
}
}
function fulfill(promise, value) {
if (promise._state === PENDING) {
promise._state = SETTLED;
promise._data = value;
asyncCall(publishFulfillment, promise);
}
}
function reject(promise, reason) {
if (promise._state === PENDING) {
promise._state = SETTLED;
promise._data = reason;
asyncCall(publishRejection, promise);
}
}
function publish(promise) {
promise._then = promise._then.forEach(invokeCallback);
}
function publishFulfillment(promise) {
promise._state = FULFILLED;
publish(promise);
}
function publishRejection(promise) {
promise._state = REJECTED;
publish(promise);
if (!promise._handled && isNode) {
global.process.emit('unhandledRejection', promise._data, promise);
}
}
function notifyRejectionHandled(promise) {
global.process.emit('rejectionHandled', promise);
}
/**
* @class
*/
function P(resolver) {
if (typeof resolver !== 'function') {
throw new TypeError('Promise resolver ' + resolver + ' is not a function');
}
if (this instanceof P === false) {
throw new TypeError('Failed to construct \'Promise\': Please use the \'new\' operator, this object constructor cannot be called as a function.');
}
this._then = [];
invokeResolver(resolver, this);
}
P.prototype = {
constructor: P,
_state: PENDING,
_then: null,
_data: undefined,
_handled: false,
then: function then(onFulfillment, onRejection) {
var subscriber = {
owner: this,
then: new this.constructor(NOOP),
fulfilled: onFulfillment,
rejected: onRejection
};
if ((onRejection || onFulfillment) && !this._handled) {
this._handled = true;
if (this._state === REJECTED && isNode) {
asyncCall(notifyRejectionHandled, this);
}
}
if (this._state === FULFILLED || this._state === REJECTED) {
// already resolved, call callback async
asyncCall(invokeCallback, subscriber);
} else {
// subscribe
this._then.push(subscriber);
}
return subscriber.then;
},
catch: function _catch(onRejection) {
return this.then(null, onRejection);
}
};
P.all = function (promises) {
if (!Array.isArray(promises)) {
throw new TypeError('You must pass an array to Promise.all().');
}
return new P(function (resolve, reject) {
var results = [];
var remaining = 0;
function resolver(index) {
remaining++;
return function (value) {
results[index] = value;
if (! --remaining) {
resolve(results);
}
};
}
for (var i = 0, promise; i < promises.length; i++) {
promise = promises[i];
if (promise && typeof promise.then === 'function') {
promise.then(resolver(i), reject);
} else {
results[i] = promise;
}
}
if (!remaining) {
resolve(results);
}
});
};
P.race = function (promises) {
if (!Array.isArray(promises)) {
throw new TypeError('You must pass an array to Promise.race().');
}
return new P(function (resolve, reject) {
for (var i = 0, promise; i < promises.length; i++) {
promise = promises[i];
if (promise && typeof promise.then === 'function') {
promise.then(resolve, reject);
} else {
resolve(promise);
}
}
});
};
P.resolve = function (value) {
if (value && _typeof(value) === 'object' && value.constructor === P) {
return value;
}
return new P(function (resolve) {
resolve(value);
});
};
P.reject = function (reason) {
return new P(function (resolve, reject) {
reject(reason);
});
};
var picked = typeof Promise === 'function' ? Promise : P;
var d = UNITS_IN_GRID;
var meaninglessTransform = {
size: 16,
x: 0,
y: 0,
rotate: 0,
flipX: false,
flipY: false
};
function isReserved(name) {
return ~RESERVED_CLASSES.indexOf(name);
}
function insertCss(css) {
if (!css || !IS_DOM) {
return;
}
var style = DOCUMENT.createElement('style');
style.setAttribute('type', 'text/css');
style.innerHTML = css;
var headChildren = DOCUMENT.head.childNodes;
var beforeChild = null;
for (var i = headChildren.length - 1; i > -1; i--) {
var child = headChildren[i];
var tagName = (child.tagName || '').toUpperCase();
if (['STYLE', 'LINK'].indexOf(tagName) > -1) {
beforeChild = child;
}
}
DOCUMENT.head.insertBefore(style, beforeChild);
return css;
}
var idPool = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ';
function nextUniqueId() {
var size = 12;
var id = '';
while (size-- > 0) {
id += idPool[Math.random() * 62 | 0];
}
return id;
}
function toArray(obj) {
var array = [];
for (var i = (obj || []).length >>> 0; i--;) {
array[i] = obj[i];
}
return array;
}
function classArray(node) {
if (node.classList) {
return toArray(node.classList);
} else {
return (node.getAttribute('class') || '').split(' ').filter(function (i) {
return i;
});
}
}
function getIconName(familyPrefix, cls) {
var parts = cls.split('-');
var prefix = parts[0];
var iconName = parts.slice(1).join('-');
if (prefix === familyPrefix && iconName !== '' && !isReserved(iconName)) {
return iconName;
} else {
return null;
}
}
function htmlEscape(str) {
return "".concat(str).replace(/&/g, '&').replace(/"/g, '"').replace(/'/g, ''').replace(//g, '>');
}
function joinAttributes(attributes) {
return Object.keys(attributes || {}).reduce(function (acc, attributeName) {
return acc + "".concat(attributeName, "=\"").concat(htmlEscape(attributes[attributeName]), "\" ");
}, '').trim();
}
function joinStyles(styles) {
return Object.keys(styles || {}).reduce(function (acc, styleName) {
return acc + "".concat(styleName, ": ").concat(styles[styleName], ";");
}, '');
}
function transformIsMeaningful(transform) {
return transform.size !== meaninglessTransform.size || transform.x !== meaninglessTransform.x || transform.y !== meaninglessTransform.y || transform.rotate !== meaninglessTransform.rotate || transform.flipX || transform.flipY;
}
function transformForSvg(_ref) {
var transform = _ref.transform,
containerWidth = _ref.containerWidth,
iconWidth = _ref.iconWidth;
var outer = {
transform: "translate(".concat(containerWidth / 2, " 256)")
};
var innerTranslate = "translate(".concat(transform.x * 32, ", ").concat(transform.y * 32, ") ");
var innerScale = "scale(".concat(transform.size / 16 * (transform.flipX ? -1 : 1), ", ").concat(transform.size / 16 * (transform.flipY ? -1 : 1), ") ");
var innerRotate = "rotate(".concat(transform.rotate, " 0 0)");
var inner = {
transform: "".concat(innerTranslate, " ").concat(innerScale, " ").concat(innerRotate)
};
var path = {
transform: "translate(".concat(iconWidth / 2 * -1, " -256)")
};
return {
outer: outer,
inner: inner,
path: path
};
}
function transformForCss(_ref2) {
var transform = _ref2.transform,
_ref2$width = _ref2.width,
width = _ref2$width === void 0 ? UNITS_IN_GRID : _ref2$width,
_ref2$height = _ref2.height,
height = _ref2$height === void 0 ? UNITS_IN_GRID : _ref2$height,
_ref2$startCentered = _ref2.startCentered,
startCentered = _ref2$startCentered === void 0 ? false : _ref2$startCentered;
var val = '';
if (startCentered && IS_IE) {
val += "translate(".concat(transform.x / d - width / 2, "em, ").concat(transform.y / d - height / 2, "em) ");
} else if (startCentered) {
val += "translate(calc(-50% + ".concat(transform.x / d, "em), calc(-50% + ").concat(transform.y / d, "em)) ");
} else {
val += "translate(".concat(transform.x / d, "em, ").concat(transform.y / d, "em) ");
}
val += "scale(".concat(transform.size / d * (transform.flipX ? -1 : 1), ", ").concat(transform.size / d * (transform.flipY ? -1 : 1), ") ");
val += "rotate(".concat(transform.rotate, "deg) ");
return val;
}
var ALL_SPACE = {
x: 0,
y: 0,
width: '100%',
height: '100%'
};
function fillBlack(abstract) {
var force = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
if (abstract.attributes && (abstract.attributes.fill || force)) {
abstract.attributes.fill = 'black';
}
return abstract;
}
function deGroup(abstract) {
if (abstract.tag === 'g') {
return abstract.children;
} else {
return [abstract];
}
}
function makeIconMasking (_ref) {
var children = _ref.children,
attributes = _ref.attributes,
main = _ref.main,
mask = _ref.mask,
explicitMaskId = _ref.maskId,
transform = _ref.transform;
var mainWidth = main.width,
mainPath = main.icon;
var maskWidth = mask.width,
maskPath = mask.icon;
var trans = transformForSvg({
transform: transform,
containerWidth: maskWidth,
iconWidth: mainWidth
});
var maskRect = {
tag: 'rect',
attributes: _objectSpread({}, ALL_SPACE, {
fill: 'white'
})
};
var maskInnerGroupChildrenMixin = mainPath.children ? {
children: mainPath.children.map(fillBlack)
} : {};
var maskInnerGroup = {
tag: 'g',
attributes: _objectSpread({}, trans.inner),
children: [fillBlack(_objectSpread({
tag: mainPath.tag,
attributes: _objectSpread({}, mainPath.attributes, trans.path)
}, maskInnerGroupChildrenMixin))]
};
var maskOuterGroup = {
tag: 'g',
attributes: _objectSpread({}, trans.outer),
children: [maskInnerGroup]
};
var maskId = "mask-".concat(explicitMaskId || nextUniqueId());
var clipId = "clip-".concat(explicitMaskId || nextUniqueId());
var maskTag = {
tag: 'mask',
attributes: _objectSpread({}, ALL_SPACE, {
id: maskId,
maskUnits: 'userSpaceOnUse',
maskContentUnits: 'userSpaceOnUse'
}),
children: [maskRect, maskOuterGroup]
};
var defs = {
tag: 'defs',
children: [{
tag: 'clipPath',
attributes: {
id: clipId
},
children: deGroup(maskPath)
}, maskTag]
};
children.push(defs, {
tag: 'rect',
attributes: _objectSpread({
fill: 'currentColor',
'clip-path': "url(#".concat(clipId, ")"),
mask: "url(#".concat(maskId, ")")
}, ALL_SPACE)
});
return {
children: children,
attributes: attributes
};
}
function makeIconStandard (_ref) {
var children = _ref.children,
attributes = _ref.attributes,
main = _ref.main,
transform = _ref.transform,
styles = _ref.styles;
var styleString = joinStyles(styles);
if (styleString.length > 0) {
attributes['style'] = styleString;
}
if (transformIsMeaningful(transform)) {
var trans = transformForSvg({
transform: transform,
containerWidth: main.width,
iconWidth: main.width
});
children.push({
tag: 'g',
attributes: _objectSpread({}, trans.outer),
children: [{
tag: 'g',
attributes: _objectSpread({}, trans.inner),
children: [{
tag: main.icon.tag,
children: main.icon.children,
attributes: _objectSpread({}, main.icon.attributes, trans.path)
}]
}]
});
} else {
children.push(main.icon);
}
return {
children: children,
attributes: attributes
};
}
function asIcon (_ref) {
var children = _ref.children,
main = _ref.main,
mask = _ref.mask,
attributes = _ref.attributes,
styles = _ref.styles,
transform = _ref.transform;
if (transformIsMeaningful(transform) && main.found && !mask.found) {
var width = main.width,
height = main.height;
var offset = {
x: width / height / 2,
y: 0.5
};
attributes['style'] = joinStyles(_objectSpread({}, styles, {
'transform-origin': "".concat(offset.x + transform.x / 16, "em ").concat(offset.y + transform.y / 16, "em")
}));
}
return [{
tag: 'svg',
attributes: attributes,
children: children
}];
}
function asSymbol (_ref) {
var prefix = _ref.prefix,
iconName = _ref.iconName,
children = _ref.children,
attributes = _ref.attributes,
symbol = _ref.symbol;
var id = symbol === true ? "".concat(prefix, "-").concat(config.familyPrefix, "-").concat(iconName) : symbol;
return [{
tag: 'svg',
attributes: {
style: 'display: none;'
},
children: [{
tag: 'symbol',
attributes: _objectSpread({}, attributes, {
id: id
}),
children: children
}]
}];
}
function makeInlineSvgAbstract(params) {
var _params$icons = params.icons,
main = _params$icons.main,
mask = _params$icons.mask,
prefix = params.prefix,
iconName = params.iconName,
transform = params.transform,
symbol = params.symbol,
title = params.title,
maskId = params.maskId,
titleId = params.titleId,
extra = params.extra,
_params$watchable = params.watchable,
watchable = _params$watchable === void 0 ? false : _params$watchable;
var _ref = mask.found ? mask : main,
width = _ref.width,
height = _ref.height;
var widthClass = "fa-w-".concat(Math.ceil(width / height * 16));
var attrClass = [config.replacementClass, iconName ? "".concat(config.familyPrefix, "-").concat(iconName) : '', widthClass].filter(function (c) {
return extra.classes.indexOf(c) === -1;
}).concat(extra.classes).join(' ');
var content = {
children: [],
attributes: _objectSpread({}, extra.attributes, {
'data-prefix': prefix,
'data-icon': iconName,
'class': attrClass,
'role': extra.attributes.role || 'img',
'xmlns': 'http://www.w3.org/2000/svg',
'viewBox': "0 0 ".concat(width, " ").concat(height)
})
};
if (watchable) {
content.attributes[DATA_FA_I2SVG] = '';
}
if (title) content.children.push({
tag: 'title',
attributes: {
id: content.attributes['aria-labelledby'] || "title-".concat(titleId || nextUniqueId())
},
children: [title]
});
var args = _objectSpread({}, content, {
prefix: prefix,
iconName: iconName,
main: main,
mask: mask,
maskId: maskId,
transform: transform,
symbol: symbol,
styles: extra.styles
});
var _ref2 = mask.found && main.found ? makeIconMasking(args) : makeIconStandard(args),
children = _ref2.children,
attributes = _ref2.attributes;
args.children = children;
args.attributes = attributes;
if (symbol) {
return asSymbol(args);
} else {
return asIcon(args);
}
}
function makeLayersTextAbstract(params) {
var content = params.content,
width = params.width,
height = params.height,
transform = params.transform,
title = params.title,
extra = params.extra,
_params$watchable2 = params.watchable,
watchable = _params$watchable2 === void 0 ? false : _params$watchable2;
var attributes = _objectSpread({}, extra.attributes, title ? {
'title': title
} : {}, {
'class': extra.classes.join(' ')
});
if (watchable) {
attributes[DATA_FA_I2SVG] = '';
}
var styles = _objectSpread({}, extra.styles);
if (transformIsMeaningful(transform)) {
styles['transform'] = transformForCss({
transform: transform,
startCentered: true,
width: width,
height: height
});
styles['-webkit-transform'] = styles['transform'];
}
var styleString = joinStyles(styles);
if (styleString.length > 0) {
attributes['style'] = styleString;
}
var val = [];
val.push({
tag: 'span',
attributes: attributes,
children: [content]
});
if (title) {
val.push({
tag: 'span',
attributes: {
class: 'sr-only'
},
children: [title]
});
}
return val;
}
function makeLayersCounterAbstract(params) {
var content = params.content,
title = params.title,
extra = params.extra;
var attributes = _objectSpread({}, extra.attributes, title ? {
'title': title
} : {}, {
'class': extra.classes.join(' ')
});
var styleString = joinStyles(extra.styles);
if (styleString.length > 0) {
attributes['style'] = styleString;
}
var val = [];
val.push({
tag: 'span',
attributes: attributes,
children: [content]
});
if (title) {
val.push({
tag: 'span',
attributes: {
class: 'sr-only'
},
children: [title]
});
}
return val;
}
var noop$1 = function noop() {};
var p = config.measurePerformance && PERFORMANCE && PERFORMANCE.mark && PERFORMANCE.measure ? PERFORMANCE : {
mark: noop$1,
measure: noop$1
};
var preamble = "FA \"5.14.0\"";
var begin = function begin(name) {
p.mark("".concat(preamble, " ").concat(name, " begins"));
return function () {
return end(name);
};
};
var end = function end(name) {
p.mark("".concat(preamble, " ").concat(name, " ends"));
p.measure("".concat(preamble, " ").concat(name), "".concat(preamble, " ").concat(name, " begins"), "".concat(preamble, " ").concat(name, " ends"));
};
var perf = {
begin: begin,
end: end
};
/**
* Internal helper to bind a function known to have 4 arguments
* to a given context.
*/
var bindInternal4 = function bindInternal4(func, thisContext) {
return function (a, b, c, d) {
return func.call(thisContext, a, b, c, d);
};
};
/**
* # Reduce
*
* A fast object `.reduce()` implementation.
*
* @param {Object} subject The object to reduce over.
* @param {Function} fn The reducer function.
* @param {mixed} initialValue The initial value for the reducer, defaults to subject[0].
* @param {Object} thisContext The context for the reducer.
* @return {mixed} The final result.
*/
var reduce = function fastReduceObject(subject, fn, initialValue, thisContext) {
var keys = Object.keys(subject),
length = keys.length,
iterator = thisContext !== undefined ? bindInternal4(fn, thisContext) : fn,
i,
key,
result;
if (initialValue === undefined) {
i = 1;
result = subject[keys[0]];
} else {
i = 0;
result = initialValue;
}
for (; i < length; i++) {
key = keys[i];
result = iterator(result, subject[key], key, subject);
}
return result;
};
function toHex(unicode) {
var result = '';
for (var i = 0; i < unicode.length; i++) {
var hex = unicode.charCodeAt(i).toString(16);
result += ('000' + hex).slice(-4);
}
return result;
}
function defineIcons(prefix, icons) {
var params = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
var _params$skipHooks = params.skipHooks,
skipHooks = _params$skipHooks === void 0 ? false : _params$skipHooks;
var normalized = Object.keys(icons).reduce(function (acc, iconName) {
var icon = icons[iconName];
var expanded = !!icon.icon;
if (expanded) {
acc[icon.iconName] = icon.icon;
} else {
acc[iconName] = icon;
}
return acc;
}, {});
if (typeof namespace.hooks.addPack === 'function' && !skipHooks) {
namespace.hooks.addPack(prefix, normalized);
} else {
namespace.styles[prefix] = _objectSpread({}, namespace.styles[prefix] || {}, normalized);
}
/**
* Font Awesome 4 used the prefix of `fa` for all icons. With the introduction
* of new styles we needed to differentiate between them. Prefix `fa` is now an alias
* for `fas` so we'll easy the upgrade process for our users by automatically defining
* this as well.
*/
if (prefix === 'fas') {
defineIcons('fa', icons);
}
}
var styles = namespace.styles,
shims = namespace.shims;
var _byUnicode = {};
var _byLigature = {};
var _byOldName = {};
var build = function build() {
var lookup = function lookup(reducer) {
return reduce(styles, function (o, style, prefix) {
o[prefix] = reduce(style, reducer, {});
return o;
}, {});
};
_byUnicode = lookup(function (acc, icon, iconName) {
if (icon[3]) {
acc[icon[3]] = iconName;
}
return acc;
});
_byLigature = lookup(function (acc, icon, iconName) {
var ligatures = icon[2];
acc[iconName] = iconName;
ligatures.forEach(function (ligature) {
acc[ligature] = iconName;
});
return acc;
});
var hasRegular = 'far' in styles;
_byOldName = reduce(shims, function (acc, shim) {
var oldName = shim[0];
var prefix = shim[1];
var iconName = shim[2];
if (prefix === 'far' && !hasRegular) {
prefix = 'fas';
}
acc[oldName] = {
prefix: prefix,
iconName: iconName
};
return acc;
}, {});
};
build();
function byUnicode(prefix, unicode) {
return (_byUnicode[prefix] || {})[unicode];
}
function byLigature(prefix, ligature) {
return (_byLigature[prefix] || {})[ligature];
}
function byOldName(name) {
return _byOldName[name] || {
prefix: null,
iconName: null
};
}
var styles$1 = namespace.styles;
var emptyCanonicalIcon = function emptyCanonicalIcon() {
return {
prefix: null,
iconName: null,
rest: []
};
};
function getCanonicalIcon(values) {
return values.reduce(function (acc, cls) {
var iconName = getIconName(config.familyPrefix, cls);
if (styles$1[cls]) {
acc.prefix = cls;
} else if (config.autoFetchSvg && ['fas', 'far', 'fal', 'fad', 'fab', 'fa'].indexOf(cls) > -1) {
acc.prefix = cls;
} else if (iconName) {
var shim = acc.prefix === 'fa' ? byOldName(iconName) : {};
acc.iconName = shim.iconName || iconName;
acc.prefix = shim.prefix || acc.prefix;
} else if (cls !== config.replacementClass && cls.indexOf('fa-w-') !== 0) {
acc.rest.push(cls);
}
return acc;
}, emptyCanonicalIcon());
}
function iconFromMapping(mapping, prefix, iconName) {
if (mapping && mapping[prefix] && mapping[prefix][iconName]) {
return {
prefix: prefix,
iconName: iconName,
icon: mapping[prefix][iconName]
};
}
}
function toHtml(abstractNodes) {
var tag = abstractNodes.tag,
_abstractNodes$attrib = abstractNodes.attributes,
attributes = _abstractNodes$attrib === void 0 ? {} : _abstractNodes$attrib,
_abstractNodes$childr = abstractNodes.children,
children = _abstractNodes$childr === void 0 ? [] : _abstractNodes$childr;
if (typeof abstractNodes === 'string') {
return htmlEscape(abstractNodes);
} else {
return "<".concat(tag, " ").concat(joinAttributes(attributes), ">").concat(children.map(toHtml).join(''), "").concat(tag, ">");
}
}
var noop$2 = function noop() {};
function isWatched(node) {
var i2svg = node.getAttribute ? node.getAttribute(DATA_FA_I2SVG) : null;
return typeof i2svg === 'string';
}
function getMutator() {
if (config.autoReplaceSvg === true) {
return mutators.replace;
}
var mutator = mutators[config.autoReplaceSvg];
return mutator || mutators.replace;
}
var mutators = {
replace: function replace(mutation) {
var node = mutation[0];
var abstract = mutation[1];
var newOuterHTML = abstract.map(function (a) {
return toHtml(a);
}).join('\n');
if (node.parentNode && node.outerHTML) {
node.outerHTML = newOuterHTML + (config.keepOriginalSource && node.tagName.toLowerCase() !== 'svg' ? "") : '');
} else if (node.parentNode) {
var newNode = document.createElement('span');
node.parentNode.replaceChild(newNode, node);
newNode.outerHTML = newOuterHTML;
}
},
nest: function nest(mutation) {
var node = mutation[0];
var abstract = mutation[1]; // If we already have a replaced node we do not want to continue nesting within it.
// Short-circuit to the standard replacement
if (~classArray(node).indexOf(config.replacementClass)) {
return mutators.replace(mutation);
}
var forSvg = new RegExp("".concat(config.familyPrefix, "-.*"));
delete abstract[0].attributes.style;
delete abstract[0].attributes.id;
var splitClasses = abstract[0].attributes.class.split(' ').reduce(function (acc, cls) {
if (cls === config.replacementClass || cls.match(forSvg)) {
acc.toSvg.push(cls);
} else {
acc.toNode.push(cls);
}
return acc;
}, {
toNode: [],
toSvg: []
});
abstract[0].attributes.class = splitClasses.toSvg.join(' ');
var newInnerHTML = abstract.map(function (a) {
return toHtml(a);
}).join('\n');
node.setAttribute('class', splitClasses.toNode.join(' '));
node.setAttribute(DATA_FA_I2SVG, '');
node.innerHTML = newInnerHTML;
}
};
function performOperationSync(op) {
op();
}
function perform(mutations, callback) {
var callbackFunction = typeof callback === 'function' ? callback : noop$2;
if (mutations.length === 0) {
callbackFunction();
} else {
var frame = performOperationSync;
if (config.mutateApproach === MUTATION_APPROACH_ASYNC) {
frame = WINDOW.requestAnimationFrame || performOperationSync;
}
frame(function () {
var mutator = getMutator();
var mark = perf.begin('mutate');
mutations.map(mutator);
mark();
callbackFunction();
});
}
}
var disabled = false;
function disableObservation() {
disabled = true;
}
function enableObservation() {
disabled = false;
}
var mo = null;
function observe(options) {
if (!MUTATION_OBSERVER) {
return;
}
if (!config.observeMutations) {
return;
}
var treeCallback = options.treeCallback,
nodeCallback = options.nodeCallback,
pseudoElementsCallback = options.pseudoElementsCallback,
_options$observeMutat = options.observeMutationsRoot,
observeMutationsRoot = _options$observeMutat === void 0 ? DOCUMENT : _options$observeMutat;
mo = new MUTATION_OBSERVER(function (objects) {
if (disabled) return;
toArray(objects).forEach(function (mutationRecord) {
if (mutationRecord.type === 'childList' && mutationRecord.addedNodes.length > 0 && !isWatched(mutationRecord.addedNodes[0])) {
if (config.searchPseudoElements) {
pseudoElementsCallback(mutationRecord.target);
}
treeCallback(mutationRecord.target);
}
if (mutationRecord.type === 'attributes' && mutationRecord.target.parentNode && config.searchPseudoElements) {
pseudoElementsCallback(mutationRecord.target.parentNode);
}
if (mutationRecord.type === 'attributes' && isWatched(mutationRecord.target) && ~ATTRIBUTES_WATCHED_FOR_MUTATION.indexOf(mutationRecord.attributeName)) {
if (mutationRecord.attributeName === 'class') {
var _getCanonicalIcon = getCanonicalIcon(classArray(mutationRecord.target)),
prefix = _getCanonicalIcon.prefix,
iconName = _getCanonicalIcon.iconName;
if (prefix) mutationRecord.target.setAttribute('data-prefix', prefix);
if (iconName) mutationRecord.target.setAttribute('data-icon', iconName);
} else {
nodeCallback(mutationRecord.target);
}
}
});
});
if (!IS_DOM) return;
mo.observe(observeMutationsRoot, {
childList: true,
attributes: true,
characterData: true,
subtree: true
});
}
function disconnect() {
if (!mo) return;
mo.disconnect();
}
function styleParser (node) {
var style = node.getAttribute('style');
var val = [];
if (style) {
val = style.split(';').reduce(function (acc, style) {
var styles = style.split(':');
var prop = styles[0];
var value = styles.slice(1);
if (prop && value.length > 0) {
acc[prop] = value.join(':').trim();
}
return acc;
}, {});
}
return val;
}
function classParser (node) {
var existingPrefix = node.getAttribute('data-prefix');
var existingIconName = node.getAttribute('data-icon');
var innerText = node.innerText !== undefined ? node.innerText.trim() : '';
var val = getCanonicalIcon(classArray(node));
if (existingPrefix && existingIconName) {
val.prefix = existingPrefix;
val.iconName = existingIconName;
}
if (val.prefix && innerText.length > 1) {
val.iconName = byLigature(val.prefix, node.innerText);
} else if (val.prefix && innerText.length === 1) {
val.iconName = byUnicode(val.prefix, toHex(node.innerText));
}
return val;
}
var parseTransformString = function parseTransformString(transformString) {
var transform = {
size: 16,
x: 0,
y: 0,
flipX: false,
flipY: false,
rotate: 0
};
if (!transformString) {
return transform;
} else {
return transformString.toLowerCase().split(' ').reduce(function (acc, n) {
var parts = n.toLowerCase().split('-');
var first = parts[0];
var rest = parts.slice(1).join('-');
if (first && rest === 'h') {
acc.flipX = true;
return acc;
}
if (first && rest === 'v') {
acc.flipY = true;
return acc;
}
rest = parseFloat(rest);
if (isNaN(rest)) {
return acc;
}
switch (first) {
case 'grow':
acc.size = acc.size + rest;
break;
case 'shrink':
acc.size = acc.size - rest;
break;
case 'left':
acc.x = acc.x - rest;
break;
case 'right':
acc.x = acc.x + rest;
break;
case 'up':
acc.y = acc.y - rest;
break;
case 'down':
acc.y = acc.y + rest;
break;
case 'rotate':
acc.rotate = acc.rotate + rest;
break;
}
return acc;
}, transform);
}
};
function transformParser (node) {
return parseTransformString(node.getAttribute('data-fa-transform'));
}
function symbolParser (node) {
var symbol = node.getAttribute('data-fa-symbol');
return symbol === null ? false : symbol === '' ? true : symbol;
}
function attributesParser (node) {
var extraAttributes = toArray(node.attributes).reduce(function (acc, attr) {
if (acc.name !== 'class' && acc.name !== 'style') {
acc[attr.name] = attr.value;
}
return acc;
}, {});
var title = node.getAttribute('title');
var titleId = node.getAttribute('data-fa-title-id');
if (config.autoA11y) {
if (title) {
extraAttributes['aria-labelledby'] = "".concat(config.replacementClass, "-title-").concat(titleId || nextUniqueId());
} else {
extraAttributes['aria-hidden'] = 'true';
extraAttributes['focusable'] = 'false';
}
}
return extraAttributes;
}
function maskParser (node) {
var mask = node.getAttribute('data-fa-mask');
if (!mask) {
return emptyCanonicalIcon();
} else {
return getCanonicalIcon(mask.split(' ').map(function (i) {
return i.trim();
}));
}
}
function blankMeta() {
return {
iconName: null,
title: null,
titleId: null,
prefix: null,
transform: meaninglessTransform,
symbol: false,
mask: null,
maskId: null,
extra: {
classes: [],
styles: {},
attributes: {}
}
};
}
function parseMeta(node) {
var _classParser = classParser(node),
iconName = _classParser.iconName,
prefix = _classParser.prefix,
extraClasses = _classParser.rest;
var extraStyles = styleParser(node);
var transform = transformParser(node);
var symbol = symbolParser(node);
var extraAttributes = attributesParser(node);
var mask = maskParser(node);
return {
iconName: iconName,
title: node.getAttribute('title'),
titleId: node.getAttribute('data-fa-title-id'),
prefix: prefix,
transform: transform,
symbol: symbol,
mask: mask,
maskId: node.getAttribute('data-fa-mask-id'),
extra: {
classes: extraClasses,
styles: extraStyles,
attributes: extraAttributes
}
};
}
function MissingIcon(error) {
this.name = 'MissingIcon';
this.message = error || 'Icon unavailable';
this.stack = new Error().stack;
}
MissingIcon.prototype = Object.create(Error.prototype);
MissingIcon.prototype.constructor = MissingIcon;
var FILL = {
fill: 'currentColor'
};
var ANIMATION_BASE = {
attributeType: 'XML',
repeatCount: 'indefinite',
dur: '2s'
};
var RING = {
tag: 'path',
attributes: _objectSpread({}, FILL, {
d: 'M156.5,447.7l-12.6,29.5c-18.7-9.5-35.9-21.2-51.5-34.9l22.7-22.7C127.6,430.5,141.5,440,156.5,447.7z M40.6,272H8.5 c1.4,21.2,5.4,41.7,11.7,61.1L50,321.2C45.1,305.5,41.8,289,40.6,272z M40.6,240c1.4-18.8,5.2-37,11.1-54.1l-29.5-12.6 C14.7,194.3,10,216.7,8.5,240H40.6z M64.3,156.5c7.8-14.9,17.2-28.8,28.1-41.5L69.7,92.3c-13.7,15.6-25.5,32.8-34.9,51.5 L64.3,156.5z M397,419.6c-13.9,12-29.4,22.3-46.1,30.4l11.9,29.8c20.7-9.9,39.8-22.6,56.9-37.6L397,419.6z M115,92.4 c13.9-12,29.4-22.3,46.1-30.4l-11.9-29.8c-20.7,9.9-39.8,22.6-56.8,37.6L115,92.4z M447.7,355.5c-7.8,14.9-17.2,28.8-28.1,41.5 l22.7,22.7c13.7-15.6,25.5-32.9,34.9-51.5L447.7,355.5z M471.4,272c-1.4,18.8-5.2,37-11.1,54.1l29.5,12.6 c7.5-21.1,12.2-43.5,13.6-66.8H471.4z M321.2,462c-15.7,5-32.2,8.2-49.2,9.4v32.1c21.2-1.4,41.7-5.4,61.1-11.7L321.2,462z M240,471.4c-18.8-1.4-37-5.2-54.1-11.1l-12.6,29.5c21.1,7.5,43.5,12.2,66.8,13.6V471.4z M462,190.8c5,15.7,8.2,32.2,9.4,49.2h32.1 c-1.4-21.2-5.4-41.7-11.7-61.1L462,190.8z M92.4,397c-12-13.9-22.3-29.4-30.4-46.1l-29.8,11.9c9.9,20.7,22.6,39.8,37.6,56.9 L92.4,397z M272,40.6c18.8,1.4,36.9,5.2,54.1,11.1l12.6-29.5C317.7,14.7,295.3,10,272,8.5V40.6z M190.8,50 c15.7-5,32.2-8.2,49.2-9.4V8.5c-21.2,1.4-41.7,5.4-61.1,11.7L190.8,50z M442.3,92.3L419.6,115c12,13.9,22.3,29.4,30.5,46.1 l29.8-11.9C470,128.5,457.3,109.4,442.3,92.3z M397,92.4l22.7-22.7c-15.6-13.7-32.8-25.5-51.5-34.9l-12.6,29.5 C370.4,72.1,384.4,81.5,397,92.4z'
})
};
var OPACITY_ANIMATE = _objectSpread({}, ANIMATION_BASE, {
attributeName: 'opacity'
});
var DOT = {
tag: 'circle',
attributes: _objectSpread({}, FILL, {
cx: '256',
cy: '364',
r: '28'
}),
children: [{
tag: 'animate',
attributes: _objectSpread({}, ANIMATION_BASE, {
attributeName: 'r',
values: '28;14;28;28;14;28;'
})
}, {
tag: 'animate',
attributes: _objectSpread({}, OPACITY_ANIMATE, {
values: '1;0;1;1;0;1;'
})
}]
};
var QUESTION = {
tag: 'path',
attributes: _objectSpread({}, FILL, {
opacity: '1',
d: 'M263.7,312h-16c-6.6,0-12-5.4-12-12c0-71,77.4-63.9,77.4-107.8c0-20-17.8-40.2-57.4-40.2c-29.1,0-44.3,9.6-59.2,28.7 c-3.9,5-11.1,6-16.2,2.4l-13.1-9.2c-5.6-3.9-6.9-11.8-2.6-17.2c21.2-27.2,46.4-44.7,91.2-44.7c52.3,0,97.4,29.8,97.4,80.2 c0,67.6-77.4,63.5-77.4,107.8C275.7,306.6,270.3,312,263.7,312z'
}),
children: [{
tag: 'animate',
attributes: _objectSpread({}, OPACITY_ANIMATE, {
values: '1;0;0;0;0;1;'
})
}]
};
var EXCLAMATION = {
tag: 'path',
attributes: _objectSpread({}, FILL, {
opacity: '0',
d: 'M232.5,134.5l7,168c0.3,6.4,5.6,11.5,12,11.5h9c6.4,0,11.7-5.1,12-11.5l7-168c0.3-6.8-5.2-12.5-12-12.5h-23 C237.7,122,232.2,127.7,232.5,134.5z'
}),
children: [{
tag: 'animate',
attributes: _objectSpread({}, OPACITY_ANIMATE, {
values: '0;0;1;1;0;0;'
})
}]
};
var missing = {
tag: 'g',
children: [RING, DOT, QUESTION, EXCLAMATION]
};
var styles$2 = namespace.styles;
function asFoundIcon(icon) {
var width = icon[0];
var height = icon[1];
var _icon$slice = icon.slice(4),
_icon$slice2 = _slicedToArray(_icon$slice, 1),
vectorData = _icon$slice2[0];
var element = null;
if (Array.isArray(vectorData)) {
element = {
tag: 'g',
attributes: {
class: "".concat(config.familyPrefix, "-").concat(DUOTONE_CLASSES.GROUP)
},
children: [{
tag: 'path',
attributes: {
class: "".concat(config.familyPrefix, "-").concat(DUOTONE_CLASSES.SECONDARY),
fill: 'currentColor',
d: vectorData[0]
}
}, {
tag: 'path',
attributes: {
class: "".concat(config.familyPrefix, "-").concat(DUOTONE_CLASSES.PRIMARY),
fill: 'currentColor',
d: vectorData[1]
}
}]
};
} else {
element = {
tag: 'path',
attributes: {
fill: 'currentColor',
d: vectorData
}
};
}
return {
found: true,
width: width,
height: height,
icon: element
};
}
function findIcon(iconName, prefix) {
return new picked(function (resolve, reject) {
var val = {
found: false,
width: 512,
height: 512,
icon: missing
};
if (iconName && prefix && styles$2[prefix] && styles$2[prefix][iconName]) {
var icon = styles$2[prefix][iconName];
return resolve(asFoundIcon(icon));
}
var headers = {};
if (_typeof(WINDOW.FontAwesomeKitConfig) === 'object' && typeof window.FontAwesomeKitConfig.token === 'string') {
headers['fa-kit-token'] = WINDOW.FontAwesomeKitConfig.token;
}
if (iconName && prefix && !config.showMissingIcons) {
reject(new MissingIcon("Icon is missing for prefix ".concat(prefix, " with icon name ").concat(iconName)));
} else {
resolve(val);
}
});
}
var styles$3 = namespace.styles;
function generateSvgReplacementMutation(node, nodeMeta) {
var iconName = nodeMeta.iconName,
title = nodeMeta.title,
titleId = nodeMeta.titleId,
prefix = nodeMeta.prefix,
transform = nodeMeta.transform,
symbol = nodeMeta.symbol,
mask = nodeMeta.mask,
maskId = nodeMeta.maskId,
extra = nodeMeta.extra;
return new picked(function (resolve, reject) {
picked.all([findIcon(iconName, prefix), findIcon(mask.iconName, mask.prefix)]).then(function (_ref) {
var _ref2 = _slicedToArray(_ref, 2),
main = _ref2[0],
mask = _ref2[1];
resolve([node, makeInlineSvgAbstract({
icons: {
main: main,
mask: mask
},
prefix: prefix,
iconName: iconName,
transform: transform,
symbol: symbol,
mask: mask,
maskId: maskId,
title: title,
titleId: titleId,
extra: extra,
watchable: true
})]);
});
});
}
function generateLayersText(node, nodeMeta) {
var title = nodeMeta.title,
transform = nodeMeta.transform,
extra = nodeMeta.extra;
var width = null;
var height = null;
if (IS_IE) {
var computedFontSize = parseInt(getComputedStyle(node).fontSize, 10);
var boundingClientRect = node.getBoundingClientRect();
width = boundingClientRect.width / computedFontSize;
height = boundingClientRect.height / computedFontSize;
}
if (config.autoA11y && !title) {
extra.attributes['aria-hidden'] = 'true';
}
return picked.resolve([node, makeLayersTextAbstract({
content: node.innerHTML,
width: width,
height: height,
transform: transform,
title: title,
extra: extra,
watchable: true
})]);
}
function generateMutation(node) {
var nodeMeta = parseMeta(node);
if (~nodeMeta.extra.classes.indexOf(LAYERS_TEXT_CLASSNAME)) {
return generateLayersText(node, nodeMeta);
} else {
return generateSvgReplacementMutation(node, nodeMeta);
}
}
function onTree(root) {
var callback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
if (!IS_DOM) return;
var htmlClassList = DOCUMENT.documentElement.classList;
var hclAdd = function hclAdd(suffix) {
return htmlClassList.add("".concat(HTML_CLASS_I2SVG_BASE_CLASS, "-").concat(suffix));
};
var hclRemove = function hclRemove(suffix) {
return htmlClassList.remove("".concat(HTML_CLASS_I2SVG_BASE_CLASS, "-").concat(suffix));
};
var prefixes = config.autoFetchSvg ? Object.keys(PREFIX_TO_STYLE) : Object.keys(styles$3);
var prefixesDomQuery = [".".concat(LAYERS_TEXT_CLASSNAME, ":not([").concat(DATA_FA_I2SVG, "])")].concat(prefixes.map(function (p) {
return ".".concat(p, ":not([").concat(DATA_FA_I2SVG, "])");
})).join(', ');
if (prefixesDomQuery.length === 0) {
return;
}
var candidates = [];
try {
candidates = toArray(root.querySelectorAll(prefixesDomQuery));
} catch (e) {// noop
}
if (candidates.length > 0) {
hclAdd('pending');
hclRemove('complete');
} else {
return;
}
var mark = perf.begin('onTree');
var mutations = candidates.reduce(function (acc, node) {
try {
var mutation = generateMutation(node);
if (mutation) {
acc.push(mutation);
}
} catch (e) {
if (!PRODUCTION) {
if (e instanceof MissingIcon) {
console.error(e);
}
}
}
return acc;
}, []);
return new picked(function (resolve, reject) {
picked.all(mutations).then(function (resolvedMutations) {
perform(resolvedMutations, function () {
hclAdd('active');
hclAdd('complete');
hclRemove('pending');
if (typeof callback === 'function') callback();
mark();
resolve();
});
}).catch(function () {
mark();
reject();
});
});
}
function onNode(node) {
var callback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
generateMutation(node).then(function (mutation) {
if (mutation) {
perform([mutation], callback);
}
});
}
function replaceForPosition(node, position) {
var pendingAttribute = "".concat(DATA_FA_PSEUDO_ELEMENT_PENDING).concat(position.replace(':', '-'));
return new picked(function (resolve, reject) {
if (node.getAttribute(pendingAttribute) !== null) {
// This node is already being processed
return resolve();
}
var children = toArray(node.children);
var alreadyProcessedPseudoElement = children.filter(function (c) {
return c.getAttribute(DATA_FA_PSEUDO_ELEMENT) === position;
})[0];
var styles = WINDOW.getComputedStyle(node, position);
var fontFamily = styles.getPropertyValue('font-family').match(FONT_FAMILY_PATTERN);
var fontWeight = styles.getPropertyValue('font-weight');
var content = styles.getPropertyValue('content');
if (alreadyProcessedPseudoElement && !fontFamily) {
// If we've already processed it but the current computed style does not result in a font-family,
// that probably means that a class name that was previously present to make the icon has been
// removed. So we now should delete the icon.
node.removeChild(alreadyProcessedPseudoElement);
return resolve();
} else if (fontFamily && content !== 'none' && content !== '') {
var prefix = ~['Solid', 'Regular', 'Light', 'Duotone', 'Brands'].indexOf(fontFamily[1]) ? STYLE_TO_PREFIX[fontFamily[1].toLowerCase()] : FONT_WEIGHT_TO_PREFIX[fontWeight];
var hexValue = toHex(content.length === 3 ? content.substr(1, 1) : content);
var iconName = byUnicode(prefix, hexValue);
var iconIdentifier = iconName; // Only convert the pseudo element in this :before/:after position into an icon if we haven't
// already done so with the same prefix and iconName
if (iconName && (!alreadyProcessedPseudoElement || alreadyProcessedPseudoElement.getAttribute(DATA_PREFIX) !== prefix || alreadyProcessedPseudoElement.getAttribute(DATA_ICON) !== iconIdentifier)) {
node.setAttribute(pendingAttribute, iconIdentifier);
if (alreadyProcessedPseudoElement) {
// Delete the old one, since we're replacing it with a new one
node.removeChild(alreadyProcessedPseudoElement);
}
var meta = blankMeta();
var extra = meta.extra;
extra.attributes[DATA_FA_PSEUDO_ELEMENT] = position;
findIcon(iconName, prefix).then(function (main) {
var abstract = makeInlineSvgAbstract(_objectSpread({}, meta, {
icons: {
main: main,
mask: emptyCanonicalIcon()
},
prefix: prefix,
iconName: iconIdentifier,
extra: extra,
watchable: true
}));
var element = DOCUMENT.createElement('svg');
if (position === ':before') {
node.insertBefore(element, node.firstChild);
} else {
node.appendChild(element);
}
element.outerHTML = abstract.map(function (a) {
return toHtml(a);
}).join('\n');
node.removeAttribute(pendingAttribute);
resolve();
}).catch(reject);
} else {
resolve();
}
} else {
resolve();
}
});
}
function replace(node) {
return picked.all([replaceForPosition(node, ':before'), replaceForPosition(node, ':after')]);
}
function processable(node) {
return node.parentNode !== document.head && !~TAGNAMES_TO_SKIP_FOR_PSEUDOELEMENTS.indexOf(node.tagName.toUpperCase()) && !node.getAttribute(DATA_FA_PSEUDO_ELEMENT) && (!node.parentNode || node.parentNode.tagName !== 'svg');
}
function searchPseudoElements (root) {
if (!IS_DOM) return;
return new picked(function (resolve, reject) {
var operations = toArray(root.querySelectorAll('*')).filter(processable).map(replace);
var end = perf.begin('searchPseudoElements');
disableObservation();
picked.all(operations).then(function () {
end();
enableObservation();
resolve();
}).catch(function () {
end();
enableObservation();
reject();
});
});
}
var baseStyles = "svg:not(:root).svg-inline--fa {\n overflow: visible;\n}\n\n.svg-inline--fa {\n display: inline-block;\n font-size: inherit;\n height: 1em;\n overflow: visible;\n vertical-align: -0.125em;\n}\n.svg-inline--fa.fa-lg {\n vertical-align: -0.225em;\n}\n.svg-inline--fa.fa-w-1 {\n width: 0.0625em;\n}\n.svg-inline--fa.fa-w-2 {\n width: 0.125em;\n}\n.svg-inline--fa.fa-w-3 {\n width: 0.1875em;\n}\n.svg-inline--fa.fa-w-4 {\n width: 0.25em;\n}\n.svg-inline--fa.fa-w-5 {\n width: 0.3125em;\n}\n.svg-inline--fa.fa-w-6 {\n width: 0.375em;\n}\n.svg-inline--fa.fa-w-7 {\n width: 0.4375em;\n}\n.svg-inline--fa.fa-w-8 {\n width: 0.5em;\n}\n.svg-inline--fa.fa-w-9 {\n width: 0.5625em;\n}\n.svg-inline--fa.fa-w-10 {\n width: 0.625em;\n}\n.svg-inline--fa.fa-w-11 {\n width: 0.6875em;\n}\n.svg-inline--fa.fa-w-12 {\n width: 0.75em;\n}\n.svg-inline--fa.fa-w-13 {\n width: 0.8125em;\n}\n.svg-inline--fa.fa-w-14 {\n width: 0.875em;\n}\n.svg-inline--fa.fa-w-15 {\n width: 0.9375em;\n}\n.svg-inline--fa.fa-w-16 {\n width: 1em;\n}\n.svg-inline--fa.fa-w-17 {\n width: 1.0625em;\n}\n.svg-inline--fa.fa-w-18 {\n width: 1.125em;\n}\n.svg-inline--fa.fa-w-19 {\n width: 1.1875em;\n}\n.svg-inline--fa.fa-w-20 {\n width: 1.25em;\n}\n.svg-inline--fa.fa-pull-left {\n margin-right: 0.3em;\n width: auto;\n}\n.svg-inline--fa.fa-pull-right {\n margin-left: 0.3em;\n width: auto;\n}\n.svg-inline--fa.fa-border {\n height: 1.5em;\n}\n.svg-inline--fa.fa-li {\n width: 2em;\n}\n.svg-inline--fa.fa-fw {\n width: 1.25em;\n}\n\n.fa-layers svg.svg-inline--fa {\n bottom: 0;\n left: 0;\n margin: auto;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.fa-layers {\n display: inline-block;\n height: 1em;\n position: relative;\n text-align: center;\n vertical-align: -0.125em;\n width: 1em;\n}\n.fa-layers svg.svg-inline--fa {\n -webkit-transform-origin: center center;\n transform-origin: center center;\n}\n\n.fa-layers-counter, .fa-layers-text {\n display: inline-block;\n position: absolute;\n text-align: center;\n}\n\n.fa-layers-text {\n left: 50%;\n top: 50%;\n -webkit-transform: translate(-50%, -50%);\n transform: translate(-50%, -50%);\n -webkit-transform-origin: center center;\n transform-origin: center center;\n}\n\n.fa-layers-counter {\n background-color: #ff253a;\n border-radius: 1em;\n -webkit-box-sizing: border-box;\n box-sizing: border-box;\n color: #fff;\n height: 1.5em;\n line-height: 1;\n max-width: 5em;\n min-width: 1.5em;\n overflow: hidden;\n padding: 0.25em;\n right: 0;\n text-overflow: ellipsis;\n top: 0;\n -webkit-transform: scale(0.25);\n transform: scale(0.25);\n -webkit-transform-origin: top right;\n transform-origin: top right;\n}\n\n.fa-layers-bottom-right {\n bottom: 0;\n right: 0;\n top: auto;\n -webkit-transform: scale(0.25);\n transform: scale(0.25);\n -webkit-transform-origin: bottom right;\n transform-origin: bottom right;\n}\n\n.fa-layers-bottom-left {\n bottom: 0;\n left: 0;\n right: auto;\n top: auto;\n -webkit-transform: scale(0.25);\n transform: scale(0.25);\n -webkit-transform-origin: bottom left;\n transform-origin: bottom left;\n}\n\n.fa-layers-top-right {\n right: 0;\n top: 0;\n -webkit-transform: scale(0.25);\n transform: scale(0.25);\n -webkit-transform-origin: top right;\n transform-origin: top right;\n}\n\n.fa-layers-top-left {\n left: 0;\n right: auto;\n top: 0;\n -webkit-transform: scale(0.25);\n transform: scale(0.25);\n -webkit-transform-origin: top left;\n transform-origin: top left;\n}\n\n.fa-lg {\n font-size: 1.3333333333em;\n line-height: 0.75em;\n vertical-align: -0.0667em;\n}\n\n.fa-xs {\n font-size: 0.75em;\n}\n\n.fa-sm {\n font-size: 0.875em;\n}\n\n.fa-1x {\n font-size: 1em;\n}\n\n.fa-2x {\n font-size: 2em;\n}\n\n.fa-3x {\n font-size: 3em;\n}\n\n.fa-4x {\n font-size: 4em;\n}\n\n.fa-5x {\n font-size: 5em;\n}\n\n.fa-6x {\n font-size: 6em;\n}\n\n.fa-7x {\n font-size: 7em;\n}\n\n.fa-8x {\n font-size: 8em;\n}\n\n.fa-9x {\n font-size: 9em;\n}\n\n.fa-10x {\n font-size: 10em;\n}\n\n.fa-fw {\n text-align: center;\n width: 1.25em;\n}\n\n.fa-ul {\n list-style-type: none;\n margin-left: 2.5em;\n padding-left: 0;\n}\n.fa-ul > li {\n position: relative;\n}\n\n.fa-li {\n left: -2em;\n position: absolute;\n text-align: center;\n width: 2em;\n line-height: inherit;\n}\n\n.fa-border {\n border: solid 0.08em #eee;\n border-radius: 0.1em;\n padding: 0.2em 0.25em 0.15em;\n}\n\n.fa-pull-left {\n float: left;\n}\n\n.fa-pull-right {\n float: right;\n}\n\n.fa.fa-pull-left,\n.fas.fa-pull-left,\n.far.fa-pull-left,\n.fal.fa-pull-left,\n.fab.fa-pull-left {\n margin-right: 0.3em;\n}\n.fa.fa-pull-right,\n.fas.fa-pull-right,\n.far.fa-pull-right,\n.fal.fa-pull-right,\n.fab.fa-pull-right {\n margin-left: 0.3em;\n}\n\n.fa-spin {\n -webkit-animation: fa-spin 2s infinite linear;\n animation: fa-spin 2s infinite linear;\n}\n\n.fa-pulse {\n -webkit-animation: fa-spin 1s infinite steps(8);\n animation: fa-spin 1s infinite steps(8);\n}\n\n@-webkit-keyframes fa-spin {\n 0% {\n -webkit-transform: rotate(0deg);\n transform: rotate(0deg);\n }\n 100% {\n -webkit-transform: rotate(360deg);\n transform: rotate(360deg);\n }\n}\n\n@keyframes fa-spin {\n 0% {\n -webkit-transform: rotate(0deg);\n transform: rotate(0deg);\n }\n 100% {\n -webkit-transform: rotate(360deg);\n transform: rotate(360deg);\n }\n}\n.fa-rotate-90 {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)\";\n -webkit-transform: rotate(90deg);\n transform: rotate(90deg);\n}\n\n.fa-rotate-180 {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)\";\n -webkit-transform: rotate(180deg);\n transform: rotate(180deg);\n}\n\n.fa-rotate-270 {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)\";\n -webkit-transform: rotate(270deg);\n transform: rotate(270deg);\n}\n\n.fa-flip-horizontal {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)\";\n -webkit-transform: scale(-1, 1);\n transform: scale(-1, 1);\n}\n\n.fa-flip-vertical {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\";\n -webkit-transform: scale(1, -1);\n transform: scale(1, -1);\n}\n\n.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {\n -ms-filter: \"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)\";\n -webkit-transform: scale(-1, -1);\n transform: scale(-1, -1);\n}\n\n:root .fa-rotate-90,\n:root .fa-rotate-180,\n:root .fa-rotate-270,\n:root .fa-flip-horizontal,\n:root .fa-flip-vertical,\n:root .fa-flip-both {\n -webkit-filter: none;\n filter: none;\n}\n\n.fa-stack {\n display: inline-block;\n height: 2em;\n position: relative;\n width: 2.5em;\n}\n\n.fa-stack-1x,\n.fa-stack-2x {\n bottom: 0;\n left: 0;\n margin: auto;\n position: absolute;\n right: 0;\n top: 0;\n}\n\n.svg-inline--fa.fa-stack-1x {\n height: 1em;\n width: 1.25em;\n}\n.svg-inline--fa.fa-stack-2x {\n height: 2em;\n width: 2.5em;\n}\n\n.fa-inverse {\n color: #fff;\n}\n\n.sr-only {\n border: 0;\n clip: rect(0, 0, 0, 0);\n height: 1px;\n margin: -1px;\n overflow: hidden;\n padding: 0;\n position: absolute;\n width: 1px;\n}\n\n.sr-only-focusable:active, .sr-only-focusable:focus {\n clip: auto;\n height: auto;\n margin: 0;\n overflow: visible;\n position: static;\n width: auto;\n}\n\n.svg-inline--fa .fa-primary {\n fill: var(--fa-primary-color, currentColor);\n opacity: 1;\n opacity: var(--fa-primary-opacity, 1);\n}\n\n.svg-inline--fa .fa-secondary {\n fill: var(--fa-secondary-color, currentColor);\n opacity: 0.4;\n opacity: var(--fa-secondary-opacity, 0.4);\n}\n\n.svg-inline--fa.fa-swap-opacity .fa-primary {\n opacity: 0.4;\n opacity: var(--fa-secondary-opacity, 0.4);\n}\n\n.svg-inline--fa.fa-swap-opacity .fa-secondary {\n opacity: 1;\n opacity: var(--fa-primary-opacity, 1);\n}\n\n.svg-inline--fa mask .fa-primary,\n.svg-inline--fa mask .fa-secondary {\n fill: black;\n}\n\n.fad.fa-inverse {\n color: #fff;\n}";
function css () {
var dfp = DEFAULT_FAMILY_PREFIX;
var drc = DEFAULT_REPLACEMENT_CLASS;
var fp = config.familyPrefix;
var rc = config.replacementClass;
var s = baseStyles;
if (fp !== dfp || rc !== drc) {
var dPatt = new RegExp("\\.".concat(dfp, "\\-"), 'g');
var customPropPatt = new RegExp("\\--".concat(dfp, "\\-"), 'g');
var rPatt = new RegExp("\\.".concat(drc), 'g');
s = s.replace(dPatt, ".".concat(fp, "-")).replace(customPropPatt, "--".concat(fp, "-")).replace(rPatt, ".".concat(rc));
}
return s;
}
var Library =
/*#__PURE__*/
function () {
function Library() {
_classCallCheck(this, Library);
this.definitions = {};
}
_createClass(Library, [{
key: "add",
value: function add() {
var _this = this;
for (var _len = arguments.length, definitions = new Array(_len), _key = 0; _key < _len; _key++) {
definitions[_key] = arguments[_key];
}
var additions = definitions.reduce(this._pullDefinitions, {});
Object.keys(additions).forEach(function (key) {
_this.definitions[key] = _objectSpread({}, _this.definitions[key] || {}, additions[key]);
defineIcons(key, additions[key]);
build();
});
}
}, {
key: "reset",
value: function reset() {
this.definitions = {};
}
}, {
key: "_pullDefinitions",
value: function _pullDefinitions(additions, definition) {
var normalized = definition.prefix && definition.iconName && definition.icon ? {
0: definition
} : definition;
Object.keys(normalized).map(function (key) {
var _normalized$key = normalized[key],
prefix = _normalized$key.prefix,
iconName = _normalized$key.iconName,
icon = _normalized$key.icon;
if (!additions[prefix]) additions[prefix] = {};
additions[prefix][iconName] = icon;
});
return additions;
}
}]);
return Library;
}();
function ensureCss() {
if (config.autoAddCss && !_cssInserted) {
insertCss(css());
_cssInserted = true;
}
}
function apiObject(val, abstractCreator) {
Object.defineProperty(val, 'abstract', {
get: abstractCreator
});
Object.defineProperty(val, 'html', {
get: function get() {
return val.abstract.map(function (a) {
return toHtml(a);
});
}
});
Object.defineProperty(val, 'node', {
get: function get() {
if (!IS_DOM) return;
var container = DOCUMENT.createElement('div');
container.innerHTML = val.html;
return container.children;
}
});
return val;
}
function findIconDefinition(iconLookup) {
var _iconLookup$prefix = iconLookup.prefix,
prefix = _iconLookup$prefix === void 0 ? 'fa' : _iconLookup$prefix,
iconName = iconLookup.iconName;
if (!iconName) return;
return iconFromMapping(library.definitions, prefix, iconName) || iconFromMapping(namespace.styles, prefix, iconName);
}
function resolveIcons(next) {
return function (maybeIconDefinition) {
var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
var iconDefinition = (maybeIconDefinition || {}).icon ? maybeIconDefinition : findIconDefinition(maybeIconDefinition || {});
var mask = params.mask;
if (mask) {
mask = (mask || {}).icon ? mask : findIconDefinition(mask || {});
}
return next(iconDefinition, _objectSpread({}, params, {
mask: mask
}));
};
}
var library = new Library();
var noAuto = function noAuto() {
config.autoReplaceSvg = false;
config.observeMutations = false;
disconnect();
};
var _cssInserted = false;
var dom = {
i2svg: function i2svg() {
var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
if (IS_DOM) {
ensureCss();
var _params$node = params.node,
node = _params$node === void 0 ? DOCUMENT : _params$node,
_params$callback = params.callback,
callback = _params$callback === void 0 ? function () {} : _params$callback;
if (config.searchPseudoElements) {
searchPseudoElements(node);
}
return onTree(node, callback);
} else {
return picked.reject('Operation requires a DOM of some kind.');
}
},
css: css,
insertCss: function insertCss$$1() {
if (!_cssInserted) {
insertCss(css());
_cssInserted = true;
}
},
watch: function watch() {
var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
var autoReplaceSvgRoot = params.autoReplaceSvgRoot,
observeMutationsRoot = params.observeMutationsRoot;
if (config.autoReplaceSvg === false) {
config.autoReplaceSvg = true;
}
config.observeMutations = true;
domready(function () {
autoReplace({
autoReplaceSvgRoot: autoReplaceSvgRoot
});
observe({
treeCallback: onTree,
nodeCallback: onNode,
pseudoElementsCallback: searchPseudoElements,
observeMutationsRoot: observeMutationsRoot
});
});
}
};
var parse = {
transform: function transform(transformString) {
return parseTransformString(transformString);
}
};
var icon = resolveIcons(function (iconDefinition) {
var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
var _params$transform = params.transform,
transform = _params$transform === void 0 ? meaninglessTransform : _params$transform,
_params$symbol = params.symbol,
symbol = _params$symbol === void 0 ? false : _params$symbol,
_params$mask = params.mask,
mask = _params$mask === void 0 ? null : _params$mask,
_params$maskId = params.maskId,
maskId = _params$maskId === void 0 ? null : _params$maskId,
_params$title = params.title,
title = _params$title === void 0 ? null : _params$title,
_params$titleId = params.titleId,
titleId = _params$titleId === void 0 ? null : _params$titleId,
_params$classes = params.classes,
classes = _params$classes === void 0 ? [] : _params$classes,
_params$attributes = params.attributes,
attributes = _params$attributes === void 0 ? {} : _params$attributes,
_params$styles = params.styles,
styles = _params$styles === void 0 ? {} : _params$styles;
if (!iconDefinition) return;
var prefix = iconDefinition.prefix,
iconName = iconDefinition.iconName,
icon = iconDefinition.icon;
return apiObject(_objectSpread({
type: 'icon'
}, iconDefinition), function () {
ensureCss();
if (config.autoA11y) {
if (title) {
attributes['aria-labelledby'] = "".concat(config.replacementClass, "-title-").concat(titleId || nextUniqueId());
} else {
attributes['aria-hidden'] = 'true';
attributes['focusable'] = 'false';
}
}
return makeInlineSvgAbstract({
icons: {
main: asFoundIcon(icon),
mask: mask ? asFoundIcon(mask.icon) : {
found: false,
width: null,
height: null,
icon: {}
}
},
prefix: prefix,
iconName: iconName,
transform: _objectSpread({}, meaninglessTransform, transform),
symbol: symbol,
title: title,
maskId: maskId,
titleId: titleId,
extra: {
attributes: attributes,
styles: styles,
classes: classes
}
});
});
});
var text = function text(content) {
var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
var _params$transform2 = params.transform,
transform = _params$transform2 === void 0 ? meaninglessTransform : _params$transform2,
_params$title2 = params.title,
title = _params$title2 === void 0 ? null : _params$title2,
_params$classes2 = params.classes,
classes = _params$classes2 === void 0 ? [] : _params$classes2,
_params$attributes2 = params.attributes,
attributes = _params$attributes2 === void 0 ? {} : _params$attributes2,
_params$styles2 = params.styles,
styles = _params$styles2 === void 0 ? {} : _params$styles2;
return apiObject({
type: 'text',
content: content
}, function () {
ensureCss();
return makeLayersTextAbstract({
content: content,
transform: _objectSpread({}, meaninglessTransform, transform),
title: title,
extra: {
attributes: attributes,
styles: styles,
classes: ["".concat(config.familyPrefix, "-layers-text")].concat(_toConsumableArray(classes))
}
});
});
};
var counter = function counter(content) {
var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
var _params$title3 = params.title,
title = _params$title3 === void 0 ? null : _params$title3,
_params$classes3 = params.classes,
classes = _params$classes3 === void 0 ? [] : _params$classes3,
_params$attributes3 = params.attributes,
attributes = _params$attributes3 === void 0 ? {} : _params$attributes3,
_params$styles3 = params.styles,
styles = _params$styles3 === void 0 ? {} : _params$styles3;
return apiObject({
type: 'counter',
content: content
}, function () {
ensureCss();
return makeLayersCounterAbstract({
content: content.toString(),
title: title,
extra: {
attributes: attributes,
styles: styles,
classes: ["".concat(config.familyPrefix, "-layers-counter")].concat(_toConsumableArray(classes))
}
});
});
};
var layer = function layer(assembler) {
var params = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
var _params$classes4 = params.classes,
classes = _params$classes4 === void 0 ? [] : _params$classes4;
return apiObject({
type: 'layer'
}, function () {
ensureCss();
var children = [];
assembler(function (args) {
Array.isArray(args) ? args.map(function (a) {
children = children.concat(a.abstract);
}) : children = children.concat(args.abstract);
});
return [{
tag: 'span',
attributes: {
class: ["".concat(config.familyPrefix, "-layers")].concat(_toConsumableArray(classes)).join(' ')
},
children: children
}];
});
};
var api = {
noAuto: noAuto,
config: config,
dom: dom,
library: library,
parse: parse,
findIconDefinition: findIconDefinition,
icon: icon,
text: text,
counter: counter,
layer: layer,
toHtml: toHtml
};
var autoReplace = function autoReplace() {
var params = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
var _params$autoReplaceSv = params.autoReplaceSvgRoot,
autoReplaceSvgRoot = _params$autoReplaceSv === void 0 ? DOCUMENT : _params$autoReplaceSv;
if ((Object.keys(namespace.styles).length > 0 || config.autoFetchSvg) && IS_DOM && config.autoReplaceSvg) api.dom.i2svg({
node: autoReplaceSvgRoot
});
};
/***/ }),
/***/ "./node_modules/@fortawesome/free-regular-svg-icons/index.es.js":
/*!**********************************************************************!*\
!*** ./node_modules/@fortawesome/free-regular-svg-icons/index.es.js ***!
\**********************************************************************/
/*! exports provided: far, prefix, faAddressBook, faAddressCard, faAngry, faArrowAltCircleDown, faArrowAltCircleLeft, faArrowAltCircleRight, faArrowAltCircleUp, faBell, faBellSlash, faBookmark, faBuilding, faCalendar, faCalendarAlt, faCalendarCheck, faCalendarMinus, faCalendarPlus, faCalendarTimes, faCaretSquareDown, faCaretSquareLeft, faCaretSquareRight, faCaretSquareUp, faChartBar, faCheckCircle, faCheckSquare, faCircle, faClipboard, faClock, faClone, faClosedCaptioning, faComment, faCommentAlt, faCommentDots, faComments, faCompass, faCopy, faCopyright, faCreditCard, faDizzy, faDotCircle, faEdit, faEnvelope, faEnvelopeOpen, faEye, faEyeSlash, faFile, faFileAlt, faFileArchive, faFileAudio, faFileCode, faFileExcel, faFileImage, faFilePdf, faFilePowerpoint, faFileVideo, faFileWord, faFlag, faFlushed, faFolder, faFolderOpen, faFontAwesomeLogoFull, faFrown, faFrownOpen, faFutbol, faGem, faGrimace, faGrin, faGrinAlt, faGrinBeam, faGrinBeamSweat, faGrinHearts, faGrinSquint, faGrinSquintTears, faGrinStars, faGrinTears, faGrinTongue, faGrinTongueSquint, faGrinTongueWink, faGrinWink, faHandLizard, faHandPaper, faHandPeace, faHandPointDown, faHandPointLeft, faHandPointRight, faHandPointUp, faHandPointer, faHandRock, faHandScissors, faHandSpock, faHandshake, faHdd, faHeart, faHospital, faHourglass, faIdBadge, faIdCard, faImage, faImages, faKeyboard, faKiss, faKissBeam, faKissWinkHeart, faLaugh, faLaughBeam, faLaughSquint, faLaughWink, faLemon, faLifeRing, faLightbulb, faListAlt, faMap, faMeh, faMehBlank, faMehRollingEyes, faMinusSquare, faMoneyBillAlt, faMoon, faNewspaper, faObjectGroup, faObjectUngroup, faPaperPlane, faPauseCircle, faPlayCircle, faPlusSquare, faQuestionCircle, faRegistered, faSadCry, faSadTear, faSave, faShareSquare, faSmile, faSmileBeam, faSmileWink, faSnowflake, faSquare, faStar, faStarHalf, faStickyNote, faStopCircle, faSun, faSurprise, faThumbsDown, faThumbsUp, faTimesCircle, faTired, faTrashAlt, faUser, faUserCircle, faWindowClose, faWindowMaximize, faWindowMinimize, faWindowRestore */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "far", function() { return _iconsCache; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "prefix", function() { return prefix; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAddressBook", function() { return faAddressBook; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAddressCard", function() { return faAddressCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngry", function() { return faAngry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleDown", function() { return faArrowAltCircleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleLeft", function() { return faArrowAltCircleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleRight", function() { return faArrowAltCircleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleUp", function() { return faArrowAltCircleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBell", function() { return faBell; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBellSlash", function() { return faBellSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookmark", function() { return faBookmark; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBuilding", function() { return faBuilding; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendar", function() { return faCalendar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarAlt", function() { return faCalendarAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarCheck", function() { return faCalendarCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarMinus", function() { return faCalendarMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarPlus", function() { return faCalendarPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarTimes", function() { return faCalendarTimes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareDown", function() { return faCaretSquareDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareLeft", function() { return faCaretSquareLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareRight", function() { return faCaretSquareRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareUp", function() { return faCaretSquareUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChartBar", function() { return faChartBar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheckCircle", function() { return faCheckCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheckSquare", function() { return faCheckSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCircle", function() { return faCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClipboard", function() { return faClipboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClock", function() { return faClock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClone", function() { return faClone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClosedCaptioning", function() { return faClosedCaptioning; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faComment", function() { return faComment; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentAlt", function() { return faCommentAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentDots", function() { return faCommentDots; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faComments", function() { return faComments; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompass", function() { return faCompass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCopy", function() { return faCopy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCopyright", function() { return faCopyright; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCreditCard", function() { return faCreditCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDizzy", function() { return faDizzy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDotCircle", function() { return faDotCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEdit", function() { return faEdit; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelope", function() { return faEnvelope; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelopeOpen", function() { return faEnvelopeOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEye", function() { return faEye; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEyeSlash", function() { return faEyeSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFile", function() { return faFile; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileAlt", function() { return faFileAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileArchive", function() { return faFileArchive; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileAudio", function() { return faFileAudio; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileCode", function() { return faFileCode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileExcel", function() { return faFileExcel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileImage", function() { return faFileImage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilePdf", function() { return faFilePdf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilePowerpoint", function() { return faFilePowerpoint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileVideo", function() { return faFileVideo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileWord", function() { return faFileWord; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlag", function() { return faFlag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlushed", function() { return faFlushed; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolder", function() { return faFolder; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolderOpen", function() { return faFolderOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFontAwesomeLogoFull", function() { return faFontAwesomeLogoFull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFrown", function() { return faFrown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFrownOpen", function() { return faFrownOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFutbol", function() { return faFutbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGem", function() { return faGem; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrimace", function() { return faGrimace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrin", function() { return faGrin; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinAlt", function() { return faGrinAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinBeam", function() { return faGrinBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinBeamSweat", function() { return faGrinBeamSweat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinHearts", function() { return faGrinHearts; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinSquint", function() { return faGrinSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinSquintTears", function() { return faGrinSquintTears; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinStars", function() { return faGrinStars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTears", function() { return faGrinTears; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongue", function() { return faGrinTongue; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongueSquint", function() { return faGrinTongueSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongueWink", function() { return faGrinTongueWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinWink", function() { return faGrinWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandLizard", function() { return faHandLizard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPaper", function() { return faHandPaper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPeace", function() { return faHandPeace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointDown", function() { return faHandPointDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointLeft", function() { return faHandPointLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointRight", function() { return faHandPointRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointUp", function() { return faHandPointUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointer", function() { return faHandPointer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandRock", function() { return faHandRock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandScissors", function() { return faHandScissors; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandSpock", function() { return faHandSpock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandshake", function() { return faHandshake; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHdd", function() { return faHdd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeart", function() { return faHeart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHospital", function() { return faHospital; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHourglass", function() { return faHourglass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIdBadge", function() { return faIdBadge; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIdCard", function() { return faIdCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faImage", function() { return faImage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faImages", function() { return faImages; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKeyboard", function() { return faKeyboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKiss", function() { return faKiss; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKissBeam", function() { return faKissBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKissWinkHeart", function() { return faKissWinkHeart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaugh", function() { return faLaugh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughBeam", function() { return faLaughBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughSquint", function() { return faLaughSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughWink", function() { return faLaughWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLemon", function() { return faLemon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLifeRing", function() { return faLifeRing; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLightbulb", function() { return faLightbulb; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faListAlt", function() { return faListAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMap", function() { return faMap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMeh", function() { return faMeh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMehBlank", function() { return faMehBlank; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMehRollingEyes", function() { return faMehRollingEyes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMinusSquare", function() { return faMinusSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyBillAlt", function() { return faMoneyBillAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoon", function() { return faMoon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNewspaper", function() { return faNewspaper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faObjectGroup", function() { return faObjectGroup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faObjectUngroup", function() { return faObjectUngroup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaperPlane", function() { return faPaperPlane; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPauseCircle", function() { return faPauseCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlayCircle", function() { return faPlayCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlusSquare", function() { return faPlusSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuestionCircle", function() { return faQuestionCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRegistered", function() { return faRegistered; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSadCry", function() { return faSadCry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSadTear", function() { return faSadTear; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSave", function() { return faSave; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShareSquare", function() { return faShareSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmile", function() { return faSmile; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmileBeam", function() { return faSmileBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmileWink", function() { return faSmileWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSnowflake", function() { return faSnowflake; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSquare", function() { return faSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStar", function() { return faStar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarHalf", function() { return faStarHalf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStickyNote", function() { return faStickyNote; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStopCircle", function() { return faStopCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSun", function() { return faSun; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSurprise", function() { return faSurprise; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThumbsDown", function() { return faThumbsDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThumbsUp", function() { return faThumbsUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTimesCircle", function() { return faTimesCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTired", function() { return faTired; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrashAlt", function() { return faTrashAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUser", function() { return faUser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserCircle", function() { return faUserCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowClose", function() { return faWindowClose; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowMaximize", function() { return faWindowMaximize; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowMinimize", function() { return faWindowMinimize; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowRestore", function() { return faWindowRestore; });
var prefix = "far";
var faAddressBook = {
prefix: 'far',
iconName: 'address-book',
icon: [448, 512, [], "f2b9", "M436 160c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20V48c0-26.5-21.5-48-48-48H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h320c26.5 0 48-21.5 48-48v-48h20c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20v-64h20c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20v-64h20zm-68 304H48V48h320v416zM208 256c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm-89.6 128h179.2c12.4 0 22.4-8.6 22.4-19.2v-19.2c0-31.8-30.1-57.6-67.2-57.6-10.8 0-18.7 8-44.8 8-26.9 0-33.4-8-44.8-8-37.1 0-67.2 25.8-67.2 57.6v19.2c0 10.6 10 19.2 22.4 19.2z"]
};
var faAddressCard = {
prefix: 'far',
iconName: 'address-card',
icon: [576, 512, [], "f2bb", "M528 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm0 400H48V80h480v352zM208 256c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm-89.6 128h179.2c12.4 0 22.4-8.6 22.4-19.2v-19.2c0-31.8-30.1-57.6-67.2-57.6-10.8 0-18.7 8-44.8 8-26.9 0-33.4-8-44.8-8-37.1 0-67.2 25.8-67.2 57.6v19.2c0 10.6 10 19.2 22.4 19.2zM360 320h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm0-64h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm0-64h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8z"]
};
var faAngry = {
prefix: 'far',
iconName: 'angry',
icon: [496, 512, [], "f556", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm0-144c-33.6 0-65.2 14.8-86.8 40.6-8.5 10.2-7.1 25.3 3.1 33.8s25.3 7.2 33.8-3c24.8-29.7 75-29.7 99.8 0 8.1 9.7 23.2 11.9 33.8 3 10.2-8.5 11.5-23.6 3.1-33.8-21.6-25.8-53.2-40.6-86.8-40.6zm-48-72c10.3 0 19.9-6.7 23-17.1 3.8-12.7-3.4-26.1-16.1-29.9l-80-24c-12.8-3.9-26.1 3.4-29.9 16.1-3.8 12.7 3.4 26.1 16.1 29.9l28.2 8.5c-3.1 4.9-5.3 10.4-5.3 16.6 0 17.7 14.3 32 32 32s32-14.4 32-32.1zm199-54.9c-3.8-12.7-17.1-19.9-29.9-16.1l-80 24c-12.7 3.8-19.9 17.2-16.1 29.9 3.1 10.4 12.7 17.1 23 17.1 0 17.7 14.3 32 32 32s32-14.3 32-32c0-6.2-2.2-11.7-5.3-16.6l28.2-8.5c12.7-3.7 19.9-17.1 16.1-29.8z"]
};
var faArrowAltCircleDown = {
prefix: 'far',
iconName: 'arrow-alt-circle-down',
icon: [512, 512, [], "f358", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 448c-110.5 0-200-89.5-200-200S145.5 56 256 56s200 89.5 200 200-89.5 200-200 200zm-32-316v116h-67c-10.7 0-16 12.9-8.5 20.5l99 99c4.7 4.7 12.3 4.7 17 0l99-99c7.6-7.6 2.2-20.5-8.5-20.5h-67V140c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12z"]
};
var faArrowAltCircleLeft = {
prefix: 'far',
iconName: 'arrow-alt-circle-left',
icon: [512, 512, [], "f359", "M8 256c0 137 111 248 248 248s248-111 248-248S393 8 256 8 8 119 8 256zm448 0c0 110.5-89.5 200-200 200S56 366.5 56 256 145.5 56 256 56s200 89.5 200 200zm-72-20v40c0 6.6-5.4 12-12 12H256v67c0 10.7-12.9 16-20.5 8.5l-99-99c-4.7-4.7-4.7-12.3 0-17l99-99c7.6-7.6 20.5-2.2 20.5 8.5v67h116c6.6 0 12 5.4 12 12z"]
};
var faArrowAltCircleRight = {
prefix: 'far',
iconName: 'arrow-alt-circle-right',
icon: [512, 512, [], "f35a", "M504 256C504 119 393 8 256 8S8 119 8 256s111 248 248 248 248-111 248-248zm-448 0c0-110.5 89.5-200 200-200s200 89.5 200 200-89.5 200-200 200S56 366.5 56 256zm72 20v-40c0-6.6 5.4-12 12-12h116v-67c0-10.7 12.9-16 20.5-8.5l99 99c4.7 4.7 4.7 12.3 0 17l-99 99c-7.6 7.6-20.5 2.2-20.5-8.5v-67H140c-6.6 0-12-5.4-12-12z"]
};
var faArrowAltCircleUp = {
prefix: 'far',
iconName: 'arrow-alt-circle-up',
icon: [512, 512, [], "f35b", "M256 504c137 0 248-111 248-248S393 8 256 8 8 119 8 256s111 248 248 248zm0-448c110.5 0 200 89.5 200 200s-89.5 200-200 200S56 366.5 56 256 145.5 56 256 56zm20 328h-40c-6.6 0-12-5.4-12-12V256h-67c-10.7 0-16-12.9-8.5-20.5l99-99c4.7-4.7 12.3-4.7 17 0l99 99c7.6 7.6 2.2 20.5-8.5 20.5h-67v116c0 6.6-5.4 12-12 12z"]
};
var faBell = {
prefix: 'far',
iconName: 'bell',
icon: [448, 512, [], "f0f3", "M439.39 362.29c-19.32-20.76-55.47-51.99-55.47-154.29 0-77.7-54.48-139.9-127.94-155.16V32c0-17.67-14.32-32-31.98-32s-31.98 14.33-31.98 32v20.84C118.56 68.1 64.08 130.3 64.08 208c0 102.3-36.15 133.53-55.47 154.29-6 6.45-8.66 14.16-8.61 21.71.11 16.4 12.98 32 32.1 32h383.8c19.12 0 32-15.6 32.1-32 .05-7.55-2.61-15.27-8.61-21.71zM67.53 368c21.22-27.97 44.42-74.33 44.53-159.42 0-.2-.06-.38-.06-.58 0-61.86 50.14-112 112-112s112 50.14 112 112c0 .2-.06.38-.06.58.11 85.1 23.31 131.46 44.53 159.42H67.53zM224 512c35.32 0 63.97-28.65 63.97-64H160.03c0 35.35 28.65 64 63.97 64z"]
};
var faBellSlash = {
prefix: 'far',
iconName: 'bell-slash',
icon: [640, 512, [], "f1f6", "M633.99 471.02L36 3.51C29.1-2.01 19.03-.9 13.51 6l-10 12.49C-2.02 25.39-.9 35.46 6 40.98l598 467.51c6.9 5.52 16.96 4.4 22.49-2.49l10-12.49c5.52-6.9 4.41-16.97-2.5-22.49zM163.53 368c16.71-22.03 34.48-55.8 41.4-110.58l-45.47-35.55c-3.27 90.73-36.47 120.68-54.84 140.42-6 6.45-8.66 14.16-8.61 21.71.11 16.4 12.98 32 32.1 32h279.66l-61.4-48H163.53zM320 96c61.86 0 112 50.14 112 112 0 .2-.06.38-.06.58.02 16.84 1.16 31.77 2.79 45.73l59.53 46.54c-8.31-22.13-14.34-51.49-14.34-92.85 0-77.7-54.48-139.9-127.94-155.16V32c0-17.67-14.32-32-31.98-32s-31.98 14.33-31.98 32v20.84c-26.02 5.41-49.45 16.94-69.13 32.72l38.17 29.84C275 103.18 296.65 96 320 96zm0 416c35.32 0 63.97-28.65 63.97-64H256.03c0 35.35 28.65 64 63.97 64z"]
};
var faBookmark = {
prefix: 'far',
iconName: 'bookmark',
icon: [384, 512, [], "f02e", "M336 0H48C21.49 0 0 21.49 0 48v464l192-112 192 112V48c0-26.51-21.49-48-48-48zm0 428.43l-144-84-144 84V54a6 6 0 0 1 6-6h276c3.314 0 6 2.683 6 5.996V428.43z"]
};
var faBuilding = {
prefix: 'far',
iconName: 'building',
icon: [448, 512, [], "f1ad", "M128 148v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12zm140 12h40c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12zm-128 96h40c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12zm128 0h40c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12zm-76 84v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm76 12h40c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12zm180 124v36H0v-36c0-6.6 5.4-12 12-12h19.5V24c0-13.3 10.7-24 24-24h337c13.3 0 24 10.7 24 24v440H436c6.6 0 12 5.4 12 12zM79.5 463H192v-67c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v67h112.5V49L80 48l-.5 415z"]
};
var faCalendar = {
prefix: 'far',
iconName: 'calendar',
icon: [448, 512, [], "f133", "M400 64h-48V12c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v52H160V12c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v52H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zm-6 400H54c-3.3 0-6-2.7-6-6V160h352v298c0 3.3-2.7 6-6 6z"]
};
var faCalendarAlt = {
prefix: 'far',
iconName: 'calendar-alt',
icon: [448, 512, [], "f073", "M148 288h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12zm108-12v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm96 0v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm-96 96v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm-96 0v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm192 0v-40c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm96-260v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V112c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48zm-48 346V160H48v298c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCalendarCheck = {
prefix: 'far',
iconName: 'calendar-check',
icon: [448, 512, [], "f274", "M400 64h-48V12c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v52H160V12c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v52H48C21.49 64 0 85.49 0 112v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V112c0-26.51-21.49-48-48-48zm-6 400H54a6 6 0 0 1-6-6V160h352v298a6 6 0 0 1-6 6zm-52.849-200.65L198.842 404.519c-4.705 4.667-12.303 4.637-16.971-.068l-75.091-75.699c-4.667-4.705-4.637-12.303.068-16.971l22.719-22.536c4.705-4.667 12.303-4.637 16.97.069l44.104 44.461 111.072-110.181c4.705-4.667 12.303-4.637 16.971.068l22.536 22.718c4.667 4.705 4.636 12.303-.069 16.97z"]
};
var faCalendarMinus = {
prefix: 'far',
iconName: 'calendar-minus',
icon: [448, 512, [], "f272", "M124 328c-6.6 0-12-5.4-12-12v-24c0-6.6 5.4-12 12-12h200c6.6 0 12 5.4 12 12v24c0 6.6-5.4 12-12 12H124zm324-216v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V112c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48zm-48 346V160H48v298c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCalendarPlus = {
prefix: 'far',
iconName: 'calendar-plus',
icon: [448, 512, [], "f271", "M336 292v24c0 6.6-5.4 12-12 12h-76v76c0 6.6-5.4 12-12 12h-24c-6.6 0-12-5.4-12-12v-76h-76c-6.6 0-12-5.4-12-12v-24c0-6.6 5.4-12 12-12h76v-76c0-6.6 5.4-12 12-12h24c6.6 0 12 5.4 12 12v76h76c6.6 0 12 5.4 12 12zm112-180v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V112c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48zm-48 346V160H48v298c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCalendarTimes = {
prefix: 'far',
iconName: 'calendar-times',
icon: [448, 512, [], "f273", "M311.7 374.7l-17 17c-4.7 4.7-12.3 4.7-17 0L224 337.9l-53.7 53.7c-4.7 4.7-12.3 4.7-17 0l-17-17c-4.7-4.7-4.7-12.3 0-17l53.7-53.7-53.7-53.7c-4.7-4.7-4.7-12.3 0-17l17-17c4.7-4.7 12.3-4.7 17 0l53.7 53.7 53.7-53.7c4.7-4.7 12.3-4.7 17 0l17 17c4.7 4.7 4.7 12.3 0 17L257.9 304l53.7 53.7c4.8 4.7 4.8 12.3.1 17zM448 112v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V112c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48zm-48 346V160H48v298c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCaretSquareDown = {
prefix: 'far',
iconName: 'caret-square-down',
icon: [448, 512, [], "f150", "M125.1 208h197.8c10.7 0 16.1 13 8.5 20.5l-98.9 98.3c-4.7 4.7-12.2 4.7-16.9 0l-98.9-98.3c-7.7-7.5-2.3-20.5 8.4-20.5zM448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCaretSquareLeft = {
prefix: 'far',
iconName: 'caret-square-left',
icon: [448, 512, [], "f191", "M272 157.1v197.8c0 10.7-13 16.1-20.5 8.5l-98.3-98.9c-4.7-4.7-4.7-12.2 0-16.9l98.3-98.9c7.5-7.7 20.5-2.3 20.5 8.4zM448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCaretSquareRight = {
prefix: 'far',
iconName: 'caret-square-right',
icon: [448, 512, [], "f152", "M176 354.9V157.1c0-10.7 13-16.1 20.5-8.5l98.3 98.9c4.7 4.7 4.7 12.2 0 16.9l-98.3 98.9c-7.5 7.7-20.5 2.3-20.5-8.4zM448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faCaretSquareUp = {
prefix: 'far',
iconName: 'caret-square-up',
icon: [448, 512, [], "f151", "M322.9 304H125.1c-10.7 0-16.1-13-8.5-20.5l98.9-98.3c4.7-4.7 12.2-4.7 16.9 0l98.9 98.3c7.7 7.5 2.3 20.5-8.4 20.5zM448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faChartBar = {
prefix: 'far',
iconName: 'chart-bar',
icon: [512, 512, [], "f080", "M396.8 352h22.4c6.4 0 12.8-6.4 12.8-12.8V108.8c0-6.4-6.4-12.8-12.8-12.8h-22.4c-6.4 0-12.8 6.4-12.8 12.8v230.4c0 6.4 6.4 12.8 12.8 12.8zm-192 0h22.4c6.4 0 12.8-6.4 12.8-12.8V140.8c0-6.4-6.4-12.8-12.8-12.8h-22.4c-6.4 0-12.8 6.4-12.8 12.8v198.4c0 6.4 6.4 12.8 12.8 12.8zm96 0h22.4c6.4 0 12.8-6.4 12.8-12.8V204.8c0-6.4-6.4-12.8-12.8-12.8h-22.4c-6.4 0-12.8 6.4-12.8 12.8v134.4c0 6.4 6.4 12.8 12.8 12.8zM496 400H48V80c0-8.84-7.16-16-16-16H16C7.16 64 0 71.16 0 80v336c0 17.67 14.33 32 32 32h464c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16zm-387.2-48h22.4c6.4 0 12.8-6.4 12.8-12.8v-70.4c0-6.4-6.4-12.8-12.8-12.8h-22.4c-6.4 0-12.8 6.4-12.8 12.8v70.4c0 6.4 6.4 12.8 12.8 12.8z"]
};
var faCheckCircle = {
prefix: 'far',
iconName: 'check-circle',
icon: [512, 512, [], "f058", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm0 48c110.532 0 200 89.451 200 200 0 110.532-89.451 200-200 200-110.532 0-200-89.451-200-200 0-110.532 89.451-200 200-200m140.204 130.267l-22.536-22.718c-4.667-4.705-12.265-4.736-16.97-.068L215.346 303.697l-59.792-60.277c-4.667-4.705-12.265-4.736-16.97-.069l-22.719 22.536c-4.705 4.667-4.736 12.265-.068 16.971l90.781 91.516c4.667 4.705 12.265 4.736 16.97.068l172.589-171.204c4.704-4.668 4.734-12.266.067-16.971z"]
};
var faCheckSquare = {
prefix: 'far',
iconName: 'check-square',
icon: [448, 512, [], "f14a", "M400 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zm0 400H48V80h352v352zm-35.864-241.724L191.547 361.48c-4.705 4.667-12.303 4.637-16.97-.068l-90.781-91.516c-4.667-4.705-4.637-12.303.069-16.971l22.719-22.536c4.705-4.667 12.303-4.637 16.97.069l59.792 60.277 141.352-140.216c4.705-4.667 12.303-4.637 16.97.068l22.536 22.718c4.667 4.706 4.637 12.304-.068 16.971z"]
};
var faCircle = {
prefix: 'far',
iconName: 'circle',
icon: [512, 512, [], "f111", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 448c-110.5 0-200-89.5-200-200S145.5 56 256 56s200 89.5 200 200-89.5 200-200 200z"]
};
var faClipboard = {
prefix: 'far',
iconName: 'clipboard',
icon: [384, 512, [], "f328", "M336 64h-80c0-35.3-28.7-64-64-64s-64 28.7-64 64H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM192 40c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm144 418c0 3.3-2.7 6-6 6H54c-3.3 0-6-2.7-6-6V118c0-3.3 2.7-6 6-6h42v36c0 6.6 5.4 12 12 12h168c6.6 0 12-5.4 12-12v-36h42c3.3 0 6 2.7 6 6z"]
};
var faClock = {
prefix: 'far',
iconName: 'clock',
icon: [512, 512, [], "f017", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 448c-110.5 0-200-89.5-200-200S145.5 56 256 56s200 89.5 200 200-89.5 200-200 200zm61.8-104.4l-84.9-61.7c-3.1-2.3-4.9-5.9-4.9-9.7V116c0-6.6 5.4-12 12-12h32c6.6 0 12 5.4 12 12v141.7l66.8 48.6c5.4 3.9 6.5 11.4 2.6 16.8L334.6 349c-3.9 5.3-11.4 6.5-16.8 2.6z"]
};
var faClone = {
prefix: 'far',
iconName: 'clone',
icon: [512, 512, [], "f24d", "M464 0H144c-26.51 0-48 21.49-48 48v48H48c-26.51 0-48 21.49-48 48v320c0 26.51 21.49 48 48 48h320c26.51 0 48-21.49 48-48v-48h48c26.51 0 48-21.49 48-48V48c0-26.51-21.49-48-48-48zM362 464H54a6 6 0 0 1-6-6V150a6 6 0 0 1 6-6h42v224c0 26.51 21.49 48 48 48h224v42a6 6 0 0 1-6 6zm96-96H150a6 6 0 0 1-6-6V54a6 6 0 0 1 6-6h308a6 6 0 0 1 6 6v308a6 6 0 0 1-6 6z"]
};
var faClosedCaptioning = {
prefix: 'far',
iconName: 'closed-captioning',
icon: [512, 512, [], "f20a", "M464 64H48C21.5 64 0 85.5 0 112v288c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zm-6 336H54c-3.3 0-6-2.7-6-6V118c0-3.3 2.7-6 6-6h404c3.3 0 6 2.7 6 6v276c0 3.3-2.7 6-6 6zm-211.1-85.7c1.7 2.4 1.5 5.6-.5 7.7-53.6 56.8-172.8 32.1-172.8-67.9 0-97.3 121.7-119.5 172.5-70.1 2.1 2 2.5 3.2 1 5.7l-17.5 30.5c-1.9 3.1-6.2 4-9.1 1.7-40.8-32-94.6-14.9-94.6 31.2 0 48 51 70.5 92.2 32.6 2.8-2.5 7.1-2.1 9.2.9l19.6 27.7zm190.4 0c1.7 2.4 1.5 5.6-.5 7.7-53.6 56.9-172.8 32.1-172.8-67.9 0-97.3 121.7-119.5 172.5-70.1 2.1 2 2.5 3.2 1 5.7L420 220.2c-1.9 3.1-6.2 4-9.1 1.7-40.8-32-94.6-14.9-94.6 31.2 0 48 51 70.5 92.2 32.6 2.8-2.5 7.1-2.1 9.2.9l19.6 27.7z"]
};
var faComment = {
prefix: 'far',
iconName: 'comment',
icon: [512, 512, [], "f075", "M256 32C114.6 32 0 125.1 0 240c0 47.6 19.9 91.2 52.9 126.3C38 405.7 7 439.1 6.5 439.5c-6.6 7-8.4 17.2-4.6 26S14.4 480 24 480c61.5 0 110-25.7 139.1-46.3C192 442.8 223.2 448 256 448c141.4 0 256-93.1 256-208S397.4 32 256 32zm0 368c-26.7 0-53.1-4.1-78.4-12.1l-22.7-7.2-19.5 13.8c-14.3 10.1-33.9 21.4-57.5 29 7.3-12.1 14.4-25.7 19.9-40.2l10.6-28.1-20.6-21.8C69.7 314.1 48 282.2 48 240c0-88.2 93.3-160 208-160s208 71.8 208 160-93.3 160-208 160z"]
};
var faCommentAlt = {
prefix: 'far',
iconName: 'comment-alt',
icon: [512, 512, [], "f27a", "M448 0H64C28.7 0 0 28.7 0 64v288c0 35.3 28.7 64 64 64h96v84c0 7.1 5.8 12 12 12 2.4 0 4.9-.7 7.1-2.4L304 416h144c35.3 0 64-28.7 64-64V64c0-35.3-28.7-64-64-64zm16 352c0 8.8-7.2 16-16 16H288l-12.8 9.6L208 428v-60H64c-8.8 0-16-7.2-16-16V64c0-8.8 7.2-16 16-16h384c8.8 0 16 7.2 16 16v288z"]
};
var faCommentDots = {
prefix: 'far',
iconName: 'comment-dots',
icon: [512, 512, [], "f4ad", "M144 208c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm112 0c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm112 0c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zM256 32C114.6 32 0 125.1 0 240c0 47.6 19.9 91.2 52.9 126.3C38 405.7 7 439.1 6.5 439.5c-6.6 7-8.4 17.2-4.6 26S14.4 480 24 480c61.5 0 110-25.7 139.1-46.3C192 442.8 223.2 448 256 448c141.4 0 256-93.1 256-208S397.4 32 256 32zm0 368c-26.7 0-53.1-4.1-78.4-12.1l-22.7-7.2-19.5 13.8c-14.3 10.1-33.9 21.4-57.5 29 7.3-12.1 14.4-25.7 19.9-40.2l10.6-28.1-20.6-21.8C69.7 314.1 48 282.2 48 240c0-88.2 93.3-160 208-160s208 71.8 208 160-93.3 160-208 160z"]
};
var faComments = {
prefix: 'far',
iconName: 'comments',
icon: [576, 512, [], "f086", "M532 386.2c27.5-27.1 44-61.1 44-98.2 0-80-76.5-146.1-176.2-157.9C368.3 72.5 294.3 32 208 32 93.1 32 0 103.6 0 192c0 37 16.5 71 44 98.2-15.3 30.7-37.3 54.5-37.7 54.9-6.3 6.7-8.1 16.5-4.4 25 3.6 8.5 12 14 21.2 14 53.5 0 96.7-20.2 125.2-38.8 9.2 2.1 18.7 3.7 28.4 4.9C208.1 407.6 281.8 448 368 448c20.8 0 40.8-2.4 59.8-6.8C456.3 459.7 499.4 480 553 480c9.2 0 17.5-5.5 21.2-14 3.6-8.5 1.9-18.3-4.4-25-.4-.3-22.5-24.1-37.8-54.8zm-392.8-92.3L122.1 305c-14.1 9.1-28.5 16.3-43.1 21.4 2.7-4.7 5.4-9.7 8-14.8l15.5-31.1L77.7 256C64.2 242.6 48 220.7 48 192c0-60.7 73.3-112 160-112s160 51.3 160 112-73.3 112-160 112c-16.5 0-33-1.9-49-5.6l-19.8-4.5zM498.3 352l-24.7 24.4 15.5 31.1c2.6 5.1 5.3 10.1 8 14.8-14.6-5.1-29-12.3-43.1-21.4l-17.1-11.1-19.9 4.6c-16 3.7-32.5 5.6-49 5.6-54 0-102.2-20.1-131.3-49.7C338 339.5 416 272.9 416 192c0-3.4-.4-6.7-.7-10C479.7 196.5 528 238.8 528 288c0 28.7-16.2 50.6-29.7 64z"]
};
var faCompass = {
prefix: 'far',
iconName: 'compass',
icon: [496, 512, [], "f14e", "M347.94 129.86L203.6 195.83a31.938 31.938 0 0 0-15.77 15.77l-65.97 144.34c-7.61 16.65 9.54 33.81 26.2 26.2l144.34-65.97a31.938 31.938 0 0 0 15.77-15.77l65.97-144.34c7.61-16.66-9.54-33.81-26.2-26.2zm-77.36 148.72c-12.47 12.47-32.69 12.47-45.16 0-12.47-12.47-12.47-32.69 0-45.16 12.47-12.47 32.69-12.47 45.16 0 12.47 12.47 12.47 32.69 0 45.16zM248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm0 448c-110.28 0-200-89.72-200-200S137.72 56 248 56s200 89.72 200 200-89.72 200-200 200z"]
};
var faCopy = {
prefix: 'far',
iconName: 'copy',
icon: [448, 512, [], "f0c5", "M433.941 65.941l-51.882-51.882A48 48 0 0 0 348.118 0H176c-26.51 0-48 21.49-48 48v48H48c-26.51 0-48 21.49-48 48v320c0 26.51 21.49 48 48 48h224c26.51 0 48-21.49 48-48v-48h80c26.51 0 48-21.49 48-48V99.882a48 48 0 0 0-14.059-33.941zM266 464H54a6 6 0 0 1-6-6V150a6 6 0 0 1 6-6h74v224c0 26.51 21.49 48 48 48h96v42a6 6 0 0 1-6 6zm128-96H182a6 6 0 0 1-6-6V54a6 6 0 0 1 6-6h106v88c0 13.255 10.745 24 24 24h88v202a6 6 0 0 1-6 6zm6-256h-64V48h9.632c1.591 0 3.117.632 4.243 1.757l48.368 48.368a6 6 0 0 1 1.757 4.243V112z"]
};
var faCopyright = {
prefix: 'far',
iconName: 'copyright',
icon: [512, 512, [], "f1f9", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm0 448c-110.532 0-200-89.451-200-200 0-110.531 89.451-200 200-200 110.532 0 200 89.451 200 200 0 110.532-89.451 200-200 200zm107.351-101.064c-9.614 9.712-45.53 41.396-104.065 41.396-82.43 0-140.484-61.425-140.484-141.567 0-79.152 60.275-139.401 139.762-139.401 55.531 0 88.738 26.62 97.593 34.779a11.965 11.965 0 0 1 1.936 15.322l-18.155 28.113c-3.841 5.95-11.966 7.282-17.499 2.921-8.595-6.776-31.814-22.538-61.708-22.538-48.303 0-77.916 35.33-77.916 80.082 0 41.589 26.888 83.692 78.277 83.692 32.657 0 56.843-19.039 65.726-27.225 5.27-4.857 13.596-4.039 17.82 1.738l19.865 27.17a11.947 11.947 0 0 1-1.152 15.518z"]
};
var faCreditCard = {
prefix: 'far',
iconName: 'credit-card',
icon: [576, 512, [], "f09d", "M527.9 32H48.1C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48.1 48h479.8c26.6 0 48.1-21.5 48.1-48V80c0-26.5-21.5-48-48.1-48zM54.1 80h467.8c3.3 0 6 2.7 6 6v42H48.1V86c0-3.3 2.7-6 6-6zm467.8 352H54.1c-3.3 0-6-2.7-6-6V256h479.8v170c0 3.3-2.7 6-6 6zM192 332v40c0 6.6-5.4 12-12 12h-72c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h72c6.6 0 12 5.4 12 12zm192 0v40c0 6.6-5.4 12-12 12H236c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h136c6.6 0 12 5.4 12 12z"]
};
var faDizzy = {
prefix: 'far',
iconName: 'dizzy',
icon: [496, 512, [], "f567", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-33.8-217.9c7.8-7.8 7.8-20.5 0-28.3L196.3 192l17.9-17.9c7.8-7.8 7.8-20.5 0-28.3-7.8-7.8-20.5-7.8-28.3 0L168 163.7l-17.8-17.8c-7.8-7.8-20.5-7.8-28.3 0-7.8 7.8-7.8 20.5 0 28.3l17.9 17.9-17.9 17.9c-7.8 7.8-7.8 20.5 0 28.3 7.8 7.8 20.5 7.8 28.3 0l17.8-17.8 17.8 17.8c7.9 7.7 20.5 7.7 28.4-.2zm160-92.2c-7.8-7.8-20.5-7.8-28.3 0L328 163.7l-17.8-17.8c-7.8-7.8-20.5-7.8-28.3 0-7.8 7.8-7.8 20.5 0 28.3l17.9 17.9-17.9 17.9c-7.8 7.8-7.8 20.5 0 28.3 7.8 7.8 20.5 7.8 28.3 0l17.8-17.8 17.8 17.8c7.8 7.8 20.5 7.8 28.3 0 7.8-7.8 7.8-20.5 0-28.3l-17.8-18 17.9-17.9c7.7-7.8 7.7-20.4 0-28.2zM248 272c-35.3 0-64 28.7-64 64s28.7 64 64 64 64-28.7 64-64-28.7-64-64-64z"]
};
var faDotCircle = {
prefix: 'far',
iconName: 'dot-circle',
icon: [512, 512, [], "f192", "M256 56c110.532 0 200 89.451 200 200 0 110.532-89.451 200-200 200-110.532 0-200-89.451-200-200 0-110.532 89.451-200 200-200m0-48C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm0 168c-44.183 0-80 35.817-80 80s35.817 80 80 80 80-35.817 80-80-35.817-80-80-80z"]
};
var faEdit = {
prefix: 'far',
iconName: 'edit',
icon: [576, 512, [], "f044", "M402.3 344.9l32-32c5-5 13.7-1.5 13.7 5.7V464c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V112c0-26.5 21.5-48 48-48h273.5c7.1 0 10.7 8.6 5.7 13.7l-32 32c-1.5 1.5-3.5 2.3-5.7 2.3H48v352h352V350.5c0-2.1.8-4.1 2.3-5.6zm156.6-201.8L296.3 405.7l-90.4 10c-26.2 2.9-48.5-19.2-45.6-45.6l10-90.4L432.9 17.1c22.9-22.9 59.9-22.9 82.7 0l43.2 43.2c22.9 22.9 22.9 60 .1 82.8zM460.1 174L402 115.9 216.2 301.8l-7.3 65.3 65.3-7.3L460.1 174zm64.8-79.7l-43.2-43.2c-4.1-4.1-10.8-4.1-14.8 0L436 82l58.1 58.1 30.9-30.9c4-4.2 4-10.8-.1-14.9z"]
};
var faEnvelope = {
prefix: 'far',
iconName: 'envelope',
icon: [512, 512, [], "f0e0", "M464 64H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V112c0-26.51-21.49-48-48-48zm0 48v40.805c-22.422 18.259-58.168 46.651-134.587 106.49-16.841 13.247-50.201 45.072-73.413 44.701-23.208.375-56.579-31.459-73.413-44.701C106.18 199.465 70.425 171.067 48 152.805V112h416zM48 400V214.398c22.914 18.251 55.409 43.862 104.938 82.646 21.857 17.205 60.134 55.186 103.062 54.955 42.717.231 80.509-37.199 103.053-54.947 49.528-38.783 82.032-64.401 104.947-82.653V400H48z"]
};
var faEnvelopeOpen = {
prefix: 'far',
iconName: 'envelope-open',
icon: [512, 512, [], "f2b6", "M494.586 164.516c-4.697-3.883-111.723-89.95-135.251-108.657C337.231 38.191 299.437 0 256 0c-43.205 0-80.636 37.717-103.335 55.859-24.463 19.45-131.07 105.195-135.15 108.549A48.004 48.004 0 0 0 0 201.485V464c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V201.509a48 48 0 0 0-17.414-36.993zM464 458a6 6 0 0 1-6 6H54a6 6 0 0 1-6-6V204.347c0-1.813.816-3.526 2.226-4.665 15.87-12.814 108.793-87.554 132.364-106.293C200.755 78.88 232.398 48 256 48c23.693 0 55.857 31.369 73.41 45.389 23.573 18.741 116.503 93.493 132.366 106.316a5.99 5.99 0 0 1 2.224 4.663V458zm-31.991-187.704c4.249 5.159 3.465 12.795-1.745 16.981-28.975 23.283-59.274 47.597-70.929 56.863C336.636 362.283 299.205 400 256 400c-43.452 0-81.287-38.237-103.335-55.86-11.279-8.967-41.744-33.413-70.927-56.865-5.21-4.187-5.993-11.822-1.745-16.981l15.258-18.528c4.178-5.073 11.657-5.843 16.779-1.726 28.618 23.001 58.566 47.035 70.56 56.571C200.143 320.631 232.307 352 256 352c23.602 0 55.246-30.88 73.41-45.389 11.994-9.535 41.944-33.57 70.563-56.568 5.122-4.116 12.601-3.346 16.778 1.727l15.258 18.526z"]
};
var faEye = {
prefix: 'far',
iconName: 'eye',
icon: [576, 512, [], "f06e", "M288 144a110.94 110.94 0 0 0-31.24 5 55.4 55.4 0 0 1 7.24 27 56 56 0 0 1-56 56 55.4 55.4 0 0 1-27-7.24A111.71 111.71 0 1 0 288 144zm284.52 97.4C518.29 135.59 410.93 64 288 64S57.68 135.64 3.48 241.41a32.35 32.35 0 0 0 0 29.19C57.71 376.41 165.07 448 288 448s230.32-71.64 284.52-177.41a32.35 32.35 0 0 0 0-29.19zM288 400c-98.65 0-189.09-55-237.93-144C98.91 167 189.34 112 288 112s189.09 55 237.93 144C477.1 345 386.66 400 288 400z"]
};
var faEyeSlash = {
prefix: 'far',
iconName: 'eye-slash',
icon: [640, 512, [], "f070", "M634 471L36 3.51A16 16 0 0 0 13.51 6l-10 12.49A16 16 0 0 0 6 41l598 467.49a16 16 0 0 0 22.49-2.49l10-12.49A16 16 0 0 0 634 471zM296.79 146.47l134.79 105.38C429.36 191.91 380.48 144 320 144a112.26 112.26 0 0 0-23.21 2.47zm46.42 219.07L208.42 260.16C210.65 320.09 259.53 368 320 368a113 113 0 0 0 23.21-2.46zM320 112c98.65 0 189.09 55 237.93 144a285.53 285.53 0 0 1-44 60.2l37.74 29.5a333.7 333.7 0 0 0 52.9-75.11 32.35 32.35 0 0 0 0-29.19C550.29 135.59 442.93 64 320 64c-36.7 0-71.71 7-104.63 18.81l46.41 36.29c18.94-4.3 38.34-7.1 58.22-7.1zm0 288c-98.65 0-189.08-55-237.93-144a285.47 285.47 0 0 1 44.05-60.19l-37.74-29.5a333.6 333.6 0 0 0-52.89 75.1 32.35 32.35 0 0 0 0 29.19C89.72 376.41 197.08 448 320 448c36.7 0 71.71-7.05 104.63-18.81l-46.41-36.28C359.28 397.2 339.89 400 320 400z"]
};
var faFile = {
prefix: 'far',
iconName: 'file',
icon: [384, 512, [], "f15b", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48z"]
};
var faFileAlt = {
prefix: 'far',
iconName: 'file-alt',
icon: [384, 512, [], "f15c", "M288 248v28c0 6.6-5.4 12-12 12H108c-6.6 0-12-5.4-12-12v-28c0-6.6 5.4-12 12-12h168c6.6 0 12 5.4 12 12zm-12 72H108c-6.6 0-12 5.4-12 12v28c0 6.6 5.4 12 12 12h168c6.6 0 12-5.4 12-12v-28c0-6.6-5.4-12-12-12zm108-188.1V464c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V48C0 21.5 21.5 0 48 0h204.1C264.8 0 277 5.1 286 14.1L369.9 98c9 8.9 14.1 21.2 14.1 33.9zm-128-80V128h76.1L256 51.9zM336 464V176H232c-13.3 0-24-10.7-24-24V48H48v416h288z"]
};
var faFileArchive = {
prefix: 'far',
iconName: 'file-archive',
icon: [384, 512, [], "f1c6", "M128.3 160v32h32v-32zm64-96h-32v32h32zm-64 32v32h32V96zm64 32h-32v32h32zm177.6-30.1L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM256 51.9l76.1 76.1H256zM336 464H48V48h79.7v16h32V48H208v104c0 13.3 10.7 24 24 24h104zM194.2 265.7c-1.1-5.6-6-9.7-11.8-9.7h-22.1v-32h-32v32l-19.7 97.1C102 385.6 126.8 416 160 416c33.1 0 57.9-30.2 51.5-62.6zm-33.9 124.4c-17.9 0-32.4-12.1-32.4-27s14.5-27 32.4-27 32.4 12.1 32.4 27-14.5 27-32.4 27zm32-198.1h-32v32h32z"]
};
var faFileAudio = {
prefix: 'far',
iconName: 'file-audio',
icon: [384, 512, [], "f1c7", "M369.941 97.941l-83.882-83.882A48 48 0 0 0 252.118 0H48C21.49 0 0 21.49 0 48v416c0 26.51 21.49 48 48 48h288c26.51 0 48-21.49 48-48V131.882a48 48 0 0 0-14.059-33.941zM332.118 128H256V51.882L332.118 128zM48 464V48h160v104c0 13.255 10.745 24 24 24h104v288H48zm144-76.024c0 10.691-12.926 16.045-20.485 8.485L136 360.486h-28c-6.627 0-12-5.373-12-12v-56c0-6.627 5.373-12 12-12h28l35.515-36.947c7.56-7.56 20.485-2.206 20.485 8.485v135.952zm41.201-47.13c9.051-9.297 9.06-24.133.001-33.439-22.149-22.752 12.235-56.246 34.395-33.481 27.198 27.94 27.212 72.444.001 100.401-21.793 22.386-56.947-10.315-34.397-33.481z"]
};
var faFileCode = {
prefix: 'far',
iconName: 'file-code',
icon: [384, 512, [], "f1c9", "M149.9 349.1l-.2-.2-32.8-28.9 32.8-28.9c3.6-3.2 4-8.8.8-12.4l-.2-.2-17.4-18.6c-3.4-3.6-9-3.7-12.4-.4l-57.7 54.1c-3.7 3.5-3.7 9.4 0 12.8l57.7 54.1c1.6 1.5 3.8 2.4 6 2.4 2.4 0 4.8-1 6.4-2.8l17.4-18.6c3.3-3.5 3.1-9.1-.4-12.4zm220-251.2L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM256 51.9l76.1 76.1H256zM336 464H48V48h160v104c0 13.3 10.7 24 24 24h104zM209.6 214c-4.7-1.4-9.5 1.3-10.9 6L144 408.1c-1.4 4.7 1.3 9.6 6 10.9l24.4 7.1c4.7 1.4 9.6-1.4 10.9-6L240 231.9c1.4-4.7-1.3-9.6-6-10.9zm24.5 76.9l.2.2 32.8 28.9-32.8 28.9c-3.6 3.2-4 8.8-.8 12.4l.2.2 17.4 18.6c3.3 3.5 8.9 3.7 12.4.4l57.7-54.1c3.7-3.5 3.7-9.4 0-12.8l-57.7-54.1c-3.5-3.3-9.1-3.2-12.4.4l-17.4 18.6c-3.3 3.5-3.1 9.1.4 12.4z"]
};
var faFileExcel = {
prefix: 'far',
iconName: 'file-excel',
icon: [384, 512, [], "f1c3", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48zm212-240h-28.8c-4.4 0-8.4 2.4-10.5 6.3-18 33.1-22.2 42.4-28.6 57.7-13.9-29.1-6.9-17.3-28.6-57.7-2.1-3.9-6.2-6.3-10.6-6.3H124c-9.3 0-15 10-10.4 18l46.3 78-46.3 78c-4.7 8 1.1 18 10.4 18h28.9c4.4 0 8.4-2.4 10.5-6.3 21.7-40 23-45 28.6-57.7 14.9 30.2 5.9 15.9 28.6 57.7 2.1 3.9 6.2 6.3 10.6 6.3H260c9.3 0 15-10 10.4-18L224 320c.7-1.1 30.3-50.5 46.3-78 4.7-8-1.1-18-10.3-18z"]
};
var faFileImage = {
prefix: 'far',
iconName: 'file-image',
icon: [384, 512, [], "f1c5", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48zm32-48h224V288l-23.5-23.5c-4.7-4.7-12.3-4.7-17 0L176 352l-39.5-39.5c-4.7-4.7-12.3-4.7-17 0L80 352v64zm48-240c-26.5 0-48 21.5-48 48s21.5 48 48 48 48-21.5 48-48-21.5-48-48-48z"]
};
var faFilePdf = {
prefix: 'far',
iconName: 'file-pdf',
icon: [384, 512, [], "f1c1", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48zm250.2-143.7c-12.2-12-47-8.7-64.4-6.5-17.2-10.5-28.7-25-36.8-46.3 3.9-16.1 10.1-40.6 5.4-56-4.2-26.2-37.8-23.6-42.6-5.9-4.4 16.1-.4 38.5 7 67.1-10 23.9-24.9 56-35.4 74.4-20 10.3-47 26.2-51 46.2-3.3 15.8 26 55.2 76.1-31.2 22.4-7.4 46.8-16.5 68.4-20.1 18.9 10.2 41 17 55.8 17 25.5 0 28-28.2 17.5-38.7zm-198.1 77.8c5.1-13.7 24.5-29.5 30.4-35-19 30.3-30.4 35.7-30.4 35zm81.6-190.6c7.4 0 6.7 32.1 1.8 40.8-4.4-13.9-4.3-40.8-1.8-40.8zm-24.4 136.6c9.7-16.9 18-37 24.7-54.7 8.3 15.1 18.9 27.2 30.1 35.5-20.8 4.3-38.9 13.1-54.8 19.2zm131.6-5s-5 6-37.3-7.8c35.1-2.6 40.9 5.4 37.3 7.8z"]
};
var faFilePowerpoint = {
prefix: 'far',
iconName: 'file-powerpoint',
icon: [384, 512, [], "f1c4", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48zm72-60V236c0-6.6 5.4-12 12-12h69.2c36.7 0 62.8 27 62.8 66.3 0 74.3-68.7 66.5-95.5 66.5V404c0 6.6-5.4 12-12 12H132c-6.6 0-12-5.4-12-12zm48.5-87.4h23c7.9 0 13.9-2.4 18.1-7.2 8.5-9.8 8.4-28.5.1-37.8-4.1-4.6-9.9-7-17.4-7h-23.9v52z"]
};
var faFileVideo = {
prefix: 'far',
iconName: 'file-video',
icon: [384, 512, [], "f1c8", "M369.941 97.941l-83.882-83.882A48 48 0 0 0 252.118 0H48C21.49 0 0 21.49 0 48v416c0 26.51 21.49 48 48 48h288c26.51 0 48-21.49 48-48V131.882a48 48 0 0 0-14.059-33.941zM332.118 128H256V51.882L332.118 128zM48 464V48h160v104c0 13.255 10.745 24 24 24h104v288H48zm228.687-211.303L224 305.374V268c0-11.046-8.954-20-20-20H100c-11.046 0-20 8.954-20 20v104c0 11.046 8.954 20 20 20h104c11.046 0 20-8.954 20-20v-37.374l52.687 52.674C286.704 397.318 304 390.28 304 375.986V264.011c0-14.311-17.309-21.319-27.313-11.314z"]
};
var faFileWord = {
prefix: 'far',
iconName: 'file-word',
icon: [384, 512, [], "f1c2", "M369.9 97.9L286 14C277 5 264.8-.1 252.1-.1H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V131.9c0-12.7-5.1-25-14.1-34zM332.1 128H256V51.9l76.1 76.1zM48 464V48h160v104c0 13.3 10.7 24 24 24h104v288H48zm220.1-208c-5.7 0-10.6 4-11.7 9.5-20.6 97.7-20.4 95.4-21 103.5-.2-1.2-.4-2.6-.7-4.3-.8-5.1.3.2-23.6-99.5-1.3-5.4-6.1-9.2-11.7-9.2h-13.3c-5.5 0-10.3 3.8-11.7 9.1-24.4 99-24 96.2-24.8 103.7-.1-1.1-.2-2.5-.5-4.2-.7-5.2-14.1-73.3-19.1-99-1.1-5.6-6-9.7-11.8-9.7h-16.8c-7.8 0-13.5 7.3-11.7 14.8 8 32.6 26.7 109.5 33.2 136 1.3 5.4 6.1 9.1 11.7 9.1h25.2c5.5 0 10.3-3.7 11.6-9.1l17.9-71.4c1.5-6.2 2.5-12 3-17.3l2.9 17.3c.1.4 12.6 50.5 17.9 71.4 1.3 5.3 6.1 9.1 11.6 9.1h24.7c5.5 0 10.3-3.7 11.6-9.1 20.8-81.9 30.2-119 34.5-136 1.9-7.6-3.8-14.9-11.6-14.9h-15.8z"]
};
var faFlag = {
prefix: 'far',
iconName: 'flag',
icon: [512, 512, [], "f024", "M336.174 80c-49.132 0-93.305-32-161.913-32-31.301 0-58.303 6.482-80.721 15.168a48.04 48.04 0 0 0 2.142-20.727C93.067 19.575 74.167 1.594 51.201.104 23.242-1.71 0 20.431 0 48c0 17.764 9.657 33.262 24 41.562V496c0 8.837 7.163 16 16 16h16c8.837 0 16-7.163 16-16v-83.443C109.869 395.28 143.259 384 199.826 384c49.132 0 93.305 32 161.913 32 58.479 0 101.972-22.617 128.548-39.981C503.846 367.161 512 352.051 512 335.855V95.937c0-34.459-35.264-57.768-66.904-44.117C409.193 67.309 371.641 80 336.174 80zM464 336c-21.783 15.412-60.824 32-102.261 32-59.945 0-102.002-32-161.913-32-43.361 0-96.379 9.403-127.826 24V128c21.784-15.412 60.824-32 102.261-32 59.945 0 102.002 32 161.913 32 43.271 0 96.32-17.366 127.826-32v240z"]
};
var faFlushed = {
prefix: 'far',
iconName: 'flushed',
icon: [496, 512, [], "f579", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm96-312c-44.2 0-80 35.8-80 80s35.8 80 80 80 80-35.8 80-80-35.8-80-80-80zm0 128c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm0-72c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm-112 24c0-44.2-35.8-80-80-80s-80 35.8-80 80 35.8 80 80 80 80-35.8 80-80zm-80 48c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm0-72c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm160 144H184c-13.2 0-24 10.8-24 24s10.8 24 24 24h128c13.2 0 24-10.8 24-24s-10.8-24-24-24z"]
};
var faFolder = {
prefix: 'far',
iconName: 'folder',
icon: [512, 512, [], "f07b", "M464 128H272l-54.63-54.63c-6-6-14.14-9.37-22.63-9.37H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V176c0-26.51-21.49-48-48-48zm0 272H48V112h140.12l54.63 54.63c6 6 14.14 9.37 22.63 9.37H464v224z"]
};
var faFolderOpen = {
prefix: 'far',
iconName: 'folder-open',
icon: [576, 512, [], "f07c", "M527.9 224H480v-48c0-26.5-21.5-48-48-48H272l-64-64H48C21.5 64 0 85.5 0 112v288c0 26.5 21.5 48 48 48h400c16.5 0 31.9-8.5 40.7-22.6l79.9-128c20-31.9-3-73.4-40.7-73.4zM48 118c0-3.3 2.7-6 6-6h134.1l64 64H426c3.3 0 6 2.7 6 6v42H152c-16.8 0-32.4 8.8-41.1 23.2L48 351.4zm400 282H72l77.2-128H528z"]
};
var faFontAwesomeLogoFull = {
prefix: 'far',
iconName: 'font-awesome-logo-full',
icon: [3992, 512, ["Font Awesome"], "f4e6", "M454.6 0H57.4C25.9 0 0 25.9 0 57.4v397.3C0 486.1 25.9 512 57.4 512h397.3c31.4 0 57.4-25.9 57.4-57.4V57.4C512 25.9 486.1 0 454.6 0zm-58.9 324.9c0 4.8-4.1 6.9-8.9 8.9-19.2 8.1-39.7 15.7-61.5 15.7-40.5 0-68.7-44.8-163.2 2.5v51.8c0 30.3-45.7 30.2-45.7 0v-250c-9-7-15-17.9-15-30.3 0-21 17.1-38.2 38.2-38.2 21 0 38.2 17.1 38.2 38.2 0 12.2-5.8 23.2-14.9 30.2v21c37.1-12 65.5-34.4 146.1-3.4 26.6 11.4 68.7-15.7 76.5-15.7 5.5 0 10.3 4.1 10.3 8.9v160.4zm432.9-174.2h-137v70.1H825c39.8 0 40.4 62.2 0 62.2H691.6v105.6c0 45.5-70.7 46.4-70.7 0V128.3c0-22 18-39.8 39.8-39.8h167.8c39.6 0 40.5 62.2.1 62.2zm191.1 23.4c-169.3 0-169.1 252.4 0 252.4 169.9 0 169.9-252.4 0-252.4zm0 196.1c-81.6 0-82.1-139.8 0-139.8 82.5 0 82.4 139.8 0 139.8zm372.4 53.4c-17.5 0-31.4-13.9-31.4-31.4v-117c0-62.4-72.6-52.5-99.1-16.4v133.4c0 41.5-63.3 41.8-63.3 0V208c0-40 63.1-41.6 63.1 0v3.4c43.3-51.6 162.4-60.4 162.4 39.3v141.5c.3 30.4-31.5 31.4-31.7 31.4zm179.7 2.9c-44.3 0-68.3-22.9-68.3-65.8V235.2H1488c-35.6 0-36.7-55.3 0-55.3h15.5v-37.3c0-41.3 63.8-42.1 63.8 0v37.5h24.9c35.4 0 35.7 55.3 0 55.3h-24.9v108.5c0 29.6 26.1 26.3 27.4 26.3 31.4 0 52.6 56.3-22.9 56.3zM1992 123c-19.5-50.2-95.5-50-114.5 0-107.3 275.7-99.5 252.7-99.5 262.8 0 42.8 58.3 51.2 72.1 14.4l13.5-35.9H2006l13 35.9c14.2 37.7 72.1 27.2 72.1-14.4 0-10.1 5.3 6.8-99.1-262.8zm-108.9 179.1l51.7-142.9 51.8 142.9h-103.5zm591.3-85.6l-53.7 176.3c-12.4 41.2-72 41-84 0l-42.3-135.9-42.3 135.9c-12.4 40.9-72 41.2-84.5 0l-54.2-176.3c-12.5-39.4 49.8-56.1 60.2-16.9L2213 342l45.3-139.5c10.9-32.7 59.6-34.7 71.2 0l45.3 139.5 39.3-142.4c10.3-38.3 72.6-23.8 60.3 16.9zm275.4 75.1c0-42.4-33.9-117.5-119.5-117.5-73.2 0-124.4 56.3-124.4 126 0 77.2 55.3 126.4 128.5 126.4 31.7 0 93-11.5 93-39.8 0-18.3-21.1-31.5-39.3-22.4-49.4 26.2-109 8.4-115.9-43.8h148.3c16.3 0 29.3-13.4 29.3-28.9zM2571 277.7c9.5-73.4 113.9-68.6 118.6 0H2571zm316.7 148.8c-31.4 0-81.6-10.5-96.6-31.9-12.4-17 2.5-39.8 21.8-39.8 16.3 0 36.8 22.9 77.7 22.9 27.4 0 40.4-11 40.4-25.8 0-39.8-142.9-7.4-142.9-102 0-40.4 35.3-75.7 98.6-75.7 31.4 0 74.1 9.9 87.6 29.4 10.8 14.8-1.4 36.2-20.9 36.2-15.1 0-26.7-17.3-66.2-17.3-22.9 0-37.8 10.5-37.8 23.8 0 35.9 142.4 6 142.4 103.1-.1 43.7-37.4 77.1-104.1 77.1zm266.8-252.4c-169.3 0-169.1 252.4 0 252.4 170.1 0 169.6-252.4 0-252.4zm0 196.1c-81.8 0-82-139.8 0-139.8 82.5 0 82.4 139.8 0 139.8zm476.9 22V268.7c0-53.8-61.4-45.8-85.7-10.5v134c0 41.3-63.8 42.1-63.8 0V268.7c0-52.1-59.5-47.4-85.7-10.1v133.6c0 41.5-63.3 41.8-63.3 0V208c0-40 63.1-41.6 63.1 0v3.4c9.9-14.4 41.8-37.3 78.6-37.3 35.3 0 57.7 16.4 66.7 43.8 13.9-21.8 45.8-43.8 82.6-43.8 44.3 0 70.7 23.4 70.7 72.7v145.3c.5 17.3-13.5 31.4-31.9 31.4 3.5.1-31.3 1.1-31.3-31.3zM3992 291.6c0-42.4-32.4-117.5-117.9-117.5-73.2 0-127.5 56.3-127.5 126 0 77.2 58.3 126.4 131.6 126.4 31.7 0 91.5-11.5 91.5-39.8 0-18.3-21.1-31.5-39.3-22.4-49.4 26.2-110.5 8.4-117.5-43.8h149.8c16.3 0 29.1-13.4 29.3-28.9zm-180.5-13.9c9.7-74.4 115.9-68.3 120.1 0h-120.1z"]
};
var faFrown = {
prefix: 'far',
iconName: 'frown',
icon: [496, 512, [], "f119", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-80-216c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160-64c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm-80 128c-40.2 0-78 17.7-103.8 48.6-8.5 10.2-7.1 25.3 3.1 33.8 10.2 8.4 25.3 7.1 33.8-3.1 16.6-19.9 41-31.4 66.9-31.4s50.3 11.4 66.9 31.4c8.1 9.7 23.1 11.9 33.8 3.1 10.2-8.5 11.5-23.6 3.1-33.8C326 321.7 288.2 304 248 304z"]
};
var faFrownOpen = {
prefix: 'far',
iconName: 'frown-open',
icon: [496, 512, [], "f57a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-48-248c0-17.7-14.3-32-32-32s-32 14.3-32 32 14.3 32 32 32 32-14.3 32-32zm128-32c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm-80 112c-35.6 0-88.8 21.3-95.8 61.2-2 11.8 9 21.5 20.5 18.1 31.2-9.6 59.4-15.3 75.3-15.3s44.1 5.7 75.3 15.3c11.4 3.5 22.5-6.3 20.5-18.1-7-39.9-60.2-61.2-95.8-61.2z"]
};
var faFutbol = {
prefix: 'far',
iconName: 'futbol',
icon: [496, 512, [], "f1e3", "M483.8 179.4C449.8 74.6 352.6 8 248.1 8c-25.4 0-51.2 3.9-76.7 12.2C41.2 62.5-30.1 202.4 12.2 332.6 46.2 437.4 143.4 504 247.9 504c25.4 0 51.2-3.9 76.7-12.2 130.2-42.3 201.5-182.2 159.2-312.4zm-74.5 193.7l-52.2 6.4-43.7-60.9 24.4-75.2 71.1-22.1 38.9 36.4c-.2 30.7-7.4 61.1-21.7 89.2-4.7 9.3-10.7 17.8-16.8 26.2zm0-235.4l-10.4 53.1-70.7 22-64.2-46.5V92.5l47.4-26.2c39.2 13 73.4 38 97.9 71.4zM184.9 66.4L232 92.5v73.8l-64.2 46.5-70.6-22-10.1-52.5c24.3-33.4 57.9-58.6 97.8-71.9zM139 379.5L85.9 373c-14.4-20.1-37.3-59.6-37.8-115.3l39-36.4 71.1 22.2 24.3 74.3-43.5 61.7zm48.2 67l-22.4-48.1 43.6-61.7H287l44.3 61.7-22.4 48.1c-6.2 1.8-57.6 20.4-121.7 0z"]
};
var faGem = {
prefix: 'far',
iconName: 'gem',
icon: [576, 512, [], "f3a5", "M464 0H112c-4 0-7.8 2-10 5.4L2 152.6c-2.9 4.4-2.6 10.2.7 14.2l276 340.8c4.8 5.9 13.8 5.9 18.6 0l276-340.8c3.3-4.1 3.6-9.8.7-14.2L474.1 5.4C471.8 2 468.1 0 464 0zm-19.3 48l63.3 96h-68.4l-51.7-96h56.8zm-202.1 0h90.7l51.7 96H191l51.6-96zm-111.3 0h56.8l-51.7 96H68l63.3-96zm-43 144h51.4L208 352 88.3 192zm102.9 0h193.6L288 435.3 191.2 192zM368 352l68.2-160h51.4L368 352z"]
};
var faGrimace = {
prefix: 'far',
iconName: 'grimace',
icon: [496, 512, [], "f57f", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-80-216c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160 0c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm16 16H152c-26.5 0-48 21.5-48 48v32c0 26.5 21.5 48 48 48h192c26.5 0 48-21.5 48-48v-32c0-26.5-21.5-48-48-48zm-168 96h-24c-8.8 0-16-7.2-16-16v-8h40v24zm0-40h-40v-8c0-8.8 7.2-16 16-16h24v24zm64 40h-48v-24h48v24zm0-40h-48v-24h48v24zm64 40h-48v-24h48v24zm0-40h-48v-24h48v24zm56 24c0 8.8-7.2 16-16 16h-24v-24h40v8zm0-24h-40v-24h24c8.8 0 16 7.2 16 16v8z"]
};
var faGrin = {
prefix: 'far',
iconName: 'grin',
icon: [496, 512, [], "f580", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm105.6-151.4c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.4-17.7 15.3 7.9 47.1 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3zM168 240c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160 0c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32z"]
};
var faGrinAlt = {
prefix: 'far',
iconName: 'grin-alt',
icon: [496, 512, [], "f581", "M200.3 248c12.4-18.7 15.1-37.3 15.7-56-.5-18.7-3.3-37.3-15.7-56-8-12-25.1-11.4-32.7 0-12.4 18.7-15.1 37.3-15.7 56 .5 18.7 3.3 37.3 15.7 56 8.1 12 25.2 11.4 32.7 0zm128 0c12.4-18.7 15.1-37.3 15.7-56-.5-18.7-3.3-37.3-15.7-56-8-12-25.1-11.4-32.7 0-12.4 18.7-15.1 37.3-15.7 56 .5 18.7 3.3 37.3 15.7 56 8.1 12 25.2 11.4 32.7 0zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm105.6-151.4c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.3-17.7 15.3 7.9 47.2 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3z"]
};
var faGrinBeam = {
prefix: 'far',
iconName: 'grin-beam',
icon: [496, 512, [], "f582", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm105.6-151.4c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.8-3.1-19.4 5.3-17.7 15.3 7.9 47.1 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3zm-235.9-72.9c3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3zm160 0c3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3z"]
};
var faGrinBeamSweat = {
prefix: 'far',
iconName: 'grin-beam-sweat',
icon: [496, 512, [], "f583", "M440 160c29.5 0 53.3-26.3 53.3-58.7 0-25-31.7-75.5-46.2-97.3-3.6-5.3-10.7-5.3-14.2 0-14.5 21.8-46.2 72.3-46.2 97.3 0 32.4 23.8 58.7 53.3 58.7zM248 400c51.9 0 115.3-32.9 123.3-80 1.7-9.9-7.7-18.5-17.7-15.3-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.8-3.1-19.4 5.3-17.7 15.3 8 47.1 71.4 80 123.3 80zm130.3-168.3c3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3 3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.6 6.2 4.6 9.3 3.7zm105.3-52.9c-24.6 15.7-46 12.9-46.4 12.9 6.9 20.2 10.8 41.8 10.8 64.3 0 110.3-89.7 200-200 200S48 366.3 48 256 137.7 56 248 56c39.8 0 76.8 11.8 108 31.9 1.7-9.5 6.3-24.1 17.2-45.7C336.4 20.6 293.7 8 248 8 111 8 0 119 0 256s111 248 248 248 248-111 248-248c0-27-4.4-52.9-12.4-77.2zM168 189.4c12.3 0 23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3 3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.8 19.2-21.6 31.5-21.6z"]
};
var faGrinHearts = {
prefix: 'far',
iconName: 'grin-hearts',
icon: [496, 512, [], "f584", "M353.6 304.6c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.8-3.1-19.4 5.3-17.7 15.3 7.9 47.2 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3zm-152.8-48.9c4.5 1.2 9.2-1.5 10.5-6l19.4-69.9c5.6-20.3-7.4-41.1-28.8-44.5-18.6-3-36.4 9.8-41.5 27.9l-2 7.1-7.1-1.9c-18.2-4.7-38.2 4.3-44.9 22-7.7 20.2 3.8 41.9 24.2 47.2l70.2 18.1zm188.8-65.3c-6.7-17.6-26.7-26.7-44.9-22l-7.1 1.9-2-7.1c-5-18.1-22.8-30.9-41.5-27.9-21.4 3.4-34.4 24.2-28.8 44.5l19.4 69.9c1.2 4.5 5.9 7.2 10.5 6l70.2-18.2c20.4-5.3 31.9-26.9 24.2-47.1zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200z"]
};
var faGrinSquint = {
prefix: 'far',
iconName: 'grin-squint',
icon: [496, 512, [], "f585", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm105.6-151.4c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.4-17.7 15.3 7.9 47.1 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3zm-234.7-40.8c3.6 4.2 9.9 5.7 15.3 2.5l80-48c3.6-2.2 5.8-6.1 5.8-10.3s-2.2-8.1-5.8-10.3l-80-48c-5.1-3-11.4-1.9-15.3 2.5-3.8 4.5-3.8 11-.1 15.5l33.6 40.3-33.6 40.3c-3.8 4.5-3.7 11.1.1 15.5zm242.9 2.5c5.4 3.2 11.7 1.7 15.3-2.5 3.8-4.5 3.8-11 .1-15.5L343.6 208l33.6-40.3c3.8-4.5 3.7-11-.1-15.5-3.8-4.4-10.2-5.4-15.3-2.5l-80 48c-3.6 2.2-5.8 6.1-5.8 10.3s2.2 8.1 5.8 10.3l80 48z"]
};
var faGrinSquintTears = {
prefix: 'far',
iconName: 'grin-squint-tears',
icon: [512, 512, [], "f586", "M117.1 384.1c-25.8 3.7-84 13.7-100.9 30.6-21.9 21.9-21.5 57.9.9 80.3s58.3 22.8 80.3.9C114.3 479 124.3 420.8 128 395c.8-6.4-4.6-11.8-10.9-10.9zm-41.2-41.7C40.3 268 53 176.1 114.6 114.6 152.4 76.8 202.6 56 256 56c36.2 0 70.8 9.8 101.2 27.7 3.8-20.3 8-36.1 12-48.3C333.8 17.2 294.9 8 256 8 192.5 8 129.1 32.2 80.6 80.6c-74.1 74.1-91.3 183.4-52 274 12.2-4.1 27.7-8.3 47.3-12.2zm352.3-187.6c45 76.6 34.9 176.9-30.8 242.6-37.8 37.8-88 58.6-141.4 58.6-30.5 0-59.8-7-86.4-19.8-3.9 19.5-8 35-12.2 47.2 31.4 13.6 65 20.6 98.7 20.6 63.5 0 126.9-24.2 175.4-72.6 78.1-78.1 93.1-195.4 45.2-288.6-12.3 4-28.2 8.1-48.5 12zm-33.3-26.9c25.8-3.7 84-13.7 100.9-30.6 21.9-21.9 21.5-57.9-.9-80.3s-58.3-22.8-80.3-.9C397.7 33 387.7 91.2 384 117c-.8 6.4 4.6 11.8 10.9 10.9zm-187 108.3c-3-3-7.2-4.2-11.4-3.2L106 255.7c-5.7 1.4-9.5 6.7-9.1 12.6.5 5.8 5.1 10.5 10.9 11l52.3 4.8 4.8 52.3c.5 5.8 5.2 10.4 11 10.9h.9c5.5 0 10.3-3.7 11.7-9.1l22.6-90.5c1-4.2-.2-8.5-3.2-11.5zm39.7-25.1l90.5-22.6c5.7-1.4 9.5-6.7 9.1-12.6-.5-5.8-5.1-10.5-10.9-11l-52.3-4.8-4.8-52.3c-.5-5.8-5.2-10.4-11-10.9-5.6-.1-11.2 3.4-12.6 9.1L233 196.5c-1 4.1.2 8.4 3.2 11.4 5 5 11.3 3.2 11.4 3.2zm52 88.5c-29.1 29.1-59.7 52.9-83.9 65.4-9.2 4.8-10 17.5-1.7 23.4 38.9 27.7 107 6.2 143.7-30.6S416 253 388.3 214.1c-5.8-8.2-18.5-7.6-23.4 1.7-12.3 24.2-36.2 54.7-65.3 83.8z"]
};
var faGrinStars = {
prefix: 'far',
iconName: 'grin-stars',
icon: [496, 512, [], "f587", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm105.6-151.4c-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.8-3.1-19.4 5.3-17.7 15.3 7.9 47.2 71.3 80 123.3 80s115.3-32.9 123.3-80c1.6-9.8-7.7-18.4-17.7-15.3zm-227.9-57.5c-1 6.2 5.4 11 11 7.9l31.3-16.3 31.3 16.3c5.6 3.1 12-1.7 11-7.9l-6-34.9 25.4-24.6c4.5-4.5 1.9-12.2-4.3-13.2l-34.9-5-15.5-31.6c-2.9-5.8-11-5.8-13.9 0l-15.5 31.6-34.9 5c-6.2.9-8.9 8.6-4.3 13.2l25.4 24.6-6.1 34.9zm259.7-72.7l-34.9-5-15.5-31.6c-2.9-5.8-11-5.8-13.9 0l-15.5 31.6-34.9 5c-6.2.9-8.9 8.6-4.3 13.2l25.4 24.6-6 34.9c-1 6.2 5.4 11 11 7.9l31.3-16.3 31.3 16.3c5.6 3.1 12-1.7 11-7.9l-6-34.9 25.4-24.6c4.5-4.6 1.8-12.2-4.4-13.2z"]
};
var faGrinTears = {
prefix: 'far',
iconName: 'grin-tears',
icon: [640, 512, [], "f588", "M117.1 256.1c-25.8 3.7-84 13.7-100.9 30.6-21.9 21.9-21.5 57.9.9 80.3s58.3 22.8 80.3.9C114.3 351 124.3 292.8 128 267c.8-6.4-4.6-11.8-10.9-10.9zm506.7 30.6c-16.9-16.9-75.1-26.9-100.9-30.6-6.3-.9-11.7 4.5-10.8 10.8 3.7 25.8 13.7 84 30.6 100.9 21.9 21.9 57.9 21.5 80.3-.9 22.3-22.3 22.7-58.3.8-80.2zm-126.6 61.7C463.8 412.3 396.9 456 320 456c-76.9 0-143.8-43.7-177.2-107.6-12.5 37.4-25.2 43.9-28.3 46.5C159.1 460.7 234.5 504 320 504s160.9-43.3 205.5-109.1c-3.2-2.7-15.9-9.2-28.3-46.5zM122.7 224.5C137.9 129.2 220.5 56 320 56c99.5 0 182.1 73.2 197.3 168.5 2.1-.2 5.2-2.4 49.5 7C554.4 106 448.7 8 320 8S85.6 106 73.2 231.4c44.5-9.4 47.1-7.2 49.5-6.9zM320 400c51.9 0 115.3-32.9 123.3-80 1.7-9.9-7.7-18.5-17.7-15.3-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.8-3.1-19.4 5.3-17.7 15.3 8 47.1 71.4 80 123.3 80zm130.3-168.3c3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3 3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.6 6.2 4.6 9.3 3.7zM240 189.4c12.3 0 23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3 3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.8 19.2-21.6 31.5-21.6z"]
};
var faGrinTongue = {
prefix: 'far',
iconName: 'grin-tongue',
icon: [496, 512, [], "f589", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm64 400c0 35.6-29.1 64.5-64.9 64-35.1-.5-63.1-29.8-63.1-65v-42.8l17.7-8.8c15-7.5 31.5 1.7 34.9 16.5l2.8 12.1c2.1 9.2 15.2 9.2 17.3 0l2.8-12.1c3.4-14.8 19.8-24.1 34.9-16.5l17.7 8.8V408zm28.2 25.3c2.2-8.1 3.8-16.5 3.8-25.3v-43.5c14.2-12.4 24.4-27.5 27.3-44.5 1.7-9.9-7.7-18.5-17.7-15.3-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.3-17.7 15.3 2.9 17 13.1 32.1 27.3 44.5V408c0 8.8 1.6 17.2 3.8 25.3C91.8 399.9 48 333 48 256c0-110.3 89.7-200 200-200s200 89.7 200 200c0 77-43.8 143.9-107.8 177.3zM168 176c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm160 0c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32z"]
};
var faGrinTongueSquint = {
prefix: 'far',
iconName: 'grin-tongue-squint',
icon: [496, 512, [], "f58a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm64 400c0 35.6-29.1 64.5-64.9 64-35.1-.5-63.1-29.8-63.1-65v-42.8l17.7-8.8c15-7.5 31.5 1.7 34.9 16.5l2.8 12.1c2.1 9.2 15.2 9.2 17.3 0l2.8-12.1c3.4-14.8 19.8-24.1 34.9-16.5l17.7 8.8V408zm28.2 25.3c2.2-8.1 3.8-16.5 3.8-25.3v-43.5c14.2-12.4 24.4-27.5 27.3-44.5 1.7-9.9-7.7-18.5-17.7-15.3-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.3-17.7 15.3 2.9 17 13.1 32.1 27.3 44.5V408c0 8.8 1.6 17.2 3.8 25.3C91.8 399.9 48 333 48 256c0-110.3 89.7-200 200-200s200 89.7 200 200c0 77-43.8 143.9-107.8 177.3zm36.9-281.1c-3.8-4.4-10.3-5.5-15.3-2.5l-80 48c-3.6 2.2-5.8 6.1-5.8 10.3s2.2 8.1 5.8 10.3l80 48c5.4 3.2 11.7 1.7 15.3-2.5 3.8-4.5 3.8-11 .1-15.5L343.6 208l33.6-40.3c3.8-4.5 3.7-11.1-.1-15.5zm-162.9 45.5l-80-48c-5-3-11.4-2-15.3 2.5-3.8 4.5-3.8 11-.1 15.5l33.6 40.3-33.6 40.3c-3.8 4.5-3.7 11 .1 15.5 3.6 4.2 9.9 5.7 15.3 2.5l80-48c3.6-2.2 5.8-6.1 5.8-10.3s-2.2-8.1-5.8-10.3z"]
};
var faGrinTongueWink = {
prefix: 'far',
iconName: 'grin-tongue-wink',
icon: [496, 512, [], "f58b", "M152 180c-25.7 0-55.9 16.9-59.8 42.1-.8 5 1.7 10 6.1 12.4 4.4 2.4 9.9 1.8 13.7-1.6l9.5-8.5c14.8-13.2 46.2-13.2 61 0l9.5 8.5c2.5 2.2 8 4.7 13.7 1.6 4.4-2.4 6.9-7.4 6.1-12.4-3.9-25.2-34.1-42.1-59.8-42.1zm176-52c-44.2 0-80 35.8-80 80s35.8 80 80 80 80-35.8 80-80-35.8-80-80-80zm0 128c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm0-72c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm64 400c0 35.6-29.1 64.5-64.9 64-35.1-.5-63.1-29.8-63.1-65v-42.8l17.7-8.8c15-7.5 31.5 1.7 34.9 16.5l2.8 12.1c2.1 9.2 15.2 9.2 17.3 0l2.8-12.1c3.4-14.8 19.8-24.1 34.9-16.5l17.7 8.8V408zm28.2 25.3c2.2-8.1 3.8-16.5 3.8-25.3v-43.5c14.2-12.4 24.4-27.5 27.3-44.5 1.7-9.9-7.7-18.5-17.7-15.3-25.9 8.3-64.4 13.1-105.6 13.1s-79.6-4.8-105.6-13.1c-9.9-3.1-19.4 5.3-17.7 15.3 2.9 17 13.1 32.1 27.3 44.5V408c0 8.8 1.6 17.2 3.8 25.3C91.8 399.9 48 333 48 256c0-110.3 89.7-200 200-200s200 89.7 200 200c0 77-43.8 143.9-107.8 177.3z"]
};
var faGrinWink = {
prefix: 'far',
iconName: 'grin-wink',
icon: [496, 512, [], "f58c", "M328 180c-25.69 0-55.88 16.92-59.86 42.12-1.75 11.22 11.5 18.24 19.83 10.84l9.55-8.48c14.81-13.19 46.16-13.19 60.97 0l9.55 8.48c8.48 7.43 21.56.25 19.83-10.84C383.88 196.92 353.69 180 328 180zm-160 60c17.67 0 32-14.33 32-32s-14.33-32-32-32-32 14.33-32 32 14.33 32 32 32zm185.55 64.64c-25.93 8.3-64.4 13.06-105.55 13.06s-79.62-4.75-105.55-13.06c-9.94-3.13-19.4 5.37-17.71 15.34C132.67 367.13 196.06 400 248 400s115.33-32.87 123.26-80.02c1.68-9.89-7.67-18.48-17.71-15.34zM248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm0 448c-110.28 0-200-89.72-200-200S137.72 56 248 56s200 89.72 200 200-89.72 200-200 200z"]
};
var faHandLizard = {
prefix: 'far',
iconName: 'hand-lizard',
icon: [576, 512, [], "f258", "M556.686 290.542L410.328 64.829C397.001 44.272 374.417 32 349.917 32H56C25.121 32 0 57.122 0 88v8c0 44.112 35.888 80 80 80h196.042l-18.333 48H144c-48.523 0-88 39.477-88 88 0 30.879 25.121 56 56 56h131.552c2.987 0 5.914.549 8.697 1.631L352 408.418V480h224V355.829c0-23.225-6.679-45.801-19.314-65.287zM528 432H400v-23.582c0-19.948-12.014-37.508-30.604-44.736l-99.751-38.788A71.733 71.733 0 0 0 243.552 320H112c-4.411 0-8-3.589-8-8 0-22.056 17.944-40 40-40h113.709c19.767 0 37.786-12.407 44.84-30.873l24.552-64.281c8.996-23.553-8.428-48.846-33.63-48.846H80c-17.645 0-32-14.355-32-32v-8c0-4.411 3.589-8 8-8h293.917c8.166 0 15.693 4.09 20.137 10.942l146.358 225.715A71.84 71.84 0 0 1 528 355.829V432z"]
};
var faHandPaper = {
prefix: 'far',
iconName: 'hand-paper',
icon: [448, 512, [], "f256", "M372.57 112.641v-10.825c0-43.612-40.52-76.691-83.039-65.546-25.629-49.5-94.09-47.45-117.982.747C130.269 26.456 89.144 57.945 89.144 102v126.13c-19.953-7.427-43.308-5.068-62.083 8.871-29.355 21.796-35.794 63.333-14.55 93.153L132.48 498.569a32 32 0 0 0 26.062 13.432h222.897c14.904 0 27.835-10.289 31.182-24.813l30.184-130.958A203.637 203.637 0 0 0 448 310.564V179c0-40.62-35.523-71.992-75.43-66.359zm27.427 197.922c0 11.731-1.334 23.469-3.965 34.886L368.707 464h-201.92L51.591 302.303c-14.439-20.27 15.023-42.776 29.394-22.605l27.128 38.079c8.995 12.626 29.031 6.287 29.031-9.283V102c0-25.645 36.571-24.81 36.571.691V256c0 8.837 7.163 16 16 16h6.856c8.837 0 16-7.163 16-16V67c0-25.663 36.571-24.81 36.571.691V256c0 8.837 7.163 16 16 16h6.856c8.837 0 16-7.163 16-16V101.125c0-25.672 36.57-24.81 36.57.691V256c0 8.837 7.163 16 16 16h6.857c8.837 0 16-7.163 16-16v-76.309c0-26.242 36.57-25.64 36.57-.691v131.563z"]
};
var faHandPeace = {
prefix: 'far',
iconName: 'hand-peace',
icon: [448, 512, [], "f25b", "M362.146 191.976c-13.71-21.649-38.761-34.016-65.006-30.341V74c0-40.804-32.811-74-73.141-74-40.33 0-73.14 33.196-73.14 74L160 168l-18.679-78.85C126.578 50.843 83.85 32.11 46.209 47.208 8.735 62.238-9.571 104.963 5.008 142.85l55.757 144.927c-30.557 24.956-43.994 57.809-24.733 92.218l54.853 97.999C102.625 498.97 124.73 512 148.575 512h205.702c30.744 0 57.558-21.44 64.555-51.797l27.427-118.999a67.801 67.801 0 0 0 1.729-15.203L448 256c0-44.956-43.263-77.343-85.854-64.024zM399.987 326c0 1.488-.169 2.977-.502 4.423l-27.427 119.001c-1.978 8.582-9.29 14.576-17.782 14.576H148.575c-6.486 0-12.542-3.621-15.805-9.449l-54.854-98c-4.557-8.141-2.619-18.668 4.508-24.488l26.647-21.764a16 16 0 0 0 4.812-18.139l-64.09-166.549C37.226 92.956 84.37 74.837 96.51 106.389l59.784 155.357A16 16 0 0 0 171.227 272h11.632c8.837 0 16-7.163 16-16V74c0-34.375 50.281-34.43 50.281 0v182c0 8.837 7.163 16 16 16h6.856c8.837 0 16-7.163 16-16v-28c0-25.122 36.567-25.159 36.567 0v28c0 8.837 7.163 16 16 16h6.856c8.837 0 16-7.163 16-16 0-25.12 36.567-25.16 36.567 0v70z"]
};
var faHandPointDown = {
prefix: 'far',
iconName: 'hand-point-down',
icon: [448, 512, [], "f0a7", "M188.8 512c45.616 0 83.2-37.765 83.2-83.2v-35.647a93.148 93.148 0 0 0 22.064-7.929c22.006 2.507 44.978-3.503 62.791-15.985C409.342 368.1 448 331.841 448 269.299V248c0-60.063-40-98.512-40-127.2v-2.679c4.952-5.747 8-13.536 8-22.12V32c0-17.673-12.894-32-28.8-32H156.8C140.894 0 128 14.327 128 32v64c0 8.584 3.048 16.373 8 22.12v2.679c0 6.964-6.193 14.862-23.668 30.183l-.148.129-.146.131c-9.937 8.856-20.841 18.116-33.253 25.851C48.537 195.798 0 207.486 0 252.8c0 56.928 35.286 92 83.2 92 8.026 0 15.489-.814 22.4-2.176V428.8c0 45.099 38.101 83.2 83.2 83.2zm0-48c-18.7 0-35.2-16.775-35.2-35.2V270.4c-17.325 0-35.2 26.4-70.4 26.4-26.4 0-35.2-20.625-35.2-44 0-8.794 32.712-20.445 56.1-34.926 14.575-9.074 27.225-19.524 39.875-30.799 18.374-16.109 36.633-33.836 39.596-59.075h176.752C364.087 170.79 400 202.509 400 248v21.299c0 40.524-22.197 57.124-61.325 50.601-8.001 14.612-33.979 24.151-53.625 12.925-18.225 19.365-46.381 17.787-61.05 4.95V428.8c0 18.975-16.225 35.2-35.2 35.2zM328 64c0-13.255 10.745-24 24-24s24 10.745 24 24-10.745 24-24 24-24-10.745-24-24z"]
};
var faHandPointLeft = {
prefix: 'far',
iconName: 'hand-point-left',
icon: [512, 512, [], "f0a5", "M0 220.8C0 266.416 37.765 304 83.2 304h35.647a93.148 93.148 0 0 0 7.929 22.064c-2.507 22.006 3.503 44.978 15.985 62.791C143.9 441.342 180.159 480 242.701 480H264c60.063 0 98.512-40 127.2-40h2.679c5.747 4.952 13.536 8 22.12 8h64c17.673 0 32-12.894 32-28.8V188.8c0-15.906-14.327-28.8-32-28.8h-64c-8.584 0-16.373 3.048-22.12 8H391.2c-6.964 0-14.862-6.193-30.183-23.668l-.129-.148-.131-.146c-8.856-9.937-18.116-20.841-25.851-33.253C316.202 80.537 304.514 32 259.2 32c-56.928 0-92 35.286-92 83.2 0 8.026.814 15.489 2.176 22.4H83.2C38.101 137.6 0 175.701 0 220.8zm48 0c0-18.7 16.775-35.2 35.2-35.2h158.4c0-17.325-26.4-35.2-26.4-70.4 0-26.4 20.625-35.2 44-35.2 8.794 0 20.445 32.712 34.926 56.1 9.074 14.575 19.524 27.225 30.799 39.875 16.109 18.374 33.836 36.633 59.075 39.596v176.752C341.21 396.087 309.491 432 264 432h-21.299c-40.524 0-57.124-22.197-50.601-61.325-14.612-8.001-24.151-33.979-12.925-53.625-19.365-18.225-17.787-46.381-4.95-61.05H83.2C64.225 256 48 239.775 48 220.8zM448 360c13.255 0 24 10.745 24 24s-10.745 24-24 24-24-10.745-24-24 10.745-24 24-24z"]
};
var faHandPointRight = {
prefix: 'far',
iconName: 'hand-point-right',
icon: [512, 512, [], "f0a4", "M428.8 137.6h-86.177a115.52 115.52 0 0 0 2.176-22.4c0-47.914-35.072-83.2-92-83.2-45.314 0-57.002 48.537-75.707 78.784-7.735 12.413-16.994 23.317-25.851 33.253l-.131.146-.129.148C135.662 161.807 127.764 168 120.8 168h-2.679c-5.747-4.952-13.536-8-22.12-8H32c-17.673 0-32 12.894-32 28.8v230.4C0 435.106 14.327 448 32 448h64c8.584 0 16.373-3.048 22.12-8h2.679c28.688 0 67.137 40 127.2 40h21.299c62.542 0 98.8-38.658 99.94-91.145 12.482-17.813 18.491-40.785 15.985-62.791A93.148 93.148 0 0 0 393.152 304H428.8c45.435 0 83.2-37.584 83.2-83.2 0-45.099-38.101-83.2-83.2-83.2zm0 118.4h-91.026c12.837 14.669 14.415 42.825-4.95 61.05 11.227 19.646 1.687 45.624-12.925 53.625 6.524 39.128-10.076 61.325-50.6 61.325H248c-45.491 0-77.21-35.913-120-39.676V215.571c25.239-2.964 42.966-21.222 59.075-39.596 11.275-12.65 21.725-25.3 30.799-39.875C232.355 112.712 244.006 80 252.8 80c23.375 0 44 8.8 44 35.2 0 35.2-26.4 53.075-26.4 70.4h158.4c18.425 0 35.2 16.5 35.2 35.2 0 18.975-16.225 35.2-35.2 35.2zM88 384c0 13.255-10.745 24-24 24s-24-10.745-24-24 10.745-24 24-24 24 10.745 24 24z"]
};
var faHandPointUp = {
prefix: 'far',
iconName: 'hand-point-up',
icon: [448, 512, [], "f0a6", "M105.6 83.2v86.177a115.52 115.52 0 0 0-22.4-2.176c-47.914 0-83.2 35.072-83.2 92 0 45.314 48.537 57.002 78.784 75.707 12.413 7.735 23.317 16.994 33.253 25.851l.146.131.148.129C129.807 376.338 136 384.236 136 391.2v2.679c-4.952 5.747-8 13.536-8 22.12v64c0 17.673 12.894 32 28.8 32h230.4c15.906 0 28.8-14.327 28.8-32v-64c0-8.584-3.048-16.373-8-22.12V391.2c0-28.688 40-67.137 40-127.2v-21.299c0-62.542-38.658-98.8-91.145-99.94-17.813-12.482-40.785-18.491-62.791-15.985A93.148 93.148 0 0 0 272 118.847V83.2C272 37.765 234.416 0 188.8 0c-45.099 0-83.2 38.101-83.2 83.2zm118.4 0v91.026c14.669-12.837 42.825-14.415 61.05 4.95 19.646-11.227 45.624-1.687 53.625 12.925 39.128-6.524 61.325 10.076 61.325 50.6V264c0 45.491-35.913 77.21-39.676 120H183.571c-2.964-25.239-21.222-42.966-39.596-59.075-12.65-11.275-25.3-21.725-39.875-30.799C80.712 279.645 48 267.994 48 259.2c0-23.375 8.8-44 35.2-44 35.2 0 53.075 26.4 70.4 26.4V83.2c0-18.425 16.5-35.2 35.2-35.2 18.975 0 35.2 16.225 35.2 35.2zM352 424c13.255 0 24 10.745 24 24s-10.745 24-24 24-24-10.745-24-24 10.745-24 24-24z"]
};
var faHandPointer = {
prefix: 'far',
iconName: 'hand-pointer',
icon: [448, 512, [], "f25a", "M358.182 179.361c-19.493-24.768-52.679-31.945-79.872-19.098-15.127-15.687-36.182-22.487-56.595-19.629V67c0-36.944-29.736-67-66.286-67S89.143 30.056 89.143 67v161.129c-19.909-7.41-43.272-5.094-62.083 8.872-29.355 21.795-35.793 63.333-14.55 93.152l109.699 154.001C134.632 501.59 154.741 512 176 512h178.286c30.802 0 57.574-21.5 64.557-51.797l27.429-118.999A67.873 67.873 0 0 0 448 326v-84c0-46.844-46.625-79.273-89.818-62.639zM80.985 279.697l27.126 38.079c8.995 12.626 29.031 6.287 29.031-9.283V67c0-25.12 36.571-25.16 36.571 0v175c0 8.836 7.163 16 16 16h6.857c8.837 0 16-7.164 16-16v-35c0-25.12 36.571-25.16 36.571 0v35c0 8.836 7.163 16 16 16H272c8.837 0 16-7.164 16-16v-21c0-25.12 36.571-25.16 36.571 0v21c0 8.836 7.163 16 16 16h6.857c8.837 0 16-7.164 16-16 0-25.121 36.571-25.16 36.571 0v84c0 1.488-.169 2.977-.502 4.423l-27.43 119.001c-1.978 8.582-9.29 14.576-17.782 14.576H176c-5.769 0-11.263-2.878-14.697-7.697l-109.712-154c-14.406-20.223 14.994-42.818 29.394-22.606zM176.143 400v-96c0-8.837 6.268-16 14-16h6c7.732 0 14 7.163 14 16v96c0 8.837-6.268 16-14 16h-6c-7.733 0-14-7.163-14-16zm75.428 0v-96c0-8.837 6.268-16 14-16h6c7.732 0 14 7.163 14 16v96c0 8.837-6.268 16-14 16h-6c-7.732 0-14-7.163-14-16zM327 400v-96c0-8.837 6.268-16 14-16h6c7.732 0 14 7.163 14 16v96c0 8.837-6.268 16-14 16h-6c-7.732 0-14-7.163-14-16z"]
};
var faHandRock = {
prefix: 'far',
iconName: 'hand-rock',
icon: [512, 512, [], "f255", "M408.864 79.052c-22.401-33.898-66.108-42.273-98.813-23.588-29.474-31.469-79.145-31.093-108.334-.022-47.16-27.02-108.71 5.055-110.671 60.806C44.846 105.407 0 140.001 0 187.429v56.953c0 32.741 14.28 63.954 39.18 85.634l97.71 85.081c4.252 3.702 3.11 5.573 3.11 32.903 0 17.673 14.327 32 32 32h252c17.673 0 32-14.327 32-32 0-23.513-1.015-30.745 3.982-42.37l42.835-99.656c6.094-14.177 9.183-29.172 9.183-44.568V146.963c0-52.839-54.314-88.662-103.136-67.911zM464 261.406a64.505 64.505 0 0 1-5.282 25.613l-42.835 99.655c-5.23 12.171-7.883 25.04-7.883 38.25V432H188v-10.286c0-16.37-7.14-31.977-19.59-42.817l-97.71-85.08C56.274 281.255 48 263.236 48 244.381v-56.953c0-33.208 52-33.537 52 .677v41.228a16 16 0 0 0 5.493 12.067l7 6.095A16 16 0 0 0 139 235.429V118.857c0-33.097 52-33.725 52 .677v26.751c0 8.836 7.164 16 16 16h7c8.836 0 16-7.164 16-16v-41.143c0-33.134 52-33.675 52 .677v40.466c0 8.836 7.163 16 16 16h7c8.837 0 16-7.164 16-16v-27.429c0-33.03 52-33.78 52 .677v26.751c0 8.836 7.163 16 16 16h7c8.837 0 16-7.164 16-16 0-33.146 52-33.613 52 .677v114.445z"]
};
var faHandScissors = {
prefix: 'far',
iconName: 'hand-scissors',
icon: [512, 512, [], "f257", "M256 480l70-.013c5.114 0 10.231-.583 15.203-1.729l118.999-27.427C490.56 443.835 512 417.02 512 386.277V180.575c0-23.845-13.03-45.951-34.005-57.69l-97.999-54.853c-34.409-19.261-67.263-5.824-92.218 24.733L142.85 37.008c-37.887-14.579-80.612 3.727-95.642 41.201-15.098 37.642 3.635 80.37 41.942 95.112L168 192l-94-9.141c-40.804 0-74 32.811-74 73.14 0 40.33 33.196 73.141 74 73.141h87.635c-3.675 26.245 8.692 51.297 30.341 65.006C178.657 436.737 211.044 480 256 480zm0-48.013c-25.16 0-25.12-36.567 0-36.567 8.837 0 16-7.163 16-16v-6.856c0-8.837-7.163-16-16-16h-28c-25.159 0-25.122-36.567 0-36.567h28c8.837 0 16-7.163 16-16v-6.856c0-8.837-7.163-16-16-16H74c-34.43 0-34.375-50.281 0-50.281h182c8.837 0 16-7.163 16-16v-11.632a16 16 0 0 0-10.254-14.933L106.389 128.51c-31.552-12.14-13.432-59.283 19.222-46.717l166.549 64.091a16.001 16.001 0 0 0 18.139-4.812l21.764-26.647c5.82-7.127 16.348-9.064 24.488-4.508l98 54.854c5.828 3.263 9.449 9.318 9.449 15.805v205.701c0 8.491-5.994 15.804-14.576 17.782l-119.001 27.427a19.743 19.743 0 0 1-4.423.502h-70z"]
};
var faHandSpock = {
prefix: 'far',
iconName: 'hand-spock',
icon: [512, 512, [], "f259", "M501.03053,116.17605c-19.39059-31.50779-51.24406-35.72849-66.31044-35.01756-14.11325-50.81051-62.0038-54.08-70.73816-54.08a74.03091,74.03091,0,0,0-72.23816,58.916l-4.64648,22.66014-13.68357-53.207c-9.09569-35.37107-46.412-64.05074-89.66-53.07223a73.89749,73.89749,0,0,0-55.121,78.94722,73.68273,73.68273,0,0,0-64.8495,94.42181l24.35933,82.19721c-38.24017-7.54492-62.79677,16.18358-68.11512,21.84764a73.6791,73.6791,0,0,0,3.19921,104.19329l91.36509,85.9765A154.164,154.164,0,0,0,220.62279,512h107.4549A127.30079,127.30079,0,0,0,452.3392,413.86139l57.623-241.96272A73.20274,73.20274,0,0,0,501.03053,116.17605Zm-37.7597,44.60544L405.64788,402.74812a79.46616,79.46616,0,0,1-77.57019,61.25972H220.62279a106.34052,106.34052,0,0,1-73.1366-28.998l-91.369-85.98041C31.34381,325.72669,66.61133,288.131,91.39644,311.5392l51.123,48.10739c5.42577,5.10937,13.48239.71679,13.48239-5.82617a246.79914,246.79914,0,0,0-10.17771-70.1523l-36.01362-121.539c-9.7324-32.88279,39.69916-47.27145,49.38664-14.625l31.3437,105.77923c5.59374,18.90428,33.78119,10.71288,28.9648-8.00781L177.06427,80.23662c-8.50389-33.1035,41.43157-45.64646,49.86515-12.83593l47.32609,184.035c4.42773,17.24218,29.16207,16.5039,32.71089-.80468l31.791-154.9706c6.81054-33.1074,57.51748-24.10741,50.11906,11.96288L360.32764,246.78924c-3.72265,18.10936,23.66793,24.63084,28.05659,6.21679L413.185,148.85962C421.1498,115.512,471.14,127.79713,463.27083,160.78149Z"]
};
var faHandshake = {
prefix: 'far',
iconName: 'handshake',
icon: [640, 512, [], "f2b5", "M519.2 127.9l-47.6-47.6A56.252 56.252 0 0 0 432 64H205.2c-14.8 0-29.1 5.9-39.6 16.3L118 127.9H0v255.7h64c17.6 0 31.8-14.2 31.9-31.7h9.1l84.6 76.4c30.9 25.1 73.8 25.7 105.6 3.8 12.5 10.8 26 15.9 41.1 15.9 18.2 0 35.3-7.4 48.8-24 22.1 8.7 48.2 2.6 64-16.8l26.2-32.3c5.6-6.9 9.1-14.8 10.9-23h57.9c.1 17.5 14.4 31.7 31.9 31.7h64V127.9H519.2zM48 351.6c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16c0 8.9-7.2 16-16 16zm390-6.9l-26.1 32.2c-2.8 3.4-7.8 4-11.3 1.2l-23.9-19.4-30 36.5c-6 7.3-15 4.8-18 2.4l-36.8-31.5-15.6 19.2c-13.9 17.1-39.2 19.7-55.3 6.6l-97.3-88H96V175.8h41.9l61.7-61.6c2-.8 3.7-1.5 5.7-2.3H262l-38.7 35.5c-29.4 26.9-31.1 72.3-4.4 101.3 14.8 16.2 61.2 41.2 101.5 4.4l8.2-7.5 108.2 87.8c3.4 2.8 3.9 7.9 1.2 11.3zm106-40.8h-69.2c-2.3-2.8-4.9-5.4-7.7-7.7l-102.7-83.4 12.5-11.4c6.5-6 7-16.1 1-22.6L367 167.1c-6-6.5-16.1-6.9-22.6-1l-55.2 50.6c-9.5 8.7-25.7 9.4-34.6 0-9.3-9.9-8.5-25.1 1.2-33.9l65.6-60.1c7.4-6.8 17-10.5 27-10.5l83.7-.2c2.1 0 4.1.8 5.5 2.3l61.7 61.6H544v128zm48 47.7c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16c0 8.9-7.2 16-16 16z"]
};
var faHdd = {
prefix: 'far',
iconName: 'hdd',
icon: [576, 512, [], "f0a0", "M567.403 235.642L462.323 84.589A48 48 0 0 0 422.919 64H153.081a48 48 0 0 0-39.404 20.589L8.597 235.642A48.001 48.001 0 0 0 0 263.054V400c0 26.51 21.49 48 48 48h480c26.51 0 48-21.49 48-48V263.054c0-9.801-3-19.366-8.597-27.412zM153.081 112h269.838l77.913 112H75.168l77.913-112zM528 400H48V272h480v128zm-32-64c0 17.673-14.327 32-32 32s-32-14.327-32-32 14.327-32 32-32 32 14.327 32 32zm-96 0c0 17.673-14.327 32-32 32s-32-14.327-32-32 14.327-32 32-32 32 14.327 32 32z"]
};
var faHeart = {
prefix: 'far',
iconName: 'heart',
icon: [512, 512, [], "f004", "M458.4 64.3C400.6 15.7 311.3 23 256 79.3 200.7 23 111.4 15.6 53.6 64.3-21.6 127.6-10.6 230.8 43 285.5l175.4 178.7c10 10.2 23.4 15.9 37.6 15.9 14.3 0 27.6-5.6 37.6-15.8L469 285.6c53.5-54.7 64.7-157.9-10.6-221.3zm-23.6 187.5L259.4 430.5c-2.4 2.4-4.4 2.4-6.8 0L77.2 251.8c-36.5-37.2-43.9-107.6 7.3-150.7 38.9-32.7 98.9-27.8 136.5 10.5l35 35.7 35-35.7c37.8-38.5 97.8-43.2 136.5-10.6 51.1 43.1 43.5 113.9 7.3 150.8z"]
};
var faHospital = {
prefix: 'far',
iconName: 'hospital',
icon: [448, 512, [], "f0f8", "M128 244v-40c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12zm140 12h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12zm-76 84v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm76 12h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12zm180 124v36H0v-36c0-6.627 5.373-12 12-12h19.5V85.035C31.5 73.418 42.245 64 55.5 64H144V24c0-13.255 10.745-24 24-24h112c13.255 0 24 10.745 24 24v40h88.5c13.255 0 24 9.418 24 21.035V464H436c6.627 0 12 5.373 12 12zM79.5 463H192v-67c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v67h112.5V112H304v24c0 13.255-10.745 24-24 24H168c-13.255 0-24-10.745-24-24v-24H79.5v351zM266 64h-26V38a6 6 0 0 0-6-6h-20a6 6 0 0 0-6 6v26h-26a6 6 0 0 0-6 6v20a6 6 0 0 0 6 6h26v26a6 6 0 0 0 6 6h20a6 6 0 0 0 6-6V96h26a6 6 0 0 0 6-6V70a6 6 0 0 0-6-6z"]
};
var faHourglass = {
prefix: 'far',
iconName: 'hourglass',
icon: [384, 512, [], "f254", "M368 48h4c6.627 0 12-5.373 12-12V12c0-6.627-5.373-12-12-12H12C5.373 0 0 5.373 0 12v24c0 6.627 5.373 12 12 12h4c0 80.564 32.188 165.807 97.18 208C47.899 298.381 16 383.9 16 464h-4c-6.627 0-12 5.373-12 12v24c0 6.627 5.373 12 12 12h360c6.627 0 12-5.373 12-12v-24c0-6.627-5.373-12-12-12h-4c0-80.564-32.188-165.807-97.18-208C336.102 213.619 368 128.1 368 48zM64 48h256c0 101.62-57.307 184-128 184S64 149.621 64 48zm256 416H64c0-101.62 57.308-184 128-184s128 82.38 128 184z"]
};
var faIdBadge = {
prefix: 'far',
iconName: 'id-badge',
icon: [384, 512, [], "f2c1", "M336 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zm0 464H48V48h288v416zM144 112h96c8.8 0 16-7.2 16-16s-7.2-16-16-16h-96c-8.8 0-16 7.2-16 16s7.2 16 16 16zm48 176c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm-89.6 128h179.2c12.4 0 22.4-8.6 22.4-19.2v-19.2c0-31.8-30.1-57.6-67.2-57.6-10.8 0-18.7 8-44.8 8-26.9 0-33.4-8-44.8-8-37.1 0-67.2 25.8-67.2 57.6v19.2c0 10.6 10 19.2 22.4 19.2z"]
};
var faIdCard = {
prefix: 'far',
iconName: 'id-card',
icon: [576, 512, [], "f2c2", "M528 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm0 400H303.2c.9-4.5.8 3.6.8-22.4 0-31.8-30.1-57.6-67.2-57.6-10.8 0-18.7 8-44.8 8-26.9 0-33.4-8-44.8-8-37.1 0-67.2 25.8-67.2 57.6 0 26-.2 17.9.8 22.4H48V144h480v288zm-168-80h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm0-64h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm0-64h112c4.4 0 8-3.6 8-8v-16c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm-168 96c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64z"]
};
var faImage = {
prefix: 'far',
iconName: 'image',
icon: [512, 512, [], "f03e", "M464 64H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V112c0-26.51-21.49-48-48-48zm-6 336H54a6 6 0 0 1-6-6V118a6 6 0 0 1 6-6h404a6 6 0 0 1 6 6v276a6 6 0 0 1-6 6zM128 152c-22.091 0-40 17.909-40 40s17.909 40 40 40 40-17.909 40-40-17.909-40-40-40zM96 352h320v-80l-87.515-87.515c-4.686-4.686-12.284-4.686-16.971 0L192 304l-39.515-39.515c-4.686-4.686-12.284-4.686-16.971 0L96 304v48z"]
};
var faImages = {
prefix: 'far',
iconName: 'images',
icon: [576, 512, [], "f302", "M480 416v16c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V176c0-26.51 21.49-48 48-48h16v48H54a6 6 0 0 0-6 6v244a6 6 0 0 0 6 6h372a6 6 0 0 0 6-6v-10h48zm42-336H150a6 6 0 0 0-6 6v244a6 6 0 0 0 6 6h372a6 6 0 0 0 6-6V86a6 6 0 0 0-6-6zm6-48c26.51 0 48 21.49 48 48v256c0 26.51-21.49 48-48 48H144c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h384zM264 144c0 22.091-17.909 40-40 40s-40-17.909-40-40 17.909-40 40-40 40 17.909 40 40zm-72 96l39.515-39.515c4.686-4.686 12.284-4.686 16.971 0L288 240l103.515-103.515c4.686-4.686 12.284-4.686 16.971 0L480 208v80H192v-48z"]
};
var faKeyboard = {
prefix: 'far',
iconName: 'keyboard',
icon: [576, 512, [], "f11c", "M528 64H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h480c26.51 0 48-21.49 48-48V112c0-26.51-21.49-48-48-48zm8 336c0 4.411-3.589 8-8 8H48c-4.411 0-8-3.589-8-8V112c0-4.411 3.589-8 8-8h480c4.411 0 8 3.589 8 8v288zM170 270v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm-336 82v-28c0-6.627-5.373-12-12-12H82c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm384 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zM122 188v-28c0-6.627-5.373-12-12-12H82c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm96 0v-28c0-6.627-5.373-12-12-12h-28c-6.627 0-12 5.373-12 12v28c0 6.627 5.373 12 12 12h28c6.627 0 12-5.373 12-12zm-98 158v-16c0-6.627-5.373-12-12-12H180c-6.627 0-12 5.373-12 12v16c0 6.627 5.373 12 12 12h216c6.627 0 12-5.373 12-12z"]
};
var faKiss = {
prefix: 'far',
iconName: 'kiss',
icon: [496, 512, [], "f596", "M168 176c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm136 132c0-19.2-28.8-41.5-71.5-44-3.8-.4-7.4 2.4-8.2 6.2-.9 3.8 1.1 7.7 4.7 9.2l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-5.7 2.4-6 12.2 0 14.8l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-3.6 1.5-5.6 5.4-4.7 9.2.8 3.6 4.1 6.2 7.8 6.2h.5c42.8-2.5 71.5-24.8 71.5-44 0-13-13.4-27.3-35.2-36C290.6 335.3 304 321 304 308zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm80-280c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32z"]
};
var faKissBeam = {
prefix: 'far',
iconName: 'kiss-beam',
icon: [496, 512, [], "f597", "M168 152c-23.8 0-52.7 29.3-56 71.4-.3 3.7 2 7.2 5.6 8.3 3.5 1 7.5-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 5.9-4.5 5.6-8.3-3.1-42.1-32-71.4-55.8-71.4zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm56-148c0-19.2-28.8-41.5-71.5-44-3.8-.4-7.4 2.4-8.2 6.2-.9 3.8 1.1 7.7 4.7 9.2l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-5.7 2.4-6 12.2 0 14.8l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-3.6 1.5-5.6 5.4-4.7 9.2.8 3.6 4.1 6.2 7.8 6.2h.5c42.8-2.5 71.5-24.8 71.5-44 0-13-13.4-27.3-35.2-36C290.6 335.3 304 321 304 308zm24-156c-23.8 0-52.7 29.3-56 71.4-.3 3.7 2 7.2 5.6 8.3 3.5 1 7.5-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 5.9-4.5 5.6-8.3-3.1-42.1-32-71.4-55.8-71.4z"]
};
var faKissWinkHeart = {
prefix: 'far',
iconName: 'kiss-wink-heart',
icon: [504, 512, [], "f598", "M304 308.5c0-19.2-28.8-41.5-71.5-44-3.8-.4-7.4 2.4-8.2 6.2-.9 3.8 1.1 7.7 4.7 9.2l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-5.7 2.4-6 12.2 0 14.8l16.9 7.2c13 5.5 20.8 13.5 20.8 21.5s-7.8 16-20.7 21.5l-17 7.2c-3.6 1.5-5.6 5.4-4.7 9.2.8 3.6 4.1 6.2 7.8 6.2h.5c42.8-2.5 71.5-24.8 71.5-44 0-13-13.4-27.3-35.2-36 21.7-9.1 35.1-23.4 35.1-36.4zm70.5-83.5l9.5 8.5c3.8 3.3 9.3 4 13.7 1.6 4.4-2.4 6.9-7.4 6.1-12.4-4-25.2-34.2-42.1-59.8-42.1s-55.9 16.9-59.8 42.1c-.8 5 1.7 10 6.1 12.4 5.8 3.1 11.2.7 13.7-1.6l9.5-8.5c14.8-13.2 46.2-13.2 61 0zM136 208.5c0 17.7 14.3 32 32 32s32-14.3 32-32-14.3-32-32-32-32 14.3-32 32zm365.1 194c-8-20.8-31.5-31.5-53.1-25.9l-8.4 2.2-2.3-8.4c-5.9-21.4-27-36.5-49-33-25.2 4-40.6 28.6-34 52.6l22.9 82.6c1.5 5.3 7 8.5 12.4 7.1l83-21.5c24.1-6.3 37.7-31.8 28.5-55.7zM334 436.3c-26.1 12.5-55.2 19.7-86 19.7-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200c0 22.1-3.7 43.3-10.4 63.2 9 6.4 17 14.2 22.6 23.9 6.4.1 12.6 1.4 18.6 2.9 10.9-27.9 17.1-58.2 17.1-90C496 119 385 8 248 8S0 119 0 256s111 248 248 248c35.4 0 68.9-7.5 99.4-20.9-2.5-7.3 4.3 17.2-13.4-46.8z"]
};
var faLaugh = {
prefix: 'far',
iconName: 'laugh',
icon: [496, 512, [], "f599", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm141.4 389.4c-37.8 37.8-88 58.6-141.4 58.6s-103.6-20.8-141.4-58.6S48 309.4 48 256s20.8-103.6 58.6-141.4S194.6 56 248 56s103.6 20.8 141.4 58.6S448 202.6 448 256s-20.8 103.6-58.6 141.4zM328 224c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm-160 0c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm194.4 64H133.6c-8.2 0-14.5 7-13.5 15 7.5 59.2 58.9 105 121.1 105h13.6c62.2 0 113.6-45.8 121.1-105 1-8-5.3-15-13.5-15z"]
};
var faLaughBeam = {
prefix: 'far',
iconName: 'laugh-beam',
icon: [496, 512, [], "f59a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm141.4 389.4c-37.8 37.8-88 58.6-141.4 58.6s-103.6-20.8-141.4-58.6S48 309.4 48 256s20.8-103.6 58.6-141.4S194.6 56 248 56s103.6 20.8 141.4 58.6S448 202.6 448 256s-20.8 103.6-58.6 141.4zM328 152c-23.8 0-52.7 29.3-56 71.4-.7 8.6 10.8 11.9 14.9 4.5l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c4.1 7.4 15.6 4 14.9-4.5-3.1-42.1-32-71.4-55.8-71.4zm-201 75.9l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c4.1 7.4 15.6 4 14.9-4.5-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.6 8.5 10.9 11.9 15.1 4.5zM362.4 288H133.6c-8.2 0-14.5 7-13.5 15 7.5 59.2 58.9 105 121.1 105h13.6c62.2 0 113.6-45.8 121.1-105 1-8-5.3-15-13.5-15z"]
};
var faLaughSquint = {
prefix: 'far',
iconName: 'laugh-squint',
icon: [496, 512, [], "f59b", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm141.4 389.4c-37.8 37.8-88 58.6-141.4 58.6s-103.6-20.8-141.4-58.6S48 309.4 48 256s20.8-103.6 58.6-141.4S194.6 56 248 56s103.6 20.8 141.4 58.6S448 202.6 448 256s-20.8 103.6-58.6 141.4zM343.6 196l33.6-40.3c8.6-10.3-3.8-24.8-15.4-18l-80 48c-7.8 4.7-7.8 15.9 0 20.6l80 48c11.5 6.8 24-7.6 15.4-18L343.6 196zm-209.4 58.3l80-48c7.8-4.7 7.8-15.9 0-20.6l-80-48c-11.6-6.9-24 7.7-15.4 18l33.6 40.3-33.6 40.3c-8.7 10.4 3.8 24.8 15.4 18zM362.4 288H133.6c-8.2 0-14.5 7-13.5 15 7.5 59.2 58.9 105 121.1 105h13.6c62.2 0 113.6-45.8 121.1-105 1-8-5.3-15-13.5-15z"]
};
var faLaughWink = {
prefix: 'far',
iconName: 'laugh-wink',
icon: [496, 512, [], "f59c", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm141.4 389.4c-37.8 37.8-88 58.6-141.4 58.6s-103.6-20.8-141.4-58.6C68.8 359.6 48 309.4 48 256s20.8-103.6 58.6-141.4C144.4 76.8 194.6 56 248 56s103.6 20.8 141.4 58.6c37.8 37.8 58.6 88 58.6 141.4s-20.8 103.6-58.6 141.4zM328 164c-25.7 0-55.9 16.9-59.9 42.1-1.7 11.2 11.5 18.2 19.8 10.8l9.5-8.5c14.8-13.2 46.2-13.2 61 0l9.5 8.5c8.5 7.4 21.6.3 19.8-10.8-3.8-25.2-34-42.1-59.7-42.1zm-160 60c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm194.4 64H133.6c-8.2 0-14.5 7-13.5 15 7.5 59.2 58.9 105 121.1 105h13.6c62.2 0 113.6-45.8 121.1-105 1-8-5.3-15-13.5-15z"]
};
var faLemon = {
prefix: 'far',
iconName: 'lemon',
icon: [512, 512, [], "f094", "M484.112 27.889C455.989-.233 416.108-8.057 387.059 8.865 347.604 31.848 223.504-41.111 91.196 91.197-41.277 223.672 31.923 347.472 8.866 387.058c-16.922 29.051-9.1 68.932 19.022 97.054 28.135 28.135 68.011 35.938 97.057 19.021 39.423-22.97 163.557 49.969 295.858-82.329 132.474-132.477 59.273-256.277 82.331-295.861 16.922-29.05 9.1-68.931-19.022-97.054zm-22.405 72.894c-38.8 66.609 45.6 165.635-74.845 286.08-120.44 120.443-219.475 36.048-286.076 74.843-22.679 13.207-64.035-27.241-50.493-50.488 38.8-66.609-45.6-165.635 74.845-286.08C245.573 4.702 344.616 89.086 411.219 50.292c22.73-13.24 64.005 27.288 50.488 50.491zm-169.861 8.736c1.37 10.96-6.404 20.957-17.365 22.327-54.846 6.855-135.779 87.787-142.635 142.635-1.373 10.989-11.399 18.734-22.326 17.365-10.961-1.37-18.735-11.366-17.365-22.326 9.162-73.286 104.167-168.215 177.365-177.365 10.953-1.368 20.956 6.403 22.326 17.364z"]
};
var faLifeRing = {
prefix: 'far',
iconName: 'life-ring',
icon: [512, 512, [], "f1cd", "M256 504c136.967 0 248-111.033 248-248S392.967 8 256 8 8 119.033 8 256s111.033 248 248 248zm-103.398-76.72l53.411-53.411c31.806 13.506 68.128 13.522 99.974 0l53.411 53.411c-63.217 38.319-143.579 38.319-206.796 0zM336 256c0 44.112-35.888 80-80 80s-80-35.888-80-80 35.888-80 80-80 80 35.888 80 80zm91.28 103.398l-53.411-53.411c13.505-31.806 13.522-68.128 0-99.974l53.411-53.411c38.319 63.217 38.319 143.579 0 206.796zM359.397 84.72l-53.411 53.411c-31.806-13.505-68.128-13.522-99.973 0L152.602 84.72c63.217-38.319 143.579-38.319 206.795 0zM84.72 152.602l53.411 53.411c-13.506 31.806-13.522 68.128 0 99.974L84.72 359.398c-38.319-63.217-38.319-143.579 0-206.796z"]
};
var faLightbulb = {
prefix: 'far',
iconName: 'lightbulb',
icon: [352, 512, [], "f0eb", "M176 80c-52.94 0-96 43.06-96 96 0 8.84 7.16 16 16 16s16-7.16 16-16c0-35.3 28.72-64 64-64 8.84 0 16-7.16 16-16s-7.16-16-16-16zM96.06 459.17c0 3.15.93 6.22 2.68 8.84l24.51 36.84c2.97 4.46 7.97 7.14 13.32 7.14h78.85c5.36 0 10.36-2.68 13.32-7.14l24.51-36.84c1.74-2.62 2.67-5.7 2.68-8.84l.05-43.18H96.02l.04 43.18zM176 0C73.72 0 0 82.97 0 176c0 44.37 16.45 84.85 43.56 115.78 16.64 18.99 42.74 58.8 52.42 92.16v.06h48v-.12c-.01-4.77-.72-9.51-2.15-14.07-5.59-17.81-22.82-64.77-62.17-109.67-20.54-23.43-31.52-53.15-31.61-84.14-.2-73.64 59.67-128 127.95-128 70.58 0 128 57.42 128 128 0 30.97-11.24 60.85-31.65 84.14-39.11 44.61-56.42 91.47-62.1 109.46a47.507 47.507 0 0 0-2.22 14.3v.1h48v-.05c9.68-33.37 35.78-73.18 52.42-92.16C335.55 260.85 352 220.37 352 176 352 78.8 273.2 0 176 0z"]
};
var faListAlt = {
prefix: 'far',
iconName: 'list-alt',
icon: [512, 512, [], "f022", "M464 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zm-6 400H54a6 6 0 0 1-6-6V86a6 6 0 0 1 6-6h404a6 6 0 0 1 6 6v340a6 6 0 0 1-6 6zm-42-92v24c0 6.627-5.373 12-12 12H204c-6.627 0-12-5.373-12-12v-24c0-6.627 5.373-12 12-12h200c6.627 0 12 5.373 12 12zm0-96v24c0 6.627-5.373 12-12 12H204c-6.627 0-12-5.373-12-12v-24c0-6.627 5.373-12 12-12h200c6.627 0 12 5.373 12 12zm0-96v24c0 6.627-5.373 12-12 12H204c-6.627 0-12-5.373-12-12v-24c0-6.627 5.373-12 12-12h200c6.627 0 12 5.373 12 12zm-252 12c0 19.882-16.118 36-36 36s-36-16.118-36-36 16.118-36 36-36 36 16.118 36 36zm0 96c0 19.882-16.118 36-36 36s-36-16.118-36-36 16.118-36 36-36 36 16.118 36 36zm0 96c0 19.882-16.118 36-36 36s-36-16.118-36-36 16.118-36 36-36 36 16.118 36 36z"]
};
var faMap = {
prefix: 'far',
iconName: 'map',
icon: [576, 512, [], "f279", "M560.02 32c-1.96 0-3.98.37-5.96 1.16L384.01 96H384L212 35.28A64.252 64.252 0 0 0 191.76 32c-6.69 0-13.37 1.05-19.81 3.14L20.12 87.95A32.006 32.006 0 0 0 0 117.66v346.32C0 473.17 7.53 480 15.99 480c1.96 0 3.97-.37 5.96-1.16L192 416l172 60.71a63.98 63.98 0 0 0 40.05.15l151.83-52.81A31.996 31.996 0 0 0 576 394.34V48.02c0-9.19-7.53-16.02-15.98-16.02zM224 90.42l128 45.19v285.97l-128-45.19V90.42zM48 418.05V129.07l128-44.53v286.2l-.64.23L48 418.05zm480-35.13l-128 44.53V141.26l.64-.24L528 93.95v288.97z"]
};
var faMeh = {
prefix: 'far',
iconName: 'meh',
icon: [496, 512, [], "f11a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-80-216c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160-64c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm8 144H160c-13.2 0-24 10.8-24 24s10.8 24 24 24h176c13.2 0 24-10.8 24-24s-10.8-24-24-24z"]
};
var faMehBlank = {
prefix: 'far',
iconName: 'meh-blank',
icon: [496, 512, [], "f5a4", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-80-280c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm160 0c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32z"]
};
var faMehRollingEyes = {
prefix: 'far',
iconName: 'meh-rolling-eyes',
icon: [496, 512, [], "f5a5", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm88-304c-39.8 0-72 32.2-72 72s32.2 72 72 72 72-32.2 72-72-32.2-72-72-72zm0 112c-22.1 0-40-17.9-40-40 0-13.6 7.3-25.1 17.7-32.3-1 2.6-1.7 5.3-1.7 8.3 0 13.3 10.7 24 24 24s24-10.7 24-24c0-2.9-.7-5.7-1.7-8.3 10.4 7.2 17.7 18.7 17.7 32.3 0 22.1-17.9 40-40 40zm-104-40c0-39.8-32.2-72-72-72s-72 32.2-72 72 32.2 72 72 72 72-32.2 72-72zm-112 0c0-13.6 7.3-25.1 17.7-32.3-1 2.6-1.7 5.3-1.7 8.3 0 13.3 10.7 24 24 24s24-10.7 24-24c0-2.9-.7-5.7-1.7-8.3 10.4 7.2 17.7 18.7 17.7 32.3 0 22.1-17.9 40-40 40s-40-17.9-40-40zm192 128H184c-13.2 0-24 10.8-24 24s10.8 24 24 24h128c13.2 0 24-10.8 24-24s-10.8-24-24-24z"]
};
var faMinusSquare = {
prefix: 'far',
iconName: 'minus-square',
icon: [448, 512, [], "f146", "M108 284c-6.6 0-12-5.4-12-12v-32c0-6.6 5.4-12 12-12h232c6.6 0 12 5.4 12 12v32c0 6.6-5.4 12-12 12H108zM448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faMoneyBillAlt = {
prefix: 'far',
iconName: 'money-bill-alt',
icon: [640, 512, [], "f3d1", "M320 144c-53.02 0-96 50.14-96 112 0 61.85 42.98 112 96 112 53 0 96-50.13 96-112 0-61.86-42.98-112-96-112zm40 168c0 4.42-3.58 8-8 8h-64c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h16v-55.44l-.47.31a7.992 7.992 0 0 1-11.09-2.22l-8.88-13.31a7.992 7.992 0 0 1 2.22-11.09l15.33-10.22a23.99 23.99 0 0 1 13.31-4.03H328c4.42 0 8 3.58 8 8v88h16c4.42 0 8 3.58 8 8v16zM608 64H32C14.33 64 0 78.33 0 96v320c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V96c0-17.67-14.33-32-32-32zm-16 272c-35.35 0-64 28.65-64 64H112c0-35.35-28.65-64-64-64V176c35.35 0 64-28.65 64-64h416c0 35.35 28.65 64 64 64v160z"]
};
var faMoon = {
prefix: 'far',
iconName: 'moon',
icon: [512, 512, [], "f186", "M279.135 512c78.756 0 150.982-35.804 198.844-94.775 28.27-34.831-2.558-85.722-46.249-77.401-82.348 15.683-158.272-47.268-158.272-130.792 0-48.424 26.06-92.292 67.434-115.836 38.745-22.05 28.999-80.788-15.022-88.919A257.936 257.936 0 0 0 279.135 0c-141.36 0-256 114.575-256 256 0 141.36 114.576 256 256 256zm0-464c12.985 0 25.689 1.201 38.016 3.478-54.76 31.163-91.693 90.042-91.693 157.554 0 113.848 103.641 199.2 215.252 177.944C402.574 433.964 344.366 464 279.135 464c-114.875 0-208-93.125-208-208s93.125-208 208-208z"]
};
var faNewspaper = {
prefix: 'far',
iconName: 'newspaper',
icon: [576, 512, [], "f1ea", "M552 64H112c-20.858 0-38.643 13.377-45.248 32H24c-13.255 0-24 10.745-24 24v272c0 30.928 25.072 56 56 56h496c13.255 0 24-10.745 24-24V88c0-13.255-10.745-24-24-24zM48 392V144h16v248c0 4.411-3.589 8-8 8s-8-3.589-8-8zm480 8H111.422c.374-2.614.578-5.283.578-8V112h416v288zM172 280h136c6.627 0 12-5.373 12-12v-96c0-6.627-5.373-12-12-12H172c-6.627 0-12 5.373-12 12v96c0 6.627 5.373 12 12 12zm28-80h80v40h-80v-40zm-40 140v-24c0-6.627 5.373-12 12-12h136c6.627 0 12 5.373 12 12v24c0 6.627-5.373 12-12 12H172c-6.627 0-12-5.373-12-12zm192 0v-24c0-6.627 5.373-12 12-12h104c6.627 0 12 5.373 12 12v24c0 6.627-5.373 12-12 12H364c-6.627 0-12-5.373-12-12zm0-144v-24c0-6.627 5.373-12 12-12h104c6.627 0 12 5.373 12 12v24c0 6.627-5.373 12-12 12H364c-6.627 0-12-5.373-12-12zm0 72v-24c0-6.627 5.373-12 12-12h104c6.627 0 12 5.373 12 12v24c0 6.627-5.373 12-12 12H364c-6.627 0-12-5.373-12-12z"]
};
var faObjectGroup = {
prefix: 'far',
iconName: 'object-group',
icon: [512, 512, [], "f247", "M500 128c6.627 0 12-5.373 12-12V44c0-6.627-5.373-12-12-12h-72c-6.627 0-12 5.373-12 12v12H96V44c0-6.627-5.373-12-12-12H12C5.373 32 0 37.373 0 44v72c0 6.627 5.373 12 12 12h12v256H12c-6.627 0-12 5.373-12 12v72c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-12h320v12c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-72c0-6.627-5.373-12-12-12h-12V128h12zm-52-64h32v32h-32V64zM32 64h32v32H32V64zm32 384H32v-32h32v32zm416 0h-32v-32h32v32zm-40-64h-12c-6.627 0-12 5.373-12 12v12H96v-12c0-6.627-5.373-12-12-12H72V128h12c6.627 0 12-5.373 12-12v-12h320v12c0 6.627 5.373 12 12 12h12v256zm-36-192h-84v-52c0-6.628-5.373-12-12-12H108c-6.627 0-12 5.372-12 12v168c0 6.628 5.373 12 12 12h84v52c0 6.628 5.373 12 12 12h200c6.627 0 12-5.372 12-12V204c0-6.628-5.373-12-12-12zm-268-24h144v112H136V168zm240 176H232v-24h76c6.627 0 12-5.372 12-12v-76h56v112z"]
};
var faObjectUngroup = {
prefix: 'far',
iconName: 'object-ungroup',
icon: [576, 512, [], "f248", "M564 224c6.627 0 12-5.373 12-12v-72c0-6.627-5.373-12-12-12h-72c-6.627 0-12 5.373-12 12v12h-88v-24h12c6.627 0 12-5.373 12-12V44c0-6.627-5.373-12-12-12h-72c-6.627 0-12 5.373-12 12v12H96V44c0-6.627-5.373-12-12-12H12C5.373 32 0 37.373 0 44v72c0 6.627 5.373 12 12 12h12v160H12c-6.627 0-12 5.373-12 12v72c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-12h88v24h-12c-6.627 0-12 5.373-12 12v72c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-12h224v12c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-72c0-6.627-5.373-12-12-12h-12V224h12zM352 64h32v32h-32V64zm0 256h32v32h-32v-32zM64 352H32v-32h32v32zm0-256H32V64h32v32zm32 216v-12c0-6.627-5.373-12-12-12H72V128h12c6.627 0 12-5.373 12-12v-12h224v12c0 6.627 5.373 12 12 12h12v160h-12c-6.627 0-12 5.373-12 12v12H96zm128 136h-32v-32h32v32zm280-64h-12c-6.627 0-12 5.373-12 12v12H256v-12c0-6.627-5.373-12-12-12h-12v-24h88v12c0 6.627 5.373 12 12 12h72c6.627 0 12-5.373 12-12v-72c0-6.627-5.373-12-12-12h-12v-88h88v12c0 6.627 5.373 12 12 12h12v160zm40 64h-32v-32h32v32zm0-256h-32v-32h32v32z"]
};
var faPaperPlane = {
prefix: 'far',
iconName: 'paper-plane',
icon: [512, 512, [], "f1d8", "M440 6.5L24 246.4c-34.4 19.9-31.1 70.8 5.7 85.9L144 379.6V464c0 46.4 59.2 65.5 86.6 28.6l43.8-59.1 111.9 46.2c5.9 2.4 12.1 3.6 18.3 3.6 8.2 0 16.3-2.1 23.6-6.2 12.8-7.2 21.6-20 23.9-34.5l59.4-387.2c6.1-40.1-36.9-68.8-71.5-48.9zM192 464v-64.6l36.6 15.1L192 464zm212.6-28.7l-153.8-63.5L391 169.5c10.7-15.5-9.5-33.5-23.7-21.2L155.8 332.6 48 288 464 48l-59.4 387.3z"]
};
var faPauseCircle = {
prefix: 'far',
iconName: 'pause-circle',
icon: [512, 512, [], "f28b", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 448c-110.5 0-200-89.5-200-200S145.5 56 256 56s200 89.5 200 200-89.5 200-200 200zm96-280v160c0 8.8-7.2 16-16 16h-48c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h48c8.8 0 16 7.2 16 16zm-112 0v160c0 8.8-7.2 16-16 16h-48c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h48c8.8 0 16 7.2 16 16z"]
};
var faPlayCircle = {
prefix: 'far',
iconName: 'play-circle',
icon: [512, 512, [], "f144", "M371.7 238l-176-107c-15.8-8.8-35.7 2.5-35.7 21v208c0 18.4 19.8 29.8 35.7 21l176-101c16.4-9.1 16.4-32.8 0-42zM504 256C504 119 393 8 256 8S8 119 8 256s111 248 248 248 248-111 248-248zm-448 0c0-110.5 89.5-200 200-200s200 89.5 200 200-89.5 200-200 200S56 366.5 56 256z"]
};
var faPlusSquare = {
prefix: 'far',
iconName: 'plus-square',
icon: [448, 512, [], "f0fe", "M352 240v32c0 6.6-5.4 12-12 12h-88v88c0 6.6-5.4 12-12 12h-32c-6.6 0-12-5.4-12-12v-88h-88c-6.6 0-12-5.4-12-12v-32c0-6.6 5.4-12 12-12h88v-88c0-6.6 5.4-12 12-12h32c6.6 0 12 5.4 12 12v88h88c6.6 0 12 5.4 12 12zm96-160v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zm-48 346V86c0-3.3-2.7-6-6-6H54c-3.3 0-6 2.7-6 6v340c0 3.3 2.7 6 6 6h340c3.3 0 6-2.7 6-6z"]
};
var faQuestionCircle = {
prefix: 'far',
iconName: 'question-circle',
icon: [512, 512, [], "f059", "M256 8C119.043 8 8 119.083 8 256c0 136.997 111.043 248 248 248s248-111.003 248-248C504 119.083 392.957 8 256 8zm0 448c-110.532 0-200-89.431-200-200 0-110.495 89.472-200 200-200 110.491 0 200 89.471 200 200 0 110.53-89.431 200-200 200zm107.244-255.2c0 67.052-72.421 68.084-72.421 92.863V300c0 6.627-5.373 12-12 12h-45.647c-6.627 0-12-5.373-12-12v-8.659c0-35.745 27.1-50.034 47.579-61.516 17.561-9.845 28.324-16.541 28.324-29.579 0-17.246-21.999-28.693-39.784-28.693-23.189 0-33.894 10.977-48.942 29.969-4.057 5.12-11.46 6.071-16.666 2.124l-27.824-21.098c-5.107-3.872-6.251-11.066-2.644-16.363C184.846 131.491 214.94 112 261.794 112c49.071 0 101.45 38.304 101.45 88.8zM298 368c0 23.159-18.841 42-42 42s-42-18.841-42-42 18.841-42 42-42 42 18.841 42 42z"]
};
var faRegistered = {
prefix: 'far',
iconName: 'registered',
icon: [512, 512, [], "f25d", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm0 448c-110.532 0-200-89.451-200-200 0-110.531 89.451-200 200-200 110.532 0 200 89.451 200 200 0 110.532-89.451 200-200 200zm110.442-81.791c-53.046-96.284-50.25-91.468-53.271-96.085 24.267-13.879 39.482-41.563 39.482-73.176 0-52.503-30.247-85.252-101.498-85.252h-78.667c-6.617 0-12 5.383-12 12V380c0 6.617 5.383 12 12 12h38.568c6.617 0 12-5.383 12-12v-83.663h31.958l47.515 89.303a11.98 11.98 0 0 0 10.593 6.36h42.81c9.14 0 14.914-9.799 10.51-17.791zM256.933 239.906h-33.875v-64.14h27.377c32.417 0 38.929 12.133 38.929 31.709-.001 20.913-11.518 32.431-32.431 32.431z"]
};
var faSadCry = {
prefix: 'far',
iconName: 'sad-cry',
icon: [496, 512, [], "f5b3", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm144 386.4V280c0-13.2-10.8-24-24-24s-24 10.8-24 24v151.4C315.5 447 282.8 456 248 456s-67.5-9-96-24.6V280c0-13.2-10.8-24-24-24s-24 10.8-24 24v114.4c-34.6-36-56-84.7-56-138.4 0-110.3 89.7-200 200-200s200 89.7 200 200c0 53.7-21.4 102.5-56 138.4zM205.8 234.5c4.4-2.4 6.9-7.4 6.1-12.4-4-25.2-34.2-42.1-59.8-42.1s-55.9 16.9-59.8 42.1c-.8 5 1.7 10 6.1 12.4 4.4 2.4 9.9 1.8 13.7-1.6l9.5-8.5c14.8-13.2 46.2-13.2 61 0l9.5 8.5c2.5 2.3 7.9 4.8 13.7 1.6zM344 180c-25.7 0-55.9 16.9-59.8 42.1-.8 5 1.7 10 6.1 12.4 4.5 2.4 9.9 1.8 13.7-1.6l9.5-8.5c14.8-13.2 46.2-13.2 61 0l9.5 8.5c2.5 2.2 8 4.7 13.7 1.6 4.4-2.4 6.9-7.4 6.1-12.4-3.9-25.2-34.1-42.1-59.8-42.1zm-96 92c-30.9 0-56 28.7-56 64s25.1 64 56 64 56-28.7 56-64-25.1-64-56-64z"]
};
var faSadTear = {
prefix: 'far',
iconName: 'sad-tear',
icon: [496, 512, [], "f5b4", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm8-152c-13.2 0-24 10.8-24 24s10.8 24 24 24c23.8 0 46.3 10.5 61.6 28.8 8.1 9.8 23.2 11.9 33.8 3.1 10.2-8.5 11.6-23.6 3.1-33.8C330 320.8 294.1 304 256 304zm-88-64c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160-64c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32zm-165.6 98.8C151 290.1 126 325.4 126 342.9c0 22.7 18.8 41.1 42 41.1s42-18.4 42-41.1c0-17.5-25-52.8-36.4-68.1-2.8-3.7-8.4-3.7-11.2 0z"]
};
var faSave = {
prefix: 'far',
iconName: 'save',
icon: [448, 512, [], "f0c7", "M433.941 129.941l-83.882-83.882A48 48 0 0 0 316.118 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V163.882a48 48 0 0 0-14.059-33.941zM272 80v80H144V80h128zm122 352H54a6 6 0 0 1-6-6V86a6 6 0 0 1 6-6h42v104c0 13.255 10.745 24 24 24h176c13.255 0 24-10.745 24-24V83.882l78.243 78.243a6 6 0 0 1 1.757 4.243V426a6 6 0 0 1-6 6zM224 232c-48.523 0-88 39.477-88 88s39.477 88 88 88 88-39.477 88-88-39.477-88-88-88zm0 128c-22.056 0-40-17.944-40-40s17.944-40 40-40 40 17.944 40 40-17.944 40-40 40z"]
};
var faShareSquare = {
prefix: 'far',
iconName: 'share-square',
icon: [576, 512, [], "f14d", "M561.938 158.06L417.94 14.092C387.926-15.922 336 5.097 336 48.032v57.198c-42.45 1.88-84.03 6.55-120.76 17.99-35.17 10.95-63.07 27.58-82.91 49.42C108.22 199.2 96 232.6 96 271.94c0 61.697 33.178 112.455 84.87 144.76 37.546 23.508 85.248-12.651 71.02-55.74-15.515-47.119-17.156-70.923 84.11-78.76V336c0 42.993 51.968 63.913 81.94 33.94l143.998-144c18.75-18.74 18.75-49.14 0-67.88zM384 336V232.16C255.309 234.082 166.492 255.35 206.31 376 176.79 357.55 144 324.08 144 271.94c0-109.334 129.14-118.947 240-119.85V48l144 144-144 144zm24.74 84.493a82.658 82.658 0 0 0 20.974-9.303c7.976-4.952 18.286.826 18.286 10.214V464c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V112c0-26.51 21.49-48 48-48h132c6.627 0 12 5.373 12 12v4.486c0 4.917-2.987 9.369-7.569 11.152-13.702 5.331-26.396 11.537-38.05 18.585a12.138 12.138 0 0 1-6.28 1.777H54a6 6 0 0 0-6 6v340a6 6 0 0 0 6 6h340a6 6 0 0 0 6-6v-25.966c0-5.37 3.579-10.059 8.74-11.541z"]
};
var faSmile = {
prefix: 'far',
iconName: 'smile',
icon: [496, 512, [], "f118", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm-80-216c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160 0c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm4 72.6c-20.8 25-51.5 39.4-84 39.4s-63.2-14.3-84-39.4c-8.5-10.2-23.7-11.5-33.8-3.1-10.2 8.5-11.5 23.6-3.1 33.8 30 36 74.1 56.6 120.9 56.6s90.9-20.6 120.9-56.6c8.5-10.2 7.1-25.3-3.1-33.8-10.1-8.4-25.3-7.1-33.8 3.1z"]
};
var faSmileBeam = {
prefix: 'far',
iconName: 'smile-beam',
icon: [496, 512, [], "f5b8", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm84-143.4c-20.8 25-51.5 39.4-84 39.4s-63.2-14.3-84-39.4c-8.5-10.2-23.6-11.5-33.8-3.1-10.2 8.5-11.5 23.6-3.1 33.8 30 36 74.1 56.6 120.9 56.6s90.9-20.6 120.9-56.6c8.5-10.2 7.1-25.3-3.1-33.8-10.2-8.4-25.3-7.1-33.8 3.1zM136.5 211c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4s-52.7 29.3-56 71.4c-.3 3.7 2.1 7.2 5.7 8.3 3.4 1.1 7.4-.5 9.3-3.7l9.5-17zM328 152c-23.8 0-52.7 29.3-56 71.4-.3 3.7 2.1 7.2 5.7 8.3 3.5 1.1 7.4-.5 9.3-3.7l9.5-17c7.7-13.7 19.2-21.6 31.5-21.6s23.8 7.9 31.5 21.6l9.5 17c2.1 3.7 6.2 4.7 9.3 3.7 3.6-1.1 6-4.5 5.7-8.3-3.3-42.1-32.2-71.4-56-71.4z"]
};
var faSmileWink = {
prefix: 'far',
iconName: 'smile-wink',
icon: [496, 512, [], "f4da", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm117.8-146.4c-10.2-8.5-25.3-7.1-33.8 3.1-20.8 25-51.5 39.4-84 39.4s-63.2-14.3-84-39.4c-8.5-10.2-23.7-11.5-33.8-3.1-10.2 8.5-11.5 23.6-3.1 33.8 30 36 74.1 56.6 120.9 56.6s90.9-20.6 120.9-56.6c8.5-10.2 7.1-25.3-3.1-33.8zM168 240c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32zm160-60c-25.7 0-55.9 16.9-59.9 42.1-1.7 11.2 11.5 18.2 19.8 10.8l9.5-8.5c14.8-13.2 46.2-13.2 61 0l9.5 8.5c8.5 7.4 21.6.3 19.8-10.8-3.8-25.2-34-42.1-59.7-42.1z"]
};
var faSnowflake = {
prefix: 'far',
iconName: 'snowflake',
icon: [448, 512, [], "f2dc", "M440.1 355.2l-39.2-23 34.1-9.3c8.4-2.3 13.4-11.1 11.1-19.6l-4.1-15.5c-2.2-8.5-10.9-13.6-19.3-11.3L343 298.2 271.2 256l71.9-42.2 79.7 21.7c8.4 2.3 17-2.8 19.3-11.3l4.1-15.5c2.2-8.5-2.7-17.3-11.1-19.6l-34.1-9.3 39.2-23c7.5-4.4 10.1-14.2 5.8-21.9l-7.9-13.9c-4.3-7.7-14-10.3-21.5-5.9l-39.2 23 9.1-34.7c2.2-8.5-2.7-17.3-11.1-19.6l-15.2-4.1c-8.4-2.3-17 2.8-19.3 11.3l-21.3 81-71.9 42.2v-84.5L306 70.4c6.1-6.2 6.1-16.4 0-22.6l-11.1-11.3c-6.1-6.2-16.1-6.2-22.2 0l-24.9 25.4V16c0-8.8-7-16-15.7-16h-15.7c-8.7 0-15.7 7.2-15.7 16v46.1l-24.9-25.4c-6.1-6.2-16.1-6.2-22.2 0L142.1 48c-6.1 6.2-6.1 16.4 0 22.6l58.3 59.3v84.5l-71.9-42.2-21.3-81c-2.2-8.5-10.9-13.6-19.3-11.3L72.7 84c-8.4 2.3-13.4 11.1-11.1 19.6l9.1 34.7-39.2-23c-7.5-4.4-17.1-1.8-21.5 5.9l-7.9 13.9c-4.3 7.7-1.8 17.4 5.8 21.9l39.2 23-34.1 9.1c-8.4 2.3-13.4 11.1-11.1 19.6L6 224.2c2.2 8.5 10.9 13.6 19.3 11.3l79.7-21.7 71.9 42.2-71.9 42.2-79.7-21.7c-8.4-2.3-17 2.8-19.3 11.3l-4.1 15.5c-2.2 8.5 2.7 17.3 11.1 19.6l34.1 9.3-39.2 23c-7.5 4.4-10.1 14.2-5.8 21.9L10 391c4.3 7.7 14 10.3 21.5 5.9l39.2-23-9.1 34.7c-2.2 8.5 2.7 17.3 11.1 19.6l15.2 4.1c8.4 2.3 17-2.8 19.3-11.3l21.3-81 71.9-42.2v84.5l-58.3 59.3c-6.1 6.2-6.1 16.4 0 22.6l11.1 11.3c6.1 6.2 16.1 6.2 22.2 0l24.9-25.4V496c0 8.8 7 16 15.7 16h15.7c8.7 0 15.7-7.2 15.7-16v-46.1l24.9 25.4c6.1 6.2 16.1 6.2 22.2 0l11.1-11.3c6.1-6.2 6.1-16.4 0-22.6l-58.3-59.3v-84.5l71.9 42.2 21.3 81c2.2 8.5 10.9 13.6 19.3 11.3L375 428c8.4-2.3 13.4-11.1 11.1-19.6l-9.1-34.7 39.2 23c7.5 4.4 17.1 1.8 21.5-5.9l7.9-13.9c4.6-7.5 2.1-17.3-5.5-21.7z"]
};
var faSquare = {
prefix: 'far',
iconName: 'square',
icon: [448, 512, [], "f0c8", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm-6 400H54c-3.3 0-6-2.7-6-6V86c0-3.3 2.7-6 6-6h340c3.3 0 6 2.7 6 6v340c0 3.3-2.7 6-6 6z"]
};
var faStar = {
prefix: 'far',
iconName: 'star',
icon: [576, 512, [], "f005", "M528.1 171.5L382 150.2 316.7 17.8c-11.7-23.6-45.6-23.9-57.4 0L194 150.2 47.9 171.5c-26.2 3.8-36.7 36.1-17.7 54.6l105.7 103-25 145.5c-4.5 26.3 23.2 46 46.4 33.7L288 439.6l130.7 68.7c23.2 12.2 50.9-7.4 46.4-33.7l-25-145.5 105.7-103c19-18.5 8.5-50.8-17.7-54.6zM388.6 312.3l23.7 138.4L288 385.4l-124.3 65.3 23.7-138.4-100.6-98 139-20.2 62.2-126 62.2 126 139 20.2-100.6 98z"]
};
var faStarHalf = {
prefix: 'far',
iconName: 'star-half',
icon: [576, 512, [], "f089", "M288 385.3l-124.3 65.4 23.7-138.4-100.6-98 139-20.2 62.2-126V0c-11.4 0-22.8 5.9-28.7 17.8L194 150.2 47.9 171.4c-26.2 3.8-36.7 36.1-17.7 54.6l105.7 103-25 145.5c-4.5 26.1 23 46 46.4 33.7L288 439.6v-54.3z"]
};
var faStickyNote = {
prefix: 'far',
iconName: 'sticky-note',
icon: [448, 512, [], "f249", "M448 348.106V80c0-26.51-21.49-48-48-48H48C21.49 32 0 53.49 0 80v351.988c0 26.51 21.49 48 48 48h268.118a48 48 0 0 0 33.941-14.059l83.882-83.882A48 48 0 0 0 448 348.106zm-128 80v-76.118h76.118L320 428.106zM400 80v223.988H296c-13.255 0-24 10.745-24 24v104H48V80h352z"]
};
var faStopCircle = {
prefix: 'far',
iconName: 'stop-circle',
icon: [512, 512, [], "f28d", "M504 256C504 119 393 8 256 8S8 119 8 256s111 248 248 248 248-111 248-248zm-448 0c0-110.5 89.5-200 200-200s200 89.5 200 200-89.5 200-200 200S56 366.5 56 256zm296-80v160c0 8.8-7.2 16-16 16H176c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h160c8.8 0 16 7.2 16 16z"]
};
var faSun = {
prefix: 'far',
iconName: 'sun',
icon: [512, 512, [], "f185", "M494.2 221.9l-59.8-40.5 13.7-71c2.6-13.2-1.6-26.8-11.1-36.4-9.6-9.5-23.2-13.7-36.2-11.1l-70.9 13.7-40.4-59.9c-15.1-22.3-51.9-22.3-67 0l-40.4 59.9-70.8-13.7C98 60.4 84.5 64.5 75 74.1c-9.5 9.6-13.7 23.1-11.1 36.3l13.7 71-59.8 40.5C6.6 229.5 0 242 0 255.5s6.7 26 17.8 33.5l59.8 40.5-13.7 71c-2.6 13.2 1.6 26.8 11.1 36.3 9.5 9.5 22.9 13.7 36.3 11.1l70.8-13.7 40.4 59.9C230 505.3 242.6 512 256 512s26-6.7 33.5-17.8l40.4-59.9 70.9 13.7c13.4 2.7 26.8-1.6 36.3-11.1 9.5-9.5 13.6-23.1 11.1-36.3l-13.7-71 59.8-40.5c11.1-7.5 17.8-20.1 17.8-33.5-.1-13.6-6.7-26.1-17.9-33.7zm-112.9 85.6l17.6 91.2-91-17.6L256 458l-51.9-77-90.9 17.6 17.6-91.2-76.8-52 76.8-52-17.6-91.2 91 17.6L256 53l51.9 76.9 91-17.6-17.6 91.1 76.8 52-76.8 52.1zM256 152c-57.3 0-104 46.7-104 104s46.7 104 104 104 104-46.7 104-104-46.7-104-104-104zm0 160c-30.9 0-56-25.1-56-56s25.1-56 56-56 56 25.1 56 56-25.1 56-56 56z"]
};
var faSurprise = {
prefix: 'far',
iconName: 'surprise',
icon: [496, 512, [], "f5c2", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm0-176c-35.3 0-64 28.7-64 64s28.7 64 64 64 64-28.7 64-64-28.7-64-64-64zm-48-72c0-17.7-14.3-32-32-32s-32 14.3-32 32 14.3 32 32 32 32-14.3 32-32zm128-32c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32z"]
};
var faThumbsDown = {
prefix: 'far',
iconName: 'thumbs-down',
icon: [512, 512, [], "f165", "M466.27 225.31c4.674-22.647.864-44.538-8.99-62.99 2.958-23.868-4.021-48.565-17.34-66.99C438.986 39.423 404.117 0 327 0c-7 0-15 .01-22.22.01C201.195.01 168.997 40 128 40h-10.845c-5.64-4.975-13.042-8-21.155-8H32C14.327 32 0 46.327 0 64v240c0 17.673 14.327 32 32 32h64c11.842 0 22.175-6.438 27.708-16h7.052c19.146 16.953 46.013 60.653 68.76 83.4 13.667 13.667 10.153 108.6 71.76 108.6 57.58 0 95.27-31.936 95.27-104.73 0-18.41-3.93-33.73-8.85-46.54h36.48c48.602 0 85.82-41.565 85.82-85.58 0-19.15-4.96-34.99-13.73-49.84zM64 296c-13.255 0-24-10.745-24-24s10.745-24 24-24 24 10.745 24 24-10.745 24-24 24zm330.18 16.73H290.19c0 37.82 28.36 55.37 28.36 94.54 0 23.75 0 56.73-47.27 56.73-18.91-18.91-9.46-66.18-37.82-94.54C206.9 342.89 167.28 272 138.92 272H128V85.83c53.611 0 100.001-37.82 171.64-37.82h37.82c35.512 0 60.82 17.12 53.12 65.9 15.2 8.16 26.5 36.44 13.94 57.57 21.581 20.384 18.699 51.065 5.21 65.62 9.45 0 22.36 18.91 22.27 37.81-.09 18.91-16.71 37.82-37.82 37.82z"]
};
var faThumbsUp = {
prefix: 'far',
iconName: 'thumbs-up',
icon: [512, 512, [], "f164", "M466.27 286.69C475.04 271.84 480 256 480 236.85c0-44.015-37.218-85.58-85.82-85.58H357.7c4.92-12.81 8.85-28.13 8.85-46.54C366.55 31.936 328.86 0 271.28 0c-61.607 0-58.093 94.933-71.76 108.6-22.747 22.747-49.615 66.447-68.76 83.4H32c-17.673 0-32 14.327-32 32v240c0 17.673 14.327 32 32 32h64c14.893 0 27.408-10.174 30.978-23.95 44.509 1.001 75.06 39.94 177.802 39.94 7.22 0 15.22.01 22.22.01 77.117 0 111.986-39.423 112.94-95.33 13.319-18.425 20.299-43.122 17.34-66.99 9.854-18.452 13.664-40.343 8.99-62.99zm-61.75 53.83c12.56 21.13 1.26 49.41-13.94 57.57 7.7 48.78-17.608 65.9-53.12 65.9h-37.82c-71.639 0-118.029-37.82-171.64-37.82V240h10.92c28.36 0 67.98-70.89 94.54-97.46 28.36-28.36 18.91-75.63 37.82-94.54 47.27 0 47.27 32.98 47.27 56.73 0 39.17-28.36 56.72-28.36 94.54h103.99c21.11 0 37.73 18.91 37.82 37.82.09 18.9-12.82 37.81-22.27 37.81 13.489 14.555 16.371 45.236-5.21 65.62zM88 432c0 13.255-10.745 24-24 24s-24-10.745-24-24 10.745-24 24-24 24 10.745 24 24z"]
};
var faTimesCircle = {
prefix: 'far',
iconName: 'times-circle',
icon: [512, 512, [], "f057", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 448c-110.5 0-200-89.5-200-200S145.5 56 256 56s200 89.5 200 200-89.5 200-200 200zm101.8-262.2L295.6 256l62.2 62.2c4.7 4.7 4.7 12.3 0 17l-22.6 22.6c-4.7 4.7-12.3 4.7-17 0L256 295.6l-62.2 62.2c-4.7 4.7-12.3 4.7-17 0l-22.6-22.6c-4.7-4.7-4.7-12.3 0-17l62.2-62.2-62.2-62.2c-4.7-4.7-4.7-12.3 0-17l22.6-22.6c4.7-4.7 12.3-4.7 17 0l62.2 62.2 62.2-62.2c4.7-4.7 12.3-4.7 17 0l22.6 22.6c4.7 4.7 4.7 12.3 0 17z"]
};
var faTired = {
prefix: 'far',
iconName: 'tired',
icon: [496, 512, [], "f5c8", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-110.3 0-200-89.7-200-200S137.7 56 248 56s200 89.7 200 200-89.7 200-200 200zm129.1-303.8c-3.8-4.4-10.3-5.4-15.3-2.5l-80 48c-3.6 2.2-5.8 6.1-5.8 10.3s2.2 8.1 5.8 10.3l80 48c5.4 3.2 11.8 1.6 15.3-2.5 3.8-4.5 3.9-11 .1-15.5L343.6 208l33.6-40.3c3.8-4.5 3.7-11.1-.1-15.5zM220 208c0-4.2-2.2-8.1-5.8-10.3l-80-48c-5-3-11.5-1.9-15.3 2.5-3.8 4.5-3.9 11-.1 15.5l33.6 40.3-33.6 40.3c-3.8 4.5-3.7 11 .1 15.5 3.5 4.1 9.9 5.7 15.3 2.5l80-48c3.6-2.2 5.8-6.1 5.8-10.3zm28 64c-45.4 0-100.9 38.3-107.8 93.3-1.5 11.8 6.9 21.6 15.5 17.9C178.4 373.5 212 368 248 368s69.6 5.5 92.3 15.2c8.5 3.7 17-6 15.5-17.9-6.9-55-62.4-93.3-107.8-93.3z"]
};
var faTrashAlt = {
prefix: 'far',
iconName: 'trash-alt',
icon: [448, 512, [], "f2ed", "M268 416h24a12 12 0 0 0 12-12V188a12 12 0 0 0-12-12h-24a12 12 0 0 0-12 12v216a12 12 0 0 0 12 12zM432 80h-82.41l-34-56.7A48 48 0 0 0 274.41 0H173.59a48 48 0 0 0-41.16 23.3L98.41 80H16A16 16 0 0 0 0 96v16a16 16 0 0 0 16 16h16v336a48 48 0 0 0 48 48h288a48 48 0 0 0 48-48V128h16a16 16 0 0 0 16-16V96a16 16 0 0 0-16-16zM171.84 50.91A6 6 0 0 1 177 48h94a6 6 0 0 1 5.15 2.91L293.61 80H154.39zM368 464H80V128h288zm-212-48h24a12 12 0 0 0 12-12V188a12 12 0 0 0-12-12h-24a12 12 0 0 0-12 12v216a12 12 0 0 0 12 12z"]
};
var faUser = {
prefix: 'far',
iconName: 'user',
icon: [448, 512, [], "f007", "M313.6 304c-28.7 0-42.5 16-89.6 16-47.1 0-60.8-16-89.6-16C60.2 304 0 364.2 0 438.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-25.6c0-74.2-60.2-134.4-134.4-134.4zM400 464H48v-25.6c0-47.6 38.8-86.4 86.4-86.4 14.6 0 38.3 16 89.6 16 51.7 0 74.9-16 89.6-16 47.6 0 86.4 38.8 86.4 86.4V464zM224 288c79.5 0 144-64.5 144-144S303.5 0 224 0 80 64.5 80 144s64.5 144 144 144zm0-240c52.9 0 96 43.1 96 96s-43.1 96-96 96-96-43.1-96-96 43.1-96 96-96z"]
};
var faUserCircle = {
prefix: 'far',
iconName: 'user-circle',
icon: [496, 512, [], "f2bd", "M248 104c-53 0-96 43-96 96s43 96 96 96 96-43 96-96-43-96-96-96zm0 144c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm0-240C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 448c-49.7 0-95.1-18.3-130.1-48.4 14.9-23 40.4-38.6 69.6-39.5 20.8 6.4 40.6 9.6 60.5 9.6s39.7-3.1 60.5-9.6c29.2 1 54.7 16.5 69.6 39.5-35 30.1-80.4 48.4-130.1 48.4zm162.7-84.1c-24.4-31.4-62.1-51.9-105.1-51.9-10.2 0-26 9.6-57.6 9.6-31.5 0-47.4-9.6-57.6-9.6-42.9 0-80.6 20.5-105.1 51.9C61.9 339.2 48 299.2 48 256c0-110.3 89.7-200 200-200s200 89.7 200 200c0 43.2-13.9 83.2-37.3 115.9z"]
};
var faWindowClose = {
prefix: 'far',
iconName: 'window-close',
icon: [512, 512, [], "f410", "M464 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm0 394c0 3.3-2.7 6-6 6H54c-3.3 0-6-2.7-6-6V86c0-3.3 2.7-6 6-6h404c3.3 0 6 2.7 6 6v340zM356.5 194.6L295.1 256l61.4 61.4c4.6 4.6 4.6 12.1 0 16.8l-22.3 22.3c-4.6 4.6-12.1 4.6-16.8 0L256 295.1l-61.4 61.4c-4.6 4.6-12.1 4.6-16.8 0l-22.3-22.3c-4.6-4.6-4.6-12.1 0-16.8l61.4-61.4-61.4-61.4c-4.6-4.6-4.6-12.1 0-16.8l22.3-22.3c4.6-4.6 12.1-4.6 16.8 0l61.4 61.4 61.4-61.4c4.6-4.6 12.1-4.6 16.8 0l22.3 22.3c4.7 4.6 4.7 12.1 0 16.8z"]
};
var faWindowMaximize = {
prefix: 'far',
iconName: 'window-maximize',
icon: [512, 512, [], "f2d0", "M464 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm0 394c0 3.3-2.7 6-6 6H54c-3.3 0-6-2.7-6-6V192h416v234z"]
};
var faWindowMinimize = {
prefix: 'far',
iconName: 'window-minimize',
icon: [512, 512, [], "f2d1", "M480 480H32c-17.7 0-32-14.3-32-32s14.3-32 32-32h448c17.7 0 32 14.3 32 32s-14.3 32-32 32z"]
};
var faWindowRestore = {
prefix: 'far',
iconName: 'window-restore',
icon: [512, 512, [], "f2d2", "M464 0H144c-26.5 0-48 21.5-48 48v48H48c-26.5 0-48 21.5-48 48v320c0 26.5 21.5 48 48 48h320c26.5 0 48-21.5 48-48v-48h48c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zm-96 464H48V256h320v208zm96-96h-48V144c0-26.5-21.5-48-48-48H144V48h320v320z"]
};
var _iconsCache = {
faAddressBook: faAddressBook,
faAddressCard: faAddressCard,
faAngry: faAngry,
faArrowAltCircleDown: faArrowAltCircleDown,
faArrowAltCircleLeft: faArrowAltCircleLeft,
faArrowAltCircleRight: faArrowAltCircleRight,
faArrowAltCircleUp: faArrowAltCircleUp,
faBell: faBell,
faBellSlash: faBellSlash,
faBookmark: faBookmark,
faBuilding: faBuilding,
faCalendar: faCalendar,
faCalendarAlt: faCalendarAlt,
faCalendarCheck: faCalendarCheck,
faCalendarMinus: faCalendarMinus,
faCalendarPlus: faCalendarPlus,
faCalendarTimes: faCalendarTimes,
faCaretSquareDown: faCaretSquareDown,
faCaretSquareLeft: faCaretSquareLeft,
faCaretSquareRight: faCaretSquareRight,
faCaretSquareUp: faCaretSquareUp,
faChartBar: faChartBar,
faCheckCircle: faCheckCircle,
faCheckSquare: faCheckSquare,
faCircle: faCircle,
faClipboard: faClipboard,
faClock: faClock,
faClone: faClone,
faClosedCaptioning: faClosedCaptioning,
faComment: faComment,
faCommentAlt: faCommentAlt,
faCommentDots: faCommentDots,
faComments: faComments,
faCompass: faCompass,
faCopy: faCopy,
faCopyright: faCopyright,
faCreditCard: faCreditCard,
faDizzy: faDizzy,
faDotCircle: faDotCircle,
faEdit: faEdit,
faEnvelope: faEnvelope,
faEnvelopeOpen: faEnvelopeOpen,
faEye: faEye,
faEyeSlash: faEyeSlash,
faFile: faFile,
faFileAlt: faFileAlt,
faFileArchive: faFileArchive,
faFileAudio: faFileAudio,
faFileCode: faFileCode,
faFileExcel: faFileExcel,
faFileImage: faFileImage,
faFilePdf: faFilePdf,
faFilePowerpoint: faFilePowerpoint,
faFileVideo: faFileVideo,
faFileWord: faFileWord,
faFlag: faFlag,
faFlushed: faFlushed,
faFolder: faFolder,
faFolderOpen: faFolderOpen,
faFontAwesomeLogoFull: faFontAwesomeLogoFull,
faFrown: faFrown,
faFrownOpen: faFrownOpen,
faFutbol: faFutbol,
faGem: faGem,
faGrimace: faGrimace,
faGrin: faGrin,
faGrinAlt: faGrinAlt,
faGrinBeam: faGrinBeam,
faGrinBeamSweat: faGrinBeamSweat,
faGrinHearts: faGrinHearts,
faGrinSquint: faGrinSquint,
faGrinSquintTears: faGrinSquintTears,
faGrinStars: faGrinStars,
faGrinTears: faGrinTears,
faGrinTongue: faGrinTongue,
faGrinTongueSquint: faGrinTongueSquint,
faGrinTongueWink: faGrinTongueWink,
faGrinWink: faGrinWink,
faHandLizard: faHandLizard,
faHandPaper: faHandPaper,
faHandPeace: faHandPeace,
faHandPointDown: faHandPointDown,
faHandPointLeft: faHandPointLeft,
faHandPointRight: faHandPointRight,
faHandPointUp: faHandPointUp,
faHandPointer: faHandPointer,
faHandRock: faHandRock,
faHandScissors: faHandScissors,
faHandSpock: faHandSpock,
faHandshake: faHandshake,
faHdd: faHdd,
faHeart: faHeart,
faHospital: faHospital,
faHourglass: faHourglass,
faIdBadge: faIdBadge,
faIdCard: faIdCard,
faImage: faImage,
faImages: faImages,
faKeyboard: faKeyboard,
faKiss: faKiss,
faKissBeam: faKissBeam,
faKissWinkHeart: faKissWinkHeart,
faLaugh: faLaugh,
faLaughBeam: faLaughBeam,
faLaughSquint: faLaughSquint,
faLaughWink: faLaughWink,
faLemon: faLemon,
faLifeRing: faLifeRing,
faLightbulb: faLightbulb,
faListAlt: faListAlt,
faMap: faMap,
faMeh: faMeh,
faMehBlank: faMehBlank,
faMehRollingEyes: faMehRollingEyes,
faMinusSquare: faMinusSquare,
faMoneyBillAlt: faMoneyBillAlt,
faMoon: faMoon,
faNewspaper: faNewspaper,
faObjectGroup: faObjectGroup,
faObjectUngroup: faObjectUngroup,
faPaperPlane: faPaperPlane,
faPauseCircle: faPauseCircle,
faPlayCircle: faPlayCircle,
faPlusSquare: faPlusSquare,
faQuestionCircle: faQuestionCircle,
faRegistered: faRegistered,
faSadCry: faSadCry,
faSadTear: faSadTear,
faSave: faSave,
faShareSquare: faShareSquare,
faSmile: faSmile,
faSmileBeam: faSmileBeam,
faSmileWink: faSmileWink,
faSnowflake: faSnowflake,
faSquare: faSquare,
faStar: faStar,
faStarHalf: faStarHalf,
faStickyNote: faStickyNote,
faStopCircle: faStopCircle,
faSun: faSun,
faSurprise: faSurprise,
faThumbsDown: faThumbsDown,
faThumbsUp: faThumbsUp,
faTimesCircle: faTimesCircle,
faTired: faTired,
faTrashAlt: faTrashAlt,
faUser: faUser,
faUserCircle: faUserCircle,
faWindowClose: faWindowClose,
faWindowMaximize: faWindowMaximize,
faWindowMinimize: faWindowMinimize,
faWindowRestore: faWindowRestore
};
/***/ }),
/***/ "./node_modules/@fortawesome/free-solid-svg-icons/index.es.js":
/*!********************************************************************!*\
!*** ./node_modules/@fortawesome/free-solid-svg-icons/index.es.js ***!
\********************************************************************/
/*! exports provided: fas, prefix, faAd, faAddressBook, faAddressCard, faAdjust, faAirFreshener, faAlignCenter, faAlignJustify, faAlignLeft, faAlignRight, faAllergies, faAmbulance, faAmericanSignLanguageInterpreting, faAnchor, faAngleDoubleDown, faAngleDoubleLeft, faAngleDoubleRight, faAngleDoubleUp, faAngleDown, faAngleLeft, faAngleRight, faAngleUp, faAngry, faAnkh, faAppleAlt, faArchive, faArchway, faArrowAltCircleDown, faArrowAltCircleLeft, faArrowAltCircleRight, faArrowAltCircleUp, faArrowCircleDown, faArrowCircleLeft, faArrowCircleRight, faArrowCircleUp, faArrowDown, faArrowLeft, faArrowRight, faArrowUp, faArrowsAlt, faArrowsAltH, faArrowsAltV, faAssistiveListeningSystems, faAsterisk, faAt, faAtlas, faAtom, faAudioDescription, faAward, faBaby, faBabyCarriage, faBackspace, faBackward, faBacon, faBacteria, faBacterium, faBahai, faBalanceScale, faBalanceScaleLeft, faBalanceScaleRight, faBan, faBandAid, faBarcode, faBars, faBaseballBall, faBasketballBall, faBath, faBatteryEmpty, faBatteryFull, faBatteryHalf, faBatteryQuarter, faBatteryThreeQuarters, faBed, faBeer, faBell, faBellSlash, faBezierCurve, faBible, faBicycle, faBiking, faBinoculars, faBiohazard, faBirthdayCake, faBlender, faBlenderPhone, faBlind, faBlog, faBold, faBolt, faBomb, faBone, faBong, faBook, faBookDead, faBookMedical, faBookOpen, faBookReader, faBookmark, faBorderAll, faBorderNone, faBorderStyle, faBowlingBall, faBox, faBoxOpen, faBoxTissue, faBoxes, faBraille, faBrain, faBreadSlice, faBriefcase, faBriefcaseMedical, faBroadcastTower, faBroom, faBrush, faBug, faBuilding, faBullhorn, faBullseye, faBurn, faBus, faBusAlt, faBusinessTime, faCalculator, faCalendar, faCalendarAlt, faCalendarCheck, faCalendarDay, faCalendarMinus, faCalendarPlus, faCalendarTimes, faCalendarWeek, faCamera, faCameraRetro, faCampground, faCandyCane, faCannabis, faCapsules, faCar, faCarAlt, faCarBattery, faCarCrash, faCarSide, faCaravan, faCaretDown, faCaretLeft, faCaretRight, faCaretSquareDown, faCaretSquareLeft, faCaretSquareRight, faCaretSquareUp, faCaretUp, faCarrot, faCartArrowDown, faCartPlus, faCashRegister, faCat, faCertificate, faChair, faChalkboard, faChalkboardTeacher, faChargingStation, faChartArea, faChartBar, faChartLine, faChartPie, faCheck, faCheckCircle, faCheckDouble, faCheckSquare, faCheese, faChess, faChessBishop, faChessBoard, faChessKing, faChessKnight, faChessPawn, faChessQueen, faChessRook, faChevronCircleDown, faChevronCircleLeft, faChevronCircleRight, faChevronCircleUp, faChevronDown, faChevronLeft, faChevronRight, faChevronUp, faChild, faChurch, faCircle, faCircleNotch, faCity, faClinicMedical, faClipboard, faClipboardCheck, faClipboardList, faClock, faClone, faClosedCaptioning, faCloud, faCloudDownloadAlt, faCloudMeatball, faCloudMoon, faCloudMoonRain, faCloudRain, faCloudShowersHeavy, faCloudSun, faCloudSunRain, faCloudUploadAlt, faCocktail, faCode, faCodeBranch, faCoffee, faCog, faCogs, faCoins, faColumns, faComment, faCommentAlt, faCommentDollar, faCommentDots, faCommentMedical, faCommentSlash, faComments, faCommentsDollar, faCompactDisc, faCompass, faCompress, faCompressAlt, faCompressArrowsAlt, faConciergeBell, faCookie, faCookieBite, faCopy, faCopyright, faCouch, faCreditCard, faCrop, faCropAlt, faCross, faCrosshairs, faCrow, faCrown, faCrutch, faCube, faCubes, faCut, faDatabase, faDeaf, faDemocrat, faDesktop, faDharmachakra, faDiagnoses, faDice, faDiceD20, faDiceD6, faDiceFive, faDiceFour, faDiceOne, faDiceSix, faDiceThree, faDiceTwo, faDigitalTachograph, faDirections, faDisease, faDivide, faDizzy, faDna, faDog, faDollarSign, faDolly, faDollyFlatbed, faDonate, faDoorClosed, faDoorOpen, faDotCircle, faDove, faDownload, faDraftingCompass, faDragon, faDrawPolygon, faDrum, faDrumSteelpan, faDrumstickBite, faDumbbell, faDumpster, faDumpsterFire, faDungeon, faEdit, faEgg, faEject, faEllipsisH, faEllipsisV, faEnvelope, faEnvelopeOpen, faEnvelopeOpenText, faEnvelopeSquare, faEquals, faEraser, faEthernet, faEuroSign, faExchangeAlt, faExclamation, faExclamationCircle, faExclamationTriangle, faExpand, faExpandAlt, faExpandArrowsAlt, faExternalLinkAlt, faExternalLinkSquareAlt, faEye, faEyeDropper, faEyeSlash, faFan, faFastBackward, faFastForward, faFaucet, faFax, faFeather, faFeatherAlt, faFemale, faFighterJet, faFile, faFileAlt, faFileArchive, faFileAudio, faFileCode, faFileContract, faFileCsv, faFileDownload, faFileExcel, faFileExport, faFileImage, faFileImport, faFileInvoice, faFileInvoiceDollar, faFileMedical, faFileMedicalAlt, faFilePdf, faFilePowerpoint, faFilePrescription, faFileSignature, faFileUpload, faFileVideo, faFileWord, faFill, faFillDrip, faFilm, faFilter, faFingerprint, faFire, faFireAlt, faFireExtinguisher, faFirstAid, faFish, faFistRaised, faFlag, faFlagCheckered, faFlagUsa, faFlask, faFlushed, faFolder, faFolderMinus, faFolderOpen, faFolderPlus, faFont, faFontAwesomeLogoFull, faFootballBall, faForward, faFrog, faFrown, faFrownOpen, faFunnelDollar, faFutbol, faGamepad, faGasPump, faGavel, faGem, faGenderless, faGhost, faGift, faGifts, faGlassCheers, faGlassMartini, faGlassMartiniAlt, faGlassWhiskey, faGlasses, faGlobe, faGlobeAfrica, faGlobeAmericas, faGlobeAsia, faGlobeEurope, faGolfBall, faGopuram, faGraduationCap, faGreaterThan, faGreaterThanEqual, faGrimace, faGrin, faGrinAlt, faGrinBeam, faGrinBeamSweat, faGrinHearts, faGrinSquint, faGrinSquintTears, faGrinStars, faGrinTears, faGrinTongue, faGrinTongueSquint, faGrinTongueWink, faGrinWink, faGripHorizontal, faGripLines, faGripLinesVertical, faGripVertical, faGuitar, faHSquare, faHamburger, faHammer, faHamsa, faHandHolding, faHandHoldingHeart, faHandHoldingMedical, faHandHoldingUsd, faHandHoldingWater, faHandLizard, faHandMiddleFinger, faHandPaper, faHandPeace, faHandPointDown, faHandPointLeft, faHandPointRight, faHandPointUp, faHandPointer, faHandRock, faHandScissors, faHandSparkles, faHandSpock, faHands, faHandsHelping, faHandsWash, faHandshake, faHandshakeAltSlash, faHandshakeSlash, faHanukiah, faHardHat, faHashtag, faHatCowboy, faHatCowboySide, faHatWizard, faHdd, faHeadSideCough, faHeadSideCoughSlash, faHeadSideMask, faHeadSideVirus, faHeading, faHeadphones, faHeadphonesAlt, faHeadset, faHeart, faHeartBroken, faHeartbeat, faHelicopter, faHighlighter, faHiking, faHippo, faHistory, faHockeyPuck, faHollyBerry, faHome, faHorse, faHorseHead, faHospital, faHospitalAlt, faHospitalSymbol, faHospitalUser, faHotTub, faHotdog, faHotel, faHourglass, faHourglassEnd, faHourglassHalf, faHourglassStart, faHouseDamage, faHouseUser, faHryvnia, faICursor, faIceCream, faIcicles, faIcons, faIdBadge, faIdCard, faIdCardAlt, faIgloo, faImage, faImages, faInbox, faIndent, faIndustry, faInfinity, faInfo, faInfoCircle, faItalic, faJedi, faJoint, faJournalWhills, faKaaba, faKey, faKeyboard, faKhanda, faKiss, faKissBeam, faKissWinkHeart, faKiwiBird, faLandmark, faLanguage, faLaptop, faLaptopCode, faLaptopHouse, faLaptopMedical, faLaugh, faLaughBeam, faLaughSquint, faLaughWink, faLayerGroup, faLeaf, faLemon, faLessThan, faLessThanEqual, faLevelDownAlt, faLevelUpAlt, faLifeRing, faLightbulb, faLink, faLiraSign, faList, faListAlt, faListOl, faListUl, faLocationArrow, faLock, faLockOpen, faLongArrowAltDown, faLongArrowAltLeft, faLongArrowAltRight, faLongArrowAltUp, faLowVision, faLuggageCart, faLungs, faLungsVirus, faMagic, faMagnet, faMailBulk, faMale, faMap, faMapMarked, faMapMarkedAlt, faMapMarker, faMapMarkerAlt, faMapPin, faMapSigns, faMarker, faMars, faMarsDouble, faMarsStroke, faMarsStrokeH, faMarsStrokeV, faMask, faMedal, faMedkit, faMeh, faMehBlank, faMehRollingEyes, faMemory, faMenorah, faMercury, faMeteor, faMicrochip, faMicrophone, faMicrophoneAlt, faMicrophoneAltSlash, faMicrophoneSlash, faMicroscope, faMinus, faMinusCircle, faMinusSquare, faMitten, faMobile, faMobileAlt, faMoneyBill, faMoneyBillAlt, faMoneyBillWave, faMoneyBillWaveAlt, faMoneyCheck, faMoneyCheckAlt, faMonument, faMoon, faMortarPestle, faMosque, faMotorcycle, faMountain, faMouse, faMousePointer, faMugHot, faMusic, faNetworkWired, faNeuter, faNewspaper, faNotEqual, faNotesMedical, faObjectGroup, faObjectUngroup, faOilCan, faOm, faOtter, faOutdent, faPager, faPaintBrush, faPaintRoller, faPalette, faPallet, faPaperPlane, faPaperclip, faParachuteBox, faParagraph, faParking, faPassport, faPastafarianism, faPaste, faPause, faPauseCircle, faPaw, faPeace, faPen, faPenAlt, faPenFancy, faPenNib, faPenSquare, faPencilAlt, faPencilRuler, faPeopleArrows, faPeopleCarry, faPepperHot, faPercent, faPercentage, faPersonBooth, faPhone, faPhoneAlt, faPhoneSlash, faPhoneSquare, faPhoneSquareAlt, faPhoneVolume, faPhotoVideo, faPiggyBank, faPills, faPizzaSlice, faPlaceOfWorship, faPlane, faPlaneArrival, faPlaneDeparture, faPlaneSlash, faPlay, faPlayCircle, faPlug, faPlus, faPlusCircle, faPlusSquare, faPodcast, faPoll, faPollH, faPoo, faPooStorm, faPoop, faPortrait, faPoundSign, faPowerOff, faPray, faPrayingHands, faPrescription, faPrescriptionBottle, faPrescriptionBottleAlt, faPrint, faProcedures, faProjectDiagram, faPumpMedical, faPumpSoap, faPuzzlePiece, faQrcode, faQuestion, faQuestionCircle, faQuidditch, faQuoteLeft, faQuoteRight, faQuran, faRadiation, faRadiationAlt, faRainbow, faRandom, faReceipt, faRecordVinyl, faRecycle, faRedo, faRedoAlt, faRegistered, faRemoveFormat, faReply, faReplyAll, faRepublican, faRestroom, faRetweet, faRibbon, faRing, faRoad, faRobot, faRocket, faRoute, faRss, faRssSquare, faRubleSign, faRuler, faRulerCombined, faRulerHorizontal, faRulerVertical, faRunning, faRupeeSign, faSadCry, faSadTear, faSatellite, faSatelliteDish, faSave, faSchool, faScrewdriver, faScroll, faSdCard, faSearch, faSearchDollar, faSearchLocation, faSearchMinus, faSearchPlus, faSeedling, faServer, faShapes, faShare, faShareAlt, faShareAltSquare, faShareSquare, faShekelSign, faShieldAlt, faShieldVirus, faShip, faShippingFast, faShoePrints, faShoppingBag, faShoppingBasket, faShoppingCart, faShower, faShuttleVan, faSign, faSignInAlt, faSignLanguage, faSignOutAlt, faSignal, faSignature, faSimCard, faSink, faSitemap, faSkating, faSkiing, faSkiingNordic, faSkull, faSkullCrossbones, faSlash, faSleigh, faSlidersH, faSmile, faSmileBeam, faSmileWink, faSmog, faSmoking, faSmokingBan, faSms, faSnowboarding, faSnowflake, faSnowman, faSnowplow, faSoap, faSocks, faSolarPanel, faSort, faSortAlphaDown, faSortAlphaDownAlt, faSortAlphaUp, faSortAlphaUpAlt, faSortAmountDown, faSortAmountDownAlt, faSortAmountUp, faSortAmountUpAlt, faSortDown, faSortNumericDown, faSortNumericDownAlt, faSortNumericUp, faSortNumericUpAlt, faSortUp, faSpa, faSpaceShuttle, faSpellCheck, faSpider, faSpinner, faSplotch, faSprayCan, faSquare, faSquareFull, faSquareRootAlt, faStamp, faStar, faStarAndCrescent, faStarHalf, faStarHalfAlt, faStarOfDavid, faStarOfLife, faStepBackward, faStepForward, faStethoscope, faStickyNote, faStop, faStopCircle, faStopwatch, faStopwatch20, faStore, faStoreAlt, faStoreAltSlash, faStoreSlash, faStream, faStreetView, faStrikethrough, faStroopwafel, faSubscript, faSubway, faSuitcase, faSuitcaseRolling, faSun, faSuperscript, faSurprise, faSwatchbook, faSwimmer, faSwimmingPool, faSynagogue, faSync, faSyncAlt, faSyringe, faTable, faTableTennis, faTablet, faTabletAlt, faTablets, faTachometerAlt, faTag, faTags, faTape, faTasks, faTaxi, faTeeth, faTeethOpen, faTemperatureHigh, faTemperatureLow, faTenge, faTerminal, faTextHeight, faTextWidth, faTh, faThLarge, faThList, faTheaterMasks, faThermometer, faThermometerEmpty, faThermometerFull, faThermometerHalf, faThermometerQuarter, faThermometerThreeQuarters, faThumbsDown, faThumbsUp, faThumbtack, faTicketAlt, faTimes, faTimesCircle, faTint, faTintSlash, faTired, faToggleOff, faToggleOn, faToilet, faToiletPaper, faToiletPaperSlash, faToolbox, faTools, faTooth, faTorah, faToriiGate, faTractor, faTrademark, faTrafficLight, faTrailer, faTrain, faTram, faTransgender, faTransgenderAlt, faTrash, faTrashAlt, faTrashRestore, faTrashRestoreAlt, faTree, faTrophy, faTruck, faTruckLoading, faTruckMonster, faTruckMoving, faTruckPickup, faTshirt, faTty, faTv, faUmbrella, faUmbrellaBeach, faUnderline, faUndo, faUndoAlt, faUniversalAccess, faUniversity, faUnlink, faUnlock, faUnlockAlt, faUpload, faUser, faUserAlt, faUserAltSlash, faUserAstronaut, faUserCheck, faUserCircle, faUserClock, faUserCog, faUserEdit, faUserFriends, faUserGraduate, faUserInjured, faUserLock, faUserMd, faUserMinus, faUserNinja, faUserNurse, faUserPlus, faUserSecret, faUserShield, faUserSlash, faUserTag, faUserTie, faUserTimes, faUsers, faUsersCog, faUsersSlash, faUtensilSpoon, faUtensils, faVectorSquare, faVenus, faVenusDouble, faVenusMars, faVial, faVials, faVideo, faVideoSlash, faVihara, faVirus, faVirusSlash, faViruses, faVoicemail, faVolleyballBall, faVolumeDown, faVolumeMute, faVolumeOff, faVolumeUp, faVoteYea, faVrCardboard, faWalking, faWallet, faWarehouse, faWater, faWaveSquare, faWeight, faWeightHanging, faWheelchair, faWifi, faWind, faWindowClose, faWindowMaximize, faWindowMinimize, faWindowRestore, faWineBottle, faWineGlass, faWineGlassAlt, faWonSign, faWrench, faXRay, faYenSign, faYinYang */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "fas", function() { return _iconsCache; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "prefix", function() { return prefix; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAd", function() { return faAd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAddressBook", function() { return faAddressBook; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAddressCard", function() { return faAddressCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAdjust", function() { return faAdjust; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAirFreshener", function() { return faAirFreshener; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAlignCenter", function() { return faAlignCenter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAlignJustify", function() { return faAlignJustify; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAlignLeft", function() { return faAlignLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAlignRight", function() { return faAlignRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAllergies", function() { return faAllergies; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAmbulance", function() { return faAmbulance; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAmericanSignLanguageInterpreting", function() { return faAmericanSignLanguageInterpreting; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAnchor", function() { return faAnchor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleDoubleDown", function() { return faAngleDoubleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleDoubleLeft", function() { return faAngleDoubleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleDoubleRight", function() { return faAngleDoubleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleDoubleUp", function() { return faAngleDoubleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleDown", function() { return faAngleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleLeft", function() { return faAngleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleRight", function() { return faAngleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngleUp", function() { return faAngleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAngry", function() { return faAngry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAnkh", function() { return faAnkh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAppleAlt", function() { return faAppleAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArchive", function() { return faArchive; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArchway", function() { return faArchway; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleDown", function() { return faArrowAltCircleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleLeft", function() { return faArrowAltCircleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleRight", function() { return faArrowAltCircleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowAltCircleUp", function() { return faArrowAltCircleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowCircleDown", function() { return faArrowCircleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowCircleLeft", function() { return faArrowCircleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowCircleRight", function() { return faArrowCircleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowCircleUp", function() { return faArrowCircleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowDown", function() { return faArrowDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowLeft", function() { return faArrowLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowRight", function() { return faArrowRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowUp", function() { return faArrowUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowsAlt", function() { return faArrowsAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowsAltH", function() { return faArrowsAltH; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faArrowsAltV", function() { return faArrowsAltV; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAssistiveListeningSystems", function() { return faAssistiveListeningSystems; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAsterisk", function() { return faAsterisk; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAt", function() { return faAt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAtlas", function() { return faAtlas; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAtom", function() { return faAtom; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAudioDescription", function() { return faAudioDescription; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faAward", function() { return faAward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBaby", function() { return faBaby; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBabyCarriage", function() { return faBabyCarriage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBackspace", function() { return faBackspace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBackward", function() { return faBackward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBacon", function() { return faBacon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBacteria", function() { return faBacteria; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBacterium", function() { return faBacterium; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBahai", function() { return faBahai; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBalanceScale", function() { return faBalanceScale; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBalanceScaleLeft", function() { return faBalanceScaleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBalanceScaleRight", function() { return faBalanceScaleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBan", function() { return faBan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBandAid", function() { return faBandAid; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBarcode", function() { return faBarcode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBars", function() { return faBars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBaseballBall", function() { return faBaseballBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBasketballBall", function() { return faBasketballBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBath", function() { return faBath; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBatteryEmpty", function() { return faBatteryEmpty; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBatteryFull", function() { return faBatteryFull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBatteryHalf", function() { return faBatteryHalf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBatteryQuarter", function() { return faBatteryQuarter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBatteryThreeQuarters", function() { return faBatteryThreeQuarters; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBed", function() { return faBed; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBeer", function() { return faBeer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBell", function() { return faBell; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBellSlash", function() { return faBellSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBezierCurve", function() { return faBezierCurve; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBible", function() { return faBible; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBicycle", function() { return faBicycle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBiking", function() { return faBiking; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBinoculars", function() { return faBinoculars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBiohazard", function() { return faBiohazard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBirthdayCake", function() { return faBirthdayCake; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBlender", function() { return faBlender; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBlenderPhone", function() { return faBlenderPhone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBlind", function() { return faBlind; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBlog", function() { return faBlog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBold", function() { return faBold; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBolt", function() { return faBolt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBomb", function() { return faBomb; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBone", function() { return faBone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBong", function() { return faBong; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBook", function() { return faBook; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookDead", function() { return faBookDead; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookMedical", function() { return faBookMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookOpen", function() { return faBookOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookReader", function() { return faBookReader; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBookmark", function() { return faBookmark; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBorderAll", function() { return faBorderAll; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBorderNone", function() { return faBorderNone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBorderStyle", function() { return faBorderStyle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBowlingBall", function() { return faBowlingBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBox", function() { return faBox; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBoxOpen", function() { return faBoxOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBoxTissue", function() { return faBoxTissue; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBoxes", function() { return faBoxes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBraille", function() { return faBraille; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBrain", function() { return faBrain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBreadSlice", function() { return faBreadSlice; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBriefcase", function() { return faBriefcase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBriefcaseMedical", function() { return faBriefcaseMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBroadcastTower", function() { return faBroadcastTower; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBroom", function() { return faBroom; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBrush", function() { return faBrush; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBug", function() { return faBug; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBuilding", function() { return faBuilding; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBullhorn", function() { return faBullhorn; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBullseye", function() { return faBullseye; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBurn", function() { return faBurn; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBus", function() { return faBus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBusAlt", function() { return faBusAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faBusinessTime", function() { return faBusinessTime; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalculator", function() { return faCalculator; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendar", function() { return faCalendar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarAlt", function() { return faCalendarAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarCheck", function() { return faCalendarCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarDay", function() { return faCalendarDay; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarMinus", function() { return faCalendarMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarPlus", function() { return faCalendarPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarTimes", function() { return faCalendarTimes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCalendarWeek", function() { return faCalendarWeek; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCamera", function() { return faCamera; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCameraRetro", function() { return faCameraRetro; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCampground", function() { return faCampground; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCandyCane", function() { return faCandyCane; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCannabis", function() { return faCannabis; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCapsules", function() { return faCapsules; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCar", function() { return faCar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCarAlt", function() { return faCarAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCarBattery", function() { return faCarBattery; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCarCrash", function() { return faCarCrash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCarSide", function() { return faCarSide; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaravan", function() { return faCaravan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretDown", function() { return faCaretDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretLeft", function() { return faCaretLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretRight", function() { return faCaretRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareDown", function() { return faCaretSquareDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareLeft", function() { return faCaretSquareLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareRight", function() { return faCaretSquareRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretSquareUp", function() { return faCaretSquareUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCaretUp", function() { return faCaretUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCarrot", function() { return faCarrot; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCartArrowDown", function() { return faCartArrowDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCartPlus", function() { return faCartPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCashRegister", function() { return faCashRegister; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCat", function() { return faCat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCertificate", function() { return faCertificate; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChair", function() { return faChair; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChalkboard", function() { return faChalkboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChalkboardTeacher", function() { return faChalkboardTeacher; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChargingStation", function() { return faChargingStation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChartArea", function() { return faChartArea; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChartBar", function() { return faChartBar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChartLine", function() { return faChartLine; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChartPie", function() { return faChartPie; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheck", function() { return faCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheckCircle", function() { return faCheckCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheckDouble", function() { return faCheckDouble; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheckSquare", function() { return faCheckSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCheese", function() { return faCheese; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChess", function() { return faChess; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessBishop", function() { return faChessBishop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessBoard", function() { return faChessBoard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessKing", function() { return faChessKing; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessKnight", function() { return faChessKnight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessPawn", function() { return faChessPawn; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessQueen", function() { return faChessQueen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChessRook", function() { return faChessRook; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronCircleDown", function() { return faChevronCircleDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronCircleLeft", function() { return faChevronCircleLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronCircleRight", function() { return faChevronCircleRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronCircleUp", function() { return faChevronCircleUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronDown", function() { return faChevronDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronLeft", function() { return faChevronLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronRight", function() { return faChevronRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChevronUp", function() { return faChevronUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChild", function() { return faChild; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faChurch", function() { return faChurch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCircle", function() { return faCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCircleNotch", function() { return faCircleNotch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCity", function() { return faCity; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClinicMedical", function() { return faClinicMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClipboard", function() { return faClipboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClipboardCheck", function() { return faClipboardCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClipboardList", function() { return faClipboardList; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClock", function() { return faClock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClone", function() { return faClone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faClosedCaptioning", function() { return faClosedCaptioning; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloud", function() { return faCloud; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudDownloadAlt", function() { return faCloudDownloadAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudMeatball", function() { return faCloudMeatball; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudMoon", function() { return faCloudMoon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudMoonRain", function() { return faCloudMoonRain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudRain", function() { return faCloudRain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudShowersHeavy", function() { return faCloudShowersHeavy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudSun", function() { return faCloudSun; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudSunRain", function() { return faCloudSunRain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCloudUploadAlt", function() { return faCloudUploadAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCocktail", function() { return faCocktail; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCode", function() { return faCode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCodeBranch", function() { return faCodeBranch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCoffee", function() { return faCoffee; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCog", function() { return faCog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCogs", function() { return faCogs; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCoins", function() { return faCoins; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faColumns", function() { return faColumns; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faComment", function() { return faComment; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentAlt", function() { return faCommentAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentDollar", function() { return faCommentDollar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentDots", function() { return faCommentDots; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentMedical", function() { return faCommentMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentSlash", function() { return faCommentSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faComments", function() { return faComments; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCommentsDollar", function() { return faCommentsDollar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompactDisc", function() { return faCompactDisc; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompass", function() { return faCompass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompress", function() { return faCompress; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompressAlt", function() { return faCompressAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCompressArrowsAlt", function() { return faCompressArrowsAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faConciergeBell", function() { return faConciergeBell; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCookie", function() { return faCookie; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCookieBite", function() { return faCookieBite; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCopy", function() { return faCopy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCopyright", function() { return faCopyright; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCouch", function() { return faCouch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCreditCard", function() { return faCreditCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCrop", function() { return faCrop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCropAlt", function() { return faCropAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCross", function() { return faCross; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCrosshairs", function() { return faCrosshairs; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCrow", function() { return faCrow; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCrown", function() { return faCrown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCrutch", function() { return faCrutch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCube", function() { return faCube; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCubes", function() { return faCubes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faCut", function() { return faCut; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDatabase", function() { return faDatabase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDeaf", function() { return faDeaf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDemocrat", function() { return faDemocrat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDesktop", function() { return faDesktop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDharmachakra", function() { return faDharmachakra; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiagnoses", function() { return faDiagnoses; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDice", function() { return faDice; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceD20", function() { return faDiceD20; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceD6", function() { return faDiceD6; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceFive", function() { return faDiceFive; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceFour", function() { return faDiceFour; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceOne", function() { return faDiceOne; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceSix", function() { return faDiceSix; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceThree", function() { return faDiceThree; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDiceTwo", function() { return faDiceTwo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDigitalTachograph", function() { return faDigitalTachograph; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDirections", function() { return faDirections; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDisease", function() { return faDisease; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDivide", function() { return faDivide; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDizzy", function() { return faDizzy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDna", function() { return faDna; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDog", function() { return faDog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDollarSign", function() { return faDollarSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDolly", function() { return faDolly; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDollyFlatbed", function() { return faDollyFlatbed; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDonate", function() { return faDonate; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDoorClosed", function() { return faDoorClosed; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDoorOpen", function() { return faDoorOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDotCircle", function() { return faDotCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDove", function() { return faDove; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDownload", function() { return faDownload; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDraftingCompass", function() { return faDraftingCompass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDragon", function() { return faDragon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDrawPolygon", function() { return faDrawPolygon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDrum", function() { return faDrum; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDrumSteelpan", function() { return faDrumSteelpan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDrumstickBite", function() { return faDrumstickBite; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDumbbell", function() { return faDumbbell; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDumpster", function() { return faDumpster; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDumpsterFire", function() { return faDumpsterFire; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faDungeon", function() { return faDungeon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEdit", function() { return faEdit; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEgg", function() { return faEgg; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEject", function() { return faEject; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEllipsisH", function() { return faEllipsisH; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEllipsisV", function() { return faEllipsisV; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelope", function() { return faEnvelope; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelopeOpen", function() { return faEnvelopeOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelopeOpenText", function() { return faEnvelopeOpenText; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEnvelopeSquare", function() { return faEnvelopeSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEquals", function() { return faEquals; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEraser", function() { return faEraser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEthernet", function() { return faEthernet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEuroSign", function() { return faEuroSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExchangeAlt", function() { return faExchangeAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExclamation", function() { return faExclamation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExclamationCircle", function() { return faExclamationCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExclamationTriangle", function() { return faExclamationTriangle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExpand", function() { return faExpand; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExpandAlt", function() { return faExpandAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExpandArrowsAlt", function() { return faExpandArrowsAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExternalLinkAlt", function() { return faExternalLinkAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faExternalLinkSquareAlt", function() { return faExternalLinkSquareAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEye", function() { return faEye; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEyeDropper", function() { return faEyeDropper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faEyeSlash", function() { return faEyeSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFan", function() { return faFan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFastBackward", function() { return faFastBackward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFastForward", function() { return faFastForward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFaucet", function() { return faFaucet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFax", function() { return faFax; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFeather", function() { return faFeather; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFeatherAlt", function() { return faFeatherAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFemale", function() { return faFemale; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFighterJet", function() { return faFighterJet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFile", function() { return faFile; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileAlt", function() { return faFileAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileArchive", function() { return faFileArchive; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileAudio", function() { return faFileAudio; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileCode", function() { return faFileCode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileContract", function() { return faFileContract; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileCsv", function() { return faFileCsv; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileDownload", function() { return faFileDownload; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileExcel", function() { return faFileExcel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileExport", function() { return faFileExport; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileImage", function() { return faFileImage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileImport", function() { return faFileImport; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileInvoice", function() { return faFileInvoice; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileInvoiceDollar", function() { return faFileInvoiceDollar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileMedical", function() { return faFileMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileMedicalAlt", function() { return faFileMedicalAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilePdf", function() { return faFilePdf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilePowerpoint", function() { return faFilePowerpoint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilePrescription", function() { return faFilePrescription; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileSignature", function() { return faFileSignature; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileUpload", function() { return faFileUpload; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileVideo", function() { return faFileVideo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFileWord", function() { return faFileWord; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFill", function() { return faFill; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFillDrip", function() { return faFillDrip; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilm", function() { return faFilm; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFilter", function() { return faFilter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFingerprint", function() { return faFingerprint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFire", function() { return faFire; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFireAlt", function() { return faFireAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFireExtinguisher", function() { return faFireExtinguisher; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFirstAid", function() { return faFirstAid; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFish", function() { return faFish; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFistRaised", function() { return faFistRaised; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlag", function() { return faFlag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlagCheckered", function() { return faFlagCheckered; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlagUsa", function() { return faFlagUsa; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlask", function() { return faFlask; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFlushed", function() { return faFlushed; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolder", function() { return faFolder; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolderMinus", function() { return faFolderMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolderOpen", function() { return faFolderOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFolderPlus", function() { return faFolderPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFont", function() { return faFont; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFontAwesomeLogoFull", function() { return faFontAwesomeLogoFull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFootballBall", function() { return faFootballBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faForward", function() { return faForward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFrog", function() { return faFrog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFrown", function() { return faFrown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFrownOpen", function() { return faFrownOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFunnelDollar", function() { return faFunnelDollar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faFutbol", function() { return faFutbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGamepad", function() { return faGamepad; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGasPump", function() { return faGasPump; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGavel", function() { return faGavel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGem", function() { return faGem; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGenderless", function() { return faGenderless; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGhost", function() { return faGhost; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGift", function() { return faGift; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGifts", function() { return faGifts; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlassCheers", function() { return faGlassCheers; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlassMartini", function() { return faGlassMartini; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlassMartiniAlt", function() { return faGlassMartiniAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlassWhiskey", function() { return faGlassWhiskey; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlasses", function() { return faGlasses; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlobe", function() { return faGlobe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlobeAfrica", function() { return faGlobeAfrica; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlobeAmericas", function() { return faGlobeAmericas; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlobeAsia", function() { return faGlobeAsia; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGlobeEurope", function() { return faGlobeEurope; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGolfBall", function() { return faGolfBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGopuram", function() { return faGopuram; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGraduationCap", function() { return faGraduationCap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGreaterThan", function() { return faGreaterThan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGreaterThanEqual", function() { return faGreaterThanEqual; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrimace", function() { return faGrimace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrin", function() { return faGrin; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinAlt", function() { return faGrinAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinBeam", function() { return faGrinBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinBeamSweat", function() { return faGrinBeamSweat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinHearts", function() { return faGrinHearts; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinSquint", function() { return faGrinSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinSquintTears", function() { return faGrinSquintTears; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinStars", function() { return faGrinStars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTears", function() { return faGrinTears; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongue", function() { return faGrinTongue; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongueSquint", function() { return faGrinTongueSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinTongueWink", function() { return faGrinTongueWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGrinWink", function() { return faGrinWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGripHorizontal", function() { return faGripHorizontal; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGripLines", function() { return faGripLines; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGripLinesVertical", function() { return faGripLinesVertical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGripVertical", function() { return faGripVertical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faGuitar", function() { return faGuitar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHSquare", function() { return faHSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHamburger", function() { return faHamburger; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHammer", function() { return faHammer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHamsa", function() { return faHamsa; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandHolding", function() { return faHandHolding; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandHoldingHeart", function() { return faHandHoldingHeart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandHoldingMedical", function() { return faHandHoldingMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandHoldingUsd", function() { return faHandHoldingUsd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandHoldingWater", function() { return faHandHoldingWater; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandLizard", function() { return faHandLizard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandMiddleFinger", function() { return faHandMiddleFinger; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPaper", function() { return faHandPaper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPeace", function() { return faHandPeace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointDown", function() { return faHandPointDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointLeft", function() { return faHandPointLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointRight", function() { return faHandPointRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointUp", function() { return faHandPointUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandPointer", function() { return faHandPointer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandRock", function() { return faHandRock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandScissors", function() { return faHandScissors; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandSparkles", function() { return faHandSparkles; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandSpock", function() { return faHandSpock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHands", function() { return faHands; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandsHelping", function() { return faHandsHelping; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandsWash", function() { return faHandsWash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandshake", function() { return faHandshake; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandshakeAltSlash", function() { return faHandshakeAltSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHandshakeSlash", function() { return faHandshakeSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHanukiah", function() { return faHanukiah; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHardHat", function() { return faHardHat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHashtag", function() { return faHashtag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHatCowboy", function() { return faHatCowboy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHatCowboySide", function() { return faHatCowboySide; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHatWizard", function() { return faHatWizard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHdd", function() { return faHdd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadSideCough", function() { return faHeadSideCough; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadSideCoughSlash", function() { return faHeadSideCoughSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadSideMask", function() { return faHeadSideMask; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadSideVirus", function() { return faHeadSideVirus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeading", function() { return faHeading; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadphones", function() { return faHeadphones; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadphonesAlt", function() { return faHeadphonesAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeadset", function() { return faHeadset; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeart", function() { return faHeart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeartBroken", function() { return faHeartBroken; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHeartbeat", function() { return faHeartbeat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHelicopter", function() { return faHelicopter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHighlighter", function() { return faHighlighter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHiking", function() { return faHiking; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHippo", function() { return faHippo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHistory", function() { return faHistory; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHockeyPuck", function() { return faHockeyPuck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHollyBerry", function() { return faHollyBerry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHome", function() { return faHome; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHorse", function() { return faHorse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHorseHead", function() { return faHorseHead; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHospital", function() { return faHospital; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHospitalAlt", function() { return faHospitalAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHospitalSymbol", function() { return faHospitalSymbol; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHospitalUser", function() { return faHospitalUser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHotTub", function() { return faHotTub; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHotdog", function() { return faHotdog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHotel", function() { return faHotel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHourglass", function() { return faHourglass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHourglassEnd", function() { return faHourglassEnd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHourglassHalf", function() { return faHourglassHalf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHourglassStart", function() { return faHourglassStart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHouseDamage", function() { return faHouseDamage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHouseUser", function() { return faHouseUser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faHryvnia", function() { return faHryvnia; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faICursor", function() { return faICursor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIceCream", function() { return faIceCream; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIcicles", function() { return faIcicles; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIcons", function() { return faIcons; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIdBadge", function() { return faIdBadge; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIdCard", function() { return faIdCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIdCardAlt", function() { return faIdCardAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIgloo", function() { return faIgloo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faImage", function() { return faImage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faImages", function() { return faImages; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faInbox", function() { return faInbox; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIndent", function() { return faIndent; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faIndustry", function() { return faIndustry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faInfinity", function() { return faInfinity; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faInfo", function() { return faInfo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faInfoCircle", function() { return faInfoCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faItalic", function() { return faItalic; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faJedi", function() { return faJedi; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faJoint", function() { return faJoint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faJournalWhills", function() { return faJournalWhills; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKaaba", function() { return faKaaba; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKey", function() { return faKey; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKeyboard", function() { return faKeyboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKhanda", function() { return faKhanda; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKiss", function() { return faKiss; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKissBeam", function() { return faKissBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKissWinkHeart", function() { return faKissWinkHeart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faKiwiBird", function() { return faKiwiBird; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLandmark", function() { return faLandmark; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLanguage", function() { return faLanguage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaptop", function() { return faLaptop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaptopCode", function() { return faLaptopCode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaptopHouse", function() { return faLaptopHouse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaptopMedical", function() { return faLaptopMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaugh", function() { return faLaugh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughBeam", function() { return faLaughBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughSquint", function() { return faLaughSquint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLaughWink", function() { return faLaughWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLayerGroup", function() { return faLayerGroup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLeaf", function() { return faLeaf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLemon", function() { return faLemon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLessThan", function() { return faLessThan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLessThanEqual", function() { return faLessThanEqual; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLevelDownAlt", function() { return faLevelDownAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLevelUpAlt", function() { return faLevelUpAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLifeRing", function() { return faLifeRing; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLightbulb", function() { return faLightbulb; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLink", function() { return faLink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLiraSign", function() { return faLiraSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faList", function() { return faList; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faListAlt", function() { return faListAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faListOl", function() { return faListOl; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faListUl", function() { return faListUl; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLocationArrow", function() { return faLocationArrow; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLock", function() { return faLock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLockOpen", function() { return faLockOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLongArrowAltDown", function() { return faLongArrowAltDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLongArrowAltLeft", function() { return faLongArrowAltLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLongArrowAltRight", function() { return faLongArrowAltRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLongArrowAltUp", function() { return faLongArrowAltUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLowVision", function() { return faLowVision; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLuggageCart", function() { return faLuggageCart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLungs", function() { return faLungs; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faLungsVirus", function() { return faLungsVirus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMagic", function() { return faMagic; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMagnet", function() { return faMagnet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMailBulk", function() { return faMailBulk; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMale", function() { return faMale; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMap", function() { return faMap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapMarked", function() { return faMapMarked; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapMarkedAlt", function() { return faMapMarkedAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapMarker", function() { return faMapMarker; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapMarkerAlt", function() { return faMapMarkerAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapPin", function() { return faMapPin; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMapSigns", function() { return faMapSigns; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMarker", function() { return faMarker; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMars", function() { return faMars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMarsDouble", function() { return faMarsDouble; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMarsStroke", function() { return faMarsStroke; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMarsStrokeH", function() { return faMarsStrokeH; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMarsStrokeV", function() { return faMarsStrokeV; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMask", function() { return faMask; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMedal", function() { return faMedal; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMedkit", function() { return faMedkit; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMeh", function() { return faMeh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMehBlank", function() { return faMehBlank; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMehRollingEyes", function() { return faMehRollingEyes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMemory", function() { return faMemory; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMenorah", function() { return faMenorah; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMercury", function() { return faMercury; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMeteor", function() { return faMeteor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicrochip", function() { return faMicrochip; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicrophone", function() { return faMicrophone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicrophoneAlt", function() { return faMicrophoneAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicrophoneAltSlash", function() { return faMicrophoneAltSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicrophoneSlash", function() { return faMicrophoneSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMicroscope", function() { return faMicroscope; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMinus", function() { return faMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMinusCircle", function() { return faMinusCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMinusSquare", function() { return faMinusSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMitten", function() { return faMitten; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMobile", function() { return faMobile; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMobileAlt", function() { return faMobileAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyBill", function() { return faMoneyBill; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyBillAlt", function() { return faMoneyBillAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyBillWave", function() { return faMoneyBillWave; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyBillWaveAlt", function() { return faMoneyBillWaveAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyCheck", function() { return faMoneyCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoneyCheckAlt", function() { return faMoneyCheckAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMonument", function() { return faMonument; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMoon", function() { return faMoon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMortarPestle", function() { return faMortarPestle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMosque", function() { return faMosque; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMotorcycle", function() { return faMotorcycle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMountain", function() { return faMountain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMouse", function() { return faMouse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMousePointer", function() { return faMousePointer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMugHot", function() { return faMugHot; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faMusic", function() { return faMusic; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNetworkWired", function() { return faNetworkWired; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNeuter", function() { return faNeuter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNewspaper", function() { return faNewspaper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNotEqual", function() { return faNotEqual; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faNotesMedical", function() { return faNotesMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faObjectGroup", function() { return faObjectGroup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faObjectUngroup", function() { return faObjectUngroup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faOilCan", function() { return faOilCan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faOm", function() { return faOm; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faOtter", function() { return faOtter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faOutdent", function() { return faOutdent; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPager", function() { return faPager; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaintBrush", function() { return faPaintBrush; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaintRoller", function() { return faPaintRoller; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPalette", function() { return faPalette; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPallet", function() { return faPallet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaperPlane", function() { return faPaperPlane; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaperclip", function() { return faPaperclip; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faParachuteBox", function() { return faParachuteBox; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faParagraph", function() { return faParagraph; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faParking", function() { return faParking; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPassport", function() { return faPassport; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPastafarianism", function() { return faPastafarianism; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaste", function() { return faPaste; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPause", function() { return faPause; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPauseCircle", function() { return faPauseCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPaw", function() { return faPaw; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPeace", function() { return faPeace; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPen", function() { return faPen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPenAlt", function() { return faPenAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPenFancy", function() { return faPenFancy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPenNib", function() { return faPenNib; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPenSquare", function() { return faPenSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPencilAlt", function() { return faPencilAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPencilRuler", function() { return faPencilRuler; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPeopleArrows", function() { return faPeopleArrows; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPeopleCarry", function() { return faPeopleCarry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPepperHot", function() { return faPepperHot; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPercent", function() { return faPercent; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPercentage", function() { return faPercentage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPersonBooth", function() { return faPersonBooth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhone", function() { return faPhone; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhoneAlt", function() { return faPhoneAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhoneSlash", function() { return faPhoneSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhoneSquare", function() { return faPhoneSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhoneSquareAlt", function() { return faPhoneSquareAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhoneVolume", function() { return faPhoneVolume; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPhotoVideo", function() { return faPhotoVideo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPiggyBank", function() { return faPiggyBank; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPills", function() { return faPills; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPizzaSlice", function() { return faPizzaSlice; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlaceOfWorship", function() { return faPlaceOfWorship; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlane", function() { return faPlane; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlaneArrival", function() { return faPlaneArrival; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlaneDeparture", function() { return faPlaneDeparture; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlaneSlash", function() { return faPlaneSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlay", function() { return faPlay; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlayCircle", function() { return faPlayCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlug", function() { return faPlug; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlus", function() { return faPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlusCircle", function() { return faPlusCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPlusSquare", function() { return faPlusSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPodcast", function() { return faPodcast; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPoll", function() { return faPoll; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPollH", function() { return faPollH; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPoo", function() { return faPoo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPooStorm", function() { return faPooStorm; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPoop", function() { return faPoop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPortrait", function() { return faPortrait; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPoundSign", function() { return faPoundSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPowerOff", function() { return faPowerOff; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPray", function() { return faPray; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPrayingHands", function() { return faPrayingHands; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPrescription", function() { return faPrescription; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPrescriptionBottle", function() { return faPrescriptionBottle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPrescriptionBottleAlt", function() { return faPrescriptionBottleAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPrint", function() { return faPrint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faProcedures", function() { return faProcedures; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faProjectDiagram", function() { return faProjectDiagram; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPumpMedical", function() { return faPumpMedical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPumpSoap", function() { return faPumpSoap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faPuzzlePiece", function() { return faPuzzlePiece; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQrcode", function() { return faQrcode; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuestion", function() { return faQuestion; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuestionCircle", function() { return faQuestionCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuidditch", function() { return faQuidditch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuoteLeft", function() { return faQuoteLeft; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuoteRight", function() { return faQuoteRight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faQuran", function() { return faQuran; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRadiation", function() { return faRadiation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRadiationAlt", function() { return faRadiationAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRainbow", function() { return faRainbow; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRandom", function() { return faRandom; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faReceipt", function() { return faReceipt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRecordVinyl", function() { return faRecordVinyl; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRecycle", function() { return faRecycle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRedo", function() { return faRedo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRedoAlt", function() { return faRedoAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRegistered", function() { return faRegistered; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRemoveFormat", function() { return faRemoveFormat; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faReply", function() { return faReply; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faReplyAll", function() { return faReplyAll; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRepublican", function() { return faRepublican; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRestroom", function() { return faRestroom; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRetweet", function() { return faRetweet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRibbon", function() { return faRibbon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRing", function() { return faRing; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRoad", function() { return faRoad; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRobot", function() { return faRobot; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRocket", function() { return faRocket; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRoute", function() { return faRoute; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRss", function() { return faRss; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRssSquare", function() { return faRssSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRubleSign", function() { return faRubleSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRuler", function() { return faRuler; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRulerCombined", function() { return faRulerCombined; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRulerHorizontal", function() { return faRulerHorizontal; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRulerVertical", function() { return faRulerVertical; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRunning", function() { return faRunning; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faRupeeSign", function() { return faRupeeSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSadCry", function() { return faSadCry; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSadTear", function() { return faSadTear; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSatellite", function() { return faSatellite; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSatelliteDish", function() { return faSatelliteDish; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSave", function() { return faSave; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSchool", function() { return faSchool; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faScrewdriver", function() { return faScrewdriver; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faScroll", function() { return faScroll; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSdCard", function() { return faSdCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSearch", function() { return faSearch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSearchDollar", function() { return faSearchDollar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSearchLocation", function() { return faSearchLocation; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSearchMinus", function() { return faSearchMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSearchPlus", function() { return faSearchPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSeedling", function() { return faSeedling; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faServer", function() { return faServer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShapes", function() { return faShapes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShare", function() { return faShare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShareAlt", function() { return faShareAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShareAltSquare", function() { return faShareAltSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShareSquare", function() { return faShareSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShekelSign", function() { return faShekelSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShieldAlt", function() { return faShieldAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShieldVirus", function() { return faShieldVirus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShip", function() { return faShip; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShippingFast", function() { return faShippingFast; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShoePrints", function() { return faShoePrints; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShoppingBag", function() { return faShoppingBag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShoppingBasket", function() { return faShoppingBasket; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShoppingCart", function() { return faShoppingCart; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShower", function() { return faShower; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faShuttleVan", function() { return faShuttleVan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSign", function() { return faSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSignInAlt", function() { return faSignInAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSignLanguage", function() { return faSignLanguage; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSignOutAlt", function() { return faSignOutAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSignal", function() { return faSignal; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSignature", function() { return faSignature; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSimCard", function() { return faSimCard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSink", function() { return faSink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSitemap", function() { return faSitemap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSkating", function() { return faSkating; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSkiing", function() { return faSkiing; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSkiingNordic", function() { return faSkiingNordic; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSkull", function() { return faSkull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSkullCrossbones", function() { return faSkullCrossbones; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSlash", function() { return faSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSleigh", function() { return faSleigh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSlidersH", function() { return faSlidersH; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmile", function() { return faSmile; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmileBeam", function() { return faSmileBeam; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmileWink", function() { return faSmileWink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmog", function() { return faSmog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmoking", function() { return faSmoking; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSmokingBan", function() { return faSmokingBan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSms", function() { return faSms; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSnowboarding", function() { return faSnowboarding; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSnowflake", function() { return faSnowflake; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSnowman", function() { return faSnowman; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSnowplow", function() { return faSnowplow; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSoap", function() { return faSoap; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSocks", function() { return faSocks; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSolarPanel", function() { return faSolarPanel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSort", function() { return faSort; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAlphaDown", function() { return faSortAlphaDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAlphaDownAlt", function() { return faSortAlphaDownAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAlphaUp", function() { return faSortAlphaUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAlphaUpAlt", function() { return faSortAlphaUpAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAmountDown", function() { return faSortAmountDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAmountDownAlt", function() { return faSortAmountDownAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAmountUp", function() { return faSortAmountUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortAmountUpAlt", function() { return faSortAmountUpAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortDown", function() { return faSortDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortNumericDown", function() { return faSortNumericDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortNumericDownAlt", function() { return faSortNumericDownAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortNumericUp", function() { return faSortNumericUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortNumericUpAlt", function() { return faSortNumericUpAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSortUp", function() { return faSortUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSpa", function() { return faSpa; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSpaceShuttle", function() { return faSpaceShuttle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSpellCheck", function() { return faSpellCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSpider", function() { return faSpider; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSpinner", function() { return faSpinner; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSplotch", function() { return faSplotch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSprayCan", function() { return faSprayCan; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSquare", function() { return faSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSquareFull", function() { return faSquareFull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSquareRootAlt", function() { return faSquareRootAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStamp", function() { return faStamp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStar", function() { return faStar; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarAndCrescent", function() { return faStarAndCrescent; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarHalf", function() { return faStarHalf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarHalfAlt", function() { return faStarHalfAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarOfDavid", function() { return faStarOfDavid; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStarOfLife", function() { return faStarOfLife; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStepBackward", function() { return faStepBackward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStepForward", function() { return faStepForward; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStethoscope", function() { return faStethoscope; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStickyNote", function() { return faStickyNote; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStop", function() { return faStop; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStopCircle", function() { return faStopCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStopwatch", function() { return faStopwatch; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStopwatch20", function() { return faStopwatch20; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStore", function() { return faStore; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStoreAlt", function() { return faStoreAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStoreAltSlash", function() { return faStoreAltSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStoreSlash", function() { return faStoreSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStream", function() { return faStream; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStreetView", function() { return faStreetView; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStrikethrough", function() { return faStrikethrough; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faStroopwafel", function() { return faStroopwafel; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSubscript", function() { return faSubscript; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSubway", function() { return faSubway; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSuitcase", function() { return faSuitcase; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSuitcaseRolling", function() { return faSuitcaseRolling; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSun", function() { return faSun; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSuperscript", function() { return faSuperscript; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSurprise", function() { return faSurprise; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSwatchbook", function() { return faSwatchbook; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSwimmer", function() { return faSwimmer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSwimmingPool", function() { return faSwimmingPool; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSynagogue", function() { return faSynagogue; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSync", function() { return faSync; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSyncAlt", function() { return faSyncAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faSyringe", function() { return faSyringe; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTable", function() { return faTable; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTableTennis", function() { return faTableTennis; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTablet", function() { return faTablet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTabletAlt", function() { return faTabletAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTablets", function() { return faTablets; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTachometerAlt", function() { return faTachometerAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTag", function() { return faTag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTags", function() { return faTags; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTape", function() { return faTape; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTasks", function() { return faTasks; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTaxi", function() { return faTaxi; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTeeth", function() { return faTeeth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTeethOpen", function() { return faTeethOpen; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTemperatureHigh", function() { return faTemperatureHigh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTemperatureLow", function() { return faTemperatureLow; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTenge", function() { return faTenge; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTerminal", function() { return faTerminal; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTextHeight", function() { return faTextHeight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTextWidth", function() { return faTextWidth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTh", function() { return faTh; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThLarge", function() { return faThLarge; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThList", function() { return faThList; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTheaterMasks", function() { return faTheaterMasks; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometer", function() { return faThermometer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometerEmpty", function() { return faThermometerEmpty; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometerFull", function() { return faThermometerFull; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometerHalf", function() { return faThermometerHalf; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometerQuarter", function() { return faThermometerQuarter; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThermometerThreeQuarters", function() { return faThermometerThreeQuarters; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThumbsDown", function() { return faThumbsDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThumbsUp", function() { return faThumbsUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faThumbtack", function() { return faThumbtack; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTicketAlt", function() { return faTicketAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTimes", function() { return faTimes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTimesCircle", function() { return faTimesCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTint", function() { return faTint; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTintSlash", function() { return faTintSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTired", function() { return faTired; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToggleOff", function() { return faToggleOff; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToggleOn", function() { return faToggleOn; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToilet", function() { return faToilet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToiletPaper", function() { return faToiletPaper; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToiletPaperSlash", function() { return faToiletPaperSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToolbox", function() { return faToolbox; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTools", function() { return faTools; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTooth", function() { return faTooth; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTorah", function() { return faTorah; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faToriiGate", function() { return faToriiGate; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTractor", function() { return faTractor; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrademark", function() { return faTrademark; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrafficLight", function() { return faTrafficLight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrailer", function() { return faTrailer; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrain", function() { return faTrain; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTram", function() { return faTram; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTransgender", function() { return faTransgender; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTransgenderAlt", function() { return faTransgenderAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrash", function() { return faTrash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrashAlt", function() { return faTrashAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrashRestore", function() { return faTrashRestore; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrashRestoreAlt", function() { return faTrashRestoreAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTree", function() { return faTree; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTrophy", function() { return faTrophy; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTruck", function() { return faTruck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTruckLoading", function() { return faTruckLoading; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTruckMonster", function() { return faTruckMonster; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTruckMoving", function() { return faTruckMoving; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTruckPickup", function() { return faTruckPickup; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTshirt", function() { return faTshirt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTty", function() { return faTty; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faTv", function() { return faTv; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUmbrella", function() { return faUmbrella; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUmbrellaBeach", function() { return faUmbrellaBeach; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUnderline", function() { return faUnderline; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUndo", function() { return faUndo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUndoAlt", function() { return faUndoAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUniversalAccess", function() { return faUniversalAccess; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUniversity", function() { return faUniversity; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUnlink", function() { return faUnlink; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUnlock", function() { return faUnlock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUnlockAlt", function() { return faUnlockAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUpload", function() { return faUpload; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUser", function() { return faUser; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserAlt", function() { return faUserAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserAltSlash", function() { return faUserAltSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserAstronaut", function() { return faUserAstronaut; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserCheck", function() { return faUserCheck; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserCircle", function() { return faUserCircle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserClock", function() { return faUserClock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserCog", function() { return faUserCog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserEdit", function() { return faUserEdit; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserFriends", function() { return faUserFriends; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserGraduate", function() { return faUserGraduate; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserInjured", function() { return faUserInjured; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserLock", function() { return faUserLock; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserMd", function() { return faUserMd; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserMinus", function() { return faUserMinus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserNinja", function() { return faUserNinja; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserNurse", function() { return faUserNurse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserPlus", function() { return faUserPlus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserSecret", function() { return faUserSecret; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserShield", function() { return faUserShield; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserSlash", function() { return faUserSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserTag", function() { return faUserTag; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserTie", function() { return faUserTie; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUserTimes", function() { return faUserTimes; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUsers", function() { return faUsers; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUsersCog", function() { return faUsersCog; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUsersSlash", function() { return faUsersSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUtensilSpoon", function() { return faUtensilSpoon; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faUtensils", function() { return faUtensils; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVectorSquare", function() { return faVectorSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVenus", function() { return faVenus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVenusDouble", function() { return faVenusDouble; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVenusMars", function() { return faVenusMars; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVial", function() { return faVial; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVials", function() { return faVials; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVideo", function() { return faVideo; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVideoSlash", function() { return faVideoSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVihara", function() { return faVihara; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVirus", function() { return faVirus; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVirusSlash", function() { return faVirusSlash; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faViruses", function() { return faViruses; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVoicemail", function() { return faVoicemail; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVolleyballBall", function() { return faVolleyballBall; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVolumeDown", function() { return faVolumeDown; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVolumeMute", function() { return faVolumeMute; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVolumeOff", function() { return faVolumeOff; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVolumeUp", function() { return faVolumeUp; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVoteYea", function() { return faVoteYea; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faVrCardboard", function() { return faVrCardboard; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWalking", function() { return faWalking; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWallet", function() { return faWallet; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWarehouse", function() { return faWarehouse; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWater", function() { return faWater; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWaveSquare", function() { return faWaveSquare; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWeight", function() { return faWeight; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWeightHanging", function() { return faWeightHanging; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWheelchair", function() { return faWheelchair; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWifi", function() { return faWifi; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWind", function() { return faWind; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowClose", function() { return faWindowClose; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowMaximize", function() { return faWindowMaximize; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowMinimize", function() { return faWindowMinimize; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWindowRestore", function() { return faWindowRestore; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWineBottle", function() { return faWineBottle; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWineGlass", function() { return faWineGlass; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWineGlassAlt", function() { return faWineGlassAlt; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWonSign", function() { return faWonSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faWrench", function() { return faWrench; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faXRay", function() { return faXRay; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faYenSign", function() { return faYenSign; });
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "faYinYang", function() { return faYinYang; });
var prefix = "fas";
var faAd = {
prefix: 'fas',
iconName: 'ad',
icon: [512, 512, [], "f641", "M157.52 272h36.96L176 218.78 157.52 272zM352 256c-13.23 0-24 10.77-24 24s10.77 24 24 24 24-10.77 24-24-10.77-24-24-24zM464 64H48C21.5 64 0 85.5 0 112v288c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM250.58 352h-16.94c-6.81 0-12.88-4.32-15.12-10.75L211.15 320h-70.29l-7.38 21.25A16 16 0 0 1 118.36 352h-16.94c-11.01 0-18.73-10.85-15.12-21.25L140 176.12A23.995 23.995 0 0 1 162.67 160h26.66A23.99 23.99 0 0 1 212 176.13l53.69 154.62c3.61 10.4-4.11 21.25-15.11 21.25zM424 336c0 8.84-7.16 16-16 16h-16c-4.85 0-9.04-2.27-11.98-5.68-8.62 3.66-18.09 5.68-28.02 5.68-39.7 0-72-32.3-72-72s32.3-72 72-72c8.46 0 16.46 1.73 24 4.42V176c0-8.84 7.16-16 16-16h16c8.84 0 16 7.16 16 16v160z"]
};
var faAddressBook = {
prefix: 'fas',
iconName: 'address-book',
icon: [448, 512, [], "f2b9", "M436 160c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20V48c0-26.5-21.5-48-48-48H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h320c26.5 0 48-21.5 48-48v-48h20c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20v-64h20c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20v-64h20zm-228-32c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zm112 236.8c0 10.6-10 19.2-22.4 19.2H118.4C106 384 96 375.4 96 364.8v-19.2c0-31.8 30.1-57.6 67.2-57.6h5c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h5c37.1 0 67.2 25.8 67.2 57.6v19.2z"]
};
var faAddressCard = {
prefix: 'fas',
iconName: 'address-card',
icon: [576, 512, [], "f2bb", "M528 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm-352 96c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zm112 236.8c0 10.6-10 19.2-22.4 19.2H86.4C74 384 64 375.4 64 364.8v-19.2c0-31.8 30.1-57.6 67.2-57.6h5c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h5c37.1 0 67.2 25.8 67.2 57.6v19.2zM512 312c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16zm0-64c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16zm0-64c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16z"]
};
var faAdjust = {
prefix: 'fas',
iconName: 'adjust',
icon: [512, 512, [], "f042", "M8 256c0 136.966 111.033 248 248 248s248-111.034 248-248S392.966 8 256 8 8 119.033 8 256zm248 184V72c101.705 0 184 82.311 184 184 0 101.705-82.311 184-184 184z"]
};
var faAirFreshener = {
prefix: 'fas',
iconName: 'air-freshener',
icon: [384, 512, [], "f5d0", "M378.94 321.41L284.7 224h49.22c15.3 0 23.66-16.6 13.86-27.53L234.45 69.96c3.43-6.61 5.55-14 5.55-21.96 0-26.51-21.49-48-48-48s-48 21.49-48 48c0 7.96 2.12 15.35 5.55 21.96L36.22 196.47C26.42 207.4 34.78 224 50.08 224H99.3L5.06 321.41C-6.69 333.56 3.34 352 21.7 352H160v32H48c-8.84 0-16 7.16-16 16v96c0 8.84 7.16 16 16 16h288c8.84 0 16-7.16 16-16v-96c0-8.84-7.16-16-16-16H224v-32h138.3c18.36 0 28.39-18.44 16.64-30.59zM192 31.98c8.85 0 16.02 7.17 16.02 16.02 0 8.84-7.17 16.02-16.02 16.02S175.98 56.84 175.98 48c0-8.85 7.17-16.02 16.02-16.02zM304 432v32H80v-32h224z"]
};
var faAlignCenter = {
prefix: 'fas',
iconName: 'align-center',
icon: [448, 512, [], "f037", "M432 160H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0 256H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM108.1 96h231.81A12.09 12.09 0 0 0 352 83.9V44.09A12.09 12.09 0 0 0 339.91 32H108.1A12.09 12.09 0 0 0 96 44.09V83.9A12.1 12.1 0 0 0 108.1 96zm231.81 256A12.09 12.09 0 0 0 352 339.9v-39.81A12.09 12.09 0 0 0 339.91 288H108.1A12.09 12.09 0 0 0 96 300.09v39.81a12.1 12.1 0 0 0 12.1 12.1z"]
};
var faAlignJustify = {
prefix: 'fas',
iconName: 'align-justify',
icon: [448, 512, [], "f039", "M432 416H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-128H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-128H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-128H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faAlignLeft = {
prefix: 'fas',
iconName: 'align-left',
icon: [448, 512, [], "f036", "M12.83 352h262.34A12.82 12.82 0 0 0 288 339.17v-38.34A12.82 12.82 0 0 0 275.17 288H12.83A12.82 12.82 0 0 0 0 300.83v38.34A12.82 12.82 0 0 0 12.83 352zm0-256h262.34A12.82 12.82 0 0 0 288 83.17V44.83A12.82 12.82 0 0 0 275.17 32H12.83A12.82 12.82 0 0 0 0 44.83v38.34A12.82 12.82 0 0 0 12.83 96zM432 160H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0 256H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faAlignRight = {
prefix: 'fas',
iconName: 'align-right',
icon: [448, 512, [], "f038", "M16 224h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm416 192H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm3.17-384H172.83A12.82 12.82 0 0 0 160 44.83v38.34A12.82 12.82 0 0 0 172.83 96h262.34A12.82 12.82 0 0 0 448 83.17V44.83A12.82 12.82 0 0 0 435.17 32zm0 256H172.83A12.82 12.82 0 0 0 160 300.83v38.34A12.82 12.82 0 0 0 172.83 352h262.34A12.82 12.82 0 0 0 448 339.17v-38.34A12.82 12.82 0 0 0 435.17 288z"]
};
var faAllergies = {
prefix: 'fas',
iconName: 'allergies',
icon: [448, 512, [], "f461", "M416 112c-17.6 0-32 14.4-32 32v72c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8V64c0-17.6-14.4-32-32-32s-32 14.4-32 32v152c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8V32c0-17.6-14.4-32-32-32s-32 14.4-32 32v184c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8V64c0-17.6-14.4-32-32-32S96 46.4 96 64v241l-23.6-32.5c-13-17.9-38-21.8-55.9-8.8s-21.8 38-8.8 55.9l125.6 172.7c9 12.4 23.5 19.8 38.8 19.8h197.6c22.3 0 41.6-15.3 46.7-37l26.5-112.7c3.2-13.7 4.9-28.3 5.1-42.3V144c0-17.6-14.4-32-32-32zM176 416c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm0-96c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm64 128c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm0-96c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm64 32c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm32 64c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm32-128c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16z"]
};
var faAmbulance = {
prefix: 'fas',
iconName: 'ambulance',
icon: [640, 512, [], "f0f9", "M624 352h-16V243.9c0-12.7-5.1-24.9-14.1-33.9L494 110.1c-9-9-21.2-14.1-33.9-14.1H416V48c0-26.5-21.5-48-48-48H48C21.5 0 0 21.5 0 48v320c0 26.5 21.5 48 48 48h16c0 53 43 96 96 96s96-43 96-96h128c0 53 43 96 96 96s96-43 96-96h48c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM160 464c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm144-248c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8v48zm176 248c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm80-208H416V144h44.1l99.9 99.9V256z"]
};
var faAmericanSignLanguageInterpreting = {
prefix: 'fas',
iconName: 'american-sign-language-interpreting',
icon: [640, 512, [], "f2a3", "M290.547 189.039c-20.295-10.149-44.147-11.199-64.739-3.89 42.606 0 71.208 20.475 85.578 50.576 8.576 17.899-5.148 38.071-23.617 38.071 18.429 0 32.211 20.136 23.617 38.071-14.725 30.846-46.123 50.854-80.298 50.854-.557 0-94.471-8.615-94.471-8.615l-66.406 33.347c-9.384 4.693-19.815.379-23.895-7.781L1.86 290.747c-4.167-8.615-1.111-18.897 6.946-23.621l58.072-33.069L108 159.861c6.39-57.245 34.731-109.767 79.743-146.726 11.391-9.448 28.341-7.781 37.51 3.613 9.446 11.394 7.78 28.067-3.612 37.516-12.503 10.559-23.618 22.509-32.509 35.57 21.672-14.729 46.679-24.732 74.186-28.067 14.725-1.945 28.063 8.336 29.73 23.065 1.945 14.728-8.336 28.067-23.062 29.734-16.116 1.945-31.12 7.503-44.178 15.284 26.114-5.713 58.712-3.138 88.079 11.115 13.336 6.669 18.893 22.509 12.224 35.848-6.389 13.06-22.504 18.617-35.564 12.226zm-27.229 69.472c-6.112-12.505-18.338-20.286-32.231-20.286a35.46 35.46 0 0 0-35.565 35.57c0 21.428 17.808 35.57 35.565 35.57 13.893 0 26.119-7.781 32.231-20.286 4.446-9.449 13.614-15.006 23.339-15.284-9.725-.277-18.893-5.835-23.339-15.284zm374.821-37.237c4.168 8.615 1.111 18.897-6.946 23.621l-58.071 33.069L532 352.16c-6.39 57.245-34.731 109.767-79.743 146.726-10.932 9.112-27.799 8.144-37.51-3.613-9.446-11.394-7.78-28.067 3.613-37.516 12.503-10.559 23.617-22.509 32.508-35.57-21.672 14.729-46.679 24.732-74.186 28.067-10.021 2.506-27.552-5.643-29.73-23.065-1.945-14.728 8.336-28.067 23.062-29.734 16.116-1.946 31.12-7.503 44.178-15.284-26.114 5.713-58.712 3.138-88.079-11.115-13.336-6.669-18.893-22.509-12.224-35.848 6.389-13.061 22.505-18.619 35.565-12.227 20.295 10.149 44.147 11.199 64.739 3.89-42.606 0-71.208-20.475-85.578-50.576-8.576-17.899 5.148-38.071 23.617-38.071-18.429 0-32.211-20.136-23.617-38.071 14.033-29.396 44.039-50.887 81.966-50.854l92.803 8.615 66.406-33.347c9.408-4.704 19.828-.354 23.894 7.781l44.455 88.926zm-229.227-18.618c-13.893 0-26.119 7.781-32.231 20.286-4.446 9.449-13.614 15.006-23.339 15.284 9.725.278 18.893 5.836 23.339 15.284 6.112 12.505 18.338 20.286 32.231 20.286a35.46 35.46 0 0 0 35.565-35.57c0-21.429-17.808-35.57-35.565-35.57z"]
};
var faAnchor = {
prefix: 'fas',
iconName: 'anchor',
icon: [576, 512, [], "f13d", "M12.971 352h32.394C67.172 454.735 181.944 512 288 512c106.229 0 220.853-57.38 242.635-160h32.394c10.691 0 16.045-12.926 8.485-20.485l-67.029-67.029c-4.686-4.686-12.284-4.686-16.971 0l-67.029 67.029c-7.56 7.56-2.206 20.485 8.485 20.485h35.146c-20.29 54.317-84.963 86.588-144.117 94.015V256h52c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-52v-5.47c37.281-13.178 63.995-48.725 64-90.518C384.005 43.772 341.605.738 289.37.01 235.723-.739 192 42.525 192 96c0 41.798 26.716 77.35 64 90.53V192h-52c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h52v190.015c-58.936-7.399-123.82-39.679-144.117-94.015h35.146c10.691 0 16.045-12.926 8.485-20.485l-67.029-67.029c-4.686-4.686-12.284-4.686-16.971 0L4.485 331.515C-3.074 339.074 2.28 352 12.971 352zM288 64c17.645 0 32 14.355 32 32s-14.355 32-32 32-32-14.355-32-32 14.355-32 32-32z"]
};
var faAngleDoubleDown = {
prefix: 'fas',
iconName: 'angle-double-down',
icon: [320, 512, [], "f103", "M143 256.3L7 120.3c-9.4-9.4-9.4-24.6 0-33.9l22.6-22.6c9.4-9.4 24.6-9.4 33.9 0l96.4 96.4 96.4-96.4c9.4-9.4 24.6-9.4 33.9 0L313 86.3c9.4 9.4 9.4 24.6 0 33.9l-136 136c-9.4 9.5-24.6 9.5-34 .1zm34 192l136-136c9.4-9.4 9.4-24.6 0-33.9l-22.6-22.6c-9.4-9.4-24.6-9.4-33.9 0L160 352.1l-96.4-96.4c-9.4-9.4-24.6-9.4-33.9 0L7 278.3c-9.4 9.4-9.4 24.6 0 33.9l136 136c9.4 9.5 24.6 9.5 34 .1z"]
};
var faAngleDoubleLeft = {
prefix: 'fas',
iconName: 'angle-double-left',
icon: [448, 512, [], "f100", "M223.7 239l136-136c9.4-9.4 24.6-9.4 33.9 0l22.6 22.6c9.4 9.4 9.4 24.6 0 33.9L319.9 256l96.4 96.4c9.4 9.4 9.4 24.6 0 33.9L393.7 409c-9.4 9.4-24.6 9.4-33.9 0l-136-136c-9.5-9.4-9.5-24.6-.1-34zm-192 34l136 136c9.4 9.4 24.6 9.4 33.9 0l22.6-22.6c9.4-9.4 9.4-24.6 0-33.9L127.9 256l96.4-96.4c9.4-9.4 9.4-24.6 0-33.9L201.7 103c-9.4-9.4-24.6-9.4-33.9 0l-136 136c-9.5 9.4-9.5 24.6-.1 34z"]
};
var faAngleDoubleRight = {
prefix: 'fas',
iconName: 'angle-double-right',
icon: [448, 512, [], "f101", "M224.3 273l-136 136c-9.4 9.4-24.6 9.4-33.9 0l-22.6-22.6c-9.4-9.4-9.4-24.6 0-33.9l96.4-96.4-96.4-96.4c-9.4-9.4-9.4-24.6 0-33.9L54.3 103c9.4-9.4 24.6-9.4 33.9 0l136 136c9.5 9.4 9.5 24.6.1 34zm192-34l-136-136c-9.4-9.4-24.6-9.4-33.9 0l-22.6 22.6c-9.4 9.4-9.4 24.6 0 33.9l96.4 96.4-96.4 96.4c-9.4 9.4-9.4 24.6 0 33.9l22.6 22.6c9.4 9.4 24.6 9.4 33.9 0l136-136c9.4-9.2 9.4-24.4 0-33.8z"]
};
var faAngleDoubleUp = {
prefix: 'fas',
iconName: 'angle-double-up',
icon: [320, 512, [], "f102", "M177 255.7l136 136c9.4 9.4 9.4 24.6 0 33.9l-22.6 22.6c-9.4 9.4-24.6 9.4-33.9 0L160 351.9l-96.4 96.4c-9.4 9.4-24.6 9.4-33.9 0L7 425.7c-9.4-9.4-9.4-24.6 0-33.9l136-136c9.4-9.5 24.6-9.5 34-.1zm-34-192L7 199.7c-9.4 9.4-9.4 24.6 0 33.9l22.6 22.6c9.4 9.4 24.6 9.4 33.9 0l96.4-96.4 96.4 96.4c9.4 9.4 24.6 9.4 33.9 0l22.6-22.6c9.4-9.4 9.4-24.6 0-33.9l-136-136c-9.2-9.4-24.4-9.4-33.8 0z"]
};
var faAngleDown = {
prefix: 'fas',
iconName: 'angle-down',
icon: [320, 512, [], "f107", "M143 352.3L7 216.3c-9.4-9.4-9.4-24.6 0-33.9l22.6-22.6c9.4-9.4 24.6-9.4 33.9 0l96.4 96.4 96.4-96.4c9.4-9.4 24.6-9.4 33.9 0l22.6 22.6c9.4 9.4 9.4 24.6 0 33.9l-136 136c-9.2 9.4-24.4 9.4-33.8 0z"]
};
var faAngleLeft = {
prefix: 'fas',
iconName: 'angle-left',
icon: [256, 512, [], "f104", "M31.7 239l136-136c9.4-9.4 24.6-9.4 33.9 0l22.6 22.6c9.4 9.4 9.4 24.6 0 33.9L127.9 256l96.4 96.4c9.4 9.4 9.4 24.6 0 33.9L201.7 409c-9.4 9.4-24.6 9.4-33.9 0l-136-136c-9.5-9.4-9.5-24.6-.1-34z"]
};
var faAngleRight = {
prefix: 'fas',
iconName: 'angle-right',
icon: [256, 512, [], "f105", "M224.3 273l-136 136c-9.4 9.4-24.6 9.4-33.9 0l-22.6-22.6c-9.4-9.4-9.4-24.6 0-33.9l96.4-96.4-96.4-96.4c-9.4-9.4-9.4-24.6 0-33.9L54.3 103c9.4-9.4 24.6-9.4 33.9 0l136 136c9.5 9.4 9.5 24.6.1 34z"]
};
var faAngleUp = {
prefix: 'fas',
iconName: 'angle-up',
icon: [320, 512, [], "f106", "M177 159.7l136 136c9.4 9.4 9.4 24.6 0 33.9l-22.6 22.6c-9.4 9.4-24.6 9.4-33.9 0L160 255.9l-96.4 96.4c-9.4 9.4-24.6 9.4-33.9 0L7 329.7c-9.4-9.4-9.4-24.6 0-33.9l136-136c9.4-9.5 24.6-9.5 34-.1z"]
};
var faAngry = {
prefix: 'fas',
iconName: 'angry',
icon: [496, 512, [], "f556", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM136 240c0-9.3 4.1-17.5 10.5-23.4l-31-9.3c-8.5-2.5-13.3-11.5-10.7-19.9 2.5-8.5 11.4-13.2 19.9-10.7l80 24c8.5 2.5 13.3 11.5 10.7 19.9-2.1 6.9-8.4 11.4-15.3 11.4-.5 0-1.1-.2-1.7-.2.7 2.7 1.7 5.3 1.7 8.2 0 17.7-14.3 32-32 32S136 257.7 136 240zm168 154.2c-27.8-33.4-84.2-33.4-112.1 0-13.5 16.3-38.2-4.2-24.6-20.5 20-24 49.4-37.8 80.6-37.8s60.6 13.8 80.6 37.8c13.8 16.5-11.1 36.6-24.5 20.5zm76.6-186.9l-31 9.3c6.3 5.8 10.5 14.1 10.5 23.4 0 17.7-14.3 32-32 32s-32-14.3-32-32c0-2.9.9-5.6 1.7-8.2-.6.1-1.1.2-1.7.2-6.9 0-13.2-4.5-15.3-11.4-2.5-8.5 2.3-17.4 10.7-19.9l80-24c8.4-2.5 17.4 2.3 19.9 10.7 2.5 8.5-2.3 17.4-10.8 19.9z"]
};
var faAnkh = {
prefix: 'fas',
iconName: 'ankh',
icon: [320, 512, [], "f644", "M296 256h-44.62C272.46 222.01 288 181.65 288 144 288 55.63 230.69 0 160 0S32 55.63 32 144c0 37.65 15.54 78.01 36.62 112H24c-13.25 0-24 10.74-24 24v32c0 13.25 10.75 24 24 24h96v152c0 13.25 10.75 24 24 24h32c13.25 0 24-10.75 24-24V336h96c13.25 0 24-10.75 24-24v-32c0-13.26-10.75-24-24-24zM160 80c29.61 0 48 24.52 48 64 0 34.66-27.14 78.14-48 100.87-20.86-22.72-48-66.21-48-100.87 0-39.48 18.39-64 48-64z"]
};
var faAppleAlt = {
prefix: 'fas',
iconName: 'apple-alt',
icon: [448, 512, [], "f5d1", "M350.85 129c25.97 4.67 47.27 18.67 63.92 42 14.65 20.67 24.64 46.67 29.96 78 4.67 28.67 4.32 57.33-1 86-7.99 47.33-23.97 87-47.94 119-28.64 38.67-64.59 58-107.87 58-10.66 0-22.3-3.33-34.96-10-8.66-5.33-18.31-8-28.97-8s-20.3 2.67-28.97 8c-12.66 6.67-24.3 10-34.96 10-43.28 0-79.23-19.33-107.87-58-23.97-32-39.95-71.67-47.94-119-5.32-28.67-5.67-57.33-1-86 5.32-31.33 15.31-57.33 29.96-78 16.65-23.33 37.95-37.33 63.92-42 15.98-2.67 37.95-.33 65.92 7 23.97 6.67 44.28 14.67 60.93 24 16.65-9.33 36.96-17.33 60.93-24 27.98-7.33 49.96-9.67 65.94-7zm-54.94-41c-9.32 8.67-21.65 15-36.96 19-10.66 3.33-22.3 5-34.96 5l-14.98-1c-1.33-9.33-1.33-20 0-32 2.67-24 10.32-42.33 22.97-55 9.32-8.67 21.65-15 36.96-19 10.66-3.33 22.3-5 34.96-5l14.98 1 1 15c0 12.67-1.67 24.33-4.99 35-3.99 15.33-10.31 27.67-18.98 37z"]
};
var faArchive = {
prefix: 'fas',
iconName: 'archive',
icon: [512, 512, [], "f187", "M32 448c0 17.7 14.3 32 32 32h384c17.7 0 32-14.3 32-32V160H32v288zm160-212c0-6.6 5.4-12 12-12h104c6.6 0 12 5.4 12 12v8c0 6.6-5.4 12-12 12H204c-6.6 0-12-5.4-12-12v-8zM480 32H32C14.3 32 0 46.3 0 64v48c0 8.8 7.2 16 16 16h480c8.8 0 16-7.2 16-16V64c0-17.7-14.3-32-32-32z"]
};
var faArchway = {
prefix: 'fas',
iconName: 'archway',
icon: [576, 512, [], "f557", "M560 448h-16V96H32v352H16.02c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16H176c8.84 0 16-7.16 16-16V320c0-53.02 42.98-96 96-96s96 42.98 96 96l.02 160v16c0 8.84 7.16 16 16 16H560c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm0-448H16C7.16 0 0 7.16 0 16v32c0 8.84 7.16 16 16 16h544c8.84 0 16-7.16 16-16V16c0-8.84-7.16-16-16-16z"]
};
var faArrowAltCircleDown = {
prefix: 'fas',
iconName: 'arrow-alt-circle-down',
icon: [512, 512, [], "f358", "M504 256c0 137-111 248-248 248S8 393 8 256 119 8 256 8s248 111 248 248zM212 140v116h-70.9c-10.7 0-16.1 13-8.5 20.5l114.9 114.3c4.7 4.7 12.2 4.7 16.9 0l114.9-114.3c7.6-7.6 2.2-20.5-8.5-20.5H300V140c0-6.6-5.4-12-12-12h-64c-6.6 0-12 5.4-12 12z"]
};
var faArrowAltCircleLeft = {
prefix: 'fas',
iconName: 'arrow-alt-circle-left',
icon: [512, 512, [], "f359", "M256 504C119 504 8 393 8 256S119 8 256 8s248 111 248 248-111 248-248 248zm116-292H256v-70.9c0-10.7-13-16.1-20.5-8.5L121.2 247.5c-4.7 4.7-4.7 12.2 0 16.9l114.3 114.9c7.6 7.6 20.5 2.2 20.5-8.5V300h116c6.6 0 12-5.4 12-12v-64c0-6.6-5.4-12-12-12z"]
};
var faArrowAltCircleRight = {
prefix: 'fas',
iconName: 'arrow-alt-circle-right',
icon: [512, 512, [], "f35a", "M256 8c137 0 248 111 248 248S393 504 256 504 8 393 8 256 119 8 256 8zM140 300h116v70.9c0 10.7 13 16.1 20.5 8.5l114.3-114.9c4.7-4.7 4.7-12.2 0-16.9l-114.3-115c-7.6-7.6-20.5-2.2-20.5 8.5V212H140c-6.6 0-12 5.4-12 12v64c0 6.6 5.4 12 12 12z"]
};
var faArrowAltCircleUp = {
prefix: 'fas',
iconName: 'arrow-alt-circle-up',
icon: [512, 512, [], "f35b", "M8 256C8 119 119 8 256 8s248 111 248 248-111 248-248 248S8 393 8 256zm292 116V256h70.9c10.7 0 16.1-13 8.5-20.5L264.5 121.2c-4.7-4.7-12.2-4.7-16.9 0l-115 114.3c-7.6 7.6-2.2 20.5 8.5 20.5H212v116c0 6.6 5.4 12 12 12h64c6.6 0 12-5.4 12-12z"]
};
var faArrowCircleDown = {
prefix: 'fas',
iconName: 'arrow-circle-down',
icon: [512, 512, [], "f0ab", "M504 256c0 137-111 248-248 248S8 393 8 256 119 8 256 8s248 111 248 248zm-143.6-28.9L288 302.6V120c0-13.3-10.7-24-24-24h-16c-13.3 0-24 10.7-24 24v182.6l-72.4-75.5c-9.3-9.7-24.8-9.9-34.3-.4l-10.9 11c-9.4 9.4-9.4 24.6 0 33.9L239 404.3c9.4 9.4 24.6 9.4 33.9 0l132.7-132.7c9.4-9.4 9.4-24.6 0-33.9l-10.9-11c-9.5-9.5-25-9.3-34.3.4z"]
};
var faArrowCircleLeft = {
prefix: 'fas',
iconName: 'arrow-circle-left',
icon: [512, 512, [], "f0a8", "M256 504C119 504 8 393 8 256S119 8 256 8s248 111 248 248-111 248-248 248zm28.9-143.6L209.4 288H392c13.3 0 24-10.7 24-24v-16c0-13.3-10.7-24-24-24H209.4l75.5-72.4c9.7-9.3 9.9-24.8.4-34.3l-11-10.9c-9.4-9.4-24.6-9.4-33.9 0L107.7 239c-9.4 9.4-9.4 24.6 0 33.9l132.7 132.7c9.4 9.4 24.6 9.4 33.9 0l11-10.9c9.5-9.5 9.3-25-.4-34.3z"]
};
var faArrowCircleRight = {
prefix: 'fas',
iconName: 'arrow-circle-right',
icon: [512, 512, [], "f0a9", "M256 8c137 0 248 111 248 248S393 504 256 504 8 393 8 256 119 8 256 8zm-28.9 143.6l75.5 72.4H120c-13.3 0-24 10.7-24 24v16c0 13.3 10.7 24 24 24h182.6l-75.5 72.4c-9.7 9.3-9.9 24.8-.4 34.3l11 10.9c9.4 9.4 24.6 9.4 33.9 0L404.3 273c9.4-9.4 9.4-24.6 0-33.9L271.6 106.3c-9.4-9.4-24.6-9.4-33.9 0l-11 10.9c-9.5 9.6-9.3 25.1.4 34.4z"]
};
var faArrowCircleUp = {
prefix: 'fas',
iconName: 'arrow-circle-up',
icon: [512, 512, [], "f0aa", "M8 256C8 119 119 8 256 8s248 111 248 248-111 248-248 248S8 393 8 256zm143.6 28.9l72.4-75.5V392c0 13.3 10.7 24 24 24h16c13.3 0 24-10.7 24-24V209.4l72.4 75.5c9.3 9.7 24.8 9.9 34.3.4l10.9-11c9.4-9.4 9.4-24.6 0-33.9L273 107.7c-9.4-9.4-24.6-9.4-33.9 0L106.3 240.4c-9.4 9.4-9.4 24.6 0 33.9l10.9 11c9.6 9.5 25.1 9.3 34.4-.4z"]
};
var faArrowDown = {
prefix: 'fas',
iconName: 'arrow-down',
icon: [448, 512, [], "f063", "M413.1 222.5l22.2 22.2c9.4 9.4 9.4 24.6 0 33.9L241 473c-9.4 9.4-24.6 9.4-33.9 0L12.7 278.6c-9.4-9.4-9.4-24.6 0-33.9l22.2-22.2c9.5-9.5 25-9.3 34.3.4L184 343.4V56c0-13.3 10.7-24 24-24h32c13.3 0 24 10.7 24 24v287.4l114.8-120.5c9.3-9.8 24.8-10 34.3-.4z"]
};
var faArrowLeft = {
prefix: 'fas',
iconName: 'arrow-left',
icon: [448, 512, [], "f060", "M257.5 445.1l-22.2 22.2c-9.4 9.4-24.6 9.4-33.9 0L7 273c-9.4-9.4-9.4-24.6 0-33.9L201.4 44.7c9.4-9.4 24.6-9.4 33.9 0l22.2 22.2c9.5 9.5 9.3 25-.4 34.3L136.6 216H424c13.3 0 24 10.7 24 24v32c0 13.3-10.7 24-24 24H136.6l120.5 114.8c9.8 9.3 10 24.8.4 34.3z"]
};
var faArrowRight = {
prefix: 'fas',
iconName: 'arrow-right',
icon: [448, 512, [], "f061", "M190.5 66.9l22.2-22.2c9.4-9.4 24.6-9.4 33.9 0L441 239c9.4 9.4 9.4 24.6 0 33.9L246.6 467.3c-9.4 9.4-24.6 9.4-33.9 0l-22.2-22.2c-9.5-9.5-9.3-25 .4-34.3L311.4 296H24c-13.3 0-24-10.7-24-24v-32c0-13.3 10.7-24 24-24h287.4L190.9 101.2c-9.8-9.3-10-24.8-.4-34.3z"]
};
var faArrowUp = {
prefix: 'fas',
iconName: 'arrow-up',
icon: [448, 512, [], "f062", "M34.9 289.5l-22.2-22.2c-9.4-9.4-9.4-24.6 0-33.9L207 39c9.4-9.4 24.6-9.4 33.9 0l194.3 194.3c9.4 9.4 9.4 24.6 0 33.9L413 289.4c-9.5 9.5-25 9.3-34.3-.4L264 168.6V456c0 13.3-10.7 24-24 24h-32c-13.3 0-24-10.7-24-24V168.6L69.2 289.1c-9.3 9.8-24.8 10-34.3.4z"]
};
var faArrowsAlt = {
prefix: 'fas',
iconName: 'arrows-alt',
icon: [512, 512, [], "f0b2", "M352.201 425.775l-79.196 79.196c-9.373 9.373-24.568 9.373-33.941 0l-79.196-79.196c-15.119-15.119-4.411-40.971 16.971-40.97h51.162L228 284H127.196v51.162c0 21.382-25.851 32.09-40.971 16.971L7.029 272.937c-9.373-9.373-9.373-24.569 0-33.941L86.225 159.8c15.119-15.119 40.971-4.411 40.971 16.971V228H228V127.196h-51.23c-21.382 0-32.09-25.851-16.971-40.971l79.196-79.196c9.373-9.373 24.568-9.373 33.941 0l79.196 79.196c15.119 15.119 4.411 40.971-16.971 40.971h-51.162V228h100.804v-51.162c0-21.382 25.851-32.09 40.97-16.971l79.196 79.196c9.373 9.373 9.373 24.569 0 33.941L425.773 352.2c-15.119 15.119-40.971 4.411-40.97-16.971V284H284v100.804h51.23c21.382 0 32.09 25.851 16.971 40.971z"]
};
var faArrowsAltH = {
prefix: 'fas',
iconName: 'arrows-alt-h',
icon: [512, 512, [], "f337", "M377.941 169.941V216H134.059v-46.059c0-21.382-25.851-32.09-40.971-16.971L7.029 239.029c-9.373 9.373-9.373 24.568 0 33.941l86.059 86.059c15.119 15.119 40.971 4.411 40.971-16.971V296h243.882v46.059c0 21.382 25.851 32.09 40.971 16.971l86.059-86.059c9.373-9.373 9.373-24.568 0-33.941l-86.059-86.059c-15.119-15.12-40.971-4.412-40.971 16.97z"]
};
var faArrowsAltV = {
prefix: 'fas',
iconName: 'arrows-alt-v',
icon: [256, 512, [], "f338", "M214.059 377.941H168V134.059h46.059c21.382 0 32.09-25.851 16.971-40.971L144.971 7.029c-9.373-9.373-24.568-9.373-33.941 0L24.971 93.088c-15.119 15.119-4.411 40.971 16.971 40.971H88v243.882H41.941c-21.382 0-32.09 25.851-16.971 40.971l86.059 86.059c9.373 9.373 24.568 9.373 33.941 0l86.059-86.059c15.12-15.119 4.412-40.971-16.97-40.971z"]
};
var faAssistiveListeningSystems = {
prefix: 'fas',
iconName: 'assistive-listening-systems',
icon: [512, 512, [], "f2a2", "M216 260c0 15.464-12.536 28-28 28s-28-12.536-28-28c0-44.112 35.888-80 80-80s80 35.888 80 80c0 15.464-12.536 28-28 28s-28-12.536-28-28c0-13.234-10.767-24-24-24s-24 10.766-24 24zm24-176c-97.047 0-176 78.953-176 176 0 15.464 12.536 28 28 28s28-12.536 28-28c0-66.168 53.832-120 120-120s120 53.832 120 120c0 75.164-71.009 70.311-71.997 143.622L288 404c0 28.673-23.327 52-52 52-15.464 0-28 12.536-28 28s12.536 28 28 28c59.475 0 107.876-48.328 108-107.774.595-34.428 72-48.24 72-144.226 0-97.047-78.953-176-176-176zm-80 236c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zM32 448c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm480-187.993c0-1.518-.012-3.025-.045-4.531C510.076 140.525 436.157 38.47 327.994 1.511c-14.633-4.998-30.549 2.809-35.55 17.442-5 14.633 2.81 30.549 17.442 35.55 85.906 29.354 144.61 110.513 146.077 201.953l.003.188c.026 1.118.033 2.236.033 3.363 0 15.464 12.536 28 28 28s28.001-12.536 28.001-28zM152.971 439.029l-80-80L39.03 392.97l80 80 33.941-33.941z"]
};
var faAsterisk = {
prefix: 'fas',
iconName: 'asterisk',
icon: [512, 512, [], "f069", "M478.21 334.093L336 256l142.21-78.093c11.795-6.477 15.961-21.384 9.232-33.037l-19.48-33.741c-6.728-11.653-21.72-15.499-33.227-8.523L296 186.718l3.475-162.204C299.763 11.061 288.937 0 275.48 0h-38.96c-13.456 0-24.283 11.061-23.994 24.514L216 186.718 77.265 102.607c-11.506-6.976-26.499-3.13-33.227 8.523l-19.48 33.741c-6.728 11.653-2.562 26.56 9.233 33.037L176 256 33.79 334.093c-11.795 6.477-15.961 21.384-9.232 33.037l19.48 33.741c6.728 11.653 21.721 15.499 33.227 8.523L216 325.282l-3.475 162.204C212.237 500.939 223.064 512 236.52 512h38.961c13.456 0 24.283-11.061 23.995-24.514L296 325.282l138.735 84.111c11.506 6.976 26.499 3.13 33.227-8.523l19.48-33.741c6.728-11.653 2.563-26.559-9.232-33.036z"]
};
var faAt = {
prefix: 'fas',
iconName: 'at',
icon: [512, 512, [], "f1fa", "M256 8C118.941 8 8 118.919 8 256c0 137.059 110.919 248 248 248 48.154 0 95.342-14.14 135.408-40.223 12.005-7.815 14.625-24.288 5.552-35.372l-10.177-12.433c-7.671-9.371-21.179-11.667-31.373-5.129C325.92 429.757 291.314 440 256 440c-101.458 0-184-82.542-184-184S154.542 72 256 72c100.139 0 184 57.619 184 160 0 38.786-21.093 79.742-58.17 83.693-17.349-.454-16.91-12.857-13.476-30.024l23.433-121.11C394.653 149.75 383.308 136 368.225 136h-44.981a13.518 13.518 0 0 0-13.432 11.993l-.01.092c-14.697-17.901-40.448-21.775-59.971-21.775-74.58 0-137.831 62.234-137.831 151.46 0 65.303 36.785 105.87 96 105.87 26.984 0 57.369-15.637 74.991-38.333 9.522 34.104 40.613 34.103 70.71 34.103C462.609 379.41 504 307.798 504 232 504 95.653 394.023 8 256 8zm-21.68 304.43c-22.249 0-36.07-15.623-36.07-40.771 0-44.993 30.779-72.729 58.63-72.729 22.292 0 35.601 15.241 35.601 40.77 0 45.061-33.875 72.73-58.161 72.73z"]
};
var faAtlas = {
prefix: 'fas',
iconName: 'atlas',
icon: [448, 512, [], "f558", "M318.38 208h-39.09c-1.49 27.03-6.54 51.35-14.21 70.41 27.71-13.24 48.02-39.19 53.3-70.41zm0-32c-5.29-31.22-25.59-57.17-53.3-70.41 7.68 19.06 12.72 43.38 14.21 70.41h39.09zM224 97.31c-7.69 7.45-20.77 34.42-23.43 78.69h46.87c-2.67-44.26-15.75-71.24-23.44-78.69zm-41.08 8.28c-27.71 13.24-48.02 39.19-53.3 70.41h39.09c1.49-27.03 6.53-51.35 14.21-70.41zm0 172.82c-7.68-19.06-12.72-43.38-14.21-70.41h-39.09c5.28 31.22 25.59 57.17 53.3 70.41zM247.43 208h-46.87c2.66 44.26 15.74 71.24 23.43 78.69 7.7-7.45 20.78-34.43 23.44-78.69zM448 358.4V25.6c0-16-9.6-25.6-25.6-25.6H96C41.6 0 0 41.6 0 96v320c0 54.4 41.6 96 96 96h326.4c12.8 0 25.6-9.6 25.6-25.6v-16c0-6.4-3.2-12.8-9.6-19.2-3.2-16-3.2-60.8 0-73.6 6.4-3.2 9.6-9.6 9.6-19.2zM224 64c70.69 0 128 57.31 128 128s-57.31 128-128 128S96 262.69 96 192 153.31 64 224 64zm160 384H96c-19.2 0-32-12.8-32-32s16-32 32-32h288v64z"]
};
var faAtom = {
prefix: 'fas',
iconName: 'atom',
icon: [448, 512, [], "f5d2", "M223.99908,224a32,32,0,1,0,32.00782,32A32.06431,32.06431,0,0,0,223.99908,224Zm214.172-96c-10.877-19.5-40.50979-50.75-116.27544-41.875C300.39168,34.875,267.63386,0,223.99908,0s-76.39066,34.875-97.89653,86.125C50.3369,77.375,20.706,108.5,9.82907,128-6.54984,157.375-5.17484,201.125,34.958,256-5.17484,310.875-6.54984,354.625,9.82907,384c29.13087,52.375,101.64652,43.625,116.27348,41.875C147.60842,477.125,180.36429,512,223.99908,512s76.3926-34.875,97.89652-86.125c14.62891,1.75,87.14456,10.5,116.27544-41.875C454.55,354.625,453.175,310.875,413.04017,256,453.175,201.125,454.55,157.375,438.171,128ZM63.33886,352c-4-7.25-.125-24.75,15.00391-48.25,6.87695,6.5,14.12891,12.875,21.88087,19.125,1.625,13.75,4,27.125,6.75,40.125C82.34472,363.875,67.09081,358.625,63.33886,352Zm36.88478-162.875c-7.752,6.25-15.00392,12.625-21.88087,19.125-15.12891-23.5-19.00392-41-15.00391-48.25,3.377-6.125,16.37891-11.5,37.88478-11.5,1.75,0,3.875.375,5.75.375C104.09864,162.25,101.84864,175.625,100.22364,189.125ZM223.99908,64c9.50195,0,22.25586,13.5,33.88282,37.25-11.252,3.75-22.50391,8-33.88282,12.875-11.377-4.875-22.62892-9.125-33.88283-12.875C201.74516,77.5,214.49712,64,223.99908,64Zm0,384c-9.502,0-22.25392-13.5-33.88283-37.25,11.25391-3.75,22.50587-8,33.88283-12.875C235.378,402.75,246.62994,407,257.8819,410.75,246.25494,434.5,233.501,448,223.99908,448Zm0-112a80,80,0,1,1,80-80A80.00023,80.00023,0,0,1,223.99908,336ZM384.6593,352c-3.625,6.625-19.00392,11.875-43.63479,11,2.752-13,5.127-26.375,6.752-40.125,7.75195-6.25,15.00391-12.625,21.87891-19.125C384.7843,327.25,388.6593,344.75,384.6593,352ZM369.65538,208.25c-6.875-6.5-14.127-12.875-21.87891-19.125-1.625-13.5-3.875-26.875-6.752-40.25,1.875,0,4.002-.375,5.752-.375,21.50391,0,34.50782,5.375,37.88283,11.5C388.6593,167.25,384.7843,184.75,369.65538,208.25Z"]
};
var faAudioDescription = {
prefix: 'fas',
iconName: 'audio-description',
icon: [512, 512, [], "f29e", "M162.925 238.709l8.822 30.655h-25.606l9.041-30.652c1.277-4.421 2.651-9.994 3.872-15.245 1.22 5.251 2.594 10.823 3.871 15.242zm166.474-32.099h-14.523v98.781h14.523c29.776 0 46.175-17.678 46.175-49.776 0-32.239-17.49-49.005-46.175-49.005zM512 112v288c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V112c0-26.51 21.49-48 48-48h416c26.51 0 48 21.49 48 48zM245.459 336.139l-57.097-168A12.001 12.001 0 0 0 177 160h-35.894a12.001 12.001 0 0 0-11.362 8.139l-57.097 168C70.003 343.922 75.789 352 84.009 352h29.133a12 12 0 0 0 11.535-8.693l8.574-29.906h51.367l8.793 29.977A12 12 0 0 0 204.926 352h29.172c8.22 0 14.006-8.078 11.361-15.861zm184.701-80.525c0-58.977-37.919-95.614-98.96-95.614h-57.366c-6.627 0-12 5.373-12 12v168c0 6.627 5.373 12 12 12H331.2c61.041 0 98.96-36.933 98.96-96.386z"]
};
var faAward = {
prefix: 'fas',
iconName: 'award',
icon: [384, 512, [], "f559", "M97.12 362.63c-8.69-8.69-4.16-6.24-25.12-11.85-9.51-2.55-17.87-7.45-25.43-13.32L1.2 448.7c-4.39 10.77 3.81 22.47 15.43 22.03l52.69-2.01L105.56 507c8 8.44 22.04 5.81 26.43-4.96l52.05-127.62c-10.84 6.04-22.87 9.58-35.31 9.58-19.5 0-37.82-7.59-51.61-21.37zM382.8 448.7l-45.37-111.24c-7.56 5.88-15.92 10.77-25.43 13.32-21.07 5.64-16.45 3.18-25.12 11.85-13.79 13.78-32.12 21.37-51.62 21.37-12.44 0-24.47-3.55-35.31-9.58L252 502.04c4.39 10.77 18.44 13.4 26.43 4.96l36.25-38.28 52.69 2.01c11.62.44 19.82-11.27 15.43-22.03zM263 340c15.28-15.55 17.03-14.21 38.79-20.14 13.89-3.79 24.75-14.84 28.47-28.98 7.48-28.4 5.54-24.97 25.95-45.75 10.17-10.35 14.14-25.44 10.42-39.58-7.47-28.38-7.48-24.42 0-52.83 3.72-14.14-.25-29.23-10.42-39.58-20.41-20.78-18.47-17.36-25.95-45.75-3.72-14.14-14.58-25.19-28.47-28.98-27.88-7.61-24.52-5.62-44.95-26.41-10.17-10.35-25-14.4-38.89-10.61-27.87 7.6-23.98 7.61-51.9 0-13.89-3.79-28.72.25-38.89 10.61-20.41 20.78-17.05 18.8-44.94 26.41-13.89 3.79-24.75 14.84-28.47 28.98-7.47 28.39-5.54 24.97-25.95 45.75-10.17 10.35-14.15 25.44-10.42 39.58 7.47 28.36 7.48 24.4 0 52.82-3.72 14.14.25 29.23 10.42 39.59 20.41 20.78 18.47 17.35 25.95 45.75 3.72 14.14 14.58 25.19 28.47 28.98C104.6 325.96 106.27 325 121 340c13.23 13.47 33.84 15.88 49.74 5.82a39.676 39.676 0 0 1 42.53 0c15.89 10.06 36.5 7.65 49.73-5.82zM97.66 175.96c0-53.03 42.24-96.02 94.34-96.02s94.34 42.99 94.34 96.02-42.24 96.02-94.34 96.02-94.34-42.99-94.34-96.02z"]
};
var faBaby = {
prefix: 'fas',
iconName: 'baby',
icon: [384, 512, [], "f77c", "M192 160c44.2 0 80-35.8 80-80S236.2 0 192 0s-80 35.8-80 80 35.8 80 80 80zm-53.4 248.8l25.6-32-61.5-51.2L56.8 383c-11.4 14.2-11.7 34.4-.8 49l48 64c7.9 10.5 19.9 16 32 16 8.3 0 16.8-2.6 24-8 17.7-13.2 21.2-38.3 8-56l-29.4-39.2zm142.7-83.2l-61.5 51.2 25.6 32L216 448c-13.2 17.7-9.7 42.8 8 56 7.2 5.4 15.6 8 24 8 12.2 0 24.2-5.5 32-16l48-64c10.9-14.6 10.6-34.8-.8-49l-45.9-57.4zM376.7 145c-12.7-18.1-37.6-22.4-55.7-9.8l-40.6 28.5c-52.7 37-124.2 37-176.8 0L63 135.3C44.9 122.6 20 127 7.3 145-5.4 163.1-1 188 17 200.7l40.6 28.5c17 11.9 35.4 20.9 54.4 27.9V288h160v-30.8c19-7 37.4-16 54.4-27.9l40.6-28.5c18.1-12.8 22.4-37.7 9.7-55.8z"]
};
var faBabyCarriage = {
prefix: 'fas',
iconName: 'baby-carriage',
icon: [512, 512, [], "f77d", "M144.8 17c-11.3-17.8-37.2-22.8-54-9.4C35.3 51.9 0 118 0 192h256L144.8 17zM496 96h-48c-35.3 0-64 28.7-64 64v64H0c0 50.6 23 96.4 60.3 130.7C25.7 363.6 0 394.7 0 432c0 44.2 35.8 80 80 80s80-35.8 80-80c0-8.9-1.8-17.2-4.4-25.2 21.6 5.9 44.6 9.2 68.4 9.2s46.9-3.3 68.4-9.2c-2.7 8-4.4 16.3-4.4 25.2 0 44.2 35.8 80 80 80s80-35.8 80-80c0-37.3-25.7-68.4-60.3-77.3C425 320.4 448 274.6 448 224v-64h48c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM80 464c-17.6 0-32-14.4-32-32s14.4-32 32-32 32 14.4 32 32-14.4 32-32 32zm320-32c0 17.6-14.4 32-32 32s-32-14.4-32-32 14.4-32 32-32 32 14.4 32 32z"]
};
var faBackspace = {
prefix: 'fas',
iconName: 'backspace',
icon: [640, 512, [], "f55a", "M576 64H205.26A63.97 63.97 0 0 0 160 82.75L9.37 233.37c-12.5 12.5-12.5 32.76 0 45.25L160 429.25c12 12 28.28 18.75 45.25 18.75H576c35.35 0 64-28.65 64-64V128c0-35.35-28.65-64-64-64zm-84.69 254.06c6.25 6.25 6.25 16.38 0 22.63l-22.62 22.62c-6.25 6.25-16.38 6.25-22.63 0L384 301.25l-62.06 62.06c-6.25 6.25-16.38 6.25-22.63 0l-22.62-22.62c-6.25-6.25-6.25-16.38 0-22.63L338.75 256l-62.06-62.06c-6.25-6.25-6.25-16.38 0-22.63l22.62-22.62c6.25-6.25 16.38-6.25 22.63 0L384 210.75l62.06-62.06c6.25-6.25 16.38-6.25 22.63 0l22.62 22.62c6.25 6.25 6.25 16.38 0 22.63L429.25 256l62.06 62.06z"]
};
var faBackward = {
prefix: 'fas',
iconName: 'backward',
icon: [512, 512, [], "f04a", "M11.5 280.6l192 160c20.6 17.2 52.5 2.8 52.5-24.6V96c0-27.4-31.9-41.8-52.5-24.6l-192 160c-15.3 12.8-15.3 36.4 0 49.2zm256 0l192 160c20.6 17.2 52.5 2.8 52.5-24.6V96c0-27.4-31.9-41.8-52.5-24.6l-192 160c-15.3 12.8-15.3 36.4 0 49.2z"]
};
var faBacon = {
prefix: 'fas',
iconName: 'bacon',
icon: [576, 512, [], "f7e5", "M218.92 336.39c34.89-34.89 44.2-59.7 54.05-86 10.61-28.29 21.59-57.54 61.37-97.34s69.05-50.77 97.35-61.38c23.88-9 46.64-17.68 76.79-45.37L470.81 8.91a31 31 0 0 0-40.18-2.83c-13.64 10.1-25.15 14.39-41 20.3C247 79.52 209.26 191.29 200.65 214.1c-29.75 78.83-89.55 94.68-98.72 98.09-24.86 9.26-54.73 20.38-91.07 50.36C-3 374-3.63 395 9.07 407.61l35.76 35.51C80 410.52 107 400.15 133 390.39c26.27-9.84 51.06-19.12 85.92-54zm348-232l-35.75-35.51c-35.19 32.63-62.18 43-88.25 52.79-26.26 9.85-51.06 19.16-85.95 54s-44.19 59.69-54 86C292.33 290 281.34 319.22 241.55 359s-69 50.73-97.3 61.32c-23.86 9-46.61 17.66-76.72 45.33l37.68 37.43a31 31 0 0 0 40.18 2.82c13.6-10.06 25.09-14.34 40.94-20.24 142.2-53 180-164.1 188.94-187.69C405 219.18 464.8 203.3 474 199.86c24.87-9.27 54.74-20.4 91.11-50.41 13.89-11.4 14.52-32.45 1.82-45.05z"]
};
var faBacteria = {
prefix: 'fas',
iconName: 'bacteria',
icon: [640, 512, [], "e059", "M272.35,226.4A17.71,17.71,0,0,0,281.46,203l-4-9.08a121.29,121.29,0,0,1,12.36-3.08A83.34,83.34,0,0,0,323.57,177l10,9a17.76,17.76,0,1,0,23.92-26.27l-9.72-8.76a83.12,83.12,0,0,0,11.65-48.18l11.85-3.51a17.73,17.73,0,1,0-10.15-34l-11.34,3.36a84,84,0,0,0-36.38-35.57l2.84-10.85a17.8,17.8,0,0,0-34.47-8.93l-2.82,10.78a83.25,83.25,0,0,0-16.74,1.1C250.83,27,240,30.22,229.1,33.39l-3.38-9.46a17.8,17.8,0,0,0-33.56,11.89l3.49,9.8a286.74,286.74,0,0,0-43.94,23.57l-6.32-8.43a17.9,17.9,0,0,0-24.94-3.6A17.69,17.69,0,0,0,116.84,82l6.45,8.61a286.59,286.59,0,0,0-34.95,35.33l-8.82-6.42a17.84,17.84,0,0,0-24.89,3.86,17.66,17.66,0,0,0,3.88,24.77l8.88,6.47a286.6,286.6,0,0,0-23,43.91l-10.48-3.59a17.73,17.73,0,1,0-11.59,33.52L32.67,232c-2.79,10-5.79,19.84-7.52,30.22a83.16,83.16,0,0,0-.82,19l-11.58,3.43a17.73,17.73,0,1,0,10.13,34l11.27-3.33a83.51,83.51,0,0,0,36.39,35.43l-2.88,11.06a17.81,17.81,0,0,0,34.48,8.92l2.87-11c1,0,2.07.26,3.1.26a83.39,83.39,0,0,0,45.65-13.88l8.59,8.8a17.77,17.77,0,0,0,25.56-24.7l-9.14-9.37a83.41,83.41,0,0,0,12.08-31.05,119.08,119.08,0,0,1,3.87-15.53l9,4.22a17.74,17.74,0,1,0,15.15-32.09l-8.8-4.11c.67-1,1.2-2.08,1.9-3.05a119.89,119.89,0,0,1,7.87-9.41,121.73,121.73,0,0,1,11.65-11.4,119.49,119.49,0,0,1,9.94-7.82c1.12-.77,2.32-1.42,3.47-2.15l3.92,8.85a17.86,17.86,0,0,0,16.32,10.58A18.14,18.14,0,0,0,272.35,226.4ZM128,256a32,32,0,1,1,32-32A32,32,0,0,1,128,256Zm80-96a16,16,0,1,1,16-16A16,16,0,0,1,208,160Zm431.26,45.3a17.79,17.79,0,0,0-17.06-12.69,17.55,17.55,0,0,0-5.08.74l-11.27,3.33a83.61,83.61,0,0,0-36.39-35.43l2.88-11.06a17.81,17.81,0,0,0-34.48-8.91l-2.87,11c-1,0-2.07-.26-3.1-.26a83.32,83.32,0,0,0-45.65,13.89l-8.59-8.81a17.77,17.77,0,0,0-25.56,24.7l9.14,9.37a83.28,83.28,0,0,0-12.08,31.06,119.34,119.34,0,0,1-3.87,15.52l-9-4.22a17.74,17.74,0,1,0-15.15,32.09l8.8,4.11c-.67,1-1.2,2.08-1.89,3.05a117.71,117.71,0,0,1-7.94,9.47,119,119,0,0,1-11.57,11.33,121.59,121.59,0,0,1-10,7.83c-1.12.77-2.32,1.42-3.47,2.15l-3.92-8.85a17.86,17.86,0,0,0-16.32-10.58,18.14,18.14,0,0,0-7.18,1.5A17.71,17.71,0,0,0,358.54,309l4,9.08a118.71,118.71,0,0,1-12.36,3.08,83.34,83.34,0,0,0-33.77,13.9l-10-9a17.77,17.77,0,1,0-23.92,26.28l9.72,8.75a83.12,83.12,0,0,0-11.65,48.18l-11.86,3.51a17.73,17.73,0,1,0,10.16,34l11.34-3.36A84,84,0,0,0,326.61,479l-2.84,10.85a17.8,17.8,0,0,0,34.47,8.93L361.06,488a83.3,83.3,0,0,0,16.74-1.1c11.37-1.89,22.24-5.07,33.1-8.24l3.38,9.46a17.8,17.8,0,0,0,33.56-11.89l-3.49-9.79a287.66,287.66,0,0,0,43.94-23.58l6.32,8.43a17.88,17.88,0,0,0,24.93,3.6A17.67,17.67,0,0,0,523.16,430l-6.45-8.61a287.37,287.37,0,0,0,34.95-35.34l8.82,6.42a17.76,17.76,0,1,0,21-28.63l-8.88-6.46a287.17,287.17,0,0,0,23-43.92l10.48,3.59a17.73,17.73,0,1,0,11.59-33.52L607.33,280c2.79-10,5.79-19.84,7.52-30.21a83.27,83.27,0,0,0,.82-19.05l11.58-3.43A17.7,17.7,0,0,0,639.26,205.3ZM416,416a32,32,0,1,1,32-32A32,32,0,0,1,416,416Z"]
};
var faBacterium = {
prefix: 'fas',
iconName: 'bacterium',
icon: [512, 512, [], "e05a", "M511,102.93A23.76,23.76,0,0,0,481.47,87l-15.12,4.48a111.85,111.85,0,0,0-48.5-47.42l3.79-14.47a23.74,23.74,0,0,0-46-11.91l-3.76,14.37a111.94,111.94,0,0,0-22.33,1.47,386.74,386.74,0,0,0-44.33,10.41l-4.3-12a23.74,23.74,0,0,0-44.75,15.85l4.3,12.05a383.4,383.4,0,0,0-58.69,31.83l-8-10.63a23.85,23.85,0,0,0-33.24-4.8,23.57,23.57,0,0,0-4.83,33.09l8,10.63a386.14,386.14,0,0,0-46.7,47.44l-11-8a23.68,23.68,0,1,0-28,38.17l11.09,8.06a383.45,383.45,0,0,0-30.92,58.75l-12.93-4.43a23.65,23.65,0,1,0-15.47,44.69l13,4.48a385.81,385.81,0,0,0-9.3,40.53A111.58,111.58,0,0,0,32.44,375L17,379.56a23.64,23.64,0,0,0,13.51,45.31l15-4.44a111.49,111.49,0,0,0,48.53,47.24l-3.85,14.75a23.66,23.66,0,0,0,17,28.83,24.7,24.7,0,0,0,6,.75,23.73,23.73,0,0,0,23-17.7L140,479.67c1.37.05,2.77.35,4.13.35A111.22,111.22,0,0,0,205,461.5l11.45,11.74a23.7,23.7,0,0,0,34.08-32.93l-12.19-12.5a111,111,0,0,0,16.11-41.4,158.69,158.69,0,0,1,5.16-20.71l12,5.64a23.66,23.66,0,1,0,20.19-42.79l-11.72-5.49c.89-1.32,1.59-2.77,2.52-4.06a157.86,157.86,0,0,1,10.46-12.49,159.5,159.5,0,0,1,15.59-15.28,162.18,162.18,0,0,1,13.23-10.4c1.5-1,3.1-1.89,4.63-2.87l5.23,11.8a23.74,23.74,0,0,0,43.48-19.08l-5.36-12.11a158.87,158.87,0,0,1,16.49-4.1,111,111,0,0,0,45-18.54l13.33,12a23.69,23.69,0,1,0,31.88-35l-12.94-11.67A110.83,110.83,0,0,0,479.21,137L495,132.32A23.61,23.61,0,0,0,511,102.93ZM160,368a48,48,0,1,1,48-48A48,48,0,0,1,160,368Zm80-136a24,24,0,1,1,24-24A24,24,0,0,1,240,232Z"]
};
var faBahai = {
prefix: 'fas',
iconName: 'bahai',
icon: [512, 512, [], "f666", "M496.25 202.52l-110-15.44 41.82-104.34c6.67-16.64-11.6-32.18-26.59-22.63L307.44 120 273.35 12.82C270.64 4.27 263.32 0 256 0c-7.32 0-14.64 4.27-17.35 12.82l-34.09 107.19-94.04-59.89c-14.99-9.55-33.25 5.99-26.59 22.63l41.82 104.34-110 15.43c-17.54 2.46-21.68 26.27-6.03 34.67l98.16 52.66-74.48 83.54c-10.92 12.25-1.72 30.93 13.29 30.93 1.31 0 2.67-.14 4.07-.45l108.57-23.65-4.11 112.55c-.43 11.65 8.87 19.22 18.41 19.22 5.15 0 10.39-2.21 14.2-7.18l68.18-88.9 68.18 88.9c3.81 4.97 9.04 7.18 14.2 7.18 9.54 0 18.84-7.57 18.41-19.22l-4.11-112.55 108.57 23.65c17.36 3.76 29.21-17.2 17.35-30.49l-74.48-83.54 98.16-52.66c15.64-8.39 11.5-32.2-6.04-34.66zM338.51 311.68l-51.89-11.3 1.97 53.79L256 311.68l-32.59 42.49 1.96-53.79-51.89 11.3 35.6-39.93-46.92-25.17 52.57-7.38-19.99-49.87 44.95 28.62L256 166.72l16.29 51.23 44.95-28.62-19.99 49.87 52.57 7.38-46.92 25.17 35.61 39.93z"]
};
var faBalanceScale = {
prefix: 'fas',
iconName: 'balance-scale',
icon: [640, 512, [], "f24e", "M256 336h-.02c0-16.18 1.34-8.73-85.05-181.51-17.65-35.29-68.19-35.36-85.87 0C-2.06 328.75.02 320.33.02 336H0c0 44.18 57.31 80 128 80s128-35.82 128-80zM128 176l72 144H56l72-144zm511.98 160c0-16.18 1.34-8.73-85.05-181.51-17.65-35.29-68.19-35.36-85.87 0-87.12 174.26-85.04 165.84-85.04 181.51H384c0 44.18 57.31 80 128 80s128-35.82 128-80h-.02zM440 320l72-144 72 144H440zm88 128H352V153.25c23.51-10.29 41.16-31.48 46.39-57.25H528c8.84 0 16-7.16 16-16V48c0-8.84-7.16-16-16-16H383.64C369.04 12.68 346.09 0 320 0s-49.04 12.68-63.64 32H112c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h129.61c5.23 25.76 22.87 46.96 46.39 57.25V448H112c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h416c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faBalanceScaleLeft = {
prefix: 'fas',
iconName: 'balance-scale-left',
icon: [640, 512, [], "f515", "M528 448H352V153.25c20.42-8.94 36.1-26.22 43.38-47.47l132-44.26c8.38-2.81 12.89-11.88 10.08-20.26l-10.17-30.34C524.48 2.54 515.41-1.97 507.03.84L389.11 40.37C375.3 16.36 349.69 0 320 0c-44.18 0-80 35.82-80 80 0 3.43.59 6.71 1.01 10.03l-128.39 43.05c-8.38 2.81-12.89 11.88-10.08 20.26l10.17 30.34c2.81 8.38 11.88 12.89 20.26 10.08l142.05-47.63c4.07 2.77 8.43 5.12 12.99 7.12V496c0 8.84 7.16 16 16 16h224c8.84 0 16-7.16 16-16v-32c-.01-8.84-7.17-16-16.01-16zm111.98-144c0-16.18 1.34-8.73-85.05-181.51-17.65-35.29-68.19-35.36-85.87 0-87.12 174.26-85.04 165.84-85.04 181.51H384c0 44.18 57.31 80 128 80s128-35.82 128-80h-.02zM440 288l72-144 72 144H440zm-269.07-37.51c-17.65-35.29-68.19-35.36-85.87 0C-2.06 424.75.02 416.33.02 432H0c0 44.18 57.31 80 128 80s128-35.82 128-80h-.02c0-16.18 1.34-8.73-85.05-181.51zM56 416l72-144 72 144H56z"]
};
var faBalanceScaleRight = {
prefix: 'fas',
iconName: 'balance-scale-right',
icon: [640, 512, [], "f516", "M96 464v32c0 8.84 7.16 16 16 16h224c8.84 0 16-7.16 16-16V153.25c4.56-2 8.92-4.35 12.99-7.12l142.05 47.63c8.38 2.81 17.45-1.71 20.26-10.08l10.17-30.34c2.81-8.38-1.71-17.45-10.08-20.26l-128.4-43.05c.42-3.32 1.01-6.6 1.01-10.03 0-44.18-35.82-80-80-80-29.69 0-55.3 16.36-69.11 40.37L132.96.83c-8.38-2.81-17.45 1.71-20.26 10.08l-10.17 30.34c-2.81 8.38 1.71 17.45 10.08 20.26l132 44.26c7.28 21.25 22.96 38.54 43.38 47.47V448H112c-8.84 0-16 7.16-16 16zM0 304c0 44.18 57.31 80 128 80s128-35.82 128-80h-.02c0-15.67 2.08-7.25-85.05-181.51-17.68-35.36-68.22-35.29-85.87 0C-1.32 295.27.02 287.82.02 304H0zm56-16l72-144 72 144H56zm328.02 144H384c0 44.18 57.31 80 128 80s128-35.82 128-80h-.02c0-15.67 2.08-7.25-85.05-181.51-17.68-35.36-68.22-35.29-85.87 0-86.38 172.78-85.04 165.33-85.04 181.51zM440 416l72-144 72 144H440z"]
};
var faBan = {
prefix: 'fas',
iconName: 'ban',
icon: [512, 512, [], "f05e", "M256 8C119.034 8 8 119.033 8 256s111.034 248 248 248 248-111.034 248-248S392.967 8 256 8zm130.108 117.892c65.448 65.448 70 165.481 20.677 235.637L150.47 105.216c70.204-49.356 170.226-44.735 235.638 20.676zM125.892 386.108c-65.448-65.448-70-165.481-20.677-235.637L361.53 406.784c-70.203 49.356-170.226 44.736-235.638-20.676z"]
};
var faBandAid = {
prefix: 'fas',
iconName: 'band-aid',
icon: [640, 512, [], "f462", "M0 160v192c0 35.3 28.7 64 64 64h96V96H64c-35.3 0-64 28.7-64 64zm576-64h-96v320h96c35.3 0 64-28.7 64-64V160c0-35.3-28.7-64-64-64zM192 416h256V96H192v320zm176-232c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm0 96c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm-96-96c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm0 96c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24z"]
};
var faBarcode = {
prefix: 'fas',
iconName: 'barcode',
icon: [512, 512, [], "f02a", "M0 448V64h18v384H0zm26.857-.273V64H36v383.727h-9.143zm27.143 0V64h8.857v383.727H54zm44.857 0V64h8.857v383.727h-8.857zm36 0V64h17.714v383.727h-17.714zm44.857 0V64h8.857v383.727h-8.857zm18 0V64h8.857v383.727h-8.857zm18 0V64h8.857v383.727h-8.857zm35.715 0V64h18v383.727h-18zm44.857 0V64h18v383.727h-18zm35.999 0V64h18.001v383.727h-18.001zm36.001 0V64h18.001v383.727h-18.001zm26.857 0V64h18v383.727h-18zm45.143 0V64h26.857v383.727h-26.857zm35.714 0V64h9.143v383.727H476zm18 .273V64h18v384h-18z"]
};
var faBars = {
prefix: 'fas',
iconName: 'bars',
icon: [448, 512, [], "f0c9", "M16 132h416c8.837 0 16-7.163 16-16V76c0-8.837-7.163-16-16-16H16C7.163 60 0 67.163 0 76v40c0 8.837 7.163 16 16 16zm0 160h416c8.837 0 16-7.163 16-16v-40c0-8.837-7.163-16-16-16H16c-8.837 0-16 7.163-16 16v40c0 8.837 7.163 16 16 16zm0 160h416c8.837 0 16-7.163 16-16v-40c0-8.837-7.163-16-16-16H16c-8.837 0-16 7.163-16 16v40c0 8.837 7.163 16 16 16z"]
};
var faBaseballBall = {
prefix: 'fas',
iconName: 'baseball-ball',
icon: [496, 512, [], "f433", "M368.5 363.9l28.8-13.9c11.1 22.9 26 43.2 44.1 60.9 34-42.5 54.5-96.3 54.5-154.9 0-58.5-20.4-112.2-54.2-154.6-17.8 17.3-32.6 37.1-43.6 59.5l-28.7-14.1c12.8-26 30-49 50.8-69C375.6 34.7 315 8 248 8 181.1 8 120.5 34.6 75.9 77.7c20.7 19.9 37.9 42.9 50.7 68.8l-28.7 14.1c-11-22.3-25.7-42.1-43.5-59.4C20.4 143.7 0 197.4 0 256c0 58.6 20.4 112.3 54.4 154.7 18.2-17.7 33.2-38 44.3-61l28.8 13.9c-12.9 26.7-30.3 50.3-51.5 70.7 44.5 43.1 105.1 69.7 172 69.7 66.8 0 127.3-26.5 171.9-69.5-21.1-20.4-38.5-43.9-51.4-70.6zm-228.3-32l-30.5-9.8c14.9-46.4 12.7-93.8-.6-134l30.4-10c15 45.6 18 99.9.7 153.8zm216.3-153.4l30.4 10c-13.2 40.1-15.5 87.5-.6 134l-30.5 9.8c-17.3-54-14.3-108.3.7-153.8z"]
};
var faBasketballBall = {
prefix: 'fas',
iconName: 'basketball-ball',
icon: [496, 512, [], "f434", "M212.3 10.3c-43.8 6.3-86.2 24.1-122.2 53.8l77.4 77.4c27.8-35.8 43.3-81.2 44.8-131.2zM248 222L405.9 64.1c-42.4-35-93.6-53.5-145.5-56.1-1.2 63.9-21.5 122.3-58.7 167.7L248 222zM56.1 98.1c-29.7 36-47.5 78.4-53.8 122.2 50-1.5 95.5-17 131.2-44.8L56.1 98.1zm272.2 204.2c45.3-37.1 103.7-57.4 167.7-58.7-2.6-51.9-21.1-103.1-56.1-145.5L282 256l46.3 46.3zM248 290L90.1 447.9c42.4 34.9 93.6 53.5 145.5 56.1 1.3-64 21.6-122.4 58.7-167.7L248 290zm191.9 123.9c29.7-36 47.5-78.4 53.8-122.2-50.1 1.6-95.5 17.1-131.2 44.8l77.4 77.4zM167.7 209.7C122.3 246.9 63.9 267.3 0 268.4c2.6 51.9 21.1 103.1 56.1 145.5L214 256l-46.3-46.3zm116 292c43.8-6.3 86.2-24.1 122.2-53.8l-77.4-77.4c-27.7 35.7-43.2 81.2-44.8 131.2z"]
};
var faBath = {
prefix: 'fas',
iconName: 'bath',
icon: [512, 512, [], "f2cd", "M32,384a95.4,95.4,0,0,0,32,71.09V496a16,16,0,0,0,16,16h32a16,16,0,0,0,16-16V480H384v16a16,16,0,0,0,16,16h32a16,16,0,0,0,16-16V455.09A95.4,95.4,0,0,0,480,384V336H32ZM496,256H80V69.25a21.26,21.26,0,0,1,36.28-15l19.27,19.26c-13.13,29.88-7.61,59.11,8.62,79.73l-.17.17A16,16,0,0,0,144,176l11.31,11.31a16,16,0,0,0,22.63,0L283.31,81.94a16,16,0,0,0,0-22.63L272,48a16,16,0,0,0-22.62,0l-.17.17c-20.62-16.23-49.83-21.75-79.73-8.62L150.22,20.28A69.25,69.25,0,0,0,32,69.25V256H16A16,16,0,0,0,0,272v16a16,16,0,0,0,16,16H496a16,16,0,0,0,16-16V272A16,16,0,0,0,496,256Z"]
};
var faBatteryEmpty = {
prefix: 'fas',
iconName: 'battery-empty',
icon: [640, 512, [], "f244", "M544 160v64h32v64h-32v64H64V160h480m16-64H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h512c26.51 0 48-21.49 48-48v-16h8c13.255 0 24-10.745 24-24V184c0-13.255-10.745-24-24-24h-8v-16c0-26.51-21.49-48-48-48z"]
};
var faBatteryFull = {
prefix: 'fas',
iconName: 'battery-full',
icon: [640, 512, [], "f240", "M544 160v64h32v64h-32v64H64V160h480m16-64H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h512c26.51 0 48-21.49 48-48v-16h8c13.255 0 24-10.745 24-24V184c0-13.255-10.745-24-24-24h-8v-16c0-26.51-21.49-48-48-48zm-48 96H96v128h416V192z"]
};
var faBatteryHalf = {
prefix: 'fas',
iconName: 'battery-half',
icon: [640, 512, [], "f242", "M544 160v64h32v64h-32v64H64V160h480m16-64H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h512c26.51 0 48-21.49 48-48v-16h8c13.255 0 24-10.745 24-24V184c0-13.255-10.745-24-24-24h-8v-16c0-26.51-21.49-48-48-48zm-240 96H96v128h224V192z"]
};
var faBatteryQuarter = {
prefix: 'fas',
iconName: 'battery-quarter',
icon: [640, 512, [], "f243", "M544 160v64h32v64h-32v64H64V160h480m16-64H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h512c26.51 0 48-21.49 48-48v-16h8c13.255 0 24-10.745 24-24V184c0-13.255-10.745-24-24-24h-8v-16c0-26.51-21.49-48-48-48zm-336 96H96v128h128V192z"]
};
var faBatteryThreeQuarters = {
prefix: 'fas',
iconName: 'battery-three-quarters',
icon: [640, 512, [], "f241", "M544 160v64h32v64h-32v64H64V160h480m16-64H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h512c26.51 0 48-21.49 48-48v-16h8c13.255 0 24-10.745 24-24V184c0-13.255-10.745-24-24-24h-8v-16c0-26.51-21.49-48-48-48zm-144 96H96v128h320V192z"]
};
var faBed = {
prefix: 'fas',
iconName: 'bed',
icon: [640, 512, [], "f236", "M176 256c44.11 0 80-35.89 80-80s-35.89-80-80-80-80 35.89-80 80 35.89 80 80 80zm352-128H304c-8.84 0-16 7.16-16 16v144H64V80c0-8.84-7.16-16-16-16H16C7.16 64 0 71.16 0 80v352c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-48h512v48c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16V240c0-61.86-50.14-112-112-112z"]
};
var faBeer = {
prefix: 'fas',
iconName: 'beer',
icon: [448, 512, [], "f0fc", "M368 96h-48V56c0-13.255-10.745-24-24-24H24C10.745 32 0 42.745 0 56v400c0 13.255 10.745 24 24 24h272c13.255 0 24-10.745 24-24v-42.11l80.606-35.977C429.396 365.063 448 336.388 448 304.86V176c0-44.112-35.888-80-80-80zm16 208.86a16.018 16.018 0 0 1-9.479 14.611L320 343.805V160h48c8.822 0 16 7.178 16 16v128.86zM208 384c-8.836 0-16-7.164-16-16V144c0-8.836 7.164-16 16-16s16 7.164 16 16v224c0 8.836-7.164 16-16 16zm-96 0c-8.836 0-16-7.164-16-16V144c0-8.836 7.164-16 16-16s16 7.164 16 16v224c0 8.836-7.164 16-16 16z"]
};
var faBell = {
prefix: 'fas',
iconName: 'bell',
icon: [448, 512, [], "f0f3", "M224 512c35.32 0 63.97-28.65 63.97-64H160.03c0 35.35 28.65 64 63.97 64zm215.39-149.71c-19.32-20.76-55.47-51.99-55.47-154.29 0-77.7-54.48-139.9-127.94-155.16V32c0-17.67-14.32-32-31.98-32s-31.98 14.33-31.98 32v20.84C118.56 68.1 64.08 130.3 64.08 208c0 102.3-36.15 133.53-55.47 154.29-6 6.45-8.66 14.16-8.61 21.71.11 16.4 12.98 32 32.1 32h383.8c19.12 0 32-15.6 32.1-32 .05-7.55-2.61-15.27-8.61-21.71z"]
};
var faBellSlash = {
prefix: 'fas',
iconName: 'bell-slash',
icon: [640, 512, [], "f1f6", "M633.82 458.1l-90.62-70.05c.19-1.38.8-2.66.8-4.06.05-7.55-2.61-15.27-8.61-21.71-19.32-20.76-55.47-51.99-55.47-154.29 0-77.7-54.48-139.9-127.94-155.16V32c0-17.67-14.32-32-31.98-32s-31.98 14.33-31.98 32v20.84c-40.33 8.38-74.66 31.07-97.59 62.57L45.47 3.37C38.49-2.05 28.43-.8 23.01 6.18L3.37 31.45C-2.05 38.42-.8 48.47 6.18 53.9l588.35 454.73c6.98 5.43 17.03 4.17 22.46-2.81l19.64-25.27c5.42-6.97 4.17-17.02-2.81-22.45zM157.23 251.54c-8.61 67.96-36.41 93.33-52.62 110.75-6 6.45-8.66 14.16-8.61 21.71.11 16.4 12.98 32 32.1 32h241.92L157.23 251.54zM320 512c35.32 0 63.97-28.65 63.97-64H256.03c0 35.35 28.65 64 63.97 64z"]
};
var faBezierCurve = {
prefix: 'fas',
iconName: 'bezier-curve',
icon: [640, 512, [], "f55b", "M368 32h-96c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32V64c0-17.67-14.33-32-32-32zM208 88h-84.75C113.75 64.56 90.84 48 64 48 28.66 48 0 76.65 0 112s28.66 64 64 64c26.84 0 49.75-16.56 59.25-40h79.73c-55.37 32.52-95.86 87.32-109.54 152h49.4c11.3-41.61 36.77-77.21 71.04-101.56-3.7-8.08-5.88-16.99-5.88-26.44V88zm-48 232H64c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32zM576 48c-26.84 0-49.75 16.56-59.25 40H432v72c0 9.45-2.19 18.36-5.88 26.44 34.27 24.35 59.74 59.95 71.04 101.56h49.4c-13.68-64.68-54.17-119.48-109.54-152h79.73c9.5 23.44 32.41 40 59.25 40 35.34 0 64-28.65 64-64s-28.66-64-64-64zm0 272h-96c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32z"]
};
var faBible = {
prefix: 'fas',
iconName: 'bible',
icon: [448, 512, [], "f647", "M448 358.4V25.6c0-16-9.6-25.6-25.6-25.6H96C41.6 0 0 41.6 0 96v320c0 54.4 41.6 96 96 96h326.4c12.8 0 25.6-9.6 25.6-25.6v-16c0-6.4-3.2-12.8-9.6-19.2-3.2-16-3.2-60.8 0-73.6 6.4-3.2 9.6-9.6 9.6-19.2zM144 144c0-8.84 7.16-16 16-16h48V80c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v48h48c8.84 0 16 7.16 16 16v32c0 8.84-7.16 16-16 16h-48v112c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16V192h-48c-8.84 0-16-7.16-16-16v-32zm236.8 304H96c-19.2 0-32-12.8-32-32s16-32 32-32h284.8v64z"]
};
var faBicycle = {
prefix: 'fas',
iconName: 'bicycle',
icon: [640, 512, [], "f206", "M512.509 192.001c-16.373-.064-32.03 2.955-46.436 8.495l-77.68-125.153A24 24 0 0 0 368.001 64h-64c-8.837 0-16 7.163-16 16v16c0 8.837 7.163 16 16 16h50.649l14.896 24H256.002v-16c0-8.837-7.163-16-16-16h-87.459c-13.441 0-24.777 10.999-24.536 24.437.232 13.044 10.876 23.563 23.995 23.563h48.726l-29.417 47.52c-13.433-4.83-27.904-7.483-42.992-7.52C58.094 191.83.412 249.012.002 319.236-.413 390.279 57.055 448 128.002 448c59.642 0 109.758-40.793 123.967-96h52.033a24 24 0 0 0 20.406-11.367L410.37 201.77l14.938 24.067c-25.455 23.448-41.385 57.081-41.307 94.437.145 68.833 57.899 127.051 126.729 127.719 70.606.685 128.181-55.803 129.255-125.996 1.086-70.941-56.526-129.72-127.476-129.996zM186.75 265.772c9.727 10.529 16.673 23.661 19.642 38.228h-43.306l23.664-38.228zM128.002 400c-44.112 0-80-35.888-80-80s35.888-80 80-80c5.869 0 11.586.653 17.099 1.859l-45.505 73.509C89.715 331.327 101.213 352 120.002 352h81.3c-12.37 28.225-40.562 48-73.3 48zm162.63-96h-35.624c-3.96-31.756-19.556-59.894-42.383-80.026L237.371 184h127.547l-74.286 120zm217.057 95.886c-41.036-2.165-74.049-35.692-75.627-76.755-.812-21.121 6.633-40.518 19.335-55.263l44.433 71.586c4.66 7.508 14.524 9.816 22.032 5.156l13.594-8.437c7.508-4.66 9.817-14.524 5.156-22.032l-44.468-71.643a79.901 79.901 0 0 1 19.858-2.497c44.112 0 80 35.888 80 80-.001 45.54-38.252 82.316-84.313 79.885z"]
};
var faBiking = {
prefix: 'fas',
iconName: 'biking',
icon: [640, 512, [], "f84a", "M400 96a48 48 0 1 0-48-48 48 48 0 0 0 48 48zm-4 121a31.9 31.9 0 0 0 20 7h64a32 32 0 0 0 0-64h-52.78L356 103a31.94 31.94 0 0 0-40.81.68l-112 96a32 32 0 0 0 3.08 50.92L288 305.12V416a32 32 0 0 0 64 0V288a32 32 0 0 0-14.25-26.62l-41.36-27.57 58.25-49.92zm116 39a128 128 0 1 0 128 128 128 128 0 0 0-128-128zm0 192a64 64 0 1 1 64-64 64 64 0 0 1-64 64zM128 256a128 128 0 1 0 128 128 128 128 0 0 0-128-128zm0 192a64 64 0 1 1 64-64 64 64 0 0 1-64 64z"]
};
var faBinoculars = {
prefix: 'fas',
iconName: 'binoculars',
icon: [512, 512, [], "f1e5", "M416 48c0-8.84-7.16-16-16-16h-64c-8.84 0-16 7.16-16 16v48h96V48zM63.91 159.99C61.4 253.84 3.46 274.22 0 404v44c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32V288h32V128H95.84c-17.63 0-31.45 14.37-31.93 31.99zm384.18 0c-.48-17.62-14.3-31.99-31.93-31.99H320v160h32v160c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-44c-3.46-129.78-61.4-150.16-63.91-244.01zM176 32h-64c-8.84 0-16 7.16-16 16v48h96V48c0-8.84-7.16-16-16-16zm48 256h64V128h-64v160z"]
};
var faBiohazard = {
prefix: 'fas',
iconName: 'biohazard',
icon: [576, 512, [], "f780", "M287.9 112c18.6 0 36.2 3.8 52.8 9.6 13.3-10.3 23.6-24.3 29.5-40.7-25.2-10.9-53-17-82.2-17-29.1 0-56.9 6-82.1 16.9 5.9 16.4 16.2 30.4 29.5 40.7 16.5-5.7 34-9.5 52.5-9.5zM163.6 438.7c12-11.8 20.4-26.4 24.5-42.4-32.9-26.4-54.8-65.3-58.9-109.6-8.5-2.8-17.2-4.6-26.4-4.6-7.6 0-15.2 1-22.5 3.1 4.1 62.8 35.8 118 83.3 153.5zm224.2-42.6c4.1 16 12.5 30.7 24.5 42.5 47.4-35.5 79.1-90.7 83-153.5-7.2-2-14.7-3-22.2-3-9.2 0-18 1.9-26.6 4.7-4.1 44.2-26 82.9-58.7 109.3zm113.5-205c-17.6-10.4-36.3-16.6-55.3-19.9 6-17.7 10-36.4 10-56.2 0-41-14.5-80.8-41-112.2-2.5-3-6.6-3.7-10-1.8-3.3 1.9-4.8 6-3.6 9.7 4.5 13.8 6.6 26.3 6.6 38.5 0 67.8-53.8 122.9-120 122.9S168 117 168 49.2c0-12.1 2.2-24.7 6.6-38.5 1.2-3.7-.3-7.8-3.6-9.7-3.4-1.9-7.5-1.2-10 1.8C134.6 34.2 120 74 120 115c0 19.8 3.9 38.5 10 56.2-18.9 3.3-37.7 9.5-55.3 19.9-34.6 20.5-61 53.3-74.3 92.4-1.3 3.7.2 7.7 3.5 9.8 3.3 2 7.5 1.3 10-1.6 9.4-10.8 19-19.1 29.2-25.1 57.3-33.9 130.8-13.7 163.9 45 33.1 58.7 13.4 134-43.9 167.9-10.2 6.1-22 10.4-35.8 13.4-3.7.8-6.4 4.2-6.4 8.1.1 4 2.7 7.3 6.5 8 39.7 7.8 80.6.8 115.2-19.7 18-10.6 32.9-24.5 45.3-40.1 12.4 15.6 27.3 29.5 45.3 40.1 34.6 20.5 75.5 27.5 115.2 19.7 3.8-.7 6.4-4 6.5-8 0-3.9-2.6-7.3-6.4-8.1-13.9-2.9-25.6-7.3-35.8-13.4-57.3-33.9-77-109.2-43.9-167.9s106.6-78.9 163.9-45c10.2 6.1 19.8 14.3 29.2 25.1 2.5 2.9 6.7 3.6 10 1.6s4.8-6.1 3.5-9.8c-13.1-39.1-39.5-72-74.1-92.4zm-213.4 129c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48z"]
};
var faBirthdayCake = {
prefix: 'fas',
iconName: 'birthday-cake',
icon: [448, 512, [], "f1fd", "M448 384c-28.02 0-31.26-32-74.5-32-43.43 0-46.825 32-74.75 32-27.695 0-31.454-32-74.75-32-42.842 0-47.218 32-74.5 32-28.148 0-31.202-32-74.75-32-43.547 0-46.653 32-74.75 32v-80c0-26.5 21.5-48 48-48h16V112h64v144h64V112h64v144h64V112h64v144h16c26.5 0 48 21.5 48 48v80zm0 128H0v-96c43.356 0 46.767-32 74.75-32 27.951 0 31.253 32 74.75 32 42.843 0 47.217-32 74.5-32 28.148 0 31.201 32 74.75 32 43.357 0 46.767-32 74.75-32 27.488 0 31.252 32 74.5 32v96zM96 96c-17.75 0-32-14.25-32-32 0-31 32-23 32-64 12 0 32 29.5 32 56s-14.25 40-32 40zm128 0c-17.75 0-32-14.25-32-32 0-31 32-23 32-64 12 0 32 29.5 32 56s-14.25 40-32 40zm128 0c-17.75 0-32-14.25-32-32 0-31 32-23 32-64 12 0 32 29.5 32 56s-14.25 40-32 40z"]
};
var faBlender = {
prefix: 'fas',
iconName: 'blender',
icon: [512, 512, [], "f517", "M416 384H160c-35.35 0-64 28.65-64 64v32c0 17.67 14.33 32 32 32h320c17.67 0 32-14.33 32-32v-32c0-35.35-28.65-64-64-64zm-128 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm40-416h166.54L512 0H48C21.49 0 0 21.49 0 48v160c0 26.51 21.49 48 48 48h103.27l8.73 96h256l17.46-64H328c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h114.18l17.46-64H328c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h140.36l17.46-64H328c-4.42 0-8-3.58-8-8V72c0-4.42 3.58-8 8-8zM64 192V64h69.82l11.64 128H64z"]
};
var faBlenderPhone = {
prefix: 'fas',
iconName: 'blender-phone',
icon: [576, 512, [], "f6b6", "M392 64h166.54L576 0H192v352h288l17.46-64H392c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h114.18l17.46-64H392c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h140.36l17.46-64H392c-4.42 0-8-3.58-8-8V72c0-4.42 3.58-8 8-8zM158.8 335.01l-25.78-63.26c-2.78-6.81-9.8-10.99-17.24-10.26l-45.03 4.42c-17.28-46.94-17.65-99.78 0-147.72l45.03 4.42c7.43.73 14.46-3.46 17.24-10.26l25.78-63.26c3.02-7.39.2-15.85-6.68-20.07l-39.28-24.1C98.51-3.87 80.09-.5 68.95 11.97c-92.57 103.6-92 259.55 2.1 362.49 9.87 10.8 29.12 12.48 41.65 4.8l39.41-24.18c6.89-4.22 9.7-12.67 6.69-20.07zM480 384H192c-35.35 0-64 28.65-64 64v32c0 17.67 14.33 32 32 32h352c17.67 0 32-14.33 32-32v-32c0-35.35-28.65-64-64-64zm-144 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faBlind = {
prefix: 'fas',
iconName: 'blind',
icon: [384, 512, [], "f29d", "M380.15 510.837a8 8 0 0 1-10.989-2.687l-125.33-206.427a31.923 31.923 0 0 0 12.958-9.485l126.048 207.608a8 8 0 0 1-2.687 10.991zM142.803 314.338l-32.54 89.485 36.12 88.285c6.693 16.36 25.377 24.192 41.733 17.501 16.357-6.692 24.193-25.376 17.501-41.734l-62.814-153.537zM96 88c24.301 0 44-19.699 44-44S120.301 0 96 0 52 19.699 52 44s19.699 44 44 44zm154.837 169.128l-120-152c-4.733-5.995-11.75-9.108-18.837-9.112V96H80v.026c-7.146.003-14.217 3.161-18.944 9.24L0 183.766v95.694c0 13.455 11.011 24.791 24.464 24.536C37.505 303.748 48 293.1 48 280v-79.766l16-20.571v140.698L9.927 469.055c-6.04 16.609 2.528 34.969 19.138 41.009 16.602 6.039 34.968-2.524 41.009-19.138L136 309.638V202.441l-31.406-39.816a4 4 0 1 1 6.269-4.971l102.3 129.217c9.145 11.584 24.368 11.339 33.708 3.965 10.41-8.216 12.159-23.334 3.966-33.708z"]
};
var faBlog = {
prefix: 'fas',
iconName: 'blog',
icon: [512, 512, [], "f781", "M172.2 226.8c-14.6-2.9-28.2 8.9-28.2 23.8V301c0 10.2 7.1 18.4 16.7 22 18.2 6.8 31.3 24.4 31.3 45 0 26.5-21.5 48-48 48s-48-21.5-48-48V120c0-13.3-10.7-24-24-24H24c-13.3 0-24 10.7-24 24v248c0 89.5 82.1 160.2 175 140.7 54.4-11.4 98.3-55.4 109.7-109.7 17.4-82.9-37-157.2-112.5-172.2zM209 0c-9.2-.5-17 6.8-17 16v31.6c0 8.5 6.6 15.5 15 15.9 129.4 7 233.4 112 240.9 241.5.5 8.4 7.5 15 15.9 15h32.1c9.2 0 16.5-7.8 16-17C503.4 139.8 372.2 8.6 209 0zm.3 96c-9.3-.7-17.3 6.7-17.3 16.1v32.1c0 8.4 6.5 15.3 14.8 15.9 76.8 6.3 138 68.2 144.9 145.2.8 8.3 7.6 14.7 15.9 14.7h32.2c9.3 0 16.8-8 16.1-17.3-8.4-110.1-96.5-198.2-206.6-206.7z"]
};
var faBold = {
prefix: 'fas',
iconName: 'bold',
icon: [384, 512, [], "f032", "M333.49 238a122 122 0 0 0 27-65.21C367.87 96.49 308 32 233.42 32H34a16 16 0 0 0-16 16v48a16 16 0 0 0 16 16h31.87v288H34a16 16 0 0 0-16 16v48a16 16 0 0 0 16 16h209.32c70.8 0 134.14-51.75 141-122.4 4.74-48.45-16.39-92.06-50.83-119.6zM145.66 112h87.76a48 48 0 0 1 0 96h-87.76zm87.76 288h-87.76V288h87.76a56 56 0 0 1 0 112z"]
};
var faBolt = {
prefix: 'fas',
iconName: 'bolt',
icon: [320, 512, [], "f0e7", "M296 160H180.6l42.6-129.8C227.2 15 215.7 0 200 0H56C44 0 33.8 8.9 32.2 20.8l-32 240C-1.7 275.2 9.5 288 24 288h118.7L96.6 482.5c-3.6 15.2 8 29.5 23.3 29.5 8.4 0 16.4-4.4 20.8-12l176-304c9.3-15.9-2.2-36-20.7-36z"]
};
var faBomb = {
prefix: 'fas',
iconName: 'bomb',
icon: [512, 512, [], "f1e2", "M440.5 88.5l-52 52L415 167c9.4 9.4 9.4 24.6 0 33.9l-17.4 17.4c11.8 26.1 18.4 55.1 18.4 85.6 0 114.9-93.1 208-208 208S0 418.9 0 304 93.1 96 208 96c30.5 0 59.5 6.6 85.6 18.4L311 97c9.4-9.4 24.6-9.4 33.9 0l26.5 26.5 52-52 17.1 17zM500 60h-24c-6.6 0-12 5.4-12 12s5.4 12 12 12h24c6.6 0 12-5.4 12-12s-5.4-12-12-12zM440 0c-6.6 0-12 5.4-12 12v24c0 6.6 5.4 12 12 12s12-5.4 12-12V12c0-6.6-5.4-12-12-12zm33.9 55l17-17c4.7-4.7 4.7-12.3 0-17-4.7-4.7-12.3-4.7-17 0l-17 17c-4.7 4.7-4.7 12.3 0 17 4.8 4.7 12.4 4.7 17 0zm-67.8 0c4.7 4.7 12.3 4.7 17 0 4.7-4.7 4.7-12.3 0-17l-17-17c-4.7-4.7-12.3-4.7-17 0-4.7 4.7-4.7 12.3 0 17l17 17zm67.8 34c-4.7-4.7-12.3-4.7-17 0-4.7 4.7-4.7 12.3 0 17l17 17c4.7 4.7 12.3 4.7 17 0 4.7-4.7 4.7-12.3 0-17l-17-17zM112 272c0-35.3 28.7-64 64-64 8.8 0 16-7.2 16-16s-7.2-16-16-16c-52.9 0-96 43.1-96 96 0 8.8 7.2 16 16 16s16-7.2 16-16z"]
};
var faBone = {
prefix: 'fas',
iconName: 'bone',
icon: [640, 512, [], "f5d7", "M598.88 244.56c25.2-12.6 41.12-38.36 41.12-66.53v-7.64C640 129.3 606.7 96 565.61 96c-32.02 0-60.44 20.49-70.57 50.86-7.68 23.03-11.6 45.14-38.11 45.14H183.06c-27.38 0-31.58-25.54-38.11-45.14C134.83 116.49 106.4 96 74.39 96 33.3 96 0 129.3 0 170.39v7.64c0 28.17 15.92 53.93 41.12 66.53 9.43 4.71 9.43 18.17 0 22.88C15.92 280.04 0 305.8 0 333.97v7.64C0 382.7 33.3 416 74.38 416c32.02 0 60.44-20.49 70.57-50.86 7.68-23.03 11.6-45.14 38.11-45.14h273.87c27.38 0 31.58 25.54 38.11 45.14C505.17 395.51 533.6 416 565.61 416c41.08 0 74.38-33.3 74.38-74.39v-7.64c0-28.18-15.92-53.93-41.12-66.53-9.42-4.71-9.42-18.17.01-22.88z"]
};
var faBong = {
prefix: 'fas',
iconName: 'bong',
icon: [448, 512, [], "f55c", "M302.5 512c23.18 0 44.43-12.58 56-32.66C374.69 451.26 384 418.75 384 384c0-36.12-10.08-69.81-27.44-98.62L400 241.94l9.38 9.38c6.25 6.25 16.38 6.25 22.63 0l11.3-11.32c6.25-6.25 6.25-16.38 0-22.63l-52.69-52.69c-6.25-6.25-16.38-6.25-22.63 0l-11.31 11.31c-6.25 6.25-6.25 16.38 0 22.63l9.38 9.38-39.41 39.41c-11.56-11.37-24.53-21.33-38.65-29.51V63.74l15.97-.02c8.82-.01 15.97-7.16 15.98-15.98l.04-31.72C320 7.17 312.82-.01 303.97 0L80.03.26c-8.82.01-15.97 7.16-15.98 15.98l-.04 31.73c-.01 8.85 7.17 16.02 16.02 16.01L96 63.96v153.93C38.67 251.1 0 312.97 0 384c0 34.75 9.31 67.27 25.5 95.34C37.08 499.42 58.33 512 81.5 512h221zM120.06 259.43L144 245.56V63.91l96-.11v181.76l23.94 13.87c24.81 14.37 44.12 35.73 56.56 60.57h-257c12.45-24.84 31.75-46.2 56.56-60.57z"]
};
var faBook = {
prefix: 'fas',
iconName: 'book',
icon: [448, 512, [], "f02d", "M448 360V24c0-13.3-10.7-24-24-24H96C43 0 0 43 0 96v320c0 53 43 96 96 96h328c13.3 0 24-10.7 24-24v-16c0-7.5-3.5-14.3-8.9-18.7-4.2-15.4-4.2-59.3 0-74.7 5.4-4.3 8.9-11.1 8.9-18.6zM128 134c0-3.3 2.7-6 6-6h212c3.3 0 6 2.7 6 6v20c0 3.3-2.7 6-6 6H134c-3.3 0-6-2.7-6-6v-20zm0 64c0-3.3 2.7-6 6-6h212c3.3 0 6 2.7 6 6v20c0 3.3-2.7 6-6 6H134c-3.3 0-6-2.7-6-6v-20zm253.4 250H96c-17.7 0-32-14.3-32-32 0-17.6 14.4-32 32-32h285.4c-1.9 17.1-1.9 46.9 0 64z"]
};
var faBookDead = {
prefix: 'fas',
iconName: 'book-dead',
icon: [448, 512, [], "f6b7", "M272 136c8.8 0 16-7.2 16-16s-7.2-16-16-16-16 7.2-16 16 7.2 16 16 16zm176 222.4V25.6c0-16-9.6-25.6-25.6-25.6H96C41.6 0 0 41.6 0 96v320c0 54.4 41.6 96 96 96h326.4c12.8 0 25.6-9.6 25.6-25.6v-16c0-6.4-3.2-12.8-9.6-19.2-3.2-16-3.2-60.8 0-73.6 6.4-3.2 9.6-9.6 9.6-19.2zM240 56c44.2 0 80 28.7 80 64 0 20.9-12.7 39.2-32 50.9V184c0 8.8-7.2 16-16 16h-64c-8.8 0-16-7.2-16-16v-13.1c-19.3-11.7-32-30-32-50.9 0-35.3 35.8-64 80-64zM124.8 223.3l6.3-14.7c1.7-4.1 6.4-5.9 10.5-4.2l98.3 42.1 98.4-42.1c4.1-1.7 8.8.1 10.5 4.2l6.3 14.7c1.7 4.1-.1 8.8-4.2 10.5L280.6 264l70.3 30.1c4.1 1.7 5.9 6.4 4.2 10.5l-6.3 14.7c-1.7 4.1-6.4 5.9-10.5 4.2L240 281.4l-98.3 42.2c-4.1 1.7-8.8-.1-10.5-4.2l-6.3-14.7c-1.7-4.1.1-8.8 4.2-10.5l70.4-30.1-70.5-30.3c-4.1-1.7-5.9-6.4-4.2-10.5zm256 224.7H96c-19.2 0-32-12.8-32-32s16-32 32-32h284.8zM208 136c8.8 0 16-7.2 16-16s-7.2-16-16-16-16 7.2-16 16 7.2 16 16 16z"]
};
var faBookMedical = {
prefix: 'fas',
iconName: 'book-medical',
icon: [448, 512, [], "f7e6", "M448 358.4V25.6c0-16-9.6-25.6-25.6-25.6H96C41.6 0 0 41.6 0 96v320c0 54.4 41.6 96 96 96h326.4c12.8 0 25.6-9.6 25.6-25.6v-16q0-9.6-9.6-19.2c-3.2-16-3.2-60.8 0-73.6q9.6-4.8 9.6-19.2zM144 168a8 8 0 0 1 8-8h56v-56a8 8 0 0 1 8-8h48a8 8 0 0 1 8 8v56h56a8 8 0 0 1 8 8v48a8 8 0 0 1-8 8h-56v56a8 8 0 0 1-8 8h-48a8 8 0 0 1-8-8v-56h-56a8 8 0 0 1-8-8zm236.8 280H96c-19.2 0-32-12.8-32-32s16-32 32-32h284.8z"]
};
var faBookOpen = {
prefix: 'fas',
iconName: 'book-open',
icon: [576, 512, [], "f518", "M542.22 32.05c-54.8 3.11-163.72 14.43-230.96 55.59-4.64 2.84-7.27 7.89-7.27 13.17v363.87c0 11.55 12.63 18.85 23.28 13.49 69.18-34.82 169.23-44.32 218.7-46.92 16.89-.89 30.02-14.43 30.02-30.66V62.75c.01-17.71-15.35-31.74-33.77-30.7zM264.73 87.64C197.5 46.48 88.58 35.17 33.78 32.05 15.36 31.01 0 45.04 0 62.75V400.6c0 16.24 13.13 29.78 30.02 30.66 49.49 2.6 149.59 12.11 218.77 46.95 10.62 5.35 23.21-1.94 23.21-13.46V100.63c0-5.29-2.62-10.14-7.27-12.99z"]
};
var faBookReader = {
prefix: 'fas',
iconName: 'book-reader',
icon: [512, 512, [], "f5da", "M352 96c0-53.02-42.98-96-96-96s-96 42.98-96 96 42.98 96 96 96 96-42.98 96-96zM233.59 241.1c-59.33-36.32-155.43-46.3-203.79-49.05C13.55 191.13 0 203.51 0 219.14v222.8c0 14.33 11.59 26.28 26.49 27.05 43.66 2.29 131.99 10.68 193.04 41.43 9.37 4.72 20.48-1.71 20.48-11.87V252.56c-.01-4.67-2.32-8.95-6.42-11.46zm248.61-49.05c-48.35 2.74-144.46 12.73-203.78 49.05-4.1 2.51-6.41 6.96-6.41 11.63v245.79c0 10.19 11.14 16.63 20.54 11.9 61.04-30.72 149.32-39.11 192.97-41.4 14.9-.78 26.49-12.73 26.49-27.06V219.14c-.01-15.63-13.56-28.01-29.81-27.09z"]
};
var faBookmark = {
prefix: 'fas',
iconName: 'bookmark',
icon: [384, 512, [], "f02e", "M0 512V48C0 21.49 21.49 0 48 0h288c26.51 0 48 21.49 48 48v464L192 400 0 512z"]
};
var faBorderAll = {
prefix: 'fas',
iconName: 'border-all',
icon: [448, 512, [], "f84c", "M416 32H32A32 32 0 0 0 0 64v384a32 32 0 0 0 32 32h384a32 32 0 0 0 32-32V64a32 32 0 0 0-32-32zm-32 64v128H256V96zm-192 0v128H64V96zM64 416V288h128v128zm192 0V288h128v128z"]
};
var faBorderNone = {
prefix: 'fas',
iconName: 'border-none',
icon: [448, 512, [], "f850", "M240 224h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-288 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96 192h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-96h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-192h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM240 320h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-192h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-96 288h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96-384h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zM48 224H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0 192H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-96H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-192H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-96H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zm96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faBorderStyle = {
prefix: 'fas',
iconName: 'border-style',
icon: [448, 512, [], "f853", "M240 416h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-96 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm192 0h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm96-192h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0 96h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0 96h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-288h-32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-96H32A32 32 0 0 0 0 64v400a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V96h368a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faBowlingBall = {
prefix: 'fas',
iconName: 'bowling-ball',
icon: [496, 512, [], "f436", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM120 192c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm64-96c0-17.7 14.3-32 32-32s32 14.3 32 32-14.3 32-32 32-32-14.3-32-32zm48 144c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faBox = {
prefix: 'fas',
iconName: 'box',
icon: [512, 512, [], "f466", "M509.5 184.6L458.9 32.8C452.4 13.2 434.1 0 413.4 0H272v192h238.7c-.4-2.5-.4-5-1.2-7.4zM240 0H98.6c-20.7 0-39 13.2-45.5 32.8L2.5 184.6c-.8 2.4-.8 4.9-1.2 7.4H240V0zM0 224v240c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V224H0z"]
};
var faBoxOpen = {
prefix: 'fas',
iconName: 'box-open',
icon: [640, 512, [], "f49e", "M425.7 256c-16.9 0-32.8-9-41.4-23.4L320 126l-64.2 106.6c-8.7 14.5-24.6 23.5-41.5 23.5-4.5 0-9-.6-13.3-1.9L64 215v178c0 14.7 10 27.5 24.2 31l216.2 54.1c10.2 2.5 20.9 2.5 31 0L551.8 424c14.2-3.6 24.2-16.4 24.2-31V215l-137 39.1c-4.3 1.3-8.8 1.9-13.3 1.9zm212.6-112.2L586.8 41c-3.1-6.2-9.8-9.8-16.7-8.9L320 64l91.7 152.1c3.8 6.3 11.4 9.3 18.5 7.3l197.9-56.5c9.9-2.9 14.7-13.9 10.2-23.1zM53.2 41L1.7 143.8c-4.6 9.2.3 20.2 10.1 23l197.9 56.5c7.1 2 14.7-1 18.5-7.3L320 64 69.8 32.1c-6.9-.8-13.5 2.7-16.6 8.9z"]
};
var faBoxTissue = {
prefix: 'fas',
iconName: 'box-tissue',
icon: [512, 512, [], "e05b", "M383.88,287.82l64-192H338.47a70.2,70.2,0,0,1-66.59-48,70.21,70.21,0,0,0-66.6-48H63.88l64,288Zm-384,192a32,32,0,0,0,32,32h448a32,32,0,0,0,32-32v-64H-.12Zm480-256H438.94l-21.33,64h14.27a16,16,0,0,1,0,32h-352a16,16,0,1,1,0-32H95.09l-14.22-64h-49a32,32,0,0,0-32,32v128h512v-128A32,32,0,0,0,479.88,223.82Z"]
};
var faBoxes = {
prefix: 'fas',
iconName: 'boxes',
icon: [576, 512, [], "f468", "M560 288h-80v96l-32-21.3-32 21.3v-96h-80c-8.8 0-16 7.2-16 16v192c0 8.8 7.2 16 16 16h224c8.8 0 16-7.2 16-16V304c0-8.8-7.2-16-16-16zm-384-64h224c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16h-80v96l-32-21.3L256 96V0h-80c-8.8 0-16 7.2-16 16v192c0 8.8 7.2 16 16 16zm64 64h-80v96l-32-21.3L96 384v-96H16c-8.8 0-16 7.2-16 16v192c0 8.8 7.2 16 16 16h224c8.8 0 16-7.2 16-16V304c0-8.8-7.2-16-16-16z"]
};
var faBraille = {
prefix: 'fas',
iconName: 'braille',
icon: [640, 512, [], "f2a1", "M128 256c0 35.346-28.654 64-64 64S0 291.346 0 256s28.654-64 64-64 64 28.654 64 64zM64 384c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0-352C28.654 32 0 60.654 0 96s28.654 64 64 64 64-28.654 64-64-28.654-64-64-64zm160 192c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0 160c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0-352c-35.346 0-64 28.654-64 64s28.654 64 64 64 64-28.654 64-64-28.654-64-64-64zm224 192c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0 160c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0-352c-35.346 0-64 28.654-64 64s28.654 64 64 64 64-28.654 64-64-28.654-64-64-64zm160 192c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0 160c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm0-320c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32z"]
};
var faBrain = {
prefix: 'fas',
iconName: 'brain',
icon: [576, 512, [], "f5dc", "M208 0c-29.9 0-54.7 20.5-61.8 48.2-.8 0-1.4-.2-2.2-.2-35.3 0-64 28.7-64 64 0 4.8.6 9.5 1.7 14C52.5 138 32 166.6 32 200c0 12.6 3.2 24.3 8.3 34.9C16.3 248.7 0 274.3 0 304c0 33.3 20.4 61.9 49.4 73.9-.9 4.6-1.4 9.3-1.4 14.1 0 39.8 32.2 72 72 72 4.1 0 8.1-.5 12-1.2 9.6 28.5 36.2 49.2 68 49.2 39.8 0 72-32.2 72-72V64c0-35.3-28.7-64-64-64zm368 304c0-29.7-16.3-55.3-40.3-69.1 5.2-10.6 8.3-22.3 8.3-34.9 0-33.4-20.5-62-49.7-74 1-4.5 1.7-9.2 1.7-14 0-35.3-28.7-64-64-64-.8 0-1.5.2-2.2.2C422.7 20.5 397.9 0 368 0c-35.3 0-64 28.6-64 64v376c0 39.8 32.2 72 72 72 31.8 0 58.4-20.7 68-49.2 3.9.7 7.9 1.2 12 1.2 39.8 0 72-32.2 72-72 0-4.8-.5-9.5-1.4-14.1 29-12 49.4-40.6 49.4-73.9z"]
};
var faBreadSlice = {
prefix: 'fas',
iconName: 'bread-slice',
icon: [576, 512, [], "f7ec", "M288 0C108 0 0 93.4 0 169.14 0 199.44 24.24 224 64 224v256c0 17.67 16.12 32 36 32h376c19.88 0 36-14.33 36-32V224c39.76 0 64-24.56 64-54.86C576 93.4 468 0 288 0z"]
};
var faBriefcase = {
prefix: 'fas',
iconName: 'briefcase',
icon: [512, 512, [], "f0b1", "M320 336c0 8.84-7.16 16-16 16h-96c-8.84 0-16-7.16-16-16v-48H0v144c0 25.6 22.4 48 48 48h416c25.6 0 48-22.4 48-48V288H320v48zm144-208h-80V80c0-25.6-22.4-48-48-48H176c-25.6 0-48 22.4-48 48v48H48c-25.6 0-48 22.4-48 48v80h512v-80c0-25.6-22.4-48-48-48zm-144 0H192V96h128v32z"]
};
var faBriefcaseMedical = {
prefix: 'fas',
iconName: 'briefcase-medical',
icon: [512, 512, [], "f469", "M464 128h-80V80c0-26.5-21.5-48-48-48H176c-26.5 0-48 21.5-48 48v48H48c-26.5 0-48 21.5-48 48v288c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V176c0-26.5-21.5-48-48-48zM192 96h128v32H192V96zm160 248c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8v48z"]
};
var faBroadcastTower = {
prefix: 'fas',
iconName: 'broadcast-tower',
icon: [640, 512, [], "f519", "M150.94 192h33.73c11.01 0 18.61-10.83 14.86-21.18-4.93-13.58-7.55-27.98-7.55-42.82s2.62-29.24 7.55-42.82C203.29 74.83 195.68 64 184.67 64h-33.73c-7.01 0-13.46 4.49-15.41 11.23C130.64 92.21 128 109.88 128 128c0 18.12 2.64 35.79 7.54 52.76 1.94 6.74 8.39 11.24 15.4 11.24zM89.92 23.34C95.56 12.72 87.97 0 75.96 0H40.63c-6.27 0-12.14 3.59-14.74 9.31C9.4 45.54 0 85.65 0 128c0 24.75 3.12 68.33 26.69 118.86 2.62 5.63 8.42 9.14 14.61 9.14h34.84c12.02 0 19.61-12.74 13.95-23.37-49.78-93.32-16.71-178.15-.17-209.29zM614.06 9.29C611.46 3.58 605.6 0 599.33 0h-35.42c-11.98 0-19.66 12.66-14.02 23.25 18.27 34.29 48.42 119.42.28 209.23-5.72 10.68 1.8 23.52 13.91 23.52h35.23c6.27 0 12.13-3.58 14.73-9.29C630.57 210.48 640 170.36 640 128s-9.42-82.48-25.94-118.71zM489.06 64h-33.73c-11.01 0-18.61 10.83-14.86 21.18 4.93 13.58 7.55 27.98 7.55 42.82s-2.62 29.24-7.55 42.82c-3.76 10.35 3.85 21.18 14.86 21.18h33.73c7.02 0 13.46-4.49 15.41-11.24 4.9-16.97 7.53-34.64 7.53-52.76 0-18.12-2.64-35.79-7.54-52.76-1.94-6.75-8.39-11.24-15.4-11.24zm-116.3 100.12c7.05-10.29 11.2-22.71 11.2-36.12 0-35.35-28.63-64-63.96-64-35.32 0-63.96 28.65-63.96 64 0 13.41 4.15 25.83 11.2 36.12l-130.5 313.41c-3.4 8.15.46 17.52 8.61 20.92l29.51 12.31c8.15 3.4 17.52-.46 20.91-8.61L244.96 384h150.07l49.2 118.15c3.4 8.16 12.76 12.01 20.91 8.61l29.51-12.31c8.15-3.4 12-12.77 8.61-20.92l-130.5-313.41zM271.62 320L320 203.81 368.38 320h-96.76z"]
};
var faBroom = {
prefix: 'fas',
iconName: 'broom',
icon: [640, 512, [], "f51a", "M256.47 216.77l86.73 109.18s-16.6 102.36-76.57 150.12C206.66 523.85 0 510.19 0 510.19s3.8-23.14 11-55.43l94.62-112.17c3.97-4.7-.87-11.62-6.65-9.5l-60.4 22.09c14.44-41.66 32.72-80.04 54.6-97.47 59.97-47.76 163.3-40.94 163.3-40.94zM636.53 31.03l-19.86-25c-5.49-6.9-15.52-8.05-22.41-2.56l-232.48 177.8-34.14-42.97c-5.09-6.41-15.14-5.21-18.59 2.21l-25.33 54.55 86.73 109.18 58.8-12.45c8-1.69 11.42-11.2 6.34-17.6l-34.09-42.92 232.48-177.8c6.89-5.48 8.04-15.53 2.55-22.44z"]
};
var faBrush = {
prefix: 'fas',
iconName: 'brush',
icon: [384, 512, [], "f55d", "M352 0H32C14.33 0 0 14.33 0 32v224h384V32c0-17.67-14.33-32-32-32zM0 320c0 35.35 28.66 64 64 64h64v64c0 35.35 28.66 64 64 64s64-28.65 64-64v-64h64c35.34 0 64-28.65 64-64v-32H0v32zm192 104c13.25 0 24 10.74 24 24 0 13.25-10.75 24-24 24s-24-10.75-24-24c0-13.26 10.75-24 24-24z"]
};
var faBug = {
prefix: 'fas',
iconName: 'bug',
icon: [512, 512, [], "f188", "M511.988 288.9c-.478 17.43-15.217 31.1-32.653 31.1H424v16c0 21.864-4.882 42.584-13.6 61.145l60.228 60.228c12.496 12.497 12.496 32.758 0 45.255-12.498 12.497-32.759 12.496-45.256 0l-54.736-54.736C345.886 467.965 314.351 480 280 480V236c0-6.627-5.373-12-12-12h-24c-6.627 0-12 5.373-12 12v244c-34.351 0-65.886-12.035-90.636-32.108l-54.736 54.736c-12.498 12.497-32.759 12.496-45.256 0-12.496-12.497-12.496-32.758 0-45.255l60.228-60.228C92.882 378.584 88 357.864 88 336v-16H32.666C15.23 320 .491 306.33.013 288.9-.484 270.816 14.028 256 32 256h56v-58.745l-46.628-46.628c-12.496-12.497-12.496-32.758 0-45.255 12.498-12.497 32.758-12.497 45.256 0L141.255 160h229.489l54.627-54.627c12.498-12.497 32.758-12.497 45.256 0 12.496 12.497 12.496 32.758 0 45.255L424 197.255V256h56c17.972 0 32.484 14.816 31.988 32.9zM257 0c-61.856 0-112 50.144-112 112h224C369 50.144 318.856 0 257 0z"]
};
var faBuilding = {
prefix: 'fas',
iconName: 'building',
icon: [448, 512, [], "f1ad", "M436 480h-20V24c0-13.255-10.745-24-24-24H56C42.745 0 32 10.745 32 24v456H12c-6.627 0-12 5.373-12 12v20h448v-20c0-6.627-5.373-12-12-12zM128 76c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12V76zm0 96c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12v-40zm52 148h-40c-6.627 0-12-5.373-12-12v-40c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12zm76 160h-64v-84c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v84zm64-172c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12v-40c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40zm0-96c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12v-40c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40zm0-96c0 6.627-5.373 12-12 12h-40c-6.627 0-12-5.373-12-12V76c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v40z"]
};
var faBullhorn = {
prefix: 'fas',
iconName: 'bullhorn',
icon: [576, 512, [], "f0a1", "M576 240c0-23.63-12.95-44.04-32-55.12V32.01C544 23.26 537.02 0 512 0c-7.12 0-14.19 2.38-19.98 7.02l-85.03 68.03C364.28 109.19 310.66 128 256 128H64c-35.35 0-64 28.65-64 64v96c0 35.35 28.65 64 64 64h33.7c-1.39 10.48-2.18 21.14-2.18 32 0 39.77 9.26 77.35 25.56 110.94 5.19 10.69 16.52 17.06 28.4 17.06h74.28c26.05 0 41.69-29.84 25.9-50.56-16.4-21.52-26.15-48.36-26.15-77.44 0-11.11 1.62-21.79 4.41-32H256c54.66 0 108.28 18.81 150.98 52.95l85.03 68.03a32.023 32.023 0 0 0 19.98 7.02c24.92 0 32-22.78 32-32V295.13C563.05 284.04 576 263.63 576 240zm-96 141.42l-33.05-26.44C392.95 311.78 325.12 288 256 288v-96c69.12 0 136.95-23.78 190.95-66.98L480 98.58v282.84z"]
};
var faBullseye = {
prefix: 'fas',
iconName: 'bullseye',
icon: [496, 512, [], "f140", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm0 432c-101.69 0-184-82.29-184-184 0-101.69 82.29-184 184-184 101.69 0 184 82.29 184 184 0 101.69-82.29 184-184 184zm0-312c-70.69 0-128 57.31-128 128s57.31 128 128 128 128-57.31 128-128-57.31-128-128-128zm0 192c-35.29 0-64-28.71-64-64s28.71-64 64-64 64 28.71 64 64-28.71 64-64 64z"]
};
var faBurn = {
prefix: 'fas',
iconName: 'burn',
icon: [384, 512, [], "f46a", "M192 0C79.7 101.3 0 220.9 0 300.5 0 425 79 512 192 512s192-87 192-211.5c0-79.9-80.2-199.6-192-300.5zm0 448c-56.5 0-96-39-96-94.8 0-13.5 4.6-61.5 96-161.2 91.4 99.7 96 147.7 96 161.2 0 55.8-39.5 94.8-96 94.8z"]
};
var faBus = {
prefix: 'fas',
iconName: 'bus',
icon: [512, 512, [], "f207", "M488 128h-8V80c0-44.8-99.2-80-224-80S32 35.2 32 80v48h-8c-13.25 0-24 10.74-24 24v80c0 13.25 10.75 24 24 24h8v160c0 17.67 14.33 32 32 32v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h192v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h6.4c16 0 25.6-12.8 25.6-25.6V256h8c13.25 0 24-10.75 24-24v-80c0-13.26-10.75-24-24-24zM112 400c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm16-112c-17.67 0-32-14.33-32-32V128c0-17.67 14.33-32 32-32h256c17.67 0 32 14.33 32 32v128c0 17.67-14.33 32-32 32H128zm272 112c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faBusAlt = {
prefix: 'fas',
iconName: 'bus-alt',
icon: [512, 512, [], "f55e", "M488 128h-8V80c0-44.8-99.2-80-224-80S32 35.2 32 80v48h-8c-13.25 0-24 10.74-24 24v80c0 13.25 10.75 24 24 24h8v160c0 17.67 14.33 32 32 32v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h192v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h6.4c16 0 25.6-12.8 25.6-25.6V256h8c13.25 0 24-10.75 24-24v-80c0-13.26-10.75-24-24-24zM160 72c0-4.42 3.58-8 8-8h176c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H168c-4.42 0-8-3.58-8-8V72zm-48 328c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm128-112H128c-17.67 0-32-14.33-32-32v-96c0-17.67 14.33-32 32-32h112v160zm32 0V128h112c17.67 0 32 14.33 32 32v96c0 17.67-14.33 32-32 32H272zm128 112c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faBusinessTime = {
prefix: 'fas',
iconName: 'business-time',
icon: [640, 512, [], "f64a", "M496 224c-79.59 0-144 64.41-144 144s64.41 144 144 144 144-64.41 144-144-64.41-144-144-144zm64 150.29c0 5.34-4.37 9.71-9.71 9.71h-60.57c-5.34 0-9.71-4.37-9.71-9.71v-76.57c0-5.34 4.37-9.71 9.71-9.71h12.57c5.34 0 9.71 4.37 9.71 9.71V352h38.29c5.34 0 9.71 4.37 9.71 9.71v12.58zM496 192c5.4 0 10.72.33 16 .81V144c0-25.6-22.4-48-48-48h-80V48c0-25.6-22.4-48-48-48H176c-25.6 0-48 22.4-48 48v48H48c-25.6 0-48 22.4-48 48v80h395.12c28.6-20.09 63.35-32 100.88-32zM320 96H192V64h128v32zm6.82 224H208c-8.84 0-16-7.16-16-16v-48H0v144c0 25.6 22.4 48 48 48h291.43C327.1 423.96 320 396.82 320 368c0-16.66 2.48-32.72 6.82-48z"]
};
var faCalculator = {
prefix: 'fas',
iconName: 'calculator',
icon: [448, 512, [], "f1ec", "M400 0H48C22.4 0 0 22.4 0 48v416c0 25.6 22.4 48 48 48h352c25.6 0 48-22.4 48-48V48c0-25.6-22.4-48-48-48zM128 435.2c0 6.4-6.4 12.8-12.8 12.8H76.8c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4zm0-128c0 6.4-6.4 12.8-12.8 12.8H76.8c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4zm128 128c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4zm0-128c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4zm128 128c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8V268.8c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v166.4zm0-256c0 6.4-6.4 12.8-12.8 12.8H76.8c-6.4 0-12.8-6.4-12.8-12.8V76.8C64 70.4 70.4 64 76.8 64h294.4c6.4 0 12.8 6.4 12.8 12.8v102.4z"]
};
var faCalendar = {
prefix: 'fas',
iconName: 'calendar',
icon: [448, 512, [], "f133", "M12 192h424c6.6 0 12 5.4 12 12v260c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V204c0-6.6 5.4-12 12-12zm436-44v-36c0-26.5-21.5-48-48-48h-48V12c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v52H160V12c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v52H48C21.5 64 0 85.5 0 112v36c0 6.6 5.4 12 12 12h424c6.6 0 12-5.4 12-12z"]
};
var faCalendarAlt = {
prefix: 'fas',
iconName: 'calendar-alt',
icon: [448, 512, [], "f073", "M0 464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V192H0v272zm320-196c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40zm0 128c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40zM192 268c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40zm0 128c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40zM64 268c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H76c-6.6 0-12-5.4-12-12v-40zm0 128c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H76c-6.6 0-12-5.4-12-12v-40zM400 64h-48V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H160V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H48C21.5 64 0 85.5 0 112v48h448v-48c0-26.5-21.5-48-48-48z"]
};
var faCalendarCheck = {
prefix: 'fas',
iconName: 'calendar-check',
icon: [448, 512, [], "f274", "M436 160H12c-6.627 0-12-5.373-12-12v-36c0-26.51 21.49-48 48-48h48V12c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v52h128V12c0-6.627 5.373-12 12-12h40c6.627 0 12 5.373 12 12v52h48c26.51 0 48 21.49 48 48v36c0 6.627-5.373 12-12 12zM12 192h424c6.627 0 12 5.373 12 12v260c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V204c0-6.627 5.373-12 12-12zm333.296 95.947l-28.169-28.398c-4.667-4.705-12.265-4.736-16.97-.068L194.12 364.665l-45.98-46.352c-4.667-4.705-12.266-4.736-16.971-.068l-28.397 28.17c-4.705 4.667-4.736 12.265-.068 16.97l82.601 83.269c4.667 4.705 12.265 4.736 16.97.068l142.953-141.805c4.705-4.667 4.736-12.265.068-16.97z"]
};
var faCalendarDay = {
prefix: 'fas',
iconName: 'calendar-day',
icon: [448, 512, [], "f783", "M0 464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V192H0v272zm64-192c0-8.8 7.2-16 16-16h96c8.8 0 16 7.2 16 16v96c0 8.8-7.2 16-16 16H80c-8.8 0-16-7.2-16-16v-96zM400 64h-48V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H160V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H48C21.5 64 0 85.5 0 112v48h448v-48c0-26.5-21.5-48-48-48z"]
};
var faCalendarMinus = {
prefix: 'fas',
iconName: 'calendar-minus',
icon: [448, 512, [], "f272", "M436 160H12c-6.6 0-12-5.4-12-12v-36c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48v36c0 6.6-5.4 12-12 12zM12 192h424c6.6 0 12 5.4 12 12v260c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V204c0-6.6 5.4-12 12-12zm304 192c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12H132c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h184z"]
};
var faCalendarPlus = {
prefix: 'fas',
iconName: 'calendar-plus',
icon: [448, 512, [], "f271", "M436 160H12c-6.6 0-12-5.4-12-12v-36c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48v36c0 6.6-5.4 12-12 12zM12 192h424c6.6 0 12 5.4 12 12v260c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V204c0-6.6 5.4-12 12-12zm316 140c0-6.6-5.4-12-12-12h-60v-60c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v60h-60c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h60v60c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-60h60c6.6 0 12-5.4 12-12v-40z"]
};
var faCalendarTimes = {
prefix: 'fas',
iconName: 'calendar-times',
icon: [448, 512, [], "f273", "M436 160H12c-6.6 0-12-5.4-12-12v-36c0-26.5 21.5-48 48-48h48V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h128V12c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v52h48c26.5 0 48 21.5 48 48v36c0 6.6-5.4 12-12 12zM12 192h424c6.6 0 12 5.4 12 12v260c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V204c0-6.6 5.4-12 12-12zm257.3 160l48.1-48.1c4.7-4.7 4.7-12.3 0-17l-28.3-28.3c-4.7-4.7-12.3-4.7-17 0L224 306.7l-48.1-48.1c-4.7-4.7-12.3-4.7-17 0l-28.3 28.3c-4.7 4.7-4.7 12.3 0 17l48.1 48.1-48.1 48.1c-4.7 4.7-4.7 12.3 0 17l28.3 28.3c4.7 4.7 12.3 4.7 17 0l48.1-48.1 48.1 48.1c4.7 4.7 12.3 4.7 17 0l28.3-28.3c4.7-4.7 4.7-12.3 0-17L269.3 352z"]
};
var faCalendarWeek = {
prefix: 'fas',
iconName: 'calendar-week',
icon: [448, 512, [], "f784", "M0 464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V192H0v272zm64-192c0-8.8 7.2-16 16-16h288c8.8 0 16 7.2 16 16v64c0 8.8-7.2 16-16 16H80c-8.8 0-16-7.2-16-16v-64zM400 64h-48V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H160V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48H48C21.5 64 0 85.5 0 112v48h448v-48c0-26.5-21.5-48-48-48z"]
};
var faCamera = {
prefix: 'fas',
iconName: 'camera',
icon: [512, 512, [], "f030", "M512 144v288c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V144c0-26.5 21.5-48 48-48h88l12.3-32.9c7-18.7 24.9-31.1 44.9-31.1h125.5c20 0 37.9 12.4 44.9 31.1L376 96h88c26.5 0 48 21.5 48 48zM376 288c0-66.2-53.8-120-120-120s-120 53.8-120 120 53.8 120 120 120 120-53.8 120-120zm-32 0c0 48.5-39.5 88-88 88s-88-39.5-88-88 39.5-88 88-88 88 39.5 88 88z"]
};
var faCameraRetro = {
prefix: 'fas',
iconName: 'camera-retro',
icon: [512, 512, [], "f083", "M48 32C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48H48zm0 32h106c3.3 0 6 2.7 6 6v20c0 3.3-2.7 6-6 6H38c-3.3 0-6-2.7-6-6V80c0-8.8 7.2-16 16-16zm426 96H38c-3.3 0-6-2.7-6-6v-36c0-3.3 2.7-6 6-6h138l30.2-45.3c1.1-1.7 3-2.7 5-2.7H464c8.8 0 16 7.2 16 16v74c0 3.3-2.7 6-6 6zM256 424c-66.2 0-120-53.8-120-120s53.8-120 120-120 120 53.8 120 120-53.8 120-120 120zm0-208c-48.5 0-88 39.5-88 88s39.5 88 88 88 88-39.5 88-88-39.5-88-88-88zm-48 104c-8.8 0-16-7.2-16-16 0-35.3 28.7-64 64-64 8.8 0 16 7.2 16 16s-7.2 16-16 16c-17.6 0-32 14.4-32 32 0 8.8-7.2 16-16 16z"]
};
var faCampground = {
prefix: 'fas',
iconName: 'campground',
icon: [640, 512, [], "f6bb", "M624 448h-24.68L359.54 117.75l53.41-73.55c5.19-7.15 3.61-17.16-3.54-22.35l-25.9-18.79c-7.15-5.19-17.15-3.61-22.35 3.55L320 63.3 278.83 6.6c-5.19-7.15-15.2-8.74-22.35-3.55l-25.88 18.8c-7.15 5.19-8.74 15.2-3.54 22.35l53.41 73.55L40.68 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h608c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM320 288l116.36 160H203.64L320 288z"]
};
var faCandyCane = {
prefix: 'fas',
iconName: 'candy-cane',
icon: [512, 512, [], "f786", "M497.5 92C469.6 33.1 411.8 0 352.4 0c-27.9 0-56.2 7.3-81.8 22.6L243.1 39c-15.2 9.1-20.1 28.7-11 43.9l32.8 54.9c6 10 16.6 15.6 27.5 15.6 5.6 0 11.2-1.5 16.4-4.5l27.5-16.4c5.1-3.1 10.8-4.5 16.4-4.5 10.9 0 21.5 5.6 27.5 15.6 9.1 15.1 4.1 34.8-11 43.9L15.6 397.6c-15.2 9.1-20.1 28.7-11 43.9l32.8 54.9c6 10 16.6 15.6 27.5 15.6 5.6 0 11.2-1.5 16.4-4.5L428.6 301c71.7-42.9 104.6-133.5 68.9-209zm-177.7 13l-2.5 1.5L296.8 45c9.7-4.7 19.8-8.1 30.3-10.2l20.6 61.8c-9.8.8-19.4 3.3-27.9 8.4zM145.9 431.8l-60.5-38.5 30.8-18.3 60.5 38.5-30.8 18.3zm107.5-63.9l-60.5-38.5 30.8-18.3 60.5 38.5-30.8 18.3zM364.3 302l-60.5-38.5 30.8-18.3 60.5 38.5-30.8 18.3zm20.4-197.3l46-46c8.4 6.5 16 14.1 22.6 22.6L407.6 127c-5.7-9.3-13.7-16.9-22.9-22.3zm82.1 107.8l-59.5-19.8c3.2-5.3 5.8-10.9 7.4-17.1 1.1-4.5 1.7-9.1 1.8-13.6l60.4 20.1c-2.1 10.4-5.5 20.6-10.1 30.4z"]
};
var faCannabis = {
prefix: 'fas',
iconName: 'cannabis',
icon: [512, 512, [], "f55f", "M503.47 360.25c-1.56-.82-32.39-16.89-76.78-25.81 64.25-75.12 84.05-161.67 84.93-165.64 1.18-5.33-.44-10.9-4.3-14.77-3.03-3.04-7.12-4.7-11.32-4.7-1.14 0-2.29.12-3.44.38-3.88.85-86.54 19.59-160.58 79.76.01-1.46.01-2.93.01-4.4 0-118.79-59.98-213.72-62.53-217.7A15.973 15.973 0 0 0 256 0c-5.45 0-10.53 2.78-13.47 7.37-2.55 3.98-62.53 98.91-62.53 217.7 0 1.47.01 2.94.01 4.4-74.03-60.16-156.69-78.9-160.58-79.76-1.14-.25-2.29-.38-3.44-.38-4.2 0-8.29 1.66-11.32 4.7A15.986 15.986 0 0 0 .38 168.8c.88 3.97 20.68 90.52 84.93 165.64-44.39 8.92-75.21 24.99-76.78 25.81a16.003 16.003 0 0 0-.02 28.29c2.45 1.29 60.76 31.72 133.49 31.72 6.14 0 11.96-.1 17.5-.31-11.37 22.23-16.52 38.31-16.81 39.22-1.8 5.68-.29 11.89 3.91 16.11a16.019 16.019 0 0 0 16.1 3.99c1.83-.57 37.72-11.99 77.3-39.29V504c0 4.42 3.58 8 8 8h16c4.42 0 8-3.58 8-8v-64.01c39.58 27.3 75.47 38.71 77.3 39.29a16.019 16.019 0 0 0 16.1-3.99c4.2-4.22 5.71-10.43 3.91-16.11-.29-.91-5.45-16.99-16.81-39.22 5.54.21 11.37.31 17.5.31 72.72 0 131.04-30.43 133.49-31.72 5.24-2.78 8.52-8.22 8.51-14.15-.01-5.94-3.29-11.39-8.53-14.15z"]
};
var faCapsules = {
prefix: 'fas',
iconName: 'capsules',
icon: [576, 512, [], "f46b", "M555.3 300.1L424.2 112.8C401.9 81 366.4 64 330.4 64c-22.6 0-45.5 6.7-65.5 20.7-19.7 13.8-33.7 32.8-41.5 53.8C220.5 79.2 172 32 112 32 50.1 32 0 82.1 0 144v224c0 61.9 50.1 112 112 112s112-50.1 112-112V218.9c3.3 8.6 7.3 17.1 12.8 25L368 431.2c22.2 31.8 57.7 48.8 93.8 48.8 22.7 0 45.5-6.7 65.5-20.7 51.7-36.2 64.2-107.5 28-159.2zM160 256H64V144c0-26.5 21.5-48 48-48s48 21.5 48 48v112zm194.8 44.9l-65.6-93.7c-7.7-11-10.7-24.4-8.3-37.6 2.3-13.2 9.7-24.8 20.7-32.5 8.5-6 18.5-9.1 28.8-9.1 16.5 0 31.9 8 41.3 21.5l65.6 93.7-82.5 57.7z"]
};
var faCar = {
prefix: 'fas',
iconName: 'car',
icon: [512, 512, [], "f1b9", "M499.99 176h-59.87l-16.64-41.6C406.38 91.63 365.57 64 319.5 64h-127c-46.06 0-86.88 27.63-103.99 70.4L71.87 176H12.01C4.2 176-1.53 183.34.37 190.91l6 24C7.7 220.25 12.5 224 18.01 224h20.07C24.65 235.73 16 252.78 16 272v48c0 16.12 6.16 30.67 16 41.93V416c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h256v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-54.07c9.84-11.25 16-25.8 16-41.93v-48c0-19.22-8.65-36.27-22.07-48H494c5.51 0 10.31-3.75 11.64-9.09l6-24c1.89-7.57-3.84-14.91-11.65-14.91zm-352.06-17.83c7.29-18.22 24.94-30.17 44.57-30.17h127c19.63 0 37.28 11.95 44.57 30.17L384 208H128l19.93-49.83zM96 319.8c-19.2 0-32-12.76-32-31.9S76.8 256 96 256s48 28.71 48 47.85-28.8 15.95-48 15.95zm320 0c-19.2 0-48 3.19-48-15.95S396.8 256 416 256s32 12.76 32 31.9-12.8 31.9-32 31.9z"]
};
var faCarAlt = {
prefix: 'fas',
iconName: 'car-alt',
icon: [480, 512, [], "f5de", "M438.66 212.33l-11.24-28.1-19.93-49.83C390.38 91.63 349.57 64 303.5 64h-127c-46.06 0-86.88 27.63-103.99 70.4l-19.93 49.83-11.24 28.1C17.22 221.5 0 244.66 0 272v48c0 16.12 6.16 30.67 16 41.93V416c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h256v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-54.07c9.84-11.25 16-25.8 16-41.93v-48c0-27.34-17.22-50.5-41.34-59.67zm-306.73-54.16c7.29-18.22 24.94-30.17 44.57-30.17h127c19.63 0 37.28 11.95 44.57 30.17L368 208H112l19.93-49.83zM80 319.8c-19.2 0-32-12.76-32-31.9S60.8 256 80 256s48 28.71 48 47.85-28.8 15.95-48 15.95zm320 0c-19.2 0-48 3.19-48-15.95S380.8 256 400 256s32 12.76 32 31.9-12.8 31.9-32 31.9z"]
};
var faCarBattery = {
prefix: 'fas',
iconName: 'car-battery',
icon: [512, 512, [], "f5df", "M480 128h-32V80c0-8.84-7.16-16-16-16h-96c-8.84 0-16 7.16-16 16v48H192V80c0-8.84-7.16-16-16-16H80c-8.84 0-16 7.16-16 16v48H32c-17.67 0-32 14.33-32 32v256c0 17.67 14.33 32 32 32h448c17.67 0 32-14.33 32-32V160c0-17.67-14.33-32-32-32zM192 264c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h112c4.42 0 8 3.58 8 8v16zm256 0c0 4.42-3.58 8-8 8h-40v40c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-40h-40c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h40v-40c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v40h40c4.42 0 8 3.58 8 8v16z"]
};
var faCarCrash = {
prefix: 'fas',
iconName: 'car-crash',
icon: [640, 512, [], "f5e1", "M143.25 220.81l-12.42 46.37c-3.01 11.25-3.63 22.89-2.41 34.39l-35.2 28.98c-6.57 5.41-16.31-.43-14.62-8.77l15.44-76.68c1.06-5.26-2.66-10.28-8-10.79l-77.86-7.55c-8.47-.82-11.23-11.83-4.14-16.54l65.15-43.3c4.46-2.97 5.38-9.15 1.98-13.29L21.46 93.22c-5.41-6.57.43-16.3 8.78-14.62l76.68 15.44c5.26 1.06 10.28-2.66 10.8-8l7.55-77.86c.82-8.48 11.83-11.23 16.55-4.14l43.3 65.14c2.97 4.46 9.15 5.38 13.29 1.98l60.4-49.71c6.57-5.41 16.3.43 14.62 8.77L262.1 86.38c-2.71 3.05-5.43 6.09-7.91 9.4l-32.15 42.97-10.71 14.32c-32.73 8.76-59.18 34.53-68.08 67.74zm494.57 132.51l-12.42 46.36c-3.13 11.68-9.38 21.61-17.55 29.36a66.876 66.876 0 0 1-8.76 7l-13.99 52.23c-1.14 4.27-3.1 8.1-5.65 11.38-7.67 9.84-20.74 14.68-33.54 11.25L515 502.62c-17.07-4.57-27.2-22.12-22.63-39.19l8.28-30.91-247.28-66.26-8.28 30.91c-4.57 17.07-22.12 27.2-39.19 22.63l-30.91-8.28c-12.8-3.43-21.7-14.16-23.42-26.51-.57-4.12-.35-8.42.79-12.68l13.99-52.23a66.62 66.62 0 0 1-4.09-10.45c-3.2-10.79-3.65-22.52-.52-34.2l12.42-46.37c5.31-19.8 19.36-34.83 36.89-42.21a64.336 64.336 0 0 1 18.49-4.72l18.13-24.23 32.15-42.97c3.45-4.61 7.19-8.9 11.2-12.84 8-7.89 17.03-14.44 26.74-19.51 4.86-2.54 9.89-4.71 15.05-6.49 10.33-3.58 21.19-5.63 32.24-6.04 11.05-.41 22.31.82 33.43 3.8l122.68 32.87c11.12 2.98 21.48 7.54 30.85 13.43a111.11 111.11 0 0 1 34.69 34.5c8.82 13.88 14.64 29.84 16.68 46.99l6.36 53.29 3.59 30.05a64.49 64.49 0 0 1 22.74 29.93c4.39 11.88 5.29 25.19 1.75 38.39zM255.58 234.34c-18.55-4.97-34.21 4.04-39.17 22.53-4.96 18.49 4.11 34.12 22.65 39.09 18.55 4.97 45.54 15.51 50.49-2.98 4.96-18.49-15.43-53.67-33.97-58.64zm290.61 28.17l-6.36-53.29c-.58-4.87-1.89-9.53-3.82-13.86-5.8-12.99-17.2-23.01-31.42-26.82l-122.68-32.87a48.008 48.008 0 0 0-50.86 17.61l-32.15 42.97 172 46.08 75.29 20.18zm18.49 54.65c-18.55-4.97-53.8 15.31-58.75 33.79-4.95 18.49 23.69 22.86 42.24 27.83 18.55 4.97 34.21-4.04 39.17-22.53 4.95-18.48-4.11-34.12-22.66-39.09z"]
};
var faCarSide = {
prefix: 'fas',
iconName: 'car-side',
icon: [640, 512, [], "f5e4", "M544 192h-16L419.22 56.02A64.025 64.025 0 0 0 369.24 32H155.33c-26.17 0-49.7 15.93-59.42 40.23L48 194.26C20.44 201.4 0 226.21 0 256v112c0 8.84 7.16 16 16 16h48c0 53.02 42.98 96 96 96s96-42.98 96-96h128c0 53.02 42.98 96 96 96s96-42.98 96-96h48c8.84 0 16-7.16 16-16v-80c0-53.02-42.98-96-96-96zM160 432c-26.47 0-48-21.53-48-48s21.53-48 48-48 48 21.53 48 48-21.53 48-48 48zm72-240H116.93l38.4-96H232v96zm48 0V96h89.24l76.8 96H280zm200 240c-26.47 0-48-21.53-48-48s21.53-48 48-48 48 21.53 48 48-21.53 48-48 48z"]
};
var faCaravan = {
prefix: 'fas',
iconName: 'caravan',
icon: [640, 512, [], "f8ff", "M416,208a16,16,0,1,0,16,16A16,16,0,0,0,416,208ZM624,320H576V160A160,160,0,0,0,416,0H64A64,64,0,0,0,0,64V320a64,64,0,0,0,64,64H96a96,96,0,0,0,192,0H624a16,16,0,0,0,16-16V336A16,16,0,0,0,624,320ZM192,432a48,48,0,1,1,48-48A48.05,48.05,0,0,1,192,432Zm64-240a32,32,0,0,1-32,32H96a32,32,0,0,1-32-32V128A32,32,0,0,1,96,96H224a32,32,0,0,1,32,32ZM448,320H320V128a32,32,0,0,1,32-32h64a32,32,0,0,1,32,32Z"]
};
var faCaretDown = {
prefix: 'fas',
iconName: 'caret-down',
icon: [320, 512, [], "f0d7", "M31.3 192h257.3c17.8 0 26.7 21.5 14.1 34.1L174.1 354.8c-7.8 7.8-20.5 7.8-28.3 0L17.2 226.1C4.6 213.5 13.5 192 31.3 192z"]
};
var faCaretLeft = {
prefix: 'fas',
iconName: 'caret-left',
icon: [192, 512, [], "f0d9", "M192 127.338v257.324c0 17.818-21.543 26.741-34.142 14.142L29.196 270.142c-7.81-7.81-7.81-20.474 0-28.284l128.662-128.662c12.599-12.6 34.142-3.676 34.142 14.142z"]
};
var faCaretRight = {
prefix: 'fas',
iconName: 'caret-right',
icon: [192, 512, [], "f0da", "M0 384.662V127.338c0-17.818 21.543-26.741 34.142-14.142l128.662 128.662c7.81 7.81 7.81 20.474 0 28.284L34.142 398.804C21.543 411.404 0 402.48 0 384.662z"]
};
var faCaretSquareDown = {
prefix: 'fas',
iconName: 'caret-square-down',
icon: [448, 512, [], "f150", "M448 80v352c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48zM92.5 220.5l123 123c4.7 4.7 12.3 4.7 17 0l123-123c7.6-7.6 2.2-20.5-8.5-20.5H101c-10.7 0-16.1 12.9-8.5 20.5z"]
};
var faCaretSquareLeft = {
prefix: 'fas',
iconName: 'caret-square-left',
icon: [448, 512, [], "f191", "M400 480H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48v352c0 26.51-21.49 48-48 48zM259.515 124.485l-123.03 123.03c-4.686 4.686-4.686 12.284 0 16.971l123.029 123.029c7.56 7.56 20.485 2.206 20.485-8.485V132.971c.001-10.691-12.925-16.045-20.484-8.486z"]
};
var faCaretSquareRight = {
prefix: 'fas',
iconName: 'caret-square-right',
icon: [448, 512, [], "f152", "M48 32h352c26.51 0 48 21.49 48 48v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48zm140.485 355.515l123.029-123.029c4.686-4.686 4.686-12.284 0-16.971l-123.029-123.03c-7.56-7.56-20.485-2.206-20.485 8.485v246.059c0 10.691 12.926 16.045 20.485 8.486z"]
};
var faCaretSquareUp = {
prefix: 'fas',
iconName: 'caret-square-up',
icon: [448, 512, [], "f151", "M0 432V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48zm355.515-140.485l-123.03-123.03c-4.686-4.686-12.284-4.686-16.971 0L92.485 291.515c-7.56 7.56-2.206 20.485 8.485 20.485h246.059c10.691 0 16.045-12.926 8.486-20.485z"]
};
var faCaretUp = {
prefix: 'fas',
iconName: 'caret-up',
icon: [320, 512, [], "f0d8", "M288.662 352H31.338c-17.818 0-26.741-21.543-14.142-34.142l128.662-128.662c7.81-7.81 20.474-7.81 28.284 0l128.662 128.662c12.6 12.599 3.676 34.142-14.142 34.142z"]
};
var faCarrot = {
prefix: 'fas',
iconName: 'carrot',
icon: [512, 512, [], "f787", "M298.2 156.6c-52.7-25.7-114.5-10.5-150.2 32.8l55.2 55.2c6.3 6.3 6.3 16.4 0 22.6-3.1 3.1-7.2 4.7-11.3 4.7s-8.2-1.6-11.3-4.7L130.4 217 2.3 479.7c-2.9 6-3.1 13.3 0 19.7 5.4 11.1 18.9 15.7 30 10.3l133.6-65.2-49.2-49.2c-6.3-6.2-6.3-16.4 0-22.6 6.3-6.2 16.4-6.2 22.6 0l57 57 102-49.8c24-11.7 44.5-31.3 57.1-57.1 30.1-61.7 4.5-136.1-57.2-166.2zm92.1-34.9C409.8 81 399.7 32.9 360 0c-50.3 41.7-52.5 107.5-7.9 151.9l8 8c44.4 44.6 110.3 42.4 151.9-7.9-32.9-39.7-81-49.8-121.7-30.3z"]
};
var faCartArrowDown = {
prefix: 'fas',
iconName: 'cart-arrow-down',
icon: [576, 512, [], "f218", "M504.717 320H211.572l6.545 32h268.418c15.401 0 26.816 14.301 23.403 29.319l-5.517 24.276C523.112 414.668 536 433.828 536 456c0 31.202-25.519 56.444-56.824 55.994-29.823-.429-54.35-24.631-55.155-54.447-.44-16.287 6.085-31.049 16.803-41.548H231.176C241.553 426.165 248 440.326 248 456c0 31.813-26.528 57.431-58.67 55.938-28.54-1.325-51.751-24.385-53.251-52.917-1.158-22.034 10.436-41.455 28.051-51.586L93.883 64H24C10.745 64 0 53.255 0 40V24C0 10.745 10.745 0 24 0h102.529c11.401 0 21.228 8.021 23.513 19.19L159.208 64H551.99c15.401 0 26.816 14.301 23.403 29.319l-47.273 208C525.637 312.246 515.923 320 504.717 320zM403.029 192H360v-60c0-6.627-5.373-12-12-12h-24c-6.627 0-12 5.373-12 12v60h-43.029c-10.691 0-16.045 12.926-8.485 20.485l67.029 67.029c4.686 4.686 12.284 4.686 16.971 0l67.029-67.029c7.559-7.559 2.205-20.485-8.486-20.485z"]
};
var faCartPlus = {
prefix: 'fas',
iconName: 'cart-plus',
icon: [576, 512, [], "f217", "M504.717 320H211.572l6.545 32h268.418c15.401 0 26.816 14.301 23.403 29.319l-5.517 24.276C523.112 414.668 536 433.828 536 456c0 31.202-25.519 56.444-56.824 55.994-29.823-.429-54.35-24.631-55.155-54.447-.44-16.287 6.085-31.049 16.803-41.548H231.176C241.553 426.165 248 440.326 248 456c0 31.813-26.528 57.431-58.67 55.938-28.54-1.325-51.751-24.385-53.251-52.917-1.158-22.034 10.436-41.455 28.051-51.586L93.883 64H24C10.745 64 0 53.255 0 40V24C0 10.745 10.745 0 24 0h102.529c11.401 0 21.228 8.021 23.513 19.19L159.208 64H551.99c15.401 0 26.816 14.301 23.403 29.319l-47.273 208C525.637 312.246 515.923 320 504.717 320zM408 168h-48v-40c0-8.837-7.163-16-16-16h-16c-8.837 0-16 7.163-16 16v40h-48c-8.837 0-16 7.163-16 16v16c0 8.837 7.163 16 16 16h48v40c0 8.837 7.163 16 16 16h16c8.837 0 16-7.163 16-16v-40h48c8.837 0 16-7.163 16-16v-16c0-8.837-7.163-16-16-16z"]
};
var faCashRegister = {
prefix: 'fas',
iconName: 'cash-register',
icon: [512, 512, [], "f788", "M511.1 378.8l-26.7-160c-2.6-15.4-15.9-26.7-31.6-26.7H208v-64h96c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16H48c-8.8 0-16 7.2-16 16v96c0 8.8 7.2 16 16 16h96v64H59.1c-15.6 0-29 11.3-31.6 26.7L.8 378.7c-.6 3.5-.9 7-.9 10.5V480c0 17.7 14.3 32 32 32h448c17.7 0 32-14.3 32-32v-90.7c.1-3.5-.2-7-.8-10.5zM280 248c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v16c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16v-16zm-32 64h16c8.8 0 16 7.2 16 16v16c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16v-16c0-8.8 7.2-16 16-16zm-32-80c8.8 0 16 7.2 16 16v16c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16v-16c0-8.8 7.2-16 16-16h16zM80 80V48h192v32H80zm40 200h-16c-8.8 0-16-7.2-16-16v-16c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v16c0 8.8-7.2 16-16 16zm16 64v-16c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v16c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16zm216 112c0 4.4-3.6 8-8 8H168c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h176c4.4 0 8 3.6 8 8v16zm24-112c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16v-16c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v16zm48-80c0 8.8-7.2 16-16 16h-16c-8.8 0-16-7.2-16-16v-16c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v16z"]
};
var faCat = {
prefix: 'fas',
iconName: 'cat',
icon: [512, 512, [], "f6be", "M290.59 192c-20.18 0-106.82 1.98-162.59 85.95V192c0-52.94-43.06-96-96-96-17.67 0-32 14.33-32 32s14.33 32 32 32c17.64 0 32 14.36 32 32v256c0 35.3 28.7 64 64 64h176c8.84 0 16-7.16 16-16v-16c0-17.67-14.33-32-32-32h-32l128-96v144c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16V289.86c-10.29 2.67-20.89 4.54-32 4.54-61.81 0-113.52-44.05-125.41-102.4zM448 96h-64l-64-64v134.4c0 53.02 42.98 96 96 96s96-42.98 96-96V32l-64 64zm-72 80c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16zm80 0c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16z"]
};
var faCertificate = {
prefix: 'fas',
iconName: 'certificate',
icon: [512, 512, [], "f0a3", "M458.622 255.92l45.985-45.005c13.708-12.977 7.316-36.039-10.664-40.339l-62.65-15.99 17.661-62.015c4.991-17.838-11.829-34.663-29.661-29.671l-61.994 17.667-15.984-62.671C337.085.197 313.765-6.276 300.99 7.228L256 53.57 211.011 7.229c-12.63-13.351-36.047-7.234-40.325 10.668l-15.984 62.671-61.995-17.667C74.87 57.907 58.056 74.738 63.046 92.572l17.661 62.015-62.65 15.99C.069 174.878-6.31 197.944 7.392 210.915l45.985 45.005-45.985 45.004c-13.708 12.977-7.316 36.039 10.664 40.339l62.65 15.99-17.661 62.015c-4.991 17.838 11.829 34.663 29.661 29.671l61.994-17.667 15.984 62.671c4.439 18.575 27.696 24.018 40.325 10.668L256 458.61l44.989 46.001c12.5 13.488 35.987 7.486 40.325-10.668l15.984-62.671 61.994 17.667c17.836 4.994 34.651-11.837 29.661-29.671l-17.661-62.015 62.65-15.99c17.987-4.302 24.366-27.367 10.664-40.339l-45.984-45.004z"]
};
var faChair = {
prefix: 'fas',
iconName: 'chair',
icon: [448, 512, [], "f6c0", "M112 128c0-29.5 16.2-55 40-68.9V256h48V48h48v208h48V59.1c23.8 13.9 40 39.4 40 68.9v128h48V128C384 57.3 326.7 0 256 0h-64C121.3 0 64 57.3 64 128v128h48zm334.3 213.9l-10.7-32c-4.4-13.1-16.6-21.9-30.4-21.9H42.7c-13.8 0-26 8.8-30.4 21.9l-10.7 32C-5.2 362.6 10.2 384 32 384v112c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V384h256v112c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V384c21.8 0 37.2-21.4 30.3-42.1z"]
};
var faChalkboard = {
prefix: 'fas',
iconName: 'chalkboard',
icon: [640, 512, [], "f51b", "M96 64h448v352h64V40c0-22.06-17.94-40-40-40H72C49.94 0 32 17.94 32 40v376h64V64zm528 384H480v-64H288v64H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h608c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faChalkboardTeacher = {
prefix: 'fas',
iconName: 'chalkboard-teacher',
icon: [640, 512, [], "f51c", "M208 352c-2.39 0-4.78.35-7.06 1.09C187.98 357.3 174.35 360 160 360c-14.35 0-27.98-2.7-40.95-6.91-2.28-.74-4.66-1.09-7.05-1.09C49.94 352-.33 402.48 0 464.62.14 490.88 21.73 512 48 512h224c26.27 0 47.86-21.12 48-47.38.33-62.14-49.94-112.62-112-112.62zm-48-32c53.02 0 96-42.98 96-96s-42.98-96-96-96-96 42.98-96 96 42.98 96 96 96zM592 0H208c-26.47 0-48 22.25-48 49.59V96c23.42 0 45.1 6.78 64 17.8V64h352v288h-64v-64H384v64h-76.24c19.1 16.69 33.12 38.73 39.69 64H592c26.47 0 48-22.25 48-49.59V49.59C640 22.25 618.47 0 592 0z"]
};
var faChargingStation = {
prefix: 'fas',
iconName: 'charging-station',
icon: [576, 512, [], "f5e7", "M336 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h320c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm208-320V80c0-8.84-7.16-16-16-16s-16 7.16-16 16v48h-32V80c0-8.84-7.16-16-16-16s-16 7.16-16 16v48h-16c-8.84 0-16 7.16-16 16v32c0 35.76 23.62 65.69 56 75.93v118.49c0 13.95-9.5 26.92-23.26 29.19C431.22 402.5 416 388.99 416 372v-28c0-48.6-39.4-88-88-88h-8V64c0-35.35-28.65-64-64-64H96C60.65 0 32 28.65 32 64v352h288V304h8c22.09 0 40 17.91 40 40v24.61c0 39.67 28.92 75.16 68.41 79.01C481.71 452.05 520 416.41 520 372V251.93c32.38-10.24 56-40.17 56-75.93v-32c0-8.84-7.16-16-16-16h-16zm-283.91 47.76l-93.7 139c-2.2 3.33-6.21 5.24-10.39 5.24-7.67 0-13.47-6.28-11.67-12.92L167.35 224H108c-7.25 0-12.85-5.59-11.89-11.89l16-107C112.9 99.9 117.98 96 124 96h68c7.88 0 13.62 6.54 11.6 13.21L192 160h57.7c9.24 0 15.01 8.78 10.39 15.76z"]
};
var faChartArea = {
prefix: 'fas',
iconName: 'chart-area',
icon: [512, 512, [], "f1fe", "M500 384c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H12c-6.6 0-12-5.4-12-12V76c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v308h436zM372.7 159.5L288 216l-85.3-113.7c-5.1-6.8-15.5-6.3-19.9 1L96 248v104h384l-89.9-187.8c-3.2-6.5-11.4-8.7-17.4-4.7z"]
};
var faChartBar = {
prefix: 'fas',
iconName: 'chart-bar',
icon: [512, 512, [], "f080", "M332.8 320h38.4c6.4 0 12.8-6.4 12.8-12.8V172.8c0-6.4-6.4-12.8-12.8-12.8h-38.4c-6.4 0-12.8 6.4-12.8 12.8v134.4c0 6.4 6.4 12.8 12.8 12.8zm96 0h38.4c6.4 0 12.8-6.4 12.8-12.8V76.8c0-6.4-6.4-12.8-12.8-12.8h-38.4c-6.4 0-12.8 6.4-12.8 12.8v230.4c0 6.4 6.4 12.8 12.8 12.8zm-288 0h38.4c6.4 0 12.8-6.4 12.8-12.8v-70.4c0-6.4-6.4-12.8-12.8-12.8h-38.4c-6.4 0-12.8 6.4-12.8 12.8v70.4c0 6.4 6.4 12.8 12.8 12.8zm96 0h38.4c6.4 0 12.8-6.4 12.8-12.8V108.8c0-6.4-6.4-12.8-12.8-12.8h-38.4c-6.4 0-12.8 6.4-12.8 12.8v198.4c0 6.4 6.4 12.8 12.8 12.8zM496 384H64V80c0-8.84-7.16-16-16-16H16C7.16 64 0 71.16 0 80v336c0 17.67 14.33 32 32 32h464c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faChartLine = {
prefix: 'fas',
iconName: 'chart-line',
icon: [512, 512, [], "f201", "M496 384H64V80c0-8.84-7.16-16-16-16H16C7.16 64 0 71.16 0 80v336c0 17.67 14.33 32 32 32h464c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM464 96H345.94c-21.38 0-32.09 25.85-16.97 40.97l32.4 32.4L288 242.75l-73.37-73.37c-12.5-12.5-32.76-12.5-45.25 0l-68.69 68.69c-6.25 6.25-6.25 16.38 0 22.63l22.62 22.62c6.25 6.25 16.38 6.25 22.63 0L192 237.25l73.37 73.37c12.5 12.5 32.76 12.5 45.25 0l96-96 32.4 32.4c15.12 15.12 40.97 4.41 40.97-16.97V112c.01-8.84-7.15-16-15.99-16z"]
};
var faChartPie = {
prefix: 'fas',
iconName: 'chart-pie',
icon: [544, 512, [], "f200", "M527.79 288H290.5l158.03 158.03c6.04 6.04 15.98 6.53 22.19.68 38.7-36.46 65.32-85.61 73.13-140.86 1.34-9.46-6.51-17.85-16.06-17.85zm-15.83-64.8C503.72 103.74 408.26 8.28 288.8.04 279.68-.59 272 7.1 272 16.24V240h223.77c9.14 0 16.82-7.68 16.19-16.8zM224 288V50.71c0-9.55-8.39-17.4-17.84-16.06C86.99 51.49-4.1 155.6.14 280.37 4.5 408.51 114.83 513.59 243.03 511.98c50.4-.63 96.97-16.87 135.26-44.03 7.9-5.6 8.42-17.23 1.57-24.08L224 288z"]
};
var faCheck = {
prefix: 'fas',
iconName: 'check',
icon: [512, 512, [], "f00c", "M173.898 439.404l-166.4-166.4c-9.997-9.997-9.997-26.206 0-36.204l36.203-36.204c9.997-9.998 26.207-9.998 36.204 0L192 312.69 432.095 72.596c9.997-9.997 26.207-9.997 36.204 0l36.203 36.204c9.997 9.997 9.997 26.206 0 36.204l-294.4 294.401c-9.998 9.997-26.207 9.997-36.204-.001z"]
};
var faCheckCircle = {
prefix: 'fas',
iconName: 'check-circle',
icon: [512, 512, [], "f058", "M504 256c0 136.967-111.033 248-248 248S8 392.967 8 256 119.033 8 256 8s248 111.033 248 248zM227.314 387.314l184-184c6.248-6.248 6.248-16.379 0-22.627l-22.627-22.627c-6.248-6.249-16.379-6.249-22.628 0L216 308.118l-70.059-70.059c-6.248-6.248-16.379-6.248-22.628 0l-22.627 22.627c-6.248 6.248-6.248 16.379 0 22.627l104 104c6.249 6.249 16.379 6.249 22.628.001z"]
};
var faCheckDouble = {
prefix: 'fas',
iconName: 'check-double',
icon: [512, 512, [], "f560", "M505 174.8l-39.6-39.6c-9.4-9.4-24.6-9.4-33.9 0L192 374.7 80.6 263.2c-9.4-9.4-24.6-9.4-33.9 0L7 302.9c-9.4 9.4-9.4 24.6 0 34L175 505c9.4 9.4 24.6 9.4 33.9 0l296-296.2c9.4-9.5 9.4-24.7.1-34zm-324.3 106c6.2 6.3 16.4 6.3 22.6 0l208-208.2c6.2-6.3 6.2-16.4 0-22.6L366.1 4.7c-6.2-6.3-16.4-6.3-22.6 0L192 156.2l-55.4-55.5c-6.2-6.3-16.4-6.3-22.6 0L68.7 146c-6.2 6.3-6.2 16.4 0 22.6l112 112.2z"]
};
var faCheckSquare = {
prefix: 'fas',
iconName: 'check-square',
icon: [448, 512, [], "f14a", "M400 480H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48v352c0 26.51-21.49 48-48 48zm-204.686-98.059l184-184c6.248-6.248 6.248-16.379 0-22.627l-22.627-22.627c-6.248-6.248-16.379-6.249-22.628 0L184 302.745l-70.059-70.059c-6.248-6.248-16.379-6.248-22.628 0l-22.627 22.627c-6.248 6.248-6.248 16.379 0 22.627l104 104c6.249 6.25 16.379 6.25 22.628.001z"]
};
var faCheese = {
prefix: 'fas',
iconName: 'cheese',
icon: [512, 512, [], "f7ef", "M0 288v160a32 32 0 0 0 32 32h448a32 32 0 0 0 32-32V288zM299.83 32a32 32 0 0 0-21.13 7L0 256h512c0-119.89-94-217.8-212.17-224z"]
};
var faChess = {
prefix: 'fas',
iconName: 'chess',
icon: [512, 512, [], "f439", "M74 208H64a16 16 0 0 0-16 16v16a16 16 0 0 0 16 16h15.94A535.78 535.78 0 0 1 64 384h128a535.78 535.78 0 0 1-15.94-128H192a16 16 0 0 0 16-16v-16a16 16 0 0 0-16-16h-10l33.89-90.38a16 16 0 0 0-15-21.62H144V64h24a8 8 0 0 0 8-8V40a8 8 0 0 0-8-8h-24V8a8 8 0 0 0-8-8h-16a8 8 0 0 0-8 8v24H88a8 8 0 0 0-8 8v16a8 8 0 0 0 8 8h24v32H55.09a16 16 0 0 0-15 21.62zm173.16 251.58L224 448v-16a16 16 0 0 0-16-16H48a16 16 0 0 0-16 16v16L8.85 459.58A16 16 0 0 0 0 473.89V496a16 16 0 0 0 16 16h224a16 16 0 0 0 16-16v-22.11a16 16 0 0 0-8.84-14.31zm92.77-157.78l-3.29 82.2h126.72l-3.29-82.21 24.6-20.79A32 32 0 0 0 496 256.54V198a6 6 0 0 0-6-6h-26.38a6 6 0 0 0-6 6v26h-24.71v-26a6 6 0 0 0-6-6H373.1a6 6 0 0 0-6 6v26h-24.71v-26a6 6 0 0 0-6-6H310a6 6 0 0 0-6 6v58.6a32 32 0 0 0 11.36 24.4zM384 304a16 16 0 0 1 32 0v32h-32zm119.16 155.58L480 448v-16a16 16 0 0 0-16-16H336a16 16 0 0 0-16 16v16l-23.15 11.58a16 16 0 0 0-8.85 14.31V496a16 16 0 0 0 16 16h192a16 16 0 0 0 16-16v-22.11a16 16 0 0 0-8.84-14.31z"]
};
var faChessBishop = {
prefix: 'fas',
iconName: 'chess-bishop',
icon: [320, 512, [], "f43a", "M8 287.88c0 51.64 22.14 73.83 56 84.6V416h192v-43.52c33.86-10.77 56-33 56-84.6 0-30.61-10.73-67.1-26.69-102.56L185 285.65a8 8 0 0 1-11.31 0l-11.31-11.31a8 8 0 0 1 0-11.31L270.27 155.1c-20.8-37.91-46.47-72.1-70.87-92.59C213.4 59.09 224 47.05 224 32a32 32 0 0 0-32-32h-64a32 32 0 0 0-32 32c0 15 10.6 27.09 24.6 30.51C67.81 106.8 8 214.5 8 287.88zM304 448H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h288a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faChessBoard = {
prefix: 'fas',
iconName: 'chess-board',
icon: [512, 512, [], "f43c", "M255.9.2h-64v64h64zM0 64.17v64h64v-64zM128 .2H64v64h64zm64 255.9v64h64v-64zM0 192.12v64h64v-64zM383.85.2h-64v64h64zm128 0h-64v64h64zM128 256.1H64v64h64zM511.8 448v-64h-64v64zm0-128v-64h-64v64zM383.85 512h64v-64h-64zm128-319.88v-64h-64v64zM128 512h64v-64h-64zM0 512h64v-64H0zm255.9 0h64v-64h-64zM0 320.07v64h64v-64zm319.88-191.92v-64h-64v64zm-64 128h64v-64h-64zm-64 128v64h64v-64zm128-64h64v-64h-64zm0-127.95h64v-64h-64zm0 191.93v64h64v-64zM64 384.05v64h64v-64zm128-255.9v-64h-64v64zm191.92 255.9h64v-64h-64zm-128-191.93v-64h-64v64zm128-127.95v64h64v-64zm-128 255.9v64h64v-64zm-64-127.95H128v64h64zm191.92 64h64v-64h-64zM128 128.15H64v64h64zm0 191.92v64h64v-64z"]
};
var faChessKing = {
prefix: 'fas',
iconName: 'chess-king',
icon: [448, 512, [], "f43f", "M400 448H48a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h352a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm16-288H256v-48h40a8 8 0 0 0 8-8V56a8 8 0 0 0-8-8h-40V8a8 8 0 0 0-8-8h-48a8 8 0 0 0-8 8v40h-40a8 8 0 0 0-8 8v48a8 8 0 0 0 8 8h40v48H32a32 32 0 0 0-30.52 41.54L74.56 416h298.88l73.08-214.46A32 32 0 0 0 416 160z"]
};
var faChessKnight = {
prefix: 'fas',
iconName: 'chess-knight',
icon: [384, 512, [], "f441", "M19 272.47l40.63 18.06a32 32 0 0 0 24.88.47l12.78-5.12a32 32 0 0 0 18.76-20.5l9.22-30.65a24 24 0 0 1 12.55-15.65L159.94 208v50.33a48 48 0 0 1-26.53 42.94l-57.22 28.65A80 80 0 0 0 32 401.48V416h319.86V224c0-106-85.92-192-191.92-192H12A12 12 0 0 0 0 44a16.9 16.9 0 0 0 1.79 7.58L16 80l-9 9a24 24 0 0 0-7 17v137.21a32 32 0 0 0 19 29.26zM52 128a20 20 0 1 1-20 20 20 20 0 0 1 20-20zm316 320H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h352a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faChessPawn = {
prefix: 'fas',
iconName: 'chess-pawn',
icon: [320, 512, [], "f443", "M105.1 224H80a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h16v5.49c0 44-4.14 86.6-24 122.51h176c-19.89-35.91-24-78.51-24-122.51V288h16a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-25.1c29.39-18.38 49.1-50.78 49.1-88a104 104 0 0 0-208 0c0 37.22 19.71 69.62 49.1 88zM304 448H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h288a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faChessQueen = {
prefix: 'fas',
iconName: 'chess-queen',
icon: [512, 512, [], "f445", "M256 112a56 56 0 1 0-56-56 56 56 0 0 0 56 56zm176 336H80a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h352a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm72.87-263.84l-28.51-15.92c-7.44-5-16.91-2.46-22.29 4.68a47.59 47.59 0 0 1-47.23 18.23C383.7 186.86 368 164.93 368 141.4a13.4 13.4 0 0 0-13.4-13.4h-38.77c-6 0-11.61 4-12.86 9.91a48 48 0 0 1-93.94 0c-1.25-5.92-6.82-9.91-12.86-9.91H157.4a13.4 13.4 0 0 0-13.4 13.4c0 25.69-19 48.75-44.67 50.49a47.5 47.5 0 0 1-41.54-19.15c-5.28-7.09-14.73-9.45-22.09-4.54l-28.57 16a16 16 0 0 0-5.44 20.47L104.24 416h303.52l102.55-211.37a16 16 0 0 0-5.44-20.47z"]
};
var faChessRook = {
prefix: 'fas',
iconName: 'chess-rook',
icon: [384, 512, [], "f447", "M368 32h-56a16 16 0 0 0-16 16v48h-48V48a16 16 0 0 0-16-16h-80a16 16 0 0 0-16 16v48H88.1V48a16 16 0 0 0-16-16H16A16 16 0 0 0 0 48v176l64 32c0 48.33-1.54 95-13.21 160h282.42C321.54 351 320 303.72 320 256l64-32V48a16 16 0 0 0-16-16zM224 320h-64v-64a32 32 0 0 1 64 0zm144 128H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h352a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faChevronCircleDown = {
prefix: 'fas',
iconName: 'chevron-circle-down',
icon: [512, 512, [], "f13a", "M504 256c0 137-111 248-248 248S8 393 8 256 119 8 256 8s248 111 248 248zM273 369.9l135.5-135.5c9.4-9.4 9.4-24.6 0-33.9l-17-17c-9.4-9.4-24.6-9.4-33.9 0L256 285.1 154.4 183.5c-9.4-9.4-24.6-9.4-33.9 0l-17 17c-9.4 9.4-9.4 24.6 0 33.9L239 369.9c9.4 9.4 24.6 9.4 34 0z"]
};
var faChevronCircleLeft = {
prefix: 'fas',
iconName: 'chevron-circle-left',
icon: [512, 512, [], "f137", "M256 504C119 504 8 393 8 256S119 8 256 8s248 111 248 248-111 248-248 248zM142.1 273l135.5 135.5c9.4 9.4 24.6 9.4 33.9 0l17-17c9.4-9.4 9.4-24.6 0-33.9L226.9 256l101.6-101.6c9.4-9.4 9.4-24.6 0-33.9l-17-17c-9.4-9.4-24.6-9.4-33.9 0L142.1 239c-9.4 9.4-9.4 24.6 0 34z"]
};
var faChevronCircleRight = {
prefix: 'fas',
iconName: 'chevron-circle-right',
icon: [512, 512, [], "f138", "M256 8c137 0 248 111 248 248S393 504 256 504 8 393 8 256 119 8 256 8zm113.9 231L234.4 103.5c-9.4-9.4-24.6-9.4-33.9 0l-17 17c-9.4 9.4-9.4 24.6 0 33.9L285.1 256 183.5 357.6c-9.4 9.4-9.4 24.6 0 33.9l17 17c9.4 9.4 24.6 9.4 33.9 0L369.9 273c9.4-9.4 9.4-24.6 0-34z"]
};
var faChevronCircleUp = {
prefix: 'fas',
iconName: 'chevron-circle-up',
icon: [512, 512, [], "f139", "M8 256C8 119 119 8 256 8s248 111 248 248-111 248-248 248S8 393 8 256zm231-113.9L103.5 277.6c-9.4 9.4-9.4 24.6 0 33.9l17 17c9.4 9.4 24.6 9.4 33.9 0L256 226.9l101.6 101.6c9.4 9.4 24.6 9.4 33.9 0l17-17c9.4-9.4 9.4-24.6 0-33.9L273 142.1c-9.4-9.4-24.6-9.4-34 0z"]
};
var faChevronDown = {
prefix: 'fas',
iconName: 'chevron-down',
icon: [448, 512, [], "f078", "M207.029 381.476L12.686 187.132c-9.373-9.373-9.373-24.569 0-33.941l22.667-22.667c9.357-9.357 24.522-9.375 33.901-.04L224 284.505l154.745-154.021c9.379-9.335 24.544-9.317 33.901.04l22.667 22.667c9.373 9.373 9.373 24.569 0 33.941L240.971 381.476c-9.373 9.372-24.569 9.372-33.942 0z"]
};
var faChevronLeft = {
prefix: 'fas',
iconName: 'chevron-left',
icon: [320, 512, [], "f053", "M34.52 239.03L228.87 44.69c9.37-9.37 24.57-9.37 33.94 0l22.67 22.67c9.36 9.36 9.37 24.52.04 33.9L131.49 256l154.02 154.75c9.34 9.38 9.32 24.54-.04 33.9l-22.67 22.67c-9.37 9.37-24.57 9.37-33.94 0L34.52 272.97c-9.37-9.37-9.37-24.57 0-33.94z"]
};
var faChevronRight = {
prefix: 'fas',
iconName: 'chevron-right',
icon: [320, 512, [], "f054", "M285.476 272.971L91.132 467.314c-9.373 9.373-24.569 9.373-33.941 0l-22.667-22.667c-9.357-9.357-9.375-24.522-.04-33.901L188.505 256 34.484 101.255c-9.335-9.379-9.317-24.544.04-33.901l22.667-22.667c9.373-9.373 24.569-9.373 33.941 0L285.475 239.03c9.373 9.372 9.373 24.568.001 33.941z"]
};
var faChevronUp = {
prefix: 'fas',
iconName: 'chevron-up',
icon: [448, 512, [], "f077", "M240.971 130.524l194.343 194.343c9.373 9.373 9.373 24.569 0 33.941l-22.667 22.667c-9.357 9.357-24.522 9.375-33.901.04L224 227.495 69.255 381.516c-9.379 9.335-24.544 9.317-33.901-.04l-22.667-22.667c-9.373-9.373-9.373-24.569 0-33.941L207.03 130.525c9.372-9.373 24.568-9.373 33.941-.001z"]
};
var faChild = {
prefix: 'fas',
iconName: 'child',
icon: [384, 512, [], "f1ae", "M120 72c0-39.765 32.235-72 72-72s72 32.235 72 72c0 39.764-32.235 72-72 72s-72-32.236-72-72zm254.627 1.373c-12.496-12.497-32.758-12.497-45.254 0L242.745 160H141.254L54.627 73.373c-12.496-12.497-32.758-12.497-45.254 0-12.497 12.497-12.497 32.758 0 45.255L104 213.254V480c0 17.673 14.327 32 32 32h16c17.673 0 32-14.327 32-32V368h16v112c0 17.673 14.327 32 32 32h16c17.673 0 32-14.327 32-32V213.254l94.627-94.627c12.497-12.497 12.497-32.757 0-45.254z"]
};
var faChurch = {
prefix: 'fas',
iconName: 'church',
icon: [640, 512, [], "f51d", "M464.46 246.68L352 179.2V128h48c8.84 0 16-7.16 16-16V80c0-8.84-7.16-16-16-16h-48V16c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v48h-48c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h48v51.2l-112.46 67.48A31.997 31.997 0 0 0 160 274.12V512h96v-96c0-35.35 28.65-64 64-64s64 28.65 64 64v96h96V274.12c0-11.24-5.9-21.66-15.54-27.44zM0 395.96V496c0 8.84 7.16 16 16 16h112V320L19.39 366.54A32.024 32.024 0 0 0 0 395.96zm620.61-29.42L512 320v192h112c8.84 0 16-7.16 16-16V395.96c0-12.8-7.63-24.37-19.39-29.42z"]
};
var faCircle = {
prefix: 'fas',
iconName: 'circle',
icon: [512, 512, [], "f111", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8z"]
};
var faCircleNotch = {
prefix: 'fas',
iconName: 'circle-notch',
icon: [512, 512, [], "f1ce", "M288 39.056v16.659c0 10.804 7.281 20.159 17.686 23.066C383.204 100.434 440 171.518 440 256c0 101.689-82.295 184-184 184-101.689 0-184-82.295-184-184 0-84.47 56.786-155.564 134.312-177.219C216.719 75.874 224 66.517 224 55.712V39.064c0-15.709-14.834-27.153-30.046-23.234C86.603 43.482 7.394 141.206 8.003 257.332c.72 137.052 111.477 246.956 248.531 246.667C393.255 503.711 504 392.788 504 256c0-115.633-79.14-212.779-186.211-240.236C302.678 11.889 288 23.456 288 39.056z"]
};
var faCity = {
prefix: 'fas',
iconName: 'city',
icon: [640, 512, [], "f64f", "M616 192H480V24c0-13.26-10.74-24-24-24H312c-13.26 0-24 10.74-24 24v72h-64V16c0-8.84-7.16-16-16-16h-16c-8.84 0-16 7.16-16 16v80h-64V16c0-8.84-7.16-16-16-16H80c-8.84 0-16 7.16-16 16v80H24c-13.26 0-24 10.74-24 24v360c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V216c0-13.26-10.75-24-24-24zM128 404c0 6.63-5.37 12-12 12H76c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12H76c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12H76c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm128 192c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm160 96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12V76c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm160 288c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40zm0-96c0 6.63-5.37 12-12 12h-40c-6.63 0-12-5.37-12-12v-40c0-6.63 5.37-12 12-12h40c6.63 0 12 5.37 12 12v40z"]
};
var faClinicMedical = {
prefix: 'fas',
iconName: 'clinic-medical',
icon: [576, 512, [], "f7f2", "M288 115L69.47 307.71c-1.62 1.46-3.69 2.14-5.47 3.35V496a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V311.1c-1.7-1.16-3.72-1.82-5.26-3.2zm96 261a8 8 0 0 1-8 8h-56v56a8 8 0 0 1-8 8h-48a8 8 0 0 1-8-8v-56h-56a8 8 0 0 1-8-8v-48a8 8 0 0 1 8-8h56v-56a8 8 0 0 1 8-8h48a8 8 0 0 1 8 8v56h56a8 8 0 0 1 8 8zm186.69-139.72l-255.94-226a39.85 39.85 0 0 0-53.45 0l-256 226a16 16 0 0 0-1.21 22.6L25.5 282.7a16 16 0 0 0 22.6 1.21L277.42 81.63a16 16 0 0 1 21.17 0L527.91 283.9a16 16 0 0 0 22.6-1.21l21.4-23.82a16 16 0 0 0-1.22-22.59z"]
};
var faClipboard = {
prefix: 'fas',
iconName: 'clipboard',
icon: [384, 512, [], "f328", "M384 112v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V112c0-26.51 21.49-48 48-48h80c0-35.29 28.71-64 64-64s64 28.71 64 64h80c26.51 0 48 21.49 48 48zM192 40c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24m96 114v-20a6 6 0 0 0-6-6H102a6 6 0 0 0-6 6v20a6 6 0 0 0 6 6h180a6 6 0 0 0 6-6z"]
};
var faClipboardCheck = {
prefix: 'fas',
iconName: 'clipboard-check',
icon: [384, 512, [], "f46c", "M336 64h-80c0-35.3-28.7-64-64-64s-64 28.7-64 64H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM192 40c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm121.2 231.8l-143 141.8c-4.7 4.7-12.3 4.6-17-.1l-82.6-83.3c-4.7-4.7-4.6-12.3.1-17L99.1 285c4.7-4.7 12.3-4.6 17 .1l46 46.4 106-105.2c4.7-4.7 12.3-4.6 17 .1l28.2 28.4c4.7 4.8 4.6 12.3-.1 17z"]
};
var faClipboardList = {
prefix: 'fas',
iconName: 'clipboard-list',
icon: [384, 512, [], "f46d", "M336 64h-80c0-35.3-28.7-64-64-64s-64 28.7-64 64H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM96 424c-13.3 0-24-10.7-24-24s10.7-24 24-24 24 10.7 24 24-10.7 24-24 24zm0-96c-13.3 0-24-10.7-24-24s10.7-24 24-24 24 10.7 24 24-10.7 24-24 24zm0-96c-13.3 0-24-10.7-24-24s10.7-24 24-24 24 10.7 24 24-10.7 24-24 24zm96-192c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm128 368c0 4.4-3.6 8-8 8H168c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16zm0-96c0 4.4-3.6 8-8 8H168c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16zm0-96c0 4.4-3.6 8-8 8H168c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16z"]
};
var faClock = {
prefix: 'fas',
iconName: 'clock',
icon: [512, 512, [], "f017", "M256,8C119,8,8,119,8,256S119,504,256,504,504,393,504,256,393,8,256,8Zm92.49,313h0l-20,25a16,16,0,0,1-22.49,2.5h0l-67-49.72a40,40,0,0,1-15-31.23V112a16,16,0,0,1,16-16h32a16,16,0,0,1,16,16V256l58,42.5A16,16,0,0,1,348.49,321Z"]
};
var faClone = {
prefix: 'fas',
iconName: 'clone',
icon: [512, 512, [], "f24d", "M464 0c26.51 0 48 21.49 48 48v288c0 26.51-21.49 48-48 48H176c-26.51 0-48-21.49-48-48V48c0-26.51 21.49-48 48-48h288M176 416c-44.112 0-80-35.888-80-80V128H48c-26.51 0-48 21.49-48 48v288c0 26.51 21.49 48 48 48h288c26.51 0 48-21.49 48-48v-48H176z"]
};
var faClosedCaptioning = {
prefix: 'fas',
iconName: 'closed-captioning',
icon: [512, 512, [], "f20a", "M464 64H48C21.5 64 0 85.5 0 112v288c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM218.1 287.7c2.8-2.5 7.1-2.1 9.2.9l19.5 27.7c1.7 2.4 1.5 5.6-.5 7.7-53.6 56.8-172.8 32.1-172.8-67.9 0-97.3 121.7-119.5 172.5-70.1 2.1 2 2.5 3.2 1 5.7l-17.5 30.5c-1.9 3.1-6.2 4-9.1 1.7-40.8-32-94.6-14.9-94.6 31.2.1 48 51.1 70.5 92.3 32.6zm190.4 0c2.8-2.5 7.1-2.1 9.2.9l19.5 27.7c1.7 2.4 1.5 5.6-.5 7.7-53.5 56.9-172.7 32.1-172.7-67.9 0-97.3 121.7-119.5 172.5-70.1 2.1 2 2.5 3.2 1 5.7L420 222.2c-1.9 3.1-6.2 4-9.1 1.7-40.8-32-94.6-14.9-94.6 31.2 0 48 51 70.5 92.2 32.6z"]
};
var faCloud = {
prefix: 'fas',
iconName: 'cloud',
icon: [640, 512, [], "f0c2", "M537.6 226.6c4.1-10.7 6.4-22.4 6.4-34.6 0-53-43-96-96-96-19.7 0-38.1 6-53.3 16.2C367 64.2 315.3 32 256 32c-88.4 0-160 71.6-160 160 0 2.7.1 5.4.2 8.1C40.2 219.8 0 273.2 0 336c0 79.5 64.5 144 144 144h368c70.7 0 128-57.3 128-128 0-61.9-44-113.6-102.4-125.4z"]
};
var faCloudDownloadAlt = {
prefix: 'fas',
iconName: 'cloud-download-alt',
icon: [640, 512, [], "f381", "M537.6 226.6c4.1-10.7 6.4-22.4 6.4-34.6 0-53-43-96-96-96-19.7 0-38.1 6-53.3 16.2C367 64.2 315.3 32 256 32c-88.4 0-160 71.6-160 160 0 2.7.1 5.4.2 8.1C40.2 219.8 0 273.2 0 336c0 79.5 64.5 144 144 144h368c70.7 0 128-57.3 128-128 0-61.9-44-113.6-102.4-125.4zm-132.9 88.7L299.3 420.7c-6.2 6.2-16.4 6.2-22.6 0L171.3 315.3c-10.1-10.1-2.9-27.3 11.3-27.3H248V176c0-8.8 7.2-16 16-16h48c8.8 0 16 7.2 16 16v112h65.4c14.2 0 21.4 17.2 11.3 27.3z"]
};
var faCloudMeatball = {
prefix: 'fas',
iconName: 'cloud-meatball',
icon: [512, 512, [], "f73b", "M48 352c-26.5 0-48 21.5-48 48s21.5 48 48 48 48-21.5 48-48-21.5-48-48-48zm416 0c-26.5 0-48 21.5-48 48s21.5 48 48 48 48-21.5 48-48-21.5-48-48-48zm-119 11.1c4.6-14.5 1.6-30.8-9.8-42.3-11.5-11.5-27.8-14.4-42.3-9.9-7-13.5-20.7-23-36.9-23s-29.9 9.5-36.9 23c-14.5-4.6-30.8-1.6-42.3 9.9-11.5 11.5-14.4 27.8-9.9 42.3-13.5 7-23 20.7-23 36.9s9.5 29.9 23 36.9c-4.6 14.5-1.6 30.8 9.9 42.3 8.2 8.2 18.9 12.3 29.7 12.3 4.3 0 8.5-1.1 12.6-2.5 7 13.5 20.7 23 36.9 23s29.9-9.5 36.9-23c4.1 1.3 8.3 2.5 12.6 2.5 10.8 0 21.5-4.1 29.7-12.3 11.5-11.5 14.4-27.8 9.8-42.3 13.5-7 23-20.7 23-36.9s-9.5-29.9-23-36.9zM512 224c0-53-43-96-96-96-.6 0-1.1.2-1.6.2 1.1-5.2 1.6-10.6 1.6-16.2 0-44.2-35.8-80-80-80-24.6 0-46.3 11.3-61 28.8C256.4 24.8 219.3 0 176 0 114.1 0 64 50.1 64 112c0 7.3.8 14.3 2.1 21.2C27.8 145.8 0 181.5 0 224c0 53 43 96 96 96h43.4c3.6-8 8.4-15.4 14.8-21.8 13.5-13.5 31.5-21.1 50.8-21.3 13.5-13.2 31.7-20.9 51-20.9s37.5 7.7 51 20.9c19.3.2 37.3 7.8 50.8 21.3 6.4 6.4 11.3 13.8 14.8 21.8H416c53 0 96-43 96-96z"]
};
var faCloudMoon = {
prefix: 'fas',
iconName: 'cloud-moon',
icon: [576, 512, [], "f6c3", "M342.8 352.7c5.7-9.6 9.2-20.7 9.2-32.7 0-35.3-28.7-64-64-64-17.2 0-32.8 6.9-44.3 17.9-16.3-29.6-47.5-49.9-83.7-49.9-53 0-96 43-96 96 0 2 .5 3.8.6 5.7C27.1 338.8 0 374.1 0 416c0 53 43 96 96 96h240c44.2 0 80-35.8 80-80 0-41.9-32.3-75.8-73.2-79.3zm222.5-54.3c-93.1 17.7-178.5-53.7-178.5-147.7 0-54.2 29-104 76.1-130.8 7.3-4.1 5.4-15.1-2.8-16.7C448.4 1.1 436.7 0 425 0 319.1 0 233.1 85.9 233.1 192c0 8.5.7 16.8 1.8 25 5.9 4.3 11.6 8.9 16.7 14.2 11.4-4.7 23.7-7.2 36.4-7.2 52.9 0 96 43.1 96 96 0 3.6-.2 7.2-.6 10.7 23.6 10.8 42.4 29.5 53.5 52.6 54.4-3.4 103.7-29.3 137.1-70.4 5.3-6.5-.5-16.1-8.7-14.5z"]
};
var faCloudMoonRain = {
prefix: 'fas',
iconName: 'cloud-moon-rain',
icon: [576, 512, [], "f73c", "M350.5 225.5c-6.9-37.2-39.3-65.5-78.5-65.5-12.3 0-23.9 3-34.3 8-17.4-24.1-45.6-40-77.7-40-53 0-96 43-96 96 0 .5.2 1.1.2 1.6C27.6 232.9 0 265.2 0 304c0 44.2 35.8 80 80 80h256c44.2 0 80-35.8 80-80 0-39.2-28.2-71.7-65.5-78.5zm217.4-1.7c-70.4 13.3-135-40.3-135-110.8 0-40.6 21.9-78 57.5-98.1 5.5-3.1 4.1-11.4-2.1-12.5C479.6.8 470.7 0 461.8 0c-77.9 0-141.1 61.2-144.4 137.9 26.7 11.9 48.2 33.8 58.9 61.7 37.1 14.3 64 47.4 70.2 86.8 5.1.5 10 1.5 15.2 1.5 44.7 0 85.6-20.2 112.6-53.3 4.2-4.8-.2-12-6.4-10.8zM364.5 418.1c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8z"]
};
var faCloudRain = {
prefix: 'fas',
iconName: 'cloud-rain',
icon: [512, 512, [], "f73d", "M416 128c-.6 0-1.1.2-1.6.2 1.1-5.2 1.6-10.6 1.6-16.2 0-44.2-35.8-80-80-80-24.6 0-46.3 11.3-61 28.8C256.4 24.8 219.3 0 176 0 114.1 0 64 50.1 64 112c0 7.3.8 14.3 2.1 21.2C27.8 145.8 0 181.5 0 224c0 53 43 96 96 96h320c53 0 96-43 96-96s-43-96-96-96zM88 374.2c-12.8 44.4-40 56.4-40 87.7 0 27.7 21.5 50.1 48 50.1s48-22.4 48-50.1c0-31.4-27.2-43.1-40-87.7-2.2-8.1-13.5-8.5-16 0zm160 0c-12.8 44.4-40 56.4-40 87.7 0 27.7 21.5 50.1 48 50.1s48-22.4 48-50.1c0-31.4-27.2-43.1-40-87.7-2.2-8.1-13.5-8.5-16 0zm160 0c-12.8 44.4-40 56.4-40 87.7 0 27.7 21.5 50.1 48 50.1s48-22.4 48-50.1c0-31.4-27.2-43.1-40-87.7-2.2-8.1-13.5-8.5-16 0z"]
};
var faCloudShowersHeavy = {
prefix: 'fas',
iconName: 'cloud-showers-heavy',
icon: [512, 512, [], "f740", "M183.9 370.1c-7.6-4.4-17.4-1.8-21.8 6l-64 112c-4.4 7.7-1.7 17.5 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l64-112c4.4-7.6 1.7-17.4-6-21.8zm96 0c-7.6-4.4-17.4-1.8-21.8 6l-64 112c-4.4 7.7-1.7 17.5 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l64-112c4.4-7.6 1.7-17.4-6-21.8zm-192 0c-7.6-4.4-17.4-1.8-21.8 6l-64 112c-4.4 7.7-1.7 17.5 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l64-112c4.4-7.6 1.7-17.4-6-21.8zm384 0c-7.6-4.4-17.4-1.8-21.8 6l-64 112c-4.4 7.7-1.7 17.5 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l64-112c4.4-7.6 1.7-17.4-6-21.8zm-96 0c-7.6-4.4-17.4-1.8-21.8 6l-64 112c-4.4 7.7-1.7 17.5 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l64-112c4.4-7.6 1.7-17.4-6-21.8zM416 128c-.6 0-1.1.2-1.6.2 1.1-5.2 1.6-10.6 1.6-16.2 0-44.2-35.8-80-80-80-24.6 0-46.3 11.3-61 28.8C256.4 24.8 219.3 0 176 0 114.2 0 64 50.1 64 112c0 7.3.8 14.3 2.1 21.2C27.8 145.8 0 181.5 0 224c0 53 43 96 96 96h320c53 0 96-43 96-96s-43-96-96-96z"]
};
var faCloudSun = {
prefix: 'fas',
iconName: 'cloud-sun',
icon: [640, 512, [], "f6c4", "M575.2 325.7c.2-1.9.8-3.7.8-5.6 0-35.3-28.7-64-64-64-12.6 0-24.2 3.8-34.1 10-17.6-38.8-56.5-66-101.9-66-61.8 0-112 50.1-112 112 0 3 .7 5.8.9 8.7-49.6 3.7-88.9 44.7-88.9 95.3 0 53 43 96 96 96h272c53 0 96-43 96-96 0-42.1-27.2-77.4-64.8-90.4zm-430.4-22.6c-43.7-43.7-43.7-114.7 0-158.3 43.7-43.7 114.7-43.7 158.4 0 9.7 9.7 16.9 20.9 22.3 32.7 9.8-3.7 20.1-6 30.7-7.5L386 81.1c4-11.9-7.3-23.1-19.2-19.2L279 91.2 237.5 8.4C232-2.8 216-2.8 210.4 8.4L169 91.2 81.1 61.9C69.3 58 58 69.3 61.9 81.1l29.3 87.8-82.8 41.5c-11.2 5.6-11.2 21.5 0 27.1l82.8 41.4-29.3 87.8c-4 11.9 7.3 23.1 19.2 19.2l76.1-25.3c6.1-12.4 14-23.7 23.6-33.5-13.1-5.4-25.4-13.4-36-24zm-4.8-79.2c0 40.8 29.3 74.8 67.9 82.3 8-4.7 16.3-8.8 25.2-11.7 5.4-44.3 31-82.5 67.4-105C287.3 160.4 258 140 224 140c-46.3 0-84 37.6-84 83.9z"]
};
var faCloudSunRain = {
prefix: 'fas',
iconName: 'cloud-sun-rain',
icon: [576, 512, [], "f743", "M510.5 225.5c-6.9-37.2-39.3-65.5-78.5-65.5-12.3 0-23.9 3-34.3 8-17.4-24.1-45.6-40-77.7-40-53 0-96 43-96 96 0 .5.2 1.1.2 1.6C187.6 233 160 265.2 160 304c0 44.2 35.8 80 80 80h256c44.2 0 80-35.8 80-80 0-39.2-28.2-71.7-65.5-78.5zm-386.4 34.4c-37.4-37.4-37.4-98.3 0-135.8 34.6-34.6 89.1-36.8 126.7-7.4 20-12.9 43.6-20.7 69.2-20.7.7 0 1.3.2 2 .2l8.9-26.7c3.4-10.2-6.3-19.8-16.5-16.4l-75.3 25.1-35.5-71c-4.8-9.6-18.5-9.6-23.3 0l-35.5 71-75.3-25.1c-10.2-3.4-19.8 6.3-16.4 16.5l25.1 75.3-71 35.5c-9.6 4.8-9.6 18.5 0 23.3l71 35.5-25.1 75.3c-3.4 10.2 6.3 19.8 16.5 16.5l59.2-19.7c-.2-2.4-.7-4.7-.7-7.2 0-12.5 2.3-24.5 6.2-35.9-3.6-2.7-7.1-5.2-10.2-8.3zm69.8-58c4.3-24.5 15.8-46.4 31.9-64-9.8-6.2-21.4-9.9-33.8-9.9-35.3 0-64 28.7-64 64 0 18.7 8.2 35.4 21.1 47.1 11.3-15.9 26.6-28.9 44.8-37.2zm330.6 216.2c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8zm-96 0c-7.6-4.3-17.4-1.8-21.8 6l-36.6 64c-4.4 7.7-1.7 17.4 6 21.8 2.5 1.4 5.2 2.1 7.9 2.1 5.5 0 10.9-2.9 13.9-8.1l36.6-64c4.3-7.7 1.7-17.4-6-21.8z"]
};
var faCloudUploadAlt = {
prefix: 'fas',
iconName: 'cloud-upload-alt',
icon: [640, 512, [], "f382", "M537.6 226.6c4.1-10.7 6.4-22.4 6.4-34.6 0-53-43-96-96-96-19.7 0-38.1 6-53.3 16.2C367 64.2 315.3 32 256 32c-88.4 0-160 71.6-160 160 0 2.7.1 5.4.2 8.1C40.2 219.8 0 273.2 0 336c0 79.5 64.5 144 144 144h368c70.7 0 128-57.3 128-128 0-61.9-44-113.6-102.4-125.4zM393.4 288H328v112c0 8.8-7.2 16-16 16h-48c-8.8 0-16-7.2-16-16V288h-65.4c-14.3 0-21.4-17.2-11.3-27.3l105.4-105.4c6.2-6.2 16.4-6.2 22.6 0l105.4 105.4c10.1 10.1 2.9 27.3-11.3 27.3z"]
};
var faCocktail = {
prefix: 'fas',
iconName: 'cocktail',
icon: [576, 512, [], "f561", "M296 464h-56V338.78l168.74-168.73c15.52-15.52 4.53-42.05-17.42-42.05H24.68c-21.95 0-32.94 26.53-17.42 42.05L176 338.78V464h-56c-22.09 0-40 17.91-40 40 0 4.42 3.58 8 8 8h240c4.42 0 8-3.58 8-8 0-22.09-17.91-40-40-40zM432 0c-62.61 0-115.35 40.2-135.18 96h52.54c16.65-28.55 47.27-48 82.64-48 52.93 0 96 43.06 96 96s-43.07 96-96 96c-14.04 0-27.29-3.2-39.32-8.64l-35.26 35.26C379.23 279.92 404.59 288 432 288c79.53 0 144-64.47 144-144S511.53 0 432 0z"]
};
var faCode = {
prefix: 'fas',
iconName: 'code',
icon: [640, 512, [], "f121", "M278.9 511.5l-61-17.7c-6.4-1.8-10-8.5-8.2-14.9L346.2 8.7c1.8-6.4 8.5-10 14.9-8.2l61 17.7c6.4 1.8 10 8.5 8.2 14.9L293.8 503.3c-1.9 6.4-8.5 10.1-14.9 8.2zm-114-112.2l43.5-46.4c4.6-4.9 4.3-12.7-.8-17.2L117 256l90.6-79.7c5.1-4.5 5.5-12.3.8-17.2l-43.5-46.4c-4.5-4.8-12.1-5.1-17-.5L3.8 247.2c-5.1 4.7-5.1 12.8 0 17.5l144.1 135.1c4.9 4.6 12.5 4.4 17-.5zm327.2.6l144.1-135.1c5.1-4.7 5.1-12.8 0-17.5L492.1 112.1c-4.8-4.5-12.4-4.3-17 .5L431.6 159c-4.6 4.9-4.3 12.7.8 17.2L523 256l-90.6 79.7c-5.1 4.5-5.5 12.3-.8 17.2l43.5 46.4c4.5 4.9 12.1 5.1 17 .6z"]
};
var faCodeBranch = {
prefix: 'fas',
iconName: 'code-branch',
icon: [384, 512, [], "f126", "M384 144c0-44.2-35.8-80-80-80s-80 35.8-80 80c0 36.4 24.3 67.1 57.5 76.8-.6 16.1-4.2 28.5-11 36.9-15.4 19.2-49.3 22.4-85.2 25.7-28.2 2.6-57.4 5.4-81.3 16.9v-144c32.5-10.2 56-40.5 56-76.3 0-44.2-35.8-80-80-80S0 35.8 0 80c0 35.8 23.5 66.1 56 76.3v199.3C23.5 365.9 0 396.2 0 432c0 44.2 35.8 80 80 80s80-35.8 80-80c0-34-21.2-63.1-51.2-74.6 3.1-5.2 7.8-9.8 14.9-13.4 16.2-8.2 40.4-10.4 66.1-12.8 42.2-3.9 90-8.4 118.2-43.4 14-17.4 21.1-39.8 21.6-67.9 31.6-10.8 54.4-40.7 54.4-75.9zM80 64c8.8 0 16 7.2 16 16s-7.2 16-16 16-16-7.2-16-16 7.2-16 16-16zm0 384c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm224-320c8.8 0 16 7.2 16 16s-7.2 16-16 16-16-7.2-16-16 7.2-16 16-16z"]
};
var faCoffee = {
prefix: 'fas',
iconName: 'coffee',
icon: [640, 512, [], "f0f4", "M192 384h192c53 0 96-43 96-96h32c70.6 0 128-57.4 128-128S582.6 32 512 32H120c-13.3 0-24 10.7-24 24v232c0 53 43 96 96 96zM512 96c35.3 0 64 28.7 64 64s-28.7 64-64 64h-32V96h32zm47.7 384H48.3c-47.6 0-61-64-36-64h583.3c25 0 11.8 64-35.9 64z"]
};
var faCog = {
prefix: 'fas',
iconName: 'cog',
icon: [512, 512, [], "f013", "M487.4 315.7l-42.6-24.6c4.3-23.2 4.3-47 0-70.2l42.6-24.6c4.9-2.8 7.1-8.6 5.5-14-11.1-35.6-30-67.8-54.7-94.6-3.8-4.1-10-5.1-14.8-2.3L380.8 110c-17.9-15.4-38.5-27.3-60.8-35.1V25.8c0-5.6-3.9-10.5-9.4-11.7-36.7-8.2-74.3-7.8-109.2 0-5.5 1.2-9.4 6.1-9.4 11.7V75c-22.2 7.9-42.8 19.8-60.8 35.1L88.7 85.5c-4.9-2.8-11-1.9-14.8 2.3-24.7 26.7-43.6 58.9-54.7 94.6-1.7 5.4.6 11.2 5.5 14L67.3 221c-4.3 23.2-4.3 47 0 70.2l-42.6 24.6c-4.9 2.8-7.1 8.6-5.5 14 11.1 35.6 30 67.8 54.7 94.6 3.8 4.1 10 5.1 14.8 2.3l42.6-24.6c17.9 15.4 38.5 27.3 60.8 35.1v49.2c0 5.6 3.9 10.5 9.4 11.7 36.7 8.2 74.3 7.8 109.2 0 5.5-1.2 9.4-6.1 9.4-11.7v-49.2c22.2-7.9 42.8-19.8 60.8-35.1l42.6 24.6c4.9 2.8 11 1.9 14.8-2.3 24.7-26.7 43.6-58.9 54.7-94.6 1.5-5.5-.7-11.3-5.6-14.1zM256 336c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faCogs = {
prefix: 'fas',
iconName: 'cogs',
icon: [640, 512, [], "f085", "M512.1 191l-8.2 14.3c-3 5.3-9.4 7.5-15.1 5.4-11.8-4.4-22.6-10.7-32.1-18.6-4.6-3.8-5.8-10.5-2.8-15.7l8.2-14.3c-6.9-8-12.3-17.3-15.9-27.4h-16.5c-6 0-11.2-4.3-12.2-10.3-2-12-2.1-24.6 0-37.1 1-6 6.2-10.4 12.2-10.4h16.5c3.6-10.1 9-19.4 15.9-27.4l-8.2-14.3c-3-5.2-1.9-11.9 2.8-15.7 9.5-7.9 20.4-14.2 32.1-18.6 5.7-2.1 12.1.1 15.1 5.4l8.2 14.3c10.5-1.9 21.2-1.9 31.7 0L552 6.3c3-5.3 9.4-7.5 15.1-5.4 11.8 4.4 22.6 10.7 32.1 18.6 4.6 3.8 5.8 10.5 2.8 15.7l-8.2 14.3c6.9 8 12.3 17.3 15.9 27.4h16.5c6 0 11.2 4.3 12.2 10.3 2 12 2.1 24.6 0 37.1-1 6-6.2 10.4-12.2 10.4h-16.5c-3.6 10.1-9 19.4-15.9 27.4l8.2 14.3c3 5.2 1.9 11.9-2.8 15.7-9.5 7.9-20.4 14.2-32.1 18.6-5.7 2.1-12.1-.1-15.1-5.4l-8.2-14.3c-10.4 1.9-21.2 1.9-31.7 0zm-10.5-58.8c38.5 29.6 82.4-14.3 52.8-52.8-38.5-29.7-82.4 14.3-52.8 52.8zM386.3 286.1l33.7 16.8c10.1 5.8 14.5 18.1 10.5 29.1-8.9 24.2-26.4 46.4-42.6 65.8-7.4 8.9-20.2 11.1-30.3 5.3l-29.1-16.8c-16 13.7-34.6 24.6-54.9 31.7v33.6c0 11.6-8.3 21.6-19.7 23.6-24.6 4.2-50.4 4.4-75.9 0-11.5-2-20-11.9-20-23.6V418c-20.3-7.2-38.9-18-54.9-31.7L74 403c-10 5.8-22.9 3.6-30.3-5.3-16.2-19.4-33.3-41.6-42.2-65.7-4-10.9.4-23.2 10.5-29.1l33.3-16.8c-3.9-20.9-3.9-42.4 0-63.4L12 205.8c-10.1-5.8-14.6-18.1-10.5-29 8.9-24.2 26-46.4 42.2-65.8 7.4-8.9 20.2-11.1 30.3-5.3l29.1 16.8c16-13.7 34.6-24.6 54.9-31.7V57.1c0-11.5 8.2-21.5 19.6-23.5 24.6-4.2 50.5-4.4 76-.1 11.5 2 20 11.9 20 23.6v33.6c20.3 7.2 38.9 18 54.9 31.7l29.1-16.8c10-5.8 22.9-3.6 30.3 5.3 16.2 19.4 33.2 41.6 42.1 65.8 4 10.9.1 23.2-10 29.1l-33.7 16.8c3.9 21 3.9 42.5 0 63.5zm-117.6 21.1c59.2-77-28.7-164.9-105.7-105.7-59.2 77 28.7 164.9 105.7 105.7zm243.4 182.7l-8.2 14.3c-3 5.3-9.4 7.5-15.1 5.4-11.8-4.4-22.6-10.7-32.1-18.6-4.6-3.8-5.8-10.5-2.8-15.7l8.2-14.3c-6.9-8-12.3-17.3-15.9-27.4h-16.5c-6 0-11.2-4.3-12.2-10.3-2-12-2.1-24.6 0-37.1 1-6 6.2-10.4 12.2-10.4h16.5c3.6-10.1 9-19.4 15.9-27.4l-8.2-14.3c-3-5.2-1.9-11.9 2.8-15.7 9.5-7.9 20.4-14.2 32.1-18.6 5.7-2.1 12.1.1 15.1 5.4l8.2 14.3c10.5-1.9 21.2-1.9 31.7 0l8.2-14.3c3-5.3 9.4-7.5 15.1-5.4 11.8 4.4 22.6 10.7 32.1 18.6 4.6 3.8 5.8 10.5 2.8 15.7l-8.2 14.3c6.9 8 12.3 17.3 15.9 27.4h16.5c6 0 11.2 4.3 12.2 10.3 2 12 2.1 24.6 0 37.1-1 6-6.2 10.4-12.2 10.4h-16.5c-3.6 10.1-9 19.4-15.9 27.4l8.2 14.3c3 5.2 1.9 11.9-2.8 15.7-9.5 7.9-20.4 14.2-32.1 18.6-5.7 2.1-12.1-.1-15.1-5.4l-8.2-14.3c-10.4 1.9-21.2 1.9-31.7 0zM501.6 431c38.5 29.6 82.4-14.3 52.8-52.8-38.5-29.6-82.4 14.3-52.8 52.8z"]
};
var faCoins = {
prefix: 'fas',
iconName: 'coins',
icon: [512, 512, [], "f51e", "M0 405.3V448c0 35.3 86 64 192 64s192-28.7 192-64v-42.7C342.7 434.4 267.2 448 192 448S41.3 434.4 0 405.3zM320 128c106 0 192-28.7 192-64S426 0 320 0 128 28.7 128 64s86 64 192 64zM0 300.4V352c0 35.3 86 64 192 64s192-28.7 192-64v-51.6c-41.3 34-116.9 51.6-192 51.6S41.3 334.4 0 300.4zm416 11c57.3-11.1 96-31.7 96-55.4v-42.7c-23.2 16.4-57.3 27.6-96 34.5v63.6zM192 160C86 160 0 195.8 0 240s86 80 192 80 192-35.8 192-80-86-80-192-80zm219.3 56.3c60-10.8 100.7-32 100.7-56.3v-42.7c-35.5 25.1-96.5 38.6-160.7 41.8 29.5 14.3 51.2 33.5 60 57.2z"]
};
var faColumns = {
prefix: 'fas',
iconName: 'columns',
icon: [512, 512, [], "f0db", "M464 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zM224 416H64V160h160v256zm224 0H288V160h160v256z"]
};
var faComment = {
prefix: 'fas',
iconName: 'comment',
icon: [512, 512, [], "f075", "M256 32C114.6 32 0 125.1 0 240c0 49.6 21.4 95 57 130.7C44.5 421.1 2.7 466 2.2 466.5c-2.2 2.3-2.8 5.7-1.5 8.7S4.8 480 8 480c66.3 0 116-31.8 140.6-51.4 32.7 12.3 69 19.4 107.4 19.4 141.4 0 256-93.1 256-208S397.4 32 256 32z"]
};
var faCommentAlt = {
prefix: 'fas',
iconName: 'comment-alt',
icon: [512, 512, [], "f27a", "M448 0H64C28.7 0 0 28.7 0 64v288c0 35.3 28.7 64 64 64h96v84c0 9.8 11.2 15.5 19.1 9.7L304 416h144c35.3 0 64-28.7 64-64V64c0-35.3-28.7-64-64-64z"]
};
var faCommentDollar = {
prefix: 'fas',
iconName: 'comment-dollar',
icon: [512, 512, [], "f651", "M256 32C114.62 32 0 125.12 0 240c0 49.56 21.41 95.01 57.02 130.74C44.46 421.05 2.7 465.97 2.2 466.5A7.995 7.995 0 0 0 8 480c66.26 0 115.99-31.75 140.6-51.38C181.29 440.93 217.59 448 256 448c141.38 0 256-93.12 256-208S397.38 32 256 32zm24 302.44V352c0 8.84-7.16 16-16 16h-16c-8.84 0-16-7.16-16-16v-17.73c-11.42-1.35-22.28-5.19-31.78-11.46-6.22-4.11-6.82-13.11-1.55-18.38l17.52-17.52c3.74-3.74 9.31-4.24 14.11-2.03 3.18 1.46 6.66 2.22 10.26 2.22h32.78c4.66 0 8.44-3.78 8.44-8.42 0-3.75-2.52-7.08-6.12-8.11l-50.07-14.3c-22.25-6.35-40.01-24.71-42.91-47.67-4.05-32.07 19.03-59.43 49.32-63.05V128c0-8.84 7.16-16 16-16h16c8.84 0 16 7.16 16 16v17.73c11.42 1.35 22.28 5.19 31.78 11.46 6.22 4.11 6.82 13.11 1.55 18.38l-17.52 17.52c-3.74 3.74-9.31 4.24-14.11 2.03a24.516 24.516 0 0 0-10.26-2.22h-32.78c-4.66 0-8.44 3.78-8.44 8.42 0 3.75 2.52 7.08 6.12 8.11l50.07 14.3c22.25 6.36 40.01 24.71 42.91 47.67 4.05 32.06-19.03 59.42-49.32 63.04z"]
};
var faCommentDots = {
prefix: 'fas',
iconName: 'comment-dots',
icon: [512, 512, [], "f4ad", "M256 32C114.6 32 0 125.1 0 240c0 49.6 21.4 95 57 130.7C44.5 421.1 2.7 466 2.2 466.5c-2.2 2.3-2.8 5.7-1.5 8.7S4.8 480 8 480c66.3 0 116-31.8 140.6-51.4 32.7 12.3 69 19.4 107.4 19.4 141.4 0 256-93.1 256-208S397.4 32 256 32zM128 272c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm128 0c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm128 0c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faCommentMedical = {
prefix: 'fas',
iconName: 'comment-medical',
icon: [512, 512, [], "f7f5", "M256 32C114.62 32 0 125.12 0 240c0 49.56 21.41 95 57 130.74C44.46 421.05 2.7 466 2.2 466.5A8 8 0 0 0 8 480c66.26 0 116-31.75 140.6-51.38A304.66 304.66 0 0 0 256 448c141.39 0 256-93.12 256-208S397.39 32 256 32zm96 232a8 8 0 0 1-8 8h-56v56a8 8 0 0 1-8 8h-48a8 8 0 0 1-8-8v-56h-56a8 8 0 0 1-8-8v-48a8 8 0 0 1 8-8h56v-56a8 8 0 0 1 8-8h48a8 8 0 0 1 8 8v56h56a8 8 0 0 1 8 8z"]
};
var faCommentSlash = {
prefix: 'fas',
iconName: 'comment-slash',
icon: [640, 512, [], "f4b3", "M64 240c0 49.6 21.4 95 57 130.7-12.6 50.3-54.3 95.2-54.8 95.8-2.2 2.3-2.8 5.7-1.5 8.7 1.3 2.9 4.1 4.8 7.3 4.8 66.3 0 116-31.8 140.6-51.4 32.7 12.3 69 19.4 107.4 19.4 27.4 0 53.7-3.6 78.4-10L72.9 186.4c-5.6 17.1-8.9 35-8.9 53.6zm569.8 218.1l-114.4-88.4C554.6 334.1 576 289.2 576 240c0-114.9-114.6-208-256-208-65.1 0-124.2 20.1-169.4 52.7L45.5 3.4C38.5-2 28.5-.8 23 6.2L3.4 31.4c-5.4 7-4.2 17 2.8 22.4l588.4 454.7c7 5.4 17 4.2 22.5-2.8l19.6-25.3c5.4-6.8 4.1-16.9-2.9-22.3z"]
};
var faComments = {
prefix: 'fas',
iconName: 'comments',
icon: [576, 512, [], "f086", "M416 192c0-88.4-93.1-160-208-160S0 103.6 0 192c0 34.3 14.1 65.9 38 92-13.4 30.2-35.5 54.2-35.8 54.5-2.2 2.3-2.8 5.7-1.5 8.7S4.8 352 8 352c36.6 0 66.9-12.3 88.7-25 32.2 15.7 70.3 25 111.3 25 114.9 0 208-71.6 208-160zm122 220c23.9-26 38-57.7 38-92 0-66.9-53.5-124.2-129.3-148.1.9 6.6 1.3 13.3 1.3 20.1 0 105.9-107.7 192-240 192-10.8 0-21.3-.8-31.7-1.9C207.8 439.6 281.8 480 368 480c41 0 79.1-9.2 111.3-25 21.8 12.7 52.1 25 88.7 25 3.2 0 6.1-1.9 7.3-4.8 1.3-2.9.7-6.3-1.5-8.7-.3-.3-22.4-24.2-35.8-54.5z"]
};
var faCommentsDollar = {
prefix: 'fas',
iconName: 'comments-dollar',
icon: [576, 512, [], "f653", "M416 192c0-88.37-93.12-160-208-160S0 103.63 0 192c0 34.27 14.13 65.95 37.97 91.98C24.61 314.22 2.52 338.16 2.2 338.5A7.995 7.995 0 0 0 8 352c36.58 0 66.93-12.25 88.73-24.98C128.93 342.76 167.02 352 208 352c114.88 0 208-71.63 208-160zm-224 96v-16.29c-11.29-.58-22.27-4.52-31.37-11.35-3.9-2.93-4.1-8.77-.57-12.14l11.75-11.21c2.77-2.64 6.89-2.76 10.13-.73 3.87 2.42 8.26 3.72 12.82 3.72h28.11c6.5 0 11.8-5.92 11.8-13.19 0-5.95-3.61-11.19-8.77-12.73l-45-13.5c-18.59-5.58-31.58-23.42-31.58-43.39 0-24.52 19.05-44.44 42.67-45.07V96c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16.29c11.29.58 22.27 4.51 31.37 11.35 3.9 2.93 4.1 8.77.57 12.14l-11.75 11.21c-2.77 2.64-6.89 2.76-10.13.73-3.87-2.43-8.26-3.72-12.82-3.72h-28.11c-6.5 0-11.8 5.92-11.8 13.19 0 5.95 3.61 11.19 8.77 12.73l45 13.5c18.59 5.58 31.58 23.42 31.58 43.39 0 24.53-19.05 44.44-42.67 45.07V288c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8zm346.01 123.99C561.87 385.96 576 354.27 576 320c0-66.94-53.49-124.2-129.33-148.07.86 6.6 1.33 13.29 1.33 20.07 0 105.87-107.66 192-240 192-10.78 0-21.32-.77-31.73-1.88C207.8 439.63 281.77 480 368 480c40.98 0 79.07-9.24 111.27-24.98C501.07 467.75 531.42 480 568 480c3.2 0 6.09-1.91 7.34-4.84 1.27-2.94.66-6.34-1.55-8.67-.31-.33-22.42-24.24-35.78-54.5z"]
};
var faCompactDisc = {
prefix: 'fas',
iconName: 'compact-disc',
icon: [496, 512, [], "f51f", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM88 256H56c0-105.9 86.1-192 192-192v32c-88.2 0-160 71.8-160 160zm160 96c-53 0-96-43-96-96s43-96 96-96 96 43 96 96-43 96-96 96zm0-128c-17.7 0-32 14.3-32 32s14.3 32 32 32 32-14.3 32-32-14.3-32-32-32z"]
};
var faCompass = {
prefix: 'fas',
iconName: 'compass',
icon: [496, 512, [], "f14e", "M225.38 233.37c-12.5 12.5-12.5 32.76 0 45.25 12.49 12.5 32.76 12.5 45.25 0 12.5-12.5 12.5-32.76 0-45.25-12.5-12.49-32.76-12.49-45.25 0zM248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm126.14 148.05L308.17 300.4a31.938 31.938 0 0 1-15.77 15.77l-144.34 65.97c-16.65 7.61-33.81-9.55-26.2-26.2l65.98-144.35a31.938 31.938 0 0 1 15.77-15.77l144.34-65.97c16.65-7.6 33.8 9.55 26.19 26.2z"]
};
var faCompress = {
prefix: 'fas',
iconName: 'compress',
icon: [448, 512, [], "f066", "M436 192H312c-13.3 0-24-10.7-24-24V44c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v84h84c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12zm-276-24V44c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v84H12c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h124c13.3 0 24-10.7 24-24zm0 300V344c0-13.3-10.7-24-24-24H12c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h84v84c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12zm192 0v-84h84c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12H312c-13.3 0-24 10.7-24 24v124c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12z"]
};
var faCompressAlt = {
prefix: 'fas',
iconName: 'compress-alt',
icon: [448, 512, [], "f422", "M4.686 427.314L104 328l-32.922-31.029C55.958 281.851 66.666 256 88.048 256h112C213.303 256 224 266.745 224 280v112c0 21.382-25.803 32.09-40.922 16.971L152 376l-99.314 99.314c-6.248 6.248-16.379 6.248-22.627 0L4.686 449.941c-6.248-6.248-6.248-16.379 0-22.627zM443.314 84.686L344 184l32.922 31.029c15.12 15.12 4.412 40.971-16.97 40.971h-112C234.697 256 224 245.255 224 232V120c0-21.382 25.803-32.09 40.922-16.971L296 136l99.314-99.314c6.248-6.248 16.379-6.248 22.627 0l25.373 25.373c6.248 6.248 6.248 16.379 0 22.627z"]
};
var faCompressArrowsAlt = {
prefix: 'fas',
iconName: 'compress-arrows-alt',
icon: [512, 512, [], "f78c", "M200 288H88c-21.4 0-32.1 25.8-17 41l32.9 31-99.2 99.3c-6.2 6.2-6.2 16.4 0 22.6l25.4 25.4c6.2 6.2 16.4 6.2 22.6 0L152 408l31.1 33c15.1 15.1 40.9 4.4 40.9-17V312c0-13.3-10.7-24-24-24zm112-64h112c21.4 0 32.1-25.9 17-41l-33-31 99.3-99.3c6.2-6.2 6.2-16.4 0-22.6L481.9 4.7c-6.2-6.2-16.4-6.2-22.6 0L360 104l-31.1-33C313.8 55.9 288 66.6 288 88v112c0 13.3 10.7 24 24 24zm96 136l33-31.1c15.1-15.1 4.4-40.9-17-40.9H312c-13.3 0-24 10.7-24 24v112c0 21.4 25.9 32.1 41 17l31-32.9 99.3 99.3c6.2 6.2 16.4 6.2 22.6 0l25.4-25.4c6.2-6.2 6.2-16.4 0-22.6L408 360zM183 71.1L152 104 52.7 4.7c-6.2-6.2-16.4-6.2-22.6 0L4.7 30.1c-6.2 6.2-6.2 16.4 0 22.6L104 152l-33 31.1C55.9 198.2 66.6 224 88 224h112c13.3 0 24-10.7 24-24V88c0-21.3-25.9-32-41-16.9z"]
};
var faConciergeBell = {
prefix: 'fas',
iconName: 'concierge-bell',
icon: [512, 512, [], "f562", "M288 130.54V112h16c8.84 0 16-7.16 16-16V80c0-8.84-7.16-16-16-16h-96c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h16v18.54C115.49 146.11 32 239.18 32 352h448c0-112.82-83.49-205.89-192-221.46zM496 384H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h480c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faCookie = {
prefix: 'fas',
iconName: 'cookie',
icon: [512, 512, [], "f563", "M510.37 254.79l-12.08-76.26a132.493 132.493 0 0 0-37.16-72.95l-54.76-54.75c-19.73-19.72-45.18-32.7-72.71-37.05l-76.7-12.15c-27.51-4.36-55.69.11-80.52 12.76L107.32 49.6a132.25 132.25 0 0 0-57.79 57.8l-35.1 68.88a132.602 132.602 0 0 0-12.82 80.94l12.08 76.27a132.493 132.493 0 0 0 37.16 72.95l54.76 54.75a132.087 132.087 0 0 0 72.71 37.05l76.7 12.14c27.51 4.36 55.69-.11 80.52-12.75l69.12-35.21a132.302 132.302 0 0 0 57.79-57.8l35.1-68.87c12.71-24.96 17.2-53.3 12.82-80.96zM176 368c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm32-160c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm160 128c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faCookieBite = {
prefix: 'fas',
iconName: 'cookie-bite',
icon: [512, 512, [], "f564", "M510.52 255.82c-69.97-.85-126.47-57.69-126.47-127.86-70.17 0-127-56.49-127.86-126.45-27.26-4.14-55.13.3-79.72 12.82l-69.13 35.22a132.221 132.221 0 0 0-57.79 57.81l-35.1 68.88a132.645 132.645 0 0 0-12.82 80.95l12.08 76.27a132.521 132.521 0 0 0 37.16 72.96l54.77 54.76a132.036 132.036 0 0 0 72.71 37.06l76.71 12.15c27.51 4.36 55.7-.11 80.53-12.76l69.13-35.21a132.273 132.273 0 0 0 57.79-57.81l35.1-68.88c12.56-24.64 17.01-52.58 12.91-79.91zM176 368c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm32-160c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm160 128c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faCopy = {
prefix: 'fas',
iconName: 'copy',
icon: [448, 512, [], "f0c5", "M320 448v40c0 13.255-10.745 24-24 24H24c-13.255 0-24-10.745-24-24V120c0-13.255 10.745-24 24-24h72v296c0 30.879 25.121 56 56 56h168zm0-344V0H152c-13.255 0-24 10.745-24 24v368c0 13.255 10.745 24 24 24h272c13.255 0 24-10.745 24-24V128H344c-13.2 0-24-10.8-24-24zm120.971-31.029L375.029 7.029A24 24 0 0 0 358.059 0H352v96h96v-6.059a24 24 0 0 0-7.029-16.97z"]
};
var faCopyright = {
prefix: 'fas',
iconName: 'copyright',
icon: [512, 512, [], "f1f9", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm117.134 346.753c-1.592 1.867-39.776 45.731-109.851 45.731-84.692 0-144.484-63.26-144.484-145.567 0-81.303 62.004-143.401 143.762-143.401 66.957 0 101.965 37.315 103.422 38.904a12 12 0 0 1 1.238 14.623l-22.38 34.655c-4.049 6.267-12.774 7.351-18.234 2.295-.233-.214-26.529-23.88-61.88-23.88-46.116 0-73.916 33.575-73.916 76.082 0 39.602 25.514 79.692 74.277 79.692 38.697 0 65.28-28.338 65.544-28.625 5.132-5.565 14.059-5.033 18.508 1.053l24.547 33.572a12.001 12.001 0 0 1-.553 14.866z"]
};
var faCouch = {
prefix: 'fas',
iconName: 'couch',
icon: [640, 512, [], "f4b8", "M160 224v64h320v-64c0-35.3 28.7-64 64-64h32c0-53-43-96-96-96H160c-53 0-96 43-96 96h32c35.3 0 64 28.7 64 64zm416-32h-32c-17.7 0-32 14.3-32 32v96H128v-96c0-17.7-14.3-32-32-32H64c-35.3 0-64 28.7-64 64 0 23.6 13 44 32 55.1V432c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16v-16h384v16c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16V311.1c19-11.1 32-31.5 32-55.1 0-35.3-28.7-64-64-64z"]
};
var faCreditCard = {
prefix: 'fas',
iconName: 'credit-card',
icon: [576, 512, [], "f09d", "M0 432c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V256H0v176zm192-68c0-6.6 5.4-12 12-12h136c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H204c-6.6 0-12-5.4-12-12v-40zm-128 0c0-6.6 5.4-12 12-12h72c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H76c-6.6 0-12-5.4-12-12v-40zM576 80v48H0V80c0-26.5 21.5-48 48-48h480c26.5 0 48 21.5 48 48z"]
};
var faCrop = {
prefix: 'fas',
iconName: 'crop',
icon: [512, 512, [], "f125", "M488 352h-40V109.25l59.31-59.31c6.25-6.25 6.25-16.38 0-22.63L484.69 4.69c-6.25-6.25-16.38-6.25-22.63 0L402.75 64H192v96h114.75L160 306.75V24c0-13.26-10.75-24-24-24H88C74.75 0 64 10.74 64 24v40H24C10.75 64 0 74.74 0 88v48c0 13.25 10.75 24 24 24h40v264c0 13.25 10.75 24 24 24h232v-96H205.25L352 205.25V488c0 13.25 10.75 24 24 24h48c13.25 0 24-10.75 24-24v-40h40c13.25 0 24-10.75 24-24v-48c0-13.26-10.75-24-24-24z"]
};
var faCropAlt = {
prefix: 'fas',
iconName: 'crop-alt',
icon: [512, 512, [], "f565", "M488 352h-40V96c0-17.67-14.33-32-32-32H192v96h160v328c0 13.25 10.75 24 24 24h48c13.25 0 24-10.75 24-24v-40h40c13.25 0 24-10.75 24-24v-48c0-13.26-10.75-24-24-24zM160 24c0-13.26-10.75-24-24-24H88C74.75 0 64 10.74 64 24v40H24C10.75 64 0 74.74 0 88v48c0 13.25 10.75 24 24 24h40v256c0 17.67 14.33 32 32 32h224v-96H160V24z"]
};
var faCross = {
prefix: 'fas',
iconName: 'cross',
icon: [384, 512, [], "f654", "M352 128h-96V32c0-17.67-14.33-32-32-32h-64c-17.67 0-32 14.33-32 32v96H32c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h96v224c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32V256h96c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32z"]
};
var faCrosshairs = {
prefix: 'fas',
iconName: 'crosshairs',
icon: [512, 512, [], "f05b", "M500 224h-30.364C455.724 130.325 381.675 56.276 288 42.364V12c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v30.364C130.325 56.276 56.276 130.325 42.364 224H12c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h30.364C56.276 381.675 130.325 455.724 224 469.636V500c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-30.364C381.675 455.724 455.724 381.675 469.636 288H500c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12zM288 404.634V364c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40.634C165.826 392.232 119.783 346.243 107.366 288H148c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-40.634C119.768 165.826 165.757 119.783 224 107.366V148c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-40.634C346.174 119.768 392.217 165.757 404.634 224H364c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40.634C392.232 346.174 346.243 392.217 288 404.634zM288 256c0 17.673-14.327 32-32 32s-32-14.327-32-32c0-17.673 14.327-32 32-32s32 14.327 32 32z"]
};
var faCrow = {
prefix: 'fas',
iconName: 'crow',
icon: [640, 512, [], "f520", "M544 32h-16.36C513.04 12.68 490.09 0 464 0c-44.18 0-80 35.82-80 80v20.98L12.09 393.57A30.216 30.216 0 0 0 0 417.74c0 22.46 23.64 37.07 43.73 27.03L165.27 384h96.49l44.41 120.1c2.27 6.23 9.15 9.44 15.38 7.17l22.55-8.21c6.23-2.27 9.44-9.15 7.17-15.38L312.94 384H352c1.91 0 3.76-.23 5.66-.29l44.51 120.38c2.27 6.23 9.15 9.44 15.38 7.17l22.55-8.21c6.23-2.27 9.44-9.15 7.17-15.38l-41.24-111.53C485.74 352.8 544 279.26 544 192v-80l96-16c0-35.35-42.98-64-96-64zm-80 72c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24z"]
};
var faCrown = {
prefix: 'fas',
iconName: 'crown',
icon: [640, 512, [], "f521", "M528 448H112c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h416c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm64-320c-26.5 0-48 21.5-48 48 0 7.1 1.6 13.7 4.4 19.8L476 239.2c-15.4 9.2-35.3 4-44.2-11.6L350.3 85C361 76.2 368 63 368 48c0-26.5-21.5-48-48-48s-48 21.5-48 48c0 15 7 28.2 17.7 37l-81.5 142.6c-8.9 15.6-28.9 20.8-44.2 11.6l-72.3-43.4c2.7-6 4.4-12.7 4.4-19.8 0-26.5-21.5-48-48-48S0 149.5 0 176s21.5 48 48 48c2.6 0 5.2-.4 7.7-.8L128 416h384l72.3-192.8c2.5.4 5.1.8 7.7.8 26.5 0 48-21.5 48-48s-21.5-48-48-48z"]
};
var faCrutch = {
prefix: 'fas',
iconName: 'crutch',
icon: [512, 512, [], "f7f7", "M507.31 185.71l-181-181a16 16 0 0 0-22.62 0L281 27.31a16 16 0 0 0 0 22.63l181 181a16 16 0 0 0 22.63 0l22.62-22.63a16 16 0 0 0 .06-22.6zm-179.54 66.41l-67.89-67.89 55.1-55.1-45.25-45.25-109.67 109.67a96.08 96.08 0 0 0-25.67 46.29L106.65 360.1l-102 102a16 16 0 0 0 0 22.63l22.62 22.62a16 16 0 0 0 22.63 0l102-102 120.25-27.75a95.88 95.88 0 0 0 46.29-25.65l109.68-109.68L382.87 197zm-54.57 54.57a32 32 0 0 1-15.45 8.54l-79.3 18.32 18.3-79.3a32.22 32.22 0 0 1 8.56-15.45l9.31-9.31 67.89 67.89z"]
};
var faCube = {
prefix: 'fas',
iconName: 'cube',
icon: [512, 512, [], "f1b2", "M239.1 6.3l-208 78c-18.7 7-31.1 25-31.1 45v225.1c0 18.2 10.3 34.8 26.5 42.9l208 104c13.5 6.8 29.4 6.8 42.9 0l208-104c16.3-8.1 26.5-24.8 26.5-42.9V129.3c0-20-12.4-37.9-31.1-44.9l-208-78C262 2.2 250 2.2 239.1 6.3zM256 68.4l192 72v1.1l-192 78-192-78v-1.1l192-72zm32 356V275.5l160-65v133.9l-160 80z"]
};
var faCubes = {
prefix: 'fas',
iconName: 'cubes',
icon: [512, 512, [], "f1b3", "M488.6 250.2L392 214V105.5c0-15-9.3-28.4-23.4-33.7l-100-37.5c-8.1-3.1-17.1-3.1-25.3 0l-100 37.5c-14.1 5.3-23.4 18.7-23.4 33.7V214l-96.6 36.2C9.3 255.5 0 268.9 0 283.9V394c0 13.6 7.7 26.1 19.9 32.2l100 50c10.1 5.1 22.1 5.1 32.2 0l103.9-52 103.9 52c10.1 5.1 22.1 5.1 32.2 0l100-50c12.2-6.1 19.9-18.6 19.9-32.2V283.9c0-15-9.3-28.4-23.4-33.7zM358 214.8l-85 31.9v-68.2l85-37v73.3zM154 104.1l102-38.2 102 38.2v.6l-102 41.4-102-41.4v-.6zm84 291.1l-85 42.5v-79.1l85-38.8v75.4zm0-112l-102 41.4-102-41.4v-.6l102-38.2 102 38.2v.6zm240 112l-85 42.5v-79.1l85-38.8v75.4zm0-112l-102 41.4-102-41.4v-.6l102-38.2 102 38.2v.6z"]
};
var faCut = {
prefix: 'fas',
iconName: 'cut',
icon: [448, 512, [], "f0c4", "M278.06 256L444.48 89.57c4.69-4.69 4.69-12.29 0-16.97-32.8-32.8-85.99-32.8-118.79 0L210.18 188.12l-24.86-24.86c4.31-10.92 6.68-22.81 6.68-35.26 0-53.02-42.98-96-96-96S0 74.98 0 128s42.98 96 96 96c4.54 0 8.99-.32 13.36-.93L142.29 256l-32.93 32.93c-4.37-.61-8.83-.93-13.36-.93-53.02 0-96 42.98-96 96s42.98 96 96 96 96-42.98 96-96c0-12.45-2.37-24.34-6.68-35.26l24.86-24.86L325.69 439.4c32.8 32.8 85.99 32.8 118.79 0 4.69-4.68 4.69-12.28 0-16.97L278.06 256zM96 160c-17.64 0-32-14.36-32-32s14.36-32 32-32 32 14.36 32 32-14.36 32-32 32zm0 256c-17.64 0-32-14.36-32-32s14.36-32 32-32 32 14.36 32 32-14.36 32-32 32z"]
};
var faDatabase = {
prefix: 'fas',
iconName: 'database',
icon: [448, 512, [], "f1c0", "M448 73.143v45.714C448 159.143 347.667 192 224 192S0 159.143 0 118.857V73.143C0 32.857 100.333 0 224 0s224 32.857 224 73.143zM448 176v102.857C448 319.143 347.667 352 224 352S0 319.143 0 278.857V176c48.125 33.143 136.208 48.572 224 48.572S399.874 209.143 448 176zm0 160v102.857C448 479.143 347.667 512 224 512S0 479.143 0 438.857V336c48.125 33.143 136.208 48.572 224 48.572S399.874 369.143 448 336z"]
};
var faDeaf = {
prefix: 'fas',
iconName: 'deaf',
icon: [512, 512, [], "f2a4", "M216 260c0 15.464-12.536 28-28 28s-28-12.536-28-28c0-44.112 35.888-80 80-80s80 35.888 80 80c0 15.464-12.536 28-28 28s-28-12.536-28-28c0-13.234-10.767-24-24-24s-24 10.766-24 24zm24-176c-97.047 0-176 78.953-176 176 0 15.464 12.536 28 28 28s28-12.536 28-28c0-66.168 53.832-120 120-120s120 53.832 120 120c0 75.164-71.009 70.311-71.997 143.622L288 404c0 28.673-23.327 52-52 52-15.464 0-28 12.536-28 28s12.536 28 28 28c59.475 0 107.876-48.328 108-107.774.595-34.428 72-48.24 72-144.226 0-97.047-78.953-176-176-176zm268.485-52.201L480.2 3.515c-4.687-4.686-12.284-4.686-16.971 0L376.2 90.544c-4.686 4.686-4.686 12.284 0 16.971l28.285 28.285c4.686 4.686 12.284 4.686 16.97 0l87.03-87.029c4.687-4.688 4.687-12.286 0-16.972zM168.97 314.745c-4.686-4.686-12.284-4.686-16.97 0L3.515 463.23c-4.686 4.686-4.686 12.284 0 16.971L31.8 508.485c4.687 4.686 12.284 4.686 16.971 0L197.256 360c4.686-4.686 4.686-12.284 0-16.971l-28.286-28.284z"]
};
var faDemocrat = {
prefix: 'fas',
iconName: 'democrat',
icon: [640, 512, [], "f747", "M637.3 256.9l-19.6-29.4c-28.2-42.3-75.3-67.5-126.1-67.5H256l-81.2-81.2c20.1-20.1 22.6-51.1 7.5-73.9-3.4-5.2-10.8-5.9-15.2-1.5l-41.8 41.8L82.4 2.4c-3.6-3.6-9.6-3-12.4 1.2-12.3 18.6-10.3 44 6.1 60.4 3.3 3.3 7.3 5.3 11.3 7.5-2.2 1.7-4.7 3.1-6.4 5.4L6.4 176.2c-7.3 9.7-8.4 22.7-3 33.5l14.3 28.6c5.4 10.8 16.5 17.7 28.6 17.7h31c8.5 0 16.6-3.4 22.6-9.4L138 212l54 108h352v-77.8c16.2 12.2 18.3 17.6 40.1 50.3 4.9 7.4 14.8 9.3 22.2 4.4l26.6-17.7c7.3-5 9.3-14.9 4.4-22.3zm-341.1-13.6l-16.5 16.1 3.9 22.7c.7 4.1-3.6 7.2-7.2 5.3L256 276.7l-20.4 10.7c-3.6 1.9-7.9-1.2-7.2-5.3l3.9-22.7-16.5-16.1c-3-2.9-1.3-7.9 2.8-8.5l22.8-3.3 10.2-20.7c1.8-3.7 7.1-3.7 9 0l10.2 20.7 22.8 3.3c4 .6 5.6 5.6 2.6 8.5zm112 0l-16.5 16.1 3.9 22.7c.7 4.1-3.6 7.2-7.2 5.3L368 276.7l-20.4 10.7c-3.6 1.9-7.9-1.2-7.2-5.3l3.9-22.7-16.5-16.1c-3-2.9-1.3-7.9 2.8-8.5l22.8-3.3 10.2-20.7c1.8-3.7 7.1-3.7 9 0l10.2 20.7 22.8 3.3c4 .6 5.6 5.6 2.6 8.5zm112 0l-16.5 16.1 3.9 22.7c.7 4.1-3.6 7.2-7.2 5.3L480 276.7l-20.4 10.7c-3.6 1.9-7.9-1.2-7.2-5.3l3.9-22.7-16.5-16.1c-3-2.9-1.3-7.9 2.8-8.5l22.8-3.3 10.2-20.7c1.8-3.7 7.1-3.7 9 0l10.2 20.7 22.8 3.3c4 .6 5.6 5.6 2.6 8.5zM192 496c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16v-80h160v80c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16V352H192v144z"]
};
var faDesktop = {
prefix: 'fas',
iconName: 'desktop',
icon: [576, 512, [], "f108", "M528 0H48C21.5 0 0 21.5 0 48v320c0 26.5 21.5 48 48 48h192l-16 48h-72c-13.3 0-24 10.7-24 24s10.7 24 24 24h272c13.3 0 24-10.7 24-24s-10.7-24-24-24h-72l-16-48h192c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zm-16 352H64V64h448v288z"]
};
var faDharmachakra = {
prefix: 'fas',
iconName: 'dharmachakra',
icon: [512, 512, [], "f655", "M495 225.06l-17.22 1.08c-5.27-39.49-20.79-75.64-43.86-105.84l12.95-11.43c6.92-6.11 7.25-16.79.73-23.31L426.44 64.4c-6.53-6.53-17.21-6.19-23.31.73L391.7 78.07c-30.2-23.06-66.35-38.58-105.83-43.86L286.94 17c.58-9.21-6.74-17-15.97-17h-29.94c-9.23 0-16.54 7.79-15.97 17l1.08 17.22c-39.49 5.27-75.64 20.79-105.83 43.86l-11.43-12.95c-6.11-6.92-16.79-7.25-23.31-.73L64.4 85.56c-6.53 6.53-6.19 17.21.73 23.31l12.95 11.43c-23.06 30.2-38.58 66.35-43.86 105.84L17 225.06c-9.21-.58-17 6.74-17 15.97v29.94c0 9.23 7.79 16.54 17 15.97l17.22-1.08c5.27 39.49 20.79 75.64 43.86 105.83l-12.95 11.43c-6.92 6.11-7.25 16.79-.73 23.31l21.17 21.17c6.53 6.53 17.21 6.19 23.31-.73l11.43-12.95c30.2 23.06 66.35 38.58 105.84 43.86L225.06 495c-.58 9.21 6.74 17 15.97 17h29.94c9.23 0 16.54-7.79 15.97-17l-1.08-17.22c39.49-5.27 75.64-20.79 105.84-43.86l11.43 12.95c6.11 6.92 16.79 7.25 23.31.73l21.17-21.17c6.53-6.53 6.19-17.21-.73-23.31l-12.95-11.43c23.06-30.2 38.58-66.35 43.86-105.83l17.22 1.08c9.21.58 17-6.74 17-15.97v-29.94c-.01-9.23-7.8-16.54-17.01-15.97zM281.84 98.61c24.81 4.07 47.63 13.66 67.23 27.78l-42.62 48.29c-8.73-5.44-18.32-9.54-28.62-11.95l4.01-64.12zm-51.68 0l4.01 64.12c-10.29 2.41-19.89 6.52-28.62 11.95l-42.62-48.29c19.6-14.12 42.42-23.71 67.23-27.78zm-103.77 64.33l48.3 42.61c-5.44 8.73-9.54 18.33-11.96 28.62l-64.12-4.01c4.07-24.81 13.66-47.62 27.78-67.22zm-27.78 118.9l64.12-4.01c2.41 10.29 6.52 19.89 11.95 28.62l-48.29 42.62c-14.12-19.6-23.71-42.42-27.78-67.23zm131.55 131.55c-24.81-4.07-47.63-13.66-67.23-27.78l42.61-48.3c8.73 5.44 18.33 9.54 28.62 11.96l-4 64.12zM256 288c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm25.84 125.39l-4.01-64.12c10.29-2.41 19.89-6.52 28.62-11.96l42.61 48.3c-19.6 14.12-42.41 23.71-67.22 27.78zm103.77-64.33l-48.29-42.62c5.44-8.73 9.54-18.32 11.95-28.62l64.12 4.01c-4.07 24.82-13.66 47.64-27.78 67.23zm-36.34-114.89c-2.41-10.29-6.52-19.89-11.96-28.62l48.3-42.61c14.12 19.6 23.71 42.42 27.78 67.23l-64.12 4z"]
};
var faDiagnoses = {
prefix: 'fas',
iconName: 'diagnoses',
icon: [640, 512, [], "f470", "M496 256c8.8 0 16-7.2 16-16s-7.2-16-16-16-16 7.2-16 16 7.2 16 16 16zm-176-80c48.5 0 88-39.5 88-88S368.5 0 320 0s-88 39.5-88 88 39.5 88 88 88zM59.8 364c10.2 15.3 29.3 17.8 42.9 9.8 16.2-9.6 56.2-31.7 105.3-48.6V416h224v-90.7c49.1 16.8 89.1 39 105.3 48.6 13.6 8 32.7 5.3 42.9-9.8l17.8-26.7c8.8-13.2 7.6-34.6-10-45.1-11.9-7.1-29.7-17-51.1-27.4-28.1 46.1-99.4 17.8-87.7-35.1C409.3 217.2 365.1 208 320 208c-57 0-112.9 14.5-160 32.2-.2 40.2-47.6 63.3-79.2 36-11.2 6-21.3 11.6-28.7 16-17.6 10.5-18.8 31.8-10 45.1L59.8 364zM368 344c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm-96-96c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm-160 8c8.8 0 16-7.2 16-16s-7.2-16-16-16-16 7.2-16 16 7.2 16 16 16zm512 192H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h608c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16z"]
};
var faDice = {
prefix: 'fas',
iconName: 'dice',
icon: [640, 512, [], "f522", "M592 192H473.26c12.69 29.59 7.12 65.2-17 89.32L320 417.58V464c0 26.51 21.49 48 48 48h224c26.51 0 48-21.49 48-48V240c0-26.51-21.49-48-48-48zM480 376c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm-46.37-186.7L258.7 14.37c-19.16-19.16-50.23-19.16-69.39 0L14.37 189.3c-19.16 19.16-19.16 50.23 0 69.39L189.3 433.63c19.16 19.16 50.23 19.16 69.39 0L433.63 258.7c19.16-19.17 19.16-50.24 0-69.4zM96 248c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm128 128c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm0-128c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm0-128c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm128 128c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24z"]
};
var faDiceD20 = {
prefix: 'fas',
iconName: 'dice-d20',
icon: [480, 512, [], "f6cf", "M106.75 215.06L1.2 370.95c-3.08 5 .1 11.5 5.93 12.14l208.26 22.07-108.64-190.1zM7.41 315.43L82.7 193.08 6.06 147.1c-2.67-1.6-6.06.32-6.06 3.43v162.81c0 4.03 5.29 5.53 7.41 2.09zM18.25 423.6l194.4 87.66c5.3 2.45 11.35-1.43 11.35-7.26v-65.67l-203.55-22.3c-4.45-.5-6.23 5.59-2.2 7.57zm81.22-257.78L179.4 22.88c4.34-7.06-3.59-15.25-10.78-11.14L17.81 110.35c-2.47 1.62-2.39 5.26.13 6.78l81.53 48.69zM240 176h109.21L253.63 7.62C250.5 2.54 245.25 0 240 0s-10.5 2.54-13.63 7.62L130.79 176H240zm233.94-28.9l-76.64 45.99 75.29 122.35c2.11 3.44 7.41 1.94 7.41-2.1V150.53c0-3.11-3.39-5.03-6.06-3.43zm-93.41 18.72l81.53-48.7c2.53-1.52 2.6-5.16.13-6.78l-150.81-98.6c-7.19-4.11-15.12 4.08-10.78 11.14l79.93 142.94zm79.02 250.21L256 438.32v65.67c0 5.84 6.05 9.71 11.35 7.26l194.4-87.66c4.03-1.97 2.25-8.06-2.2-7.56zm-86.3-200.97l-108.63 190.1 208.26-22.07c5.83-.65 9.01-7.14 5.93-12.14L373.25 215.06zM240 208H139.57L240 383.75 340.43 208H240z"]
};
var faDiceD6 = {
prefix: 'fas',
iconName: 'dice-d6',
icon: [448, 512, [], "f6d1", "M422.19 109.95L256.21 9.07c-19.91-12.1-44.52-12.1-64.43 0L25.81 109.95c-5.32 3.23-5.29 11.27.06 14.46L224 242.55l198.14-118.14c5.35-3.19 5.38-11.22.05-14.46zm13.84 44.63L240 271.46v223.82c0 12.88 13.39 20.91 24.05 14.43l152.16-92.48c19.68-11.96 31.79-33.94 31.79-57.7v-197.7c0-6.41-6.64-10.43-11.97-7.25zM0 161.83v197.7c0 23.77 12.11 45.74 31.79 57.7l152.16 92.47c10.67 6.48 24.05-1.54 24.05-14.43V271.46L11.97 154.58C6.64 151.4 0 155.42 0 161.83z"]
};
var faDiceFive = {
prefix: 'fas',
iconName: 'dice-five',
icon: [448, 512, [], "f523", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM128 384c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm96 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm96 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDiceFour = {
prefix: 'fas',
iconName: 'dice-four',
icon: [448, 512, [], "f524", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM128 384c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm192 192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDiceOne = {
prefix: 'fas',
iconName: 'dice-one',
icon: [448, 512, [], "f525", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM224 288c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDiceSix = {
prefix: 'fas',
iconName: 'dice-six',
icon: [448, 512, [], "f526", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM128 384c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm192 192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDiceThree = {
prefix: 'fas',
iconName: 'dice-three',
icon: [448, 512, [], "f527", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM128 192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm96 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm96 96c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDiceTwo = {
prefix: 'fas',
iconName: 'dice-two',
icon: [448, 512, [], "f528", "M384 32H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h320c35.35 0 64-28.65 64-64V96c0-35.35-28.65-64-64-64zM128 192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm192 192c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faDigitalTachograph = {
prefix: 'fas',
iconName: 'digital-tachograph',
icon: [640, 512, [], "f566", "M608 96H32c-17.67 0-32 14.33-32 32v256c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V128c0-17.67-14.33-32-32-32zM304 352c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-8c0-4.42 3.58-8 8-8h224c4.42 0 8 3.58 8 8v8zM72 288v-16c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H80c-4.42 0-8-3.58-8-8zm64 0v-16c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8zm64 0v-16c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8zm64 0v-16c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8zm40-64c0 8.84-7.16 16-16 16H80c-8.84 0-16-7.16-16-16v-48c0-8.84 7.16-16 16-16h208c8.84 0 16 7.16 16 16v48zm272 128c0 4.42-3.58 8-8 8H344c-4.42 0-8-3.58-8-8v-8c0-4.42 3.58-8 8-8h224c4.42 0 8 3.58 8 8v8z"]
};
var faDirections = {
prefix: 'fas',
iconName: 'directions',
icon: [512, 512, [], "f5eb", "M502.61 233.32L278.68 9.39c-12.52-12.52-32.83-12.52-45.36 0L9.39 233.32c-12.52 12.53-12.52 32.83 0 45.36l223.93 223.93c12.52 12.53 32.83 12.53 45.36 0l223.93-223.93c12.52-12.53 12.52-32.83 0-45.36zm-100.98 12.56l-84.21 77.73c-5.12 4.73-13.43 1.1-13.43-5.88V264h-96v64c0 4.42-3.58 8-8 8h-32c-4.42 0-8-3.58-8-8v-80c0-17.67 14.33-32 32-32h112v-53.73c0-6.97 8.3-10.61 13.43-5.88l84.21 77.73c3.43 3.17 3.43 8.59 0 11.76z"]
};
var faDisease = {
prefix: 'fas',
iconName: 'disease',
icon: [512, 512, [], "f7fa", "M472.29 195.9l-67.06-23c-19.28-6.6-33.54-20.92-38.14-38.31l-16-60.45c-11.58-43.77-76.57-57.13-110-22.62L195 99.24c-13.26 13.71-33.54 20.93-54.2 19.31l-71.9-5.62c-52-4.07-86.93 44.89-59 82.84l38.54 52.42c11.08 15.07 12.82 33.86 4.64 50.24l-28.43 57C4 396.67 47.46 440.29 98.11 429.23l70-15.28c20.11-4.39 41.45 0 57.07 11.73l54.32 40.83c39.32 29.56 101 7.57 104.45-37.22l4.7-61.86c1.35-17.8 12.8-33.87 30.63-43l62-31.74c44.84-22.96 39.55-80.17-8.99-96.79zM160 256a32 32 0 1 1 32-32 32 32 0 0 1-32 32zm128 96a32 32 0 1 1 32-32 32 32 0 0 1-32 32zm16-128a16 16 0 1 1 16-16 16 16 0 0 1-16 16z"]
};
var faDivide = {
prefix: 'fas',
iconName: 'divide',
icon: [448, 512, [], "f529", "M224 352c-35.35 0-64 28.65-64 64s28.65 64 64 64 64-28.65 64-64-28.65-64-64-64zm0-192c35.35 0 64-28.65 64-64s-28.65-64-64-64-64 28.65-64 64 28.65 64 64 64zm192 48H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h384c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32z"]
};
var faDizzy = {
prefix: 'fas',
iconName: 'dizzy',
icon: [496, 512, [], "f567", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm-96 206.6l-28.7 28.7c-14.8 14.8-37.8-7.5-22.6-22.6l28.7-28.7-28.7-28.7c-15-15 7.7-37.6 22.6-22.6l28.7 28.7 28.7-28.7c15-15 37.6 7.7 22.6 22.6L174.6 192l28.7 28.7c15.2 15.2-7.9 37.4-22.6 22.6L152 214.6zM248 416c-35.3 0-64-28.7-64-64s28.7-64 64-64 64 28.7 64 64-28.7 64-64 64zm147.3-195.3c15.2 15.2-7.9 37.4-22.6 22.6L344 214.6l-28.7 28.7c-14.8 14.8-37.8-7.5-22.6-22.6l28.7-28.7-28.7-28.7c-15-15 7.7-37.6 22.6-22.6l28.7 28.7 28.7-28.7c15-15 37.6 7.7 22.6 22.6L366.6 192l28.7 28.7z"]
};
var faDna = {
prefix: 'fas',
iconName: 'dna',
icon: [448, 512, [], "f471", "M.1 494.1c-1.1 9.5 6.3 17.8 15.9 17.8l32.3.1c8.1 0 14.9-5.9 16-13.9.7-4.9 1.8-11.1 3.4-18.1H380c1.6 6.9 2.9 13.2 3.5 18.1 1.1 8 7.9 14 16 13.9l32.3-.1c9.6 0 17.1-8.3 15.9-17.8-4.6-37.9-25.6-129-118.9-207.7-17.6 12.4-37.1 24.2-58.5 35.4 6.2 4.6 11.4 9.4 17 14.2H159.7c21.3-18.1 47-35.6 78.7-51.4C410.5 199.1 442.1 65.8 447.9 17.9 449 8.4 441.6.1 432 .1L399.6 0c-8.1 0-14.9 5.9-16 13.9-.7 4.9-1.8 11.1-3.4 18.1H67.8c-1.6-7-2.7-13.1-3.4-18.1-1.1-8-7.9-14-16-13.9L16.1.1C6.5.1-1 8.4.1 17.9 5.3 60.8 31.4 171.8 160 256 31.5 340.2 5.3 451.2.1 494.1zM224 219.6c-25.1-13.7-46.4-28.4-64.3-43.6h128.5c-17.8 15.2-39.1 30-64.2 43.6zM355.1 96c-5.8 10.4-12.8 21.1-21 32H114c-8.3-10.9-15.3-21.6-21-32h262.1zM92.9 416c5.8-10.4 12.8-21.1 21-32h219.4c8.3 10.9 15.4 21.6 21.2 32H92.9z"]
};
var faDog = {
prefix: 'fas',
iconName: 'dog',
icon: [576, 512, [], "f6d3", "M298.06,224,448,277.55V496a16,16,0,0,1-16,16H368a16,16,0,0,1-16-16V384H192V496a16,16,0,0,1-16,16H112a16,16,0,0,1-16-16V282.09C58.84,268.84,32,233.66,32,192a32,32,0,0,1,64,0,32.06,32.06,0,0,0,32,32ZM544,112v32a64,64,0,0,1-64,64H448v35.58L320,197.87V48c0-14.25,17.22-21.39,27.31-11.31L374.59,64h53.63c10.91,0,23.75,7.92,28.62,17.69L464,96h64A16,16,0,0,1,544,112Zm-112,0a16,16,0,1,0-16,16A16,16,0,0,0,432,112Z"]
};
var faDollarSign = {
prefix: 'fas',
iconName: 'dollar-sign',
icon: [288, 512, [], "f155", "M209.2 233.4l-108-31.6C88.7 198.2 80 186.5 80 173.5c0-16.3 13.2-29.5 29.5-29.5h66.3c12.2 0 24.2 3.7 34.2 10.5 6.1 4.1 14.3 3.1 19.5-2l34.8-34c7.1-6.9 6.1-18.4-1.8-24.5C238 74.8 207.4 64.1 176 64V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v48h-2.5C45.8 64-5.4 118.7.5 183.6c4.2 46.1 39.4 83.6 83.8 96.6l102.5 30c12.5 3.7 21.2 15.3 21.2 28.3 0 16.3-13.2 29.5-29.5 29.5h-66.3C100 368 88 364.3 78 357.5c-6.1-4.1-14.3-3.1-19.5 2l-34.8 34c-7.1 6.9-6.1 18.4 1.8 24.5 24.5 19.2 55.1 29.9 86.5 30v48c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-48.2c46.6-.9 90.3-28.6 105.7-72.7 21.5-61.6-14.6-124.8-72.5-141.7z"]
};
var faDolly = {
prefix: 'fas',
iconName: 'dolly',
icon: [576, 512, [], "f472", "M294.2 277.7c18 5 34.7 13.4 49.5 24.7l161.5-53.8c8.4-2.8 12.9-11.9 10.1-20.2L454.9 47.2c-2.8-8.4-11.9-12.9-20.2-10.1l-61.1 20.4 33.1 99.4L346 177l-33.1-99.4-61.6 20.5c-8.4 2.8-12.9 11.9-10.1 20.2l53 159.4zm281 48.7L565 296c-2.8-8.4-11.9-12.9-20.2-10.1l-213.5 71.2c-17.2-22-43.6-36.4-73.5-37L158.4 21.9C154 8.8 141.8 0 128 0H16C7.2 0 0 7.2 0 16v32c0 8.8 7.2 16 16 16h88.9l92.2 276.7c-26.1 20.4-41.7 53.6-36 90.5 6.1 39.4 37.9 72.3 77.3 79.2 60.2 10.7 112.3-34.8 113.4-92.6l213.3-71.2c8.3-2.8 12.9-11.8 10.1-20.2zM256 464c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48z"]
};
var faDollyFlatbed = {
prefix: 'fas',
iconName: 'dolly-flatbed',
icon: [640, 512, [], "f474", "M208 320h384c8.8 0 16-7.2 16-16V48c0-8.8-7.2-16-16-16H448v128l-48-32-48 32V32H208c-8.8 0-16 7.2-16 16v256c0 8.8 7.2 16 16 16zm416 64H128V16c0-8.8-7.2-16-16-16H16C7.2 0 0 7.2 0 16v32c0 8.8 7.2 16 16 16h48v368c0 8.8 7.2 16 16 16h82.9c-1.8 5-2.9 10.4-2.9 16 0 26.5 21.5 48 48 48s48-21.5 48-48c0-5.6-1.2-11-2.9-16H451c-1.8 5-2.9 10.4-2.9 16 0 26.5 21.5 48 48 48s48-21.5 48-48c0-5.6-1.2-11-2.9-16H624c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16z"]
};
var faDonate = {
prefix: 'fas',
iconName: 'donate',
icon: [512, 512, [], "f4b9", "M256 416c114.9 0 208-93.1 208-208S370.9 0 256 0 48 93.1 48 208s93.1 208 208 208zM233.8 97.4V80.6c0-9.2 7.4-16.6 16.6-16.6h11.1c9.2 0 16.6 7.4 16.6 16.6v17c15.5.8 30.5 6.1 43 15.4 5.6 4.1 6.2 12.3 1.2 17.1L306 145.6c-3.8 3.7-9.5 3.8-14 1-5.4-3.4-11.4-5.1-17.8-5.1h-38.9c-9 0-16.3 8.2-16.3 18.3 0 8.2 5 15.5 12.1 17.6l62.3 18.7c25.7 7.7 43.7 32.4 43.7 60.1 0 34-26.4 61.5-59.1 62.4v16.8c0 9.2-7.4 16.6-16.6 16.6h-11.1c-9.2 0-16.6-7.4-16.6-16.6v-17c-15.5-.8-30.5-6.1-43-15.4-5.6-4.1-6.2-12.3-1.2-17.1l16.3-15.5c3.8-3.7 9.5-3.8 14-1 5.4 3.4 11.4 5.1 17.8 5.1h38.9c9 0 16.3-8.2 16.3-18.3 0-8.2-5-15.5-12.1-17.6l-62.3-18.7c-25.7-7.7-43.7-32.4-43.7-60.1.1-34 26.4-61.5 59.1-62.4zM480 352h-32.5c-19.6 26-44.6 47.7-73 64h63.8c5.3 0 9.6 3.6 9.6 8v16c0 4.4-4.3 8-9.6 8H73.6c-5.3 0-9.6-3.6-9.6-8v-16c0-4.4 4.3-8 9.6-8h63.8c-28.4-16.3-53.3-38-73-64H32c-17.7 0-32 14.3-32 32v96c0 17.7 14.3 32 32 32h448c17.7 0 32-14.3 32-32v-96c0-17.7-14.3-32-32-32z"]
};
var faDoorClosed = {
prefix: 'fas',
iconName: 'door-closed',
icon: [640, 512, [], "f52a", "M624 448H512V50.8C512 22.78 490.47 0 464 0H175.99c-26.47 0-48 22.78-48 50.8V448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h608c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM415.99 288c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32c.01 17.67-14.32 32-32 32z"]
};
var faDoorOpen = {
prefix: 'fas',
iconName: 'door-open',
icon: [640, 512, [], "f52b", "M624 448h-80V113.45C544 86.19 522.47 64 496 64H384v64h96v384h144c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM312.24 1.01l-192 49.74C105.99 54.44 96 67.7 96 82.92V448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h336V33.18c0-21.58-19.56-37.41-39.76-32.17zM264 288c-13.25 0-24-14.33-24-32s10.75-32 24-32 24 14.33 24 32-10.75 32-24 32z"]
};
var faDotCircle = {
prefix: 'fas',
iconName: 'dot-circle',
icon: [512, 512, [], "f192", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm80 248c0 44.112-35.888 80-80 80s-80-35.888-80-80 35.888-80 80-80 80 35.888 80 80z"]
};
var faDove = {
prefix: 'fas',
iconName: 'dove',
icon: [512, 512, [], "f4ba", "M288 167.2v-28.1c-28.2-36.3-47.1-79.3-54.1-125.2-2.1-13.5-19-18.8-27.8-8.3-21.1 24.9-37.7 54.1-48.9 86.5 34.2 38.3 80 64.6 130.8 75.1zM400 64c-44.2 0-80 35.9-80 80.1v59.4C215.6 197.3 127 133 87 41.8c-5.5-12.5-23.2-13.2-29-.9C41.4 76 32 115.2 32 156.6c0 70.8 34.1 136.9 85.1 185.9 13.2 12.7 26.1 23.2 38.9 32.8l-143.9 36C1.4 414-3.4 426.4 2.6 435.7 20 462.6 63 508.2 155.8 512c8 .3 16-2.6 22.1-7.9l65.2-56.1H320c88.4 0 160-71.5 160-159.9V128l32-64H400zm0 96.1c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16z"]
};
var faDownload = {
prefix: 'fas',
iconName: 'download',
icon: [512, 512, [], "f019", "M216 0h80c13.3 0 24 10.7 24 24v168h87.7c17.8 0 26.7 21.5 14.1 34.1L269.7 378.3c-7.5 7.5-19.8 7.5-27.3 0L90.1 226.1c-12.6-12.6-3.7-34.1 14.1-34.1H192V24c0-13.3 10.7-24 24-24zm296 376v112c0 13.3-10.7 24-24 24H24c-13.3 0-24-10.7-24-24V376c0-13.3 10.7-24 24-24h146.7l49 49c20.1 20.1 52.5 20.1 72.6 0l49-49H488c13.3 0 24 10.7 24 24zm-124 88c0-11-9-20-20-20s-20 9-20 20 9 20 20 20 20-9 20-20zm64 0c0-11-9-20-20-20s-20 9-20 20 9 20 20 20 20-9 20-20z"]
};
var faDraftingCompass = {
prefix: 'fas',
iconName: 'drafting-compass',
icon: [512, 512, [], "f568", "M457.01 344.42c-25.05 20.33-52.63 37.18-82.54 49.05l54.38 94.19 53.95 23.04c9.81 4.19 20.89-2.21 22.17-12.8l7.02-58.25-54.98-95.23zm42.49-94.56c4.86-7.67 1.89-17.99-6.05-22.39l-28.07-15.57c-7.48-4.15-16.61-1.46-21.26 5.72C403.01 281.15 332.25 320 256 320c-23.93 0-47.23-4.25-69.41-11.53l67.36-116.68c.7.02 1.34.21 2.04.21s1.35-.19 2.04-.21l51.09 88.5c31.23-8.96 59.56-25.75 82.61-48.92l-51.79-89.71C347.39 128.03 352 112.63 352 96c0-53.02-42.98-96-96-96s-96 42.98-96 96c0 16.63 4.61 32.03 12.05 45.66l-68.3 118.31c-12.55-11.61-23.96-24.59-33.68-39-4.79-7.1-13.97-9.62-21.38-5.33l-27.75 16.07c-7.85 4.54-10.63 14.9-5.64 22.47 15.57 23.64 34.69 44.21 55.98 62.02L0 439.66l7.02 58.25c1.28 10.59 12.36 16.99 22.17 12.8l53.95-23.04 70.8-122.63C186.13 377.28 220.62 384 256 384c99.05 0 190.88-51.01 243.5-134.14zM256 64c17.67 0 32 14.33 32 32s-14.33 32-32 32-32-14.33-32-32 14.33-32 32-32z"]
};
var faDragon = {
prefix: 'fas',
iconName: 'dragon',
icon: [640, 512, [], "f6d5", "M18.32 255.78L192 223.96l-91.28 68.69c-10.08 10.08-2.94 27.31 11.31 27.31h222.7c-9.44-26.4-14.73-54.47-14.73-83.38v-42.27l-119.73-87.6c-23.82-15.88-55.29-14.01-77.06 4.59L5.81 227.64c-12.38 10.33-3.45 30.42 12.51 28.14zm556.87 34.1l-100.66-50.31A47.992 47.992 0 0 1 448 196.65v-36.69h64l28.09 22.63c6 6 14.14 9.37 22.63 9.37h30.97a32 32 0 0 0 28.62-17.69l14.31-28.62a32.005 32.005 0 0 0-3.02-33.51l-74.53-99.38C553.02 4.7 543.54 0 533.47 0H296.02c-7.13 0-10.7 8.57-5.66 13.61L352 63.96 292.42 88.8c-5.9 2.95-5.9 11.36 0 14.31L352 127.96v108.62c0 72.08 36.03 139.39 96 179.38-195.59 6.81-344.56 41.01-434.1 60.91C5.78 478.67 0 485.88 0 494.2 0 504 7.95 512 17.76 512h499.08c63.29.01 119.61-47.56 122.99-110.76 2.52-47.28-22.73-90.4-64.64-111.36zM489.18 66.25l45.65 11.41c-2.75 10.91-12.47 18.89-24.13 18.26-12.96-.71-25.85-12.53-21.52-29.67z"]
};
var faDrawPolygon = {
prefix: 'fas',
iconName: 'draw-polygon',
icon: [448, 512, [], "f5ee", "M384 352c-.35 0-.67.1-1.02.1l-39.2-65.32c5.07-9.17 8.22-19.56 8.22-30.78s-3.14-21.61-8.22-30.78l39.2-65.32c.35.01.67.1 1.02.1 35.35 0 64-28.65 64-64s-28.65-64-64-64c-23.63 0-44.04 12.95-55.12 32H119.12C108.04 44.95 87.63 32 64 32 28.65 32 0 60.65 0 96c0 23.63 12.95 44.04 32 55.12v209.75C12.95 371.96 0 392.37 0 416c0 35.35 28.65 64 64 64 23.63 0 44.04-12.95 55.12-32h209.75c11.09 19.05 31.49 32 55.12 32 35.35 0 64-28.65 64-64 .01-35.35-28.64-64-63.99-64zm-288 8.88V151.12A63.825 63.825 0 0 0 119.12 128h208.36l-38.46 64.1c-.35-.01-.67-.1-1.02-.1-35.35 0-64 28.65-64 64s28.65 64 64 64c.35 0 .67-.1 1.02-.1l38.46 64.1H119.12A63.748 63.748 0 0 0 96 360.88zM272 256c0-8.82 7.18-16 16-16s16 7.18 16 16-7.18 16-16 16-16-7.18-16-16zM400 96c0 8.82-7.18 16-16 16s-16-7.18-16-16 7.18-16 16-16 16 7.18 16 16zM64 80c8.82 0 16 7.18 16 16s-7.18 16-16 16-16-7.18-16-16 7.18-16 16-16zM48 416c0-8.82 7.18-16 16-16s16 7.18 16 16-7.18 16-16 16-16-7.18-16-16zm336 16c-8.82 0-16-7.18-16-16s7.18-16 16-16 16 7.18 16 16-7.18 16-16 16z"]
};
var faDrum = {
prefix: 'fas',
iconName: 'drum',
icon: [512, 512, [], "f569", "M431.34 122.05l73.53-47.42a16 16 0 0 0 4.44-22.19l-8.87-13.31a16 16 0 0 0-22.19-4.44l-110.06 71C318.43 96.91 271.22 96 256 96 219.55 96 0 100.55 0 208.15v160.23c0 30.27 27.5 57.68 72 77.86v-101.9a24 24 0 1 1 48 0v118.93c33.05 9.11 71.07 15.06 112 16.73V376.39a24 24 0 1 1 48 0V480c40.93-1.67 78.95-7.62 112-16.73V344.34a24 24 0 1 1 48 0v101.9c44.5-20.18 72-47.59 72-77.86V208.15c0-43.32-35.76-69.76-80.66-86.1zM256 272.24c-114.88 0-208-28.69-208-64.09s93.12-64.08 208-64.08c17.15 0 33.73.71 49.68 1.91l-72.81 47a16 16 0 0 0-4.43 22.19l8.87 13.31a16 16 0 0 0 22.19 4.44l118.64-76.52C430.09 168 464 186.84 464 208.15c0 35.4-93.13 64.09-208 64.09z"]
};
var faDrumSteelpan = {
prefix: 'fas',
iconName: 'drum-steelpan',
icon: [576, 512, [], "f56a", "M288 32C128.94 32 0 89.31 0 160v192c0 70.69 128.94 128 288 128s288-57.31 288-128V160c0-70.69-128.94-128-288-128zm-82.99 158.36c-4.45 16.61-14.54 30.57-28.31 40.48C100.23 217.46 48 190.78 48 160c0-30.16 50.11-56.39 124.04-70.03l25.6 44.34c9.86 17.09 12.48 36.99 7.37 56.05zM288 240c-21.08 0-41.41-1-60.89-2.7 8.06-26.13 32.15-45.3 60.89-45.3s52.83 19.17 60.89 45.3C329.41 239 309.08 240 288 240zm64-144c0 35.29-28.71 64-64 64s-64-28.71-64-64V82.96c20.4-1.88 41.8-2.96 64-2.96s43.6 1.08 64 2.96V96zm46.93 134.9c-13.81-9.91-23.94-23.9-28.4-40.54-5.11-19.06-2.49-38.96 7.38-56.04l25.65-44.42C477.72 103.5 528 129.79 528 160c0 30.83-52.4 57.54-129.07 70.9z"]
};
var faDrumstickBite = {
prefix: 'fas',
iconName: 'drumstick-bite',
icon: [512, 512, [], "f6d7", "M462.8 49.57a169.44 169.44 0 0 0-239.5 0C187.82 85 160.13 128 160.13 192v85.83l-40.62 40.59c-9.7 9.69-24 11.07-36.78 6a60.33 60.33 0 0 0-65 98.72C33 438.39 54.24 442.7 73.85 438.21c-4.5 19.6-.18 40.83 15.1 56.1a60.35 60.35 0 0 0 98.8-65c-5.09-12.73-3.72-27 6-36.75L234.36 352h85.89a187.87 187.87 0 0 0 61.89-10c-39.64-43.89-39.83-110.23 1.05-151.07 34.38-34.36 86.76-39.46 128.74-16.8 1.3-44.96-14.81-90.28-49.13-124.56z"]
};
var faDumbbell = {
prefix: 'fas',
iconName: 'dumbbell',
icon: [640, 512, [], "f44b", "M104 96H56c-13.3 0-24 10.7-24 24v104H8c-4.4 0-8 3.6-8 8v48c0 4.4 3.6 8 8 8h24v104c0 13.3 10.7 24 24 24h48c13.3 0 24-10.7 24-24V120c0-13.3-10.7-24-24-24zm528 128h-24V120c0-13.3-10.7-24-24-24h-48c-13.3 0-24 10.7-24 24v272c0 13.3 10.7 24 24 24h48c13.3 0 24-10.7 24-24V288h24c4.4 0 8-3.6 8-8v-48c0-4.4-3.6-8-8-8zM456 32h-48c-13.3 0-24 10.7-24 24v168H256V56c0-13.3-10.7-24-24-24h-48c-13.3 0-24 10.7-24 24v400c0 13.3 10.7 24 24 24h48c13.3 0 24-10.7 24-24V288h128v168c0 13.3 10.7 24 24 24h48c13.3 0 24-10.7 24-24V56c0-13.3-10.7-24-24-24z"]
};
var faDumpster = {
prefix: 'fas',
iconName: 'dumpster',
icon: [576, 512, [], "f793", "M560 160c10.4 0 18-9.8 15.5-19.9l-24-96C549.7 37 543.3 32 536 32h-98.9l25.6 128H560zM272 32H171.5l-25.6 128H272V32zm132.5 0H304v128h126.1L404.5 32zM16 160h97.3l25.6-128H40c-7.3 0-13.7 5-15.5 12.1l-24 96C-2 150.2 5.6 160 16 160zm544 64h-20l4-32H32l4 32H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h28l20 160v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16h320v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16l20-160h28c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16z"]
};
var faDumpsterFire = {
prefix: 'fas',
iconName: 'dumpster-fire',
icon: [640, 512, [], "f794", "M418.7 104.1l.2-.2-14.4-72H304v128h60.8c16.2-19.3 34.2-38.2 53.9-55.8zM272 32H171.5l-25.6 128H272V32zm189.3 72.1c18.2 16.3 35.5 33.7 51.1 51.5 5.7-5.6 11.4-11.1 17.3-16.3l21.3-19 21.3 19c1.1.9 2.1 2.1 3.1 3.1-.1-.8.2-1.5 0-2.3l-24-96C549.7 37 543.3 32 536 32h-98.9l12.3 61.5 11.9 10.6zM16 160h97.3l25.6-128H40c-7.3 0-13.7 5-15.5 12.1l-24 96C-2 150.2 5.6 160 16 160zm324.6 32H32l4 32H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h28l20 160v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16h208.8c-30.2-33.7-48.8-77.9-48.8-126.4 0-35.9 19.9-82.9 52.6-129.6zm210.5-28.8c-14.9 13.3-28.3 27.2-40.2 41.2-19.5-25.8-43.6-52-71-76.4-70.2 62.7-120 144.3-120 193.6 0 87.5 71.6 158.4 160 158.4s160-70.9 160-158.4c.1-36.6-37-112.2-88.8-158.4zm-18.6 229.4c-14.7 10.7-32.9 17-52.5 17-49 0-88.9-33.5-88.9-88 0-27.1 16.5-51 49.4-91.9 4.7 5.6 67.1 88.1 67.1 88.1l39.8-47c2.8 4.8 5.4 9.5 7.7 14 18.6 36.7 10.8 83.6-22.6 107.8z"]
};
var faDungeon = {
prefix: 'fas',
iconName: 'dungeon',
icon: [512, 512, [], "f6d9", "M128.73 195.32l-82.81-51.76c-8.04-5.02-18.99-2.17-22.93 6.45A254.19 254.19 0 0 0 .54 239.28C-.05 248.37 7.59 256 16.69 256h97.13c7.96 0 14.08-6.25 15.01-14.16 1.09-9.33 3.24-18.33 6.24-26.94 2.56-7.34.25-15.46-6.34-19.58zM319.03 8C298.86 2.82 277.77 0 256 0s-42.86 2.82-63.03 8c-9.17 2.35-13.91 12.6-10.39 21.39l37.47 104.03A16.003 16.003 0 0 0 235.1 144h41.8c6.75 0 12.77-4.23 15.05-10.58l37.47-104.03c3.52-8.79-1.22-19.03-10.39-21.39zM112 288H16c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h96c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16zm0 128H16c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h96c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16zm77.31-283.67l-36.32-90.8c-3.53-8.83-14.13-12.99-22.42-8.31a257.308 257.308 0 0 0-71.61 59.89c-6.06 7.32-3.85 18.48 4.22 23.52l82.93 51.83c6.51 4.07 14.66 2.62 20.11-2.79 5.18-5.15 10.79-9.85 16.79-14.05 6.28-4.41 9.15-12.17 6.3-19.29zM398.18 256h97.13c9.1 0 16.74-7.63 16.15-16.72a254.135 254.135 0 0 0-22.45-89.27c-3.94-8.62-14.89-11.47-22.93-6.45l-82.81 51.76c-6.59 4.12-8.9 12.24-6.34 19.58 3.01 8.61 5.15 17.62 6.24 26.94.93 7.91 7.05 14.16 15.01 14.16zm54.85-162.89a257.308 257.308 0 0 0-71.61-59.89c-8.28-4.68-18.88-.52-22.42 8.31l-36.32 90.8c-2.85 7.12.02 14.88 6.3 19.28 6 4.2 11.61 8.9 16.79 14.05 5.44 5.41 13.6 6.86 20.11 2.79l82.93-51.83c8.07-5.03 10.29-16.19 4.22-23.51zM496 288h-96c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h96c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16zm0 128h-96c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h96c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16zM240 177.62V472c0 4.42 3.58 8 8 8h16c4.42 0 8-3.58 8-8V177.62c-5.23-.89-10.52-1.62-16-1.62s-10.77.73-16 1.62zm-64 41.51V472c0 4.42 3.58 8 8 8h16c4.42 0 8-3.58 8-8V189.36c-12.78 7.45-23.84 17.47-32 29.77zm128-29.77V472c0 4.42 3.58 8 8 8h16c4.42 0 8-3.58 8-8V219.13c-8.16-12.3-19.22-22.32-32-29.77z"]
};
var faEdit = {
prefix: 'fas',
iconName: 'edit',
icon: [576, 512, [], "f044", "M402.6 83.2l90.2 90.2c3.8 3.8 3.8 10 0 13.8L274.4 405.6l-92.8 10.3c-12.4 1.4-22.9-9.1-21.5-21.5l10.3-92.8L388.8 83.2c3.8-3.8 10-3.8 13.8 0zm162-22.9l-48.8-48.8c-15.2-15.2-39.9-15.2-55.2 0l-35.4 35.4c-3.8 3.8-3.8 10 0 13.8l90.2 90.2c3.8 3.8 10 3.8 13.8 0l35.4-35.4c15.2-15.3 15.2-40 0-55.2zM384 346.2V448H64V128h229.8c3.2 0 6.2-1.3 8.5-3.5l40-40c7.6-7.6 2.2-20.5-8.5-20.5H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V306.2c0-10.7-12.9-16-20.5-8.5l-40 40c-2.2 2.3-3.5 5.3-3.5 8.5z"]
};
var faEgg = {
prefix: 'fas',
iconName: 'egg',
icon: [384, 512, [], "f7fb", "M192 0C86 0 0 214 0 320s86 192 192 192 192-86 192-192S298 0 192 0z"]
};
var faEject = {
prefix: 'fas',
iconName: 'eject',
icon: [448, 512, [], "f052", "M448 384v64c0 17.673-14.327 32-32 32H32c-17.673 0-32-14.327-32-32v-64c0-17.673 14.327-32 32-32h384c17.673 0 32 14.327 32 32zM48.053 320h351.886c41.651 0 63.581-49.674 35.383-80.435L259.383 47.558c-19.014-20.743-51.751-20.744-70.767 0L12.67 239.565C-15.475 270.268 6.324 320 48.053 320z"]
};
var faEllipsisH = {
prefix: 'fas',
iconName: 'ellipsis-h',
icon: [512, 512, [], "f141", "M328 256c0 39.8-32.2 72-72 72s-72-32.2-72-72 32.2-72 72-72 72 32.2 72 72zm104-72c-39.8 0-72 32.2-72 72s32.2 72 72 72 72-32.2 72-72-32.2-72-72-72zm-352 0c-39.8 0-72 32.2-72 72s32.2 72 72 72 72-32.2 72-72-32.2-72-72-72z"]
};
var faEllipsisV = {
prefix: 'fas',
iconName: 'ellipsis-v',
icon: [192, 512, [], "f142", "M96 184c39.8 0 72 32.2 72 72s-32.2 72-72 72-72-32.2-72-72 32.2-72 72-72zM24 80c0 39.8 32.2 72 72 72s72-32.2 72-72S135.8 8 96 8 24 40.2 24 80zm0 352c0 39.8 32.2 72 72 72s72-32.2 72-72-32.2-72-72-72-72 32.2-72 72z"]
};
var faEnvelope = {
prefix: 'fas',
iconName: 'envelope',
icon: [512, 512, [], "f0e0", "M502.3 190.8c3.9-3.1 9.7-.2 9.7 4.7V400c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V195.6c0-5 5.7-7.8 9.7-4.7 22.4 17.4 52.1 39.5 154.1 113.6 21.1 15.4 56.7 47.8 92.2 47.6 35.7.3 72-32.8 92.3-47.6 102-74.1 131.6-96.3 154-113.7zM256 320c23.2.4 56.6-29.2 73.4-41.4 132.7-96.3 142.8-104.7 173.4-128.7 5.8-4.5 9.2-11.5 9.2-18.9v-19c0-26.5-21.5-48-48-48H48C21.5 64 0 85.5 0 112v19c0 7.4 3.4 14.3 9.2 18.9 30.6 23.9 40.7 32.4 173.4 128.7 16.8 12.2 50.2 41.8 73.4 41.4z"]
};
var faEnvelopeOpen = {
prefix: 'fas',
iconName: 'envelope-open',
icon: [512, 512, [], "f2b6", "M512 464c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V200.724a48 48 0 0 1 18.387-37.776c24.913-19.529 45.501-35.365 164.2-121.511C199.412 29.17 232.797-.347 256 .003c23.198-.354 56.596 29.172 73.413 41.433 118.687 86.137 139.303 101.995 164.2 121.512A48 48 0 0 1 512 200.724V464zm-65.666-196.605c-2.563-3.728-7.7-4.595-11.339-1.907-22.845 16.873-55.462 40.705-105.582 77.079-16.825 12.266-50.21 41.781-73.413 41.43-23.211.344-56.559-29.143-73.413-41.43-50.114-36.37-82.734-60.204-105.582-77.079-3.639-2.688-8.776-1.821-11.339 1.907l-9.072 13.196a7.998 7.998 0 0 0 1.839 10.967c22.887 16.899 55.454 40.69 105.303 76.868 20.274 14.781 56.524 47.813 92.264 47.573 35.724.242 71.961-32.771 92.263-47.573 49.85-36.179 82.418-59.97 105.303-76.868a7.998 7.998 0 0 0 1.839-10.967l-9.071-13.196z"]
};
var faEnvelopeOpenText = {
prefix: 'fas',
iconName: 'envelope-open-text',
icon: [512, 512, [], "f658", "M176 216h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16H176c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16zm-16 80c0 8.84 7.16 16 16 16h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16H176c-8.84 0-16 7.16-16 16v16zm96 121.13c-16.42 0-32.84-5.06-46.86-15.19L0 250.86V464c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V250.86L302.86 401.94c-14.02 10.12-30.44 15.19-46.86 15.19zm237.61-254.18c-8.85-6.94-17.24-13.47-29.61-22.81V96c0-26.51-21.49-48-48-48h-77.55c-3.04-2.2-5.87-4.26-9.04-6.56C312.6 29.17 279.2-.35 256 0c-23.2-.35-56.59 29.17-73.41 41.44-3.17 2.3-6 4.36-9.04 6.56H96c-26.51 0-48 21.49-48 48v44.14c-12.37 9.33-20.76 15.87-29.61 22.81A47.995 47.995 0 0 0 0 200.72v10.65l96 69.35V96h320v184.72l96-69.35v-10.65c0-14.74-6.78-28.67-18.39-37.77z"]
};
var faEnvelopeSquare = {
prefix: 'fas',
iconName: 'envelope-square',
icon: [448, 512, [], "f199", "M400 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zM178.117 262.104C87.429 196.287 88.353 196.121 64 177.167V152c0-13.255 10.745-24 24-24h272c13.255 0 24 10.745 24 24v25.167c-24.371 18.969-23.434 19.124-114.117 84.938-10.5 7.655-31.392 26.12-45.883 25.894-14.503.218-35.367-18.227-45.883-25.895zM384 217.775V360c0 13.255-10.745 24-24 24H88c-13.255 0-24-10.745-24-24V217.775c13.958 10.794 33.329 25.236 95.303 70.214 14.162 10.341 37.975 32.145 64.694 32.01 26.887.134 51.037-22.041 64.72-32.025 61.958-44.965 81.325-59.406 95.283-70.199z"]
};
var faEquals = {
prefix: 'fas',
iconName: 'equals',
icon: [448, 512, [], "f52c", "M416 304H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h384c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32zm0-192H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h384c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32z"]
};
var faEraser = {
prefix: 'fas',
iconName: 'eraser',
icon: [512, 512, [], "f12d", "M497.941 273.941c18.745-18.745 18.745-49.137 0-67.882l-160-160c-18.745-18.745-49.136-18.746-67.883 0l-256 256c-18.745 18.745-18.745 49.137 0 67.882l96 96A48.004 48.004 0 0 0 144 480h356c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12H355.883l142.058-142.059zm-302.627-62.627l137.373 137.373L265.373 416H150.628l-80-80 124.686-124.686z"]
};
var faEthernet = {
prefix: 'fas',
iconName: 'ethernet',
icon: [512, 512, [], "f796", "M496 192h-48v-48c0-8.8-7.2-16-16-16h-48V80c0-8.8-7.2-16-16-16H144c-8.8 0-16 7.2-16 16v48H80c-8.8 0-16 7.2-16 16v48H16c-8.8 0-16 7.2-16 16v224c0 8.8 7.2 16 16 16h80V320h32v128h64V320h32v128h64V320h32v128h64V320h32v128h80c8.8 0 16-7.2 16-16V208c0-8.8-7.2-16-16-16z"]
};
var faEuroSign = {
prefix: 'fas',
iconName: 'euro-sign',
icon: [320, 512, [], "f153", "M310.706 413.765c-1.314-6.63-7.835-10.872-14.424-9.369-10.692 2.439-27.422 5.413-45.426 5.413-56.763 0-101.929-34.79-121.461-85.449h113.689a12 12 0 0 0 11.708-9.369l6.373-28.36c1.686-7.502-4.019-14.631-11.708-14.631H115.22c-1.21-14.328-1.414-28.287.137-42.245H261.95a12 12 0 0 0 11.723-9.434l6.512-29.755c1.638-7.484-4.061-14.566-11.723-14.566H130.184c20.633-44.991 62.69-75.03 117.619-75.03 14.486 0 28.564 2.25 37.851 4.145 6.216 1.268 12.347-2.498 14.002-8.623l11.991-44.368c1.822-6.741-2.465-13.616-9.326-14.917C290.217 34.912 270.71 32 249.635 32 152.451 32 74.03 92.252 45.075 176H12c-6.627 0-12 5.373-12 12v29.755c0 6.627 5.373 12 12 12h21.569c-1.009 13.607-1.181 29.287-.181 42.245H12c-6.627 0-12 5.373-12 12v28.36c0 6.627 5.373 12 12 12h30.114C67.139 414.692 145.264 480 249.635 480c26.301 0 48.562-4.544 61.101-7.788 6.167-1.595 10.027-7.708 8.788-13.957l-8.818-44.49z"]
};
var faExchangeAlt = {
prefix: 'fas',
iconName: 'exchange-alt',
icon: [512, 512, [], "f362", "M0 168v-16c0-13.255 10.745-24 24-24h360V80c0-21.367 25.899-32.042 40.971-16.971l80 80c9.372 9.373 9.372 24.569 0 33.941l-80 80C409.956 271.982 384 261.456 384 240v-48H24c-13.255 0-24-10.745-24-24zm488 152H128v-48c0-21.314-25.862-32.08-40.971-16.971l-80 80c-9.372 9.373-9.372 24.569 0 33.941l80 80C102.057 463.997 128 453.437 128 432v-48h360c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24z"]
};
var faExclamation = {
prefix: 'fas',
iconName: 'exclamation',
icon: [192, 512, [], "f12a", "M176 432c0 44.112-35.888 80-80 80s-80-35.888-80-80 35.888-80 80-80 80 35.888 80 80zM25.26 25.199l13.6 272C39.499 309.972 50.041 320 62.83 320h66.34c12.789 0 23.331-10.028 23.97-22.801l13.6-272C167.425 11.49 156.496 0 142.77 0H49.23C35.504 0 24.575 11.49 25.26 25.199z"]
};
var faExclamationCircle = {
prefix: 'fas',
iconName: 'exclamation-circle',
icon: [512, 512, [], "f06a", "M504 256c0 136.997-111.043 248-248 248S8 392.997 8 256C8 119.083 119.043 8 256 8s248 111.083 248 248zm-248 50c-25.405 0-46 20.595-46 46s20.595 46 46 46 46-20.595 46-46-20.595-46-46-46zm-43.673-165.346l7.418 136c.347 6.364 5.609 11.346 11.982 11.346h48.546c6.373 0 11.635-4.982 11.982-11.346l7.418-136c.375-6.874-5.098-12.654-11.982-12.654h-63.383c-6.884 0-12.356 5.78-11.981 12.654z"]
};
var faExclamationTriangle = {
prefix: 'fas',
iconName: 'exclamation-triangle',
icon: [576, 512, [], "f071", "M569.517 440.013C587.975 472.007 564.806 512 527.94 512H48.054c-36.937 0-59.999-40.055-41.577-71.987L246.423 23.985c18.467-32.009 64.72-31.951 83.154 0l239.94 416.028zM288 354c-25.405 0-46 20.595-46 46s20.595 46 46 46 46-20.595 46-46-20.595-46-46-46zm-43.673-165.346l7.418 136c.347 6.364 5.609 11.346 11.982 11.346h48.546c6.373 0 11.635-4.982 11.982-11.346l7.418-136c.375-6.874-5.098-12.654-11.982-12.654h-63.383c-6.884 0-12.356 5.78-11.981 12.654z"]
};
var faExpand = {
prefix: 'fas',
iconName: 'expand',
icon: [448, 512, [], "f065", "M0 180V56c0-13.3 10.7-24 24-24h124c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12H64v84c0 6.6-5.4 12-12 12H12c-6.6 0-12-5.4-12-12zM288 44v40c0 6.6 5.4 12 12 12h84v84c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12V56c0-13.3-10.7-24-24-24H300c-6.6 0-12 5.4-12 12zm148 276h-40c-6.6 0-12 5.4-12 12v84h-84c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h124c13.3 0 24-10.7 24-24V332c0-6.6-5.4-12-12-12zM160 468v-40c0-6.6-5.4-12-12-12H64v-84c0-6.6-5.4-12-12-12H12c-6.6 0-12 5.4-12 12v124c0 13.3 10.7 24 24 24h124c6.6 0 12-5.4 12-12z"]
};
var faExpandAlt = {
prefix: 'fas',
iconName: 'expand-alt',
icon: [448, 512, [], "f424", "M212.686 315.314L120 408l32.922 31.029c15.12 15.12 4.412 40.971-16.97 40.971h-112C10.697 480 0 469.255 0 456V344c0-21.382 25.803-32.09 40.922-16.971L72 360l92.686-92.686c6.248-6.248 16.379-6.248 22.627 0l25.373 25.373c6.249 6.248 6.249 16.378 0 22.627zm22.628-118.628L328 104l-32.922-31.029C279.958 57.851 290.666 32 312.048 32h112C437.303 32 448 42.745 448 56v112c0 21.382-25.803 32.09-40.922 16.971L376 152l-92.686 92.686c-6.248 6.248-16.379 6.248-22.627 0l-25.373-25.373c-6.249-6.248-6.249-16.378 0-22.627z"]
};
var faExpandArrowsAlt = {
prefix: 'fas',
iconName: 'expand-arrows-alt',
icon: [448, 512, [], "f31e", "M448 344v112a23.94 23.94 0 0 1-24 24H312c-21.39 0-32.09-25.9-17-41l36.2-36.2L224 295.6 116.77 402.9 153 439c15.09 15.1 4.39 41-17 41H24a23.94 23.94 0 0 1-24-24V344c0-21.4 25.89-32.1 41-17l36.19 36.2L184.46 256 77.18 148.7 41 185c-15.1 15.1-41 4.4-41-17V56a23.94 23.94 0 0 1 24-24h112c21.39 0 32.09 25.9 17 41l-36.2 36.2L224 216.4l107.23-107.3L295 73c-15.09-15.1-4.39-41 17-41h112a23.94 23.94 0 0 1 24 24v112c0 21.4-25.89 32.1-41 17l-36.19-36.2L263.54 256l107.28 107.3L407 327.1c15.1-15.2 41-4.5 41 16.9z"]
};
var faExternalLinkAlt = {
prefix: 'fas',
iconName: 'external-link-alt',
icon: [512, 512, [], "f35d", "M432,320H400a16,16,0,0,0-16,16V448H64V128H208a16,16,0,0,0,16-16V80a16,16,0,0,0-16-16H48A48,48,0,0,0,0,112V464a48,48,0,0,0,48,48H400a48,48,0,0,0,48-48V336A16,16,0,0,0,432,320ZM488,0h-128c-21.37,0-32.05,25.91-17,41l35.73,35.73L135,320.37a24,24,0,0,0,0,34L157.67,377a24,24,0,0,0,34,0L435.28,133.32,471,169c15,15,41,4.5,41-17V24A24,24,0,0,0,488,0Z"]
};
var faExternalLinkSquareAlt = {
prefix: 'fas',
iconName: 'external-link-square-alt',
icon: [448, 512, [], "f360", "M448 80v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48zm-88 16H248.029c-21.313 0-32.08 25.861-16.971 40.971l31.984 31.987L67.515 364.485c-4.686 4.686-4.686 12.284 0 16.971l31.029 31.029c4.687 4.686 12.285 4.686 16.971 0l195.526-195.526 31.988 31.991C358.058 263.977 384 253.425 384 231.979V120c0-13.255-10.745-24-24-24z"]
};
var faEye = {
prefix: 'fas',
iconName: 'eye',
icon: [576, 512, [], "f06e", "M572.52 241.4C518.29 135.59 410.93 64 288 64S57.68 135.64 3.48 241.41a32.35 32.35 0 0 0 0 29.19C57.71 376.41 165.07 448 288 448s230.32-71.64 284.52-177.41a32.35 32.35 0 0 0 0-29.19zM288 400a144 144 0 1 1 144-144 143.93 143.93 0 0 1-144 144zm0-240a95.31 95.31 0 0 0-25.31 3.79 47.85 47.85 0 0 1-66.9 66.9A95.78 95.78 0 1 0 288 160z"]
};
var faEyeDropper = {
prefix: 'fas',
iconName: 'eye-dropper',
icon: [512, 512, [], "f1fb", "M50.75 333.25c-12 12-18.75 28.28-18.75 45.26V424L0 480l32 32 56-32h45.49c16.97 0 33.25-6.74 45.25-18.74l126.64-126.62-128-128L50.75 333.25zM483.88 28.12c-37.47-37.5-98.28-37.5-135.75 0l-77.09 77.09-13.1-13.1c-9.44-9.44-24.65-9.31-33.94 0l-40.97 40.97c-9.37 9.37-9.37 24.57 0 33.94l161.94 161.94c9.44 9.44 24.65 9.31 33.94 0L419.88 288c9.37-9.37 9.37-24.57 0-33.94l-13.1-13.1 77.09-77.09c37.51-37.48 37.51-98.26.01-135.75z"]
};
var faEyeSlash = {
prefix: 'fas',
iconName: 'eye-slash',
icon: [640, 512, [], "f070", "M320 400c-75.85 0-137.25-58.71-142.9-133.11L72.2 185.82c-13.79 17.3-26.48 35.59-36.72 55.59a32.35 32.35 0 0 0 0 29.19C89.71 376.41 197.07 448 320 448c26.91 0 52.87-4 77.89-10.46L346 397.39a144.13 144.13 0 0 1-26 2.61zm313.82 58.1l-110.55-85.44a331.25 331.25 0 0 0 81.25-102.07 32.35 32.35 0 0 0 0-29.19C550.29 135.59 442.93 64 320 64a308.15 308.15 0 0 0-147.32 37.7L45.46 3.37A16 16 0 0 0 23 6.18L3.37 31.45A16 16 0 0 0 6.18 53.9l588.36 454.73a16 16 0 0 0 22.46-2.81l19.64-25.27a16 16 0 0 0-2.82-22.45zm-183.72-142l-39.3-30.38A94.75 94.75 0 0 0 416 256a94.76 94.76 0 0 0-121.31-92.21A47.65 47.65 0 0 1 304 192a46.64 46.64 0 0 1-1.54 10l-73.61-56.89A142.31 142.31 0 0 1 320 112a143.92 143.92 0 0 1 144 144c0 21.63-5.29 41.79-13.9 60.11z"]
};
var faFan = {
prefix: 'fas',
iconName: 'fan',
icon: [512, 512, [], "f863", "M352.57 128c-28.09 0-54.09 4.52-77.06 12.86l12.41-123.11C289 7.31 279.81-1.18 269.33.13 189.63 10.13 128 77.64 128 159.43c0 28.09 4.52 54.09 12.86 77.06L17.75 224.08C7.31 223-1.18 232.19.13 242.67c10 79.7 77.51 141.33 159.3 141.33 28.09 0 54.09-4.52 77.06-12.86l-12.41 123.11c-1.05 10.43 8.11 18.93 18.59 17.62 79.7-10 141.33-77.51 141.33-159.3 0-28.09-4.52-54.09-12.86-77.06l123.11 12.41c10.44 1.05 18.93-8.11 17.62-18.59-10-79.7-77.51-141.33-159.3-141.33zM256 288a32 32 0 1 1 32-32 32 32 0 0 1-32 32z"]
};
var faFastBackward = {
prefix: 'fas',
iconName: 'fast-backward',
icon: [512, 512, [], "f049", "M0 436V76c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v151.9L235.5 71.4C256.1 54.3 288 68.6 288 96v131.9L459.5 71.4C480.1 54.3 512 68.6 512 96v320c0 27.4-31.9 41.7-52.5 24.6L288 285.3V416c0 27.4-31.9 41.7-52.5 24.6L64 285.3V436c0 6.6-5.4 12-12 12H12c-6.6 0-12-5.4-12-12z"]
};
var faFastForward = {
prefix: 'fas',
iconName: 'fast-forward',
icon: [512, 512, [], "f050", "M512 76v360c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12V284.1L276.5 440.6c-20.6 17.2-52.5 2.8-52.5-24.6V284.1L52.5 440.6C31.9 457.8 0 443.4 0 416V96c0-27.4 31.9-41.7 52.5-24.6L224 226.8V96c0-27.4 31.9-41.7 52.5-24.6L448 226.8V76c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12z"]
};
var faFaucet = {
prefix: 'fas',
iconName: 'faucet',
icon: [512, 512, [], "e005", "M352,256H313.39c-15.71-13.44-35.46-23.07-57.39-28V180.44l-32-3.38-32,3.38V228c-21.93,5-41.68,14.6-57.39,28H16A16,16,0,0,0,0,272v96a16,16,0,0,0,16,16h92.79C129.38,421.73,173,448,224,448s94.62-26.27,115.21-64H352a32,32,0,0,1,32,32,32,32,0,0,0,32,32h64a32,32,0,0,0,32-32A160,160,0,0,0,352,256ZM81.59,159.91l142.41-15,142.41,15c9.42,1,17.59-6.81,17.59-16.8V112.89c0-10-8.17-17.8-17.59-16.81L256,107.74V80a16,16,0,0,0-16-16H208a16,16,0,0,0-16,16v27.74L81.59,96.08C72.17,95.09,64,102.9,64,112.89v30.22C64,153.1,72.17,160.91,81.59,159.91Z"]
};
var faFax = {
prefix: 'fas',
iconName: 'fax',
icon: [512, 512, [], "f1ac", "M480 160V77.25a32 32 0 0 0-9.38-22.63L425.37 9.37A32 32 0 0 0 402.75 0H160a32 32 0 0 0-32 32v448a32 32 0 0 0 32 32h320a32 32 0 0 0 32-32V192a32 32 0 0 0-32-32zM288 432a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32a16 16 0 0 1 16 16zm0-128a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32a16 16 0 0 1 16 16zm128 128a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32a16 16 0 0 1 16 16zm0-128a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32a16 16 0 0 1 16 16zm0-112H192V64h160v48a16 16 0 0 0 16 16h48zM64 128H32a32 32 0 0 0-32 32v320a32 32 0 0 0 32 32h32a32 32 0 0 0 32-32V160a32 32 0 0 0-32-32z"]
};
var faFeather = {
prefix: 'fas',
iconName: 'feather',
icon: [512, 512, [], "f52d", "M467.14 44.84c-62.55-62.48-161.67-64.78-252.28 25.73-78.61 78.52-60.98 60.92-85.75 85.66-60.46 60.39-70.39 150.83-63.64 211.17l178.44-178.25c6.26-6.25 16.4-6.25 22.65 0s6.25 16.38 0 22.63L7.04 471.03c-9.38 9.37-9.38 24.57 0 33.94 9.38 9.37 24.6 9.37 33.98 0l66.1-66.03C159.42 454.65 279 457.11 353.95 384h-98.19l147.57-49.14c49.99-49.93 36.38-36.18 46.31-46.86h-97.78l131.54-43.8c45.44-74.46 34.31-148.84-16.26-199.36z"]
};
var faFeatherAlt = {
prefix: 'fas',
iconName: 'feather-alt',
icon: [512, 512, [], "f56b", "M512 0C460.22 3.56 96.44 38.2 71.01 287.61c-3.09 26.66-4.84 53.44-5.99 80.24l178.87-178.69c6.25-6.25 16.4-6.25 22.65 0s6.25 16.38 0 22.63L7.04 471.03c-9.38 9.37-9.38 24.57 0 33.94 9.38 9.37 24.59 9.37 33.98 0l57.13-57.07c42.09-.14 84.15-2.53 125.96-7.36 53.48-5.44 97.02-26.47 132.58-56.54H255.74l146.79-48.88c11.25-14.89 21.37-30.71 30.45-47.12h-81.14l106.54-53.21C500.29 132.86 510.19 26.26 512 0z"]
};
var faFemale = {
prefix: 'fas',
iconName: 'female',
icon: [256, 512, [], "f182", "M128 0c35.346 0 64 28.654 64 64s-28.654 64-64 64c-35.346 0-64-28.654-64-64S92.654 0 128 0m119.283 354.179l-48-192A24 24 0 0 0 176 144h-11.36c-22.711 10.443-49.59 10.894-73.28 0H80a24 24 0 0 0-23.283 18.179l-48 192C4.935 369.305 16.383 384 32 384h56v104c0 13.255 10.745 24 24 24h32c13.255 0 24-10.745 24-24V384h56c15.591 0 27.071-14.671 23.283-29.821z"]
};
var faFighterJet = {
prefix: 'fas',
iconName: 'fighter-jet',
icon: [640, 512, [], "f0fb", "M544 224l-128-16-48-16h-24L227.158 44h39.509C278.333 44 288 41.375 288 38s-9.667-6-21.333-6H152v12h16v164h-48l-66.667-80H18.667L8 138.667V208h8v16h48v2.666l-64 8v42.667l64 8V288H16v16H8v69.333L18.667 384h34.667L120 304h48v164h-16v12h114.667c11.667 0 21.333-2.625 21.333-6s-9.667-6-21.333-6h-39.509L344 320h24l48-16 128-16c96-21.333 96-26.583 96-32 0-5.417 0-10.667-96-32z"]
};
var faFile = {
prefix: 'fas',
iconName: 'file',
icon: [384, 512, [], "f15b", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm160-14.1v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFileAlt = {
prefix: 'fas',
iconName: 'file-alt',
icon: [384, 512, [], "f15c", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm64 236c0 6.6-5.4 12-12 12H108c-6.6 0-12-5.4-12-12v-8c0-6.6 5.4-12 12-12h168c6.6 0 12 5.4 12 12v8zm0-64c0 6.6-5.4 12-12 12H108c-6.6 0-12-5.4-12-12v-8c0-6.6 5.4-12 12-12h168c6.6 0 12 5.4 12 12v8zm0-72v8c0 6.6-5.4 12-12 12H108c-6.6 0-12-5.4-12-12v-8c0-6.6 5.4-12 12-12h168c6.6 0 12 5.4 12 12zm96-114.1v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFileArchive = {
prefix: 'fas',
iconName: 'file-archive',
icon: [384, 512, [], "f1c6", "M377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zM128.4 336c-17.9 0-32.4 12.1-32.4 27 0 15 14.6 27 32.5 27s32.4-12.1 32.4-27-14.6-27-32.5-27zM224 136V0h-63.6v32h-32V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zM95.9 32h32v32h-32zm32.3 384c-33.2 0-58-30.4-51.4-62.9L96.4 256v-32h32v-32h-32v-32h32v-32h-32V96h32V64h32v32h-32v32h32v32h-32v32h32v32h-32v32h22.1c5.7 0 10.7 4.1 11.8 9.7l17.3 87.7c6.4 32.4-18.4 62.6-51.4 62.6z"]
};
var faFileAudio = {
prefix: 'fas',
iconName: 'file-audio',
icon: [384, 512, [], "f1c7", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm-64 268c0 10.7-12.9 16-20.5 8.5L104 376H76c-6.6 0-12-5.4-12-12v-56c0-6.6 5.4-12 12-12h28l35.5-36.5c7.6-7.6 20.5-2.2 20.5 8.5v136zm33.2-47.6c9.1-9.3 9.1-24.1 0-33.4-22.1-22.8 12.2-56.2 34.4-33.5 27.2 27.9 27.2 72.4 0 100.4-21.8 22.3-56.9-10.4-34.4-33.5zm86-117.1c54.4 55.9 54.4 144.8 0 200.8-21.8 22.4-57-10.3-34.4-33.5 36.2-37.2 36.3-96.5 0-133.8-22.1-22.8 12.3-56.3 34.4-33.5zM384 121.9v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFileCode = {
prefix: 'fas',
iconName: 'file-code',
icon: [384, 512, [], "f1c9", "M384 121.941V128H256V0h6.059c6.365 0 12.47 2.529 16.971 7.029l97.941 97.941A24.005 24.005 0 0 1 384 121.941zM248 160c-13.2 0-24-10.8-24-24V0H24C10.745 0 0 10.745 0 24v464c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24V160H248zM123.206 400.505a5.4 5.4 0 0 1-7.633.246l-64.866-60.812a5.4 5.4 0 0 1 0-7.879l64.866-60.812a5.4 5.4 0 0 1 7.633.246l19.579 20.885a5.4 5.4 0 0 1-.372 7.747L101.65 336l40.763 35.874a5.4 5.4 0 0 1 .372 7.747l-19.579 20.884zm51.295 50.479l-27.453-7.97a5.402 5.402 0 0 1-3.681-6.692l61.44-211.626a5.402 5.402 0 0 1 6.692-3.681l27.452 7.97a5.4 5.4 0 0 1 3.68 6.692l-61.44 211.626a5.397 5.397 0 0 1-6.69 3.681zm160.792-111.045l-64.866 60.812a5.4 5.4 0 0 1-7.633-.246l-19.58-20.885a5.4 5.4 0 0 1 .372-7.747L284.35 336l-40.763-35.874a5.4 5.4 0 0 1-.372-7.747l19.58-20.885a5.4 5.4 0 0 1 7.633-.246l64.866 60.812a5.4 5.4 0 0 1-.001 7.879z"]
};
var faFileContract = {
prefix: 'fas',
iconName: 'file-contract',
icon: [384, 512, [], "f56c", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zM64 72c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8V72zm0 64c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16zm192.81 248H304c8.84 0 16 7.16 16 16s-7.16 16-16 16h-47.19c-16.45 0-31.27-9.14-38.64-23.86-2.95-5.92-8.09-6.52-10.17-6.52s-7.22.59-10.02 6.19l-7.67 15.34a15.986 15.986 0 0 1-14.31 8.84c-.38 0-.75-.02-1.14-.05-6.45-.45-12-4.75-14.03-10.89L144 354.59l-10.61 31.88c-5.89 17.66-22.38 29.53-41 29.53H80c-8.84 0-16-7.16-16-16s7.16-16 16-16h12.39c4.83 0 9.11-3.08 10.64-7.66l18.19-54.64c3.3-9.81 12.44-16.41 22.78-16.41s19.48 6.59 22.77 16.41l13.88 41.64c19.77-16.19 54.05-9.7 66 14.16 2.02 4.06 5.96 6.5 10.16 6.5zM377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9z"]
};
var faFileCsv = {
prefix: 'fas',
iconName: 'file-csv',
icon: [384, 512, [], "f6dd", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm-96 144c0 4.42-3.58 8-8 8h-8c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h8c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8h-8c-26.51 0-48-21.49-48-48v-32c0-26.51 21.49-48 48-48h8c4.42 0 8 3.58 8 8v16zm44.27 104H160c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h12.27c5.95 0 10.41-3.5 10.41-6.62 0-1.3-.75-2.66-2.12-3.84l-21.89-18.77c-8.47-7.22-13.33-17.48-13.33-28.14 0-21.3 19.02-38.62 42.41-38.62H200c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8h-12.27c-5.95 0-10.41 3.5-10.41 6.62 0 1.3.75 2.66 2.12 3.84l21.89 18.77c8.47 7.22 13.33 17.48 13.33 28.14.01 21.29-19 38.62-42.39 38.62zM256 264v20.8c0 20.27 5.7 40.17 16 56.88 10.3-16.7 16-36.61 16-56.88V264c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v20.8c0 35.48-12.88 68.89-36.28 94.09-3.02 3.25-7.27 5.11-11.72 5.11s-8.7-1.86-11.72-5.11c-23.4-25.2-36.28-58.61-36.28-94.09V264c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8zm121-159L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9z"]
};
var faFileDownload = {
prefix: 'fas',
iconName: 'file-download',
icon: [384, 512, [], "f56d", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm76.45 211.36l-96.42 95.7c-6.65 6.61-17.39 6.61-24.04 0l-96.42-95.7C73.42 337.29 80.54 320 94.82 320H160v-80c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v80h65.18c14.28 0 21.4 17.29 11.27 27.36zM377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9z"]
};
var faFileExcel = {
prefix: 'fas',
iconName: 'file-excel',
icon: [384, 512, [], "f1c3", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm60.1 106.5L224 336l60.1 93.5c5.1 8-.6 18.5-10.1 18.5h-34.9c-4.4 0-8.5-2.4-10.6-6.3C208.9 405.5 192 373 192 373c-6.4 14.8-10 20-36.6 68.8-2.1 3.9-6.1 6.3-10.5 6.3H110c-9.5 0-15.2-10.5-10.1-18.5l60.3-93.5-60.3-93.5c-5.2-8 .6-18.5 10.1-18.5h34.8c4.4 0 8.5 2.4 10.6 6.3 26.1 48.8 20 33.6 36.6 68.5 0 0 6.1-11.7 36.6-68.5 2.1-3.9 6.2-6.3 10.6-6.3H274c9.5-.1 15.2 10.4 10.1 18.4zM384 121.9v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFileExport = {
prefix: 'fas',
iconName: 'file-export',
icon: [576, 512, [], "f56e", "M384 121.9c0-6.3-2.5-12.4-7-16.9L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128zM571 308l-95.7-96.4c-10.1-10.1-27.4-3-27.4 11.3V288h-64v64h64v65.2c0 14.3 17.3 21.4 27.4 11.3L571 332c6.6-6.6 6.6-17.4 0-24zm-379 28v-32c0-8.8 7.2-16 16-16h176V160H248c-13.2 0-24-10.8-24-24V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V352H208c-8.8 0-16-7.2-16-16z"]
};
var faFileImage = {
prefix: 'fas',
iconName: 'file-image',
icon: [384, 512, [], "f1c5", "M384 121.941V128H256V0h6.059a24 24 0 0 1 16.97 7.029l97.941 97.941a24.002 24.002 0 0 1 7.03 16.971zM248 160c-13.2 0-24-10.8-24-24V0H24C10.745 0 0 10.745 0 24v464c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24V160H248zm-135.455 16c26.51 0 48 21.49 48 48s-21.49 48-48 48-48-21.49-48-48 21.491-48 48-48zm208 240h-256l.485-48.485L104.545 328c4.686-4.686 11.799-4.201 16.485.485L160.545 368 264.06 264.485c4.686-4.686 12.284-4.686 16.971 0L320.545 304v112z"]
};
var faFileImport = {
prefix: 'fas',
iconName: 'file-import',
icon: [512, 512, [], "f56f", "M16 288c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h112v-64zm489-183L407.1 7c-4.5-4.5-10.6-7-17-7H384v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-153 31V0H152c-13.3 0-24 10.7-24 24v264h128v-65.2c0-14.3 17.3-21.4 27.4-11.3L379 308c6.6 6.7 6.6 17.4 0 24l-95.7 96.4c-10.1 10.1-27.4 3-27.4-11.3V352H128v136c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H376c-13.2 0-24-10.8-24-24z"]
};
var faFileInvoice = {
prefix: 'fas',
iconName: 'file-invoice',
icon: [384, 512, [], "f570", "M288 256H96v64h192v-64zm89-151L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-153 31V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zM64 72c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8V72zm0 64c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16zm256 304c0 4.42-3.58 8-8 8h-80c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16zm0-200v96c0 8.84-7.16 16-16 16H80c-8.84 0-16-7.16-16-16v-96c0-8.84 7.16-16 16-16h224c8.84 0 16 7.16 16 16z"]
};
var faFileInvoiceDollar = {
prefix: 'fas',
iconName: 'file-invoice-dollar',
icon: [384, 512, [], "f571", "M377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-153 31V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zM64 72c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8V72zm0 80v-16c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8zm144 263.88V440c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-24.29c-11.29-.58-22.27-4.52-31.37-11.35-3.9-2.93-4.1-8.77-.57-12.14l11.75-11.21c2.77-2.64 6.89-2.76 10.13-.73 3.87 2.42 8.26 3.72 12.82 3.72h28.11c6.5 0 11.8-5.92 11.8-13.19 0-5.95-3.61-11.19-8.77-12.73l-45-13.5c-18.59-5.58-31.58-23.42-31.58-43.39 0-24.52 19.05-44.44 42.67-45.07V232c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v24.29c11.29.58 22.27 4.51 31.37 11.35 3.9 2.93 4.1 8.77.57 12.14l-11.75 11.21c-2.77 2.64-6.89 2.76-10.13.73-3.87-2.43-8.26-3.72-12.82-3.72h-28.11c-6.5 0-11.8 5.92-11.8 13.19 0 5.95 3.61 11.19 8.77 12.73l45 13.5c18.59 5.58 31.58 23.42 31.58 43.39 0 24.53-19.05 44.44-42.67 45.07z"]
};
var faFileMedical = {
prefix: 'fas',
iconName: 'file-medical',
icon: [384, 512, [], "f477", "M377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-153 31V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm64 160v48c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8z"]
};
var faFileMedicalAlt = {
prefix: 'fas',
iconName: 'file-medical-alt',
icon: [448, 512, [], "f478", "M288 136V0H88C74.7 0 64 10.7 64 24v232H8c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8h140.9c3 0 5.8 1.7 7.2 4.4l19.9 39.8 56.8-113.7c2.9-5.9 11.4-5.9 14.3 0l34.7 69.5H352c8.8 0 16 7.2 16 16s-7.2 16-16 16h-89.9L240 275.8l-56.8 113.7c-2.9 5.9-11.4 5.9-14.3 0L134.1 320H64v168c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H312c-13.2 0-24-10.8-24-24zm153-31L343.1 7c-4.5-4.5-10.6-7-17-7H320v128h128v-6.1c0-6.3-2.5-12.4-7-16.9z"]
};
var faFilePdf = {
prefix: 'fas',
iconName: 'file-pdf',
icon: [384, 512, [], "f1c1", "M181.9 256.1c-5-16-4.9-46.9-2-46.9 8.4 0 7.6 36.9 2 46.9zm-1.7 47.2c-7.7 20.2-17.3 43.3-28.4 62.7 18.3-7 39-17.2 62.9-21.9-12.7-9.6-24.9-23.4-34.5-40.8zM86.1 428.1c0 .8 13.2-5.4 34.9-40.2-6.7 6.3-29.1 24.5-34.9 40.2zM248 160h136v328c0 13.3-10.7 24-24 24H24c-13.3 0-24-10.7-24-24V24C0 10.7 10.7 0 24 0h200v136c0 13.2 10.8 24 24 24zm-8 171.8c-20-12.2-33.3-29-42.7-53.8 4.5-18.5 11.6-46.6 6.2-64.2-4.7-29.4-42.4-26.5-47.8-6.8-5 18.3-.4 44.1 8.1 77-11.6 27.6-28.7 64.6-40.8 85.8-.1 0-.1.1-.2.1-27.1 13.9-73.6 44.5-54.5 68 5.6 6.9 16 10 21.5 10 17.9 0 35.7-18 61.1-61.8 25.8-8.5 54.1-19.1 79-23.2 21.7 11.8 47.1 19.5 64 19.5 29.2 0 31.2-32 19.7-43.4-13.9-13.6-54.3-9.7-73.6-7.2zM377 105L279 7c-4.5-4.5-10.6-7-17-7h-6v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-74.1 255.3c4.1-2.7-2.5-11.9-42.8-9 37.1 15.8 42.8 9 42.8 9z"]
};
var faFilePowerpoint = {
prefix: 'fas',
iconName: 'file-powerpoint',
icon: [384, 512, [], "f1c4", "M193.7 271.2c8.8 0 15.5 2.7 20.3 8.1 9.6 10.9 9.8 32.7-.2 44.1-4.9 5.6-11.9 8.5-21.1 8.5h-26.9v-60.7h27.9zM377 105L279 7c-4.5-4.5-10.6-7-17-7h-6v128h128v-6.1c0-6.3-2.5-12.4-7-16.9zm-153 31V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm53 165.2c0 90.3-88.8 77.6-111.1 77.6V436c0 6.6-5.4 12-12 12h-30.8c-6.6 0-12-5.4-12-12V236.2c0-6.6 5.4-12 12-12h81c44.5 0 72.9 32.8 72.9 77z"]
};
var faFilePrescription = {
prefix: 'fas',
iconName: 'file-prescription',
icon: [384, 512, [], "f572", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm68.53 179.48l11.31 11.31c6.25 6.25 6.25 16.38 0 22.63l-29.9 29.9L304 409.38c6.25 6.25 6.25 16.38 0 22.63l-11.31 11.31c-6.25 6.25-16.38 6.25-22.63 0L240 413.25l-30.06 30.06c-6.25 6.25-16.38 6.25-22.63 0L176 432c-6.25-6.25-6.25-16.38 0-22.63l30.06-30.06L146.74 320H128v48c0 8.84-7.16 16-16 16H96c-8.84 0-16-7.16-16-16V208c0-8.84 7.16-16 16-16h80c35.35 0 64 28.65 64 64 0 24.22-13.62 45.05-33.46 55.92L240 345.38l29.9-29.9c6.25-6.25 16.38-6.25 22.63 0zM176 272h-48v-32h48c8.82 0 16 7.18 16 16s-7.18 16-16 16zm208-150.1v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFileSignature = {
prefix: 'fas',
iconName: 'file-signature',
icon: [576, 512, [], "f573", "M218.17 424.14c-2.95-5.92-8.09-6.52-10.17-6.52s-7.22.59-10.02 6.19l-7.67 15.34c-6.37 12.78-25.03 11.37-29.48-2.09L144 386.59l-10.61 31.88c-5.89 17.66-22.38 29.53-41 29.53H80c-8.84 0-16-7.16-16-16s7.16-16 16-16h12.39c4.83 0 9.11-3.08 10.64-7.66l18.19-54.64c3.3-9.81 12.44-16.41 22.78-16.41s19.48 6.59 22.77 16.41l13.88 41.64c19.75-16.19 54.06-9.7 66 14.16 1.89 3.78 5.49 5.95 9.36 6.26v-82.12l128-127.09V160H248c-13.2 0-24-10.8-24-24V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24v-40l-128-.11c-16.12-.31-30.58-9.28-37.83-23.75zM384 121.9c0-6.3-2.5-12.4-7-16.9L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1zm-96 225.06V416h68.99l161.68-162.78-67.88-67.88L288 346.96zm280.54-179.63l-31.87-31.87c-9.94-9.94-26.07-9.94-36.01 0l-27.25 27.25 67.88 67.88 27.25-27.25c9.95-9.94 9.95-26.07 0-36.01z"]
};
var faFileUpload = {
prefix: 'fas',
iconName: 'file-upload',
icon: [384, 512, [], "f574", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm65.18 216.01H224v80c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16v-80H94.82c-14.28 0-21.41-17.29-11.27-27.36l96.42-95.7c6.65-6.61 17.39-6.61 24.04 0l96.42 95.7c10.15 10.07 3.03 27.36-11.25 27.36zM377 105L279.1 7c-4.5-4.5-10.6-7-17-7H256v128h128v-6.1c0-6.3-2.5-12.4-7-16.9z"]
};
var faFileVideo = {
prefix: 'fas',
iconName: 'file-video',
icon: [384, 512, [], "f1c8", "M384 121.941V128H256V0h6.059c6.365 0 12.47 2.529 16.971 7.029l97.941 97.941A24.005 24.005 0 0 1 384 121.941zM224 136V0H24C10.745 0 0 10.745 0 24v464c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24V160H248c-13.2 0-24-10.8-24-24zm96 144.016v111.963c0 21.445-25.943 31.998-40.971 16.971L224 353.941V392c0 13.255-10.745 24-24 24H88c-13.255 0-24-10.745-24-24V280c0-13.255 10.745-24 24-24h112c13.255 0 24 10.745 24 24v38.059l55.029-55.013c15.011-15.01 40.971-4.491 40.971 16.97z"]
};
var faFileWord = {
prefix: 'fas',
iconName: 'file-word',
icon: [384, 512, [], "f1c2", "M224 136V0H24C10.7 0 0 10.7 0 24v464c0 13.3 10.7 24 24 24h336c13.3 0 24-10.7 24-24V160H248c-13.2 0-24-10.8-24-24zm57.1 120H305c7.7 0 13.4 7.1 11.7 14.7l-38 168c-1.2 5.5-6.1 9.3-11.7 9.3h-38c-5.5 0-10.3-3.8-11.6-9.1-25.8-103.5-20.8-81.2-25.6-110.5h-.5c-1.1 14.3-2.4 17.4-25.6 110.5-1.3 5.3-6.1 9.1-11.6 9.1H117c-5.6 0-10.5-3.9-11.7-9.4l-37.8-168c-1.7-7.5 4-14.6 11.7-14.6h24.5c5.7 0 10.7 4 11.8 9.7 15.6 78 20.1 109.5 21 122.2 1.6-10.2 7.3-32.7 29.4-122.7 1.3-5.4 6.1-9.1 11.7-9.1h29.1c5.6 0 10.4 3.8 11.7 9.2 24 100.4 28.8 124 29.6 129.4-.2-11.2-2.6-17.8 21.6-129.2 1-5.6 5.9-9.5 11.5-9.5zM384 121.9v6.1H256V0h6.1c6.4 0 12.5 2.5 17 7l97.9 98c4.5 4.5 7 10.6 7 16.9z"]
};
var faFill = {
prefix: 'fas',
iconName: 'fill',
icon: [512, 512, [], "f575", "M502.63 217.06L294.94 9.37C288.69 3.12 280.5 0 272.31 0s-16.38 3.12-22.62 9.37l-81.58 81.58L81.93 4.77c-6.24-6.25-16.38-6.25-22.62 0L36.69 27.38c-6.24 6.25-6.24 16.38 0 22.63l86.19 86.18-94.76 94.76c-37.49 37.49-37.49 98.26 0 135.75l117.19 117.19c18.75 18.74 43.31 28.12 67.87 28.12 24.57 0 49.13-9.37 67.88-28.12l221.57-221.57c12.49-12.5 12.49-32.76 0-45.26zm-116.22 70.97H65.93c1.36-3.84 3.57-7.98 7.43-11.83l13.15-13.15 81.61-81.61 58.61 58.6c12.49 12.49 32.75 12.49 45.24 0 12.49-12.49 12.49-32.75 0-45.24l-58.61-58.6 58.95-58.95 162.45 162.44-48.35 48.34z"]
};
var faFillDrip = {
prefix: 'fas',
iconName: 'fill-drip',
icon: [576, 512, [], "f576", "M512 320s-64 92.65-64 128c0 35.35 28.66 64 64 64s64-28.65 64-64-64-128-64-128zm-9.37-102.94L294.94 9.37C288.69 3.12 280.5 0 272.31 0s-16.38 3.12-22.62 9.37l-81.58 81.58L81.93 4.76c-6.25-6.25-16.38-6.25-22.62 0L36.69 27.38c-6.24 6.25-6.24 16.38 0 22.62l86.19 86.18-94.76 94.76c-37.49 37.48-37.49 98.26 0 135.75l117.19 117.19c18.74 18.74 43.31 28.12 67.87 28.12 24.57 0 49.13-9.37 67.87-28.12l221.57-221.57c12.5-12.5 12.5-32.75.01-45.25zm-116.22 70.97H65.93c1.36-3.84 3.57-7.98 7.43-11.83l13.15-13.15 81.61-81.61 58.6 58.6c12.49 12.49 32.75 12.49 45.24 0s12.49-32.75 0-45.24l-58.6-58.6 58.95-58.95 162.44 162.44-48.34 48.34z"]
};
var faFilm = {
prefix: 'fas',
iconName: 'film',
icon: [512, 512, [], "f008", "M488 64h-8v20c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12V64H96v20c0 6.6-5.4 12-12 12H44c-6.6 0-12-5.4-12-12V64h-8C10.7 64 0 74.7 0 88v336c0 13.3 10.7 24 24 24h8v-20c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v20h320v-20c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v20h8c13.3 0 24-10.7 24-24V88c0-13.3-10.7-24-24-24zM96 372c0 6.6-5.4 12-12 12H44c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-96c0 6.6-5.4 12-12 12H44c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-96c0 6.6-5.4 12-12 12H44c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm272 208c0 6.6-5.4 12-12 12H156c-6.6 0-12-5.4-12-12v-96c0-6.6 5.4-12 12-12h200c6.6 0 12 5.4 12 12v96zm0-168c0 6.6-5.4 12-12 12H156c-6.6 0-12-5.4-12-12v-96c0-6.6 5.4-12 12-12h200c6.6 0 12 5.4 12 12v96zm112 152c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-96c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-96c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40z"]
};
var faFilter = {
prefix: 'fas',
iconName: 'filter',
icon: [512, 512, [], "f0b0", "M487.976 0H24.028C2.71 0-8.047 25.866 7.058 40.971L192 225.941V432c0 7.831 3.821 15.17 10.237 19.662l80 55.98C298.02 518.69 320 507.493 320 487.98V225.941l184.947-184.97C520.021 25.896 509.338 0 487.976 0z"]
};
var faFingerprint = {
prefix: 'fas',
iconName: 'fingerprint',
icon: [512, 512, [], "f577", "M256.12 245.96c-13.25 0-24 10.74-24 24 1.14 72.25-8.14 141.9-27.7 211.55-2.73 9.72 2.15 30.49 23.12 30.49 10.48 0 20.11-6.92 23.09-17.52 13.53-47.91 31.04-125.41 29.48-224.52.01-13.25-10.73-24-23.99-24zm-.86-81.73C194 164.16 151.25 211.3 152.1 265.32c.75 47.94-3.75 95.91-13.37 142.55-2.69 12.98 5.67 25.69 18.64 28.36 13.05 2.67 25.67-5.66 28.36-18.64 10.34-50.09 15.17-101.58 14.37-153.02-.41-25.95 19.92-52.49 54.45-52.34 31.31.47 57.15 25.34 57.62 55.47.77 48.05-2.81 96.33-10.61 143.55-2.17 13.06 6.69 25.42 19.76 27.58 19.97 3.33 26.81-15.1 27.58-19.77 8.28-50.03 12.06-101.21 11.27-152.11-.88-55.8-47.94-101.88-104.91-102.72zm-110.69-19.78c-10.3-8.34-25.37-6.8-33.76 3.48-25.62 31.5-39.39 71.28-38.75 112 .59 37.58-2.47 75.27-9.11 112.05-2.34 13.05 6.31 25.53 19.36 27.89 20.11 3.5 27.07-14.81 27.89-19.36 7.19-39.84 10.5-80.66 9.86-121.33-.47-29.88 9.2-57.88 28-80.97 8.35-10.28 6.79-25.39-3.49-33.76zm109.47-62.33c-15.41-.41-30.87 1.44-45.78 4.97-12.89 3.06-20.87 15.98-17.83 28.89 3.06 12.89 16 20.83 28.89 17.83 11.05-2.61 22.47-3.77 34-3.69 75.43 1.13 137.73 61.5 138.88 134.58.59 37.88-1.28 76.11-5.58 113.63-1.5 13.17 7.95 25.08 21.11 26.58 16.72 1.95 25.51-11.88 26.58-21.11a929.06 929.06 0 0 0 5.89-119.85c-1.56-98.75-85.07-180.33-186.16-181.83zm252.07 121.45c-2.86-12.92-15.51-21.2-28.61-18.27-12.94 2.86-21.12 15.66-18.26 28.61 4.71 21.41 4.91 37.41 4.7 61.6-.11 13.27 10.55 24.09 23.8 24.2h.2c13.17 0 23.89-10.61 24-23.8.18-22.18.4-44.11-5.83-72.34zm-40.12-90.72C417.29 43.46 337.6 1.29 252.81.02 183.02-.82 118.47 24.91 70.46 72.94 24.09 119.37-.9 181.04.14 246.65l-.12 21.47c-.39 13.25 10.03 24.31 23.28 24.69.23.02.48.02.72.02 12.92 0 23.59-10.3 23.97-23.3l.16-23.64c-.83-52.5 19.16-101.86 56.28-139 38.76-38.8 91.34-59.67 147.68-58.86 69.45 1.03 134.73 35.56 174.62 92.39 7.61 10.86 22.56 13.45 33.42 5.86 10.84-7.62 13.46-22.59 5.84-33.43z"]
};
var faFire = {
prefix: 'fas',
iconName: 'fire',
icon: [384, 512, [], "f06d", "M216 23.86c0-23.8-30.65-32.77-44.15-13.04C48 191.85 224 200 224 288c0 35.63-29.11 64.46-64.85 63.99-35.17-.45-63.15-29.77-63.15-64.94v-85.51c0-21.7-26.47-32.23-41.43-16.5C27.8 213.16 0 261.33 0 320c0 105.87 86.13 192 192 192s192-86.13 192-192c0-170.29-168-193-168-296.14z"]
};
var faFireAlt = {
prefix: 'fas',
iconName: 'fire-alt',
icon: [448, 512, [], "f7e4", "M323.56 51.2c-20.8 19.3-39.58 39.59-56.22 59.97C240.08 73.62 206.28 35.53 168 0 69.74 91.17 0 209.96 0 281.6 0 408.85 100.29 512 224 512s224-103.15 224-230.4c0-53.27-51.98-163.14-124.44-230.4zm-19.47 340.65C282.43 407.01 255.72 416 226.86 416 154.71 416 96 368.26 96 290.75c0-38.61 24.31-72.63 72.79-130.75 6.93 7.98 98.83 125.34 98.83 125.34l58.63-66.88c4.14 6.85 7.91 13.55 11.27 19.97 27.35 52.19 15.81 118.97-33.43 153.42z"]
};
var faFireExtinguisher = {
prefix: 'fas',
iconName: 'fire-extinguisher',
icon: [448, 512, [], "f134", "M434.027 26.329l-168 28C254.693 56.218 256 67.8 256 72h-58.332C208.353 36.108 181.446 0 144 0c-39.435 0-66.368 39.676-52.228 76.203-52.039 13.051-75.381 54.213-90.049 90.884-4.923 12.307 1.063 26.274 13.37 31.197 12.317 4.926 26.279-1.075 31.196-13.37C75.058 112.99 106.964 120 168 120v27.076c-41.543 10.862-72 49.235-72 94.129V488c0 13.255 10.745 24 24 24h144c13.255 0 24-10.745 24-24V240c0-44.731-30.596-82.312-72-92.97V120h40c0 2.974-1.703 15.716 10.027 17.671l168 28C441.342 166.89 448 161.25 448 153.834V38.166c0-7.416-6.658-13.056-13.973-11.837zM144 72c-8.822 0-16-7.178-16-16s7.178-16 16-16 16 7.178 16 16-7.178 16-16 16z"]
};
var faFirstAid = {
prefix: 'fas',
iconName: 'first-aid',
icon: [576, 512, [], "f479", "M0 80v352c0 26.5 21.5 48 48 48h48V32H48C21.5 32 0 53.5 0 80zm128 400h320V32H128v448zm64-248c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8v48c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48zM528 32h-48v448h48c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48z"]
};
var faFish = {
prefix: 'fas',
iconName: 'fish',
icon: [576, 512, [], "f578", "M327.1 96c-89.97 0-168.54 54.77-212.27 101.63L27.5 131.58c-12.13-9.18-30.24.6-27.14 14.66L24.54 256 .35 365.77c-3.1 14.06 15.01 23.83 27.14 14.66l87.33-66.05C158.55 361.23 237.13 416 327.1 416 464.56 416 576 288 576 256S464.56 96 327.1 96zm87.43 184c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24 13.26 0 24 10.74 24 24 0 13.25-10.75 24-24 24z"]
};
var faFistRaised = {
prefix: 'fas',
iconName: 'fist-raised',
icon: [384, 512, [], "f6de", "M255.98 160V16c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v146.93c5.02-1.78 10.34-2.93 15.97-2.93h48.03zm128 95.99c-.01-35.34-28.66-63.99-63.99-63.99H207.85c-8.78 0-15.9 7.07-15.9 15.85v.56c0 26.27 21.3 47.59 47.57 47.59h35.26c9.68 0 13.2 3.58 13.2 8v16.2c0 4.29-3.59 7.78-7.88 8-44.52 2.28-64.16 24.71-96.05 72.55l-6.31 9.47a7.994 7.994 0 0 1-11.09 2.22l-13.31-8.88a7.994 7.994 0 0 1-2.22-11.09l6.31-9.47c15.73-23.6 30.2-43.26 47.31-58.08-17.27-5.51-31.4-18.12-38.87-34.45-6.59 3.41-13.96 5.52-21.87 5.52h-32c-12.34 0-23.49-4.81-32-12.48C71.48 251.19 60.33 256 48 256H16c-5.64 0-10.97-1.15-16-2.95v77.93c0 33.95 13.48 66.5 37.49 90.51L63.99 448v64h255.98v-63.96l35.91-35.92A96.035 96.035 0 0 0 384 344.21l-.02-88.22zm-32.01-90.09V48c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v112h32c11.28 0 21.94 2.31 32 5.9zM16 224h32c8.84 0 16-7.16 16-16V80c0-8.84-7.16-16-16-16H16C7.16 64 0 71.16 0 80v128c0 8.84 7.16 16 16 16zm95.99 0h32c8.84 0 16-7.16 16-16V48c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v160c0 8.84 7.16 16 16 16z"]
};
var faFlag = {
prefix: 'fas',
iconName: 'flag',
icon: [512, 512, [], "f024", "M349.565 98.783C295.978 98.783 251.721 64 184.348 64c-24.955 0-47.309 4.384-68.045 12.013a55.947 55.947 0 0 0 3.586-23.562C118.117 24.015 94.806 1.206 66.338.048 34.345-1.254 8 24.296 8 56c0 19.026 9.497 35.825 24 45.945V488c0 13.255 10.745 24 24 24h16c13.255 0 24-10.745 24-24v-94.4c28.311-12.064 63.582-22.122 114.435-22.122 53.588 0 97.844 34.783 165.217 34.783 48.169 0 86.667-16.294 122.505-40.858C506.84 359.452 512 349.571 512 339.045v-243.1c0-23.393-24.269-38.87-45.485-29.016-34.338 15.948-76.454 31.854-116.95 31.854z"]
};
var faFlagCheckered = {
prefix: 'fas',
iconName: 'flag-checkered',
icon: [512, 512, [], "f11e", "M243.2 189.9V258c26.1 5.9 49.3 15.6 73.6 22.3v-68.2c-26-5.8-49.4-15.5-73.6-22.2zm223.3-123c-34.3 15.9-76.5 31.9-117 31.9C296 98.8 251.7 64 184.3 64c-25 0-47.3 4.4-68 12 2.8-7.3 4.1-15.2 3.6-23.6C118.1 24 94.8 1.2 66.3 0 34.3-1.3 8 24.3 8 56c0 19 9.5 35.8 24 45.9V488c0 13.3 10.7 24 24 24h16c13.3 0 24-10.7 24-24v-94.4c28.3-12.1 63.6-22.1 114.4-22.1 53.6 0 97.8 34.8 165.2 34.8 48.2 0 86.7-16.3 122.5-40.9 8.7-6 13.8-15.8 13.8-26.4V95.9c.1-23.3-24.2-38.8-45.4-29zM169.6 325.5c-25.8 2.7-50 8.2-73.6 16.6v-70.5c26.2-9.3 47.5-15 73.6-17.4zM464 191c-23.6 9.8-46.3 19.5-73.6 23.9V286c24.8-3.4 51.4-11.8 73.6-26v70.5c-25.1 16.1-48.5 24.7-73.6 27.1V286c-27 3.7-47.9 1.5-73.6-5.6v67.4c-23.9-7.4-47.3-16.7-73.6-21.3V258c-19.7-4.4-40.8-6.8-73.6-3.8v-70c-22.4 3.1-44.6 10.2-73.6 20.9v-70.5c33.2-12.2 50.1-19.8 73.6-22v71.6c27-3.7 48.4-1.3 73.6 5.7v-67.4c23.7 7.4 47.2 16.7 73.6 21.3v68.4c23.7 5.3 47.6 6.9 73.6 2.7V143c27-4.8 52.3-13.6 73.6-22.5z"]
};
var faFlagUsa = {
prefix: 'fas',
iconName: 'flag-usa',
icon: [512, 512, [], "f74d", "M32 0C14.3 0 0 14.3 0 32v464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V32C64 14.3 49.7 0 32 0zm267.9 303.6c-57.2-15.1-111.7-28.8-203.9 11.1V384c185.7-92.2 221.7 53.3 397.5-23.1 11.4-5 18.5-16.5 18.5-28.8v-36c-43.6 17.3-80.2 24.1-112.1 24.1-37.4-.1-68.9-8.4-100-16.6zm0-96c-57.2-15.1-111.7-28.8-203.9 11.1v61.5c94.8-37.6 154.6-22.7 212.1-7.6 57.2 15.1 111.7 28.8 203.9-11.1V200c-43.6 17.3-80.2 24.1-112.1 24.1-37.4 0-68.9-8.3-100-16.5zm9.5-125.9c51.8 15.6 97.4 29 202.6-20.1V30.8c0-25.1-26.8-38.1-49.4-26.6C291.3 91.5 305.4-62.2 96 32.4v151.9c94.8-37.5 154.6-22.7 212.1-7.6 57.2 15 111.7 28.7 203.9-11.1V96.7c-53.6 23.5-93.3 31.4-126.1 31.4s-59-7.8-85.7-15.9c-4-1.2-8.1-2.4-12.1-3.5V75.5c7.2 2 14.3 4.1 21.3 6.2zM160 128.1c-8.8 0-16-7.1-16-16 0-8.8 7.2-16 16-16s16 7.1 16 16-7.2 16-16 16zm0-55.8c-8.8 0-16-7.1-16-16 0-8.8 7.2-16 16-16s16 7.1 16 16c0 8.8-7.2 16-16 16zm64 47.9c-8.8 0-16-7.1-16-16 0-8.8 7.2-16 16-16s16 7.1 16 16c0 8.8-7.2 16-16 16zm0-55.9c-8.8 0-16-7.1-16-16 0-8.8 7.2-16 16-16s16 7.1 16 16c0 8.8-7.2 16-16 16z"]
};
var faFlask = {
prefix: 'fas',
iconName: 'flask',
icon: [448, 512, [], "f0c3", "M437.2 403.5L320 215V64h8c13.3 0 24-10.7 24-24V24c0-13.3-10.7-24-24-24H120c-13.3 0-24 10.7-24 24v16c0 13.3 10.7 24 24 24h8v151L10.8 403.5C-18.5 450.6 15.3 512 70.9 512h306.2c55.7 0 89.4-61.5 60.1-108.5zM137.9 320l48.2-77.6c3.7-5.2 5.8-11.6 5.8-18.4V64h64v160c0 6.9 2.2 13.2 5.8 18.4l48.2 77.6h-172z"]
};
var faFlushed = {
prefix: 'fas',
iconName: 'flushed',
icon: [496, 512, [], "f579", "M344 200c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm-192 0c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zM248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM80 224c0-39.8 32.2-72 72-72s72 32.2 72 72-32.2 72-72 72-72-32.2-72-72zm232 176H184c-21.2 0-21.2-32 0-32h128c21.2 0 21.2 32 0 32zm32-104c-39.8 0-72-32.2-72-72s32.2-72 72-72 72 32.2 72 72-32.2 72-72 72z"]
};
var faFolder = {
prefix: 'fas',
iconName: 'folder',
icon: [512, 512, [], "f07b", "M464 128H272l-64-64H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V176c0-26.51-21.49-48-48-48z"]
};
var faFolderMinus = {
prefix: 'fas',
iconName: 'folder-minus',
icon: [512, 512, [], "f65d", "M464 128H272l-64-64H48C21.49 64 0 85.49 0 112v288c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V176c0-26.51-21.49-48-48-48zm-96 168c0 8.84-7.16 16-16 16H160c-8.84 0-16-7.16-16-16v-16c0-8.84 7.16-16 16-16h192c8.84 0 16 7.16 16 16v16z"]
};
var faFolderOpen = {
prefix: 'fas',
iconName: 'folder-open',
icon: [576, 512, [], "f07c", "M572.694 292.093L500.27 416.248A63.997 63.997 0 0 1 444.989 448H45.025c-18.523 0-30.064-20.093-20.731-36.093l72.424-124.155A64 64 0 0 1 152 256h399.964c18.523 0 30.064 20.093 20.73 36.093zM152 224h328v-48c0-26.51-21.49-48-48-48H272l-64-64H48C21.49 64 0 85.49 0 112v278.046l69.077-118.418C86.214 242.25 117.989 224 152 224z"]
};
var faFolderPlus = {
prefix: 'fas',
iconName: 'folder-plus',
icon: [512, 512, [], "f65e", "M464,128H272L208,64H48A48,48,0,0,0,0,112V400a48,48,0,0,0,48,48H464a48,48,0,0,0,48-48V176A48,48,0,0,0,464,128ZM359.5,296a16,16,0,0,1-16,16h-64v64a16,16,0,0,1-16,16h-16a16,16,0,0,1-16-16V312h-64a16,16,0,0,1-16-16V280a16,16,0,0,1,16-16h64V200a16,16,0,0,1,16-16h16a16,16,0,0,1,16,16v64h64a16,16,0,0,1,16,16Z"]
};
var faFont = {
prefix: 'fas',
iconName: 'font',
icon: [448, 512, [], "f031", "M432 416h-23.41L277.88 53.69A32 32 0 0 0 247.58 32h-47.16a32 32 0 0 0-30.3 21.69L39.41 416H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-19.58l23.3-64h152.56l23.3 64H304a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM176.85 272L224 142.51 271.15 272z"]
};
var faFontAwesomeLogoFull = {
prefix: 'fas',
iconName: 'font-awesome-logo-full',
icon: [3992, 512, ["Font Awesome"], "f4e6", "M454.6 0H57.4C25.9 0 0 25.9 0 57.4v397.3C0 486.1 25.9 512 57.4 512h397.3c31.4 0 57.4-25.9 57.4-57.4V57.4C512 25.9 486.1 0 454.6 0zm-58.9 324.9c0 4.8-4.1 6.9-8.9 8.9-19.2 8.1-39.7 15.7-61.5 15.7-40.5 0-68.7-44.8-163.2 2.5v51.8c0 30.3-45.7 30.2-45.7 0v-250c-9-7-15-17.9-15-30.3 0-21 17.1-38.2 38.2-38.2 21 0 38.2 17.1 38.2 38.2 0 12.2-5.8 23.2-14.9 30.2v21c37.1-12 65.5-34.4 146.1-3.4 26.6 11.4 68.7-15.7 76.5-15.7 5.5 0 10.3 4.1 10.3 8.9v160.4zm432.9-174.2h-137v70.1H825c39.8 0 40.4 62.2 0 62.2H691.6v105.6c0 45.5-70.7 46.4-70.7 0V128.3c0-22 18-39.8 39.8-39.8h167.8c39.6 0 40.5 62.2.1 62.2zm191.1 23.4c-169.3 0-169.1 252.4 0 252.4 169.9 0 169.9-252.4 0-252.4zm0 196.1c-81.6 0-82.1-139.8 0-139.8 82.5 0 82.4 139.8 0 139.8zm372.4 53.4c-17.5 0-31.4-13.9-31.4-31.4v-117c0-62.4-72.6-52.5-99.1-16.4v133.4c0 41.5-63.3 41.8-63.3 0V208c0-40 63.1-41.6 63.1 0v3.4c43.3-51.6 162.4-60.4 162.4 39.3v141.5c.3 30.4-31.5 31.4-31.7 31.4zm179.7 2.9c-44.3 0-68.3-22.9-68.3-65.8V235.2H1488c-35.6 0-36.7-55.3 0-55.3h15.5v-37.3c0-41.3 63.8-42.1 63.8 0v37.5h24.9c35.4 0 35.7 55.3 0 55.3h-24.9v108.5c0 29.6 26.1 26.3 27.4 26.3 31.4 0 52.6 56.3-22.9 56.3zM1992 123c-19.5-50.2-95.5-50-114.5 0-107.3 275.7-99.5 252.7-99.5 262.8 0 42.8 58.3 51.2 72.1 14.4l13.5-35.9H2006l13 35.9c14.2 37.7 72.1 27.2 72.1-14.4 0-10.1 5.3 6.8-99.1-262.8zm-108.9 179.1l51.7-142.9 51.8 142.9h-103.5zm591.3-85.6l-53.7 176.3c-12.4 41.2-72 41-84 0l-42.3-135.9-42.3 135.9c-12.4 40.9-72 41.2-84.5 0l-54.2-176.3c-12.5-39.4 49.8-56.1 60.2-16.9L2213 342l45.3-139.5c10.9-32.7 59.6-34.7 71.2 0l45.3 139.5 39.3-142.4c10.3-38.3 72.6-23.8 60.3 16.9zm275.4 75.1c0-42.4-33.9-117.5-119.5-117.5-73.2 0-124.4 56.3-124.4 126 0 77.2 55.3 126.4 128.5 126.4 31.7 0 93-11.5 93-39.8 0-18.3-21.1-31.5-39.3-22.4-49.4 26.2-109 8.4-115.9-43.8h148.3c16.3 0 29.3-13.4 29.3-28.9zM2571 277.7c9.5-73.4 113.9-68.6 118.6 0H2571zm316.7 148.8c-31.4 0-81.6-10.5-96.6-31.9-12.4-17 2.5-39.8 21.8-39.8 16.3 0 36.8 22.9 77.7 22.9 27.4 0 40.4-11 40.4-25.8 0-39.8-142.9-7.4-142.9-102 0-40.4 35.3-75.7 98.6-75.7 31.4 0 74.1 9.9 87.6 29.4 10.8 14.8-1.4 36.2-20.9 36.2-15.1 0-26.7-17.3-66.2-17.3-22.9 0-37.8 10.5-37.8 23.8 0 35.9 142.4 6 142.4 103.1-.1 43.7-37.4 77.1-104.1 77.1zm266.8-252.4c-169.3 0-169.1 252.4 0 252.4 170.1 0 169.6-252.4 0-252.4zm0 196.1c-81.8 0-82-139.8 0-139.8 82.5 0 82.4 139.8 0 139.8zm476.9 22V268.7c0-53.8-61.4-45.8-85.7-10.5v134c0 41.3-63.8 42.1-63.8 0V268.7c0-52.1-59.5-47.4-85.7-10.1v133.6c0 41.5-63.3 41.8-63.3 0V208c0-40 63.1-41.6 63.1 0v3.4c9.9-14.4 41.8-37.3 78.6-37.3 35.3 0 57.7 16.4 66.7 43.8 13.9-21.8 45.8-43.8 82.6-43.8 44.3 0 70.7 23.4 70.7 72.7v145.3c.5 17.3-13.5 31.4-31.9 31.4 3.5.1-31.3 1.1-31.3-31.3zM3992 291.6c0-42.4-32.4-117.5-117.9-117.5-73.2 0-127.5 56.3-127.5 126 0 77.2 58.3 126.4 131.6 126.4 31.7 0 91.5-11.5 91.5-39.8 0-18.3-21.1-31.5-39.3-22.4-49.4 26.2-110.5 8.4-117.5-43.8h149.8c16.3 0 29.1-13.4 29.3-28.9zm-180.5-13.9c9.7-74.4 115.9-68.3 120.1 0h-120.1z"]
};
var faFootballBall = {
prefix: 'fas',
iconName: 'football-ball',
icon: [496, 512, [], "f44e", "M481.5 60.3c-4.8-18.2-19.1-32.5-37.3-37.4C420.3 16.5 383 8.9 339.4 8L496 164.8c-.8-43.5-8.2-80.6-14.5-104.5zm-467 391.4c4.8 18.2 19.1 32.5 37.3 37.4 23.9 6.4 61.2 14 104.8 14.9L0 347.2c.8 43.5 8.2 80.6 14.5 104.5zM4.2 283.4L220.4 500c132.5-19.4 248.8-118.7 271.5-271.4L275.6 12C143.1 31.4 26.8 130.7 4.2 283.4zm317.3-123.6c3.1-3.1 8.2-3.1 11.3 0l11.3 11.3c3.1 3.1 3.1 8.2 0 11.3l-28.3 28.3 28.3 28.3c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0l-28.3-28.3-22.6 22.7 28.3 28.3c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0L248 278.6l-22.6 22.6 28.3 28.3c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0l-28.3-28.3-28.3 28.3c-3.1 3.1-8.2 3.1-11.3 0l-11.3-11.3c-3.1-3.1-3.1-8.2 0-11.3l28.3-28.3-28.3-28.2c-3.1-3.1-3.1-8.2 0-11.3l11.3-11.3c3.1-3.1 8.2-3.1 11.3 0l28.3 28.3 22.6-22.6-28.3-28.3c-3.1-3.1-3.1-8.2 0-11.3l11.3-11.3c3.1-3.1 8.2-3.1 11.3 0l28.3 28.3 22.6-22.6-28.3-28.3c-3.1-3.1-3.1-8.2 0-11.3l11.3-11.3c3.1-3.1 8.2-3.1 11.3 0l28.3 28.3 28.3-28.5z"]
};
var faForward = {
prefix: 'fas',
iconName: 'forward',
icon: [512, 512, [], "f04e", "M500.5 231.4l-192-160C287.9 54.3 256 68.6 256 96v320c0 27.4 31.9 41.8 52.5 24.6l192-160c15.3-12.8 15.3-36.4 0-49.2zm-256 0l-192-160C31.9 54.3 0 68.6 0 96v320c0 27.4 31.9 41.8 52.5 24.6l192-160c15.3-12.8 15.3-36.4 0-49.2z"]
};
var faFrog = {
prefix: 'fas',
iconName: 'frog',
icon: [576, 512, [], "f52e", "M446.53 97.43C439.67 60.23 407.19 32 368 32c-39.23 0-71.72 28.29-78.54 65.54C126.75 112.96-.5 250.12 0 416.98.11 451.9 29.08 480 64 480h304c8.84 0 16-7.16 16-16 0-17.67-14.33-32-32-32h-79.49l35.8-48.33c24.14-36.23 10.35-88.28-33.71-106.6-23.89-9.93-51.55-4.65-72.24 10.88l-32.76 24.59c-7.06 5.31-17.09 3.91-22.41-3.19-5.3-7.08-3.88-17.11 3.19-22.41l34.78-26.09c36.84-27.66 88.28-27.62 125.13 0 10.87 8.15 45.87 39.06 40.8 93.21L469.62 480H560c8.84 0 16-7.16 16-16 0-17.67-14.33-32-32-32h-53.63l-98.52-104.68 154.44-86.65A58.16 58.16 0 0 0 576 189.94c0-21.4-11.72-40.95-30.48-51.23-40.56-22.22-98.99-41.28-98.99-41.28zM368 136c-13.26 0-24-10.75-24-24 0-13.26 10.74-24 24-24 13.25 0 24 10.74 24 24 0 13.25-10.75 24-24 24z"]
};
var faFrown = {
prefix: 'fas',
iconName: 'frown',
icon: [496, 512, [], "f119", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 168c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm-160 0c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm170.2 218.2C315.8 367.4 282.9 352 248 352s-67.8 15.4-90.2 42.2c-13.5 16.3-38.1-4.2-24.6-20.5C161.7 339.6 203.6 320 248 320s86.3 19.6 114.7 53.8c13.6 16.2-11 36.7-24.5 20.4z"]
};
var faFrownOpen = {
prefix: 'fas',
iconName: 'frown-open',
icon: [496, 512, [], "f57a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM136 208c0-17.7 14.3-32 32-32s32 14.3 32 32-14.3 32-32 32-32-14.3-32-32zm187.3 183.3c-31.2-9.6-59.4-15.3-75.3-15.3s-44.1 5.7-75.3 15.3c-11.5 3.5-22.5-6.3-20.5-18.1 7-40 60.1-61.2 95.8-61.2s88.8 21.3 95.8 61.2c2 11.9-9.1 21.6-20.5 18.1zM328 240c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faFunnelDollar = {
prefix: 'fas',
iconName: 'funnel-dollar',
icon: [640, 512, [], "f662", "M433.46 165.94l101.2-111.87C554.61 34.12 540.48 0 512.26 0H31.74C3.52 0-10.61 34.12 9.34 54.07L192 256v155.92c0 12.59 5.93 24.44 16 32l79.99 60c20.86 15.64 48.47 6.97 59.22-13.57C310.8 455.38 288 406.35 288 352c0-89.79 62.05-165.17 145.46-186.06zM480 192c-88.37 0-160 71.63-160 160s71.63 160 160 160 160-71.63 160-160-71.63-160-160-160zm16 239.88V448c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-16.29c-11.29-.58-22.27-4.52-31.37-11.35-3.9-2.93-4.1-8.77-.57-12.14l11.75-11.21c2.77-2.64 6.89-2.76 10.13-.73 3.87 2.42 8.26 3.72 12.82 3.72h28.11c6.5 0 11.8-5.92 11.8-13.19 0-5.95-3.61-11.19-8.77-12.73l-45-13.5c-18.59-5.58-31.58-23.42-31.58-43.39 0-24.52 19.05-44.44 42.67-45.07V256c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16.29c11.29.58 22.27 4.51 31.37 11.35 3.9 2.93 4.1 8.77.57 12.14l-11.75 11.21c-2.77 2.64-6.89 2.76-10.13.73-3.87-2.43-8.26-3.72-12.82-3.72h-28.11c-6.5 0-11.8 5.92-11.8 13.19 0 5.95 3.61 11.19 8.77 12.73l45 13.5c18.59 5.58 31.58 23.42 31.58 43.39 0 24.53-19.04 44.44-42.67 45.07z"]
};
var faFutbol = {
prefix: 'fas',
iconName: 'futbol',
icon: [512, 512, [], "f1e3", "M504 256c0 136.967-111.033 248-248 248S8 392.967 8 256 119.033 8 256 8s248 111.033 248 248zm-48 0l-.003-.282-26.064 22.741-62.679-58.5 16.454-84.355 34.303 3.072c-24.889-34.216-60.004-60.089-100.709-73.141l13.651 31.939L256 139l-74.953-41.525 13.651-31.939c-40.631 13.028-75.78 38.87-100.709 73.141l34.565-3.073 16.192 84.355-62.678 58.5-26.064-22.741-.003.282c0 43.015 13.497 83.952 38.472 117.991l7.704-33.897 85.138 10.447 36.301 77.826-29.902 17.786c40.202 13.122 84.29 13.148 124.572 0l-29.902-17.786 36.301-77.826 85.138-10.447 7.704 33.897C442.503 339.952 456 299.015 456 256zm-248.102 69.571l-29.894-91.312L256 177.732l77.996 56.527-29.622 91.312h-96.476z"]
};
var faGamepad = {
prefix: 'fas',
iconName: 'gamepad',
icon: [640, 512, [], "f11b", "M480.07 96H160a160 160 0 1 0 114.24 272h91.52A160 160 0 1 0 480.07 96zM248 268a12 12 0 0 1-12 12h-52v52a12 12 0 0 1-12 12h-24a12 12 0 0 1-12-12v-52H84a12 12 0 0 1-12-12v-24a12 12 0 0 1 12-12h52v-52a12 12 0 0 1 12-12h24a12 12 0 0 1 12 12v52h52a12 12 0 0 1 12 12zm216 76a40 40 0 1 1 40-40 40 40 0 0 1-40 40zm64-96a40 40 0 1 1 40-40 40 40 0 0 1-40 40z"]
};
var faGasPump = {
prefix: 'fas',
iconName: 'gas-pump',
icon: [512, 512, [], "f52f", "M336 448H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h320c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm157.2-340.7l-81-81c-6.2-6.2-16.4-6.2-22.6 0l-11.3 11.3c-6.2 6.2-6.2 16.4 0 22.6L416 97.9V160c0 28.1 20.9 51.3 48 55.2V376c0 13.2-10.8 24-24 24s-24-10.8-24-24v-32c0-48.6-39.4-88-88-88h-8V64c0-35.3-28.7-64-64-64H96C60.7 0 32 28.7 32 64v352h288V304h8c22.1 0 40 17.9 40 40v27.8c0 37.7 27 72 64.5 75.9 43 4.3 79.5-29.5 79.5-71.7V152.6c0-17-6.8-33.3-18.8-45.3zM256 192H96V64h160v128z"]
};
var faGavel = {
prefix: 'fas',
iconName: 'gavel',
icon: [512, 512, [], "f0e3", "M504.971 199.362l-22.627-22.627c-9.373-9.373-24.569-9.373-33.941 0l-5.657 5.657L329.608 69.255l5.657-5.657c9.373-9.373 9.373-24.569 0-33.941L312.638 7.029c-9.373-9.373-24.569-9.373-33.941 0L154.246 131.48c-9.373 9.373-9.373 24.569 0 33.941l22.627 22.627c9.373 9.373 24.569 9.373 33.941 0l5.657-5.657 39.598 39.598-81.04 81.04-5.657-5.657c-12.497-12.497-32.758-12.497-45.255 0L9.373 412.118c-12.497 12.497-12.497 32.758 0 45.255l45.255 45.255c12.497 12.497 32.758 12.497 45.255 0l114.745-114.745c12.497-12.497 12.497-32.758 0-45.255l-5.657-5.657 81.04-81.04 39.598 39.598-5.657 5.657c-9.373 9.373-9.373 24.569 0 33.941l22.627 22.627c9.373 9.373 24.569 9.373 33.941 0l124.451-124.451c9.372-9.372 9.372-24.568 0-33.941z"]
};
var faGem = {
prefix: 'fas',
iconName: 'gem',
icon: [576, 512, [], "f3a5", "M485.5 0L576 160H474.9L405.7 0h79.8zm-128 0l69.2 160H149.3L218.5 0h139zm-267 0h79.8l-69.2 160H0L90.5 0zM0 192h100.7l123 251.7c1.5 3.1-2.7 5.9-5 3.3L0 192zm148.2 0h279.6l-137 318.2c-1 2.4-4.5 2.4-5.5 0L148.2 192zm204.1 251.7l123-251.7H576L357.3 446.9c-2.3 2.7-6.5-.1-5-3.2z"]
};
var faGenderless = {
prefix: 'fas',
iconName: 'genderless',
icon: [288, 512, [], "f22d", "M144 176c44.1 0 80 35.9 80 80s-35.9 80-80 80-80-35.9-80-80 35.9-80 80-80m0-64C64.5 112 0 176.5 0 256s64.5 144 144 144 144-64.5 144-144-64.5-144-144-144z"]
};
var faGhost = {
prefix: 'fas',
iconName: 'ghost',
icon: [384, 512, [], "f6e2", "M186.1.09C81.01 3.24 0 94.92 0 200.05v263.92c0 14.26 17.23 21.39 27.31 11.31l24.92-18.53c6.66-4.95 16-3.99 21.51 2.21l42.95 48.35c6.25 6.25 16.38 6.25 22.63 0l40.72-45.85c6.37-7.17 17.56-7.17 23.92 0l40.72 45.85c6.25 6.25 16.38 6.25 22.63 0l42.95-48.35c5.51-6.2 14.85-7.17 21.51-2.21l24.92 18.53c10.08 10.08 27.31 2.94 27.31-11.31V192C384 84 294.83-3.17 186.1.09zM128 224c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm128 0c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faGift = {
prefix: 'fas',
iconName: 'gift',
icon: [512, 512, [], "f06b", "M32 448c0 17.7 14.3 32 32 32h160V320H32v128zm256 32h160c17.7 0 32-14.3 32-32V320H288v160zm192-320h-42.1c6.2-12.1 10.1-25.5 10.1-40 0-48.5-39.5-88-88-88-41.6 0-68.5 21.3-103 68.3-34.5-47-61.4-68.3-103-68.3-48.5 0-88 39.5-88 88 0 14.5 3.8 27.9 10.1 40H32c-17.7 0-32 14.3-32 32v80c0 8.8 7.2 16 16 16h480c8.8 0 16-7.2 16-16v-80c0-17.7-14.3-32-32-32zm-326.1 0c-22.1 0-40-17.9-40-40s17.9-40 40-40c19.9 0 34.6 3.3 86.1 80h-86.1zm206.1 0h-86.1c51.4-76.5 65.7-80 86.1-80 22.1 0 40 17.9 40 40s-17.9 40-40 40z"]
};
var faGifts = {
prefix: 'fas',
iconName: 'gifts',
icon: [640, 512, [], "f79c", "M240.6 194.1c1.9-30.8 17.3-61.2 44-79.8C279.4 103.5 268.7 96 256 96h-29.4l30.7-22c7.2-5.1 8.9-15.1 3.7-22.3l-9.3-13c-5.1-7.2-15.1-8.9-22.3-3.7l-32 22.9 11.5-30.6c3.1-8.3-1.1-17.5-9.4-20.6l-15-5.6c-8.3-3.1-17.5 1.1-20.6 9.4l-19.9 53-19.9-53.1C121 2.1 111.8-2.1 103.5 1l-15 5.6C80.2 9.7 76 19 79.2 27.2l11.5 30.6L58.6 35c-7.2-5.1-17.2-3.5-22.3 3.7l-9.3 13c-5.1 7.2-3.5 17.2 3.7 22.3l30.7 22H32c-17.7 0-32 14.3-32 32v352c0 17.7 14.3 32 32 32h168.9c-5.5-9.5-8.9-20.3-8.9-32V256c0-29.9 20.8-55 48.6-61.9zM224 480c0 17.7 14.3 32 32 32h160V384H224v96zm224 32h160c17.7 0 32-14.3 32-32v-96H448v128zm160-288h-20.4c2.6-7.6 4.4-15.5 4.4-23.8 0-35.5-27-72.2-72.1-72.2-48.1 0-75.9 47.7-87.9 75.3-12.1-27.6-39.9-75.3-87.9-75.3-45.1 0-72.1 36.7-72.1 72.2 0 8.3 1.7 16.2 4.4 23.8H256c-17.7 0-32 14.3-32 32v96h192V224h15.3l.7-.2.7.2H448v128h192v-96c0-17.7-14.3-32-32-32zm-272 0c-2.7-1.4-5.1-3-7.2-4.8-7.3-6.4-8.8-13.8-8.8-19 0-9.7 6.4-24.2 24.1-24.2 18.7 0 35.6 27.4 44.5 48H336zm199.2-4.8c-2.1 1.8-4.5 3.4-7.2 4.8h-52.6c8.8-20.3 25.8-48 44.5-48 17.7 0 24.1 14.5 24.1 24.2 0 5.2-1.5 12.6-8.8 19z"]
};
var faGlassCheers = {
prefix: 'fas',
iconName: 'glass-cheers',
icon: [640, 512, [], "f79f", "M639.4 433.6c-8.4-20.4-31.8-30.1-52.2-21.6l-22.1 9.2-38.7-101.9c47.9-35 64.8-100.3 34.5-152.8L474.3 16c-8-13.9-25.1-19.7-40-13.6L320 49.8 205.7 2.4c-14.9-6.2-32-.3-40 13.6L79.1 166.5C48.9 219 65.7 284.3 113.6 319.2L74.9 421.1l-22.1-9.2c-20.4-8.5-43.7 1.2-52.2 21.6-1.7 4.1.2 8.8 4.3 10.5l162.3 67.4c4.1 1.7 8.7-.2 10.4-4.3 8.4-20.4-1.2-43.8-21.6-52.3l-22.1-9.2L173.3 342c4.4.5 8.8 1.3 13.1 1.3 51.7 0 99.4-33.1 113.4-85.3l20.2-75.4 20.2 75.4c14 52.2 61.7 85.3 113.4 85.3 4.3 0 8.7-.8 13.1-1.3L506 445.6l-22.1 9.2c-20.4 8.5-30.1 31.9-21.6 52.3 1.7 4.1 6.4 6 10.4 4.3L635.1 444c4-1.7 6-6.3 4.3-10.4zM275.9 162.1l-112.1-46.5 36.5-63.4 94.5 39.2-18.9 70.7zm88.2 0l-18.9-70.7 94.5-39.2 36.5 63.4-112.1 46.5z"]
};
var faGlassMartini = {
prefix: 'fas',
iconName: 'glass-martini',
icon: [512, 512, [], "f000", "M502.05 57.6C523.3 36.34 508.25 0 478.2 0H33.8C3.75 0-11.3 36.34 9.95 57.6L224 271.64V464h-56c-22.09 0-40 17.91-40 40 0 4.42 3.58 8 8 8h240c4.42 0 8-3.58 8-8 0-22.09-17.91-40-40-40h-56V271.64L502.05 57.6z"]
};
var faGlassMartiniAlt = {
prefix: 'fas',
iconName: 'glass-martini-alt',
icon: [512, 512, [], "f57b", "M502.05 57.6C523.3 36.34 508.25 0 478.2 0H33.8C3.75 0-11.3 36.34 9.95 57.6L224 271.64V464h-56c-22.09 0-40 17.91-40 40 0 4.42 3.58 8 8 8h240c4.42 0 8-3.58 8-8 0-22.09-17.91-40-40-40h-56V271.64L502.05 57.6zM443.77 48l-48 48H116.24l-48-48h375.53z"]
};
var faGlassWhiskey = {
prefix: 'fas',
iconName: 'glass-whiskey',
icon: [512, 512, [], "f7a0", "M480 32H32C12.5 32-2.4 49.2.3 68.5l56 356.5c4.5 31.5 31.5 54.9 63.4 54.9h273c31.8 0 58.9-23.4 63.4-54.9l55.6-356.5C514.4 49.2 499.5 32 480 32zm-37.4 64l-30 192h-313L69.4 96h373.2z"]
};
var faGlasses = {
prefix: 'fas',
iconName: 'glasses',
icon: [576, 512, [], "f530", "M574.1 280.37L528.75 98.66c-5.91-23.7-21.59-44.05-43-55.81-21.44-11.73-46.97-14.11-70.19-6.33l-15.25 5.08c-8.39 2.79-12.92 11.86-10.12 20.24l5.06 15.18c2.79 8.38 11.85 12.91 20.23 10.12l13.18-4.39c10.87-3.62 23-3.57 33.16 1.73 10.29 5.37 17.57 14.56 20.37 25.82l38.46 153.82c-22.19-6.81-49.79-12.46-81.2-12.46-34.77 0-73.98 7.02-114.85 26.74h-73.18c-40.87-19.74-80.08-26.75-114.86-26.75-31.42 0-59.02 5.65-81.21 12.46l38.46-153.83c2.79-11.25 10.09-20.45 20.38-25.81 10.16-5.3 22.28-5.35 33.15-1.73l13.17 4.39c8.38 2.79 17.44-1.74 20.23-10.12l5.06-15.18c2.8-8.38-1.73-17.45-10.12-20.24l-15.25-5.08c-23.22-7.78-48.75-5.41-70.19 6.33-21.41 11.77-37.09 32.11-43 55.8L1.9 280.37A64.218 64.218 0 0 0 0 295.86v70.25C0 429.01 51.58 480 115.2 480h37.12c60.28 0 110.37-45.94 114.88-105.37l2.93-38.63h35.75l2.93 38.63C313.31 434.06 363.4 480 423.68 480h37.12c63.62 0 115.2-50.99 115.2-113.88v-70.25c0-5.23-.64-10.43-1.9-15.5zm-370.72 89.42c-1.97 25.91-24.4 46.21-51.06 46.21H115.2C86.97 416 64 393.62 64 366.11v-37.54c18.12-6.49 43.42-12.92 72.58-12.92 23.86 0 47.26 4.33 69.93 12.92l-3.13 41.22zM512 366.12c0 27.51-22.97 49.88-51.2 49.88h-37.12c-26.67 0-49.1-20.3-51.06-46.21l-3.13-41.22c22.67-8.59 46.08-12.92 69.95-12.92 29.12 0 54.43 6.44 72.55 12.93v37.54z"]
};
var faGlobe = {
prefix: 'fas',
iconName: 'globe',
icon: [496, 512, [], "f0ac", "M336.5 160C322 70.7 287.8 8 248 8s-74 62.7-88.5 152h177zM152 256c0 22.2 1.2 43.5 3.3 64h185.3c2.1-20.5 3.3-41.8 3.3-64s-1.2-43.5-3.3-64H155.3c-2.1 20.5-3.3 41.8-3.3 64zm324.7-96c-28.6-67.9-86.5-120.4-158-141.6 24.4 33.8 41.2 84.7 50 141.6h108zM177.2 18.4C105.8 39.6 47.8 92.1 19.3 160h108c8.7-56.9 25.5-107.8 49.9-141.6zM487.4 192H372.7c2.1 21 3.3 42.5 3.3 64s-1.2 43-3.3 64h114.6c5.5-20.5 8.6-41.8 8.6-64s-3.1-43.5-8.5-64zM120 256c0-21.5 1.2-43 3.3-64H8.6C3.2 212.5 0 233.8 0 256s3.2 43.5 8.6 64h114.6c-2-21-3.2-42.5-3.2-64zm39.5 96c14.5 89.3 48.7 152 88.5 152s74-62.7 88.5-152h-177zm159.3 141.6c71.4-21.2 129.4-73.7 158-141.6h-108c-8.8 56.9-25.6 107.8-50 141.6zM19.3 352c28.6 67.9 86.5 120.4 158 141.6-24.4-33.8-41.2-84.7-50-141.6h-108z"]
};
var faGlobeAfrica = {
prefix: 'fas',
iconName: 'globe-africa',
icon: [496, 512, [], "f57c", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm160 215.5v6.93c0 5.87-3.32 11.24-8.57 13.86l-15.39 7.7a15.485 15.485 0 0 1-15.53-.97l-18.21-12.14a15.52 15.52 0 0 0-13.5-1.81l-2.65.88c-9.7 3.23-13.66 14.79-7.99 23.3l13.24 19.86c2.87 4.31 7.71 6.9 12.89 6.9h8.21c8.56 0 15.5 6.94 15.5 15.5v11.34c0 3.35-1.09 6.62-3.1 9.3l-18.74 24.98c-1.42 1.9-2.39 4.1-2.83 6.43l-4.3 22.83c-.62 3.29-2.29 6.29-4.76 8.56a159.608 159.608 0 0 0-25 29.16l-13.03 19.55a27.756 27.756 0 0 1-23.09 12.36c-10.51 0-20.12-5.94-24.82-15.34a78.902 78.902 0 0 1-8.33-35.29V367.5c0-8.56-6.94-15.5-15.5-15.5h-25.88c-14.49 0-28.38-5.76-38.63-16a54.659 54.659 0 0 1-16-38.63v-14.06c0-17.19 8.1-33.38 21.85-43.7l27.58-20.69a54.663 54.663 0 0 1 32.78-10.93h.89c8.48 0 16.85 1.97 24.43 5.77l14.72 7.36c3.68 1.84 7.93 2.14 11.83.84l47.31-15.77c6.33-2.11 10.6-8.03 10.6-14.7 0-8.56-6.94-15.5-15.5-15.5h-10.09c-4.11 0-8.05-1.63-10.96-4.54l-6.92-6.92a15.493 15.493 0 0 0-10.96-4.54H199.5c-8.56 0-15.5-6.94-15.5-15.5v-4.4c0-7.11 4.84-13.31 11.74-15.04l14.45-3.61c3.74-.94 7-3.23 9.14-6.44l8.08-12.11c2.87-4.31 7.71-6.9 12.89-6.9h24.21c8.56 0 15.5-6.94 15.5-15.5v-21.7C359.23 71.63 422.86 131.02 441.93 208H423.5c-8.56 0-15.5 6.94-15.5 15.5z"]
};
var faGlobeAmericas = {
prefix: 'fas',
iconName: 'globe-americas',
icon: [496, 512, [], "f57d", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm82.29 357.6c-3.9 3.88-7.99 7.95-11.31 11.28-2.99 3-5.1 6.7-6.17 10.71-1.51 5.66-2.73 11.38-4.77 16.87l-17.39 46.85c-13.76 3-28 4.69-42.65 4.69v-27.38c1.69-12.62-7.64-36.26-22.63-51.25-6-6-9.37-14.14-9.37-22.63v-32.01c0-11.64-6.27-22.34-16.46-27.97-14.37-7.95-34.81-19.06-48.81-26.11-11.48-5.78-22.1-13.14-31.65-21.75l-.8-.72a114.792 114.792 0 0 1-18.06-20.74c-9.38-13.77-24.66-36.42-34.59-51.14 20.47-45.5 57.36-82.04 103.2-101.89l24.01 12.01C203.48 89.74 216 82.01 216 70.11v-11.3c7.99-1.29 16.12-2.11 24.39-2.42l28.3 28.3c6.25 6.25 6.25 16.38 0 22.63L264 112l-10.34 10.34c-3.12 3.12-3.12 8.19 0 11.31l4.69 4.69c3.12 3.12 3.12 8.19 0 11.31l-8 8a8.008 8.008 0 0 1-5.66 2.34h-8.99c-2.08 0-4.08.81-5.58 2.27l-9.92 9.65a8.008 8.008 0 0 0-1.58 9.31l15.59 31.19c2.66 5.32-1.21 11.58-7.15 11.58h-5.64c-1.93 0-3.79-.7-5.24-1.96l-9.28-8.06a16.017 16.017 0 0 0-15.55-3.1l-31.17 10.39a11.95 11.95 0 0 0-8.17 11.34c0 4.53 2.56 8.66 6.61 10.69l11.08 5.54c9.41 4.71 19.79 7.16 30.31 7.16s22.59 27.29 32 32h66.75c8.49 0 16.62 3.37 22.63 9.37l13.69 13.69a30.503 30.503 0 0 1 8.93 21.57 46.536 46.536 0 0 1-13.72 32.98zM417 274.25c-5.79-1.45-10.84-5-14.15-9.97l-17.98-26.97a23.97 23.97 0 0 1 0-26.62l19.59-29.38c2.32-3.47 5.5-6.29 9.24-8.15l12.98-6.49C440.2 193.59 448 223.87 448 256c0 8.67-.74 17.16-1.82 25.54L417 274.25z"]
};
var faGlobeAsia = {
prefix: 'fas',
iconName: 'globe-asia',
icon: [496, 512, [], "f57e", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm-11.34 240.23c-2.89 4.82-8.1 7.77-13.72 7.77h-.31c-4.24 0-8.31 1.69-11.31 4.69l-5.66 5.66c-3.12 3.12-3.12 8.19 0 11.31l5.66 5.66c3 3 4.69 7.07 4.69 11.31V304c0 8.84-7.16 16-16 16h-6.11c-6.06 0-11.6-3.42-14.31-8.85l-22.62-45.23c-2.44-4.88-8.95-5.94-12.81-2.08l-19.47 19.46c-3 3-7.07 4.69-11.31 4.69H50.81C49.12 277.55 48 266.92 48 256c0-110.28 89.72-200 200-200 21.51 0 42.2 3.51 61.63 9.82l-50.16 38.53c-5.11 3.41-4.63 11.06.86 13.81l10.83 5.41c5.42 2.71 8.84 8.25 8.84 14.31V216c0 4.42-3.58 8-8 8h-3.06c-3.03 0-5.8-1.71-7.15-4.42-1.56-3.12-5.96-3.29-7.76-.3l-17.37 28.95zM408 358.43c0 4.24-1.69 8.31-4.69 11.31l-9.57 9.57c-3 3-7.07 4.69-11.31 4.69h-15.16c-4.24 0-8.31-1.69-11.31-4.69l-13.01-13.01a26.767 26.767 0 0 0-25.42-7.04l-21.27 5.32c-1.27.32-2.57.48-3.88.48h-10.34c-4.24 0-8.31-1.69-11.31-4.69l-11.91-11.91a8.008 8.008 0 0 1-2.34-5.66v-10.2c0-3.27 1.99-6.21 5.03-7.43l39.34-15.74c1.98-.79 3.86-1.82 5.59-3.05l23.71-16.89a7.978 7.978 0 0 1 4.64-1.48h12.09c3.23 0 6.15 1.94 7.39 4.93l5.35 12.85a4 4 0 0 0 3.69 2.46h3.8c1.78 0 3.35-1.18 3.84-2.88l4.2-14.47c.5-1.71 2.06-2.88 3.84-2.88h6.06c2.21 0 4 1.79 4 4v12.93c0 2.12.84 4.16 2.34 5.66l11.91 11.91c3 3 4.69 7.07 4.69 11.31v24.6z"]
};
var faGlobeEurope = {
prefix: 'fas',
iconName: 'globe-europe',
icon: [496, 512, [], "f7a2", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm200 248c0 22.5-3.9 44.2-10.8 64.4h-20.3c-4.3 0-8.4-1.7-11.4-4.8l-32-32.6c-4.5-4.6-4.5-12.1.1-16.7l12.5-12.5v-8.7c0-3-1.2-5.9-3.3-8l-9.4-9.4c-2.1-2.1-5-3.3-8-3.3h-16c-6.2 0-11.3-5.1-11.3-11.3 0-3 1.2-5.9 3.3-8l9.4-9.4c2.1-2.1 5-3.3 8-3.3h32c6.2 0 11.3-5.1 11.3-11.3v-9.4c0-6.2-5.1-11.3-11.3-11.3h-36.7c-8.8 0-16 7.2-16 16v4.5c0 6.9-4.4 13-10.9 15.2l-31.6 10.5c-3.3 1.1-5.5 4.1-5.5 7.6v2.2c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8s-3.6-8-8-8H247c-3 0-5.8 1.7-7.2 4.4l-9.4 18.7c-2.7 5.4-8.2 8.8-14.3 8.8H194c-8.8 0-16-7.2-16-16V199c0-4.2 1.7-8.3 4.7-11.3l20.1-20.1c4.6-4.6 7.2-10.9 7.2-17.5 0-3.4 2.2-6.5 5.5-7.6l40-13.3c1.7-.6 3.2-1.5 4.4-2.7l26.8-26.8c2.1-2.1 3.3-5 3.3-8 0-6.2-5.1-11.3-11.3-11.3H258l-16 16v8c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8v-20c0-2.5 1.2-4.9 3.2-6.4l28.9-21.7c1.9-.1 3.8-.3 5.7-.3C358.3 56 448 145.7 448 256zM130.1 149.1c0-3 1.2-5.9 3.3-8l25.4-25.4c2.1-2.1 5-3.3 8-3.3 6.2 0 11.3 5.1 11.3 11.3v16c0 3-1.2 5.9-3.3 8l-9.4 9.4c-2.1 2.1-5 3.3-8 3.3h-16c-6.2 0-11.3-5.1-11.3-11.3zm128 306.4v-7.1c0-8.8-7.2-16-16-16h-20.2c-10.8 0-26.7-5.3-35.4-11.8l-22.2-16.7c-11.5-8.6-18.2-22.1-18.2-36.4v-23.9c0-16 8.4-30.8 22.1-39l42.9-25.7c7.1-4.2 15.2-6.5 23.4-6.5h31.2c10.9 0 21.4 3.9 29.6 10.9l43.2 37.1h18.3c8.5 0 16.6 3.4 22.6 9.4l17.3 17.3c3.4 3.4 8.1 5.3 12.9 5.3H423c-32.4 58.9-93.8 99.5-164.9 103.1z"]
};
var faGolfBall = {
prefix: 'fas',
iconName: 'golf-ball',
icon: [416, 512, [], "f450", "M96 416h224c0 17.7-14.3 32-32 32h-16c-17.7 0-32 14.3-32 32v20c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-20c0-17.7-14.3-32-32-32h-16c-17.7 0-32-14.3-32-32zm320-208c0 74.2-39 139.2-97.5 176h-221C39 347.2 0 282.2 0 208 0 93.1 93.1 0 208 0s208 93.1 208 208zm-180.1 43.9c18.3 0 33.1-14.8 33.1-33.1 0-14.4-9.3-26.3-22.1-30.9 9.6 26.8-15.6 51.3-41.9 41.9 4.6 12.8 16.5 22.1 30.9 22.1zm49.1 46.9c0-14.4-9.3-26.3-22.1-30.9 9.6 26.8-15.6 51.3-41.9 41.9 4.6 12.8 16.5 22.1 30.9 22.1 18.3 0 33.1-14.9 33.1-33.1zm64-64c0-14.4-9.3-26.3-22.1-30.9 9.6 26.8-15.6 51.3-41.9 41.9 4.6 12.8 16.5 22.1 30.9 22.1 18.3 0 33.1-14.9 33.1-33.1z"]
};
var faGopuram = {
prefix: 'fas',
iconName: 'gopuram',
icon: [512, 512, [], "f664", "M496 352h-16V240c0-8.8-7.2-16-16-16h-16v-80c0-8.8-7.2-16-16-16h-16V16c0-8.8-7.2-16-16-16s-16 7.2-16 16v16h-64V16c0-8.8-7.2-16-16-16s-16 7.2-16 16v16h-64V16c0-8.8-7.2-16-16-16s-16 7.2-16 16v16h-64V16c0-8.8-7.2-16-16-16S96 7.2 96 16v112H80c-8.8 0-16 7.2-16 16v80H48c-8.8 0-16 7.2-16 16v112H16c-8.8 0-16 7.2-16 16v128c0 8.8 7.2 16 16 16h80V352h32V224h32v-96h32v96h-32v128h-32v160h80v-80c0-8.8 7.2-16 16-16h64c8.8 0 16 7.2 16 16v80h80V352h-32V224h-32v-96h32v96h32v128h32v160h80c8.8 0 16-7.2 16-16V368c0-8.8-7.2-16-16-16zM232 176c0-8.8 7.2-16 16-16h16c8.8 0 16 7.2 16 16v48h-48zm56 176h-64v-64c0-8.8 7.2-16 16-16h32c8.8 0 16 7.2 16 16z"]
};
var faGraduationCap = {
prefix: 'fas',
iconName: 'graduation-cap',
icon: [640, 512, [], "f19d", "M622.34 153.2L343.4 67.5c-15.2-4.67-31.6-4.67-46.79 0L17.66 153.2c-23.54 7.23-23.54 38.36 0 45.59l48.63 14.94c-10.67 13.19-17.23 29.28-17.88 46.9C38.78 266.15 32 276.11 32 288c0 10.78 5.68 19.85 13.86 25.65L20.33 428.53C18.11 438.52 25.71 448 35.94 448h56.11c10.24 0 17.84-9.48 15.62-19.47L82.14 313.65C90.32 307.85 96 298.78 96 288c0-11.57-6.47-21.25-15.66-26.87.76-15.02 8.44-28.3 20.69-36.72L296.6 284.5c9.06 2.78 26.44 6.25 46.79 0l278.95-85.7c23.55-7.24 23.55-38.36 0-45.6zM352.79 315.09c-28.53 8.76-52.84 3.92-65.59 0l-145.02-44.55L128 384c0 35.35 85.96 64 192 64s192-28.65 192-64l-14.18-113.47-145.03 44.56z"]
};
var faGreaterThan = {
prefix: 'fas',
iconName: 'greater-than',
icon: [384, 512, [], "f531", "M365.52 209.85L59.22 67.01c-16.06-7.49-35.15-.54-42.64 15.52L3.01 111.61c-7.49 16.06-.54 35.15 15.52 42.64L236.96 256.1 18.49 357.99C2.47 365.46-4.46 384.5 3.01 400.52l13.52 29C24 445.54 43.04 452.47 59.06 445l306.47-142.91a32.003 32.003 0 0 0 18.48-29v-34.23c-.01-12.45-7.21-23.76-18.49-29.01z"]
};
var faGreaterThanEqual = {
prefix: 'fas',
iconName: 'greater-than-equal',
icon: [448, 512, [], "f532", "M55.22 107.69l175.56 68.09-175.44 68.05c-18.39 6.03-27.88 24.39-21.2 41l12.09 30.08c6.68 16.61 26.99 25.19 45.38 19.15L393.02 214.2c13.77-4.52 22.98-16.61 22.98-30.17v-15.96c0-13.56-9.21-25.65-22.98-30.17L91.3 17.92c-18.29-6-38.51 2.53-45.15 19.06L34.12 66.9c-6.64 16.53 2.81 34.79 21.1 40.79zM424 400H24c-13.25 0-24 10.74-24 24v48c0 13.25 10.75 24 24 24h400c13.25 0 24-10.75 24-24v-48c0-13.26-10.75-24-24-24z"]
};
var faGrimace = {
prefix: 'fas',
iconName: 'grimace',
icon: [496, 512, [], "f57f", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM144 400h-8c-17.7 0-32-14.3-32-32v-8h40v40zm0-56h-40v-8c0-17.7 14.3-32 32-32h8v40zm-8-136c0-17.7 14.3-32 32-32s32 14.3 32 32-14.3 32-32 32-32-14.3-32-32zm72 192h-48v-40h48v40zm0-56h-48v-40h48v40zm64 56h-48v-40h48v40zm0-56h-48v-40h48v40zm64 56h-48v-40h48v40zm0-56h-48v-40h48v40zm-8-104c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm64 128c0 17.7-14.3 32-32 32h-8v-40h40v8zm0-24h-40v-40h8c17.7 0 32 14.3 32 32v8z"]
};
var faGrin = {
prefix: 'fas',
iconName: 'grin',
icon: [496, 512, [], "f580", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 168c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm-160 0c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm80 256c-60.6 0-134.5-38.3-143.8-93.3-2-11.8 9.3-21.6 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.3-3.7 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinAlt = {
prefix: 'fas',
iconName: 'grin-alt',
icon: [496, 512, [], "f581", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm63.7 128.7c7.6-11.4 24.7-11.7 32.7 0 12.4 18.4 15.1 36.9 15.7 55.3-.5 18.4-3.3 36.9-15.7 55.3-7.6 11.4-24.7 11.7-32.7 0-12.4-18.4-15.1-36.9-15.7-55.3.5-18.4 3.3-36.9 15.7-55.3zm-160 0c7.6-11.4 24.7-11.7 32.7 0 12.4 18.4 15.1 36.9 15.7 55.3-.5 18.4-3.3 36.9-15.7 55.3-7.6 11.4-24.7 11.7-32.7 0-12.4-18.4-15.1-36.9-15.7-55.3.5-18.4 3.3-36.9 15.7-55.3zM248 432c-60.6 0-134.5-38.3-143.8-93.3-2-11.8 9.3-21.6 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.4-3.7 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinBeam = {
prefix: 'fas',
iconName: 'grin-beam',
icon: [496, 512, [], "f582", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 144c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 11.9-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.1 7.3-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm-160 0c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 11.9-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm80 280c-60.6 0-134.5-38.3-143.8-93.3-2-11.9 9.4-21.6 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.4-3.7 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinBeamSweat = {
prefix: 'fas',
iconName: 'grin-beam-sweat',
icon: [504, 512, [], "f583", "M456 128c26.5 0 48-21 48-47 0-20-28.5-60.4-41.6-77.8-3.2-4.3-9.6-4.3-12.8 0C436.5 20.6 408 61 408 81c0 26 21.5 47 48 47zm0 32c-44.1 0-80-35.4-80-79 0-4.4.3-14.2 8.1-32.2C345 23.1 298.3 8 248 8 111 8 0 119 0 256s111 248 248 248 248-111 248-248c0-35.1-7.4-68.4-20.5-98.6-6.3 1.5-12.7 2.6-19.5 2.6zm-128-8c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 12-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.1 7.4-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm-160 0c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 12-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm80 280c-60.6 0-134.5-38.3-143.8-93.3-2-11.8 9.3-21.6 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.5-3.7 22.6 6.2 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinHearts = {
prefix: 'fas',
iconName: 'grin-hearts',
icon: [496, 512, [], "f584", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM90.4 183.6c6.7-17.6 26.7-26.7 44.9-21.9l7.1 1.9 2-7.1c5-18.1 22.8-30.9 41.5-27.9 21.4 3.4 34.4 24.2 28.8 44.5L195.3 243c-1.2 4.5-5.9 7.2-10.5 6l-70.2-18.2c-20.4-5.4-31.9-27-24.2-47.2zM248 432c-60.6 0-134.5-38.3-143.8-93.3-2-11.8 9.2-21.5 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.4-3.6 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3zm133.4-201.3l-70.2 18.2c-4.5 1.2-9.2-1.5-10.5-6L281.3 173c-5.6-20.3 7.4-41.1 28.8-44.5 18.6-3 36.4 9.8 41.5 27.9l2 7.1 7.1-1.9c18.2-4.7 38.2 4.3 44.9 21.9 7.7 20.3-3.8 41.9-24.2 47.2z"]
};
var faGrinSquint = {
prefix: 'fas',
iconName: 'grin-squint',
icon: [496, 512, [], "f585", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm33.8 189.7l80-48c11.6-6.9 24 7.7 15.4 18L343.6 208l33.6 40.3c8.7 10.4-3.9 24.8-15.4 18l-80-48c-7.7-4.7-7.7-15.9 0-20.6zm-163-30c-8.6-10.3 3.8-24.9 15.4-18l80 48c7.8 4.7 7.8 15.9 0 20.6l-80 48c-11.5 6.8-24-7.6-15.4-18l33.6-40.3-33.6-40.3zM248 432c-60.6 0-134.5-38.3-143.8-93.3-2-11.9 9.4-21.6 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.5-3.7 22.6 6.2 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinSquintTears = {
prefix: 'fas',
iconName: 'grin-squint-tears',
icon: [512, 512, [], "f586", "M409.6 111.9c22.6-3.2 73.5-12 88.3-26.8 19.2-19.2 18.9-50.6-.7-70.2S446-5 426.9 14.2c-14.8 14.8-23.5 65.7-26.8 88.3-.8 5.5 3.9 10.2 9.5 9.4zM102.4 400.1c-22.6 3.2-73.5 12-88.3 26.8-19.1 19.1-18.8 50.6.8 70.2s51 19.9 70.2.7c14.8-14.8 23.5-65.7 26.8-88.3.8-5.5-3.9-10.2-9.5-9.4zm311.7-256.5c-33 3.9-48.6-25.1-45.7-45.7 3.4-24 7.4-42.1 11.5-56.5C285.1-13.4 161.8-.5 80.6 80.6-.5 161.7-13.4 285 41.4 379.9c14.4-4.1 32.4-8 56.5-11.5 33.2-3.9 48.6 25.2 45.7 45.7-3.4 24-7.4 42.1-11.5 56.5 94.8 54.8 218.1 41.9 299.3-39.2s94-204.4 39.2-299.3c-14.4 4.1-32.5 8-56.5 11.5zM255.7 106c3.3-13.2 22.4-11.5 23.6 1.8l4.8 52.3 52.3 4.8c13.4 1.2 14.9 20.3 1.8 23.6l-90.5 22.6c-8.9 2.2-16.7-5.9-14.5-14.5l22.5-90.6zm-90.9 230.3L160 284l-52.3-4.8c-13.4-1.2-14.9-20.3-1.8-23.6l90.5-22.6c8.8-2.2 16.7 5.8 14.5 14.5L188.3 338c-3.1 13.2-22.2 11.7-23.5-1.7zm215.7 44.2c-29.3 29.3-75.7 50.4-116.7 50.4-18.9 0-36.6-4.5-51-14.7-9.8-6.9-8.7-21.8 2-27.2 28.3-14.6 63.9-42.4 97.8-76.3s61.7-69.6 76.3-97.8c5.4-10.5 20.2-11.9 27.3-2 32.3 45.3 7.1 124.7-35.7 167.6z"]
};
var faGrinStars = {
prefix: 'fas',
iconName: 'grin-stars',
icon: [496, 512, [], "f587", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM94.6 168.9l34.9-5 15.5-31.6c2.9-5.8 11-5.8 13.9 0l15.5 31.6 34.9 5c6.2 1 8.9 8.6 4.3 13.2l-25.4 24.6 6 34.9c1 6.2-5.3 11-11 7.9L152 233.3l-31.3 16.3c-5.7 3.1-12-1.7-11-7.9l6-34.9-25.4-24.6c-4.6-4.7-1.9-12.3 4.3-13.3zM248 432c-60.6 0-134.5-38.3-143.8-93.3-2-11.8 9.3-21.5 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.5-3.7 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3zm157.7-249.9l-25.4 24.6 6 34.9c1 6.2-5.3 11-11 7.9L344 233.3l-31.3 16.3c-5.7 3.1-12-1.7-11-7.9l6-34.9-25.4-24.6c-4.5-4.6-1.9-12.2 4.3-13.2l34.9-5 15.5-31.6c2.9-5.8 11-5.8 13.9 0l15.5 31.6 34.9 5c6.3.9 9 8.5 4.4 13.1z"]
};
var faGrinTears = {
prefix: 'fas',
iconName: 'grin-tears',
icon: [640, 512, [], "f588", "M102.4 256.1c-22.6 3.2-73.5 12-88.3 26.8-19.1 19.1-18.8 50.6.8 70.2s51 19.9 70.2.7c14.8-14.8 23.5-65.7 26.8-88.3.8-5.5-3.9-10.2-9.5-9.4zm523.4 26.8c-14.8-14.8-65.7-23.5-88.3-26.8-5.5-.8-10.3 3.9-9.5 9.5 3.2 22.6 12 73.5 26.8 88.3 19.2 19.2 50.6 18.9 70.2-.7s20-51.2.8-70.3zm-129.4-12.8c-3.8-26.6 19.1-49.5 45.7-45.7 8.9 1.3 16.8 2.7 24.3 4.1C552.7 104.5 447.7 8 320 8S87.3 104.5 73.6 228.5c7.5-1.4 15.4-2.8 24.3-4.1 33.2-3.9 48.6 25.3 45.7 45.7-11.8 82.3-29.9 100.4-35.8 106.4-.9.9-2 1.6-3 2.5 42.7 74.6 123 125 215.2 125s172.5-50.4 215.2-125.1c-1-.9-2.1-1.5-3-2.5-5.9-5.9-24-24-35.8-106.3zM400 152c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 12-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm-160 0c23.8 0 52.7 29.3 56 71.4.7 8.6-10.8 12-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.6 4-14.9-4.5 3.1-42.1 32-71.4 55.8-71.4zm80 280c-60.6 0-134.5-38.3-143.8-93.3-2-11.7 9.2-21.6 20.7-17.9C227.1 330.5 272 336 320 336s92.9-5.5 123.1-15.2c11.4-3.7 22.6 6.1 20.7 17.9-9.3 55-83.2 93.3-143.8 93.3z"]
};
var faGrinTongue = {
prefix: 'fas',
iconName: 'grin-tongue',
icon: [496, 512, [], "f589", "M248 8C111 8 0 119 0 256c0 106.3 67 196.7 161 232-5.6-12.2-9-25.7-9-40v-45.5c-24.7-16.2-43.5-38.1-47.8-63.8-2-11.8 9.3-21.5 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.4-3.6 22.6 6.1 20.7 17.9-4.3 25.7-23.1 47.6-47.8 63.8V448c0 14.3-3.4 27.8-9 40 94-35.3 161-125.7 161-232C496 119 385 8 248 8zm-80 232c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm160 0c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm-34.9 134.6c-14.4-6.5-31.1 2.2-34.6 17.6l-1.8 7.8c-2.1 9.2-15.2 9.2-17.3 0l-1.8-7.8c-3.5-15.4-20.2-24.1-34.6-17.6-.9.4.3-.2-18.9 9.4v63c0 35.2 28 64.5 63.1 64.9 35.7.5 64.9-28.4 64.9-64v-64c-19.5-9.6-18.2-8.9-19-9.3z"]
};
var faGrinTongueSquint = {
prefix: 'fas',
iconName: 'grin-tongue-squint',
icon: [496, 512, [], "f58a", "M293.1 374.6c-14.4-6.5-31.1 2.2-34.6 17.6l-1.8 7.8c-2.1 9.2-15.2 9.2-17.3 0l-1.8-7.8c-3.5-15.4-20.2-24.1-34.6-17.6-.9.4.3-.2-18.9 9.4v63c0 35.2 28 64.5 63.1 64.9 35.7.5 64.9-28.4 64.9-64v-64c-19.5-9.6-18.2-8.9-19-9.3zM248 8C111 8 0 119 0 256c0 106.3 67 196.7 161 232-5.6-12.2-9-25.7-9-40v-45.5c-24.7-16.2-43.5-38.1-47.8-63.8-2-11.8 9.2-21.5 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.4-3.7 22.6 6.1 20.7 17.9-4.3 25.7-23.1 47.6-47.8 63.8V448c0 14.3-3.4 27.8-9 40 94-35.3 161-125.7 161-232C496 119 385 8 248 8zm-33.8 210.3l-80 48c-11.5 6.8-24-7.6-15.4-18l33.6-40.3-33.6-40.3c-8.6-10.3 3.8-24.9 15.4-18l80 48c7.7 4.7 7.7 15.9 0 20.6zm163 30c8.7 10.4-3.9 24.8-15.4 18l-80-48c-7.8-4.7-7.8-15.9 0-20.6l80-48c11.7-6.9 23.9 7.7 15.4 18L343.6 208l33.6 40.3z"]
};
var faGrinTongueWink = {
prefix: 'fas',
iconName: 'grin-tongue-wink',
icon: [496, 512, [], "f58b", "M344 184c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zM248 8C111 8 0 119 0 256c0 106.3 67 196.7 161 232-5.6-12.2-9-25.7-9-40v-45.5c-24.7-16.2-43.5-38.1-47.8-63.8-2-11.8 9.3-21.5 20.7-17.9C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.5-3.7 22.6 6.1 20.7 17.9-4.3 25.7-23.1 47.6-47.8 63.8V448c0 14.3-3.4 27.8-9 40 94-35.3 161-125.7 161-232C496 119 385 8 248 8zm-56 225l-9.5-8.5c-14.8-13.2-46.2-13.2-61 0L112 233c-8.5 7.4-21.6.3-19.8-10.8 4-25.2 34.2-42.1 59.9-42.1S208 197 212 222.2c1.6 11.1-11.6 18.2-20 10.8zm152 39c-35.3 0-64-28.7-64-64s28.7-64 64-64 64 28.7 64 64-28.7 64-64 64zm-50.9 102.6c-14.4-6.5-31.1 2.2-34.6 17.6l-1.8 7.8c-2.1 9.2-15.2 9.2-17.3 0l-1.8-7.8c-3.5-15.4-20.2-24.1-34.6-17.6-.9.4.3-.2-18.9 9.4v63c0 35.2 28 64.5 63.1 64.9 35.7.5 64.9-28.4 64.9-64v-64c-19.5-9.6-18.2-8.9-19-9.3z"]
};
var faGrinWink = {
prefix: 'fas',
iconName: 'grin-wink',
icon: [496, 512, [], "f58c", "M0 256c0 137 111 248 248 248s248-111 248-248S385 8 248 8 0 119 0 256zm200-48c0 17.7-14.3 32-32 32s-32-14.3-32-32 14.3-32 32-32 32 14.3 32 32zm168 25l-9.5-8.5c-14.8-13.2-46.2-13.2-61 0L288 233c-8.3 7.4-21.6.4-19.8-10.8 4-25.2 34.2-42.1 59.9-42.1S384 197 388 222.2c1.6 11-11.5 18.2-20 10.8zm-243.1 87.8C155.1 330.5 200 336 248 336s92.9-5.5 123.1-15.2c11.3-3.7 22.6 6 20.7 17.9-9.2 55-83.2 93.3-143.8 93.3s-134.5-38.3-143.8-93.3c-2-11.9 9.3-21.6 20.7-17.9z"]
};
var faGripHorizontal = {
prefix: 'fas',
iconName: 'grip-horizontal',
icon: [448, 512, [], "f58d", "M96 288H32c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm160 0h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm160 0h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zM96 96H32c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm160 0h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm160 0h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32z"]
};
var faGripLines = {
prefix: 'fas',
iconName: 'grip-lines',
icon: [512, 512, [], "f7a4", "M496 288H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h480c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm0-128H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h480c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16z"]
};
var faGripLinesVertical = {
prefix: 'fas',
iconName: 'grip-lines-vertical',
icon: [256, 512, [], "f7a5", "M96 496V16c0-8.8-7.2-16-16-16H48c-8.8 0-16 7.2-16 16v480c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16zm128 0V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v480c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16z"]
};
var faGripVertical = {
prefix: 'fas',
iconName: 'grip-vertical',
icon: [320, 512, [], "f58e", "M96 32H32C14.33 32 0 46.33 0 64v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32V64c0-17.67-14.33-32-32-32zm0 160H32c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm0 160H32c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zM288 32h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32V64c0-17.67-14.33-32-32-32zm0 160h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32zm0 160h-64c-17.67 0-32 14.33-32 32v64c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-64c0-17.67-14.33-32-32-32z"]
};
var faGuitar = {
prefix: 'fas',
iconName: 'guitar',
icon: [512, 512, [], "f7a6", "M502.63 39L473 9.37a32 32 0 0 0-45.26 0L381.46 55.7a35.14 35.14 0 0 0-8.53 13.79L360.77 106l-76.26 76.26c-12.16-8.76-25.5-15.74-40.1-19.14-33.45-7.78-67-.88-89.88 22a82.45 82.45 0 0 0-20.24 33.47c-6 18.56-23.21 32.69-42.15 34.46-23.7 2.27-45.73 11.45-62.61 28.44C-16.11 327-7.9 409 47.58 464.45S185 528 230.56 482.52c17-16.88 26.16-38.9 28.45-62.71 1.76-18.85 15.89-36.13 34.43-42.14a82.6 82.6 0 0 0 33.48-20.25c22.87-22.88 29.74-56.36 22-89.75-3.39-14.64-10.37-28-19.16-40.2L406 151.23l36.48-12.16a35.14 35.14 0 0 0 13.79-8.53l46.33-46.32a32 32 0 0 0 .03-45.22zM208 352a48 48 0 1 1 48-48 48 48 0 0 1-48 48z"]
};
var faHSquare = {
prefix: 'fas',
iconName: 'h-square',
icon: [448, 512, [], "f0fd", "M448 80v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48zm-112 48h-32c-8.837 0-16 7.163-16 16v80H160v-80c0-8.837-7.163-16-16-16h-32c-8.837 0-16 7.163-16 16v224c0 8.837 7.163 16 16 16h32c8.837 0 16-7.163 16-16v-80h128v80c0 8.837 7.163 16 16 16h32c8.837 0 16-7.163 16-16V144c0-8.837-7.163-16-16-16z"]
};
var faHamburger = {
prefix: 'fas',
iconName: 'hamburger',
icon: [512, 512, [], "f805", "M464 256H48a48 48 0 0 0 0 96h416a48 48 0 0 0 0-96zm16 128H32a16 16 0 0 0-16 16v16a64 64 0 0 0 64 64h352a64 64 0 0 0 64-64v-16a16 16 0 0 0-16-16zM58.64 224h394.72c34.57 0 54.62-43.9 34.82-75.88C448 83.2 359.55 32.1 256 32c-103.54.1-192 51.2-232.18 116.11C4 180.09 24.07 224 58.64 224zM384 112a16 16 0 1 1-16 16 16 16 0 0 1 16-16zM256 80a16 16 0 1 1-16 16 16 16 0 0 1 16-16zm-128 32a16 16 0 1 1-16 16 16 16 0 0 1 16-16z"]
};
var faHammer = {
prefix: 'fas',
iconName: 'hammer',
icon: [576, 512, [], "f6e3", "M571.31 193.94l-22.63-22.63c-6.25-6.25-16.38-6.25-22.63 0l-11.31 11.31-28.9-28.9c5.63-21.31.36-44.9-16.35-61.61l-45.25-45.25c-62.48-62.48-163.79-62.48-226.28 0l90.51 45.25v18.75c0 16.97 6.74 33.25 18.75 45.25l49.14 49.14c16.71 16.71 40.3 21.98 61.61 16.35l28.9 28.9-11.31 11.31c-6.25 6.25-6.25 16.38 0 22.63l22.63 22.63c6.25 6.25 16.38 6.25 22.63 0l90.51-90.51c6.23-6.24 6.23-16.37-.02-22.62zm-286.72-15.2c-3.7-3.7-6.84-7.79-9.85-11.95L19.64 404.96c-25.57 23.88-26.26 64.19-1.53 88.93s65.05 24.05 88.93-1.53l238.13-255.07c-3.96-2.91-7.9-5.87-11.44-9.41l-49.14-49.14z"]
};
var faHamsa = {
prefix: 'fas',
iconName: 'hamsa',
icon: [512, 512, [], "f665", "M509.34 307.25C504.28 295.56 492.75 288 480 288h-64V80c0-22-18-40-40-40s-40 18-40 40v134c0 5.52-4.48 10-10 10h-20c-5.52 0-10-4.48-10-10V40c0-22-18-40-40-40s-40 18-40 40v174c0 5.52-4.48 10-10 10h-20c-5.52 0-10-4.48-10-10V80c0-22-18-40-40-40S96 58 96 80v208H32c-12.75 0-24.28 7.56-29.34 19.25a31.966 31.966 0 0 0 5.94 34.58l102.69 110.03C146.97 490.08 199.69 512 256 512s109.03-21.92 144.72-60.14L503.4 341.83a31.966 31.966 0 0 0 5.94-34.58zM256 416c-53.02 0-96-64-96-64s42.98-64 96-64 96 64 96 64-42.98 64-96 64zm0-96c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32z"]
};
var faHandHolding = {
prefix: 'fas',
iconName: 'hand-holding',
icon: [576, 512, [], "f4bd", "M565.3 328.1c-11.8-10.7-30.2-10-42.6 0L430.3 402c-11.3 9.1-25.4 14-40 14H272c-8.8 0-16-7.2-16-16s7.2-16 16-16h78.3c15.9 0 30.7-10.9 33.3-26.6 3.3-20-12.1-37.4-31.6-37.4H192c-27 0-53.1 9.3-74.1 26.3L71.4 384H16c-8.8 0-16 7.2-16 16v96c0 8.8 7.2 16 16 16h356.8c14.5 0 28.6-4.9 40-14L564 377c15.2-12.1 16.4-35.3 1.3-48.9z"]
};
var faHandHoldingHeart = {
prefix: 'fas',
iconName: 'hand-holding-heart',
icon: [576, 512, [], "f4be", "M275.3 250.5c7 7.4 18.4 7.4 25.5 0l108.9-114.2c31.6-33.2 29.8-88.2-5.6-118.8-30.8-26.7-76.7-21.9-104.9 7.7L288 36.9l-11.1-11.6C248.7-4.4 202.8-9.2 172 17.5c-35.3 30.6-37.2 85.6-5.6 118.8l108.9 114.2zm290 77.6c-11.8-10.7-30.2-10-42.6 0L430.3 402c-11.3 9.1-25.4 14-40 14H272c-8.8 0-16-7.2-16-16s7.2-16 16-16h78.3c15.9 0 30.7-10.9 33.3-26.6 3.3-20-12.1-37.4-31.6-37.4H192c-27 0-53.1 9.3-74.1 26.3L71.4 384H16c-8.8 0-16 7.2-16 16v96c0 8.8 7.2 16 16 16h356.8c14.5 0 28.6-4.9 40-14L564 377c15.2-12.1 16.4-35.3 1.3-48.9z"]
};
var faHandHoldingMedical = {
prefix: 'fas',
iconName: 'hand-holding-medical',
icon: [576, 512, [], "e05c", "M159.88,175.82h64v64a16,16,0,0,0,16,16h64a16,16,0,0,0,16-16v-64h64a16,16,0,0,0,16-16v-64a16,16,0,0,0-16-16h-64v-64a16,16,0,0,0-16-16h-64a16,16,0,0,0-16,16v64h-64a16,16,0,0,0-16,16v64A16,16,0,0,0,159.88,175.82ZM568.07,336.13a39.91,39.91,0,0,0-55.93-8.47L392.47,415.84H271.86a16,16,0,0,1,0-32H350.1c16,0,30.75-10.87,33.37-26.61a32.06,32.06,0,0,0-31.62-37.38h-160a117.7,117.7,0,0,0-74.12,26.25l-46.5,37.74H15.87a16.11,16.11,0,0,0-16,16v96a16.11,16.11,0,0,0,16,16h347a104.8,104.8,0,0,0,61.7-20.27L559.6,392A40,40,0,0,0,568.07,336.13Z"]
};
var faHandHoldingUsd = {
prefix: 'fas',
iconName: 'hand-holding-usd',
icon: [576, 512, [], "f4c0", "M271.06,144.3l54.27,14.3a8.59,8.59,0,0,1,6.63,8.1c0,4.6-4.09,8.4-9.12,8.4h-35.6a30,30,0,0,1-11.19-2.2c-5.24-2.2-11.28-1.7-15.3,2l-19,17.5a11.68,11.68,0,0,0-2.25,2.66,11.42,11.42,0,0,0,3.88,15.74,83.77,83.77,0,0,0,34.51,11.5V240c0,8.8,7.83,16,17.37,16h17.37c9.55,0,17.38-7.2,17.38-16V222.4c32.93-3.6,57.84-31,53.5-63-3.15-23-22.46-41.3-46.56-47.7L282.68,97.4a8.59,8.59,0,0,1-6.63-8.1c0-4.6,4.09-8.4,9.12-8.4h35.6A30,30,0,0,1,332,83.1c5.23,2.2,11.28,1.7,15.3-2l19-17.5A11.31,11.31,0,0,0,368.47,61a11.43,11.43,0,0,0-3.84-15.78,83.82,83.82,0,0,0-34.52-11.5V16c0-8.8-7.82-16-17.37-16H295.37C285.82,0,278,7.2,278,16V33.6c-32.89,3.6-57.85,31-53.51,63C227.63,119.6,247,137.9,271.06,144.3ZM565.27,328.1c-11.8-10.7-30.2-10-42.6,0L430.27,402a63.64,63.64,0,0,1-40,14H272a16,16,0,0,1,0-32h78.29c15.9,0,30.71-10.9,33.25-26.6a31.2,31.2,0,0,0,.46-5.46A32,32,0,0,0,352,320H192a117.66,117.66,0,0,0-74.1,26.29L71.4,384H16A16,16,0,0,0,0,400v96a16,16,0,0,0,16,16H372.77a64,64,0,0,0,40-14L564,377a32,32,0,0,0,1.28-48.9Z"]
};
var faHandHoldingWater = {
prefix: 'fas',
iconName: 'hand-holding-water',
icon: [576, 512, [], "f4c1", "M288 256c53 0 96-42.1 96-94 0-40-57.1-120.7-83.2-155.6-6.4-8.5-19.2-8.5-25.6 0C249.1 41.3 192 122 192 162c0 51.9 43 94 96 94zm277.3 72.1c-11.8-10.7-30.2-10-42.6 0L430.3 402c-11.3 9.1-25.4 14-40 14H272c-8.8 0-16-7.2-16-16s7.2-16 16-16h78.3c15.9 0 30.7-10.9 33.3-26.6 3.3-20-12.1-37.4-31.6-37.4H192c-27 0-53.1 9.3-74.1 26.3L71.4 384H16c-8.8 0-16 7.2-16 16v96c0 8.8 7.2 16 16 16h356.8c14.5 0 28.6-4.9 40-14L564 377c15.2-12.1 16.4-35.3 1.3-48.9z"]
};
var faHandLizard = {
prefix: 'fas',
iconName: 'hand-lizard',
icon: [576, 512, [], "f258", "M384 480h192V363.778a95.998 95.998 0 0 0-14.833-51.263L398.127 54.368A48 48 0 0 0 357.544 32H24C10.745 32 0 42.745 0 56v16c0 30.928 25.072 56 56 56h229.981c12.844 0 21.556 13.067 16.615 24.923l-21.41 51.385A32 32 0 0 1 251.648 224H128c-35.346 0-64 28.654-64 64v8c0 13.255 10.745 24 24 24h147.406a47.995 47.995 0 0 1 25.692 7.455l111.748 70.811A24.001 24.001 0 0 1 384 418.539V480z"]
};
var faHandMiddleFinger = {
prefix: 'fas',
iconName: 'hand-middle-finger',
icon: [512, 512, [], "f806", "M479.93 317.12a37.33 37.33 0 0 0-28.28-36.19L416 272v-49.59c0-11.44-9.69-21.29-23.15-23.54l-38.4-6.4C336.63 189.5 320 200.86 320 216v32a8 8 0 0 1-16 0V50c0-26.28-20.25-49.2-46.52-50A48 48 0 0 0 208 48v200a8 8 0 0 1-16 0v-32c0-15.15-16.63-26.51-34.45-23.54l-30.68 5.12c-18 3-30.87 16.12-30.87 31.38V376a8 8 0 0 1-16 0v-76l-27.36 15A37.34 37.34 0 0 0 32 348.4v73.47a37.31 37.31 0 0 0 10.93 26.39l30.93 30.93A112 112 0 0 0 153.05 512h215A112 112 0 0 0 480 400z"]
};
var faHandPaper = {
prefix: 'fas',
iconName: 'hand-paper',
icon: [448, 512, [], "f256", "M408.781 128.007C386.356 127.578 368 146.36 368 168.79V256h-8V79.79c0-22.43-18.356-41.212-40.781-40.783C297.488 39.423 280 57.169 280 79v177h-8V40.79C272 18.36 253.644-.422 231.219.007 209.488.423 192 18.169 192 40v216h-8V80.79c0-22.43-18.356-41.212-40.781-40.783C121.488 40.423 104 58.169 104 80v235.992l-31.648-43.519c-12.993-17.866-38.009-21.817-55.877-8.823-17.865 12.994-21.815 38.01-8.822 55.877l125.601 172.705A48 48 0 0 0 172.073 512h197.59c22.274 0 41.622-15.324 46.724-37.006l26.508-112.66a192.011 192.011 0 0 0 5.104-43.975V168c.001-21.831-17.487-39.577-39.218-39.993z"]
};
var faHandPeace = {
prefix: 'fas',
iconName: 'hand-peace',
icon: [448, 512, [], "f25b", "M408 216c-22.092 0-40 17.909-40 40h-8v-32c0-22.091-17.908-40-40-40s-40 17.909-40 40v32h-8V48c0-26.51-21.49-48-48-48s-48 21.49-48 48v208h-13.572L92.688 78.449C82.994 53.774 55.134 41.63 30.461 51.324 5.787 61.017-6.356 88.877 3.337 113.551l74.765 190.342-31.09 24.872c-15.381 12.306-19.515 33.978-9.741 51.081l64 112A39.998 39.998 0 0 0 136 512h240c18.562 0 34.686-12.77 38.937-30.838l32-136A39.97 39.97 0 0 0 448 336v-80c0-22.091-17.908-40-40-40z"]
};
var faHandPointDown = {
prefix: 'fas',
iconName: 'hand-point-down',
icon: [384, 512, [], "f0a7", "M91.826 467.2V317.966c-8.248 5.841-16.558 10.57-24.918 14.153C35.098 345.752-.014 322.222 0 288c.008-18.616 10.897-32.203 29.092-40 28.286-12.122 64.329-78.648 77.323-107.534 7.956-17.857 25.479-28.453 43.845-28.464l.001-.002h171.526c11.812 0 21.897 8.596 23.703 20.269 7.25 46.837 38.483 61.76 38.315 123.731-.007 2.724.195 13.254.195 16 0 50.654-22.122 81.574-71.263 72.6-9.297 18.597-39.486 30.738-62.315 16.45-21.177 24.645-53.896 22.639-70.944 6.299V467.2c0 24.15-20.201 44.8-43.826 44.8-23.283 0-43.826-21.35-43.826-44.8zM112 72V24c0-13.255 10.745-24 24-24h192c13.255 0 24 10.745 24 24v48c0 13.255-10.745 24-24 24H136c-13.255 0-24-10.745-24-24zm212-24c0-11.046-8.954-20-20-20s-20 8.954-20 20 8.954 20 20 20 20-8.954 20-20z"]
};
var faHandPointLeft = {
prefix: 'fas',
iconName: 'hand-point-left',
icon: [512, 512, [], "f0a5", "M44.8 155.826h149.234c-5.841-8.248-10.57-16.558-14.153-24.918C166.248 99.098 189.778 63.986 224 64c18.616.008 32.203 10.897 40 29.092 12.122 28.286 78.648 64.329 107.534 77.323 17.857 7.956 28.453 25.479 28.464 43.845l.002.001v171.526c0 11.812-8.596 21.897-20.269 23.703-46.837 7.25-61.76 38.483-123.731 38.315-2.724-.007-13.254.195-16 .195-50.654 0-81.574-22.122-72.6-71.263-18.597-9.297-30.738-39.486-16.45-62.315-24.645-21.177-22.639-53.896-6.299-70.944H44.8c-24.15 0-44.8-20.201-44.8-43.826 0-23.283 21.35-43.826 44.8-43.826zM440 176h48c13.255 0 24 10.745 24 24v192c0 13.255-10.745 24-24 24h-48c-13.255 0-24-10.745-24-24V200c0-13.255 10.745-24 24-24zm24 212c11.046 0 20-8.954 20-20s-8.954-20-20-20-20 8.954-20 20 8.954 20 20 20z"]
};
var faHandPointRight = {
prefix: 'fas',
iconName: 'hand-point-right',
icon: [512, 512, [], "f0a4", "M512 199.652c0 23.625-20.65 43.826-44.8 43.826h-99.851c16.34 17.048 18.346 49.766-6.299 70.944 14.288 22.829 2.147 53.017-16.45 62.315C353.574 425.878 322.654 448 272 448c-2.746 0-13.276-.203-16-.195-61.971.168-76.894-31.065-123.731-38.315C120.596 407.683 112 397.599 112 385.786V214.261l.002-.001c.011-18.366 10.607-35.889 28.464-43.845 28.886-12.994 95.413-49.038 107.534-77.323 7.797-18.194 21.384-29.084 40-29.092 34.222-.014 57.752 35.098 44.119 66.908-3.583 8.359-8.312 16.67-14.153 24.918H467.2c23.45 0 44.8 20.543 44.8 43.826zM96 200v192c0 13.255-10.745 24-24 24H24c-13.255 0-24-10.745-24-24V200c0-13.255 10.745-24 24-24h48c13.255 0 24 10.745 24 24zM68 368c0-11.046-8.954-20-20-20s-20 8.954-20 20 8.954 20 20 20 20-8.954 20-20z"]
};
var faHandPointUp = {
prefix: 'fas',
iconName: 'hand-point-up',
icon: [384, 512, [], "f0a6", "M135.652 0c23.625 0 43.826 20.65 43.826 44.8v99.851c17.048-16.34 49.766-18.346 70.944 6.299 22.829-14.288 53.017-2.147 62.315 16.45C361.878 158.426 384 189.346 384 240c0 2.746-.203 13.276-.195 16 .168 61.971-31.065 76.894-38.315 123.731C343.683 391.404 333.599 400 321.786 400H150.261l-.001-.002c-18.366-.011-35.889-10.607-43.845-28.464C93.421 342.648 57.377 276.122 29.092 264 10.897 256.203.008 242.616 0 224c-.014-34.222 35.098-57.752 66.908-44.119 8.359 3.583 16.67 8.312 24.918 14.153V44.8c0-23.45 20.543-44.8 43.826-44.8zM136 416h192c13.255 0 24 10.745 24 24v48c0 13.255-10.745 24-24 24H136c-13.255 0-24-10.745-24-24v-48c0-13.255 10.745-24 24-24zm168 28c-11.046 0-20 8.954-20 20s8.954 20 20 20 20-8.954 20-20-8.954-20-20-20z"]
};
var faHandPointer = {
prefix: 'fas',
iconName: 'hand-pointer',
icon: [448, 512, [], "f25a", "M448 240v96c0 3.084-.356 6.159-1.063 9.162l-32 136C410.686 499.23 394.562 512 376 512H168a40.004 40.004 0 0 1-32.35-16.473l-127.997-176c-12.993-17.866-9.043-42.883 8.822-55.876 17.867-12.994 42.884-9.043 55.877 8.823L104 315.992V40c0-22.091 17.908-40 40-40s40 17.909 40 40v200h8v-40c0-22.091 17.908-40 40-40s40 17.909 40 40v40h8v-24c0-22.091 17.908-40 40-40s40 17.909 40 40v24h8c0-22.091 17.908-40 40-40s40 17.909 40 40zm-256 80h-8v96h8v-96zm88 0h-8v96h8v-96zm88 0h-8v96h8v-96z"]
};
var faHandRock = {
prefix: 'fas',
iconName: 'hand-rock',
icon: [512, 512, [], "f255", "M464.8 80c-26.9-.4-48.8 21.2-48.8 48h-8V96.8c0-26.3-20.9-48.3-47.2-48.8-26.9-.4-48.8 21.2-48.8 48v32h-8V80.8c0-26.3-20.9-48.3-47.2-48.8-26.9-.4-48.8 21.2-48.8 48v48h-8V96.8c0-26.3-20.9-48.3-47.2-48.8-26.9-.4-48.8 21.2-48.8 48v136l-8-7.1v-48.1c0-26.3-20.9-48.3-47.2-48.8C21.9 127.6 0 149.2 0 176v66.4c0 27.4 11.7 53.5 32.2 71.8l111.7 99.3c10.2 9.1 16.1 22.2 16.1 35.9v6.7c0 13.3 10.7 24 24 24h240c13.3 0 24-10.7 24-24v-2.9c0-12.8 2.6-25.5 7.5-37.3l49-116.3c5-11.8 7.5-24.5 7.5-37.3V128.8c0-26.3-20.9-48.4-47.2-48.8z"]
};
var faHandScissors = {
prefix: 'fas',
iconName: 'hand-scissors',
icon: [512, 512, [], "f257", "M216 440c0-22.092 17.909-40 40-40v-8h-32c-22.091 0-40-17.908-40-40s17.909-40 40-40h32v-8H48c-26.51 0-48-21.49-48-48s21.49-48 48-48h208v-13.572l-177.551-69.74c-24.674-9.694-36.818-37.555-27.125-62.228 9.693-24.674 37.554-36.817 62.228-27.124l190.342 74.765 24.872-31.09c12.306-15.381 33.978-19.515 51.081-9.741l112 64A40.002 40.002 0 0 1 512 168v240c0 18.562-12.77 34.686-30.838 38.937l-136 32A39.982 39.982 0 0 1 336 480h-80c-22.091 0-40-17.908-40-40z"]
};
var faHandSparkles = {
prefix: 'fas',
iconName: 'hand-sparkles',
icon: [640, 512, [], "e05d", "M106.66,170.64l.09,0,49.55-20.65a7.32,7.32,0,0,0,3.68-6h0a7.29,7.29,0,0,0-3.68-6l-49.57-20.67-.07,0L86,67.68a6.66,6.66,0,0,0-11.92,0l-20.7,49.63-.05,0L3.7,138A7.29,7.29,0,0,0,0,144H0a7.32,7.32,0,0,0,3.68,6L53.27,170.6l.07,0L74,220.26a6.65,6.65,0,0,0,11.92,0l20.69-49.62ZM471.38,467.41l-1-.42-1-.5a38.67,38.67,0,0,1,0-69.14l1-.49,1-.43,37.49-15.63,15.63-37.48.41-1,.47-.95c3.85-7.74,10.58-13.63,18.35-17.34,0-1.33.25-2.69.27-4V144a32,32,0,0,0-64,0v72a8,8,0,0,1-8,8H456a8,8,0,0,1-8-8V64a32,32,0,0,0-64,0V216a8,8,0,0,1-8,8H360a8,8,0,0,1-8-8V32a32,32,0,0,0-64,0V216a8,8,0,0,1-8,8H264a8,8,0,0,1-8-8V64a32,32,0,0,0-64,0v241l-23.59-32.49a40,40,0,0,0-64.71,47.09L229.3,492.21A48.07,48.07,0,0,0,268.09,512H465.7c19.24,0,35.65-11.73,43.24-28.79l-.07-.17ZM349.79,339.52,320,351.93l-12.42,29.78a4,4,0,0,1-7.15,0L288,351.93l-29.79-12.41a4,4,0,0,1,0-7.16L288,319.94l12.42-29.78a4,4,0,0,1,7.15,0L320,319.94l29.79,12.42a4,4,0,0,1,0,7.16ZM640,431.91a7.28,7.28,0,0,0-3.68-6l-49.57-20.67-.07,0L566,355.63a6.66,6.66,0,0,0-11.92,0l-20.7,49.63-.05,0L483.7,426a7.28,7.28,0,0,0-3.68,6h0a7.29,7.29,0,0,0,3.68,5.95l49.57,20.67.07,0L554,508.21a6.65,6.65,0,0,0,11.92,0l20.69-49.62h0l.09,0,49.55-20.66a7.29,7.29,0,0,0,3.68-5.95h0Z"]
};
var faHandSpock = {
prefix: 'fas',
iconName: 'hand-spock',
icon: [512, 512, [], "f259", "M510.9005,145.27027,442.604,432.09391A103.99507,103.99507,0,0,1,341.43745,512H214.074a135.96968,135.96968,0,0,1-93.18489-36.95291L12.59072,373.12723a39.992,39.992,0,0,1,54.8122-58.24988l60.59342,57.02528v0a283.24849,283.24849,0,0,0-11.6703-80.46734L73.63726,147.36011a40.00575,40.00575,0,1,1,76.71833-22.7187l37.15458,125.39477a8.33113,8.33113,0,0,0,16.05656-4.4414L153.26183,49.95406A39.99638,39.99638,0,1,1,230.73015,30.0166l56.09491,218.15825a10.42047,10.42047,0,0,0,20.30018-.501L344.80766,63.96966a40.052,40.052,0,0,1,51.30245-30.0893c19.86073,6.2998,30.86262,27.67378,26.67564,48.08487l-33.83869,164.966a7.55172,7.55172,0,0,0,14.74406,3.2666l29.3973-123.45874a39.99414,39.99414,0,1,1,77.81208,18.53121Z"]
};
var faHands = {
prefix: 'fas',
iconName: 'hands',
icon: [640, 512, [], "f4c2", "M204.8 230.4c-10.6-14.1-30.7-17-44.8-6.4-14.1 10.6-17 30.7-6.4 44.8l38.1 50.8c4.8 6.4 4.1 15.3-1.5 20.9l-12.8 12.8c-6.7 6.7-17.6 6.2-23.6-1.1L64 244.4V96c0-17.7-14.3-32-32-32S0 78.3 0 96v218.4c0 10.9 3.7 21.5 10.5 30l104.1 134.3c5 6.5 8.4 13.9 10.4 21.7 1.8 6.9 8.1 11.6 15.3 11.6H272c8.8 0 16-7.2 16-16V384c0-27.7-9-54.6-25.6-76.8l-57.6-76.8zM608 64c-17.7 0-32 14.3-32 32v148.4l-89.8 107.8c-6 7.2-17 7.7-23.6 1.1l-12.8-12.8c-5.6-5.6-6.3-14.5-1.5-20.9l38.1-50.8c10.6-14.1 7.7-34.2-6.4-44.8-14.1-10.6-34.2-7.7-44.8 6.4l-57.6 76.8C361 329.4 352 356.3 352 384v112c0 8.8 7.2 16 16 16h131.7c7.1 0 13.5-4.7 15.3-11.6 2-7.8 5.4-15.2 10.4-21.7l104.1-134.3c6.8-8.5 10.5-19.1 10.5-30V96c0-17.7-14.3-32-32-32z"]
};
var faHandsHelping = {
prefix: 'fas',
iconName: 'hands-helping',
icon: [640, 512, [], "f4c4", "M488 192H336v56c0 39.7-32.3 72-72 72s-72-32.3-72-72V126.4l-64.9 39C107.8 176.9 96 197.8 96 220.2v47.3l-80 46.2C.7 322.5-4.6 342.1 4.3 357.4l80 138.6c8.8 15.3 28.4 20.5 43.7 11.7L231.4 448H368c35.3 0 64-28.7 64-64h16c17.7 0 32-14.3 32-32v-64h8c13.3 0 24-10.7 24-24v-48c0-13.3-10.7-24-24-24zm147.7-37.4L555.7 16C546.9.7 527.3-4.5 512 4.3L408.6 64H306.4c-12 0-23.7 3.4-33.9 9.7L239 94.6c-9.4 5.8-15 16.1-15 27.1V248c0 22.1 17.9 40 40 40s40-17.9 40-40v-88h184c30.9 0 56 25.1 56 56v28.5l80-46.2c15.3-8.9 20.5-28.4 11.7-43.7z"]
};
var faHandsWash = {
prefix: 'fas',
iconName: 'hands-wash',
icon: [576, 512, [], "e05e", "M496,224a48,48,0,1,0-48-48A48,48,0,0,0,496,224ZM311.47,178.45A56.77,56.77,0,0,1,328,176a56,56,0,0,1,19,3.49l15.35-48.61A24,24,0,0,0,342,99.74c-11.53-1.35-22.21,6.44-25.71,17.51l-20.9,66.17ZM93.65,386.33c.8-.19,1.54-.54,2.35-.71V359.93a156,156,0,0,1,107.06-148l73.7-22.76L310.92,81.05a24,24,0,0,0-20.33-31.11c-11.53-1.34-22.22,6.45-25.72,17.52L231.42,173.88a8,8,0,0,1-15.26-4.83L259.53,31.26A24,24,0,0,0,239.2.15C227.67-1.19,217,6.6,213.49,17.66L165.56,169.37a8,8,0,1,1-15.26-4.82l38.56-122a24,24,0,0,0-20.33-31.11C157,10,146.32,17.83,142.82,28.9l-60,189.85L80.76,168.7A24,24,0,0,0,56.9,144.55c-13.23-.05-24.72,10.54-24.9,23.86V281.14A123.69,123.69,0,0,0,93.65,386.33ZM519.1,336H360a8,8,0,0,1,0-16H488a24,24,0,0,0,23.54-28.76C509.35,279.84,498.71,272,487.1,272H288l47.09-17.06a24,24,0,0,0-14.18-45.88L213.19,242.31A123.88,123.88,0,0,0,128,360v25.65a79.78,79.78,0,0,1,58,108.63A118.9,118.9,0,0,0,248,512H456a24,24,0,0,0,23.54-28.76C477.35,471.84,466.71,464,455.1,464H360a8,8,0,0,1,0-16H488a24,24,0,0,0,23.54-28.76C509.35,407.84,498.71,400,487.1,400H360a8,8,0,0,1,0-16H520a24,24,0,0,0,23.54-28.76C541.35,343.84,530.71,336,519.1,336ZM416,64a32,32,0,1,0-32-32A32,32,0,0,0,416,64ZM112,416a48,48,0,1,0,48,48A48,48,0,0,0,112,416Z"]
};
var faHandshake = {
prefix: 'fas',
iconName: 'handshake',
icon: [640, 512, [], "f2b5", "M434.7 64h-85.9c-8 0-15.7 3-21.6 8.4l-98.3 90c-.1.1-.2.3-.3.4-16.6 15.6-16.3 40.5-2.1 56 12.7 13.9 39.4 17.6 56.1 2.7.1-.1.3-.1.4-.2l79.9-73.2c6.5-5.9 16.7-5.5 22.6 1 6 6.5 5.5 16.6-1 22.6l-26.1 23.9L504 313.8c2.9 2.4 5.5 5 7.9 7.7V128l-54.6-54.6c-5.9-6-14.1-9.4-22.6-9.4zM544 128.2v223.9c0 17.7 14.3 32 32 32h64V128.2h-96zm48 223.9c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zM0 384h64c17.7 0 32-14.3 32-32V128.2H0V384zm48-63.9c8.8 0 16 7.2 16 16s-7.2 16-16 16-16-7.2-16-16c0-8.9 7.2-16 16-16zm435.9 18.6L334.6 217.5l-30 27.5c-29.7 27.1-75.2 24.5-101.7-4.4-26.9-29.4-24.8-74.9 4.4-101.7L289.1 64h-83.8c-8.5 0-16.6 3.4-22.6 9.4L128 128v223.9h18.3l90.5 81.9c27.4 22.3 67.7 18.1 90-9.3l.2-.2 17.9 15.5c15.9 13 39.4 10.5 52.3-5.4l31.4-38.6 5.4 4.4c13.7 11.1 33.9 9.1 45-4.7l9.5-11.7c11.2-13.8 9.1-33.9-4.6-45.1z"]
};
var faHandshakeAltSlash = {
prefix: 'fas',
iconName: 'handshake-alt-slash',
icon: [640, 512, [], "e05f", "M358.59,195.6,504.2,313.8a63.4,63.4,0,0,1,22.21,37.91H624a16.05,16.05,0,0,0,16-16V143.91A16,16,0,0,0,624,128H512L457.41,73.41A32,32,0,0,0,434.8,64H348.91a32,32,0,0,0-21.61,8.41l-88.12,80.68-25.69-19.85L289.09,64H205.3a32,32,0,0,0-22.6,9.41l-20.34,20.3L45.47,3.38A16,16,0,0,0,23,6.19L3.38,31.46A16,16,0,0,0,6.19,53.91L594.54,508.63A16,16,0,0,0,617,505.82l19.64-25.27a16,16,0,0,0-2.81-22.45L303.4,202.72l32.69-29.92,27-24.7a16,16,0,0,1,21.61,23.61ZM16,128A16.05,16.05,0,0,0,0,144V335.91a16,16,0,0,0,16,16H146.3l90.5,81.89a64,64,0,0,0,90-9.3l.2-.2,17.91,15.5a37.16,37.16,0,0,0,52.29-5.39l8.8-10.82L23.56,128Z"]
};
var faHandshakeSlash = {
prefix: 'fas',
iconName: 'handshake-slash',
icon: [640, 512, [], "e060", "M0,128.21V384H64a32,32,0,0,0,32-32V184L23.83,128.21ZM48,320.1a16,16,0,1,1-16,16A16,16,0,0,1,48,320.1Zm80,31.81h18.3l90.5,81.89a64,64,0,0,0,90-9.3l.2-.2,17.91,15.5a37.16,37.16,0,0,0,52.29-5.39l8.8-10.82L128,208.72Zm416-223.7V352.1a32,32,0,0,0,32,32h64V128.21ZM592,352.1a16,16,0,1,1,16-16A16,16,0,0,1,592,352.1ZM303.33,202.67l59.58-54.57a16,16,0,0,1,21.59,23.61L358.41,195.6,504,313.8a73.08,73.08,0,0,1,7.91,7.7V128L457.3,73.41A31.76,31.76,0,0,0,434.7,64H348.8a31.93,31.93,0,0,0-21.6,8.41l-88.07,80.64-25.64-19.81L289.09,64H205.3a32,32,0,0,0-22.6,9.41L162.36,93.72,45.47,3.38A16,16,0,0,0,23,6.19L3.38,31.46A16,16,0,0,0,6.19,53.91L594.53,508.63A16,16,0,0,0,617,505.82l19.65-25.27a16,16,0,0,0-2.82-22.45Z"]
};
var faHanukiah = {
prefix: 'fas',
iconName: 'hanukiah',
icon: [640, 512, [], "f6e6", "M232 160c-4.42 0-8 3.58-8 8v120h32V168c0-4.42-3.58-8-8-8h-16zm-64 0c-4.42 0-8 3.58-8 8v120h32V168c0-4.42-3.58-8-8-8h-16zm224 0c-4.42 0-8 3.58-8 8v120h32V168c0-4.42-3.58-8-8-8h-16zm64 0c-4.42 0-8 3.58-8 8v120h32V168c0-4.42-3.58-8-8-8h-16zm88 8c0-4.42-3.58-8-8-8h-16c-4.42 0-8 3.58-8 8v120h32V168zm-440-8c-4.42 0-8 3.58-8 8v120h32V168c0-4.42-3.58-8-8-8h-16zm520 0h-32c-8.84 0-16 7.16-16 16v112c0 17.67-14.33 32-32 32H352V128c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v192H96c-17.67 0-32-14.33-32-32V176c0-8.84-7.16-16-16-16H16c-8.84 0-16 7.16-16 16v112c0 53.02 42.98 96 96 96h192v64H112c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h416c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16H352v-64h192c53.02 0 96-42.98 96-96V176c0-8.84-7.16-16-16-16zm-16-32c13.25 0 24-11.94 24-26.67S608 48 608 48s-24 38.61-24 53.33S594.75 128 608 128zm-576 0c13.25 0 24-11.94 24-26.67S32 48 32 48 8 86.61 8 101.33 18.75 128 32 128zm288-48c13.25 0 24-11.94 24-26.67S320 0 320 0s-24 38.61-24 53.33S306.75 80 320 80zm-208 48c13.25 0 24-11.94 24-26.67S112 48 112 48s-24 38.61-24 53.33S98.75 128 112 128zm64 0c13.25 0 24-11.94 24-26.67S176 48 176 48s-24 38.61-24 53.33S162.75 128 176 128zm64 0c13.25 0 24-11.94 24-26.67S240 48 240 48s-24 38.61-24 53.33S226.75 128 240 128zm160 0c13.25 0 24-11.94 24-26.67S400 48 400 48s-24 38.61-24 53.33S386.75 128 400 128zm64 0c13.25 0 24-11.94 24-26.67S464 48 464 48s-24 38.61-24 53.33S450.75 128 464 128zm64 0c13.25 0 24-11.94 24-26.67S528 48 528 48s-24 38.61-24 53.33S514.75 128 528 128z"]
};
var faHardHat = {
prefix: 'fas',
iconName: 'hard-hat',
icon: [512, 512, [], "f807", "M480 288c0-80.25-49.28-148.92-119.19-177.62L320 192V80a16 16 0 0 0-16-16h-96a16 16 0 0 0-16 16v112l-40.81-81.62C81.28 139.08 32 207.75 32 288v64h448zm16 96H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h480a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faHashtag = {
prefix: 'fas',
iconName: 'hashtag',
icon: [448, 512, [], "f292", "M440.667 182.109l7.143-40c1.313-7.355-4.342-14.109-11.813-14.109h-74.81l14.623-81.891C377.123 38.754 371.468 32 363.997 32h-40.632a12 12 0 0 0-11.813 9.891L296.175 128H197.54l14.623-81.891C213.477 38.754 207.822 32 200.35 32h-40.632a12 12 0 0 0-11.813 9.891L132.528 128H53.432a12 12 0 0 0-11.813 9.891l-7.143 40C33.163 185.246 38.818 192 46.289 192h74.81L98.242 320H19.146a12 12 0 0 0-11.813 9.891l-7.143 40C-1.123 377.246 4.532 384 12.003 384h74.81L72.19 465.891C70.877 473.246 76.532 480 84.003 480h40.632a12 12 0 0 0 11.813-9.891L151.826 384h98.634l-14.623 81.891C234.523 473.246 240.178 480 247.65 480h40.632a12 12 0 0 0 11.813-9.891L315.472 384h79.096a12 12 0 0 0 11.813-9.891l7.143-40c1.313-7.355-4.342-14.109-11.813-14.109h-74.81l22.857-128h79.096a12 12 0 0 0 11.813-9.891zM261.889 320h-98.634l22.857-128h98.634l-22.857 128z"]
};
var faHatCowboy = {
prefix: 'fas',
iconName: 'hat-cowboy',
icon: [640, 512, [], "f8c0", "M490 296.9C480.51 239.51 450.51 64 392.3 64c-14 0-26.49 5.93-37 14a58.21 58.21 0 0 1-70.58 0c-10.51-8-23-14-37-14-58.2 0-88.2 175.47-97.71 232.88C188.81 309.47 243.73 320 320 320s131.23-10.51 170-23.1zm142.9-37.18a16 16 0 0 0-19.75 1.5c-1 .9-101.27 90.78-293.16 90.78-190.82 0-292.22-89.94-293.24-90.84A16 16 0 0 0 1 278.53C1.73 280.55 78.32 480 320 480s318.27-199.45 319-201.47a16 16 0 0 0-6.09-18.81z"]
};
var faHatCowboySide = {
prefix: 'fas',
iconName: 'hat-cowboy-side',
icon: [640, 512, [], "f8c1", "M260.8 291.06c-28.63-22.94-62-35.06-96.4-35.06C87 256 21.47 318.72 1.43 412.06c-3.55 16.6-.43 33.83 8.57 47.3C18.75 472.47 31.83 480 45.88 480H592c-103.21 0-155-37.07-233.19-104.46zm234.65-18.29L468.4 116.2A64 64 0 0 0 392 64.41L200.85 105a64 64 0 0 0-50.35 55.79L143.61 226c6.9-.83 13.7-2 20.79-2 41.79 0 82 14.55 117.29 42.82l98 84.48C450.76 412.54 494.9 448 592 448a48 48 0 0 0 48-48c0-25.39-29.6-119.33-144.55-127.23z"]
};
var faHatWizard = {
prefix: 'fas',
iconName: 'hat-wizard',
icon: [512, 512, [], "f6e8", "M496 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h480c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm-304-64l-64-32 64-32 32-64 32 64 64 32-64 32-16 32h208l-86.41-201.63a63.955 63.955 0 0 1-1.89-45.45L416 0 228.42 107.19a127.989 127.989 0 0 0-53.46 59.15L64 416h144l-16-32zm64-224l16-32 16 32 32 16-32 16-16 32-16-32-32-16 32-16z"]
};
var faHdd = {
prefix: 'fas',
iconName: 'hdd',
icon: [576, 512, [], "f0a0", "M576 304v96c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48v-96c0-26.51 21.49-48 48-48h480c26.51 0 48 21.49 48 48zm-48-80a79.557 79.557 0 0 1 30.777 6.165L462.25 85.374A48.003 48.003 0 0 0 422.311 64H153.689a48 48 0 0 0-39.938 21.374L17.223 230.165A79.557 79.557 0 0 1 48 224h480zm-48 96c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zm-96 0c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32z"]
};
var faHeadSideCough = {
prefix: 'fas',
iconName: 'head-side-cough',
icon: [640, 512, [], "e061", "M616,304a24,24,0,1,0-24-24A24,24,0,0,0,616,304ZM552,416a24,24,0,1,0,24,24A24,24,0,0,0,552,416Zm-64-56a24,24,0,1,0,24,24A24,24,0,0,0,488,360ZM616,464a24,24,0,1,0,24,24A24,24,0,0,0,616,464Zm0-104a24,24,0,1,0,24,24A24,24,0,0,0,616,360Zm-64-40a24,24,0,1,0,24,24A24,24,0,0,0,552,320Zm-74.78-45c-21-47.12-48.5-151.75-73.12-186.75A208.13,208.13,0,0,0,234.1,0H192C86,0,0,86,0,192c0,56.75,24.75,107.62,64,142.88V512H288V480h64a64,64,0,0,0,64-64H320a32,32,0,0,1,0-64h96V320h32A32,32,0,0,0,477.22,275ZM288,224a32,32,0,1,1,32-32A32.07,32.07,0,0,1,288,224Z"]
};
var faHeadSideCoughSlash = {
prefix: 'fas',
iconName: 'head-side-cough-slash',
icon: [640, 512, [], "e062", "M454.11,319.21c19.56-3.81,31.62-25,23.11-44.21-21-47.12-48.5-151.75-73.12-186.75A208.13,208.13,0,0,0,234.1,0H192A190.64,190.64,0,0,0,84.18,33.3L45.46,3.38A16,16,0,0,0,23,6.19L3.37,31.46A16,16,0,0,0,6.18,53.91L594.53,508.63A16,16,0,0,0,617,505.82l19.64-25.27a16,16,0,0,0-2.81-22.45ZM313.39,210.45,263.61,172c5.88-7.14,14.43-12,24.36-12a32.06,32.06,0,0,1,32,32C320,199,317.24,205.17,313.39,210.45ZM616,304a24,24,0,1,0-24-24A24,24,0,0,0,616,304Zm-64,64a24,24,0,1,0-24-24A24,24,0,0,0,552,368ZM288,384a32,32,0,0,1,32-32h19.54L20.73,105.59A190.86,190.86,0,0,0,0,192c0,56.75,24.75,107.62,64,142.88V512H288V480h64a64,64,0,0,0,64-64H320A32,32,0,0,1,288,384Zm328-24a24,24,0,1,0,24,24A24,24,0,0,0,616,360Z"]
};
var faHeadSideMask = {
prefix: 'fas',
iconName: 'head-side-mask',
icon: [512, 512, [], "e063", "M.15,184.42C-2.17,244.21,23,298.06,64,334.88V512H224V316.51L3.67,156.25A182.28,182.28,0,0,0,.15,184.42ZM509.22,275c-21-47.12-48.5-151.75-73.12-186.75A208.11,208.11,0,0,0,266.11,0H200C117,0,42.48,50.57,13.25,123.65L239.21,288H511.76A31.35,31.35,0,0,0,509.22,275ZM320,224a32,32,0,1,1,32-32A32.07,32.07,0,0,1,320,224Zm16,144H496l16-48H256V512H401.88a64,64,0,0,0,60.71-43.76L464,464H336a16,16,0,0,1,0-32H474.67l10.67-32H336a16,16,0,0,1,0-32Z"]
};
var faHeadSideVirus = {
prefix: 'fas',
iconName: 'head-side-virus',
icon: [512, 512, [], "e064", "M272,240a16,16,0,1,0,16,16A16,16,0,0,0,272,240Zm-64-64a16,16,0,1,0,16,16A16,16,0,0,0,208,176Zm301.2,99c-20.93-47.12-48.43-151.73-73.07-186.75A207.9,207.9,0,0,0,266.09,0H192C86,0,0,86,0,192A191.23,191.23,0,0,0,64,334.81V512H320V448h64a64,64,0,0,0,64-64V320H480A32,32,0,0,0,509.2,275ZM368,240H355.88c-28.51,0-42.79,34.47-22.63,54.63l8.58,8.57a16,16,0,1,1-22.63,22.63l-8.57-8.58C290.47,297.09,256,311.37,256,339.88V352a16,16,0,0,1-32,0V339.88c0-28.51-34.47-42.79-54.63-22.63l-8.57,8.58a16,16,0,0,1-22.63-22.63l8.58-8.57c20.16-20.16,5.88-54.63-22.63-54.63H112a16,16,0,0,1,0-32h12.12c28.51,0,42.79-34.47,22.63-54.63l-8.58-8.57a16,16,0,0,1,22.63-22.63l8.57,8.58c20.16,20.16,54.63,5.88,54.63-22.63V96a16,16,0,0,1,32,0v12.12c0,28.51,34.47,42.79,54.63,22.63l8.57-8.58a16,16,0,0,1,22.63,22.63l-8.58,8.57C313.09,173.53,327.37,208,355.88,208H368a16,16,0,0,1,0,32Z"]
};
var faHeading = {
prefix: 'fas',
iconName: 'heading',
icon: [512, 512, [], "f1dc", "M448 96v320h32a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16H320a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32V288H160v128h32a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16H32a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h32V96H32a16 16 0 0 1-16-16V48a16 16 0 0 1 16-16h160a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16h-32v128h192V96h-32a16 16 0 0 1-16-16V48a16 16 0 0 1 16-16h160a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16z"]
};
var faHeadphones = {
prefix: 'fas',
iconName: 'headphones',
icon: [512, 512, [], "f025", "M256 32C114.52 32 0 146.496 0 288v48a32 32 0 0 0 17.689 28.622l14.383 7.191C34.083 431.903 83.421 480 144 480h24c13.255 0 24-10.745 24-24V280c0-13.255-10.745-24-24-24h-24c-31.342 0-59.671 12.879-80 33.627V288c0-105.869 86.131-192 192-192s192 86.131 192 192v1.627C427.671 268.879 399.342 256 368 256h-24c-13.255 0-24 10.745-24 24v176c0 13.255 10.745 24 24 24h24c60.579 0 109.917-48.098 111.928-108.187l14.382-7.191A32 32 0 0 0 512 336v-48c0-141.479-114.496-256-256-256z"]
};
var faHeadphonesAlt = {
prefix: 'fas',
iconName: 'headphones-alt',
icon: [512, 512, [], "f58f", "M160 288h-16c-35.35 0-64 28.7-64 64.12v63.76c0 35.41 28.65 64.12 64 64.12h16c17.67 0 32-14.36 32-32.06V320.06c0-17.71-14.33-32.06-32-32.06zm208 0h-16c-17.67 0-32 14.35-32 32.06v127.88c0 17.7 14.33 32.06 32 32.06h16c35.35 0 64-28.71 64-64.12v-63.76c0-35.41-28.65-64.12-64-64.12zM256 32C112.91 32 4.57 151.13 0 288v112c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16V288c0-114.67 93.33-207.8 208-207.82 114.67.02 208 93.15 208 207.82v112c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16V288C507.43 151.13 399.09 32 256 32z"]
};
var faHeadset = {
prefix: 'fas',
iconName: 'headset',
icon: [512, 512, [], "f590", "M192 208c0-17.67-14.33-32-32-32h-16c-35.35 0-64 28.65-64 64v48c0 35.35 28.65 64 64 64h16c17.67 0 32-14.33 32-32V208zm176 144c35.35 0 64-28.65 64-64v-48c0-35.35-28.65-64-64-64h-16c-17.67 0-32 14.33-32 32v112c0 17.67 14.33 32 32 32h16zM256 0C113.18 0 4.58 118.83 0 256v16c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-16c0-114.69 93.31-208 208-208s208 93.31 208 208h-.12c.08 2.43.12 165.72.12 165.72 0 23.35-18.93 42.28-42.28 42.28H320c0-26.51-21.49-48-48-48h-32c-26.51 0-48 21.49-48 48s21.49 48 48 48h181.72c49.86 0 90.28-40.42 90.28-90.28V256C507.42 118.83 398.82 0 256 0z"]
};
var faHeart = {
prefix: 'fas',
iconName: 'heart',
icon: [512, 512, [], "f004", "M462.3 62.6C407.5 15.9 326 24.3 275.7 76.2L256 96.5l-19.7-20.3C186.1 24.3 104.5 15.9 49.7 62.6c-62.8 53.6-66.1 149.8-9.9 207.9l193.5 199.8c12.5 12.9 32.8 12.9 45.3 0l193.5-199.8c56.3-58.1 53-154.3-9.8-207.9z"]
};
var faHeartBroken = {
prefix: 'fas',
iconName: 'heart-broken',
icon: [512, 512, [], "f7a9", "M473.7 73.8l-2.4-2.5c-46-47-118-51.7-169.6-14.8L336 159.9l-96 64 48 128-144-144 96-64-28.6-86.5C159.7 19.6 87 24 40.7 71.4l-2.4 2.4C-10.4 123.6-12.5 202.9 31 256l212.1 218.6c7.1 7.3 18.6 7.3 25.7 0L481 255.9c43.5-53 41.4-132.3-7.3-182.1z"]
};
var faHeartbeat = {
prefix: 'fas',
iconName: 'heartbeat',
icon: [512, 512, [], "f21e", "M320.2 243.8l-49.7 99.4c-6 12.1-23.4 11.7-28.9-.6l-56.9-126.3-30 71.7H60.6l182.5 186.5c7.1 7.3 18.6 7.3 25.7 0L451.4 288H342.3l-22.1-44.2zM473.7 73.9l-2.4-2.5c-51.5-52.6-135.8-52.6-187.4 0L256 100l-27.9-28.5c-51.5-52.7-135.9-52.7-187.4 0l-2.4 2.4C-10.4 123.7-12.5 203 31 256h102.4l35.9-86.2c5.4-12.9 23.6-13.2 29.4-.4l58.2 129.3 49-97.9c5.9-11.8 22.7-11.8 28.6 0l27.6 55.2H481c43.5-53 41.4-132.3-7.3-182.1z"]
};
var faHelicopter = {
prefix: 'fas',
iconName: 'helicopter',
icon: [640, 512, [], "f533", "M304 384h272c17.67 0 32-14.33 32-32 0-123.71-100.29-224-224-224V64h176c8.84 0 16-7.16 16-16V16c0-8.84-7.16-16-16-16H144c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h176v64H112L68.8 70.4C65.78 66.37 61.03 64 56 64H16.01C5.6 64-2.04 73.78.49 83.88L32 192l160 64 86.4 115.2A31.992 31.992 0 0 0 304 384zm112-188.49C478.55 208.3 528.03 257.44 540.79 320H416V195.51zm219.37 263.3l-22.15-22.2c-6.25-6.26-16.24-6.1-22.64.01-7.09 6.77-13.84 11.25-24.64 11.25H240c-8.84 0-16 7.18-16 16.03v32.06c0 8.85 7.16 16.03 16 16.03h325.94c14.88 0 35.3-.47 68.45-29.52 7.02-6.14 7.57-17.05.98-23.66z"]
};
var faHighlighter = {
prefix: 'fas',
iconName: 'highlighter',
icon: [544, 512, [], "f591", "M0 479.98L99.92 512l35.45-35.45-67.04-67.04L0 479.98zm124.61-240.01a36.592 36.592 0 0 0-10.79 38.1l13.05 42.83-50.93 50.94 96.23 96.23 50.86-50.86 42.74 13.08c13.73 4.2 28.65-.01 38.15-10.78l35.55-41.64-173.34-173.34-41.52 35.44zm403.31-160.7l-63.2-63.2c-20.49-20.49-53.38-21.52-75.12-2.35L190.55 183.68l169.77 169.78L530.27 154.4c19.18-21.74 18.15-54.63-2.35-75.13z"]
};
var faHiking = {
prefix: 'fas',
iconName: 'hiking',
icon: [384, 512, [], "f6ec", "M80.95 472.23c-4.28 17.16 6.14 34.53 23.28 38.81 2.61.66 5.22.95 7.8.95 14.33 0 27.37-9.7 31.02-24.23l25.24-100.97-52.78-52.78-34.56 138.22zm14.89-196.12L137 117c2.19-8.42-3.14-16.95-11.92-19.06-43.88-10.52-88.35 15.07-99.32 57.17L.49 253.24c-2.19 8.42 3.14 16.95 11.92 19.06l63.56 15.25c8.79 2.1 17.68-3.02 19.87-11.44zM368 160h-16c-8.84 0-16 7.16-16 16v16h-34.75l-46.78-46.78C243.38 134.11 228.61 128 212.91 128c-27.02 0-50.47 18.3-57.03 44.52l-26.92 107.72a32.012 32.012 0 0 0 8.42 30.39L224 397.25V480c0 17.67 14.33 32 32 32s32-14.33 32-32v-82.75c0-17.09-6.66-33.16-18.75-45.25l-46.82-46.82c.15-.5.49-.89.62-1.41l19.89-79.57 22.43 22.43c6 6 14.14 9.38 22.62 9.38h48v240c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16V176c.01-8.84-7.15-16-15.99-16zM240 96c26.51 0 48-21.49 48-48S266.51 0 240 0s-48 21.49-48 48 21.49 48 48 48z"]
};
var faHippo = {
prefix: 'fas',
iconName: 'hippo',
icon: [640, 512, [], "f6ed", "M581.12 96.2c-27.67-.15-52.5 17.58-76.6 26.62C489.98 88.27 455.83 64 416 64c-11.28 0-21.95 2.3-32 5.88V56c0-13.26-10.75-24-24-24h-16c-13.25 0-24 10.74-24 24v48.98C286.01 79.58 241.24 64 192 64 85.96 64 0 135.64 0 224v240c0 8.84 7.16 16 16 16h64c8.84 0 16-7.16 16-16v-70.79C128.35 407.57 166.72 416 208 416s79.65-8.43 112-22.79V464c0 8.84 7.16 16 16 16h64c8.84 0 16-7.16 16-16V288h128v32c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-32c17.67 0 32-14.33 32-32v-92.02c0-34.09-24.79-67.59-58.88-67.78zM448 176c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16z"]
};
var faHistory = {
prefix: 'fas',
iconName: 'history',
icon: [512, 512, [], "f1da", "M504 255.531c.253 136.64-111.18 248.372-247.82 248.468-59.015.042-113.223-20.53-155.822-54.911-11.077-8.94-11.905-25.541-1.839-35.607l11.267-11.267c8.609-8.609 22.353-9.551 31.891-1.984C173.062 425.135 212.781 440 256 440c101.705 0 184-82.311 184-184 0-101.705-82.311-184-184-184-48.814 0-93.149 18.969-126.068 49.932l50.754 50.754c10.08 10.08 2.941 27.314-11.313 27.314H24c-8.837 0-16-7.163-16-16V38.627c0-14.254 17.234-21.393 27.314-11.314l49.372 49.372C129.209 34.136 189.552 8 256 8c136.81 0 247.747 110.78 248 247.531zm-180.912 78.784l9.823-12.63c8.138-10.463 6.253-25.542-4.21-33.679L288 256.349V152c0-13.255-10.745-24-24-24h-16c-13.255 0-24 10.745-24 24v135.651l65.409 50.874c10.463 8.137 25.541 6.253 33.679-4.21z"]
};
var faHockeyPuck = {
prefix: 'fas',
iconName: 'hockey-puck',
icon: [512, 512, [], "f453", "M0 160c0-53 114.6-96 256-96s256 43 256 96-114.6 96-256 96S0 213 0 160zm0 82.2V352c0 53 114.6 96 256 96s256-43 256-96V242.2c-113.4 82.3-398.5 82.4-512 0z"]
};
var faHollyBerry = {
prefix: 'fas',
iconName: 'holly-berry',
icon: [448, 512, [], "f7aa", "M144 192c26.5 0 48-21.5 48-48s-21.5-48-48-48-48 21.5-48 48 21.5 48 48 48zm112-48c0 26.5 21.5 48 48 48s48-21.5 48-48-21.5-48-48-48-48 21.5-48 48zm-32-48c26.5 0 48-21.5 48-48S250.5 0 224 0s-48 21.5-48 48 21.5 48 48 48zm-16.2 139.1c.1-12.4-13.1-20.1-23.8-13.7-34.3 20.3-71.4 32.7-108.7 36.2-9.7.9-15.6 11.3-11.6 20.2 6.2 13.9 11.1 28.6 14.7 43.8 3.6 15.2-5.3 30.6-20.2 35.1-14.9 4.5-30.1 7.6-45.3 9.1-9.7 1-15.7 11.3-11.7 20.2 15 32.8 22.9 69.5 23 107.7.1 14.4 15.2 23.1 27.6 16 33.2-19 68.9-30.5 104.8-33.9 9.7-.9 15.6-11.3 11.6-20.2-6.2-13.9-11.1-28.6-14.7-43.8-3.6-15.2 5.3-30.6 20.2-35.1 14.9-4.5 30.1-7.6 45.3-9.1 9.7-1 15.7-11.3 11.7-20.2-15.5-34.2-23.3-72.5-22.9-112.3zM435 365.6c-15.2-1.6-30.3-4.7-45.3-9.1-14.9-4.5-23.8-19.9-20.2-35.1 3.6-15.2 8.5-29.8 14.7-43.8 4-8.9-1.9-19.3-11.6-20.2-37.3-3.5-74.4-15.9-108.7-36.2-10.7-6.3-23.9 1.4-23.8 13.7 0 1.6-.2 3.2-.2 4.9.2 33.3 7 65.7 19.9 94 5.7 12.4 5.2 26.6-.6 38.9 4.9 1.2 9.9 2.2 14.8 3.7 14.9 4.5 23.8 19.9 20.2 35.1-3.6 15.2-8.5 29.8-14.7 43.8-4 8.9 1.9 19.3 11.6 20.2 35.9 3.4 71.6 14.9 104.8 33.9 12.5 7.1 27.6-1.6 27.6-16 .2-38.2 8-75 23-107.7 4.3-8.7-1.8-19.1-11.5-20.1z"]
};
var faHome = {
prefix: 'fas',
iconName: 'home',
icon: [576, 512, [], "f015", "M280.37 148.26L96 300.11V464a16 16 0 0 0 16 16l112.06-.29a16 16 0 0 0 15.92-16V368a16 16 0 0 1 16-16h64a16 16 0 0 1 16 16v95.64a16 16 0 0 0 16 16.05L464 480a16 16 0 0 0 16-16V300L295.67 148.26a12.19 12.19 0 0 0-15.3 0zM571.6 251.47L488 182.56V44.05a12 12 0 0 0-12-12h-56a12 12 0 0 0-12 12v72.61L318.47 43a48 48 0 0 0-61 0L4.34 251.47a12 12 0 0 0-1.6 16.9l25.5 31A12 12 0 0 0 45.15 301l235.22-193.74a12.19 12.19 0 0 1 15.3 0L530.9 301a12 12 0 0 0 16.9-1.6l25.5-31a12 12 0 0 0-1.7-16.93z"]
};
var faHorse = {
prefix: 'fas',
iconName: 'horse',
icon: [576, 512, [], "f6f0", "M575.92 76.6c-.01-8.13-3.02-15.87-8.58-21.8-3.78-4.03-8.58-9.12-13.69-14.5 11.06-6.84 19.5-17.49 22.18-30.66C576.85 4.68 572.96 0 567.9 0H447.92c-70.69 0-128 57.31-128 128H160c-28.84 0-54.4 12.98-72 33.11V160c-48.53 0-88 39.47-88 88v56c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-56c0-13.22 6.87-24.39 16.78-31.68-.21 2.58-.78 5.05-.78 7.68 0 27.64 11.84 52.36 30.54 69.88l-25.72 68.6a63.945 63.945 0 0 0-2.16 37.99l24.85 99.41A15.982 15.982 0 0 0 107.02 512h65.96c10.41 0 18.05-9.78 15.52-19.88l-26.31-105.26 23.84-63.59L320 345.6V496c0 8.84 7.16 16 16 16h64c8.84 0 16-7.16 16-16V318.22c19.74-20.19 32-47.75 32-78.22 0-.22-.07-.42-.08-.64V136.89l16 7.11 18.9 37.7c7.45 14.87 25.05 21.55 40.49 15.37l32.55-13.02a31.997 31.997 0 0 0 20.12-29.74l-.06-77.71zm-64 19.4c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16z"]
};
var faHorseHead = {
prefix: 'fas',
iconName: 'horse-head',
icon: [512, 512, [], "f7ab", "M509.8 332.5l-69.9-164.3c-14.9-41.2-50.4-71-93-79.2 18-10.6 46.3-35.9 34.2-82.3-1.3-5-7.1-7.9-12-6.1L166.9 76.3C35.9 123.4 0 238.9 0 398.8V480c0 17.7 14.3 32 32 32h236.2c23.8 0 39.3-25 28.6-46.3L256 384v-.7c-45.6-3.5-84.6-30.7-104.3-69.6-1.6-3.1-.9-6.9 1.6-9.3l12.1-12.1c3.9-3.9 10.6-2.7 12.9 2.4 14.8 33.7 48.2 57.4 87.4 57.4 17.2 0 33-5.1 46.8-13.2l46 63.9c6 8.4 15.7 13.3 26 13.3h50.3c8.5 0 16.6-3.4 22.6-9.4l45.3-39.8c8.9-9.1 11.7-22.6 7.1-34.4zM328 224c-13.3 0-24-10.7-24-24s10.7-24 24-24 24 10.7 24 24-10.7 24-24 24z"]
};
var faHospital = {
prefix: 'fas',
iconName: 'hospital',
icon: [448, 512, [], "f0f8", "M448 492v20H0v-20c0-6.627 5.373-12 12-12h20V120c0-13.255 10.745-24 24-24h88V24c0-13.255 10.745-24 24-24h112c13.255 0 24 10.745 24 24v72h88c13.255 0 24 10.745 24 24v360h20c6.627 0 12 5.373 12 12zM308 192h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12zm-168 64h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12zm104 128h-40c-6.627 0-12 5.373-12 12v84h64v-84c0-6.627-5.373-12-12-12zm64-96h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12zm-116 12c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-40zM182 96h26v26a6 6 0 0 0 6 6h20a6 6 0 0 0 6-6V96h26a6 6 0 0 0 6-6V70a6 6 0 0 0-6-6h-26V38a6 6 0 0 0-6-6h-20a6 6 0 0 0-6 6v26h-26a6 6 0 0 0-6 6v20a6 6 0 0 0 6 6z"]
};
var faHospitalAlt = {
prefix: 'fas',
iconName: 'hospital-alt',
icon: [576, 512, [], "f47d", "M544 96H416V32c0-17.7-14.3-32-32-32H192c-17.7 0-32 14.3-32 32v64H32c-17.7 0-32 14.3-32 32v368c0 8.8 7.2 16 16 16h544c8.8 0 16-7.2 16-16V128c0-17.7-14.3-32-32-32zM160 436c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-128c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm160 128c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-128c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm16-170c0 3.3-2.7 6-6 6h-26v26c0 3.3-2.7 6-6 6h-20c-3.3 0-6-2.7-6-6v-26h-26c-3.3 0-6-2.7-6-6v-20c0-3.3 2.7-6 6-6h26V86c0-3.3 2.7-6 6-6h20c3.3 0 6 2.7 6 6v26h26c3.3 0 6 2.7 6 6v20zm144 298c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40zm0-128c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h40c6.6 0 12 5.4 12 12v40z"]
};
var faHospitalSymbol = {
prefix: 'fas',
iconName: 'hospital-symbol',
icon: [512, 512, [], "f47e", "M256 0C114.6 0 0 114.6 0 256s114.6 256 256 256 256-114.6 256-256S397.4 0 256 0zm112 376c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-88h-96v88c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8V136c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v88h96v-88c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v240z"]
};
var faHospitalUser = {
prefix: 'fas',
iconName: 'hospital-user',
icon: [640, 512, [], "f80d", "M480 320a96 96 0 1 0-96-96 96 96 0 0 0 96 96zm48 32a22.88 22.88 0 0 0-7.06 1.09 124.76 124.76 0 0 1-81.89 0A22.82 22.82 0 0 0 432 352a112 112 0 0 0-112 112.62c.14 26.26 21.73 47.38 48 47.38h224c26.27 0 47.86-21.12 48-47.38A112 112 0 0 0 528 352zm-198.09 10.45A145.19 145.19 0 0 1 352 344.62V128a32 32 0 0 0-32-32h-32V32a32 32 0 0 0-32-32H96a32 32 0 0 0-32 32v64H32a32 32 0 0 0-32 32v368a16 16 0 0 0 16 16h288.31A78.62 78.62 0 0 1 288 464.79a143.06 143.06 0 0 1 41.91-102.34zM144 404a12 12 0 0 1-12 12H92a12 12 0 0 1-12-12v-40a12 12 0 0 1 12-12h40a12 12 0 0 1 12 12zm0-128a12 12 0 0 1-12 12H92a12 12 0 0 1-12-12v-40a12 12 0 0 1 12-12h40a12 12 0 0 1 12 12zm48-122a6 6 0 0 1-6 6h-20a6 6 0 0 1-6-6v-26h-26a6 6 0 0 1-6-6v-20a6 6 0 0 1 6-6h26V70a6 6 0 0 1 6-6h20a6 6 0 0 1 6 6v26h26a6 6 0 0 1 6 6v20a6 6 0 0 1-6 6h-26zm80 250a12 12 0 0 1-12 12h-40a12 12 0 0 1-12-12v-40a12 12 0 0 1 12-12h40a12 12 0 0 1 12 12zm0-128a12 12 0 0 1-12 12h-40a12 12 0 0 1-12-12v-40a12 12 0 0 1 12-12h40a12 12 0 0 1 12 12z"]
};
var faHotTub = {
prefix: 'fas',
iconName: 'hot-tub',
icon: [512, 512, [], "f593", "M414.21 177.65c1.02 8.21 7.75 14.35 15.75 14.35h16.12c9.51 0 17.08-8.57 16-18.35-4.34-39.11-22.4-74.53-50.13-97.16-17.37-14.17-28.82-36.75-31.98-62.15C378.96 6.14 372.22 0 364.23 0h-16.12c-9.51 0-17.09 8.57-16 18.35 4.34 39.11 22.4 74.53 50.13 97.16 17.36 14.17 28.82 36.75 31.97 62.14zm-108 0c1.02 8.21 7.75 14.35 15.75 14.35h16.12c9.51 0 17.08-8.57 16-18.35-4.34-39.11-22.4-74.53-50.13-97.16-17.37-14.17-28.82-36.75-31.98-62.15C270.96 6.14 264.22 0 256.23 0h-16.12c-9.51 0-17.09 8.57-16 18.35 4.34 39.11 22.4 74.53 50.13 97.16 17.36 14.17 28.82 36.75 31.97 62.14zM480 256H256l-110.93-83.2a63.99 63.99 0 0 0-38.4-12.8H64c-35.35 0-64 28.65-64 64v224c0 35.35 28.65 64 64 64h384c35.35 0 64-28.65 64-64V288c0-17.67-14.33-32-32-32zM128 440c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8V328c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v112zm96 0c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8V328c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v112zm96 0c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8V328c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v112zm96 0c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8V328c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v112zM64 128c35.35 0 64-28.65 64-64S99.35 0 64 0 0 28.65 0 64s28.65 64 64 64z"]
};
var faHotdog = {
prefix: 'fas',
iconName: 'hotdog',
icon: [512, 512, [], "f80f", "M488.56 23.44a80 80 0 0 0-113.12 0l-352 352a80 80 0 1 0 113.12 113.12l352-352a80 80 0 0 0 0-113.12zm-49.93 95.19c-19.6 19.59-37.52 22.67-51.93 25.14C373.76 146 364.4 147.6 352 160s-14 21.76-16.23 34.71c-2.48 14.4-5.55 32.33-25.15 51.92s-37.52 22.67-51.92 25.15C245.75 274 236.4 275.6 224 288s-14 21.75-16.23 34.7c-2.47 14.4-5.54 32.33-25.14 51.92s-37.53 22.68-51.93 25.15C117.76 402 108.4 403.6 96 416a16 16 0 0 1-22.63-22.63c19.6-19.59 37.52-22.67 51.92-25.14 13-2.22 22.3-3.82 34.71-16.23s14-21.75 16.22-34.7c2.48-14.4 5.55-32.33 25.15-51.92s37.52-22.67 51.92-25.14c13-2.22 22.3-3.83 34.7-16.23s14-21.76 16.24-34.71c2.47-14.4 5.54-32.33 25.14-51.92s37.52-22.68 51.92-25.15C394.24 110 403.59 108.41 416 96a16 16 0 0 1 22.63 22.63zM31.44 322.18L322.18 31.44l-11.54-11.55c-25-25-63.85-26.66-86.79-3.72L16.17 223.85c-22.94 22.94-21.27 61.79 3.72 86.78zm449.12-132.36L189.82 480.56l11.54 11.55c25 25 63.85 26.66 86.79 3.72l207.68-207.68c22.94-22.94 21.27-61.79-3.72-86.79z"]
};
var faHotel = {
prefix: 'fas',
iconName: 'hotel',
icon: [576, 512, [], "f594", "M560 64c8.84 0 16-7.16 16-16V16c0-8.84-7.16-16-16-16H16C7.16 0 0 7.16 0 16v32c0 8.84 7.16 16 16 16h15.98v384H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h240v-80c0-8.8 7.2-16 16-16h32c8.8 0 16 7.2 16 16v80h240c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16h-16V64h16zm-304 44.8c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4zm0 96c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4zm-128-96c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4zM179.2 256h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4c0 6.4-6.4 12.8-12.8 12.8zM192 384c0-53.02 42.98-96 96-96s96 42.98 96 96H192zm256-140.8c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4zm0-96c0 6.4-6.4 12.8-12.8 12.8h-38.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h38.4c6.4 0 12.8 6.4 12.8 12.8v38.4z"]
};
var faHourglass = {
prefix: 'fas',
iconName: 'hourglass',
icon: [384, 512, [], "f254", "M360 64c13.255 0 24-10.745 24-24V24c0-13.255-10.745-24-24-24H24C10.745 0 0 10.745 0 24v16c0 13.255 10.745 24 24 24 0 90.965 51.016 167.734 120.842 192C75.016 280.266 24 357.035 24 448c-13.255 0-24 10.745-24 24v16c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24 0-90.965-51.016-167.734-120.842-192C308.984 231.734 360 154.965 360 64z"]
};
var faHourglassEnd = {
prefix: 'fas',
iconName: 'hourglass-end',
icon: [384, 512, [], "f253", "M360 64c13.255 0 24-10.745 24-24V24c0-13.255-10.745-24-24-24H24C10.745 0 0 10.745 0 24v16c0 13.255 10.745 24 24 24 0 90.965 51.016 167.734 120.842 192C75.016 280.266 24 357.035 24 448c-13.255 0-24 10.745-24 24v16c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24 0-90.965-51.016-167.734-120.842-192C308.984 231.734 360 154.965 360 64zM192 208c-57.787 0-104-66.518-104-144h208c0 77.945-46.51 144-104 144z"]
};
var faHourglassHalf = {
prefix: 'fas',
iconName: 'hourglass-half',
icon: [384, 512, [], "f252", "M360 0H24C10.745 0 0 10.745 0 24v16c0 13.255 10.745 24 24 24 0 90.965 51.016 167.734 120.842 192C75.016 280.266 24 357.035 24 448c-13.255 0-24 10.745-24 24v16c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24 0-90.965-51.016-167.734-120.842-192C308.984 231.734 360 154.965 360 64c13.255 0 24-10.745 24-24V24c0-13.255-10.745-24-24-24zm-75.078 384H99.08c17.059-46.797 52.096-80 92.92-80 40.821 0 75.862 33.196 92.922 80zm.019-256H99.078C91.988 108.548 88 86.748 88 64h208c0 22.805-3.987 44.587-11.059 64z"]
};
var faHourglassStart = {
prefix: 'fas',
iconName: 'hourglass-start',
icon: [384, 512, [], "f251", "M360 0H24C10.745 0 0 10.745 0 24v16c0 13.255 10.745 24 24 24 0 90.965 51.016 167.734 120.842 192C75.016 280.266 24 357.035 24 448c-13.255 0-24 10.745-24 24v16c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24 0-90.965-51.016-167.734-120.842-192C308.984 231.734 360 154.965 360 64c13.255 0 24-10.745 24-24V24c0-13.255-10.745-24-24-24zm-64 448H88c0-77.458 46.204-144 104-144 57.786 0 104 66.517 104 144z"]
};
var faHouseDamage = {
prefix: 'fas',
iconName: 'house-damage',
icon: [576, 512, [], "f6f1", "M288 114.96L69.47 307.71c-1.62 1.46-3.69 2.14-5.47 3.35V496c0 8.84 7.16 16 16 16h149.23L192 439.19l104.11-64-60.16-119.22L384 392.75l-104.11 64L319.81 512H496c8.84 0 16-7.16 16-16V311.1c-1.7-1.16-3.72-1.82-5.26-3.2L288 114.96zm282.69 121.32L512 184.45V48c0-8.84-7.16-16-16-16h-64c-8.84 0-16 7.16-16 16v51.69L314.75 10.31C307.12 3.45 297.56.01 288 0s-19.1 3.41-26.7 10.27L5.31 236.28c-6.57 5.91-7.12 16.02-1.21 22.6l21.4 23.82c5.9 6.57 16.02 7.12 22.6 1.21L277.42 81.63c6.05-5.33 15.12-5.33 21.17 0L527.91 283.9c6.57 5.9 16.69 5.36 22.6-1.21l21.4-23.82c5.9-6.57 5.36-16.69-1.22-22.59z"]
};
var faHouseUser = {
prefix: 'fas',
iconName: 'house-user',
icon: [576, 512, [], "e065", "M570.69,236.27,512,184.44V48a16,16,0,0,0-16-16H432a16,16,0,0,0-16,16V99.67L314.78,10.3C308.5,4.61,296.53,0,288,0s-20.46,4.61-26.74,10.3l-256,226A18.27,18.27,0,0,0,0,248.2a18.64,18.64,0,0,0,4.09,10.71L25.5,282.7a21.14,21.14,0,0,0,12,5.3,21.67,21.67,0,0,0,10.69-4.11l15.9-14V480a32,32,0,0,0,32,32H480a32,32,0,0,0,32-32V269.88l15.91,14A21.94,21.94,0,0,0,538.63,288a20.89,20.89,0,0,0,11.87-5.31l21.41-23.81A21.64,21.64,0,0,0,576,248.19,21,21,0,0,0,570.69,236.27ZM288,176a64,64,0,1,1-64,64A64,64,0,0,1,288,176ZM400,448H176a16,16,0,0,1-16-16,96,96,0,0,1,96-96h64a96,96,0,0,1,96,96A16,16,0,0,1,400,448Z"]
};
var faHryvnia = {
prefix: 'fas',
iconName: 'hryvnia',
icon: [384, 512, [], "f6f2", "M368 240c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16h-41.86c13.41-28.63 13.74-63.33-4.13-94.05C303.34 49.84 267.1 32 229.96 32h-78.82c-24.32 0-47.86 8.53-66.54 24.09L72.83 65.9c-10.18 8.49-11.56 23.62-3.07 33.8l20.49 24.59c8.49 10.19 23.62 11.56 33.81 3.07l11.73-9.78c4.32-3.6 9.77-5.57 15.39-5.57h83.62c11.69 0 21.2 9.52 21.2 21.2 0 5.91-2.48 11.58-6.81 15.58L219.7 176H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h134.37l-34.67 32H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h41.86c-13.41 28.63-13.74 63.33 4.13 94.05C80.66 462.15 116.9 480 154.04 480h78.82c24.32 0 47.86-8.53 66.54-24.09l11.77-9.81c10.18-8.49 11.56-23.62 3.07-33.8l-20.49-24.59c-8.49-10.19-23.62-11.56-33.81-3.07l-11.75 9.8a23.992 23.992 0 0 1-15.36 5.56H149.2c-11.69 0-21.2-9.52-21.2-21.2 0-5.91 2.48-11.58 6.81-15.58L164.3 336H368c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16H233.63l34.67-32H368z"]
};
var faICursor = {
prefix: 'fas',
iconName: 'i-cursor',
icon: [256, 512, [], "f246", "M256 52.048V12.065C256 5.496 250.726.148 244.158.066 211.621-.344 166.469.011 128 37.959 90.266.736 46.979-.114 11.913.114 5.318.157 0 5.519 0 12.114v39.645c0 6.687 5.458 12.078 12.145 11.998C38.111 63.447 96 67.243 96 112.182V224H60c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h36v112c0 44.932-56.075 48.031-83.95 47.959C5.404 447.942 0 453.306 0 459.952v39.983c0 6.569 5.274 11.917 11.842 11.999 32.537.409 77.689.054 116.158-37.894 37.734 37.223 81.021 38.073 116.087 37.845 6.595-.043 11.913-5.405 11.913-12V460.24c0-6.687-5.458-12.078-12.145-11.998C217.889 448.553 160 444.939 160 400V288h36c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-36V112.182c0-44.932 56.075-48.213 83.95-48.142 6.646.018 12.05-5.346 12.05-11.992z"]
};
var faIceCream = {
prefix: 'fas',
iconName: 'ice-cream',
icon: [448, 512, [], "f810", "M368 160h-.94a144 144 0 1 0-286.12 0H80a48 48 0 0 0 0 96h288a48 48 0 0 0 0-96zM195.38 493.69a31.52 31.52 0 0 0 57.24 0L352 288H96z"]
};
var faIcicles = {
prefix: 'fas',
iconName: 'icicles',
icon: [512, 512, [], "f7ad", "M511.4 37.9C515.1 18.2 500 0 480 0H32C10.6 0-4.8 20.7 1.4 41.2l87.1 273.4c2.5 7.2 12.7 7.2 15.1 0L140 190.5l44.2 187.3c1.9 8.3 13.7 8.3 15.6 0l46.5-196.9 34.1 133.4c2.3 7.6 13 7.6 15.3 0l45.8-172.5 66.7 363.8c1.7 8.6 14 8.6 15.7 0l87.5-467.7z"]
};
var faIcons = {
prefix: 'fas',
iconName: 'icons',
icon: [512, 512, [], "f86d", "M116.65 219.35a15.68 15.68 0 0 0 22.65 0l96.75-99.83c28.15-29 26.5-77.1-4.91-103.88C203.75-7.7 163-3.5 137.86 22.44L128 32.58l-9.85-10.14C93.05-3.5 52.25-7.7 24.86 15.64c-31.41 26.78-33 74.85-5 103.88zm143.92 100.49h-48l-7.08-14.24a27.39 27.39 0 0 0-25.66-17.78h-71.71a27.39 27.39 0 0 0-25.66 17.78l-7 14.24h-48A27.45 27.45 0 0 0 0 347.3v137.25A27.44 27.44 0 0 0 27.43 512h233.14A27.45 27.45 0 0 0 288 484.55V347.3a27.45 27.45 0 0 0-27.43-27.46zM144 468a52 52 0 1 1 52-52 52 52 0 0 1-52 52zm355.4-115.9h-60.58l22.36-50.75c2.1-6.65-3.93-13.21-12.18-13.21h-75.59c-6.3 0-11.66 3.9-12.5 9.1l-16.8 106.93c-1 6.3 4.88 11.89 12.5 11.89h62.31l-24.2 83c-1.89 6.65 4.2 12.9 12.23 12.9a13.26 13.26 0 0 0 10.92-5.25l92.4-138.91c4.88-6.91-1.16-15.7-10.87-15.7zM478.08.33L329.51 23.17C314.87 25.42 304 38.92 304 54.83V161.6a83.25 83.25 0 0 0-16-1.7c-35.35 0-64 21.48-64 48s28.65 48 64 48c35.2 0 63.73-21.32 64-47.66V99.66l112-17.22v47.18a83.25 83.25 0 0 0-16-1.7c-35.35 0-64 21.48-64 48s28.65 48 64 48c35.2 0 63.73-21.32 64-47.66V32c0-19.48-16-34.42-33.92-31.67z"]
};
var faIdBadge = {
prefix: 'fas',
iconName: 'id-badge',
icon: [384, 512, [], "f2c1", "M336 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM144 32h96c8.8 0 16 7.2 16 16s-7.2 16-16 16h-96c-8.8 0-16-7.2-16-16s7.2-16 16-16zm48 128c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zm112 236.8c0 10.6-10 19.2-22.4 19.2H102.4C90 416 80 407.4 80 396.8v-19.2c0-31.8 30.1-57.6 67.2-57.6h5c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h5c37.1 0 67.2 25.8 67.2 57.6v19.2z"]
};
var faIdCard = {
prefix: 'fas',
iconName: 'id-card',
icon: [576, 512, [], "f2c2", "M528 32H48C21.5 32 0 53.5 0 80v16h576V80c0-26.5-21.5-48-48-48zM0 432c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V128H0v304zm352-232c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16zm0 64c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16zm0 64c0-4.4 3.6-8 8-8h144c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H360c-4.4 0-8-3.6-8-8v-16zM176 192c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zM67.1 396.2C75.5 370.5 99.6 352 128 352h8.2c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h8.2c28.4 0 52.5 18.5 60.9 44.2 3.2 9.9-5.2 19.8-15.6 19.8H82.7c-10.4 0-18.8-10-15.6-19.8z"]
};
var faIdCardAlt = {
prefix: 'fas',
iconName: 'id-card-alt',
icon: [576, 512, [], "f47f", "M528 64H384v96H192V64H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h480c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM288 224c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zm93.3 224H194.7c-10.4 0-18.8-10-15.6-19.8 8.3-25.6 32.4-44.2 60.9-44.2h8.2c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h8.2c28.4 0 52.5 18.5 60.9 44.2 3.2 9.8-5.2 19.8-15.6 19.8zM352 32c0-17.7-14.3-32-32-32h-64c-17.7 0-32 14.3-32 32v96h128V32z"]
};
var faIgloo = {
prefix: 'fas',
iconName: 'igloo',
icon: [576, 512, [], "f7ae", "M320 33.9c-10.5-1.2-21.2-1.9-32-1.9-99.8 0-187.8 50.8-239.4 128H320V33.9zM96 192H30.3C11.1 230.6 0 274 0 320h96V192zM352 39.4V160h175.4C487.2 99.9 424.8 55.9 352 39.4zM480 320h96c0-46-11.1-89.4-30.3-128H480v128zm-64 64v96h128c17.7 0 32-14.3 32-32v-96H411.5c2.6 10.3 4.5 20.9 4.5 32zm32-192H128v128h49.8c22.2-38.1 63-64 110.2-64s88 25.9 110.2 64H448V192zM0 448c0 17.7 14.3 32 32 32h128v-96c0-11.1 1.9-21.7 4.5-32H0v96zm288-160c-53 0-96 43-96 96v96h192v-96c0-53-43-96-96-96z"]
};
var faImage = {
prefix: 'fas',
iconName: 'image',
icon: [512, 512, [], "f03e", "M464 448H48c-26.51 0-48-21.49-48-48V112c0-26.51 21.49-48 48-48h416c26.51 0 48 21.49 48 48v288c0 26.51-21.49 48-48 48zM112 120c-30.928 0-56 25.072-56 56s25.072 56 56 56 56-25.072 56-56-25.072-56-56-56zM64 384h384V272l-87.515-87.515c-4.686-4.686-12.284-4.686-16.971 0L208 320l-55.515-55.515c-4.686-4.686-12.284-4.686-16.971 0L64 336v48z"]
};
var faImages = {
prefix: 'fas',
iconName: 'images',
icon: [576, 512, [], "f302", "M480 416v16c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V176c0-26.51 21.49-48 48-48h16v208c0 44.112 35.888 80 80 80h336zm96-80V80c0-26.51-21.49-48-48-48H144c-26.51 0-48 21.49-48 48v256c0 26.51 21.49 48 48 48h384c26.51 0 48-21.49 48-48zM256 128c0 26.51-21.49 48-48 48s-48-21.49-48-48 21.49-48 48-48 48 21.49 48 48zm-96 144l55.515-55.515c4.686-4.686 12.284-4.686 16.971 0L272 256l135.515-135.515c4.686-4.686 12.284-4.686 16.971 0L512 208v112H160v-48z"]
};
var faInbox = {
prefix: 'fas',
iconName: 'inbox',
icon: [576, 512, [], "f01c", "M567.938 243.908L462.25 85.374A48.003 48.003 0 0 0 422.311 64H153.689a48 48 0 0 0-39.938 21.374L8.062 243.908A47.994 47.994 0 0 0 0 270.533V400c0 26.51 21.49 48 48 48h480c26.51 0 48-21.49 48-48V270.533a47.994 47.994 0 0 0-8.062-26.625zM162.252 128h251.497l85.333 128H376l-32 64H232l-32-64H76.918l85.334-128z"]
};
var faIndent = {
prefix: 'fas',
iconName: 'indent',
icon: [448, 512, [], "f03c", "M27.31 363.3l96-96a16 16 0 0 0 0-22.62l-96-96C17.27 138.66 0 145.78 0 160v192c0 14.31 17.33 21.3 27.31 11.3zM432 416H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm3.17-128H204.83A12.82 12.82 0 0 0 192 300.83v38.34A12.82 12.82 0 0 0 204.83 352h230.34A12.82 12.82 0 0 0 448 339.17v-38.34A12.82 12.82 0 0 0 435.17 288zm0-128H204.83A12.82 12.82 0 0 0 192 172.83v38.34A12.82 12.82 0 0 0 204.83 224h230.34A12.82 12.82 0 0 0 448 211.17v-38.34A12.82 12.82 0 0 0 435.17 160zM432 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faIndustry = {
prefix: 'fas',
iconName: 'industry',
icon: [512, 512, [], "f275", "M475.115 163.781L336 252.309v-68.28c0-18.916-20.931-30.399-36.885-20.248L160 252.309V56c0-13.255-10.745-24-24-24H24C10.745 32 0 42.745 0 56v400c0 13.255 10.745 24 24 24h464c13.255 0 24-10.745 24-24V184.029c0-18.917-20.931-30.399-36.885-20.248z"]
};
var faInfinity = {
prefix: 'fas',
iconName: 'infinity',
icon: [640, 512, [], "f534", "M471.1 96C405 96 353.3 137.3 320 174.6 286.7 137.3 235 96 168.9 96 75.8 96 0 167.8 0 256s75.8 160 168.9 160c66.1 0 117.8-41.3 151.1-78.6 33.3 37.3 85 78.6 151.1 78.6 93.1 0 168.9-71.8 168.9-160S564.2 96 471.1 96zM168.9 320c-40.2 0-72.9-28.7-72.9-64s32.7-64 72.9-64c38.2 0 73.4 36.1 94 64-20.4 27.6-55.9 64-94 64zm302.2 0c-38.2 0-73.4-36.1-94-64 20.4-27.6 55.9-64 94-64 40.2 0 72.9 28.7 72.9 64s-32.7 64-72.9 64z"]
};
var faInfo = {
prefix: 'fas',
iconName: 'info',
icon: [192, 512, [], "f129", "M20 424.229h20V279.771H20c-11.046 0-20-8.954-20-20V212c0-11.046 8.954-20 20-20h112c11.046 0 20 8.954 20 20v212.229h20c11.046 0 20 8.954 20 20V492c0 11.046-8.954 20-20 20H20c-11.046 0-20-8.954-20-20v-47.771c0-11.046 8.954-20 20-20zM96 0C56.235 0 24 32.235 24 72s32.235 72 72 72 72-32.235 72-72S135.764 0 96 0z"]
};
var faInfoCircle = {
prefix: 'fas',
iconName: 'info-circle',
icon: [512, 512, [], "f05a", "M256 8C119.043 8 8 119.083 8 256c0 136.997 111.043 248 248 248s248-111.003 248-248C504 119.083 392.957 8 256 8zm0 110c23.196 0 42 18.804 42 42s-18.804 42-42 42-42-18.804-42-42 18.804-42 42-42zm56 254c0 6.627-5.373 12-12 12h-88c-6.627 0-12-5.373-12-12v-24c0-6.627 5.373-12 12-12h12v-64h-12c-6.627 0-12-5.373-12-12v-24c0-6.627 5.373-12 12-12h64c6.627 0 12 5.373 12 12v100h12c6.627 0 12 5.373 12 12v24z"]
};
var faItalic = {
prefix: 'fas',
iconName: 'italic',
icon: [320, 512, [], "f033", "M320 48v32a16 16 0 0 1-16 16h-62.76l-80 320H208a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16H16a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h62.76l80-320H112a16 16 0 0 1-16-16V48a16 16 0 0 1 16-16h192a16 16 0 0 1 16 16z"]
};
var faJedi = {
prefix: 'fas',
iconName: 'jedi',
icon: [576, 512, [], "f669", "M535.95308,352c-42.64069,94.17188-137.64086,160-247.9848,160q-6.39844,0-12.84377-.29688C171.15558,506.9375,81.26481,442.23438,40.01474,352H79.93668L21.3272,293.40625a264.82522,264.82522,0,0,1-5.10938-39.42187,273.6653,273.6653,0,0,1,.5-29.98438H63.93665L22.546,182.625A269.79782,269.79782,0,0,1,130.51489,20.54688a16.06393,16.06393,0,0,1,9.28127-3,16.36332,16.36332,0,0,1,13.5,7.25,16.02739,16.02739,0,0,1,1.625,15.09374,138.387,138.387,0,0,0-9.84376,51.26563c0,45.10937,21.04691,86.57813,57.71884,113.73437a16.29989,16.29989,0,0,1,1.20313,25.39063c-26.54692,23.98437-41.17194,56.5-41.17194,91.57813,0,60.03124,42.95319,110.28124,99.89079,121.92187l2.5-65.26563L238.062,397a8.33911,8.33911,0,0,1-10-.75,8.025,8.025,0,0,1-1.39063-9.9375l20.125-33.76562-42.06257-8.73438a7.9898,7.9898,0,0,1,0-15.65625l42.06257-8.71875-20.10941-33.73438a7.99122,7.99122,0,0,1,11.35939-10.71874L268.437,295.64062,279.95265,7.67188a7.97138,7.97138,0,0,1,8-7.67188h.04687a8.02064,8.02064,0,0,1,7.95314,7.70312L307.48394,295.625l30.39068-20.67188a8.08327,8.08327,0,0,1,10,.8125,7.99866,7.99866,0,0,1,1.39062,9.90626L329.12461,319.4375l42.07819,8.73438a7.99373,7.99373,0,0,1,0,15.65624l-42.07819,8.71876,20.1094,33.73437a7.97791,7.97791,0,0,1-1.32812,9.92187A8.25739,8.25739,0,0,1,337.87462,397L310.7027,378.53125l2.5,65.34375c48.48446-9.40625,87.57828-48.15625,97.31267-96.5A123.52652,123.52652,0,0,0,371.9528,230.29688a16.30634,16.30634,0,0,1,1.20313-25.42188c36.65631-27.17188,57.6876-68.60938,57.6876-113.73438a138.01689,138.01689,0,0,0-9.85939-51.3125,15.98132,15.98132,0,0,1,1.60937-15.09374,16.36914,16.36914,0,0,1,13.5-7.23438,16.02453,16.02453,0,0,1,9.25,2.98438A271.26947,271.26947,0,0,1,553.25,182.76562L511.99992,224h46.9532C559.3125,229.76562,560,235.45312,560,241.26562a270.092,270.092,0,0,1-5.125,51.85938L495.98427,352Z"]
};
var faJoint = {
prefix: 'fas',
iconName: 'joint',
icon: [640, 512, [], "f595", "M444.34 181.1c22.38 15.68 35.66 41.16 35.66 68.59V280c0 4.42 3.58 8 8 8h48c4.42 0 8-3.58 8-8v-30.31c0-43.24-21.01-83.41-56.34-108.06C463.85 125.02 448 99.34 448 70.31V8c0-4.42-3.58-8-8-8h-48c-4.42 0-8 3.58-8 8v66.4c0 43.69 24.56 81.63 60.34 106.7zM194.97 358.98C126.03 370.07 59.69 394.69 0 432c83.65 52.28 180.3 80 278.94 80h88.57L254.79 380.49c-14.74-17.2-37.45-25.11-59.82-21.51zM553.28 87.09c-5.67-3.8-9.28-9.96-9.28-16.78V8c0-4.42-3.58-8-8-8h-48c-4.42 0-8 3.58-8 8v62.31c0 22.02 10.17 43.41 28.64 55.39C550.79 153.04 576 199.54 576 249.69V280c0 4.42 3.58 8 8 8h48c4.42 0 8-3.58 8-8v-30.31c0-65.44-32.41-126.19-86.72-162.6zM360.89 352.05c-34.4.06-86.81.15-88.21.17l117.8 137.43A63.987 63.987 0 0 0 439.07 512h88.45L409.57 374.4a63.955 63.955 0 0 0-48.68-22.35zM616 352H432l117.99 137.65A63.987 63.987 0 0 0 598.58 512H616c13.25 0 24-10.75 24-24V376c0-13.26-10.75-24-24-24z"]
};
var faJournalWhills = {
prefix: 'fas',
iconName: 'journal-whills',
icon: [448, 512, [], "f66a", "M438.40625,377.59375c-3.20313,12.8125-3.20313,57.60937,0,73.60937Q447.9922,460.78907,448,470.40625v16c0,16-12.79688,25.59375-25.59375,25.59375H96c-54.40625,0-96-41.59375-96-96V96C0,41.59375,41.59375,0,96,0H422.40625C438.40625,0,448,9.59375,448,25.59375v332.8125Q448,372.79688,438.40625,377.59375ZM380.79688,384H96c-16,0-32,12.79688-32,32s12.79688,32,32,32H380.79688ZM128.01562,176.01562c0,.51563.14063.98438.14063,1.5l37.10937,32.46876A7.99954,7.99954,0,0,1,160,224h-.01562a9.17678,9.17678,0,0,1-5.25-1.98438L131.14062,201.375C142.6875,250.95312,186.90625,288,240,288s97.3125-37.04688,108.875-86.625l-23.59375,20.64062a8.02516,8.02516,0,0,1-5.26563,1.96876H320a9.14641,9.14641,0,0,1-6.01562-2.71876A9.26508,9.26508,0,0,1,312,216a9.097,9.097,0,0,1,2.73438-6.01562l37.10937-32.46876c.01563-.53124.15625-1,.15625-1.51562,0-11.04688-2.09375-21.51562-5.06251-31.59375l-21.26562,21.25a8.00467,8.00467,0,0,1-11.32812-11.3125l26.42187-26.40625a111.81517,111.81517,0,0,0-46.35937-49.26562,63.02336,63.02336,0,0,1-14.0625,82.64062A55.83846,55.83846,0,0,1,251.625,254.73438l-1.42188-34.28126,12.67188,8.625a3.967,3.967,0,0,0,2.25.6875,3.98059,3.98059,0,0,0,3.43749-6.03124l-8.53124-14.3125,17.90625-3.71876a4.00647,4.00647,0,0,0,0-7.84374l-17.90625-3.71876,8.53124-14.3125a3.98059,3.98059,0,0,0-3.43749-6.03124,4.726,4.726,0,0,0-2.25.67187L248.6875,184.125,244,71.82812a4.00386,4.00386,0,0,0-8,0l-4.625,110.8125-12-8.15624a4.003,4.003,0,0,0-5.68751,5.35937l8.53126,14.3125L204.3125,197.875a3.99686,3.99686,0,0,0,0,7.82812l17.90625,3.73438-8.53126,14.29688a4.72469,4.72469,0,0,0-.56249,2.04687,4.59547,4.59547,0,0,0,1.25,2.90625,4.01059,4.01059,0,0,0,2.75,1.09375,4.09016,4.09016,0,0,0,2.25-.6875l10.35937-7.04687L228.375,254.76562a55.86414,55.86414,0,0,1-28.71875-93.45312,63.01119,63.01119,0,0,1-14.04688-82.65625,111.93158,111.93158,0,0,0-46.375,49.26563l26.42187,26.42187a7.99917,7.99917,0,0,1-11.3125,11.3125l-21.26563-21.26563C130.09375,154.48438,128,164.95312,128.01562,176.01562Z"]
};
var faKaaba = {
prefix: 'fas',
iconName: 'kaaba',
icon: [576, 512, [], "f66b", "M554.12 83.51L318.36 4.93a95.962 95.962 0 0 0-60.71 0L21.88 83.51A32.006 32.006 0 0 0 0 113.87v49.01l265.02-79.51c15.03-4.5 30.92-4.5 45.98 0l265 79.51v-49.01c0-13.77-8.81-26-21.88-30.36zm-279.9 30.52L0 196.3v228.38c0 15 10.42 27.98 25.06 31.24l242.12 53.8a95.937 95.937 0 0 0 41.65 0l242.12-53.8c14.64-3.25 25.06-16.24 25.06-31.24V196.29l-274.2-82.26c-9.04-2.72-18.59-2.72-27.59 0zM128 230.11c0 3.61-2.41 6.77-5.89 7.72l-80 21.82C37.02 261.03 32 257.2 32 251.93v-16.58c0-3.61 2.41-6.77 5.89-7.72l80-21.82c5.09-1.39 10.11 2.44 10.11 7.72v16.58zm144-39.28c0 3.61-2.41 6.77-5.89 7.72l-96 26.18c-5.09 1.39-10.11-2.44-10.11-7.72v-16.58c0-3.61 2.41-6.77 5.89-7.72l96-26.18c5.09-1.39 10.11 2.44 10.11 7.72v16.58zm176 22.7c0-5.28 5.02-9.11 10.11-7.72l80 21.82c3.48.95 5.89 4.11 5.89 7.72v16.58c0 5.28-5.02 9.11-10.11 7.72l-80-21.82a7.997 7.997 0 0 1-5.89-7.72v-16.58zm-144-39.27c0-5.28 5.02-9.11 10.11-7.72l96 26.18c3.48.95 5.89 4.11 5.89 7.72v16.58c0 5.28-5.02 9.11-10.11 7.72l-96-26.18a7.997 7.997 0 0 1-5.89-7.72v-16.58z"]
};
var faKey = {
prefix: 'fas',
iconName: 'key',
icon: [512, 512, [], "f084", "M512 176.001C512 273.203 433.202 352 336 352c-11.22 0-22.19-1.062-32.827-3.069l-24.012 27.014A23.999 23.999 0 0 1 261.223 384H224v40c0 13.255-10.745 24-24 24h-40v40c0 13.255-10.745 24-24 24H24c-13.255 0-24-10.745-24-24v-78.059c0-6.365 2.529-12.47 7.029-16.971l161.802-161.802C163.108 213.814 160 195.271 160 176 160 78.798 238.797.001 335.999 0 433.488-.001 512 78.511 512 176.001zM336 128c0 26.51 21.49 48 48 48s48-21.49 48-48-21.49-48-48-48-48 21.49-48 48z"]
};
var faKeyboard = {
prefix: 'fas',
iconName: 'keyboard',
icon: [576, 512, [], "f11c", "M528 448H48c-26.51 0-48-21.49-48-48V112c0-26.51 21.49-48 48-48h480c26.51 0 48 21.49 48 48v288c0 26.51-21.49 48-48 48zM128 180v-40c0-6.627-5.373-12-12-12H76c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm-336 96v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm-336 96v-40c0-6.627-5.373-12-12-12H76c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm288 0v-40c0-6.627-5.373-12-12-12H172c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h232c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12z"]
};
var faKhanda = {
prefix: 'fas',
iconName: 'khanda',
icon: [512, 512, [], "f66d", "M415.81 66c-6.37-3.5-14.37-2.33-19.36 3.02a15.974 15.974 0 0 0-1.91 19.52c16.49 26.16 25.2 56.39 25.2 87.41-.19 53.25-26.77 102.69-71.27 132.41l-76.63 53.35v-20.1l44.05-36.09c3.92-4.2 5-10.09 2.81-15.28L310.85 273c33.84-19.26 56.94-55.25 56.94-96.99 0-40.79-22.02-76.13-54.59-95.71l5.22-11.44c2.34-5.53.93-11.83-3.57-16.04L255.86 0l-58.99 52.81c-4.5 4.21-5.9 10.51-3.57 16.04l5.22 11.44c-32.57 19.58-54.59 54.93-54.59 95.72 0 41.75 23.09 77.73 56.94 96.99l-7.85 17.24c-2.19 5.18-1.1 11.07 2.81 15.28l44.05 36.09v19.9l-76.59-53.33C119.02 278.62 92.44 229.19 92.26 176c0-31.08 8.71-61.31 25.2-87.47 3.87-6.16 2.4-13.77-2.59-19.08-5-5.34-13.68-6.2-20.02-2.7C16.32 109.6-22.3 205.3 13.36 295.99c7.07 17.99 17.89 34.38 30.46 49.06l55.97 65.36c4.87 5.69 13.04 7.24 19.65 3.72l79.35-42.23L228 392.23l-47.08 32.78c-1.67-.37-3.23-1.01-5.01-1.01-13.25 0-23.99 10.74-23.99 24 0 13.25 10.74 24 23.99 24 12.1 0 21.69-9.11 23.33-20.76l40.63-28.28v29.95c-9.39 5.57-15.99 15.38-15.99 27.1 0 17.67 14.32 32 31.98 32s31.98-14.33 31.98-32c0-11.71-6.61-21.52-15.99-27.1v-30.15l40.91 28.48C314.41 462.89 324 472 336.09 472c13.25 0 23.99-10.75 23.99-24 0-13.26-10.74-24-23.99-24-1.78 0-3.34.64-5.01 1.01L284 392.23l29.21-20.34 79.35 42.23c6.61 3.52 14.78 1.97 19.65-3.71l52.51-61.31c18.87-22.02 34-47.5 41.25-75.59 21.62-83.66-16.45-167.27-90.16-207.51zm-95.99 110c0 22.3-11.49 41.92-28.83 53.38l-5.65-12.41c-8.75-24.52-8.75-51.04 0-75.56l7.83-17.18c16.07 11.65 26.65 30.45 26.65 51.77zm-127.93 0c0-21.32 10.58-40.12 26.66-51.76l7.83 17.18c8.75 24.52 8.75 51.03 0 75.56l-5.65 12.41c-17.34-11.46-28.84-31.09-28.84-53.39z"]
};
var faKiss = {
prefix: 'fas',
iconName: 'kiss',
icon: [496, 512, [], "f596", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm-80 232c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm136 156c0 19.2-28.7 41.5-71.5 44-8.5.8-12.1-11.8-3.6-15.4l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-6-2.5-6.1-12.2 0-14.8l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-8.6-3.6-4.8-16.5 3.6-15.4 42.8 2.5 71.5 24.8 71.5 44 0 13-13.4 27.3-35.2 36C290.6 368.7 304 383 304 396zm24-156c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faKissBeam = {
prefix: 'fas',
iconName: 'kiss-beam',
icon: [496, 512, [], "f597", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm-39 219.9l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.6 4-14.9-4.5 3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.5 8.5-10.9 12-15.1 4.5zM304 396c0 19.2-28.7 41.5-71.5 44-8.5.8-12.1-11.8-3.6-15.4l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-6-2.5-6.1-12.2 0-14.8l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-8.6-3.6-4.8-16.5 3.6-15.4 42.8 2.5 71.5 24.8 71.5 44 0 13-13.4 27.3-35.2 36C290.6 368.7 304 383 304 396zm65-168.1l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.1 7.3-15.6 4-14.9-4.5 3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.5 8.5-10.9 12-15.1 4.5z"]
};
var faKissWinkHeart = {
prefix: 'fas',
iconName: 'kiss-wink-heart',
icon: [504, 512, [], "f598", "M501.1 402.5c-8-20.8-31.5-31.5-53.1-25.9l-8.4 2.2-2.3-8.4c-5.9-21.4-27-36.5-49-33-25.2 4-40.6 28.6-34 52.6l22.9 82.6c1.5 5.3 7 8.5 12.4 7.1l83-21.5c24.1-6.3 37.7-31.8 28.5-55.7zm-177.6-4c-5.6-20.3-2.3-42 9-59.7 29.7-46.3 98.7-45.5 127.8 4.3 6.4.1 12.6 1.4 18.6 2.9 10.9-27.9 17.1-58.2 17.1-90C496 119 385 8 248 8S0 119 0 256s111 248 248 248c35.4 0 68.9-7.5 99.4-20.9-.3-.7-23.9-84.6-23.9-84.6zM168 240c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm120 156c0 19.2-28.7 41.5-71.5 44-8.5.8-12.1-11.8-3.6-15.4l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-6-2.5-5.7-12.3 0-14.8l17-7.2c13-5.5 20.8-13.5 20.8-21.5s-7.8-16-20.8-21.5l-17-7.2c-8.8-3.7-4.6-16.6 3.6-15.4 42.8 2.5 71.5 24.8 71.5 44 0 13-13.4 27.3-35.2 36C274.6 368.7 288 383 288 396zm16-179c-8.3 7.4-21.6.4-19.8-10.8 4-25.2 34.2-42.1 59.9-42.1S400 181 404 206.2c1.7 11.1-11.3 18.3-19.8 10.8l-9.5-8.5c-14.8-13.2-46.2-13.2-61 0L304 217z"]
};
var faKiwiBird = {
prefix: 'fas',
iconName: 'kiwi-bird',
icon: [576, 512, [], "f535", "M575.81 217.98C572.64 157.41 518.28 112 457.63 112h-9.37c-52.82 0-104.25-16.25-147.74-46.24-41.99-28.96-96.04-41.62-153.21-28.7C129.3 41.12-.08 78.24 0 224c.04 70.95 38.68 132.8 95.99 166.01V464c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-54.26c15.36 3.96 31.4 6.26 48 6.26 5.44 0 10.68-.73 16-1.18V464c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-59.43c14.24-5.06 27.88-11.39 40.34-19.51C342.07 355.25 393.86 336 448.46 336c25.48 0 16.01-.31 23.05-.78l74.41 136.44c2.86 5.23 8.3 8.34 14.05 8.34 1.31 0 2.64-.16 3.95-.5 7.09-1.8 12.05-8.19 12.05-15.5 0 0 .14-240.24-.16-246.02zM463.97 248c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24zm80 153.25l-39.86-73.08c15.12-5.83 28.73-14.6 39.86-25.98v99.06z"]
};
var faLandmark = {
prefix: 'fas',
iconName: 'landmark',
icon: [512, 512, [], "f66f", "M501.62 92.11L267.24 2.04a31.958 31.958 0 0 0-22.47 0L10.38 92.11A16.001 16.001 0 0 0 0 107.09V144c0 8.84 7.16 16 16 16h480c8.84 0 16-7.16 16-16v-36.91c0-6.67-4.14-12.64-10.38-14.98zM64 192v160H48c-8.84 0-16 7.16-16 16v48h448v-48c0-8.84-7.16-16-16-16h-16V192h-64v160h-96V192h-64v160h-96V192H64zm432 256H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h480c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faLanguage = {
prefix: 'fas',
iconName: 'language',
icon: [640, 512, [], "f1ab", "M152.1 236.2c-3.5-12.1-7.8-33.2-7.8-33.2h-.5s-4.3 21.1-7.8 33.2l-11.1 37.5H163zM616 96H336v320h280c13.3 0 24-10.7 24-24V120c0-13.3-10.7-24-24-24zm-24 120c0 6.6-5.4 12-12 12h-11.4c-6.9 23.6-21.7 47.4-42.7 69.9 8.4 6.4 17.1 12.5 26.1 18 5.5 3.4 7.3 10.5 4.1 16.2l-7.9 13.9c-3.4 5.9-10.9 7.8-16.7 4.3-12.6-7.8-24.5-16.1-35.4-24.9-10.9 8.7-22.7 17.1-35.4 24.9-5.8 3.5-13.3 1.6-16.7-4.3l-7.9-13.9c-3.2-5.6-1.4-12.8 4.2-16.2 9.3-5.7 18-11.7 26.1-18-7.9-8.4-14.9-17-21-25.7-4-5.7-2.2-13.6 3.7-17.1l6.5-3.9 7.3-4.3c5.4-3.2 12.4-1.7 16 3.4 5 7 10.8 14 17.4 20.9 13.5-14.2 23.8-28.9 30-43.2H412c-6.6 0-12-5.4-12-12v-16c0-6.6 5.4-12 12-12h64v-16c0-6.6 5.4-12 12-12h16c6.6 0 12 5.4 12 12v16h64c6.6 0 12 5.4 12 12zM0 120v272c0 13.3 10.7 24 24 24h280V96H24c-13.3 0-24 10.7-24 24zm58.9 216.1L116.4 167c1.7-4.9 6.2-8.1 11.4-8.1h32.5c5.1 0 9.7 3.3 11.4 8.1l57.5 169.1c2.6 7.8-3.1 15.9-11.4 15.9h-22.9a12 12 0 0 1-11.5-8.6l-9.4-31.9h-60.2l-9.1 31.8c-1.5 5.1-6.2 8.7-11.5 8.7H70.3c-8.2 0-14-8.1-11.4-15.9z"]
};
var faLaptop = {
prefix: 'fas',
iconName: 'laptop',
icon: [640, 512, [], "f109", "M624 416H381.54c-.74 19.81-14.71 32-32.74 32H288c-18.69 0-33.02-17.47-32.77-32H16c-8.8 0-16 7.2-16 16v16c0 35.2 28.8 64 64 64h512c35.2 0 64-28.8 64-64v-16c0-8.8-7.2-16-16-16zM576 48c0-26.4-21.6-48-48-48H112C85.6 0 64 21.6 64 48v336h512V48zm-64 272H128V64h384v256z"]
};
var faLaptopCode = {
prefix: 'fas',
iconName: 'laptop-code',
icon: [640, 512, [], "f5fc", "M255.03 261.65c6.25 6.25 16.38 6.25 22.63 0l11.31-11.31c6.25-6.25 6.25-16.38 0-22.63L253.25 192l35.71-35.72c6.25-6.25 6.25-16.38 0-22.63l-11.31-11.31c-6.25-6.25-16.38-6.25-22.63 0l-58.34 58.34c-6.25 6.25-6.25 16.38 0 22.63l58.35 58.34zm96.01-11.3l11.31 11.31c6.25 6.25 16.38 6.25 22.63 0l58.34-58.34c6.25-6.25 6.25-16.38 0-22.63l-58.34-58.34c-6.25-6.25-16.38-6.25-22.63 0l-11.31 11.31c-6.25 6.25-6.25 16.38 0 22.63L386.75 192l-35.71 35.72c-6.25 6.25-6.25 16.38 0 22.63zM624 416H381.54c-.74 19.81-14.71 32-32.74 32H288c-18.69 0-33.02-17.47-32.77-32H16c-8.8 0-16 7.2-16 16v16c0 35.2 28.8 64 64 64h512c35.2 0 64-28.8 64-64v-16c0-8.8-7.2-16-16-16zM576 48c0-26.4-21.6-48-48-48H112C85.6 0 64 21.6 64 48v336h512V48zm-64 272H128V64h384v256z"]
};
var faLaptopHouse = {
prefix: 'fas',
iconName: 'laptop-house',
icon: [640, 512, [], "e066", "M272,288H208a16,16,0,0,1-16-16V208a16,16,0,0,1,16-16h64a16,16,0,0,1,16,16v37.12C299.11,232.24,315,224,332.8,224H469.74l6.65-7.53A16.51,16.51,0,0,0,480,207a16.31,16.31,0,0,0-4.75-10.61L416,144V48a16,16,0,0,0-16-16H368a16,16,0,0,0-16,16V87.3L263.5,8.92C258,4,247.45,0,240.05,0s-17.93,4-23.47,8.92L4.78,196.42A16.15,16.15,0,0,0,0,207a16.4,16.4,0,0,0,3.55,9.39L22.34,237.7A16.22,16.22,0,0,0,33,242.48,16.51,16.51,0,0,0,42.34,239L64,219.88V384a32,32,0,0,0,32,32H272ZM629.33,448H592V288c0-17.67-12.89-32-28.8-32H332.8c-15.91,0-28.8,14.33-28.8,32V448H266.67A10.67,10.67,0,0,0,256,458.67v10.66A42.82,42.82,0,0,0,298.6,512H597.4A42.82,42.82,0,0,0,640,469.33V458.67A10.67,10.67,0,0,0,629.33,448ZM544,448H352V304H544Z"]
};
var faLaptopMedical = {
prefix: 'fas',
iconName: 'laptop-medical',
icon: [640, 512, [], "f812", "M232 224h56v56a8 8 0 0 0 8 8h48a8 8 0 0 0 8-8v-56h56a8 8 0 0 0 8-8v-48a8 8 0 0 0-8-8h-56v-56a8 8 0 0 0-8-8h-48a8 8 0 0 0-8 8v56h-56a8 8 0 0 0-8 8v48a8 8 0 0 0 8 8zM576 48a48.14 48.14 0 0 0-48-48H112a48.14 48.14 0 0 0-48 48v336h512zm-64 272H128V64h384zm112 96H381.54c-.74 19.81-14.71 32-32.74 32H288c-18.69 0-33-17.47-32.77-32H16a16 16 0 0 0-16 16v16a64.19 64.19 0 0 0 64 64h512a64.19 64.19 0 0 0 64-64v-16a16 16 0 0 0-16-16z"]
};
var faLaugh = {
prefix: 'fas',
iconName: 'laugh',
icon: [496, 512, [], "f599", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 152c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm-160 0c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm88 272h-16c-73.4 0-134-55-142.9-126-1.2-9.5 6.3-18 15.9-18h270c9.6 0 17.1 8.4 15.9 18-8.9 71-69.5 126-142.9 126z"]
};
var faLaughBeam = {
prefix: 'fas',
iconName: 'laugh-beam',
icon: [496, 512, [], "f59a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm24 199.4c3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.7 8.6-10.8 11.9-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.2 7.4-15.8 4.1-15.1-4.5zm-160 0c3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.7 8.6-10.8 11.9-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.3 7.4-15.8 4-15.1-4.5zM398.9 306C390 377 329.4 432 256 432h-16c-73.4 0-134-55-142.9-126-1.2-9.5 6.3-18 15.9-18h270c9.6 0 17.1 8.4 15.9 18z"]
};
var faLaughSquint = {
prefix: 'fas',
iconName: 'laugh-squint',
icon: [496, 512, [], "f59b", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm33.8 161.7l80-48c11.6-6.9 24 7.7 15.4 18L343.6 180l33.6 40.3c8.7 10.4-3.9 24.8-15.4 18l-80-48c-7.7-4.7-7.7-15.9 0-20.6zm-163-30c-8.6-10.3 3.8-24.9 15.4-18l80 48c7.8 4.7 7.8 15.9 0 20.6l-80 48c-11.5 6.8-24-7.6-15.4-18l33.6-40.3-33.6-40.3zM398.9 306C390 377 329.4 432 256 432h-16c-73.4 0-134-55-142.9-126-1.2-9.5 6.3-18 15.9-18h270c9.6 0 17.1 8.4 15.9 18z"]
};
var faLaughWink = {
prefix: 'fas',
iconName: 'laugh-wink',
icon: [496, 512, [], "f59c", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm20.1 198.1c4-25.2 34.2-42.1 59.9-42.1s55.9 16.9 59.9 42.1c1.7 11.1-11.4 18.3-19.8 10.8l-9.5-8.5c-14.8-13.2-46.2-13.2-61 0L288 217c-8.4 7.4-21.6.3-19.9-10.9zM168 160c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm230.9 146C390 377 329.4 432 256 432h-16c-73.4 0-134-55-142.9-126-1.2-9.5 6.3-18 15.9-18h270c9.6 0 17.1 8.4 15.9 18z"]
};
var faLayerGroup = {
prefix: 'fas',
iconName: 'layer-group',
icon: [512, 512, [], "f5fd", "M12.41 148.02l232.94 105.67c6.8 3.09 14.49 3.09 21.29 0l232.94-105.67c16.55-7.51 16.55-32.52 0-40.03L266.65 2.31a25.607 25.607 0 0 0-21.29 0L12.41 107.98c-16.55 7.51-16.55 32.53 0 40.04zm487.18 88.28l-58.09-26.33-161.64 73.27c-7.56 3.43-15.59 5.17-23.86 5.17s-16.29-1.74-23.86-5.17L70.51 209.97l-58.1 26.33c-16.55 7.5-16.55 32.5 0 40l232.94 105.59c6.8 3.08 14.49 3.08 21.29 0L499.59 276.3c16.55-7.5 16.55-32.5 0-40zm0 127.8l-57.87-26.23-161.86 73.37c-7.56 3.43-15.59 5.17-23.86 5.17s-16.29-1.74-23.86-5.17L70.29 337.87 12.41 364.1c-16.55 7.5-16.55 32.5 0 40l232.94 105.59c6.8 3.08 14.49 3.08 21.29 0L499.59 404.1c16.55-7.5 16.55-32.5 0-40z"]
};
var faLeaf = {
prefix: 'fas',
iconName: 'leaf',
icon: [576, 512, [], "f06c", "M546.2 9.7c-5.6-12.5-21.6-13-28.3-1.2C486.9 62.4 431.4 96 368 96h-80C182 96 96 182 96 288c0 7 .8 13.7 1.5 20.5C161.3 262.8 253.4 224 384 224c8.8 0 16 7.2 16 16s-7.2 16-16 16C132.6 256 26 410.1 2.4 468c-6.6 16.3 1.2 34.9 17.5 41.6 16.4 6.8 35-1.1 41.8-17.3 1.5-3.6 20.9-47.9 71.9-90.6 32.4 43.9 94 85.8 174.9 77.2C465.5 467.5 576 326.7 576 154.3c0-50.2-10.8-102.2-29.8-144.6z"]
};
var faLemon = {
prefix: 'fas',
iconName: 'lemon',
icon: [512, 512, [], "f094", "M489.038 22.963C465.944-.13 434.648-5.93 413.947 6.129c-58.906 34.312-181.25-53.077-321.073 86.746S40.441 355.041 6.129 413.945c-12.059 20.702-6.26 51.999 16.833 75.093 23.095 23.095 54.392 28.891 75.095 16.832 58.901-34.31 181.246 53.079 321.068-86.743S471.56 156.96 505.871 98.056c12.059-20.702 6.261-51.999-16.833-75.093zM243.881 95.522c-58.189 14.547-133.808 90.155-148.358 148.358-1.817 7.27-8.342 12.124-15.511 12.124-1.284 0-2.59-.156-3.893-.481-8.572-2.144-13.784-10.83-11.642-19.403C81.901 166.427 166.316 81.93 236.119 64.478c8.575-2.143 17.261 3.069 19.403 11.642s-3.069 17.259-11.641 19.402z"]
};
var faLessThan = {
prefix: 'fas',
iconName: 'less-than',
icon: [384, 512, [], "f536", "M365.46 357.74L147.04 255.89l218.47-101.88c16.02-7.47 22.95-26.51 15.48-42.53l-13.52-29C360 66.46 340.96 59.53 324.94 67L18.48 209.91a32.014 32.014 0 0 0-18.48 29v34.24c0 12.44 7.21 23.75 18.48 29l306.31 142.83c16.06 7.49 35.15.54 42.64-15.52l13.56-29.08c7.49-16.06.54-35.15-15.53-42.64z"]
};
var faLessThanEqual = {
prefix: 'fas',
iconName: 'less-than-equal',
icon: [448, 512, [], "f537", "M54.98 214.2l301.41 119.87c18.39 6.03 38.71-2.54 45.38-19.15l12.09-30.08c6.68-16.61-2.82-34.97-21.21-41l-175.44-68.05 175.56-68.09c18.29-6 27.74-24.27 21.1-40.79l-12.03-29.92c-6.64-16.53-26.86-25.06-45.15-19.06L54.98 137.89C41.21 142.41 32 154.5 32 168.07v15.96c0 13.56 9.21 25.65 22.98 30.17zM424 400H24c-13.25 0-24 10.74-24 24v48c0 13.25 10.75 24 24 24h400c13.25 0 24-10.75 24-24v-48c0-13.26-10.75-24-24-24z"]
};
var faLevelDownAlt = {
prefix: 'fas',
iconName: 'level-down-alt',
icon: [320, 512, [], "f3be", "M313.553 392.331L209.587 504.334c-9.485 10.214-25.676 10.229-35.174 0L70.438 392.331C56.232 377.031 67.062 352 88.025 352H152V80H68.024a11.996 11.996 0 0 1-8.485-3.515l-56-56C-4.021 12.926 1.333 0 12.024 0H208c13.255 0 24 10.745 24 24v328h63.966c20.878 0 31.851 24.969 17.587 40.331z"]
};
var faLevelUpAlt = {
prefix: 'fas',
iconName: 'level-up-alt',
icon: [320, 512, [], "f3bf", "M313.553 119.669L209.587 7.666c-9.485-10.214-25.676-10.229-35.174 0L70.438 119.669C56.232 134.969 67.062 160 88.025 160H152v272H68.024a11.996 11.996 0 0 0-8.485 3.515l-56 56C-4.021 499.074 1.333 512 12.024 512H208c13.255 0 24-10.745 24-24V160h63.966c20.878 0 31.851-24.969 17.587-40.331z"]
};
var faLifeRing = {
prefix: 'fas',
iconName: 'life-ring',
icon: [512, 512, [], "f1cd", "M256 8C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm173.696 119.559l-63.399 63.399c-10.987-18.559-26.67-34.252-45.255-45.255l63.399-63.399a218.396 218.396 0 0 1 45.255 45.255zM256 352c-53.019 0-96-42.981-96-96s42.981-96 96-96 96 42.981 96 96-42.981 96-96 96zM127.559 82.304l63.399 63.399c-18.559 10.987-34.252 26.67-45.255 45.255l-63.399-63.399a218.372 218.372 0 0 1 45.255-45.255zM82.304 384.441l63.399-63.399c10.987 18.559 26.67 34.252 45.255 45.255l-63.399 63.399a218.396 218.396 0 0 1-45.255-45.255zm302.137 45.255l-63.399-63.399c18.559-10.987 34.252-26.67 45.255-45.255l63.399 63.399a218.403 218.403 0 0 1-45.255 45.255z"]
};
var faLightbulb = {
prefix: 'fas',
iconName: 'lightbulb',
icon: [352, 512, [], "f0eb", "M96.06 454.35c.01 6.29 1.87 12.45 5.36 17.69l17.09 25.69a31.99 31.99 0 0 0 26.64 14.28h61.71a31.99 31.99 0 0 0 26.64-14.28l17.09-25.69a31.989 31.989 0 0 0 5.36-17.69l.04-38.35H96.01l.05 38.35zM0 176c0 44.37 16.45 84.85 43.56 115.78 16.52 18.85 42.36 58.23 52.21 91.45.04.26.07.52.11.78h160.24c.04-.26.07-.51.11-.78 9.85-33.22 35.69-72.6 52.21-91.45C335.55 260.85 352 220.37 352 176 352 78.61 272.91-.3 175.45 0 73.44.31 0 82.97 0 176zm176-80c-44.11 0-80 35.89-80 80 0 8.84-7.16 16-16 16s-16-7.16-16-16c0-61.76 50.24-112 112-112 8.84 0 16 7.16 16 16s-7.16 16-16 16z"]
};
var faLink = {
prefix: 'fas',
iconName: 'link',
icon: [512, 512, [], "f0c1", "M326.612 185.391c59.747 59.809 58.927 155.698.36 214.59-.11.12-.24.25-.36.37l-67.2 67.2c-59.27 59.27-155.699 59.262-214.96 0-59.27-59.26-59.27-155.7 0-214.96l37.106-37.106c9.84-9.84 26.786-3.3 27.294 10.606.648 17.722 3.826 35.527 9.69 52.721 1.986 5.822.567 12.262-3.783 16.612l-13.087 13.087c-28.026 28.026-28.905 73.66-1.155 101.96 28.024 28.579 74.086 28.749 102.325.51l67.2-67.19c28.191-28.191 28.073-73.757 0-101.83-3.701-3.694-7.429-6.564-10.341-8.569a16.037 16.037 0 0 1-6.947-12.606c-.396-10.567 3.348-21.456 11.698-29.806l21.054-21.055c5.521-5.521 14.182-6.199 20.584-1.731a152.482 152.482 0 0 1 20.522 17.197zM467.547 44.449c-59.261-59.262-155.69-59.27-214.96 0l-67.2 67.2c-.12.12-.25.25-.36.37-58.566 58.892-59.387 154.781.36 214.59a152.454 152.454 0 0 0 20.521 17.196c6.402 4.468 15.064 3.789 20.584-1.731l21.054-21.055c8.35-8.35 12.094-19.239 11.698-29.806a16.037 16.037 0 0 0-6.947-12.606c-2.912-2.005-6.64-4.875-10.341-8.569-28.073-28.073-28.191-73.639 0-101.83l67.2-67.19c28.239-28.239 74.3-28.069 102.325.51 27.75 28.3 26.872 73.934-1.155 101.96l-13.087 13.087c-4.35 4.35-5.769 10.79-3.783 16.612 5.864 17.194 9.042 34.999 9.69 52.721.509 13.906 17.454 20.446 27.294 10.606l37.106-37.106c59.271-59.259 59.271-155.699.001-214.959z"]
};
var faLiraSign = {
prefix: 'fas',
iconName: 'lira-sign',
icon: [384, 512, [], "f195", "M371.994 256h-48.019C317.64 256 312 260.912 312 267.246 312 368 230.179 416 144 416V256.781l134.603-29.912A12 12 0 0 0 288 215.155v-40.976c0-7.677-7.109-13.38-14.603-11.714L144 191.219V160.78l134.603-29.912A12 12 0 0 0 288 119.154V78.179c0-7.677-7.109-13.38-14.603-11.714L144 95.219V44c0-6.627-5.373-12-12-12H76c-6.627 0-12 5.373-12 12v68.997L9.397 125.131A12 12 0 0 0 0 136.845v40.976c0 7.677 7.109 13.38 14.603 11.714L64 178.558v30.439L9.397 221.131A12 12 0 0 0 0 232.845v40.976c0 7.677 7.109 13.38 14.603 11.714L64 274.558V468c0 6.627 5.373 12 12 12h79.583c134.091 0 223.255-77.834 228.408-211.592.261-6.782-5.211-12.408-11.997-12.408z"]
};
var faList = {
prefix: 'fas',
iconName: 'list',
icon: [512, 512, [], "f03a", "M80 368H16a16 16 0 0 0-16 16v64a16 16 0 0 0 16 16h64a16 16 0 0 0 16-16v-64a16 16 0 0 0-16-16zm0-320H16A16 16 0 0 0 0 64v64a16 16 0 0 0 16 16h64a16 16 0 0 0 16-16V64a16 16 0 0 0-16-16zm0 160H16a16 16 0 0 0-16 16v64a16 16 0 0 0 16 16h64a16 16 0 0 0 16-16v-64a16 16 0 0 0-16-16zm416 176H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-320H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16zm0 160H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faListAlt = {
prefix: 'fas',
iconName: 'list-alt',
icon: [512, 512, [], "f022", "M464 480H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h416c26.51 0 48 21.49 48 48v352c0 26.51-21.49 48-48 48zM128 120c-22.091 0-40 17.909-40 40s17.909 40 40 40 40-17.909 40-40-17.909-40-40-40zm0 96c-22.091 0-40 17.909-40 40s17.909 40 40 40 40-17.909 40-40-17.909-40-40-40zm0 96c-22.091 0-40 17.909-40 40s17.909 40 40 40 40-17.909 40-40-17.909-40-40-40zm288-136v-32c0-6.627-5.373-12-12-12H204c-6.627 0-12 5.373-12 12v32c0 6.627 5.373 12 12 12h200c6.627 0 12-5.373 12-12zm0 96v-32c0-6.627-5.373-12-12-12H204c-6.627 0-12 5.373-12 12v32c0 6.627 5.373 12 12 12h200c6.627 0 12-5.373 12-12zm0 96v-32c0-6.627-5.373-12-12-12H204c-6.627 0-12 5.373-12 12v32c0 6.627 5.373 12 12 12h200c6.627 0 12-5.373 12-12z"]
};
var faListOl = {
prefix: 'fas',
iconName: 'list-ol',
icon: [512, 512, [], "f0cb", "M61.77 401l17.5-20.15a19.92 19.92 0 0 0 5.07-14.19v-3.31C84.34 356 80.5 352 73 352H16a8 8 0 0 0-8 8v16a8 8 0 0 0 8 8h22.83a157.41 157.41 0 0 0-11 12.31l-5.61 7c-4 5.07-5.25 10.13-2.8 14.88l1.05 1.93c3 5.76 6.29 7.88 12.25 7.88h4.73c10.33 0 15.94 2.44 15.94 9.09 0 4.72-4.2 8.22-14.36 8.22a41.54 41.54 0 0 1-15.47-3.12c-6.49-3.88-11.74-3.5-15.6 3.12l-5.59 9.31c-3.72 6.13-3.19 11.72 2.63 15.94 7.71 4.69 20.38 9.44 37 9.44 34.16 0 48.5-22.75 48.5-44.12-.03-14.38-9.12-29.76-28.73-34.88zM496 224H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-160H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16zm0 320H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM16 160h64a8 8 0 0 0 8-8v-16a8 8 0 0 0-8-8H64V40a8 8 0 0 0-8-8H32a8 8 0 0 0-7.14 4.42l-8 16A8 8 0 0 0 24 64h8v64H16a8 8 0 0 0-8 8v16a8 8 0 0 0 8 8zm-3.91 160H80a8 8 0 0 0 8-8v-16a8 8 0 0 0-8-8H41.32c3.29-10.29 48.34-18.68 48.34-56.44 0-29.06-25-39.56-44.47-39.56-21.36 0-33.8 10-40.46 18.75-4.37 5.59-3 10.84 2.8 15.37l8.58 6.88c5.61 4.56 11 2.47 16.12-2.44a13.44 13.44 0 0 1 9.46-3.84c3.33 0 9.28 1.56 9.28 8.75C51 248.19 0 257.31 0 304.59v4C0 316 5.08 320 12.09 320z"]
};
var faListUl = {
prefix: 'fas',
iconName: 'list-ul',
icon: [512, 512, [], "f0ca", "M48 48a48 48 0 1 0 48 48 48 48 0 0 0-48-48zm0 160a48 48 0 1 0 48 48 48 48 0 0 0-48-48zm0 160a48 48 0 1 0 48 48 48 48 0 0 0-48-48zm448 16H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-320H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16zm0 160H176a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h320a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faLocationArrow = {
prefix: 'fas',
iconName: 'location-arrow',
icon: [512, 512, [], "f124", "M444.52 3.52L28.74 195.42c-47.97 22.39-31.98 92.75 19.19 92.75h175.91v175.91c0 51.17 70.36 67.17 92.75 19.19l191.9-415.78c15.99-38.39-25.59-79.97-63.97-63.97z"]
};
var faLock = {
prefix: 'fas',
iconName: 'lock',
icon: [448, 512, [], "f023", "M400 224h-24v-72C376 68.2 307.8 0 224 0S72 68.2 72 152v72H48c-26.5 0-48 21.5-48 48v192c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V272c0-26.5-21.5-48-48-48zm-104 0H152v-72c0-39.7 32.3-72 72-72s72 32.3 72 72v72z"]
};
var faLockOpen = {
prefix: 'fas',
iconName: 'lock-open',
icon: [576, 512, [], "f3c1", "M423.5 0C339.5.3 272 69.5 272 153.5V224H48c-26.5 0-48 21.5-48 48v192c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V272c0-26.5-21.5-48-48-48h-48v-71.1c0-39.6 31.7-72.5 71.3-72.9 40-.4 72.7 32.1 72.7 72v80c0 13.3 10.7 24 24 24h32c13.3 0 24-10.7 24-24v-80C576 68 507.5-.3 423.5 0z"]
};
var faLongArrowAltDown = {
prefix: 'fas',
iconName: 'long-arrow-alt-down',
icon: [256, 512, [], "f309", "M168 345.941V44c0-6.627-5.373-12-12-12h-56c-6.627 0-12 5.373-12 12v301.941H41.941c-21.382 0-32.09 25.851-16.971 40.971l86.059 86.059c9.373 9.373 24.569 9.373 33.941 0l86.059-86.059c15.119-15.119 4.411-40.971-16.971-40.971H168z"]
};
var faLongArrowAltLeft = {
prefix: 'fas',
iconName: 'long-arrow-alt-left',
icon: [448, 512, [], "f30a", "M134.059 296H436c6.627 0 12-5.373 12-12v-56c0-6.627-5.373-12-12-12H134.059v-46.059c0-21.382-25.851-32.09-40.971-16.971L7.029 239.029c-9.373 9.373-9.373 24.569 0 33.941l86.059 86.059c15.119 15.119 40.971 4.411 40.971-16.971V296z"]
};
var faLongArrowAltRight = {
prefix: 'fas',
iconName: 'long-arrow-alt-right',
icon: [448, 512, [], "f30b", "M313.941 216H12c-6.627 0-12 5.373-12 12v56c0 6.627 5.373 12 12 12h301.941v46.059c0 21.382 25.851 32.09 40.971 16.971l86.059-86.059c9.373-9.373 9.373-24.569 0-33.941l-86.059-86.059c-15.119-15.119-40.971-4.411-40.971 16.971V216z"]
};
var faLongArrowAltUp = {
prefix: 'fas',
iconName: 'long-arrow-alt-up',
icon: [256, 512, [], "f30c", "M88 166.059V468c0 6.627 5.373 12 12 12h56c6.627 0 12-5.373 12-12V166.059h46.059c21.382 0 32.09-25.851 16.971-40.971l-86.059-86.059c-9.373-9.373-24.569-9.373-33.941 0l-86.059 86.059c-15.119 15.119-4.411 40.971 16.971 40.971H88z"]
};
var faLowVision = {
prefix: 'fas',
iconName: 'low-vision',
icon: [576, 512, [], "f2a8", "M569.344 231.631C512.96 135.949 407.81 72 288 72c-28.468 0-56.102 3.619-82.451 10.409L152.778 10.24c-7.601-10.858-22.564-13.5-33.423-5.9l-13.114 9.178c-10.86 7.601-13.502 22.566-5.9 33.426l43.131 58.395C89.449 131.73 40.228 174.683 6.682 231.581c-.01.017-.023.033-.034.05-8.765 14.875-8.964 33.528 0 48.739 38.5 65.332 99.742 115.862 172.859 141.349L55.316 244.302A272.194 272.194 0 0 1 83.61 208.39l119.4 170.58h.01l40.63 58.04a330.055 330.055 0 0 0 78.94 1.17l-189.98-271.4a277.628 277.628 0 0 1 38.777-21.563l251.836 356.544c7.601 10.858 22.564 13.499 33.423 5.9l13.114-9.178c10.86-7.601 13.502-22.567 5.9-33.426l-43.12-58.377-.007-.009c57.161-27.978 104.835-72.04 136.81-126.301a47.938 47.938 0 0 0 .001-48.739zM390.026 345.94l-19.066-27.23c24.682-32.567 27.711-76.353 8.8-111.68v.03c0 23.65-19.17 42.82-42.82 42.82-23.828 0-42.82-19.349-42.82-42.82 0-23.65 19.17-42.82 42.82-42.82h.03c-24.75-13.249-53.522-15.643-79.51-7.68l-19.068-27.237C253.758 123.306 270.488 120 288 120c75.162 0 136 60.826 136 136 0 34.504-12.833 65.975-33.974 89.94z"]
};
var faLuggageCart = {
prefix: 'fas',
iconName: 'luggage-cart',
icon: [640, 512, [], "f59d", "M224 320h32V96h-32c-17.67 0-32 14.33-32 32v160c0 17.67 14.33 32 32 32zm352-32V128c0-17.67-14.33-32-32-32h-32v224h32c17.67 0 32-14.33 32-32zm48 96H128V16c0-8.84-7.16-16-16-16H16C7.16 0 0 7.16 0 16v32c0 8.84 7.16 16 16 16h48v368c0 8.84 7.16 16 16 16h82.94c-1.79 5.03-2.94 10.36-2.94 16 0 26.51 21.49 48 48 48s48-21.49 48-48c0-5.64-1.15-10.97-2.94-16h197.88c-1.79 5.03-2.94 10.36-2.94 16 0 26.51 21.49 48 48 48s48-21.49 48-48c0-5.64-1.15-10.97-2.94-16H624c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM480 96V48c0-26.51-21.49-48-48-48h-96c-26.51 0-48 21.49-48 48v272h192V96zm-48 0h-96V48h96v48z"]
};
var faLungs = {
prefix: 'fas',
iconName: 'lungs',
icon: [640, 512, [], "f604", "M636.11 390.15C614.44 308.85 580.07 231 534.1 159.13 511.98 124.56 498.03 96 454.05 96 415.36 96 384 125.42 384 161.71v60.11l-32.88-21.92a15.996 15.996 0 0 1-7.12-13.31V16c0-8.84-7.16-16-16-16h-16c-8.84 0-16 7.16-16 16v170.59c0 5.35-2.67 10.34-7.12 13.31L256 221.82v-60.11C256 125.42 224.64 96 185.95 96c-43.98 0-57.93 28.56-80.05 63.13C59.93 231 25.56 308.85 3.89 390.15 1.3 399.84 0 409.79 0 419.78c0 61.23 62.48 105.44 125.24 88.62l59.5-15.95c42.18-11.3 71.26-47.47 71.26-88.62v-87.49l-85.84 57.23a7.992 7.992 0 0 1-11.09-2.22l-8.88-13.31a7.992 7.992 0 0 1 2.22-11.09L320 235.23l167.59 111.72a7.994 7.994 0 0 1 2.22 11.09l-8.88 13.31a7.994 7.994 0 0 1-11.09 2.22L384 316.34v87.49c0 41.15 29.08 77.31 71.26 88.62l59.5 15.95C577.52 525.22 640 481.01 640 419.78c0-9.99-1.3-19.94-3.89-29.63z"]
};
var faLungsVirus = {
prefix: 'fas',
iconName: 'lungs-virus',
icon: [640, 512, [], "e067", "M344,150.68V16A16,16,0,0,0,328,0H312a16,16,0,0,0-16,16V150.68a46.45,46.45,0,0,1,48,0ZM195.54,444.46a48.06,48.06,0,0,1,0-67.88l8.58-8.58H192a48,48,0,0,1,0-96h12.12l-8.58-8.57a48,48,0,0,1,60.46-74V161.75C256,125.38,224.62,96,186,96c-44,0-58,28.5-80.12,63.13a819.52,819.52,0,0,0-102,231A113.16,113.16,0,0,0,0,419.75C0,481,62.5,525.26,125.25,508.38l59.5-15.87a98.51,98.51,0,0,0,52.5-34.75,46.49,46.49,0,0,1-41.71-13.3Zm226.29-22.63a16,16,0,0,0,0-22.62l-8.58-8.58C393.09,370.47,407.37,336,435.88,336H448a16,16,0,0,0,0-32H435.88c-28.51,0-42.79-34.47-22.63-54.62l8.58-8.58a16,16,0,0,0-22.63-22.63l-8.57,8.58C370.47,246.91,336,232.63,336,204.12V192a16,16,0,0,0-32,0v12.12c0,28.51-34.47,42.79-54.63,22.63l-8.57-8.58a16,16,0,0,0-22.63,22.63l8.58,8.58c20.16,20.15,5.88,54.62-22.63,54.62H192a16,16,0,0,0,0,32h12.12c28.51,0,42.79,34.47,22.63,54.63l-8.58,8.58a16,16,0,1,0,22.63,22.62l8.57-8.57C269.53,393.1,304,407.38,304,435.88V448a16,16,0,0,0,32,0V435.88c0-28.5,34.47-42.78,54.63-22.62l8.57,8.57a16,16,0,0,0,22.63,0ZM288,304a16,16,0,1,1,16-16A16,16,0,0,1,288,304Zm64,64a16,16,0,1,1,16-16A16,16,0,0,1,352,368Zm284.12,22.13a819.52,819.52,0,0,0-102-231C512,124.5,498,96,454,96c-38.62,0-70,29.38-70,65.75v27.72a48,48,0,0,1,60.46,74L435.88,272H448a48,48,0,0,1,0,96H435.88l8.58,8.58a47.7,47.7,0,0,1-41.71,81.18,98.51,98.51,0,0,0,52.5,34.75l59.5,15.87C577.5,525.26,640,481,640,419.75A113.16,113.16,0,0,0,636.12,390.13Z"]
};
var faMagic = {
prefix: 'fas',
iconName: 'magic',
icon: [512, 512, [], "f0d0", "M224 96l16-32 32-16-32-16-16-32-16 32-32 16 32 16 16 32zM80 160l26.66-53.33L160 80l-53.34-26.67L80 0 53.34 53.33 0 80l53.34 26.67L80 160zm352 128l-26.66 53.33L352 368l53.34 26.67L432 448l26.66-53.33L512 368l-53.34-26.67L432 288zm70.62-193.77L417.77 9.38C411.53 3.12 403.34 0 395.15 0c-8.19 0-16.38 3.12-22.63 9.38L9.38 372.52c-12.5 12.5-12.5 32.76 0 45.25l84.85 84.85c6.25 6.25 14.44 9.37 22.62 9.37 8.19 0 16.38-3.12 22.63-9.37l363.14-363.15c12.5-12.48 12.5-32.75 0-45.24zM359.45 203.46l-50.91-50.91 86.6-86.6 50.91 50.91-86.6 86.6z"]
};
var faMagnet = {
prefix: 'fas',
iconName: 'magnet',
icon: [512, 512, [], "f076", "M164.07 148.1H12a12 12 0 0 1-12-12v-80a36 36 0 0 1 36-36h104a36 36 0 0 1 36 36v80a11.89 11.89 0 0 1-11.93 12zm347.93-12V56a36 36 0 0 0-36-36H372a36 36 0 0 0-36 36v80a12 12 0 0 0 12 12h152a11.89 11.89 0 0 0 12-11.9zm-164 44a12 12 0 0 0-12 12v52c0 128.1-160 127.9-160 0v-52a12 12 0 0 0-12-12H12.1a12 12 0 0 0-12 12.1c.1 21.4.6 40.3 0 53.3 0 150.6 136.17 246.6 256.75 246.6s255-96 255-246.7c-.6-12.8-.2-33 0-53.2a12 12 0 0 0-12-12.1z"]
};
var faMailBulk = {
prefix: 'fas',
iconName: 'mail-bulk',
icon: [576, 512, [], "f674", "M160 448c-25.6 0-51.2-22.4-64-32-64-44.8-83.2-60.8-96-70.4V480c0 17.67 14.33 32 32 32h256c17.67 0 32-14.33 32-32V345.6c-12.8 9.6-32 25.6-96 70.4-12.8 9.6-38.4 32-64 32zm128-192H32c-17.67 0-32 14.33-32 32v16c25.6 19.2 22.4 19.2 115.2 86.4 9.6 6.4 28.8 25.6 44.8 25.6s35.2-19.2 44.8-22.4c92.8-67.2 89.6-67.2 115.2-86.4V288c0-17.67-14.33-32-32-32zm256-96H224c-17.67 0-32 14.33-32 32v32h96c33.21 0 60.59 25.42 63.71 57.82l.29-.22V416h192c17.67 0 32-14.33 32-32V192c0-17.67-14.33-32-32-32zm-32 128h-64v-64h64v64zm-352-96c0-35.29 28.71-64 64-64h224V32c0-17.67-14.33-32-32-32H96C78.33 0 64 14.33 64 32v192h96v-32z"]
};
var faMale = {
prefix: 'fas',
iconName: 'male',
icon: [192, 512, [], "f183", "M96 0c35.346 0 64 28.654 64 64s-28.654 64-64 64-64-28.654-64-64S60.654 0 96 0m48 144h-11.36c-22.711 10.443-49.59 10.894-73.28 0H48c-26.51 0-48 21.49-48 48v136c0 13.255 10.745 24 24 24h16v136c0 13.255 10.745 24 24 24h64c13.255 0 24-10.745 24-24V352h16c13.255 0 24-10.745 24-24V192c0-26.51-21.49-48-48-48z"]
};
var faMap = {
prefix: 'fas',
iconName: 'map',
icon: [576, 512, [], "f279", "M0 117.66v346.32c0 11.32 11.43 19.06 21.94 14.86L160 416V32L20.12 87.95A32.006 32.006 0 0 0 0 117.66zM192 416l192 64V96L192 32v384zM554.06 33.16L416 96v384l139.88-55.95A31.996 31.996 0 0 0 576 394.34V48.02c0-11.32-11.43-19.06-21.94-14.86z"]
};
var faMapMarked = {
prefix: 'fas',
iconName: 'map-marked',
icon: [576, 512, [], "f59f", "M288 0c-69.59 0-126 56.41-126 126 0 56.26 82.35 158.8 113.9 196.02 6.39 7.54 17.82 7.54 24.2 0C331.65 284.8 414 182.26 414 126 414 56.41 357.59 0 288 0zM20.12 215.95A32.006 32.006 0 0 0 0 245.66v250.32c0 11.32 11.43 19.06 21.94 14.86L160 448V214.92c-8.84-15.98-16.07-31.54-21.25-46.42L20.12 215.95zM288 359.67c-14.07 0-27.38-6.18-36.51-16.96-19.66-23.2-40.57-49.62-59.49-76.72v182l192 64V266c-18.92 27.09-39.82 53.52-59.49 76.72-9.13 10.77-22.44 16.95-36.51 16.95zm266.06-198.51L416 224v288l139.88-55.95A31.996 31.996 0 0 0 576 426.34V176.02c0-11.32-11.43-19.06-21.94-14.86z"]
};
var faMapMarkedAlt = {
prefix: 'fas',
iconName: 'map-marked-alt',
icon: [576, 512, [], "f5a0", "M288 0c-69.59 0-126 56.41-126 126 0 56.26 82.35 158.8 113.9 196.02 6.39 7.54 17.82 7.54 24.2 0C331.65 284.8 414 182.26 414 126 414 56.41 357.59 0 288 0zm0 168c-23.2 0-42-18.8-42-42s18.8-42 42-42 42 18.8 42 42-18.8 42-42 42zM20.12 215.95A32.006 32.006 0 0 0 0 245.66v250.32c0 11.32 11.43 19.06 21.94 14.86L160 448V214.92c-8.84-15.98-16.07-31.54-21.25-46.42L20.12 215.95zM288 359.67c-14.07 0-27.38-6.18-36.51-16.96-19.66-23.2-40.57-49.62-59.49-76.72v182l192 64V266c-18.92 27.09-39.82 53.52-59.49 76.72-9.13 10.77-22.44 16.95-36.51 16.95zm266.06-198.51L416 224v288l139.88-55.95A31.996 31.996 0 0 0 576 426.34V176.02c0-11.32-11.43-19.06-21.94-14.86z"]
};
var faMapMarker = {
prefix: 'fas',
iconName: 'map-marker',
icon: [384, 512, [], "f041", "M172.268 501.67C26.97 291.031 0 269.413 0 192 0 85.961 85.961 0 192 0s192 85.961 192 192c0 77.413-26.97 99.031-172.268 309.67-9.535 13.774-29.93 13.773-39.464 0z"]
};
var faMapMarkerAlt = {
prefix: 'fas',
iconName: 'map-marker-alt',
icon: [384, 512, [], "f3c5", "M172.268 501.67C26.97 291.031 0 269.413 0 192 0 85.961 85.961 0 192 0s192 85.961 192 192c0 77.413-26.97 99.031-172.268 309.67-9.535 13.774-29.93 13.773-39.464 0zM192 272c44.183 0 80-35.817 80-80s-35.817-80-80-80-80 35.817-80 80 35.817 80 80 80z"]
};
var faMapPin = {
prefix: 'fas',
iconName: 'map-pin',
icon: [288, 512, [], "f276", "M112 316.94v156.69l22.02 33.02c4.75 7.12 15.22 7.12 19.97 0L176 473.63V316.94c-10.39 1.92-21.06 3.06-32 3.06s-21.61-1.14-32-3.06zM144 0C64.47 0 0 64.47 0 144s64.47 144 144 144 144-64.47 144-144S223.53 0 144 0zm0 76c-37.5 0-68 30.5-68 68 0 6.62-5.38 12-12 12s-12-5.38-12-12c0-50.73 41.28-92 92-92 6.62 0 12 5.38 12 12s-5.38 12-12 12z"]
};
var faMapSigns = {
prefix: 'fas',
iconName: 'map-signs',
icon: [512, 512, [], "f277", "M507.31 84.69L464 41.37c-6-6-14.14-9.37-22.63-9.37H288V16c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v16H56c-13.25 0-24 10.75-24 24v80c0 13.25 10.75 24 24 24h385.37c8.49 0 16.62-3.37 22.63-9.37l43.31-43.31c6.25-6.26 6.25-16.38 0-22.63zM224 496c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16V384h-64v112zm232-272H288v-32h-64v32H70.63c-8.49 0-16.62 3.37-22.63 9.37L4.69 276.69c-6.25 6.25-6.25 16.38 0 22.63L48 342.63c6 6 14.14 9.37 22.63 9.37H456c13.25 0 24-10.75 24-24v-80c0-13.25-10.75-24-24-24z"]
};
var faMarker = {
prefix: 'fas',
iconName: 'marker',
icon: [512, 512, [], "f5a1", "M93.95 290.03A327.038 327.038 0 0 0 .17 485.11l-.03.23c-1.7 15.28 11.21 28.2 26.49 26.51a327.02 327.02 0 0 0 195.34-93.8l75.4-75.4-128.02-128.02-75.4 75.4zM485.49 26.51c-35.35-35.35-92.67-35.35-128.02 0l-21.76 21.76-36.56-36.55c-15.62-15.62-40.95-15.62-56.56 0L138.47 115.84c-6.25 6.25-6.25 16.38 0 22.63l22.62 22.62c6.25 6.25 16.38 6.25 22.63 0l87.15-87.15 19.59 19.59L191.98 192 320 320.02l165.49-165.49c35.35-35.35 35.35-92.66 0-128.02z"]
};
var faMars = {
prefix: 'fas',
iconName: 'mars',
icon: [384, 512, [], "f222", "M372 64h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-80.7 80.7c-22.2-14-48.5-22.1-76.7-22.1C64.5 160 0 224.5 0 304s64.5 144 144 144 144-64.5 144-144c0-28.2-8.1-54.5-22.1-76.7l80.7-80.7 16.9 16.9c7.6 7.6 20.5 2.2 20.5-8.5V76c0-6.6-5.4-12-12-12zM144 384c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faMarsDouble = {
prefix: 'fas',
iconName: 'mars-double',
icon: [512, 512, [], "f227", "M340 0h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-48.7 48.7C198.5 72.1 172.2 64 144 64 64.5 64 0 128.5 0 208s64.5 144 144 144 144-64.5 144-144c0-28.2-8.1-54.5-22.1-76.7l48.7-48.7 16.9 16.9c2.4 2.4 5.5 3.5 8.4 3.5 6.2 0 12.1-4.8 12.1-12V12c0-6.6-5.4-12-12-12zM144 288c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80zm356-128.1h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-48.7 48.7c-18.2-11.4-39-18.9-61.5-21.3-2.1 21.8-8.2 43.3-18.4 63.3 1.1 0 2.2-.1 3.2-.1 44.1 0 80 35.9 80 80s-35.9 80-80 80-80-35.9-80-80c0-1.1 0-2.2.1-3.2-20 10.2-41.5 16.4-63.3 18.4C168.4 455.6 229.6 512 304 512c79.5 0 144-64.5 144-144 0-28.2-8.1-54.5-22.1-76.7l48.7-48.7 16.9 16.9c2.4 2.4 5.4 3.5 8.4 3.5 6.2 0 12.1-4.8 12.1-12v-79c0-6.7-5.4-12.1-12-12.1z"]
};
var faMarsStroke = {
prefix: 'fas',
iconName: 'mars-stroke',
icon: [384, 512, [], "f229", "M372 64h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-17.5 17.5-14.1-14.1c-4.7-4.7-12.3-4.7-17 0L224.5 133c-4.7 4.7-4.7 12.3 0 17l14.1 14.1-18 18c-22.2-14-48.5-22.1-76.7-22.1C64.5 160 0 224.5 0 304s64.5 144 144 144 144-64.5 144-144c0-28.2-8.1-54.5-22.1-76.7l18-18 14.1 14.1c4.7 4.7 12.3 4.7 17 0l28.3-28.3c4.7-4.7 4.7-12.3 0-17L329.2 164l17.5-17.5 16.9 16.9c7.6 7.6 20.5 2.2 20.5-8.5V76c-.1-6.6-5.5-12-12.1-12zM144 384c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faMarsStrokeH = {
prefix: 'fas',
iconName: 'mars-stroke-h',
icon: [480, 512, [], "f22b", "M476.2 247.5l-55.9-55.9c-7.6-7.6-20.5-2.2-20.5 8.5V224H376v-20c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12v20h-27.6c-5.8-25.6-18.7-49.9-38.6-69.8C189.6 98 98.4 98 42.2 154.2c-56.2 56.2-56.2 147.4 0 203.6 56.2 56.2 147.4 56.2 203.6 0 19.9-19.9 32.8-44.2 38.6-69.8H312v20c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-20h23.9v23.9c0 10.7 12.9 16 20.5 8.5l55.9-55.9c4.6-4.7 4.6-12.3-.1-17zm-275.6 65.1c-31.2 31.2-81.9 31.2-113.1 0-31.2-31.2-31.2-81.9 0-113.1 31.2-31.2 81.9-31.2 113.1 0 31.2 31.1 31.2 81.9 0 113.1z"]
};
var faMarsStrokeV = {
prefix: 'fas',
iconName: 'mars-stroke-v',
icon: [288, 512, [], "f22a", "M245.8 234.2c-19.9-19.9-44.2-32.8-69.8-38.6v-25.4h20c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-20V81.4h23.9c10.7 0 16-12.9 8.5-20.5L152.5 5.1c-4.7-4.7-12.3-4.7-17 0L79.6 61c-7.6 7.6-2.2 20.5 8.5 20.5H112v24.7H92c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h20v25.4c-25.6 5.8-49.9 18.7-69.8 38.6-56.2 56.2-56.2 147.4 0 203.6 56.2 56.2 147.4 56.2 203.6 0 56.3-56.2 56.3-147.4 0-203.6zm-45.2 158.4c-31.2 31.2-81.9 31.2-113.1 0-31.2-31.2-31.2-81.9 0-113.1 31.2-31.2 81.9-31.2 113.1 0 31.2 31.1 31.2 81.9 0 113.1z"]
};
var faMask = {
prefix: 'fas',
iconName: 'mask',
icon: [640, 512, [], "f6fa", "M320.67 64c-442.6 0-357.57 384-158.46 384 39.9 0 77.47-20.69 101.42-55.86l25.73-37.79c15.66-22.99 46.97-22.99 62.63 0l25.73 37.79C401.66 427.31 439.23 448 479.13 448c189.86 0 290.63-384-158.46-384zM184 308.36c-41.06 0-67.76-25.66-80.08-41.05-5.23-6.53-5.23-16.09 0-22.63 12.32-15.4 39.01-41.05 80.08-41.05s67.76 25.66 80.08 41.05c5.23 6.53 5.23 16.09 0 22.63-12.32 15.4-39.02 41.05-80.08 41.05zm272 0c-41.06 0-67.76-25.66-80.08-41.05-5.23-6.53-5.23-16.09 0-22.63 12.32-15.4 39.01-41.05 80.08-41.05s67.76 25.66 80.08 41.05c5.23 6.53 5.23 16.09 0 22.63-12.32 15.4-39.02 41.05-80.08 41.05z"]
};
var faMedal = {
prefix: 'fas',
iconName: 'medal',
icon: [512, 512, [], "f5a2", "M223.75 130.75L154.62 15.54A31.997 31.997 0 0 0 127.18 0H16.03C3.08 0-4.5 14.57 2.92 25.18l111.27 158.96c29.72-27.77 67.52-46.83 109.56-53.39zM495.97 0H384.82c-11.24 0-21.66 5.9-27.44 15.54l-69.13 115.21c42.04 6.56 79.84 25.62 109.56 53.38L509.08 25.18C516.5 14.57 508.92 0 495.97 0zM256 160c-97.2 0-176 78.8-176 176s78.8 176 176 176 176-78.8 176-176-78.8-176-176-176zm92.52 157.26l-37.93 36.96 8.97 52.22c1.6 9.36-8.26 16.51-16.65 12.09L256 393.88l-46.9 24.65c-8.4 4.45-18.25-2.74-16.65-12.09l8.97-52.22-37.93-36.96c-6.82-6.64-3.05-18.23 6.35-19.59l52.43-7.64 23.43-47.52c2.11-4.28 6.19-6.39 10.28-6.39 4.11 0 8.22 2.14 10.33 6.39l23.43 47.52 52.43 7.64c9.4 1.36 13.17 12.95 6.35 19.59z"]
};
var faMedkit = {
prefix: 'fas',
iconName: 'medkit',
icon: [512, 512, [], "f0fa", "M96 480h320V128h-32V80c0-26.51-21.49-48-48-48H176c-26.51 0-48 21.49-48 48v48H96v352zm96-384h128v32H192V96zm320 80v256c0 26.51-21.49 48-48 48h-16V128h16c26.51 0 48 21.49 48 48zM64 480H48c-26.51 0-48-21.49-48-48V176c0-26.51 21.49-48 48-48h16v352zm288-208v32c0 8.837-7.163 16-16 16h-48v48c0 8.837-7.163 16-16 16h-32c-8.837 0-16-7.163-16-16v-48h-48c-8.837 0-16-7.163-16-16v-32c0-8.837 7.163-16 16-16h48v-48c0-8.837 7.163-16 16-16h32c8.837 0 16 7.163 16 16v48h48c8.837 0 16 7.163 16 16z"]
};
var faMeh = {
prefix: 'fas',
iconName: 'meh',
icon: [496, 512, [], "f11a", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm-80 168c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm176 192H152c-21.2 0-21.2-32 0-32h192c21.2 0 21.2 32 0 32zm-16-128c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faMehBlank = {
prefix: 'fas',
iconName: 'meh-blank',
icon: [496, 512, [], "f5a4", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm-80 232c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm160 0c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faMehRollingEyes = {
prefix: 'fas',
iconName: 'meh-rolling-eyes',
icon: [496, 512, [], "f5a5", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM88 224c0-24.3 13.7-45.2 33.6-56-.7 2.6-1.6 5.2-1.6 8 0 17.7 14.3 32 32 32s32-14.3 32-32c0-2.8-.9-5.4-1.6-8 19.9 10.8 33.6 31.7 33.6 56 0 35.3-28.7 64-64 64s-64-28.7-64-64zm224 176H184c-21.2 0-21.2-32 0-32h128c21.2 0 21.2 32 0 32zm32-112c-35.3 0-64-28.7-64-64 0-24.3 13.7-45.2 33.6-56-.7 2.6-1.6 5.2-1.6 8 0 17.7 14.3 32 32 32s32-14.3 32-32c0-2.8-.9-5.4-1.6-8 19.9 10.8 33.6 31.7 33.6 56 0 35.3-28.7 64-64 64z"]
};
var faMemory = {
prefix: 'fas',
iconName: 'memory',
icon: [640, 512, [], "f538", "M640 130.94V96c0-17.67-14.33-32-32-32H32C14.33 64 0 78.33 0 96v34.94c18.6 6.61 32 24.19 32 45.06s-13.4 38.45-32 45.06V320h640v-98.94c-18.6-6.61-32-24.19-32-45.06s13.4-38.45 32-45.06zM224 256h-64V128h64v128zm128 0h-64V128h64v128zm128 0h-64V128h64v128zM0 448h64v-26.67c0-8.84 7.16-16 16-16s16 7.16 16 16V448h128v-26.67c0-8.84 7.16-16 16-16s16 7.16 16 16V448h128v-26.67c0-8.84 7.16-16 16-16s16 7.16 16 16V448h128v-26.67c0-8.84 7.16-16 16-16s16 7.16 16 16V448h64v-96H0v96z"]
};
var faMenorah = {
prefix: 'fas',
iconName: 'menorah',
icon: [640, 512, [], "f676", "M144 128h-32c-8.84 0-16 7.16-16 16v144h64V144c0-8.84-7.16-16-16-16zm96 0h-32c-8.84 0-16 7.16-16 16v144h64V144c0-8.84-7.16-16-16-16zm192 0h-32c-8.84 0-16 7.16-16 16v144h64V144c0-8.84-7.16-16-16-16zm96 0h-32c-8.84 0-16 7.16-16 16v144h64V144c0-8.84-7.16-16-16-16zm80-32c17.67 0 32-14.33 32-32S608 0 608 0s-32 46.33-32 64 14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S512 0 512 0s-32 46.33-32 64 14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S416 0 416 0s-32 46.33-32 64 14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S320 0 320 0s-32 46.33-32 64 14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S224 0 224 0s-32 46.33-32 64 14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S128 0 128 0 96 46.33 96 64s14.33 32 32 32zm-96 0c17.67 0 32-14.33 32-32S32 0 32 0 0 46.33 0 64s14.33 32 32 32zm544 192c0 17.67-14.33 32-32 32H352V144c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v176H96c-17.67 0-32-14.33-32-32V144c0-8.84-7.16-16-16-16H16c-8.84 0-16 7.16-16 16v144c0 53.02 42.98 96 96 96h192v64H112c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h416c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16H352v-64h192c53.02 0 96-42.98 96-96V144c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v144z"]
};
var faMercury = {
prefix: 'fas',
iconName: 'mercury',
icon: [288, 512, [], "f223", "M288 208c0-44.2-19.9-83.7-51.2-110.1 2.5-1.8 4.9-3.8 7.2-5.8 24.7-21.2 39.8-48.8 43.2-78.8.9-7.1-4.7-13.3-11.9-13.3h-40.5C229 0 224.1 4.1 223 9.8c-2.4 12.5-9.6 24.3-20.7 33.8C187 56.8 166.3 64 144 64s-43-7.2-58.4-20.4C74.5 34.1 67.4 22.3 64.9 9.8 63.8 4.1 58.9 0 53.2 0H12.7C5.5 0-.1 6.2.8 13.3 4.2 43.4 19.2 71 44 92.2c2.3 2 4.7 3.9 7.2 5.8C19.9 124.3 0 163.8 0 208c0 68.5 47.9 125.9 112 140.4V400H76c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v36c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-36h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-51.6c64.1-14.5 112-71.9 112-140.4zm-224 0c0-44.1 35.9-80 80-80s80 35.9 80 80-35.9 80-80 80-80-35.9-80-80z"]
};
var faMeteor = {
prefix: 'fas',
iconName: 'meteor',
icon: [512, 512, [], "f753", "M511.328,20.8027c-11.60759,38.70264-34.30724,111.70173-61.30311,187.70077,6.99893,2.09372,13.4042,4,18.60653,5.59368a16.06158,16.06158,0,0,1,9.49854,22.906c-22.106,42.29635-82.69047,152.795-142.47819,214.40356-.99984,1.09373-1.99969,2.5-2.99954,3.49995A194.83046,194.83046,0,1,1,57.085,179.41009c.99985-1,2.40588-2,3.49947-3,61.59994-59.90549,171.97367-120.40473,214.37343-142.4982a16.058,16.058,0,0,1,22.90274,9.49988c1.59351,5.09368,3.49947,11.5936,5.5929,18.59351C379.34818,35.00565,452.43074,12.30281,491.12794.70921A16.18325,16.18325,0,0,1,511.328,20.8027ZM319.951,320.00207A127.98041,127.98041,0,1,0,191.97061,448.00046,127.97573,127.97573,0,0,0,319.951,320.00207Zm-127.98041-31.9996a31.9951,31.9951,0,1,1-31.9951-31.9996A31.959,31.959,0,0,1,191.97061,288.00247Zm31.9951,79.999a15.99755,15.99755,0,1,1-15.99755-15.9998A16.04975,16.04975,0,0,1,223.96571,368.00147Z"]
};
var faMicrochip = {
prefix: 'fas',
iconName: 'microchip',
icon: [512, 512, [], "f2db", "M416 48v416c0 26.51-21.49 48-48 48H144c-26.51 0-48-21.49-48-48V48c0-26.51 21.49-48 48-48h224c26.51 0 48 21.49 48 48zm96 58v12a6 6 0 0 1-6 6h-18v6a6 6 0 0 1-6 6h-42V88h42a6 6 0 0 1 6 6v6h18a6 6 0 0 1 6 6zm0 96v12a6 6 0 0 1-6 6h-18v6a6 6 0 0 1-6 6h-42v-48h42a6 6 0 0 1 6 6v6h18a6 6 0 0 1 6 6zm0 96v12a6 6 0 0 1-6 6h-18v6a6 6 0 0 1-6 6h-42v-48h42a6 6 0 0 1 6 6v6h18a6 6 0 0 1 6 6zm0 96v12a6 6 0 0 1-6 6h-18v6a6 6 0 0 1-6 6h-42v-48h42a6 6 0 0 1 6 6v6h18a6 6 0 0 1 6 6zM30 376h42v48H30a6 6 0 0 1-6-6v-6H6a6 6 0 0 1-6-6v-12a6 6 0 0 1 6-6h18v-6a6 6 0 0 1 6-6zm0-96h42v48H30a6 6 0 0 1-6-6v-6H6a6 6 0 0 1-6-6v-12a6 6 0 0 1 6-6h18v-6a6 6 0 0 1 6-6zm0-96h42v48H30a6 6 0 0 1-6-6v-6H6a6 6 0 0 1-6-6v-12a6 6 0 0 1 6-6h18v-6a6 6 0 0 1 6-6zm0-96h42v48H30a6 6 0 0 1-6-6v-6H6a6 6 0 0 1-6-6v-12a6 6 0 0 1 6-6h18v-6a6 6 0 0 1 6-6z"]
};
var faMicrophone = {
prefix: 'fas',
iconName: 'microphone',
icon: [352, 512, [], "f130", "M176 352c53.02 0 96-42.98 96-96V96c0-53.02-42.98-96-96-96S80 42.98 80 96v160c0 53.02 42.98 96 96 96zm160-160h-16c-8.84 0-16 7.16-16 16v48c0 74.8-64.49 134.82-140.79 127.38C96.71 376.89 48 317.11 48 250.3V208c0-8.84-7.16-16-16-16H16c-8.84 0-16 7.16-16 16v40.16c0 89.64 63.97 169.55 152 181.69V464H96c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16h-56v-33.77C285.71 418.47 352 344.9 352 256v-48c0-8.84-7.16-16-16-16z"]
};
var faMicrophoneAlt = {
prefix: 'fas',
iconName: 'microphone-alt',
icon: [352, 512, [], "f3c9", "M336 192h-16c-8.84 0-16 7.16-16 16v48c0 74.8-64.49 134.82-140.79 127.38C96.71 376.89 48 317.11 48 250.3V208c0-8.84-7.16-16-16-16H16c-8.84 0-16 7.16-16 16v40.16c0 89.64 63.97 169.55 152 181.69V464H96c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16h-56v-33.77C285.71 418.47 352 344.9 352 256v-48c0-8.84-7.16-16-16-16zM176 352c53.02 0 96-42.98 96-96h-85.33c-5.89 0-10.67-3.58-10.67-8v-16c0-4.42 4.78-8 10.67-8H272v-32h-85.33c-5.89 0-10.67-3.58-10.67-8v-16c0-4.42 4.78-8 10.67-8H272v-32h-85.33c-5.89 0-10.67-3.58-10.67-8v-16c0-4.42 4.78-8 10.67-8H272c0-53.02-42.98-96-96-96S80 42.98 80 96v160c0 53.02 42.98 96 96 96z"]
};
var faMicrophoneAltSlash = {
prefix: 'fas',
iconName: 'microphone-alt-slash',
icon: [640, 512, [], "f539", "M633.82 458.1L476.26 336.33C488.74 312.21 496 284.98 496 256v-48c0-8.84-7.16-16-16-16h-16c-8.84 0-16 7.16-16 16v48c0 17.92-3.96 34.8-10.72 50.2l-26.55-20.52c3.1-9.4 5.28-19.22 5.28-29.67h-43.67l-41.4-32H416v-32h-85.33c-5.89 0-10.67-3.58-10.67-8v-16c0-4.42 4.78-8 10.67-8H416v-32h-85.33c-5.89 0-10.67-3.58-10.67-8v-16c0-4.42 4.78-8 10.67-8H416c0-53.02-42.98-96-96-96s-96 42.98-96 96v45.36L45.47 3.37C38.49-2.05 28.43-.8 23.01 6.18L3.37 31.45C-2.05 38.42-.8 48.47 6.18 53.9l588.36 454.73c6.98 5.43 17.03 4.17 22.46-2.81l19.64-25.27c5.41-6.97 4.16-17.02-2.82-22.45zM400 464h-56v-33.78c11.71-1.62 23.1-4.28 33.96-8.08l-50.4-38.96c-6.71.4-13.41.87-20.35.2-55.85-5.45-98.74-48.63-111.18-101.85L144 241.31v6.85c0 89.64 63.97 169.55 152 181.69V464h-56c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16z"]
};
var faMicrophoneSlash = {
prefix: 'fas',
iconName: 'microphone-slash',
icon: [640, 512, [], "f131", "M633.82 458.1l-157.8-121.96C488.61 312.13 496 285.01 496 256v-48c0-8.84-7.16-16-16-16h-16c-8.84 0-16 7.16-16 16v48c0 17.92-3.96 34.8-10.72 50.2l-26.55-20.52c3.1-9.4 5.28-19.22 5.28-29.67V96c0-53.02-42.98-96-96-96s-96 42.98-96 96v45.36L45.47 3.37C38.49-2.05 28.43-.8 23.01 6.18L3.37 31.45C-2.05 38.42-.8 48.47 6.18 53.9l588.36 454.73c6.98 5.43 17.03 4.17 22.46-2.81l19.64-25.27c5.41-6.97 4.16-17.02-2.82-22.45zM400 464h-56v-33.77c11.66-1.6 22.85-4.54 33.67-8.31l-50.11-38.73c-6.71.4-13.41.87-20.35.2-55.85-5.45-98.74-48.63-111.18-101.85L144 241.31v6.85c0 89.64 63.97 169.55 152 181.69V464h-56c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h160c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16z"]
};
var faMicroscope = {
prefix: 'fas',
iconName: 'microscope',
icon: [512, 512, [], "f610", "M160 320h12v16c0 8.84 7.16 16 16 16h40c8.84 0 16-7.16 16-16v-16h12c17.67 0 32-14.33 32-32V64c0-17.67-14.33-32-32-32V16c0-8.84-7.16-16-16-16h-64c-8.84 0-16 7.16-16 16v16c-17.67 0-32 14.33-32 32v224c0 17.67 14.33 32 32 32zm304 128h-1.29C493.24 413.99 512 369.2 512 320c0-105.88-86.12-192-192-192v64c70.58 0 128 57.42 128 128s-57.42 128-128 128H48c-26.51 0-48 21.49-48 48 0 8.84 7.16 16 16 16h480c8.84 0 16-7.16 16-16 0-26.51-21.49-48-48-48zm-360-32h208c4.42 0 8-3.58 8-8v-16c0-4.42-3.58-8-8-8H104c-4.42 0-8 3.58-8 8v16c0 4.42 3.58 8 8 8z"]
};
var faMinus = {
prefix: 'fas',
iconName: 'minus',
icon: [448, 512, [], "f068", "M416 208H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h384c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32z"]
};
var faMinusCircle = {
prefix: 'fas',
iconName: 'minus-circle',
icon: [512, 512, [], "f056", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zM124 296c-6.6 0-12-5.4-12-12v-56c0-6.6 5.4-12 12-12h264c6.6 0 12 5.4 12 12v56c0 6.6-5.4 12-12 12H124z"]
};
var faMinusSquare = {
prefix: 'fas',
iconName: 'minus-square',
icon: [448, 512, [], "f146", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zM92 296c-6.6 0-12-5.4-12-12v-56c0-6.6 5.4-12 12-12h264c6.6 0 12 5.4 12 12v56c0 6.6-5.4 12-12 12H92z"]
};
var faMitten = {
prefix: 'fas',
iconName: 'mitten',
icon: [448, 512, [], "f7b5", "M368 416H48c-8.8 0-16 7.2-16 16v64c0 8.8 7.2 16 16 16h320c8.8 0 16-7.2 16-16v-64c0-8.8-7.2-16-16-16zm57-209.1c-27.2-22.6-67.5-19-90.1 8.2l-20.9 25-29.6-128.4c-18-77.5-95.4-125.9-172.8-108C34.2 21.6-14.2 98.9 3.7 176.4L51.6 384h309l72.5-87c22.7-27.2 19-67.5-8.1-90.1z"]
};
var faMobile = {
prefix: 'fas',
iconName: 'mobile',
icon: [320, 512, [], "f10b", "M272 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h224c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM160 480c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faMobileAlt = {
prefix: 'fas',
iconName: 'mobile-alt',
icon: [320, 512, [], "f3cd", "M272 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h224c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM160 480c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm112-108c0 6.6-5.4 12-12 12H60c-6.6 0-12-5.4-12-12V60c0-6.6 5.4-12 12-12h200c6.6 0 12 5.4 12 12v312z"]
};
var faMoneyBill = {
prefix: 'fas',
iconName: 'money-bill',
icon: [640, 512, [], "f0d6", "M608 64H32C14.33 64 0 78.33 0 96v320c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V96c0-17.67-14.33-32-32-32zM48 400v-64c35.35 0 64 28.65 64 64H48zm0-224v-64h64c0 35.35-28.65 64-64 64zm272 176c-44.19 0-80-42.99-80-96 0-53.02 35.82-96 80-96s80 42.98 80 96c0 53.03-35.83 96-80 96zm272 48h-64c0-35.35 28.65-64 64-64v64zm0-224c-35.35 0-64-28.65-64-64h64v64z"]
};
var faMoneyBillAlt = {
prefix: 'fas',
iconName: 'money-bill-alt',
icon: [640, 512, [], "f3d1", "M352 288h-16v-88c0-4.42-3.58-8-8-8h-13.58c-4.74 0-9.37 1.4-13.31 4.03l-15.33 10.22a7.994 7.994 0 0 0-2.22 11.09l8.88 13.31a7.994 7.994 0 0 0 11.09 2.22l.47-.31V288h-16c-4.42 0-8 3.58-8 8v16c0 4.42 3.58 8 8 8h64c4.42 0 8-3.58 8-8v-16c0-4.42-3.58-8-8-8zM608 64H32C14.33 64 0 78.33 0 96v320c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V96c0-17.67-14.33-32-32-32zM48 400v-64c35.35 0 64 28.65 64 64H48zm0-224v-64h64c0 35.35-28.65 64-64 64zm272 192c-53.02 0-96-50.15-96-112 0-61.86 42.98-112 96-112s96 50.14 96 112c0 61.87-43 112-96 112zm272 32h-64c0-35.35 28.65-64 64-64v64zm0-224c-35.35 0-64-28.65-64-64h64v64z"]
};
var faMoneyBillWave = {
prefix: 'fas',
iconName: 'money-bill-wave',
icon: [640, 512, [], "f53a", "M621.16 54.46C582.37 38.19 543.55 32 504.75 32c-123.17-.01-246.33 62.34-369.5 62.34-30.89 0-61.76-3.92-92.65-13.72-3.47-1.1-6.95-1.62-10.35-1.62C15.04 79 0 92.32 0 110.81v317.26c0 12.63 7.23 24.6 18.84 29.46C57.63 473.81 96.45 480 135.25 480c123.17 0 246.34-62.35 369.51-62.35 30.89 0 61.76 3.92 92.65 13.72 3.47 1.1 6.95 1.62 10.35 1.62 17.21 0 32.25-13.32 32.25-31.81V83.93c-.01-12.64-7.24-24.6-18.85-29.47zM48 132.22c20.12 5.04 41.12 7.57 62.72 8.93C104.84 170.54 79 192.69 48 192.69v-60.47zm0 285v-47.78c34.37 0 62.18 27.27 63.71 61.4-22.53-1.81-43.59-6.31-63.71-13.62zM320 352c-44.19 0-80-42.99-80-96 0-53.02 35.82-96 80-96s80 42.98 80 96c0 53.03-35.83 96-80 96zm272 27.78c-17.52-4.39-35.71-6.85-54.32-8.44 5.87-26.08 27.5-45.88 54.32-49.28v57.72zm0-236.11c-30.89-3.91-54.86-29.7-55.81-61.55 19.54 2.17 38.09 6.23 55.81 12.66v48.89z"]
};
var faMoneyBillWaveAlt = {
prefix: 'fas',
iconName: 'money-bill-wave-alt',
icon: [640, 512, [], "f53b", "M621.16 54.46C582.37 38.19 543.55 32 504.75 32c-123.17-.01-246.33 62.34-369.5 62.34-30.89 0-61.76-3.92-92.65-13.72-3.47-1.1-6.95-1.62-10.35-1.62C15.04 79 0 92.32 0 110.81v317.26c0 12.63 7.23 24.6 18.84 29.46C57.63 473.81 96.45 480 135.25 480c123.17 0 246.34-62.35 369.51-62.35 30.89 0 61.76 3.92 92.65 13.72 3.47 1.1 6.95 1.62 10.35 1.62 17.21 0 32.25-13.32 32.25-31.81V83.93c-.01-12.64-7.24-24.6-18.85-29.47zM320 352c-44.19 0-80-42.99-80-96 0-53.02 35.82-96 80-96s80 42.98 80 96c0 53.03-35.83 96-80 96z"]
};
var faMoneyCheck = {
prefix: 'fas',
iconName: 'money-check',
icon: [640, 512, [], "f53c", "M0 448c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V128H0v320zm448-208c0-8.84 7.16-16 16-16h96c8.84 0 16 7.16 16 16v32c0 8.84-7.16 16-16 16h-96c-8.84 0-16-7.16-16-16v-32zm0 120c0-4.42 3.58-8 8-8h112c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H456c-4.42 0-8-3.58-8-8v-16zM64 264c0-4.42 3.58-8 8-8h304c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16zm0 96c0-4.42 3.58-8 8-8h176c4.42 0 8 3.58 8 8v16c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16zM624 32H16C7.16 32 0 39.16 0 48v48h640V48c0-8.84-7.16-16-16-16z"]
};
var faMoneyCheckAlt = {
prefix: 'fas',
iconName: 'money-check-alt',
icon: [640, 512, [], "f53d", "M608 32H32C14.33 32 0 46.33 0 64v384c0 17.67 14.33 32 32 32h576c17.67 0 32-14.33 32-32V64c0-17.67-14.33-32-32-32zM176 327.88V344c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-16.29c-11.29-.58-22.27-4.52-31.37-11.35-3.9-2.93-4.1-8.77-.57-12.14l11.75-11.21c2.77-2.64 6.89-2.76 10.13-.73 3.87 2.42 8.26 3.72 12.82 3.72h28.11c6.5 0 11.8-5.92 11.8-13.19 0-5.95-3.61-11.19-8.77-12.73l-45-13.5c-18.59-5.58-31.58-23.42-31.58-43.39 0-24.52 19.05-44.44 42.67-45.07V152c0-4.42 3.58-8 8-8h16c4.42 0 8 3.58 8 8v16.29c11.29.58 22.27 4.51 31.37 11.35 3.9 2.93 4.1 8.77.57 12.14l-11.75 11.21c-2.77 2.64-6.89 2.76-10.13.73-3.87-2.43-8.26-3.72-12.82-3.72h-28.11c-6.5 0-11.8 5.92-11.8 13.19 0 5.95 3.61 11.19 8.77 12.73l45 13.5c18.59 5.58 31.58 23.42 31.58 43.39 0 24.53-19.05 44.44-42.67 45.07zM416 312c0 4.42-3.58 8-8 8H296c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h112c4.42 0 8 3.58 8 8v16zm160 0c0 4.42-3.58 8-8 8h-80c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h80c4.42 0 8 3.58 8 8v16zm0-96c0 4.42-3.58 8-8 8H296c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h272c4.42 0 8 3.58 8 8v16z"]
};
var faMonument = {
prefix: 'fas',
iconName: 'monument',
icon: [384, 512, [], "f5a6", "M368 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h352c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm-78.86-347.26a31.97 31.97 0 0 0-9.21-19.44L203.31 4.69c-6.25-6.25-16.38-6.25-22.63 0l-76.6 76.61a31.97 31.97 0 0 0-9.21 19.44L64 416h256l-30.86-315.26zM240 307.2c0 6.4-6.4 12.8-12.8 12.8h-70.4c-6.4 0-12.8-6.4-12.8-12.8v-38.4c0-6.4 6.4-12.8 12.8-12.8h70.4c6.4 0 12.8 6.4 12.8 12.8v38.4z"]
};
var faMoon = {
prefix: 'fas',
iconName: 'moon',
icon: [512, 512, [], "f186", "M283.211 512c78.962 0 151.079-35.925 198.857-94.792 7.068-8.708-.639-21.43-11.562-19.35-124.203 23.654-238.262-71.576-238.262-196.954 0-72.222 38.662-138.635 101.498-174.394 9.686-5.512 7.25-20.197-3.756-22.23A258.156 258.156 0 0 0 283.211 0c-141.309 0-256 114.511-256 256 0 141.309 114.511 256 256 256z"]
};
var faMortarPestle = {
prefix: 'fas',
iconName: 'mortar-pestle',
icon: [512, 512, [], "f5a7", "M501.54 60.91c17.22-17.22 12.51-46.25-9.27-57.14a35.696 35.696 0 0 0-37.37 3.37L251.09 160h151.37l99.08-99.09zM496 192H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h16c0 80.98 50.2 150.11 121.13 178.32-12.76 16.87-21.72 36.8-24.95 58.69-1.46 9.92 6.04 18.98 16.07 18.98h223.5c10.03 0 17.53-9.06 16.07-18.98-3.22-21.89-12.18-41.82-24.95-58.69C429.8 406.11 480 336.98 480 256h16c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16z"]
};
var faMosque = {
prefix: 'fas',
iconName: 'mosque',
icon: [640, 512, [], "f678", "M0 480c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32V160H0v320zm579.16-192c17.86-17.39 28.84-37.34 28.84-58.91 0-52.86-41.79-93.79-87.92-122.9-41.94-26.47-80.63-57.77-111.96-96.22L400 0l-8.12 9.97c-31.33 38.45-70.01 69.76-111.96 96.22C233.79 135.3 192 176.23 192 229.09c0 21.57 10.98 41.52 28.84 58.91h358.32zM608 320H192c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h32v-64c0-17.67 14.33-32 32-32s32 14.33 32 32v64h64v-72c0-48 48-72 48-72s48 24 48 72v72h64v-64c0-17.67 14.33-32 32-32s32 14.33 32 32v64h32c17.67 0 32-14.33 32-32V352c0-17.67-14.33-32-32-32zM64 0S0 32 0 96v32h128V96c0-64-64-96-64-96z"]
};
var faMotorcycle = {
prefix: 'fas',
iconName: 'motorcycle',
icon: [640, 512, [], "f21c", "M512.9 192c-14.9-.1-29.1 2.3-42.4 6.9L437.6 144H520c13.3 0 24-10.7 24-24V88c0-13.3-10.7-24-24-24h-45.3c-6.8 0-13.3 2.9-17.8 7.9l-37.5 41.7-22.8-38C392.2 68.4 384.4 64 376 64h-80c-8.8 0-16 7.2-16 16v16c0 8.8 7.2 16 16 16h66.4l19.2 32H227.9c-17.7-23.1-44.9-40-99.9-40H72.5C59 104 47.7 115 48 128.5c.2 13 10.9 23.5 24 23.5h56c24.5 0 38.7 10.9 47.8 24.8l-11.3 20.5c-13-3.9-26.9-5.7-41.3-5.2C55.9 194.5 1.6 249.6 0 317c-1.6 72.1 56.3 131 128 131 59.6 0 109.7-40.8 124-96h84.2c13.7 0 24.6-11.4 24-25.1-2.1-47.1 17.5-93.7 56.2-125l12.5 20.8c-27.6 23.7-45.1 58.9-44.8 98.2.5 69.6 57.2 126.5 126.8 127.1 71.6.7 129.8-57.5 129.2-129.1-.7-69.6-57.6-126.4-127.2-126.9zM128 400c-44.1 0-80-35.9-80-80s35.9-80 80-80c4.2 0 8.4.3 12.5 1L99 316.4c-8.8 16 2.8 35.6 21 35.6h81.3c-12.4 28.2-40.6 48-73.3 48zm463.9-75.6c-2.2 40.6-35 73.4-75.5 75.5-46.1 2.5-84.4-34.3-84.4-79.9 0-21.4 8.4-40.8 22.1-55.1l49.4 82.4c4.5 7.6 14.4 10 22 5.5l13.7-8.2c7.6-4.5 10-14.4 5.5-22l-48.6-80.9c5.2-1.1 10.5-1.6 15.9-1.6 45.6-.1 82.3 38.2 79.9 84.3z"]
};
var faMountain = {
prefix: 'fas',
iconName: 'mountain',
icon: [640, 512, [], "f6fc", "M634.92 462.7l-288-448C341.03 5.54 330.89 0 320 0s-21.03 5.54-26.92 14.7l-288 448a32.001 32.001 0 0 0-1.17 32.64A32.004 32.004 0 0 0 32 512h576c11.71 0 22.48-6.39 28.09-16.67a31.983 31.983 0 0 0-1.17-32.63zM320 91.18L405.39 224H320l-64 64-38.06-38.06L320 91.18z"]
};
var faMouse = {
prefix: 'fas',
iconName: 'mouse',
icon: [384, 512, [], "f8cc", "M0 352a160 160 0 0 0 160 160h64a160 160 0 0 0 160-160V224H0zM176 0h-16A160 160 0 0 0 0 160v32h176zm48 0h-16v192h176v-32A160 160 0 0 0 224 0z"]
};
var faMousePointer = {
prefix: 'fas',
iconName: 'mouse-pointer',
icon: [320, 512, [], "f245", "M302.189 329.126H196.105l55.831 135.993c3.889 9.428-.555 19.999-9.444 23.999l-49.165 21.427c-9.165 4-19.443-.571-23.332-9.714l-53.053-129.136-86.664 89.138C18.729 472.71 0 463.554 0 447.977V18.299C0 1.899 19.921-6.096 30.277 5.443l284.412 292.542c11.472 11.179 3.007 31.141-12.5 31.141z"]
};
var faMugHot = {
prefix: 'fas',
iconName: 'mug-hot',
icon: [512, 512, [], "f7b6", "M127.1 146.5c1.3 7.7 8 13.5 16 13.5h16.5c9.8 0 17.6-8.5 16.3-18-3.8-28.2-16.4-54.2-36.6-74.7-14.4-14.7-23.6-33.3-26.4-53.5C111.8 5.9 105 0 96.8 0H80.4C70.6 0 63 8.5 64.1 18c3.9 31.9 18 61.3 40.6 84.4 12 12.2 19.7 27.5 22.4 44.1zm112 0c1.3 7.7 8 13.5 16 13.5h16.5c9.8 0 17.6-8.5 16.3-18-3.8-28.2-16.4-54.2-36.6-74.7-14.4-14.7-23.6-33.3-26.4-53.5C223.8 5.9 217 0 208.8 0h-16.4c-9.8 0-17.5 8.5-16.3 18 3.9 31.9 18 61.3 40.6 84.4 12 12.2 19.7 27.5 22.4 44.1zM400 192H32c-17.7 0-32 14.3-32 32v192c0 53 43 96 96 96h192c53 0 96-43 96-96h16c61.8 0 112-50.2 112-112s-50.2-112-112-112zm0 160h-16v-96h16c26.5 0 48 21.5 48 48s-21.5 48-48 48z"]
};
var faMusic = {
prefix: 'fas',
iconName: 'music',
icon: [512, 512, [], "f001", "M470.38 1.51L150.41 96A32 32 0 0 0 128 126.51v261.41A139 139 0 0 0 96 384c-53 0-96 28.66-96 64s43 64 96 64 96-28.66 96-64V214.32l256-75v184.61a138.4 138.4 0 0 0-32-3.93c-53 0-96 28.66-96 64s43 64 96 64 96-28.65 96-64V32a32 32 0 0 0-41.62-30.49z"]
};
var faNetworkWired = {
prefix: 'fas',
iconName: 'network-wired',
icon: [640, 512, [], "f6ff", "M640 264v-16c0-8.84-7.16-16-16-16H344v-40h72c17.67 0 32-14.33 32-32V32c0-17.67-14.33-32-32-32H224c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h72v40H16c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h104v40H64c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h160c17.67 0 32-14.33 32-32V352c0-17.67-14.33-32-32-32h-56v-40h304v40h-56c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h160c17.67 0 32-14.33 32-32V352c0-17.67-14.33-32-32-32h-56v-40h104c8.84 0 16-7.16 16-16zM256 128V64h128v64H256zm-64 320H96v-64h96v64zm352 0h-96v-64h96v64z"]
};
var faNeuter = {
prefix: 'fas',
iconName: 'neuter',
icon: [288, 512, [], "f22c", "M288 176c0-79.5-64.5-144-144-144S0 96.5 0 176c0 68.5 47.9 125.9 112 140.4V468c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12V316.4c64.1-14.5 112-71.9 112-140.4zm-144 80c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faNewspaper = {
prefix: 'fas',
iconName: 'newspaper',
icon: [576, 512, [], "f1ea", "M552 64H88c-13.255 0-24 10.745-24 24v8H24c-13.255 0-24 10.745-24 24v272c0 30.928 25.072 56 56 56h472c26.51 0 48-21.49 48-48V88c0-13.255-10.745-24-24-24zM56 400a8 8 0 0 1-8-8V144h16v248a8 8 0 0 1-8 8zm236-16H140c-6.627 0-12-5.373-12-12v-8c0-6.627 5.373-12 12-12h152c6.627 0 12 5.373 12 12v8c0 6.627-5.373 12-12 12zm208 0H348c-6.627 0-12-5.373-12-12v-8c0-6.627 5.373-12 12-12h152c6.627 0 12 5.373 12 12v8c0 6.627-5.373 12-12 12zm-208-96H140c-6.627 0-12-5.373-12-12v-8c0-6.627 5.373-12 12-12h152c6.627 0 12 5.373 12 12v8c0 6.627-5.373 12-12 12zm208 0H348c-6.627 0-12-5.373-12-12v-8c0-6.627 5.373-12 12-12h152c6.627 0 12 5.373 12 12v8c0 6.627-5.373 12-12 12zm0-96H140c-6.627 0-12-5.373-12-12v-40c0-6.627 5.373-12 12-12h360c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12z"]
};
var faNotEqual = {
prefix: 'fas',
iconName: 'not-equal',
icon: [448, 512, [], "f53e", "M416 208c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32h-23.88l51.87-66.81c5.37-7.02 4.04-17.06-2.97-22.43L415.61 3.3c-7.02-5.38-17.06-4.04-22.44 2.97L311.09 112H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h204.56l-74.53 96H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h55.49l-51.87 66.81c-5.37 7.01-4.04 17.05 2.97 22.43L64 508.7c7.02 5.38 17.06 4.04 22.43-2.97L168.52 400H416c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32H243.05l74.53-96H416z"]
};
var faNotesMedical = {
prefix: 'fas',
iconName: 'notes-medical',
icon: [384, 512, [], "f481", "M336 64h-80c0-35.3-28.7-64-64-64s-64 28.7-64 64H48C21.5 64 0 85.5 0 112v352c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V112c0-26.5-21.5-48-48-48zM192 40c13.3 0 24 10.7 24 24s-10.7 24-24 24-24-10.7-24-24 10.7-24 24-24zm96 304c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8v48zm0-192c0 4.4-3.6 8-8 8H104c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h176c4.4 0 8 3.6 8 8v16z"]
};
var faObjectGroup = {
prefix: 'fas',
iconName: 'object-group',
icon: [512, 512, [], "f247", "M480 128V96h20c6.627 0 12-5.373 12-12V44c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v20H64V44c0-6.627-5.373-12-12-12H12C5.373 32 0 37.373 0 44v40c0 6.627 5.373 12 12 12h20v320H12c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-20h384v20c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-20V128zM96 276V140c0-6.627 5.373-12 12-12h168c6.627 0 12 5.373 12 12v136c0 6.627-5.373 12-12 12H108c-6.627 0-12-5.373-12-12zm320 96c0 6.627-5.373 12-12 12H236c-6.627 0-12-5.373-12-12v-52h72c13.255 0 24-10.745 24-24v-72h84c6.627 0 12 5.373 12 12v136z"]
};
var faObjectUngroup = {
prefix: 'fas',
iconName: 'object-ungroup',
icon: [576, 512, [], "f248", "M64 320v26a6 6 0 0 1-6 6H6a6 6 0 0 1-6-6v-52a6 6 0 0 1 6-6h26V96H6a6 6 0 0 1-6-6V38a6 6 0 0 1 6-6h52a6 6 0 0 1 6 6v26h288V38a6 6 0 0 1 6-6h52a6 6 0 0 1 6 6v52a6 6 0 0 1-6 6h-26v192h26a6 6 0 0 1 6 6v52a6 6 0 0 1-6 6h-52a6 6 0 0 1-6-6v-26H64zm480-64v-32h26a6 6 0 0 0 6-6v-52a6 6 0 0 0-6-6h-52a6 6 0 0 0-6 6v26H408v72h8c13.255 0 24 10.745 24 24v64c0 13.255-10.745 24-24 24h-64c-13.255 0-24-10.745-24-24v-8H192v72h-26a6 6 0 0 0-6 6v52a6 6 0 0 0 6 6h52a6 6 0 0 0 6-6v-26h288v26a6 6 0 0 0 6 6h52a6 6 0 0 0 6-6v-52a6 6 0 0 0-6-6h-26V256z"]
};
var faOilCan = {
prefix: 'fas',
iconName: 'oil-can',
icon: [640, 512, [], "f613", "M629.8 160.31L416 224l-50.49-25.24a64.07 64.07 0 0 0-28.62-6.76H280v-48h56c8.84 0 16-7.16 16-16v-16c0-8.84-7.16-16-16-16H176c-8.84 0-16 7.16-16 16v16c0 8.84 7.16 16 16 16h56v48h-56L37.72 166.86a31.9 31.9 0 0 0-5.79-.53C14.67 166.33 0 180.36 0 198.34v94.95c0 15.46 11.06 28.72 26.28 31.48L96 337.46V384c0 17.67 14.33 32 32 32h274.63c8.55 0 16.75-3.42 22.76-9.51l212.26-214.75c1.5-1.5 2.34-3.54 2.34-5.66V168c.01-5.31-5.08-9.15-10.19-7.69zM96 288.67l-48-8.73v-62.43l48 8.73v62.43zm453.33 84.66c0 23.56 19.1 42.67 42.67 42.67s42.67-19.1 42.67-42.67S592 288 592 288s-42.67 61.77-42.67 85.33z"]
};
var faOm = {
prefix: 'fas',
iconName: 'om',
icon: [512, 512, [], "f679", "M360.6 60.94a10.43 10.43 0 0 0 14.76 0l21.57-21.56a10.43 10.43 0 0 0 0-14.76L375.35 3.06c-4.08-4.07-10.68-4.07-14.76 0l-21.57 21.56a10.43 10.43 0 0 0 0 14.76l21.58 21.56zM412.11 192c-26.69 0-51.77 10.39-70.64 29.25l-24.25 24.25c-6.78 6.77-15.78 10.5-25.38 10.5H245c10.54-22.1 14.17-48.11 7.73-75.23-10.1-42.55-46.36-76.11-89.52-83.19-36.15-5.93-70.9 5.04-96.01 28.78-7.36 6.96-6.97 18.85 1.12 24.93l26.15 19.63c5.72 4.3 13.66 4.32 19.2-.21 8.45-6.9 19.02-10.71 30.27-10.71 26.47 0 48.01 21.53 48.01 48s-21.54 48-48.01 48h-31.9c-11.96 0-19.74 12.58-14.39 23.28l16.09 32.17c2.53 5.06 7.6 8.1 13.17 8.55h33.03c35.3 0 64.01 28.7 64.01 64s-28.71 64-64.01 64c-96.02 0-122.35-54.02-145.15-92.03-4.53-7.55-14.77-3.58-14.79 5.22C-.09 416 41.13 512 159.94 512c70.59 0 128.02-57.42 128.02-128 0-23.42-6.78-45.1-17.81-64h21.69c26.69 0 51.77-10.39 70.64-29.25l24.25-24.25c6.78-6.77 15.78-10.5 25.38-10.5 19.78 0 35.88 16.09 35.88 35.88V392c0 13.23-18.77 24-32.01 24-39.4 0-66.67-24.24-81.82-42.89-4.77-5.87-14.2-2.54-14.2 5.02V416s0 64 96.02 64c48.54 0 96.02-39.47 96.02-88V291.88c0-55.08-44.8-99.88-99.89-99.88zm42.18-124.73c-85.55 65.12-169.05 2.75-172.58.05-6.02-4.62-14.44-4.38-20.14.55-5.74 4.92-7.27 13.17-3.66 19.8 1.61 2.95 40.37 72.34 118.8 72.34 79.92 0 98.78-31.36 101.75-37.66 1.02-2.12 1.53-4.47 1.53-6.83V80c0-13.22-15.14-20.69-25.7-12.73z"]
};
var faOtter = {
prefix: 'fas',
iconName: 'otter',
icon: [640, 512, [], "f700", "M608 32h-32l-13.25-13.25A63.97 63.97 0 0 0 517.49 0H497c-11.14 0-22.08 2.91-31.75 8.43L312 96h-56C149.96 96 64 181.96 64 288v1.61c0 32.75-16 62.14-39.56 84.89-18.19 17.58-28.1 43.68-23.19 71.8 6.76 38.8 42.9 65.7 82.28 65.7H192c17.67 0 32-14.33 32-32s-14.33-32-32-32H80c-8.83 0-16-7.17-16-16s7.17-16 16-16h224c8.84 0 16-7.16 16-16v-16c0-17.67-14.33-32-32-32h-64l149.49-80.5L448 416h80c8.84 0 16-7.16 16-16v-16c0-17.67-14.33-32-32-32h-28.22l-55.11-110.21L521.14 192H544c53.02 0 96-42.98 96-96V64c0-17.67-14.33-32-32-32zm-96 16c8.84 0 16 7.16 16 16s-7.16 16-16 16-16-7.16-16-16 7.16-16 16-16zm32 96h-34.96L407.2 198.84l-13.77-27.55L512 112h77.05c-6.62 18.58-24.22 32-45.05 32z"]
};
var faOutdent = {
prefix: 'fas',
iconName: 'outdent',
icon: [448, 512, [], "f03b", "M100.69 363.29c10 10 27.31 2.93 27.31-11.31V160c0-14.32-17.33-21.31-27.31-11.31l-96 96a16 16 0 0 0 0 22.62zM432 416H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm3.17-128H204.83A12.82 12.82 0 0 0 192 300.83v38.34A12.82 12.82 0 0 0 204.83 352h230.34A12.82 12.82 0 0 0 448 339.17v-38.34A12.82 12.82 0 0 0 435.17 288zm0-128H204.83A12.82 12.82 0 0 0 192 172.83v38.34A12.82 12.82 0 0 0 204.83 224h230.34A12.82 12.82 0 0 0 448 211.17v-38.34A12.82 12.82 0 0 0 435.17 160zM432 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faPager = {
prefix: 'fas',
iconName: 'pager',
icon: [512, 512, [], "f815", "M448 64H64a64 64 0 0 0-64 64v256a64 64 0 0 0 64 64h384a64 64 0 0 0 64-64V128a64 64 0 0 0-64-64zM160 368H80a16 16 0 0 1-16-16v-16a16 16 0 0 1 16-16h80zm128-16a16 16 0 0 1-16 16h-80v-48h80a16 16 0 0 1 16 16zm160-128a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32v-64a32 32 0 0 1 32-32h320a32 32 0 0 1 32 32z"]
};
var faPaintBrush = {
prefix: 'fas',
iconName: 'paint-brush',
icon: [512, 512, [], "f1fc", "M167.02 309.34c-40.12 2.58-76.53 17.86-97.19 72.3-2.35 6.21-8 9.98-14.59 9.98-11.11 0-45.46-27.67-55.25-34.35C0 439.62 37.93 512 128 512c75.86 0 128-43.77 128-120.19 0-3.11-.65-6.08-.97-9.13l-88.01-73.34zM457.89 0c-15.16 0-29.37 6.71-40.21 16.45C213.27 199.05 192 203.34 192 257.09c0 13.7 3.25 26.76 8.73 38.7l63.82 53.18c7.21 1.8 14.64 3.03 22.39 3.03 62.11 0 98.11-45.47 211.16-256.46 7.38-14.35 13.9-29.85 13.9-45.99C512 20.64 486 0 457.89 0z"]
};
var faPaintRoller = {
prefix: 'fas',
iconName: 'paint-roller',
icon: [512, 512, [], "f5aa", "M416 128V32c0-17.67-14.33-32-32-32H32C14.33 0 0 14.33 0 32v96c0 17.67 14.33 32 32 32h352c17.67 0 32-14.33 32-32zm32-64v128c0 17.67-14.33 32-32 32H256c-35.35 0-64 28.65-64 64v32c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32V352c0-17.67-14.33-32-32-32v-32h160c53.02 0 96-42.98 96-96v-64c0-35.35-28.65-64-64-64z"]
};
var faPalette = {
prefix: 'fas',
iconName: 'palette',
icon: [512, 512, [], "f53f", "M204.3 5C104.9 24.4 24.8 104.3 5.2 203.4c-37 187 131.7 326.4 258.8 306.7 41.2-6.4 61.4-54.6 42.5-91.7-23.1-45.4 9.9-98.4 60.9-98.4h79.7c35.8 0 64.8-29.6 64.9-65.3C511.5 97.1 368.1-26.9 204.3 5zM96 320c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm32-128c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm128-64c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm128 64c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faPallet = {
prefix: 'fas',
iconName: 'pallet',
icon: [640, 512, [], "f482", "M144 256h352c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16H384v128l-64-32-64 32V0H144c-8.8 0-16 7.2-16 16v224c0 8.8 7.2 16 16 16zm480 128c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h48v64H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h608c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16h-48v-64h48zm-336 64H128v-64h160v64zm224 0H352v-64h160v64z"]
};
var faPaperPlane = {
prefix: 'fas',
iconName: 'paper-plane',
icon: [512, 512, [], "f1d8", "M476 3.2L12.5 270.6c-18.1 10.4-15.8 35.6 2.2 43.2L121 358.4l287.3-253.2c5.5-4.9 13.3 2.6 8.6 8.3L176 407v80.5c0 23.6 28.5 32.9 42.5 15.8L282 426l124.6 52.2c14.2 6 30.4-2.9 33-18.2l72-432C515 7.8 493.3-6.8 476 3.2z"]
};
var faPaperclip = {
prefix: 'fas',
iconName: 'paperclip',
icon: [448, 512, [], "f0c6", "M43.246 466.142c-58.43-60.289-57.341-157.511 1.386-217.581L254.392 34c44.316-45.332 116.351-45.336 160.671 0 43.89 44.894 43.943 117.329 0 162.276L232.214 383.128c-29.855 30.537-78.633 30.111-107.982-.998-28.275-29.97-27.368-77.473 1.452-106.953l143.743-146.835c6.182-6.314 16.312-6.422 22.626-.241l22.861 22.379c6.315 6.182 6.422 16.312.241 22.626L171.427 319.927c-4.932 5.045-5.236 13.428-.648 18.292 4.372 4.634 11.245 4.711 15.688.165l182.849-186.851c19.613-20.062 19.613-52.725-.011-72.798-19.189-19.627-49.957-19.637-69.154 0L90.39 293.295c-34.763 35.56-35.299 93.12-1.191 128.313 34.01 35.093 88.985 35.137 123.058.286l172.06-175.999c6.177-6.319 16.307-6.433 22.626-.256l22.877 22.364c6.319 6.177 6.434 16.307.256 22.626l-172.06 175.998c-59.576 60.938-155.943 60.216-214.77-.485z"]
};
var faParachuteBox = {
prefix: 'fas',
iconName: 'parachute-box',
icon: [512, 512, [], "f4cd", "M511.9 175c-9.1-75.6-78.4-132.4-158.3-158.7C390 55.7 416 116.9 416 192h28.1L327.5 321.5c-2.5-.6-4.8-1.5-7.5-1.5h-48V192h112C384 76.8 315.1 0 256 0S128 76.8 128 192h112v128h-48c-2.7 0-5 .9-7.5 1.5L67.9 192H96c0-75.1 26-136.3 62.4-175.7C78.5 42.7 9.2 99.5.1 175c-1.1 9.1 6.8 17 16 17h8.7l136.7 151.9c-.7 2.6-1.6 5.2-1.6 8.1v128c0 17.7 14.3 32 32 32h128c17.7 0 32-14.3 32-32V352c0-2.9-.9-5.4-1.6-8.1L487.1 192h8.7c9.3 0 17.2-7.8 16.1-17z"]
};
var faParagraph = {
prefix: 'fas',
iconName: 'paragraph',
icon: [448, 512, [], "f1dd", "M448 48v32a16 16 0 0 1-16 16h-48v368a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16V96h-32v368a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16V352h-32a160 160 0 0 1 0-320h240a16 16 0 0 1 16 16z"]
};
var faParking = {
prefix: 'fas',
iconName: 'parking',
icon: [448, 512, [], "f540", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zM240 320h-48v48c0 8.8-7.2 16-16 16h-32c-8.8 0-16-7.2-16-16V144c0-8.8 7.2-16 16-16h96c52.9 0 96 43.1 96 96s-43.1 96-96 96zm0-128h-48v64h48c17.6 0 32-14.4 32-32s-14.4-32-32-32z"]
};
var faPassport = {
prefix: 'fas',
iconName: 'passport',
icon: [448, 512, [], "f5ab", "M129.62 176h39.09c1.49-27.03 6.54-51.35 14.21-70.41-27.71 13.24-48.02 39.19-53.3 70.41zm0 32c5.29 31.22 25.59 57.17 53.3 70.41-7.68-19.06-12.72-43.38-14.21-70.41h-39.09zM224 286.69c7.69-7.45 20.77-34.42 23.43-78.69h-46.87c2.67 44.26 15.75 71.24 23.44 78.69zM200.57 176h46.87c-2.66-44.26-15.74-71.24-23.43-78.69-7.7 7.45-20.78 34.43-23.44 78.69zm64.51 102.41c27.71-13.24 48.02-39.19 53.3-70.41h-39.09c-1.49 27.03-6.53 51.35-14.21 70.41zM416 0H64C28.65 0 0 28.65 0 64v384c0 35.35 28.65 64 64 64h352c17.67 0 32-14.33 32-32V32c0-17.67-14.33-32-32-32zm-80 416H112c-8.8 0-16-7.2-16-16s7.2-16 16-16h224c8.8 0 16 7.2 16 16s-7.2 16-16 16zm-112-96c-70.69 0-128-57.31-128-128S153.31 64 224 64s128 57.31 128 128-57.31 128-128 128zm41.08-214.41c7.68 19.06 12.72 43.38 14.21 70.41h39.09c-5.28-31.22-25.59-57.17-53.3-70.41z"]
};
var faPastafarianism = {
prefix: 'fas',
iconName: 'pastafarianism',
icon: [640, 512, [], "f67b", "M624.54 347.67c-32.7-12.52-57.36 4.25-75.37 16.45-17.06 11.53-23.25 14.42-31.41 11.36-8.12-3.09-10.83-9.38-15.89-29.38-3.33-13.15-7.44-29.32-17.95-42.65 2.24-2.91 4.43-5.79 6.38-8.57C500.47 304.45 513.71 312 532 312c33.95 0 50.87-25.78 62.06-42.83 10.59-16.14 15-21.17 21.94-21.17 13.25 0 24-10.75 24-24s-10.75-24-24-24c-33.95 0-50.87 25.78-62.06 42.83-10.6 16.14-15 21.17-21.94 21.17-17.31 0-37.48-61.43-97.26-101.91l17.25-34.5C485.43 125.5 512 97.98 512 64c0-35.35-28.65-64-64-64s-64 28.65-64 64c0 13.02 3.94 25.1 10.62 35.21l-18.15 36.3c-16.98-4.6-35.6-7.51-56.46-7.51s-39.49 2.91-56.46 7.51l-18.15-36.3C252.06 89.1 256 77.02 256 64c0-35.35-28.65-64-64-64s-64 28.65-64 64c0 33.98 26.56 61.5 60.02 63.6l17.25 34.5C145.68 202.44 125.15 264 108 264c-6.94 0-11.34-5.03-21.94-21.17C74.88 225.78 57.96 200 24 200c-13.25 0-24 10.75-24 24s10.75 24 24 24c6.94 0 11.34 5.03 21.94 21.17C57.13 286.22 74.05 312 108 312c18.29 0 31.53-7.55 41.7-17.11 1.95 2.79 4.14 5.66 6.38 8.57-10.51 13.33-14.62 29.5-17.95 42.65-5.06 20-7.77 26.28-15.89 29.38-8.11 3.06-14.33.17-31.41-11.36-18.03-12.2-42.72-28.92-75.37-16.45-12.39 4.72-18.59 18.58-13.87 30.97 4.72 12.41 18.61 18.61 30.97 13.88 8.16-3.09 14.34-.19 31.39 11.36 13.55 9.16 30.83 20.86 52.42 20.84 7.17 0 14.83-1.28 22.97-4.39 32.66-12.44 39.98-41.33 45.33-62.44 2.21-8.72 3.99-14.49 5.95-18.87 16.62 13.61 36.95 25.88 61.64 34.17-9.96 37-32.18 90.8-60.26 90.8-13.25 0-24 10.75-24 24s10.75 24 24 24c66.74 0 97.05-88.63 107.42-129.14 6.69.6 13.42 1.14 20.58 1.14s13.89-.54 20.58-1.14C350.95 423.37 381.26 512 448 512c13.25 0 24-10.75 24-24s-10.75-24-24-24c-27.94 0-50.21-53.81-60.22-90.81 24.69-8.29 45-20.56 61.62-34.16 1.96 4.38 3.74 10.15 5.95 18.87 5.34 21.11 12.67 50 45.33 62.44 8.14 3.11 15.8 4.39 22.97 4.39 21.59 0 38.87-11.69 52.42-20.84 17.05-11.55 23.28-14.45 31.39-11.36 12.39 4.75 26.27-1.47 30.97-13.88 4.71-12.4-1.49-26.26-13.89-30.98zM448 48c8.82 0 16 7.18 16 16s-7.18 16-16 16-16-7.18-16-16 7.18-16 16-16zm-256 0c8.82 0 16 7.18 16 16s-7.18 16-16 16-16-7.18-16-16 7.18-16 16-16z"]
};
var faPaste = {
prefix: 'fas',
iconName: 'paste',
icon: [448, 512, [], "f0ea", "M128 184c0-30.879 25.122-56 56-56h136V56c0-13.255-10.745-24-24-24h-80.61C204.306 12.89 183.637 0 160 0s-44.306 12.89-55.39 32H24C10.745 32 0 42.745 0 56v336c0 13.255 10.745 24 24 24h104V184zm32-144c13.255 0 24 10.745 24 24s-10.745 24-24 24-24-10.745-24-24 10.745-24 24-24zm184 248h104v200c0 13.255-10.745 24-24 24H184c-13.255 0-24-10.745-24-24V184c0-13.255 10.745-24 24-24h136v104c0 13.2 10.8 24 24 24zm104-38.059V256h-96v-96h6.059a24 24 0 0 1 16.97 7.029l65.941 65.941a24.002 24.002 0 0 1 7.03 16.971z"]
};
var faPause = {
prefix: 'fas',
iconName: 'pause',
icon: [448, 512, [], "f04c", "M144 479H48c-26.5 0-48-21.5-48-48V79c0-26.5 21.5-48 48-48h96c26.5 0 48 21.5 48 48v352c0 26.5-21.5 48-48 48zm304-48V79c0-26.5-21.5-48-48-48h-96c-26.5 0-48 21.5-48 48v352c0 26.5 21.5 48 48 48h96c26.5 0 48-21.5 48-48z"]
};
var faPauseCircle = {
prefix: 'fas',
iconName: 'pause-circle',
icon: [512, 512, [], "f28b", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm-16 328c0 8.8-7.2 16-16 16h-48c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h48c8.8 0 16 7.2 16 16v160zm112 0c0 8.8-7.2 16-16 16h-48c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h48c8.8 0 16 7.2 16 16v160z"]
};
var faPaw = {
prefix: 'fas',
iconName: 'paw',
icon: [512, 512, [], "f1b0", "M256 224c-79.41 0-192 122.76-192 200.25 0 34.9 26.81 55.75 71.74 55.75 48.84 0 81.09-25.08 120.26-25.08 39.51 0 71.85 25.08 120.26 25.08 44.93 0 71.74-20.85 71.74-55.75C448 346.76 335.41 224 256 224zm-147.28-12.61c-10.4-34.65-42.44-57.09-71.56-50.13-29.12 6.96-44.29 40.69-33.89 75.34 10.4 34.65 42.44 57.09 71.56 50.13 29.12-6.96 44.29-40.69 33.89-75.34zm84.72-20.78c30.94-8.14 46.42-49.94 34.58-93.36s-46.52-72.01-77.46-63.87-46.42 49.94-34.58 93.36c11.84 43.42 46.53 72.02 77.46 63.87zm281.39-29.34c-29.12-6.96-61.15 15.48-71.56 50.13-10.4 34.65 4.77 68.38 33.89 75.34 29.12 6.96 61.15-15.48 71.56-50.13 10.4-34.65-4.77-68.38-33.89-75.34zm-156.27 29.34c30.94 8.14 65.62-20.45 77.46-63.87 11.84-43.42-3.64-85.21-34.58-93.36s-65.62 20.45-77.46 63.87c-11.84 43.42 3.64 85.22 34.58 93.36z"]
};
var faPeace = {
prefix: 'fas',
iconName: 'peace',
icon: [496, 512, [], "f67c", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm184 248c0 31.93-8.2 61.97-22.57 88.17L280 240.63V74.97c86.23 15.21 152 90.5 152 181.03zM216 437.03c-33.86-5.97-64.49-21.2-89.29-43.02L216 322.57v114.46zm64-114.46L369.29 394c-24.8 21.82-55.43 37.05-89.29 43.02V322.57zm-64-247.6v165.66L86.57 344.17C72.2 317.97 64 287.93 64 256c0-90.53 65.77-165.82 152-181.03z"]
};
var faPen = {
prefix: 'fas',
iconName: 'pen',
icon: [512, 512, [], "f304", "M290.74 93.24l128.02 128.02-277.99 277.99-114.14 12.6C11.35 513.54-1.56 500.62.14 485.34l12.7-114.22 277.9-277.88zm207.2-19.06l-60.11-60.11c-18.75-18.75-49.16-18.75-67.91 0l-56.55 56.55 128.02 128.02 56.55-56.55c18.75-18.76 18.75-49.16 0-67.91z"]
};
var faPenAlt = {
prefix: 'fas',
iconName: 'pen-alt',
icon: [512, 512, [], "f305", "M497.94 74.17l-60.11-60.11c-18.75-18.75-49.16-18.75-67.91 0l-56.55 56.55 128.02 128.02 56.55-56.55c18.75-18.75 18.75-49.15 0-67.91zm-246.8-20.53c-15.62-15.62-40.94-15.62-56.56 0L75.8 172.43c-6.25 6.25-6.25 16.38 0 22.62l22.63 22.63c6.25 6.25 16.38 6.25 22.63 0l101.82-101.82 22.63 22.62L93.95 290.03A327.038 327.038 0 0 0 .17 485.11l-.03.23c-1.7 15.28 11.21 28.2 26.49 26.51a327.02 327.02 0 0 0 195.34-93.8l196.79-196.79-82.77-82.77-84.85-84.85z"]
};
var faPenFancy = {
prefix: 'fas',
iconName: 'pen-fancy',
icon: [512, 512, [], "f5ac", "M79.18 282.94a32.005 32.005 0 0 0-20.24 20.24L0 480l4.69 4.69 92.89-92.89c-.66-2.56-1.57-5.03-1.57-7.8 0-17.67 14.33-32 32-32s32 14.33 32 32-14.33 32-32 32c-2.77 0-5.24-.91-7.8-1.57l-92.89 92.89L32 512l176.82-58.94a31.983 31.983 0 0 0 20.24-20.24l33.07-84.07-98.88-98.88-84.07 33.07zM369.25 28.32L186.14 227.81l97.85 97.85 199.49-183.11C568.4 67.48 443.73-55.94 369.25 28.32z"]
};
var faPenNib = {
prefix: 'fas',
iconName: 'pen-nib',
icon: [512, 512, [], "f5ad", "M136.6 138.79a64.003 64.003 0 0 0-43.31 41.35L0 460l14.69 14.69L164.8 324.58c-2.99-6.26-4.8-13.18-4.8-20.58 0-26.51 21.49-48 48-48s48 21.49 48 48-21.49 48-48 48c-7.4 0-14.32-1.81-20.58-4.8L37.31 497.31 52 512l279.86-93.29a64.003 64.003 0 0 0 41.35-43.31L416 224 288 96l-151.4 42.79zm361.34-64.62l-60.11-60.11c-18.75-18.75-49.16-18.75-67.91 0l-56.55 56.55 128.02 128.02 56.55-56.55c18.75-18.75 18.75-49.15 0-67.91z"]
};
var faPenSquare = {
prefix: 'fas',
iconName: 'pen-square',
icon: [448, 512, [], "f14b", "M400 480H48c-26.5 0-48-21.5-48-48V80c0-26.5 21.5-48 48-48h352c26.5 0 48 21.5 48 48v352c0 26.5-21.5 48-48 48zM238.1 177.9L102.4 313.6l-6.3 57.1c-.8 7.6 5.6 14.1 13.3 13.3l57.1-6.3L302.2 242c2.3-2.3 2.3-6.1 0-8.5L246.7 178c-2.5-2.4-6.3-2.4-8.6-.1zM345 165.1L314.9 135c-9.4-9.4-24.6-9.4-33.9 0l-23.1 23.1c-2.3 2.3-2.3 6.1 0 8.5l55.5 55.5c2.3 2.3 6.1 2.3 8.5 0L345 199c9.3-9.3 9.3-24.5 0-33.9z"]
};
var faPencilAlt = {
prefix: 'fas',
iconName: 'pencil-alt',
icon: [512, 512, [], "f303", "M497.9 142.1l-46.1 46.1c-4.7 4.7-12.3 4.7-17 0l-111-111c-4.7-4.7-4.7-12.3 0-17l46.1-46.1c18.7-18.7 49.1-18.7 67.9 0l60.1 60.1c18.8 18.7 18.8 49.1 0 67.9zM284.2 99.8L21.6 362.4.4 483.9c-2.9 16.4 11.4 30.6 27.8 27.8l121.5-21.3 262.6-262.6c4.7-4.7 4.7-12.3 0-17l-111-111c-4.8-4.7-12.4-4.7-17.1 0zM124.1 339.9c-5.5-5.5-5.5-14.3 0-19.8l154-154c5.5-5.5 14.3-5.5 19.8 0s5.5 14.3 0 19.8l-154 154c-5.5 5.5-14.3 5.5-19.8 0zM88 424h48v36.3l-64.5 11.3-31.1-31.1L51.7 376H88v48z"]
};
var faPencilRuler = {
prefix: 'fas',
iconName: 'pencil-ruler',
icon: [512, 512, [], "f5ae", "M109.46 244.04l134.58-134.56-44.12-44.12-61.68 61.68a7.919 7.919 0 0 1-11.21 0l-11.21-11.21c-3.1-3.1-3.1-8.12 0-11.21l61.68-61.68-33.64-33.65C131.47-3.1 111.39-3.1 99 9.29L9.29 99c-12.38 12.39-12.39 32.47 0 44.86l100.17 100.18zm388.47-116.8c18.76-18.76 18.75-49.17 0-67.93l-45.25-45.25c-18.76-18.76-49.18-18.76-67.95 0l-46.02 46.01 113.2 113.2 46.02-46.03zM316.08 82.71l-297 296.96L.32 487.11c-2.53 14.49 10.09 27.11 24.59 24.56l107.45-18.84L429.28 195.9 316.08 82.71zm186.63 285.43l-33.64-33.64-61.68 61.68c-3.1 3.1-8.12 3.1-11.21 0l-11.21-11.21c-3.09-3.1-3.09-8.12 0-11.21l61.68-61.68-44.14-44.14L267.93 402.5l100.21 100.2c12.39 12.39 32.47 12.39 44.86 0l89.71-89.7c12.39-12.39 12.39-32.47 0-44.86z"]
};
var faPeopleArrows = {
prefix: 'fas',
iconName: 'people-arrows',
icon: [576, 512, [], "e068", "M96,128A64,64,0,1,0,32,64,64,64,0,0,0,96,128Zm0,176.08a44.11,44.11,0,0,1,13.64-32L181.77,204c1.65-1.55,3.77-2.31,5.61-3.57A63.91,63.91,0,0,0,128,160H64A64,64,0,0,0,0,224v96a32,32,0,0,0,32,32V480a32,32,0,0,0,32,32h64a32,32,0,0,0,32-32V383.61l-50.36-47.53A44.08,44.08,0,0,1,96,304.08ZM480,128a64,64,0,1,0-64-64A64,64,0,0,0,480,128Zm32,32H448a63.91,63.91,0,0,0-59.38,40.42c1.84,1.27,4,2,5.62,3.59l72.12,68.06a44.37,44.37,0,0,1,0,64L416,383.62V480a32,32,0,0,0,32,32h64a32,32,0,0,0,32-32V352a32,32,0,0,0,32-32V224A64,64,0,0,0,512,160ZM444.4,295.34l-72.12-68.06A12,12,0,0,0,352,236v36H224V236a12,12,0,0,0-20.28-8.73L131.6,295.34a12.4,12.4,0,0,0,0,17.47l72.12,68.07A12,12,0,0,0,224,372.14V336H352v36.14a12,12,0,0,0,20.28,8.74l72.12-68.07A12.4,12.4,0,0,0,444.4,295.34Z"]
};
var faPeopleCarry = {
prefix: 'fas',
iconName: 'people-carry',
icon: [640, 512, [], "f4ce", "M128 96c26.5 0 48-21.5 48-48S154.5 0 128 0 80 21.5 80 48s21.5 48 48 48zm384 0c26.5 0 48-21.5 48-48S538.5 0 512 0s-48 21.5-48 48 21.5 48 48 48zm125.7 372.1l-44-110-41.1 46.4-2 18.2 27.7 69.2c5 12.5 17 20.1 29.7 20.1 4 0 8-.7 11.9-2.3 16.4-6.6 24.4-25.2 17.8-41.6zm-34.2-209.8L585 178.1c-4.6-20-18.6-36.8-37.5-44.9-18.5-8-39-6.7-56.1 3.3-22.7 13.4-39.7 34.5-48.1 59.4L432 229.8 416 240v-96c0-8.8-7.2-16-16-16H240c-8.8 0-16 7.2-16 16v96l-16.1-10.2-11.3-33.9c-8.3-25-25.4-46-48.1-59.4-17.2-10-37.6-11.3-56.1-3.3-18.9 8.1-32.9 24.9-37.5 44.9l-18.4 80.2c-4.6 20 .7 41.2 14.4 56.7l67.2 75.9 10.1 92.6C130 499.8 143.8 512 160 512c1.2 0 2.3-.1 3.5-.2 17.6-1.9 30.2-17.7 28.3-35.3l-10.1-92.8c-1.5-13-6.9-25.1-15.6-35l-43.3-49 17.6-70.3 6.8 20.4c4.1 12.5 11.9 23.4 24.5 32.6l51.1 32.5c4.6 2.9 12.1 4.6 17.2 5h160c5.1-.4 12.6-2.1 17.2-5l51.1-32.5c12.6-9.2 20.4-20 24.5-32.6l6.8-20.4 17.6 70.3-43.3 49c-8.7 9.9-14.1 22-15.6 35l-10.1 92.8c-1.9 17.6 10.8 33.4 28.3 35.3 1.2.1 2.3.2 3.5.2 16.1 0 30-12.1 31.8-28.5l10.1-92.6 67.2-75.9c13.6-15.5 19-36.7 14.4-56.7zM46.3 358.1l-44 110c-6.6 16.4 1.4 35 17.8 41.6 16.8 6.6 35.1-1.7 41.6-17.8l27.7-69.2-2-18.2-41.1-46.4z"]
};
var faPepperHot = {
prefix: 'fas',
iconName: 'pepper-hot',
icon: [512, 512, [], "f816", "M330.67 263.12V173.4l-52.75-24.22C219.44 218.76 197.58 400 56 400a56 56 0 0 0 0 112c212.64 0 370.65-122.87 419.18-210.34l-37.05-38.54zm131.09-128.37C493.92 74.91 477.18 26.48 458.62 3a8 8 0 0 0-11.93-.59l-22.9 23a8.06 8.06 0 0 0-.89 10.23c6.86 10.36 17.05 35.1-1.4 72.32A142.85 142.85 0 0 0 364.34 96c-28 0-54 8.54-76.34 22.59l74.67 34.29v78.24h89.09L506.44 288c3.26-12.62 5.56-25.63 5.56-39.31a154 154 0 0 0-50.24-113.94z"]
};
var faPercent = {
prefix: 'fas',
iconName: 'percent',
icon: [448, 512, [], "f295", "M112 224c61.9 0 112-50.1 112-112S173.9 0 112 0 0 50.1 0 112s50.1 112 112 112zm0-160c26.5 0 48 21.5 48 48s-21.5 48-48 48-48-21.5-48-48 21.5-48 48-48zm224 224c-61.9 0-112 50.1-112 112s50.1 112 112 112 112-50.1 112-112-50.1-112-112-112zm0 160c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zM392.3.2l31.6-.1c19.4-.1 30.9 21.8 19.7 37.8L77.4 501.6a23.95 23.95 0 0 1-19.6 10.2l-33.4.1c-19.5 0-30.9-21.9-19.7-37.8l368-463.7C377.2 4 384.5.2 392.3.2z"]
};
var faPercentage = {
prefix: 'fas',
iconName: 'percentage',
icon: [384, 512, [], "f541", "M109.25 173.25c24.99-24.99 24.99-65.52 0-90.51-24.99-24.99-65.52-24.99-90.51 0-24.99 24.99-24.99 65.52 0 90.51 25 25 65.52 25 90.51 0zm256 165.49c-24.99-24.99-65.52-24.99-90.51 0-24.99 24.99-24.99 65.52 0 90.51 24.99 24.99 65.52 24.99 90.51 0 25-24.99 25-65.51 0-90.51zm-1.94-231.43l-22.62-22.62c-12.5-12.5-32.76-12.5-45.25 0L20.69 359.44c-12.5 12.5-12.5 32.76 0 45.25l22.62 22.62c12.5 12.5 32.76 12.5 45.25 0l274.75-274.75c12.5-12.49 12.5-32.75 0-45.25z"]
};
var faPersonBooth = {
prefix: 'fas',
iconName: 'person-booth',
icon: [576, 512, [], "f756", "M192 496c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320h-64v176zm32-272h-50.9l-45.2-45.3C115.8 166.6 99.7 160 82.7 160H64c-17.1 0-33.2 6.7-45.3 18.8C6.7 190.9 0 207 0 224.1L.2 320 0 480c0 17.7 14.3 32 31.9 32 17.6 0 32-14.3 32-32l.1-100.7c.9.5 1.6 1.3 2.5 1.7l29.1 43v56c0 17.7 14.3 32 32 32s32-14.3 32-32v-56.5c0-9.9-2.3-19.8-6.7-28.6l-41.2-61.3V253l20.9 20.9c9.1 9.1 21.1 14.1 33.9 14.1H224c17.7 0 32-14.3 32-32s-14.3-32-32-32zM64 128c26.5 0 48-21.5 48-48S90.5 32 64 32 16 53.5 16 80s21.5 48 48 48zm224-96l31.5 223.1-30.9 154.6c-4.3 21.6 13 38.3 31.4 38.3 15.2 0 28-9.1 32.3-30.4.9 16.9 14.6 30.4 31.7 30.4 17.7 0 32-14.3 32-32 0 17.7 14.3 32 32 32s32-14.3 32-32V0H288v32zm-96 0v160h64V0h-32c-17.7 0-32 14.3-32 32zM544 0h-32v496c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V32c0-17.7-14.3-32-32-32z"]
};
var faPhone = {
prefix: 'fas',
iconName: 'phone',
icon: [512, 512, [], "f095", "M493.4 24.6l-104-24c-11.3-2.6-22.9 3.3-27.5 13.9l-48 112c-4.2 9.8-1.4 21.3 6.9 28l60.6 49.6c-36 76.7-98.9 140.5-177.2 177.2l-49.6-60.6c-6.8-8.3-18.2-11.1-28-6.9l-112 48C3.9 366.5-2 378.1.6 389.4l24 104C27.1 504.2 36.7 512 48 512c256.1 0 464-207.5 464-464 0-11.2-7.7-20.9-18.6-23.4z"]
};
var faPhoneAlt = {
prefix: 'fas',
iconName: 'phone-alt',
icon: [512, 512, [], "f879", "M497.39 361.8l-112-48a24 24 0 0 0-28 6.9l-49.6 60.6A370.66 370.66 0 0 1 130.6 204.11l60.6-49.6a23.94 23.94 0 0 0 6.9-28l-48-112A24.16 24.16 0 0 0 122.6.61l-104 24A24 24 0 0 0 0 48c0 256.5 207.9 464 464 464a24 24 0 0 0 23.4-18.6l24-104a24.29 24.29 0 0 0-14.01-27.6z"]
};
var faPhoneSlash = {
prefix: 'fas',
iconName: 'phone-slash',
icon: [640, 512, [], "f3dd", "M268.2 381.4l-49.6-60.6c-6.8-8.3-18.2-11.1-28-6.9l-112 48c-10.7 4.6-16.5 16.1-13.9 27.5l24 104c2.5 10.8 12.1 18.6 23.4 18.6 100.7 0 193.7-32.4 269.7-86.9l-80-61.8c-10.9 6.5-22.1 12.7-33.6 18.1zm365.6 76.7L475.1 335.5C537.9 256.4 576 156.9 576 48c0-11.2-7.7-20.9-18.6-23.4l-104-24c-11.3-2.6-22.9 3.3-27.5 13.9l-48 112c-4.2 9.8-1.4 21.3 6.9 28l60.6 49.6c-12.2 26.1-27.9 50.3-46 72.8L45.5 3.4C38.5-2 28.5-.8 23 6.2L3.4 31.4c-5.4 7-4.2 17 2.8 22.4l588.4 454.7c7 5.4 17 4.2 22.5-2.8l19.6-25.3c5.4-6.8 4.1-16.9-2.9-22.3z"]
};
var faPhoneSquare = {
prefix: 'fas',
iconName: 'phone-square',
icon: [448, 512, [], "f098", "M400 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zM94 416c-7.033 0-13.057-4.873-14.616-11.627l-14.998-65a15 15 0 0 1 8.707-17.16l69.998-29.999a15 15 0 0 1 17.518 4.289l30.997 37.885c48.944-22.963 88.297-62.858 110.781-110.78l-37.886-30.997a15.001 15.001 0 0 1-4.289-17.518l30-69.998a15 15 0 0 1 17.16-8.707l65 14.998A14.997 14.997 0 0 1 384 126c0 160.292-129.945 290-290 290z"]
};
var faPhoneSquareAlt = {
prefix: 'fas',
iconName: 'phone-square-alt',
icon: [448, 512, [], "f87b", "M400 32H48A48 48 0 0 0 0 80v352a48 48 0 0 0 48 48h352a48 48 0 0 0 48-48V80a48 48 0 0 0-48-48zm-16.39 307.37l-15 65A15 15 0 0 1 354 416C194 416 64 286.29 64 126a15.7 15.7 0 0 1 11.63-14.61l65-15A18.23 18.23 0 0 1 144 96a16.27 16.27 0 0 1 13.79 9.09l30 70A17.9 17.9 0 0 1 189 181a17 17 0 0 1-5.5 11.61l-37.89 31a231.91 231.91 0 0 0 110.78 110.78l31-37.89A17 17 0 0 1 299 291a17.85 17.85 0 0 1 5.91 1.21l70 30A16.25 16.25 0 0 1 384 336a17.41 17.41 0 0 1-.39 3.37z"]
};
var faPhoneVolume = {
prefix: 'fas',
iconName: 'phone-volume',
icon: [384, 512, [], "f2a0", "M97.333 506.966c-129.874-129.874-129.681-340.252 0-469.933 5.698-5.698 14.527-6.632 21.263-2.422l64.817 40.513a17.187 17.187 0 0 1 6.849 20.958l-32.408 81.021a17.188 17.188 0 0 1-17.669 10.719l-55.81-5.58c-21.051 58.261-20.612 122.471 0 179.515l55.811-5.581a17.188 17.188 0 0 1 17.669 10.719l32.408 81.022a17.188 17.188 0 0 1-6.849 20.958l-64.817 40.513a17.19 17.19 0 0 1-21.264-2.422zM247.126 95.473c11.832 20.047 11.832 45.008 0 65.055-3.95 6.693-13.108 7.959-18.718 2.581l-5.975-5.726c-3.911-3.748-4.793-9.622-2.261-14.41a32.063 32.063 0 0 0 0-29.945c-2.533-4.788-1.65-10.662 2.261-14.41l5.975-5.726c5.61-5.378 14.768-4.112 18.718 2.581zm91.787-91.187c60.14 71.604 60.092 175.882 0 247.428-4.474 5.327-12.53 5.746-17.552.933l-5.798-5.557c-4.56-4.371-4.977-11.529-.93-16.379 49.687-59.538 49.646-145.933 0-205.422-4.047-4.85-3.631-12.008.93-16.379l5.798-5.557c5.022-4.813 13.078-4.394 17.552.933zm-45.972 44.941c36.05 46.322 36.108 111.149 0 157.546-4.39 5.641-12.697 6.251-17.856 1.304l-5.818-5.579c-4.4-4.219-4.998-11.095-1.285-15.931 26.536-34.564 26.534-82.572 0-117.134-3.713-4.836-3.115-11.711 1.285-15.931l5.818-5.579c5.159-4.947 13.466-4.337 17.856 1.304z"]
};
var faPhotoVideo = {
prefix: 'fas',
iconName: 'photo-video',
icon: [640, 512, [], "f87c", "M608 0H160a32 32 0 0 0-32 32v96h160V64h192v320h128a32 32 0 0 0 32-32V32a32 32 0 0 0-32-32zM232 103a9 9 0 0 1-9 9h-30a9 9 0 0 1-9-9V73a9 9 0 0 1 9-9h30a9 9 0 0 1 9 9zm352 208a9 9 0 0 1-9 9h-30a9 9 0 0 1-9-9v-30a9 9 0 0 1 9-9h30a9 9 0 0 1 9 9zm0-104a9 9 0 0 1-9 9h-30a9 9 0 0 1-9-9v-30a9 9 0 0 1 9-9h30a9 9 0 0 1 9 9zm0-104a9 9 0 0 1-9 9h-30a9 9 0 0 1-9-9V73a9 9 0 0 1 9-9h30a9 9 0 0 1 9 9zm-168 57H32a32 32 0 0 0-32 32v288a32 32 0 0 0 32 32h384a32 32 0 0 0 32-32V192a32 32 0 0 0-32-32zM96 224a32 32 0 1 1-32 32 32 32 0 0 1 32-32zm288 224H64v-32l64-64 32 32 128-128 96 96z"]
};
var faPiggyBank = {
prefix: 'fas',
iconName: 'piggy-bank',
icon: [576, 512, [], "f4d3", "M560 224h-29.5c-8.8-20-21.6-37.7-37.4-52.5L512 96h-32c-29.4 0-55.4 13.5-73 34.3-7.6-1.1-15.1-2.3-23-2.3H256c-77.4 0-141.9 55-156.8 128H56c-14.8 0-26.5-13.5-23.5-28.8C34.7 215.8 45.4 208 57 208h1c3.3 0 6-2.7 6-6v-20c0-3.3-2.7-6-6-6-28.5 0-53.9 20.4-57.5 48.6C-3.9 258.8 22.7 288 56 288h40c0 52.2 25.4 98.1 64 127.3V496c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16v-48h128v48c0 8.8 7.2 16 16 16h64c8.8 0 16-7.2 16-16v-80.7c11.8-8.9 22.3-19.4 31.3-31.3H560c8.8 0 16-7.2 16-16V240c0-8.8-7.2-16-16-16zm-128 64c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zM256 96h128c5.4 0 10.7.4 15.9.8 0-.3.1-.5.1-.8 0-53-43-96-96-96s-96 43-96 96c0 2.1.5 4.1.6 6.2 15.2-3.9 31-6.2 47.4-6.2z"]
};
var faPills = {
prefix: 'fas',
iconName: 'pills',
icon: [576, 512, [], "f484", "M112 32C50.1 32 0 82.1 0 144v224c0 61.9 50.1 112 112 112s112-50.1 112-112V144c0-61.9-50.1-112-112-112zm48 224H64V144c0-26.5 21.5-48 48-48s48 21.5 48 48v112zm139.7-29.7c-3.5-3.5-9.4-3.1-12.3.8-45.3 62.5-40.4 150.1 15.9 206.4 56.3 56.3 143.9 61.2 206.4 15.9 4-2.9 4.3-8.8.8-12.3L299.7 226.3zm229.8-19c-56.3-56.3-143.9-61.2-206.4-15.9-4 2.9-4.3 8.8-.8 12.3l210.8 210.8c3.5 3.5 9.4 3.1 12.3-.8 45.3-62.6 40.5-150.1-15.9-206.4z"]
};
var faPizzaSlice = {
prefix: 'fas',
iconName: 'pizza-slice',
icon: [512, 512, [], "f818", "M158.87.15c-16.16-1.52-31.2 8.42-35.33 24.12l-14.81 56.27c187.62 5.49 314.54 130.61 322.48 317l56.94-15.78c15.72-4.36 25.49-19.68 23.62-35.9C490.89 165.08 340.78 17.32 158.87.15zm-58.47 112L.55 491.64a16.21 16.21 0 0 0 20 19.75l379-105.1c-4.27-174.89-123.08-292.14-299.15-294.1zM128 416a32 32 0 1 1 32-32 32 32 0 0 1-32 32zm48-152a32 32 0 1 1 32-32 32 32 0 0 1-32 32zm104 104a32 32 0 1 1 32-32 32 32 0 0 1-32 32z"]
};
var faPlaceOfWorship = {
prefix: 'fas',
iconName: 'place-of-worship',
icon: [640, 512, [], "f67f", "M620.61 366.55L512 320v192h112c8.84 0 16-7.16 16-16V395.96a32 32 0 0 0-19.39-29.41zM0 395.96V496c0 8.84 7.16 16 16 16h112V320L19.39 366.55A32 32 0 0 0 0 395.96zm464.46-149.28L416 217.6V102.63c0-8.49-3.37-16.62-9.38-22.63L331.31 4.69c-6.25-6.25-16.38-6.25-22.62 0L233.38 80c-6 6-9.38 14.14-9.38 22.63V217.6l-48.46 29.08A31.997 31.997 0 0 0 160 274.12V512h96v-96c0-35.35 28.66-64 64-64s64 28.65 64 64v96h96V274.12c0-11.24-5.9-21.66-15.54-27.44z"]
};
var faPlane = {
prefix: 'fas',
iconName: 'plane',
icon: [576, 512, [], "f072", "M480 192H365.71L260.61 8.06A16.014 16.014 0 0 0 246.71 0h-65.5c-10.63 0-18.3 10.17-15.38 20.39L214.86 192H112l-43.2-57.6c-3.02-4.03-7.77-6.4-12.8-6.4H16.01C5.6 128-2.04 137.78.49 147.88L32 256 .49 364.12C-2.04 374.22 5.6 384 16.01 384H56c5.04 0 9.78-2.37 12.8-6.4L112 320h102.86l-49.03 171.6c-2.92 10.22 4.75 20.4 15.38 20.4h65.5c5.74 0 11.04-3.08 13.89-8.06L365.71 320H480c35.35 0 96-28.65 96-64s-60.65-64-96-64z"]
};
var faPlaneArrival = {
prefix: 'fas',
iconName: 'plane-arrival',
icon: [640, 512, [], "f5af", "M624 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h608c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM44.81 205.66l88.74 80a62.607 62.607 0 0 0 25.47 13.93l287.6 78.35c26.48 7.21 54.56 8.72 81 1.36 29.67-8.27 43.44-21.21 47.25-35.71 3.83-14.5-1.73-32.71-23.37-54.96-19.28-19.82-44.35-32.79-70.83-40l-97.51-26.56L282.8 30.22c-1.51-5.81-5.95-10.35-11.66-11.91L206.05.58c-10.56-2.88-20.9 5.32-20.71 16.44l47.92 164.21-102.2-27.84-27.59-67.88c-1.93-4.89-6.01-8.57-11.02-9.93L52.72 64.75c-10.34-2.82-20.53 5-20.72 15.88l.23 101.78c.19 8.91 6.03 17.34 12.58 23.25z"]
};
var faPlaneDeparture = {
prefix: 'fas',
iconName: 'plane-departure',
icon: [640, 512, [], "f5b0", "M624 448H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h608c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM80.55 341.27c6.28 6.84 15.1 10.72 24.33 10.71l130.54-.18a65.62 65.62 0 0 0 29.64-7.12l290.96-147.65c26.74-13.57 50.71-32.94 67.02-58.31 18.31-28.48 20.3-49.09 13.07-63.65-7.21-14.57-24.74-25.27-58.25-27.45-29.85-1.94-59.54 5.92-86.28 19.48l-98.51 49.99-218.7-82.06a17.799 17.799 0 0 0-18-1.11L90.62 67.29c-10.67 5.41-13.25 19.65-5.17 28.53l156.22 98.1-103.21 52.38-72.35-36.47a17.804 17.804 0 0 0-16.07.02L9.91 230.22c-10.44 5.3-13.19 19.12-5.57 28.08l76.21 82.97z"]
};
var faPlaneSlash = {
prefix: 'fas',
iconName: 'plane-slash',
icon: [640, 512, [], "e069", "M32.48,147.88,64,256,32.48,364.13A16,16,0,0,0,48,384H88a16,16,0,0,0,12.8-6.41L144,320H246.85l-49,171.59A16,16,0,0,0,213.2,512h65.5a16,16,0,0,0,13.89-8.06l66.6-116.54L34.35,136.34A15.47,15.47,0,0,0,32.48,147.88ZM633.82,458.09,455.14,320H512c35.34,0,96-28.66,96-64s-60.66-64-96-64H397.7L292.61,8.06C290.06,3.61,283.84,0,278.71,0H213.2a16,16,0,0,0-15.38,20.39l36.94,129.29L45.46,3.38A16,16,0,0,0,23,6.19L3.37,31.45A16,16,0,0,0,6.18,53.91L594.54,508.63A16,16,0,0,0,617,505.81l19.64-25.26A16,16,0,0,0,633.82,458.09Z"]
};
var faPlay = {
prefix: 'fas',
iconName: 'play',
icon: [448, 512, [], "f04b", "M424.4 214.7L72.4 6.6C43.8-10.3 0 6.1 0 47.9V464c0 37.5 40.7 60.1 72.4 41.3l352-208c31.4-18.5 31.5-64.1 0-82.6z"]
};
var faPlayCircle = {
prefix: 'fas',
iconName: 'play-circle',
icon: [512, 512, [], "f144", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm115.7 272l-176 101c-15.8 8.8-35.7-2.5-35.7-21V152c0-18.4 19.8-29.8 35.7-21l176 107c16.4 9.2 16.4 32.9 0 42z"]
};
var faPlug = {
prefix: 'fas',
iconName: 'plug',
icon: [384, 512, [], "f1e6", "M320,32a32,32,0,0,0-64,0v96h64Zm48,128H16A16,16,0,0,0,0,176v32a16,16,0,0,0,16,16H32v32A160.07,160.07,0,0,0,160,412.8V512h64V412.8A160.07,160.07,0,0,0,352,256V224h16a16,16,0,0,0,16-16V176A16,16,0,0,0,368,160ZM128,32a32,32,0,0,0-64,0v96h64Z"]
};
var faPlus = {
prefix: 'fas',
iconName: 'plus',
icon: [448, 512, [], "f067", "M416 208H272V64c0-17.67-14.33-32-32-32h-32c-17.67 0-32 14.33-32 32v144H32c-17.67 0-32 14.33-32 32v32c0 17.67 14.33 32 32 32h144v144c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32V304h144c17.67 0 32-14.33 32-32v-32c0-17.67-14.33-32-32-32z"]
};
var faPlusCircle = {
prefix: 'fas',
iconName: 'plus-circle',
icon: [512, 512, [], "f055", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm144 276c0 6.6-5.4 12-12 12h-92v92c0 6.6-5.4 12-12 12h-56c-6.6 0-12-5.4-12-12v-92h-92c-6.6 0-12-5.4-12-12v-56c0-6.6 5.4-12 12-12h92v-92c0-6.6 5.4-12 12-12h56c6.6 0 12 5.4 12 12v92h92c6.6 0 12 5.4 12 12v56z"]
};
var faPlusSquare = {
prefix: 'fas',
iconName: 'plus-square',
icon: [448, 512, [], "f0fe", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm-32 252c0 6.6-5.4 12-12 12h-92v92c0 6.6-5.4 12-12 12h-56c-6.6 0-12-5.4-12-12v-92H92c-6.6 0-12-5.4-12-12v-56c0-6.6 5.4-12 12-12h92v-92c0-6.6 5.4-12 12-12h56c6.6 0 12 5.4 12 12v92h92c6.6 0 12 5.4 12 12v56z"]
};
var faPodcast = {
prefix: 'fas',
iconName: 'podcast',
icon: [448, 512, [], "f2ce", "M267.429 488.563C262.286 507.573 242.858 512 224 512c-18.857 0-38.286-4.427-43.428-23.437C172.927 460.134 160 388.898 160 355.75c0-35.156 31.142-43.75 64-43.75s64 8.594 64 43.75c0 32.949-12.871 104.179-20.571 132.813zM156.867 288.554c-18.693-18.308-29.958-44.173-28.784-72.599 2.054-49.724 42.395-89.956 92.124-91.881C274.862 121.958 320 165.807 320 220c0 26.827-11.064 51.116-28.866 68.552-2.675 2.62-2.401 6.986.628 9.187 9.312 6.765 16.46 15.343 21.234 25.363 1.741 3.654 6.497 4.66 9.449 1.891 28.826-27.043 46.553-65.783 45.511-108.565-1.855-76.206-63.595-138.208-139.793-140.369C146.869 73.753 80 139.215 80 220c0 41.361 17.532 78.7 45.55 104.989 2.953 2.771 7.711 1.77 9.453-1.887 4.774-10.021 11.923-18.598 21.235-25.363 3.029-2.2 3.304-6.566.629-9.185zM224 0C100.204 0 0 100.185 0 224c0 89.992 52.602 165.647 125.739 201.408 4.333 2.118 9.267-1.544 8.535-6.31-2.382-15.512-4.342-30.946-5.406-44.339-.146-1.836-1.149-3.486-2.678-4.512-47.4-31.806-78.564-86.016-78.187-147.347.592-96.237 79.29-174.648 175.529-174.899C320.793 47.747 400 126.797 400 224c0 61.932-32.158 116.49-80.65 147.867-.999 14.037-3.069 30.588-5.624 47.23-.732 4.767 4.203 8.429 8.535 6.31C395.227 389.727 448 314.187 448 224 448 100.205 347.815 0 224 0zm0 160c-35.346 0-64 28.654-64 64s28.654 64 64 64 64-28.654 64-64-28.654-64-64-64z"]
};
var faPoll = {
prefix: 'fas',
iconName: 'poll',
icon: [448, 512, [], "f681", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zM160 368c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16V240c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v128zm96 0c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16V144c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v224zm96 0c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16v-64c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v64z"]
};
var faPollH = {
prefix: 'fas',
iconName: 'poll-h',
icon: [448, 512, [], "f682", "M448 432V80c0-26.5-21.5-48-48-48H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48zM112 192c-8.84 0-16-7.16-16-16v-32c0-8.84 7.16-16 16-16h128c8.84 0 16 7.16 16 16v32c0 8.84-7.16 16-16 16H112zm0 96c-8.84 0-16-7.16-16-16v-32c0-8.84 7.16-16 16-16h224c8.84 0 16 7.16 16 16v32c0 8.84-7.16 16-16 16H112zm0 96c-8.84 0-16-7.16-16-16v-32c0-8.84 7.16-16 16-16h64c8.84 0 16 7.16 16 16v32c0 8.84-7.16 16-16 16h-64z"]
};
var faPoo = {
prefix: 'fas',
iconName: 'poo',
icon: [512, 512, [], "f2fe", "M451.4 369.1C468.7 356 480 335.4 480 312c0-39.8-32.2-72-72-72h-14.1c13.4-11.7 22.1-28.8 22.1-48 0-35.3-28.7-64-64-64h-5.9c3.6-10.1 5.9-20.7 5.9-32 0-53-43-96-96-96-5.2 0-10.2.7-15.1 1.5C250.3 14.6 256 30.6 256 48c0 44.2-35.8 80-80 80h-16c-35.3 0-64 28.7-64 64 0 19.2 8.7 36.3 22.1 48H104c-39.8 0-72 32.2-72 72 0 23.4 11.3 44 28.6 57.1C26.3 374.6 0 404.1 0 440c0 39.8 32.2 72 72 72h368c39.8 0 72-32.2 72-72 0-35.9-26.3-65.4-60.6-70.9zM192 256c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm159.5 139C341 422.9 293 448 256 448s-85-25.1-95.5-53c-2-5.3 2-11 7.8-11h175.4c5.8 0 9.8 5.7 7.8 11zM320 320c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faPooStorm = {
prefix: 'fas',
iconName: 'poo-storm',
icon: [448, 512, [], "f75a", "M308 336h-57.7l17.3-64.9c2-7.6-3.7-15.1-11.6-15.1h-68c-6 0-11.1 4.5-11.9 10.4l-16 120c-1 7.2 4.6 13.6 11.9 13.6h59.3l-23 97.2c-1.8 7.6 4 14.8 11.7 14.8 4.2 0 8.2-2.2 10.4-6l88-152c4.6-8-1.2-18-10.4-18zm66.4-111.3c5.9-9.6 9.6-20.6 9.6-32.7 0-35.3-28.7-64-64-64h-5.9c3.6-10.1 5.9-20.7 5.9-32 0-53-43-96-96-96-5.2 0-10.2.7-15.1 1.5C218.3 14.6 224 30.6 224 48c0 44.2-35.8 80-80 80h-16c-35.3 0-64 28.7-64 64 0 12.1 3.7 23.1 9.6 32.7C32.6 228 0 262.2 0 304c0 44 36 80 80 80h48.3c.1-.6 0-1.2 0-1.8l16-120c3-21.8 21.7-38.2 43.7-38.2h68c13.8 0 26.5 6.3 34.9 17.2s11.2 24.8 7.6 38.1l-6.6 24.7h16c15.7 0 30.3 8.4 38.1 22 7.8 13.6 7.8 30.5 0 44l-8.1 14h30c44 0 80-36 80-80 .1-41.8-32.5-76-73.5-79.3z"]
};
var faPoop = {
prefix: 'fas',
iconName: 'poop',
icon: [512, 512, [], "f619", "M451.36 369.14C468.66 355.99 480 335.41 480 312c0-39.77-32.24-72-72-72h-14.07c13.42-11.73 22.07-28.78 22.07-48 0-35.35-28.65-64-64-64h-5.88c3.57-10.05 5.88-20.72 5.88-32 0-53.02-42.98-96-96-96-5.17 0-10.15.74-15.11 1.52C250.31 14.64 256 30.62 256 48c0 44.18-35.82 80-80 80h-16c-35.35 0-64 28.65-64 64 0 19.22 8.65 36.27 22.07 48H104c-39.76 0-72 32.23-72 72 0 23.41 11.34 43.99 28.64 57.14C26.31 374.62 0 404.12 0 440c0 39.76 32.24 72 72 72h368c39.76 0 72-32.24 72-72 0-35.88-26.31-65.38-60.64-70.86z"]
};
var faPortrait = {
prefix: 'fas',
iconName: 'portrait',
icon: [384, 512, [], "f3e0", "M336 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM192 128c35.3 0 64 28.7 64 64s-28.7 64-64 64-64-28.7-64-64 28.7-64 64-64zm112 236.8c0 10.6-10 19.2-22.4 19.2H102.4C90 384 80 375.4 80 364.8v-19.2c0-31.8 30.1-57.6 67.2-57.6h5c12.3 5.1 25.7 8 39.8 8s27.6-2.9 39.8-8h5c37.1 0 67.2 25.8 67.2 57.6v19.2z"]
};
var faPoundSign = {
prefix: 'fas',
iconName: 'pound-sign',
icon: [320, 512, [], "f154", "M308 352h-45.495c-6.627 0-12 5.373-12 12v50.848H128V288h84c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-84v-63.556c0-32.266 24.562-57.086 61.792-57.086 23.658 0 45.878 11.505 57.652 18.849 5.151 3.213 11.888 2.051 15.688-2.685l28.493-35.513c4.233-5.276 3.279-13.005-2.119-17.081C273.124 54.56 236.576 32 187.931 32 106.026 32 48 84.742 48 157.961V224H20c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h28v128H12c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h296c6.627 0 12-5.373 12-12V364c0-6.627-5.373-12-12-12z"]
};
var faPowerOff = {
prefix: 'fas',
iconName: 'power-off',
icon: [512, 512, [], "f011", "M400 54.1c63 45 104 118.6 104 201.9 0 136.8-110.8 247.7-247.5 248C120 504.3 8.2 393 8 256.4 7.9 173.1 48.9 99.3 111.8 54.2c11.7-8.3 28-4.8 35 7.7L162.6 90c5.9 10.5 3.1 23.8-6.6 31-41.5 30.8-68 79.6-68 134.9-.1 92.3 74.5 168.1 168 168.1 91.6 0 168.6-74.2 168-169.1-.3-51.8-24.7-101.8-68.1-134-9.7-7.2-12.4-20.5-6.5-30.9l15.8-28.1c7-12.4 23.2-16.1 34.8-7.8zM296 264V24c0-13.3-10.7-24-24-24h-32c-13.3 0-24 10.7-24 24v240c0 13.3 10.7 24 24 24h32c13.3 0 24-10.7 24-24z"]
};
var faPray = {
prefix: 'fas',
iconName: 'pray',
icon: [384, 512, [], "f683", "M256 128c35.35 0 64-28.65 64-64S291.35 0 256 0s-64 28.65-64 64 28.65 64 64 64zm-30.63 169.75c14.06 16.72 39 19.09 55.97 5.22l88-72.02c17.09-13.98 19.59-39.19 5.62-56.28-13.97-17.11-39.19-19.59-56.31-5.62l-57.44 47-38.91-46.31c-15.44-18.39-39.22-27.92-64-25.33-24.19 2.48-45.25 16.27-56.37 36.92l-49.37 92.03c-23.4 43.64-8.69 96.37 34.19 123.75L131.56 432H40c-22.09 0-40 17.91-40 40s17.91 40 40 40h208c34.08 0 53.77-42.79 28.28-68.28L166.42 333.86l34.8-64.87 24.15 28.76z"]
};
var faPrayingHands = {
prefix: 'fas',
iconName: 'praying-hands',
icon: [640, 512, [], "f684", "M272 191.91c-17.6 0-32 14.4-32 32v80c0 8.84-7.16 16-16 16s-16-7.16-16-16v-76.55c0-17.39 4.72-34.47 13.69-49.39l77.75-129.59c9.09-15.16 4.19-34.81-10.97-43.91-14.45-8.67-32.72-4.3-42.3 9.21-.2.23-.62.21-.79.48l-117.26 175.9C117.56 205.9 112 224.31 112 243.29v80.23l-90.12 30.04A31.974 31.974 0 0 0 0 383.91v96c0 10.82 8.52 32 32 32 2.69 0 5.41-.34 8.06-1.03l179.19-46.62C269.16 449.99 304 403.8 304 351.91v-128c0-17.6-14.4-32-32-32zm346.12 161.73L528 323.6v-80.23c0-18.98-5.56-37.39-16.12-53.23L394.62 14.25c-.18-.27-.59-.24-.79-.48-9.58-13.51-27.85-17.88-42.3-9.21-15.16 9.09-20.06 28.75-10.97 43.91l77.75 129.59c8.97 14.92 13.69 32 13.69 49.39V304c0 8.84-7.16 16-16 16s-16-7.16-16-16v-80c0-17.6-14.4-32-32-32s-32 14.4-32 32v128c0 51.89 34.84 98.08 84.75 112.34l179.19 46.62c2.66.69 5.38 1.03 8.06 1.03 23.48 0 32-21.18 32-32v-96c0-13.77-8.81-25.99-21.88-30.35z"]
};
var faPrescription = {
prefix: 'fas',
iconName: 'prescription',
icon: [384, 512, [], "f5b1", "M301.26 352l78.06-78.06c6.25-6.25 6.25-16.38 0-22.63l-22.63-22.63c-6.25-6.25-16.38-6.25-22.63 0L256 306.74l-83.96-83.96C219.31 216.8 256 176.89 256 128c0-53.02-42.98-96-96-96H16C7.16 32 0 39.16 0 48v256c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-80h18.75l128 128-78.06 78.06c-6.25 6.25-6.25 16.38 0 22.63l22.63 22.63c6.25 6.25 16.38 6.25 22.63 0L256 397.25l78.06 78.06c6.25 6.25 16.38 6.25 22.63 0l22.63-22.63c6.25-6.25 6.25-16.38 0-22.63L301.26 352zM64 96h96c17.64 0 32 14.36 32 32s-14.36 32-32 32H64V96z"]
};
var faPrescriptionBottle = {
prefix: 'fas',
iconName: 'prescription-bottle',
icon: [384, 512, [], "f485", "M32 192h120c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H32v64h120c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H32v64h120c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H32v64c0 17.6 14.4 32 32 32h256c17.6 0 32-14.4 32-32V128H32v64zM360 0H24C10.8 0 0 10.8 0 24v48c0 13.2 10.8 24 24 24h336c13.2 0 24-10.8 24-24V24c0-13.2-10.8-24-24-24z"]
};
var faPrescriptionBottleAlt = {
prefix: 'fas',
iconName: 'prescription-bottle-alt',
icon: [384, 512, [], "f486", "M360 0H24C10.8 0 0 10.8 0 24v48c0 13.2 10.8 24 24 24h336c13.2 0 24-10.8 24-24V24c0-13.2-10.8-24-24-24zM32 480c0 17.6 14.4 32 32 32h256c17.6 0 32-14.4 32-32V128H32v352zm64-184c0-4.4 3.6-8 8-8h56v-56c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v56h56c4.4 0 8 3.6 8 8v48c0 4.4-3.6 8-8 8h-56v56c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8v-56h-56c-4.4 0-8-3.6-8-8v-48z"]
};
var faPrint = {
prefix: 'fas',
iconName: 'print',
icon: [512, 512, [], "f02f", "M448 192V77.25c0-8.49-3.37-16.62-9.37-22.63L393.37 9.37c-6-6-14.14-9.37-22.63-9.37H96C78.33 0 64 14.33 64 32v160c-35.35 0-64 28.65-64 64v112c0 8.84 7.16 16 16 16h48v96c0 17.67 14.33 32 32 32h320c17.67 0 32-14.33 32-32v-96h48c8.84 0 16-7.16 16-16V256c0-35.35-28.65-64-64-64zm-64 256H128v-96h256v96zm0-224H128V64h192v48c0 8.84 7.16 16 16 16h48v96zm48 72c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24z"]
};
var faProcedures = {
prefix: 'fas',
iconName: 'procedures',
icon: [640, 512, [], "f487", "M528 224H272c-8.8 0-16 7.2-16 16v144H64V144c0-8.8-7.2-16-16-16H16c-8.8 0-16 7.2-16 16v352c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-48h512v48c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V336c0-61.9-50.1-112-112-112zM136 96h126.1l27.6 55.2c5.9 11.8 22.7 11.8 28.6 0L368 51.8 390.1 96H512c8.8 0 16-7.2 16-16s-7.2-16-16-16H409.9L382.3 8.8C376.4-3 359.6-3 353.7 8.8L304 108.2l-19.9-39.8c-1.4-2.7-4.1-4.4-7.2-4.4H136c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8zm24 256c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64z"]
};
var faProjectDiagram = {
prefix: 'fas',
iconName: 'project-diagram',
icon: [640, 512, [], "f542", "M384 320H256c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h128c17.67 0 32-14.33 32-32V352c0-17.67-14.33-32-32-32zM192 32c0-17.67-14.33-32-32-32H32C14.33 0 0 14.33 0 32v128c0 17.67 14.33 32 32 32h95.72l73.16 128.04C211.98 300.98 232.4 288 256 288h.28L192 175.51V128h224V64H192V32zM608 0H480c-17.67 0-32 14.33-32 32v128c0 17.67 14.33 32 32 32h128c17.67 0 32-14.33 32-32V32c0-17.67-14.33-32-32-32z"]
};
var faPumpMedical = {
prefix: 'fas',
iconName: 'pump-medical',
icon: [384, 512, [], "e06a", "M235.51,159.82H84.24A64,64,0,0,0,20.51,218L.14,442a64,64,0,0,0,63.74,69.8h192A64,64,0,0,0,319.61,442L299.24,218A64,64,0,0,0,235.51,159.82Zm4.37,173.33a13.35,13.35,0,0,1-13.34,13.34h-40v40a13.33,13.33,0,0,1-13.33,13.33H146.54a13.33,13.33,0,0,1-13.33-13.33v-40h-40a13.34,13.34,0,0,1-13.33-13.34V306.49a13.33,13.33,0,0,1,13.33-13.34h40v-40a13.33,13.33,0,0,1,13.33-13.33h26.67a13.33,13.33,0,0,1,13.33,13.33v40h40a13.34,13.34,0,0,1,13.34,13.34ZM379.19,93.88,335.87,50.56a64,64,0,0,0-45.24-18.74H223.88a32,32,0,0,0-32-32h-64a32,32,0,0,0-32,32v96h128v-32h66.75l43.31,43.31a16,16,0,0,0,22.63,0l22.62-22.62A16,16,0,0,0,379.19,93.88Z"]
};
var faPumpSoap = {
prefix: 'fas',
iconName: 'pump-soap',
icon: [384, 512, [], "e06b", "M235.63,160H84.37a64,64,0,0,0-63.74,58.21L.27,442.21A64,64,0,0,0,64,512H256a64,64,0,0,0,63.74-69.79l-20.36-224A64,64,0,0,0,235.63,160ZM160,416c-33.12,0-60-26.33-60-58.75,0-25,35.7-75.47,52-97.27A10,10,0,0,1,168,260c16.33,21.8,52,72.27,52,97.27C220,389.67,193.12,416,160,416ZM379.31,94.06,336,50.74A64,64,0,0,0,290.75,32H224A32,32,0,0,0,192,0H128A32,32,0,0,0,96,32v96H224V96h66.75l43.31,43.31a16,16,0,0,0,22.63,0l22.62-22.62A16,16,0,0,0,379.31,94.06Z"]
};
var faPuzzlePiece = {
prefix: 'fas',
iconName: 'puzzle-piece',
icon: [576, 512, [], "f12e", "M519.442 288.651c-41.519 0-59.5 31.593-82.058 31.593C377.409 320.244 432 144 432 144s-196.288 80-196.288-3.297c0-35.827 36.288-46.25 36.288-85.985C272 19.216 243.885 0 210.539 0c-34.654 0-66.366 18.891-66.366 56.346 0 41.364 31.711 59.277 31.711 81.75C175.885 207.719 0 166.758 0 166.758v333.237s178.635 41.047 178.635-28.662c0-22.473-40-40.107-40-81.471 0-37.456 29.25-56.346 63.577-56.346 33.673 0 61.788 19.216 61.788 54.717 0 39.735-36.288 50.158-36.288 85.985 0 60.803 129.675 25.73 181.23 25.73 0 0-34.725-120.101 25.827-120.101 35.962 0 46.423 36.152 86.308 36.152C556.712 416 576 387.99 576 354.443c0-34.199-18.962-65.792-56.558-65.792z"]
};
var faQrcode = {
prefix: 'fas',
iconName: 'qrcode',
icon: [448, 512, [], "f029", "M0 224h192V32H0v192zM64 96h64v64H64V96zm192-64v192h192V32H256zm128 128h-64V96h64v64zM0 480h192V288H0v192zm64-128h64v64H64v-64zm352-64h32v128h-96v-32h-32v96h-64V288h96v32h64v-32zm0 160h32v32h-32v-32zm-64 0h32v32h-32v-32z"]
};
var faQuestion = {
prefix: 'fas',
iconName: 'question',
icon: [384, 512, [], "f128", "M202.021 0C122.202 0 70.503 32.703 29.914 91.026c-7.363 10.58-5.093 25.086 5.178 32.874l43.138 32.709c10.373 7.865 25.132 6.026 33.253-4.148 25.049-31.381 43.63-49.449 82.757-49.449 30.764 0 68.816 19.799 68.816 49.631 0 22.552-18.617 34.134-48.993 51.164-35.423 19.86-82.299 44.576-82.299 106.405V320c0 13.255 10.745 24 24 24h72.471c13.255 0 24-10.745 24-24v-5.773c0-42.86 125.268-44.645 125.268-160.627C377.504 66.256 286.902 0 202.021 0zM192 373.459c-38.196 0-69.271 31.075-69.271 69.271 0 38.195 31.075 69.27 69.271 69.27s69.271-31.075 69.271-69.271-31.075-69.27-69.271-69.27z"]
};
var faQuestionCircle = {
prefix: 'fas',
iconName: 'question-circle',
icon: [512, 512, [], "f059", "M504 256c0 136.997-111.043 248-248 248S8 392.997 8 256C8 119.083 119.043 8 256 8s248 111.083 248 248zM262.655 90c-54.497 0-89.255 22.957-116.549 63.758-3.536 5.286-2.353 12.415 2.715 16.258l34.699 26.31c5.205 3.947 12.621 3.008 16.665-2.122 17.864-22.658 30.113-35.797 57.303-35.797 20.429 0 45.698 13.148 45.698 32.958 0 14.976-12.363 22.667-32.534 33.976C247.128 238.528 216 254.941 216 296v4c0 6.627 5.373 12 12 12h56c6.627 0 12-5.373 12-12v-1.333c0-28.462 83.186-29.647 83.186-106.667 0-58.002-60.165-102-116.531-102zM256 338c-25.365 0-46 20.635-46 46 0 25.364 20.635 46 46 46s46-20.636 46-46c0-25.365-20.635-46-46-46z"]
};
var faQuidditch = {
prefix: 'fas',
iconName: 'quidditch',
icon: [640, 512, [], "f458", "M256.5 216.8L343.2 326s-16.6 102.4-76.6 150.1C206.7 523.8 0 510.2 0 510.2s3.8-23.1 11-55.4l94.6-112.2c4-4.7-.9-11.6-6.6-9.5l-60.4 22.1c14.4-41.7 32.7-80 54.6-97.5 59.9-47.8 163.3-40.9 163.3-40.9zm238 135c-44 0-79.8 35.8-79.8 79.9 0 44.1 35.7 79.9 79.8 79.9 44.1 0 79.8-35.8 79.8-79.9 0-44.2-35.8-79.9-79.8-79.9zM636.5 31L616.7 6c-5.5-6.9-15.5-8-22.4-2.6L361.8 181.3l-34.1-43c-5.1-6.4-15.1-5.2-18.6 2.2l-25.3 54.6 86.7 109.2 58.8-12.4c8-1.7 11.4-11.2 6.3-17.6l-34.1-42.9L634 53.5c6.9-5.5 8-15.6 2.5-22.5z"]
};
var faQuoteLeft = {
prefix: 'fas',
iconName: 'quote-left',
icon: [512, 512, [], "f10d", "M464 256h-80v-64c0-35.3 28.7-64 64-64h8c13.3 0 24-10.7 24-24V56c0-13.3-10.7-24-24-24h-8c-88.4 0-160 71.6-160 160v240c0 26.5 21.5 48 48 48h128c26.5 0 48-21.5 48-48V304c0-26.5-21.5-48-48-48zm-288 0H96v-64c0-35.3 28.7-64 64-64h8c13.3 0 24-10.7 24-24V56c0-13.3-10.7-24-24-24h-8C71.6 32 0 103.6 0 192v240c0 26.5 21.5 48 48 48h128c26.5 0 48-21.5 48-48V304c0-26.5-21.5-48-48-48z"]
};
var faQuoteRight = {
prefix: 'fas',
iconName: 'quote-right',
icon: [512, 512, [], "f10e", "M464 32H336c-26.5 0-48 21.5-48 48v128c0 26.5 21.5 48 48 48h80v64c0 35.3-28.7 64-64 64h-8c-13.3 0-24 10.7-24 24v48c0 13.3 10.7 24 24 24h8c88.4 0 160-71.6 160-160V80c0-26.5-21.5-48-48-48zm-288 0H48C21.5 32 0 53.5 0 80v128c0 26.5 21.5 48 48 48h80v64c0 35.3-28.7 64-64 64h-8c-13.3 0-24 10.7-24 24v48c0 13.3 10.7 24 24 24h8c88.4 0 160-71.6 160-160V80c0-26.5-21.5-48-48-48z"]
};
var faQuran = {
prefix: 'fas',
iconName: 'quran',
icon: [448, 512, [], "f687", "M448 358.4V25.6c0-16-9.6-25.6-25.6-25.6H96C41.6 0 0 41.6 0 96v320c0 54.4 41.6 96 96 96h326.4c12.8 0 25.6-9.6 25.6-25.6v-16c0-6.4-3.2-12.8-9.6-19.2-3.2-16-3.2-60.8 0-73.6 6.4-3.2 9.6-9.6 9.6-19.2zM301.08 145.82c.6-1.21 1.76-1.82 2.92-1.82s2.32.61 2.92 1.82l11.18 22.65 25 3.63c2.67.39 3.74 3.67 1.81 5.56l-18.09 17.63 4.27 24.89c.36 2.11-1.31 3.82-3.21 3.82-.5 0-1.02-.12-1.52-.38L304 211.87l-22.36 11.75c-.5.26-1.02.38-1.52.38-1.9 0-3.57-1.71-3.21-3.82l4.27-24.89-18.09-17.63c-1.94-1.89-.87-5.17 1.81-5.56l24.99-3.63 11.19-22.65zm-57.89-69.01c13.67 0 27.26 2.49 40.38 7.41a6.775 6.775 0 1 1-2.38 13.12c-.67 0-3.09-.21-4.13-.21-52.31 0-94.86 42.55-94.86 94.86 0 52.3 42.55 94.86 94.86 94.86 1.03 0 3.48-.21 4.13-.21 3.93 0 6.8 3.14 6.8 6.78 0 2.98-1.94 5.51-4.62 6.42-13.07 4.87-26.59 7.34-40.19 7.34C179.67 307.19 128 255.51 128 192c0-63.52 51.67-115.19 115.19-115.19zM380.8 448H96c-19.2 0-32-12.8-32-32s16-32 32-32h284.8v64z"]
};
var faRadiation = {
prefix: 'fas',
iconName: 'radiation',
icon: [496, 512, [], "f7b9", "M328.2 255.8h151.6c9.1 0 16.8-7.7 16.2-16.8-5.1-75.8-44.4-142.2-102.5-184.2-7.4-5.3-17.9-2.9-22.7 4.8L290.4 188c22.6 14.3 37.8 39.2 37.8 67.8zm-37.8 67.7c-12.3 7.7-26.8 12.4-42.4 12.4-15.6 0-30-4.7-42.4-12.4L125.2 452c-4.8 7.7-2.4 18.1 5.6 22.4C165.7 493.2 205.6 504 248 504s82.3-10.8 117.2-29.6c8-4.3 10.4-14.8 5.6-22.4l-80.4-128.5zM248 303.8c26.5 0 48-21.5 48-48s-21.5-48-48-48-48 21.5-48 48 21.5 48 48 48zm-231.8-48h151.6c0-28.6 15.2-53.5 37.8-67.7L125.2 59.7c-4.8-7.7-15.3-10.2-22.7-4.8C44.4 96.9 5.1 163.3 0 239.1c-.6 9 7.1 16.7 16.2 16.7z"]
};
var faRadiationAlt = {
prefix: 'fas',
iconName: 'radiation-alt',
icon: [496, 512, [], "f7ba", "M312 256h79.1c9.2 0 16.9-7.7 16-16.8-4.6-43.6-27-81.8-59.5-107.8-7.6-6.1-18.8-4.5-24 3.8L281.9 202c18 11.2 30.1 31.2 30.1 54zm-97.8 54.1L172.4 377c-4.9 7.8-2.4 18.4 5.8 22.5 21.1 10.4 44.7 16.5 69.8 16.5s48.7-6.1 69.9-16.5c8.2-4.1 10.6-14.7 5.8-22.5l-41.8-66.9c-9.8 6.2-21.4 9.9-33.8 9.9s-24.1-3.7-33.9-9.9zM104.9 256H184c0-22.8 12.1-42.8 30.2-54.1l-41.7-66.8c-5.2-8.3-16.4-9.9-24-3.8-32.6 26-54.9 64.2-59.5 107.8-1.1 9.2 6.7 16.9 15.9 16.9zM248 504c137 0 248-111 248-248S385 8 248 8 0 119 0 256s111 248 248 248zm0-432c101.5 0 184 82.5 184 184s-82.5 184-184 184S64 357.5 64 256 146.5 72 248 72zm0 216c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32z"]
};
var faRainbow = {
prefix: 'fas',
iconName: 'rainbow',
icon: [576, 512, [], "f75b", "M268.3 32.7C115.4 42.9 0 176.9 0 330.2V464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320C64 186.8 180.9 80.3 317.5 97.9 430.4 112.4 512 214 512 327.8V464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320c0-165.3-140-298.6-307.7-287.3zm-5.6 96.9C166 142 96 229.1 96 326.7V464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320c0-74.8 64.5-134.8 140.8-127.4 66.5 6.5 115.2 66.2 115.2 133.1V464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320c0-114.2-100.2-205.4-217.3-190.4zm6.2 96.3c-45.6 8.9-76.9 51.5-76.9 97.9V464c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320c0-17.6 14.3-32 32-32s32 14.4 32 32v144c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320c0-59.2-53.8-106-115.1-94.1z"]
};
var faRandom = {
prefix: 'fas',
iconName: 'random',
icon: [512, 512, [], "f074", "M504.971 359.029c9.373 9.373 9.373 24.569 0 33.941l-80 79.984c-15.01 15.01-40.971 4.49-40.971-16.971V416h-58.785a12.004 12.004 0 0 1-8.773-3.812l-70.556-75.596 53.333-57.143L352 336h32v-39.981c0-21.438 25.943-31.998 40.971-16.971l80 79.981zM12 176h84l52.781 56.551 53.333-57.143-70.556-75.596A11.999 11.999 0 0 0 122.785 96H12c-6.627 0-12 5.373-12 12v56c0 6.627 5.373 12 12 12zm372 0v39.984c0 21.46 25.961 31.98 40.971 16.971l80-79.984c9.373-9.373 9.373-24.569 0-33.941l-80-79.981C409.943 24.021 384 34.582 384 56.019V96h-58.785a12.004 12.004 0 0 0-8.773 3.812L96 336H12c-6.627 0-12 5.373-12 12v56c0 6.627 5.373 12 12 12h110.785c3.326 0 6.503-1.381 8.773-3.812L352 176h32z"]
};
var faReceipt = {
prefix: 'fas',
iconName: 'receipt',
icon: [384, 512, [], "f543", "M358.4 3.2L320 48 265.6 3.2a15.9 15.9 0 0 0-19.2 0L192 48 137.6 3.2a15.9 15.9 0 0 0-19.2 0L64 48 25.6 3.2C15-4.7 0 2.8 0 16v480c0 13.2 15 20.7 25.6 12.8L64 464l54.4 44.8a15.9 15.9 0 0 0 19.2 0L192 464l54.4 44.8a15.9 15.9 0 0 0 19.2 0L320 464l38.4 44.8c10.5 7.9 25.6.4 25.6-12.8V16c0-13.2-15-20.7-25.6-12.8zM320 360c0 4.4-3.6 8-8 8H72c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h240c4.4 0 8 3.6 8 8v16zm0-96c0 4.4-3.6 8-8 8H72c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h240c4.4 0 8 3.6 8 8v16zm0-96c0 4.4-3.6 8-8 8H72c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h240c4.4 0 8 3.6 8 8v16z"]
};
var faRecordVinyl = {
prefix: 'fas',
iconName: 'record-vinyl',
icon: [512, 512, [], "f8d9", "M256 152a104 104 0 1 0 104 104 104 104 0 0 0-104-104zm0 128a24 24 0 1 1 24-24 24 24 0 0 1-24 24zm0-272C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm0 376a128 128 0 1 1 128-128 128 128 0 0 1-128 128z"]
};
var faRecycle = {
prefix: 'fas',
iconName: 'recycle',
icon: [512, 512, [], "f1b8", "M184.561 261.903c3.232 13.997-12.123 24.635-24.068 17.168l-40.736-25.455-50.867 81.402C55.606 356.273 70.96 384 96.012 384H148c6.627 0 12 5.373 12 12v40c0 6.627-5.373 12-12 12H96.115c-75.334 0-121.302-83.048-81.408-146.88l50.822-81.388-40.725-25.448c-12.081-7.547-8.966-25.961 4.879-29.158l110.237-25.45c8.611-1.988 17.201 3.381 19.189 11.99l25.452 110.237zm98.561-182.915l41.289 66.076-40.74 25.457c-12.051 7.528-9 25.953 4.879 29.158l110.237 25.45c8.672 1.999 17.215-3.438 19.189-11.99l25.45-110.237c3.197-13.844-11.99-24.719-24.068-17.168l-40.687 25.424-41.263-66.082c-37.521-60.033-125.209-60.171-162.816 0l-17.963 28.766c-3.51 5.62-1.8 13.021 3.82 16.533l33.919 21.195c5.62 3.512 13.024 1.803 16.536-3.817l17.961-28.743c12.712-20.341 41.973-19.676 54.257-.022zM497.288 301.12l-27.515-44.065c-3.511-5.623-10.916-7.334-16.538-3.821l-33.861 21.159c-5.62 3.512-7.33 10.915-3.818 16.536l27.564 44.112c13.257 21.211-2.057 48.96-27.136 48.96H320V336.02c0-14.213-17.242-21.383-27.313-11.313l-80 79.981c-6.249 6.248-6.249 16.379 0 22.627l80 79.989C302.689 517.308 320 510.3 320 495.989V448h95.88c75.274 0 121.335-82.997 81.408-146.88z"]
};
var faRedo = {
prefix: 'fas',
iconName: 'redo',
icon: [512, 512, [], "f01e", "M500.33 0h-47.41a12 12 0 0 0-12 12.57l4 82.76A247.42 247.42 0 0 0 256 8C119.34 8 7.9 119.53 8 256.19 8.1 393.07 119.1 504 256 504a247.1 247.1 0 0 0 166.18-63.91 12 12 0 0 0 .48-17.43l-34-34a12 12 0 0 0-16.38-.55A176 176 0 1 1 402.1 157.8l-101.53-4.87a12 12 0 0 0-12.57 12v47.41a12 12 0 0 0 12 12h200.33a12 12 0 0 0 12-12V12a12 12 0 0 0-12-12z"]
};
var faRedoAlt = {
prefix: 'fas',
iconName: 'redo-alt',
icon: [512, 512, [], "f2f9", "M256.455 8c66.269.119 126.437 26.233 170.859 68.685l35.715-35.715C478.149 25.851 504 36.559 504 57.941V192c0 13.255-10.745 24-24 24H345.941c-21.382 0-32.09-25.851-16.971-40.971l41.75-41.75c-30.864-28.899-70.801-44.907-113.23-45.273-92.398-.798-170.283 73.977-169.484 169.442C88.764 348.009 162.184 424 256 424c41.127 0 79.997-14.678 110.629-41.556 4.743-4.161 11.906-3.908 16.368.553l39.662 39.662c4.872 4.872 4.631 12.815-.482 17.433C378.202 479.813 319.926 504 256 504 119.034 504 8.001 392.967 8 256.002 7.999 119.193 119.646 7.755 256.455 8z"]
};
var faRegistered = {
prefix: 'fas',
iconName: 'registered',
icon: [512, 512, [], "f25d", "M285.363 207.475c0 18.6-9.831 28.431-28.431 28.431h-29.876v-56.14h23.378c28.668 0 34.929 8.773 34.929 27.709zM504 256c0 136.967-111.033 248-248 248S8 392.967 8 256 119.033 8 256 8s248 111.033 248 248zM363.411 360.414c-46.729-84.825-43.299-78.636-44.702-80.98 23.432-15.172 37.945-42.979 37.945-74.486 0-54.244-31.5-89.252-105.498-89.252h-70.667c-13.255 0-24 10.745-24 24V372c0 13.255 10.745 24 24 24h22.567c13.255 0 24-10.745 24-24v-71.663h25.556l44.129 82.937a24.001 24.001 0 0 0 21.188 12.727h24.464c18.261-.001 29.829-19.591 21.018-35.587z"]
};
var faRemoveFormat = {
prefix: 'fas',
iconName: 'remove-format',
icon: [640, 512, [], "f87d", "M336 416h-11.17l9.26-27.77L267 336.4 240.49 416H208a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm297.82 42.1L377 259.59 426.17 112H544v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16H176a16 16 0 0 0-16 16v43.9L45.46 3.38A16 16 0 0 0 23 6.19L3.37 31.46a16 16 0 0 0 2.81 22.45l588.36 454.72a16 16 0 0 0 22.46-2.81l19.64-25.27a16 16 0 0 0-2.82-22.45zM309.91 207.76L224 141.36V112h117.83z"]
};
var faReply = {
prefix: 'fas',
iconName: 'reply',
icon: [512, 512, [], "f3e5", "M8.309 189.836L184.313 37.851C199.719 24.546 224 35.347 224 56.015v80.053c160.629 1.839 288 34.032 288 186.258 0 61.441-39.581 122.309-83.333 154.132-13.653 9.931-33.111-2.533-28.077-18.631 45.344-145.012-21.507-183.51-176.59-185.742V360c0 20.7-24.3 31.453-39.687 18.164l-176.004-152c-11.071-9.562-11.086-26.753 0-36.328z"]
};
var faReplyAll = {
prefix: 'fas',
iconName: 'reply-all',
icon: [576, 512, [], "f122", "M136.309 189.836L312.313 37.851C327.72 24.546 352 35.348 352 56.015v82.763c129.182 10.231 224 52.212 224 183.548 0 61.441-39.582 122.309-83.333 154.132-13.653 9.931-33.111-2.533-28.077-18.631 38.512-123.162-3.922-169.482-112.59-182.015v84.175c0 20.701-24.3 31.453-39.687 18.164L136.309 226.164c-11.071-9.561-11.086-26.753 0-36.328zm-128 36.328L184.313 378.15C199.7 391.439 224 380.687 224 359.986v-15.818l-108.606-93.785A55.96 55.96 0 0 1 96 207.998a55.953 55.953 0 0 1 19.393-42.38L224 71.832V56.015c0-20.667-24.28-31.469-39.687-18.164L8.309 189.836c-11.086 9.575-11.071 26.767 0 36.328z"]
};
var faRepublican = {
prefix: 'fas',
iconName: 'republican',
icon: [640, 512, [], "f75e", "M544 192c0-88.4-71.6-160-160-160H160C71.6 32 0 103.6 0 192v64h544v-64zm-367.7-21.6l-19.8 19.3 4.7 27.3c.8 4.9-4.3 8.6-8.7 6.3L128 210.4l-24.5 12.9c-4.3 2.3-9.5-1.4-8.7-6.3l4.7-27.3-19.8-19.3c-3.6-3.5-1.6-9.5 3.3-10.2l27.4-4 12.2-24.8c2.2-4.5 8.6-4.4 10.7 0l12.2 24.8 27.4 4c5 .7 6.9 6.7 3.4 10.2zm144 0l-19.8 19.3 4.7 27.3c.8 4.9-4.3 8.6-8.7 6.3L272 210.4l-24.5 12.9c-4.3 2.3-9.5-1.4-8.7-6.3l4.7-27.3-19.8-19.3c-3.6-3.5-1.6-9.5 3.3-10.2l27.4-4 12.2-24.8c2.2-4.5 8.6-4.4 10.7 0l12.2 24.8 27.4 4c5 .7 6.9 6.7 3.4 10.2zm144 0l-19.8 19.3 4.7 27.3c.8 4.9-4.3 8.6-8.7 6.3L416 210.4l-24.5 12.9c-4.3 2.3-9.5-1.4-8.7-6.3l4.7-27.3-19.8-19.3c-3.6-3.5-1.6-9.5 3.3-10.2l27.4-4 12.2-24.8c2.2-4.5 8.6-4.4 10.7 0l12.2 24.8 27.4 4c5 .7 6.9 6.7 3.4 10.2zM624 320h-32c-8.8 0-16 7.2-16 16v64c0 8.8-7.2 16-16 16s-16-7.2-16-16V288H0v176c0 8.8 7.2 16 16 16h96c8.8 0 16-7.2 16-16v-80h192v80c0 8.8 7.2 16 16 16h96c8.8 0 16-7.2 16-16V352h32v43.3c0 41.8 30 80.1 71.6 84.3 47.8 4.9 88.4-32.7 88.4-79.6v-64c0-8.8-7.2-16-16-16z"]
};
var faRestroom = {
prefix: 'fas',
iconName: 'restroom',
icon: [640, 512, [], "f7bd", "M128 128c35.3 0 64-28.7 64-64S163.3 0 128 0 64 28.7 64 64s28.7 64 64 64zm384 0c35.3 0 64-28.7 64-64S547.3 0 512 0s-64 28.7-64 64 28.7 64 64 64zm127.3 226.5l-45.6-185.8c-3.3-13.5-15.5-23-29.8-24.2-15 9.7-32.8 15.5-52 15.5-19.2 0-37-5.8-52-15.5-14.3 1.2-26.5 10.7-29.8 24.2l-45.6 185.8C381 369.6 393 384 409.2 384H464v104c0 13.3 10.7 24 24 24h48c13.3 0 24-10.7 24-24V384h54.8c16.2 0 28.2-14.4 24.5-29.5zM336 0h-32c-8.8 0-16 7.2-16 16v480c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16zM180.1 144.4c-15 9.8-32.9 15.6-52.1 15.6-19.2 0-37.1-5.8-52.1-15.6C51.3 146.5 32 166.9 32 192v136c0 13.3 10.7 24 24 24h8v136c0 13.3 10.7 24 24 24h80c13.3 0 24-10.7 24-24V352h8c13.3 0 24-10.7 24-24V192c0-25.1-19.3-45.5-43.9-47.6z"]
};
var faRetweet = {
prefix: 'fas',
iconName: 'retweet',
icon: [640, 512, [], "f079", "M629.657 343.598L528.971 444.284c-9.373 9.372-24.568 9.372-33.941 0L394.343 343.598c-9.373-9.373-9.373-24.569 0-33.941l10.823-10.823c9.562-9.562 25.133-9.34 34.419.492L480 342.118V160H292.451a24.005 24.005 0 0 1-16.971-7.029l-16-16C244.361 121.851 255.069 96 276.451 96H520c13.255 0 24 10.745 24 24v222.118l40.416-42.792c9.285-9.831 24.856-10.054 34.419-.492l10.823 10.823c9.372 9.372 9.372 24.569-.001 33.941zm-265.138 15.431A23.999 23.999 0 0 0 347.548 352H160V169.881l40.416 42.792c9.286 9.831 24.856 10.054 34.419.491l10.822-10.822c9.373-9.373 9.373-24.569 0-33.941L144.971 67.716c-9.373-9.373-24.569-9.373-33.941 0L10.343 168.402c-9.373 9.373-9.373 24.569 0 33.941l10.822 10.822c9.562 9.562 25.133 9.34 34.419-.491L96 169.881V392c0 13.255 10.745 24 24 24h243.549c21.382 0 32.09-25.851 16.971-40.971l-16.001-16z"]
};
var faRibbon = {
prefix: 'fas',
iconName: 'ribbon',
icon: [448, 512, [], "f4d6", "M6.1 444.3c-9.6 10.8-7.5 27.6 4.5 35.7l68.8 27.9c9.9 6.7 23.3 5 31.3-3.8l91.8-101.9-79.2-87.9-117.2 130zm435.8 0s-292-324.6-295.4-330.1c15.4-8.4 40.2-17.9 77.5-17.9s62.1 9.5 77.5 17.9c-3.3 5.6-56 64.6-56 64.6l79.1 87.7 34.2-38c28.7-31.9 33.3-78.6 11.4-115.5l-43.7-73.5c-4.3-7.2-9.9-13.3-16.8-18-40.7-27.6-127.4-29.7-171.4 0-6.9 4.7-12.5 10.8-16.8 18l-43.6 73.2c-1.5 2.5-37.1 62.2 11.5 116L337.5 504c8 8.9 21.4 10.5 31.3 3.8l68.8-27.9c11.9-8 14-24.8 4.3-35.6z"]
};
var faRing = {
prefix: 'fas',
iconName: 'ring',
icon: [512, 512, [], "f70b", "M256 64C110.06 64 0 125.91 0 208v98.13C0 384.48 114.62 448 256 448s256-63.52 256-141.87V208c0-82.09-110.06-144-256-144zm0 64c106.04 0 192 35.82 192 80 0 9.26-3.97 18.12-10.91 26.39C392.15 208.21 328.23 192 256 192s-136.15 16.21-181.09 42.39C67.97 226.12 64 217.26 64 208c0-44.18 85.96-80 192-80zM120.43 264.64C155.04 249.93 201.64 240 256 240s100.96 9.93 135.57 24.64C356.84 279.07 308.93 288 256 288s-100.84-8.93-135.57-23.36z"]
};
var faRoad = {
prefix: 'fas',
iconName: 'road',
icon: [576, 512, [], "f018", "M573.19 402.67l-139.79-320C428.43 71.29 417.6 64 405.68 64h-97.59l2.45 23.16c.5 4.72-3.21 8.84-7.96 8.84h-29.16c-4.75 0-8.46-4.12-7.96-8.84L267.91 64h-97.59c-11.93 0-22.76 7.29-27.73 18.67L2.8 402.67C-6.45 423.86 8.31 448 30.54 448h196.84l10.31-97.68c.86-8.14 7.72-14.32 15.91-14.32h68.8c8.19 0 15.05 6.18 15.91 14.32L348.62 448h196.84c22.23 0 36.99-24.14 27.73-45.33zM260.4 135.16a8 8 0 0 1 7.96-7.16h39.29c4.09 0 7.53 3.09 7.96 7.16l4.6 43.58c.75 7.09-4.81 13.26-11.93 13.26h-40.54c-7.13 0-12.68-6.17-11.93-13.26l4.59-43.58zM315.64 304h-55.29c-9.5 0-16.91-8.23-15.91-17.68l5.07-48c.86-8.14 7.72-14.32 15.91-14.32h45.15c8.19 0 15.05 6.18 15.91 14.32l5.07 48c1 9.45-6.41 17.68-15.91 17.68z"]
};
var faRobot = {
prefix: 'fas',
iconName: 'robot',
icon: [640, 512, [], "f544", "M32,224H64V416H32A31.96166,31.96166,0,0,1,0,384V256A31.96166,31.96166,0,0,1,32,224Zm512-48V448a64.06328,64.06328,0,0,1-64,64H160a64.06328,64.06328,0,0,1-64-64V176a79.974,79.974,0,0,1,80-80H288V32a32,32,0,0,1,64,0V96H464A79.974,79.974,0,0,1,544,176ZM264,256a40,40,0,1,0-40,40A39.997,39.997,0,0,0,264,256Zm-8,128H192v32h64Zm96,0H288v32h64ZM456,256a40,40,0,1,0-40,40A39.997,39.997,0,0,0,456,256Zm-8,128H384v32h64ZM640,256V384a31.96166,31.96166,0,0,1-32,32H576V224h32A31.96166,31.96166,0,0,1,640,256Z"]
};
var faRocket = {
prefix: 'fas',
iconName: 'rocket',
icon: [512, 512, [], "f135", "M505.12019,19.09375c-1.18945-5.53125-6.65819-11-12.207-12.1875C460.716,0,435.507,0,410.40747,0,307.17523,0,245.26909,55.20312,199.05238,128H94.83772c-16.34763.01562-35.55658,11.875-42.88664,26.48438L2.51562,253.29688A28.4,28.4,0,0,0,0,264a24.00867,24.00867,0,0,0,24.00582,24H127.81618l-22.47457,22.46875c-11.36521,11.36133-12.99607,32.25781,0,45.25L156.24582,406.625c11.15623,11.1875,32.15619,13.15625,45.27726,0l22.47457-22.46875V488a24.00867,24.00867,0,0,0,24.00581,24,28.55934,28.55934,0,0,0,10.707-2.51562l98.72834-49.39063c14.62888-7.29687,26.50776-26.5,26.50776-42.85937V312.79688c72.59753-46.3125,128.03493-108.40626,128.03493-211.09376C512.07526,76.5,512.07526,51.29688,505.12019,19.09375ZM384.04033,168A40,40,0,1,1,424.05,128,40.02322,40.02322,0,0,1,384.04033,168Z"]
};
var faRoute = {
prefix: 'fas',
iconName: 'route',
icon: [512, 512, [], "f4d7", "M416 320h-96c-17.6 0-32-14.4-32-32s14.4-32 32-32h96s96-107 96-160-43-96-96-96-96 43-96 96c0 25.5 22.2 63.4 45.3 96H320c-52.9 0-96 43.1-96 96s43.1 96 96 96h96c17.6 0 32 14.4 32 32s-14.4 32-32 32H185.5c-16 24.8-33.8 47.7-47.3 64H416c52.9 0 96-43.1 96-96s-43.1-96-96-96zm0-256c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zM96 256c-53 0-96 43-96 96s96 160 96 160 96-107 96-160-43-96-96-96zm0 128c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faRss = {
prefix: 'fas',
iconName: 'rss',
icon: [448, 512, [], "f09e", "M128.081 415.959c0 35.369-28.672 64.041-64.041 64.041S0 451.328 0 415.959s28.672-64.041 64.041-64.041 64.04 28.673 64.04 64.041zm175.66 47.25c-8.354-154.6-132.185-278.587-286.95-286.95C7.656 175.765 0 183.105 0 192.253v48.069c0 8.415 6.49 15.472 14.887 16.018 111.832 7.284 201.473 96.702 208.772 208.772.547 8.397 7.604 14.887 16.018 14.887h48.069c9.149.001 16.489-7.655 15.995-16.79zm144.249.288C439.596 229.677 251.465 40.445 16.503 32.01 7.473 31.686 0 38.981 0 48.016v48.068c0 8.625 6.835 15.645 15.453 15.999 191.179 7.839 344.627 161.316 352.465 352.465.353 8.618 7.373 15.453 15.999 15.453h48.068c9.034-.001 16.329-7.474 16.005-16.504z"]
};
var faRssSquare = {
prefix: 'fas',
iconName: 'rss-square',
icon: [448, 512, [], "f143", "M400 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zM112 416c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm157.533 0h-34.335c-6.011 0-11.051-4.636-11.442-10.634-5.214-80.05-69.243-143.92-149.123-149.123-5.997-.39-10.633-5.431-10.633-11.441v-34.335c0-6.535 5.468-11.777 11.994-11.425 110.546 5.974 198.997 94.536 204.964 204.964.352 6.526-4.89 11.994-11.425 11.994zm103.027 0h-34.334c-6.161 0-11.175-4.882-11.427-11.038-5.598-136.535-115.204-246.161-251.76-251.76C68.882 152.949 64 147.935 64 141.774V107.44c0-6.454 5.338-11.664 11.787-11.432 167.83 6.025 302.21 141.191 308.205 308.205.232 6.449-4.978 11.787-11.432 11.787z"]
};
var faRubleSign = {
prefix: 'fas',
iconName: 'ruble-sign',
icon: [384, 512, [], "f158", "M239.36 320C324.48 320 384 260.542 384 175.071S324.48 32 239.36 32H76c-6.627 0-12 5.373-12 12v206.632H12c-6.627 0-12 5.373-12 12V308c0 6.627 5.373 12 12 12h52v32H12c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h52v52c0 6.627 5.373 12 12 12h58.56c6.627 0 12-5.373 12-12v-52H308c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12H146.56v-32h92.8zm-92.8-219.252h78.72c46.72 0 74.88 29.11 74.88 74.323 0 45.832-28.16 75.561-76.16 75.561h-77.44V100.748z"]
};
var faRuler = {
prefix: 'fas',
iconName: 'ruler',
icon: [640, 512, [], "f545", "M635.7 167.2L556.1 31.7c-8.8-15-28.3-20.1-43.5-11.5l-69 39.1L503.3 161c2.2 3.8.9 8.5-2.9 10.7l-13.8 7.8c-3.8 2.2-8.7.9-10.9-2.9L416 75l-55.2 31.3 27.9 47.4c2.2 3.8.9 8.5-2.9 10.7l-13.8 7.8c-3.8 2.2-8.7.9-10.9-2.9L333.2 122 278 153.3 337.8 255c2.2 3.7.9 8.5-2.9 10.7l-13.8 7.8c-3.8 2.2-8.7.9-10.9-2.9l-59.7-101.7-55.2 31.3 27.9 47.4c2.2 3.8.9 8.5-2.9 10.7l-13.8 7.8c-3.8 2.2-8.7.9-10.9-2.9l-27.9-47.5-55.2 31.3 59.7 101.7c2.2 3.7.9 8.5-2.9 10.7l-13.8 7.8c-3.8 2.2-8.7.9-10.9-2.9L84.9 262.9l-69 39.1C.7 310.7-4.6 329.8 4.2 344.8l79.6 135.6c8.8 15 28.3 20.1 43.5 11.5L624.1 210c15.2-8.6 20.4-27.8 11.6-42.8z"]
};
var faRulerCombined = {
prefix: 'fas',
iconName: 'ruler-combined',
icon: [512, 512, [], "f546", "M160 288h-56c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h56v-64h-56c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h56V96h-56c-4.42 0-8-3.58-8-8V72c0-4.42 3.58-8 8-8h56V32c0-17.67-14.33-32-32-32H32C14.33 0 0 14.33 0 32v448c0 2.77.91 5.24 1.57 7.8L160 329.38V288zm320 64h-32v56c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-56h-64v56c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-56h-64v56c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-56h-41.37L24.2 510.43c2.56.66 5.04 1.57 7.8 1.57h448c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32z"]
};
var faRulerHorizontal = {
prefix: 'fas',
iconName: 'ruler-horizontal',
icon: [576, 512, [], "f547", "M544 128h-48v88c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-88h-64v88c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-88h-64v88c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-88h-64v88c0 4.42-3.58 8-8 8h-16c-4.42 0-8-3.58-8-8v-88h-64v88c0 4.42-3.58 8-8 8H88c-4.42 0-8-3.58-8-8v-88H32c-17.67 0-32 14.33-32 32v192c0 17.67 14.33 32 32 32h512c17.67 0 32-14.33 32-32V160c0-17.67-14.33-32-32-32z"]
};
var faRulerVertical = {
prefix: 'fas',
iconName: 'ruler-vertical',
icon: [256, 512, [], "f548", "M168 416c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h88v-64h-88c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h88v-64h-88c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h88v-64h-88c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h88V32c0-17.67-14.33-32-32-32H32C14.33 0 0 14.33 0 32v448c0 17.67 14.33 32 32 32h192c17.67 0 32-14.33 32-32v-64h-88z"]
};
var faRunning = {
prefix: 'fas',
iconName: 'running',
icon: [416, 512, [], "f70c", "M272 96c26.51 0 48-21.49 48-48S298.51 0 272 0s-48 21.49-48 48 21.49 48 48 48zM113.69 317.47l-14.8 34.52H32c-17.67 0-32 14.33-32 32s14.33 32 32 32h77.45c19.25 0 36.58-11.44 44.11-29.09l8.79-20.52-10.67-6.3c-17.32-10.23-30.06-25.37-37.99-42.61zM384 223.99h-44.03l-26.06-53.25c-12.5-25.55-35.45-44.23-61.78-50.94l-71.08-21.14c-28.3-6.8-57.77-.55-80.84 17.14l-39.67 30.41c-14.03 10.75-16.69 30.83-5.92 44.86s30.84 16.66 44.86 5.92l39.69-30.41c7.67-5.89 17.44-8 25.27-6.14l14.7 4.37-37.46 87.39c-12.62 29.48-1.31 64.01 26.3 80.31l84.98 50.17-27.47 87.73c-5.28 16.86 4.11 34.81 20.97 40.09 3.19 1 6.41 1.48 9.58 1.48 13.61 0 26.23-8.77 30.52-22.45l31.64-101.06c5.91-20.77-2.89-43.08-21.64-54.39l-61.24-36.14 31.31-78.28 20.27 41.43c8 16.34 24.92 26.89 43.11 26.89H384c17.67 0 32-14.33 32-32s-14.33-31.99-32-31.99z"]
};
var faRupeeSign = {
prefix: 'fas',
iconName: 'rupee-sign',
icon: [320, 512, [], "f156", "M308 96c6.627 0 12-5.373 12-12V44c0-6.627-5.373-12-12-12H12C5.373 32 0 37.373 0 44v44.748c0 6.627 5.373 12 12 12h85.28c27.308 0 48.261 9.958 60.97 27.252H12c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h158.757c-6.217 36.086-32.961 58.632-74.757 58.632H12c-6.627 0-12 5.373-12 12v53.012c0 3.349 1.4 6.546 3.861 8.818l165.052 152.356a12.001 12.001 0 0 0 8.139 3.182h82.562c10.924 0 16.166-13.408 8.139-20.818L116.871 319.906c76.499-2.34 131.144-53.395 138.318-127.906H308c6.627 0 12-5.373 12-12v-40c0-6.627-5.373-12-12-12h-58.69c-3.486-11.541-8.28-22.246-14.252-32H308z"]
};
var faSadCry = {
prefix: 'fas',
iconName: 'sad-cry',
icon: [496, 512, [], "f5b3", "M248 8C111 8 0 119 0 256c0 90.1 48.2 168.7 120 212.1V288c0-8.8 7.2-16 16-16s16 7.2 16 16v196.7c29.5 12.4 62 19.3 96 19.3s66.5-6.9 96-19.3V288c0-8.8 7.2-16 16-16s16 7.2 16 16v180.1C447.8 424.7 496 346 496 256 496 119 385 8 248 8zm-65.5 216.5c-14.8-13.2-46.2-13.2-61 0L112 233c-3.8 3.3-9.3 4-13.7 1.6-4.4-2.4-6.9-7.4-6.1-12.4 4-25.2 34.2-42.1 59.9-42.1S208 197 212 222.2c.8 5-1.7 10-6.1 12.4-5.8 3.1-11.2.7-13.7-1.6l-9.7-8.5zM248 416c-26.5 0-48-28.7-48-64s21.5-64 48-64 48 28.7 48 64-21.5 64-48 64zm149.8-181.5c-5.8 3.1-11.2.7-13.7-1.6l-9.5-8.5c-14.8-13.2-46.2-13.2-61 0L304 233c-3.8 3.3-9.3 4-13.7 1.6-4.4-2.4-6.9-7.4-6.1-12.4 4-25.2 34.2-42.1 59.9-42.1S400 197 404 222.2c.6 4.9-1.8 9.9-6.2 12.3z"]
};
var faSadTear = {
prefix: 'fas',
iconName: 'sad-tear',
icon: [496, 512, [], "f5b4", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 168c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zM152 416c-26.5 0-48-21-48-47 0-20 28.5-60.4 41.6-77.8 3.2-4.3 9.6-4.3 12.8 0C171.5 308.6 200 349 200 369c0 26-21.5 47-48 47zm16-176c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm170.2 154.2C315.8 367.4 282.9 352 248 352c-21.2 0-21.2-32 0-32 44.4 0 86.3 19.6 114.7 53.8 13.8 16.4-11.2 36.5-24.5 20.4z"]
};
var faSatellite = {
prefix: 'fas',
iconName: 'satellite',
icon: [512, 512, [], "f7bf", "M502.60969,310.04206l-96.70393,96.71625a31.88151,31.88151,0,0,1-45.00765,0L280.572,326.34115l-9.89231,9.90759a190.56343,190.56343,0,0,1-5.40716,168.52287c-4.50077,8.50115-16.39342,9.59505-23.20707,2.79725L134.54715,400.05428l-17.7999,17.79929c.70324,2.60972,1.60965,5.00067,1.60965,7.79793a32.00544,32.00544,0,1,1-32.00544-32.00434c2.79735,0,5.18838.90637,7.7982,1.60959l17.7999-17.79929L4.43129,269.94287c-6.798-6.81342-5.70409-18.6119,2.79735-23.20627a190.58161,190.58161,0,0,1,168.52864-5.407l9.79854-9.79821-80.31053-80.41716a32.002,32.002,0,0,1,0-45.09987L201.96474,9.29814A31.62639,31.62639,0,0,1,224.46868,0a31.99951,31.99951,0,0,1,22.59759,9.29814l80.32615,80.30777,47.805-47.89713a33.6075,33.6075,0,0,1,47.50808,0l47.50807,47.50645a33.63308,33.63308,0,0,1,0,47.50644l-47.805,47.89713L502.71908,265.036A31.78938,31.78938,0,0,1,502.60969,310.04206ZM219.56159,197.433l73.82505-73.82252-68.918-68.9-73.80942,73.80689Zm237.74352,90.106-68.90233-68.9156-73.825,73.82252,68.918,68.9Z"]
};
var faSatelliteDish = {
prefix: 'fas',
iconName: 'satellite-dish',
icon: [512, 512, [], "f7c0", "M305.44954,462.59c7.39157,7.29792,6.18829,20.09661-3.00038,25.00356-77.713,41.80281-176.72559,29.9105-242.34331-35.7082C-5.49624,386.28227-17.404,287.362,24.41381,209.554c4.89125-9.095,17.68975-10.29834,25.00318-3.00043L166.22872,323.36708l27.39411-27.39452c-.68759-2.60974-1.594-5.00071-1.594-7.81361a32.00407,32.00407,0,1,1,32.00407,32.00455c-2.79723,0-5.20378-.89075-7.79786-1.594l-27.40974,27.41015ZM511.9758,303.06732a16.10336,16.10336,0,0,1-16.002,17.00242H463.86031a15.96956,15.96956,0,0,1-15.89265-15.00213C440.46671,175.5492,336.45348,70.53427,207.03078,63.53328a15.84486,15.84486,0,0,1-15.00191-15.90852V16.02652A16.09389,16.09389,0,0,1,209.031.02425C372.25491,8.61922,503.47472,139.841,511.9758,303.06732Zm-96.01221-.29692a16.21093,16.21093,0,0,1-16.11142,17.29934H367.645a16.06862,16.06862,0,0,1-15.89265-14.70522c-6.90712-77.01094-68.118-138.91037-144.92467-145.22376a15.94,15.94,0,0,1-14.79876-15.89289V112.13393a16.134,16.134,0,0,1,17.29908-16.096C319.45132,104.5391,407.55627,192.64538,415.96359,302.7704Z"]
};
var faSave = {
prefix: 'fas',
iconName: 'save',
icon: [448, 512, [], "f0c7", "M433.941 129.941l-83.882-83.882A48 48 0 0 0 316.118 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48V163.882a48 48 0 0 0-14.059-33.941zM224 416c-35.346 0-64-28.654-64-64 0-35.346 28.654-64 64-64s64 28.654 64 64c0 35.346-28.654 64-64 64zm96-304.52V212c0 6.627-5.373 12-12 12H76c-6.627 0-12-5.373-12-12V108c0-6.627 5.373-12 12-12h228.52c3.183 0 6.235 1.264 8.485 3.515l3.48 3.48A11.996 11.996 0 0 1 320 111.48z"]
};
var faSchool = {
prefix: 'fas',
iconName: 'school',
icon: [640, 512, [], "f549", "M0 224v272c0 8.84 7.16 16 16 16h80V192H32c-17.67 0-32 14.33-32 32zm360-48h-24v-40c0-4.42-3.58-8-8-8h-16c-4.42 0-8 3.58-8 8v64c0 4.42 3.58 8 8 8h48c4.42 0 8-3.58 8-8v-16c0-4.42-3.58-8-8-8zm137.75-63.96l-160-106.67a32.02 32.02 0 0 0-35.5 0l-160 106.67A32.002 32.002 0 0 0 128 138.66V512h128V368c0-8.84 7.16-16 16-16h96c8.84 0 16 7.16 16 16v144h128V138.67c0-10.7-5.35-20.7-14.25-26.63zM320 256c-44.18 0-80-35.82-80-80s35.82-80 80-80 80 35.82 80 80-35.82 80-80 80zm288-64h-64v320h80c8.84 0 16-7.16 16-16V224c0-17.67-14.33-32-32-32z"]
};
var faScrewdriver = {
prefix: 'fas',
iconName: 'screwdriver',
icon: [512, 512, [], "f54a", "M448 0L320 96v62.06l-83.03 83.03c6.79 4.25 13.27 9.06 19.07 14.87 5.8 5.8 10.62 12.28 14.87 19.07L353.94 192H416l96-128-64-64zM128 278.59L10.92 395.67c-14.55 14.55-14.55 38.15 0 52.71l52.7 52.7c14.56 14.56 38.15 14.56 52.71 0L233.41 384c29.11-29.11 29.11-76.3 0-105.41s-76.3-29.11-105.41 0z"]
};
var faScroll = {
prefix: 'fas',
iconName: 'scroll',
icon: [640, 512, [], "f70e", "M48 0C21.53 0 0 21.53 0 48v64c0 8.84 7.16 16 16 16h80V48C96 21.53 74.47 0 48 0zm208 412.57V352h288V96c0-52.94-43.06-96-96-96H111.59C121.74 13.41 128 29.92 128 48v368c0 38.87 34.65 69.65 74.75 63.12C234.22 474 256 444.46 256 412.57zM288 384v32c0 52.93-43.06 96-96 96h336c61.86 0 112-50.14 112-112 0-8.84-7.16-16-16-16H288z"]
};
var faSdCard = {
prefix: 'fas',
iconName: 'sd-card',
icon: [384, 512, [], "f7c2", "M320 0H128L0 128v320c0 35.3 28.7 64 64 64h256c35.3 0 64-28.7 64-64V64c0-35.3-28.7-64-64-64zM160 160h-48V64h48v96zm80 0h-48V64h48v96zm80 0h-48V64h48v96z"]
};
var faSearch = {
prefix: 'fas',
iconName: 'search',
icon: [512, 512, [], "f002", "M505 442.7L405.3 343c-4.5-4.5-10.6-7-17-7H372c27.6-35.3 44-79.7 44-128C416 93.1 322.9 0 208 0S0 93.1 0 208s93.1 208 208 208c48.3 0 92.7-16.4 128-44v16.3c0 6.4 2.5 12.5 7 17l99.7 99.7c9.4 9.4 24.6 9.4 33.9 0l28.3-28.3c9.4-9.4 9.4-24.6.1-34zM208 336c-70.7 0-128-57.2-128-128 0-70.7 57.2-128 128-128 70.7 0 128 57.2 128 128 0 70.7-57.2 128-128 128z"]
};
var faSearchDollar = {
prefix: 'fas',
iconName: 'search-dollar',
icon: [512, 512, [], "f688", "M505.04 442.66l-99.71-99.69c-4.5-4.5-10.6-7-17-7h-16.3c27.6-35.3 44-79.69 44-127.99C416.03 93.09 322.92 0 208.02 0S0 93.09 0 207.98s93.11 207.98 208.02 207.98c48.3 0 92.71-16.4 128.01-44v16.3c0 6.4 2.5 12.5 7 17l99.71 99.69c9.4 9.4 24.6 9.4 33.9 0l28.3-28.3c9.4-9.4 9.4-24.59.1-33.99zm-297.02-90.7c-79.54 0-144-64.34-144-143.98 0-79.53 64.35-143.98 144-143.98 79.54 0 144 64.34 144 143.98 0 79.53-64.35 143.98-144 143.98zm27.11-152.54l-45.01-13.5c-5.16-1.55-8.77-6.78-8.77-12.73 0-7.27 5.3-13.19 11.8-13.19h28.11c4.56 0 8.96 1.29 12.82 3.72 3.24 2.03 7.36 1.91 10.13-.73l11.75-11.21c3.53-3.37 3.33-9.21-.57-12.14-9.1-6.83-20.08-10.77-31.37-11.35V112c0-4.42-3.58-8-8-8h-16c-4.42 0-8 3.58-8 8v16.12c-23.63.63-42.68 20.55-42.68 45.07 0 19.97 12.99 37.81 31.58 43.39l45.01 13.5c5.16 1.55 8.77 6.78 8.77 12.73 0 7.27-5.3 13.19-11.8 13.19h-28.1c-4.56 0-8.96-1.29-12.82-3.72-3.24-2.03-7.36-1.91-10.13.73l-11.75 11.21c-3.53 3.37-3.33 9.21.57 12.14 9.1 6.83 20.08 10.77 31.37 11.35V304c0 4.42 3.58 8 8 8h16c4.42 0 8-3.58 8-8v-16.12c23.63-.63 42.68-20.54 42.68-45.07 0-19.97-12.99-37.81-31.59-43.39z"]
};
var faSearchLocation = {
prefix: 'fas',
iconName: 'search-location',
icon: [512, 512, [], "f689", "M505.04 442.66l-99.71-99.69c-4.5-4.5-10.6-7-17-7h-16.3c27.6-35.3 44-79.69 44-127.99C416.03 93.09 322.92 0 208.02 0S0 93.09 0 207.98s93.11 207.98 208.02 207.98c48.3 0 92.71-16.4 128.01-44v16.3c0 6.4 2.5 12.5 7 17l99.71 99.69c9.4 9.4 24.6 9.4 33.9 0l28.3-28.3c9.4-9.4 9.4-24.59.1-33.99zm-297.02-90.7c-79.54 0-144-64.34-144-143.98 0-79.53 64.35-143.98 144-143.98 79.54 0 144 64.34 144 143.98 0 79.53-64.35 143.98-144 143.98zm.02-239.96c-40.78 0-73.84 33.05-73.84 73.83 0 32.96 48.26 93.05 66.75 114.86a9.24 9.24 0 0 0 14.18 0c18.49-21.81 66.75-81.89 66.75-114.86 0-40.78-33.06-73.83-73.84-73.83zm0 96c-13.26 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24z"]
};
var faSearchMinus = {
prefix: 'fas',
iconName: 'search-minus',
icon: [512, 512, [], "f010", "M304 192v32c0 6.6-5.4 12-12 12H124c-6.6 0-12-5.4-12-12v-32c0-6.6 5.4-12 12-12h168c6.6 0 12 5.4 12 12zm201 284.7L476.7 505c-9.4 9.4-24.6 9.4-33.9 0L343 405.3c-4.5-4.5-7-10.6-7-17V372c-35.3 27.6-79.7 44-128 44C93.1 416 0 322.9 0 208S93.1 0 208 0s208 93.1 208 208c0 48.3-16.4 92.7-44 128h16.3c6.4 0 12.5 2.5 17 7l99.7 99.7c9.3 9.4 9.3 24.6 0 34zM344 208c0-75.2-60.8-136-136-136S72 132.8 72 208s60.8 136 136 136 136-60.8 136-136z"]
};
var faSearchPlus = {
prefix: 'fas',
iconName: 'search-plus',
icon: [512, 512, [], "f00e", "M304 192v32c0 6.6-5.4 12-12 12h-56v56c0 6.6-5.4 12-12 12h-32c-6.6 0-12-5.4-12-12v-56h-56c-6.6 0-12-5.4-12-12v-32c0-6.6 5.4-12 12-12h56v-56c0-6.6 5.4-12 12-12h32c6.6 0 12 5.4 12 12v56h56c6.6 0 12 5.4 12 12zm201 284.7L476.7 505c-9.4 9.4-24.6 9.4-33.9 0L343 405.3c-4.5-4.5-7-10.6-7-17V372c-35.3 27.6-79.7 44-128 44C93.1 416 0 322.9 0 208S93.1 0 208 0s208 93.1 208 208c0 48.3-16.4 92.7-44 128h16.3c6.4 0 12.5 2.5 17 7l99.7 99.7c9.3 9.4 9.3 24.6 0 34zM344 208c0-75.2-60.8-136-136-136S72 132.8 72 208s60.8 136 136 136 136-60.8 136-136z"]
};
var faSeedling = {
prefix: 'fas',
iconName: 'seedling',
icon: [512, 512, [], "f4d8", "M64 96H0c0 123.7 100.3 224 224 224v144c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V320C288 196.3 187.7 96 64 96zm384-64c-84.2 0-157.4 46.5-195.7 115.2 27.7 30.2 48.2 66.9 59 107.6C424 243.1 512 147.9 512 32h-64z"]
};
var faServer = {
prefix: 'fas',
iconName: 'server',
icon: [512, 512, [], "f233", "M480 160H32c-17.673 0-32-14.327-32-32V64c0-17.673 14.327-32 32-32h448c17.673 0 32 14.327 32 32v64c0 17.673-14.327 32-32 32zm-48-88c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24zm-64 0c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24zm112 248H32c-17.673 0-32-14.327-32-32v-64c0-17.673 14.327-32 32-32h448c17.673 0 32 14.327 32 32v64c0 17.673-14.327 32-32 32zm-48-88c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24zm-64 0c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24zm112 248H32c-17.673 0-32-14.327-32-32v-64c0-17.673 14.327-32 32-32h448c17.673 0 32 14.327 32 32v64c0 17.673-14.327 32-32 32zm-48-88c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24zm-64 0c-13.255 0-24 10.745-24 24s10.745 24 24 24 24-10.745 24-24-10.745-24-24-24z"]
};
var faShapes = {
prefix: 'fas',
iconName: 'shapes',
icon: [512, 512, [], "f61f", "M128,256A128,128,0,1,0,256,384,128,128,0,0,0,128,256Zm379-54.86L400.07,18.29a37.26,37.26,0,0,0-64.14,0L229,201.14C214.76,225.52,232.58,256,261.09,256H474.91C503.42,256,521.24,225.52,507,201.14ZM480,288H320a32,32,0,0,0-32,32V480a32,32,0,0,0,32,32H480a32,32,0,0,0,32-32V320A32,32,0,0,0,480,288Z"]
};
var faShare = {
prefix: 'fas',
iconName: 'share',
icon: [512, 512, [], "f064", "M503.691 189.836L327.687 37.851C312.281 24.546 288 35.347 288 56.015v80.053C127.371 137.907 0 170.1 0 322.326c0 61.441 39.581 122.309 83.333 154.132 13.653 9.931 33.111-2.533 28.077-18.631C66.066 312.814 132.917 274.316 288 272.085V360c0 20.7 24.3 31.453 39.687 18.164l176.004-152c11.071-9.562 11.086-26.753 0-36.328z"]
};
var faShareAlt = {
prefix: 'fas',
iconName: 'share-alt',
icon: [448, 512, [], "f1e0", "M352 320c-22.608 0-43.387 7.819-59.79 20.895l-102.486-64.054a96.551 96.551 0 0 0 0-41.683l102.486-64.054C308.613 184.181 329.392 192 352 192c53.019 0 96-42.981 96-96S405.019 0 352 0s-96 42.981-96 96c0 7.158.79 14.13 2.276 20.841L155.79 180.895C139.387 167.819 118.608 160 96 160c-53.019 0-96 42.981-96 96s42.981 96 96 96c22.608 0 43.387-7.819 59.79-20.895l102.486 64.054A96.301 96.301 0 0 0 256 416c0 53.019 42.981 96 96 96s96-42.981 96-96-42.981-96-96-96z"]
};
var faShareAltSquare = {
prefix: 'fas',
iconName: 'share-alt-square',
icon: [448, 512, [], "f1e1", "M448 80v352c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48V80c0-26.51 21.49-48 48-48h352c26.51 0 48 21.49 48 48zM304 296c-14.562 0-27.823 5.561-37.783 14.671l-67.958-40.775a56.339 56.339 0 0 0 0-27.793l67.958-40.775C276.177 210.439 289.438 216 304 216c30.928 0 56-25.072 56-56s-25.072-56-56-56-56 25.072-56 56c0 4.797.605 9.453 1.74 13.897l-67.958 40.775C171.823 205.561 158.562 200 144 200c-30.928 0-56 25.072-56 56s25.072 56 56 56c14.562 0 27.823-5.561 37.783-14.671l67.958 40.775a56.088 56.088 0 0 0-1.74 13.897c0 30.928 25.072 56 56 56s56-25.072 56-56C360 321.072 334.928 296 304 296z"]
};
var faShareSquare = {
prefix: 'fas',
iconName: 'share-square',
icon: [576, 512, [], "f14d", "M568.482 177.448L424.479 313.433C409.3 327.768 384 317.14 384 295.985v-71.963c-144.575.97-205.566 35.113-164.775 171.353 4.483 14.973-12.846 26.567-25.006 17.33C155.252 383.105 120 326.488 120 269.339c0-143.937 117.599-172.5 264-173.312V24.012c0-21.174 25.317-31.768 40.479-17.448l144.003 135.988c10.02 9.463 10.028 25.425 0 34.896zM384 379.128V448H64V128h50.916a11.99 11.99 0 0 0 8.648-3.693c14.953-15.568 32.237-27.89 51.014-37.676C185.708 80.83 181.584 64 169.033 64H48C21.49 64 0 85.49 0 112v352c0 26.51 21.49 48 48 48h352c26.51 0 48-21.49 48-48v-88.806c0-8.288-8.197-14.066-16.011-11.302a71.83 71.83 0 0 1-34.189 3.377c-7.27-1.046-13.8 4.514-13.8 11.859z"]
};
var faShekelSign = {
prefix: 'fas',
iconName: 'shekel-sign',
icon: [448, 512, [], "f20b", "M248 168v168c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V168c0-75.11-60.89-136-136-136H24C10.75 32 0 42.74 0 56v408c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V112h112c30.93 0 56 25.07 56 56zM432 32h-48c-8.84 0-16 7.16-16 16v296c0 30.93-25.07 56-56 56H200V176c0-8.84-7.16-16-16-16h-48c-8.84 0-16 7.16-16 16v280c0 13.25 10.75 24 24 24h168c75.11 0 136-60.89 136-136V48c0-8.84-7.16-16-16-16z"]
};
var faShieldAlt = {
prefix: 'fas',
iconName: 'shield-alt',
icon: [512, 512, [], "f3ed", "M466.5 83.7l-192-80a48.15 48.15 0 0 0-36.9 0l-192 80C27.7 91.1 16 108.6 16 128c0 198.5 114.5 335.7 221.5 380.3 11.8 4.9 25.1 4.9 36.9 0C360.1 472.6 496 349.3 496 128c0-19.4-11.7-36.9-29.5-44.3zM256.1 446.3l-.1-381 175.9 73.3c-3.3 151.4-82.1 261.1-175.8 307.7z"]
};
var faShieldVirus = {
prefix: 'fas',
iconName: 'shield-virus',
icon: [512, 512, [], "e06c", "M224,192a16,16,0,1,0,16,16A16,16,0,0,0,224,192ZM466.5,83.68l-192-80A57.4,57.4,0,0,0,256.05,0a57.4,57.4,0,0,0-18.46,3.67l-192,80A47.93,47.93,0,0,0,16,128C16,326.5,130.5,463.72,237.5,508.32a48.09,48.09,0,0,0,36.91,0C360.09,472.61,496,349.3,496,128A48,48,0,0,0,466.5,83.68ZM384,256H371.88c-28.51,0-42.79,34.47-22.63,54.63l8.58,8.57a16,16,0,1,1-22.63,22.63l-8.57-8.58C306.47,313.09,272,327.37,272,355.88V368a16,16,0,0,1-32,0V355.88c0-28.51-34.47-42.79-54.63-22.63l-8.57,8.58a16,16,0,0,1-22.63-22.63l8.58-8.57c20.16-20.16,5.88-54.63-22.63-54.63H128a16,16,0,0,1,0-32h12.12c28.51,0,42.79-34.47,22.63-54.63l-8.58-8.57a16,16,0,0,1,22.63-22.63l8.57,8.58c20.16,20.16,54.63,5.88,54.63-22.63V112a16,16,0,0,1,32,0v12.12c0,28.51,34.47,42.79,54.63,22.63l8.57-8.58a16,16,0,0,1,22.63,22.63l-8.58,8.57C329.09,189.53,343.37,224,371.88,224H384a16,16,0,0,1,0,32Zm-96,0a16,16,0,1,0,16,16A16,16,0,0,0,288,256Z"]
};
var faShip = {
prefix: 'fas',
iconName: 'ship',
icon: [640, 512, [], "f21a", "M496.616 372.639l70.012-70.012c16.899-16.9 9.942-45.771-12.836-53.092L512 236.102V96c0-17.673-14.327-32-32-32h-64V24c0-13.255-10.745-24-24-24H248c-13.255 0-24 10.745-24 24v40h-64c-17.673 0-32 14.327-32 32v140.102l-41.792 13.433c-22.753 7.313-29.754 36.173-12.836 53.092l70.012 70.012C125.828 416.287 85.587 448 24 448c-13.255 0-24 10.745-24 24v16c0 13.255 10.745 24 24 24 61.023 0 107.499-20.61 143.258-59.396C181.677 487.432 216.021 512 256 512h128c39.979 0 74.323-24.568 88.742-59.396C508.495 491.384 554.968 512 616 512c13.255 0 24-10.745 24-24v-16c0-13.255-10.745-24-24-24-60.817 0-101.542-31.001-119.384-75.361zM192 128h256v87.531l-118.208-37.995a31.995 31.995 0 0 0-19.584 0L192 215.531V128z"]
};
var faShippingFast = {
prefix: 'fas',
iconName: 'shipping-fast',
icon: [640, 512, [], "f48b", "M624 352h-16V243.9c0-12.7-5.1-24.9-14.1-33.9L494 110.1c-9-9-21.2-14.1-33.9-14.1H416V48c0-26.5-21.5-48-48-48H112C85.5 0 64 21.5 64 48v48H8c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8h272c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H40c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8h208c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H8c-4.4 0-8 3.6-8 8v16c0 4.4 3.6 8 8 8h208c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H64v128c0 53 43 96 96 96s96-43 96-96h128c0 53 43 96 96 96s96-43 96-96h48c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM160 464c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm320 0c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm80-208H416V144h44.1l99.9 99.9V256z"]
};
var faShoePrints = {
prefix: 'fas',
iconName: 'shoe-prints',
icon: [640, 512, [], "f54b", "M192 160h32V32h-32c-35.35 0-64 28.65-64 64s28.65 64 64 64zM0 416c0 35.35 28.65 64 64 64h32V352H64c-35.35 0-64 28.65-64 64zm337.46-128c-34.91 0-76.16 13.12-104.73 32-24.79 16.38-44.52 32-104.73 32v128l57.53 15.97c26.21 7.28 53.01 13.12 80.31 15.05 32.69 2.31 65.6.67 97.58-6.2C472.9 481.3 512 429.22 512 384c0-64-84.18-96-174.54-96zM491.42 7.19C459.44.32 426.53-1.33 393.84.99c-27.3 1.93-54.1 7.77-80.31 15.04L256 32v128c60.2 0 79.94 15.62 104.73 32 28.57 18.88 69.82 32 104.73 32C555.82 224 640 192 640 128c0-45.22-39.1-97.3-148.58-120.81z"]
};
var faShoppingBag = {
prefix: 'fas',
iconName: 'shopping-bag',
icon: [448, 512, [], "f290", "M352 160v-32C352 57.42 294.579 0 224 0 153.42 0 96 57.42 96 128v32H0v272c0 44.183 35.817 80 80 80h288c44.183 0 80-35.817 80-80V160h-96zm-192-32c0-35.29 28.71-64 64-64s64 28.71 64 64v32H160v-32zm160 120c-13.255 0-24-10.745-24-24s10.745-24 24-24 24 10.745 24 24-10.745 24-24 24zm-192 0c-13.255 0-24-10.745-24-24s10.745-24 24-24 24 10.745 24 24-10.745 24-24 24z"]
};
var faShoppingBasket = {
prefix: 'fas',
iconName: 'shopping-basket',
icon: [576, 512, [], "f291", "M576 216v16c0 13.255-10.745 24-24 24h-8l-26.113 182.788C514.509 462.435 494.257 480 470.37 480H105.63c-23.887 0-44.139-17.565-47.518-41.212L32 256h-8c-13.255 0-24-10.745-24-24v-16c0-13.255 10.745-24 24-24h67.341l106.78-146.821c10.395-14.292 30.407-17.453 44.701-7.058 14.293 10.395 17.453 30.408 7.058 44.701L170.477 192h235.046L326.12 82.821c-10.395-14.292-7.234-34.306 7.059-44.701 14.291-10.395 34.306-7.235 44.701 7.058L484.659 192H552c13.255 0 24 10.745 24 24zM312 392V280c0-13.255-10.745-24-24-24s-24 10.745-24 24v112c0 13.255 10.745 24 24 24s24-10.745 24-24zm112 0V280c0-13.255-10.745-24-24-24s-24 10.745-24 24v112c0 13.255 10.745 24 24 24s24-10.745 24-24zm-224 0V280c0-13.255-10.745-24-24-24s-24 10.745-24 24v112c0 13.255 10.745 24 24 24s24-10.745 24-24z"]
};
var faShoppingCart = {
prefix: 'fas',
iconName: 'shopping-cart',
icon: [576, 512, [], "f07a", "M528.12 301.319l47.273-208C578.806 78.301 567.391 64 551.99 64H159.208l-9.166-44.81C147.758 8.021 137.93 0 126.529 0H24C10.745 0 0 10.745 0 24v16c0 13.255 10.745 24 24 24h69.883l70.248 343.435C147.325 417.1 136 435.222 136 456c0 30.928 25.072 56 56 56s56-25.072 56-56c0-15.674-6.447-29.835-16.824-40h209.647C430.447 426.165 424 440.326 424 456c0 30.928 25.072 56 56 56s56-25.072 56-56c0-22.172-12.888-41.332-31.579-50.405l5.517-24.276c3.413-15.018-8.002-29.319-23.403-29.319H218.117l-6.545-32h293.145c11.206 0 20.92-7.754 23.403-18.681z"]
};
var faShower = {
prefix: 'fas',
iconName: 'shower',
icon: [512, 512, [], "f2cc", "M304,320a16,16,0,1,0,16,16A16,16,0,0,0,304,320Zm32-96a16,16,0,1,0,16,16A16,16,0,0,0,336,224Zm32,64a16,16,0,1,0-16-16A16,16,0,0,0,368,288Zm-32,32a16,16,0,1,0-16-16A16,16,0,0,0,336,320Zm-32-64a16,16,0,1,0,16,16A16,16,0,0,0,304,256Zm128-32a16,16,0,1,0-16-16A16,16,0,0,0,432,224Zm-48,16a16,16,0,1,0,16-16A16,16,0,0,0,384,240Zm-16-48a16,16,0,1,0,16,16A16,16,0,0,0,368,192Zm96,32a16,16,0,1,0,16,16A16,16,0,0,0,464,224Zm32-32a16,16,0,1,0,16,16A16,16,0,0,0,496,192Zm-64,64a16,16,0,1,0,16,16A16,16,0,0,0,432,256Zm-32,32a16,16,0,1,0,16,16A16,16,0,0,0,400,288Zm-64,64a16,16,0,1,0,16,16A16,16,0,0,0,336,352Zm-32,32a16,16,0,1,0,16,16A16,16,0,0,0,304,384Zm64-64a16,16,0,1,0,16,16A16,16,0,0,0,368,320Zm21.65-218.35-11.3-11.31a16,16,0,0,0-22.63,0L350.05,96A111.19,111.19,0,0,0,272,64c-19.24,0-37.08,5.3-52.9,13.85l-10-10A121.72,121.72,0,0,0,123.44,32C55.49,31.5,0,92.91,0,160.85V464a16,16,0,0,0,16,16H48a16,16,0,0,0,16-16V158.4c0-30.15,21-58.2,51-61.93a58.38,58.38,0,0,1,48.93,16.67l10,10C165.3,138.92,160,156.76,160,176a111.23,111.23,0,0,0,32,78.05l-5.66,5.67a16,16,0,0,0,0,22.62l11.3,11.31a16,16,0,0,0,22.63,0L389.65,124.28A16,16,0,0,0,389.65,101.65Z"]
};
var faShuttleVan = {
prefix: 'fas',
iconName: 'shuttle-van',
icon: [640, 512, [], "f5b6", "M628.88 210.65L494.39 49.27A48.01 48.01 0 0 0 457.52 32H32C14.33 32 0 46.33 0 64v288c0 17.67 14.33 32 32 32h32c0 53.02 42.98 96 96 96s96-42.98 96-96h128c0 53.02 42.98 96 96 96s96-42.98 96-96h32c17.67 0 32-14.33 32-32V241.38c0-11.23-3.94-22.1-11.12-30.73zM64 192V96h96v96H64zm96 240c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm160-240h-96V96h96v96zm160 240c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm-96-240V96h66.02l80 96H384z"]
};
var faSign = {
prefix: 'fas',
iconName: 'sign',
icon: [512, 512, [], "f4d9", "M496 64H128V16c0-8.8-7.2-16-16-16H80c-8.8 0-16 7.2-16 16v48H16C7.2 64 0 71.2 0 80v32c0 8.8 7.2 16 16 16h48v368c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V128h368c8.8 0 16-7.2 16-16V80c0-8.8-7.2-16-16-16zM160 384h320V160H160v224z"]
};
var faSignInAlt = {
prefix: 'fas',
iconName: 'sign-in-alt',
icon: [512, 512, [], "f2f6", "M416 448h-84c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h84c17.7 0 32-14.3 32-32V160c0-17.7-14.3-32-32-32h-84c-6.6 0-12-5.4-12-12V76c0-6.6 5.4-12 12-12h84c53 0 96 43 96 96v192c0 53-43 96-96 96zm-47-201L201 79c-15-15-41-4.5-41 17v96H24c-13.3 0-24 10.7-24 24v96c0 13.3 10.7 24 24 24h136v96c0 21.5 26 32 41 17l168-168c9.3-9.4 9.3-24.6 0-34z"]
};
var faSignLanguage = {
prefix: 'fas',
iconName: 'sign-language',
icon: [448, 512, [], "f2a7", "M91.434 483.987c-.307-16.018 13.109-29.129 29.13-29.129h62.293v-5.714H56.993c-16.021 0-29.437-13.111-29.13-29.129C28.16 404.491 40.835 392 56.428 392h126.429v-5.714H29.136c-16.021 0-29.437-13.111-29.13-29.129.297-15.522 12.973-28.013 28.566-28.013h154.286v-5.714H57.707c-16.021 0-29.437-13.111-29.13-29.129.297-15.522 12.973-28.013 28.566-28.013h168.566l-31.085-22.606c-12.762-9.281-15.583-27.149-6.302-39.912 9.281-12.761 27.15-15.582 39.912-6.302l123.361 89.715a34.287 34.287 0 0 1 14.12 27.728v141.136c0 15.91-10.946 29.73-26.433 33.374l-80.471 18.934a137.16 137.16 0 0 1-31.411 3.646H120c-15.593-.001-28.269-12.492-28.566-28.014zm73.249-225.701h36.423l-11.187-8.136c-18.579-13.511-20.313-40.887-3.17-56.536l-13.004-16.7c-9.843-12.641-28.43-15.171-40.88-5.088-12.065 9.771-14.133 27.447-4.553 39.75l36.371 46.71zm283.298-2.103l-5.003-152.452c-.518-15.771-13.722-28.136-29.493-27.619-15.773.518-28.137 13.722-27.619 29.493l1.262 38.415L283.565 11.019c-9.58-12.303-27.223-14.63-39.653-5.328-12.827 9.599-14.929 28.24-5.086 40.881l76.889 98.745-4.509 3.511-94.79-121.734c-9.58-12.303-27.223-14.63-39.653-5.328-12.827 9.599-14.929 28.24-5.086 40.881l94.443 121.288-4.509 3.511-77.675-99.754c-9.58-12.303-27.223-14.63-39.653-5.328-12.827 9.599-14.929 28.24-5.086 40.881l52.053 66.849c12.497-8.257 29.055-8.285 41.69.904l123.36 89.714c10.904 7.93 17.415 20.715 17.415 34.198v16.999l61.064-47.549a34.285 34.285 0 0 0 13.202-28.177z"]
};
var faSignOutAlt = {
prefix: 'fas',
iconName: 'sign-out-alt',
icon: [512, 512, [], "f2f5", "M497 273L329 441c-15 15-41 4.5-41-17v-96H152c-13.3 0-24-10.7-24-24v-96c0-13.3 10.7-24 24-24h136V88c0-21.4 25.9-32 41-17l168 168c9.3 9.4 9.3 24.6 0 34zM192 436v-40c0-6.6-5.4-12-12-12H96c-17.7 0-32-14.3-32-32V160c0-17.7 14.3-32 32-32h84c6.6 0 12-5.4 12-12V76c0-6.6-5.4-12-12-12H96c-53 0-96 43-96 96v192c0 53 43 96 96 96h84c6.6 0 12-5.4 12-12z"]
};
var faSignal = {
prefix: 'fas',
iconName: 'signal',
icon: [640, 512, [], "f012", "M216 288h-48c-8.84 0-16 7.16-16 16v192c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V304c0-8.84-7.16-16-16-16zM88 384H40c-8.84 0-16 7.16-16 16v96c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16v-96c0-8.84-7.16-16-16-16zm256-192h-48c-8.84 0-16 7.16-16 16v288c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V208c0-8.84-7.16-16-16-16zm128-96h-48c-8.84 0-16 7.16-16 16v384c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V112c0-8.84-7.16-16-16-16zM600 0h-48c-8.84 0-16 7.16-16 16v480c0 8.84 7.16 16 16 16h48c8.84 0 16-7.16 16-16V16c0-8.84-7.16-16-16-16z"]
};
var faSignature = {
prefix: 'fas',
iconName: 'signature',
icon: [640, 512, [], "f5b7", "M623.2 192c-51.8 3.5-125.7 54.7-163.1 71.5-29.1 13.1-54.2 24.4-76.1 24.4-22.6 0-26-16.2-21.3-51.9 1.1-8 11.7-79.2-42.7-76.1-25.1 1.5-64.3 24.8-169.5 126L192 182.2c30.4-75.9-53.2-151.5-129.7-102.8L7.4 116.3C0 121-2.2 130.9 2.5 138.4l17.2 27c4.7 7.5 14.6 9.7 22.1 4.9l58-38.9c18.4-11.7 40.7 7.2 32.7 27.1L34.3 404.1C27.5 421 37 448 64 448c8.3 0 16.5-3.2 22.6-9.4 42.2-42.2 154.7-150.7 211.2-195.8-2.2 28.5-2.1 58.9 20.6 83.8 15.3 16.8 37.3 25.3 65.5 25.3 35.6 0 68-14.6 102.3-30 33-14.8 99-62.6 138.4-65.8 8.5-.7 15.2-7.3 15.2-15.8v-32.1c.2-9.1-7.5-16.8-16.6-16.2z"]
};
var faSimCard = {
prefix: 'fas',
iconName: 'sim-card',
icon: [384, 512, [], "f7c4", "M0 64v384c0 35.3 28.7 64 64 64h256c35.3 0 64-28.7 64-64V128L256 0H64C28.7 0 0 28.7 0 64zm224 192h-64v-64h64v64zm96 0h-64v-64h32c17.7 0 32 14.3 32 32v32zm-64 128h64v32c0 17.7-14.3 32-32 32h-32v-64zm-96 0h64v64h-64v-64zm-96 0h64v64H96c-17.7 0-32-14.3-32-32v-32zm0-96h256v64H64v-64zm0-64c0-17.7 14.3-32 32-32h32v64H64v-32z"]
};
var faSink = {
prefix: 'fas',
iconName: 'sink',
icon: [512, 512, [], "e06d", "M32,416a96,96,0,0,0,96,96H384a96,96,0,0,0,96-96V384H32ZM496,288H400V256h64a16,16,0,0,0,16-16V224a16,16,0,0,0-16-16H384a32,32,0,0,0-32,32v48H288V96a32,32,0,0,1,64,0v16a16,16,0,0,0,16,16h32a16,16,0,0,0,16-16V96A96.16,96.16,0,0,0,300.87,1.86C255.29,10.71,224,53.36,224,99.79V288H160V240a32,32,0,0,0-32-32H48a16,16,0,0,0-16,16v16a16,16,0,0,0,16,16h64v32H16A16,16,0,0,0,0,304v32a16,16,0,0,0,16,16H496a16,16,0,0,0,16-16V304A16,16,0,0,0,496,288Z"]
};
var faSitemap = {
prefix: 'fas',
iconName: 'sitemap',
icon: [640, 512, [], "f0e8", "M128 352H32c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32zm-24-80h192v48h48v-48h192v48h48v-57.59c0-21.17-17.23-38.41-38.41-38.41H344v-64h40c17.67 0 32-14.33 32-32V32c0-17.67-14.33-32-32-32H256c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h40v64H94.41C73.23 224 56 241.23 56 262.41V320h48v-48zm264 80h-96c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32zm240 0h-96c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32z"]
};
var faSkating = {
prefix: 'fas',
iconName: 'skating',
icon: [448, 512, [], "f7c5", "M400 0c-26.5 0-48 21.5-48 48s21.5 48 48 48 48-21.5 48-48-21.5-48-48-48zm0 448c-8.8 0-16 7.2-16 16s-7.2 16-16 16h-96c-8.8 0-16 7.2-16 16s7.2 16 16 16h96c26.5 0 48-21.5 48-48 0-8.8-7.2-16-16-16zm-282.2 8.6c-6.2 6.2-16.4 6.3-22.6 0l-67.9-67.9c-6.2-6.2-16.4-6.2-22.6 0s-6.2 16.4 0 22.6l67.9 67.9c9.4 9.4 21.7 14 34 14s24.6-4.7 33.9-14c6.2-6.2 6.2-16.4 0-22.6s-16.4-6.3-22.7 0zm56.1-179.8l-93.7 93.7c-12.5 12.5-12.5 32.8 0 45.2 6.2 6.2 14.4 9.4 22.6 9.4s16.4-3.1 22.6-9.4l91.9-91.9-30.2-30.2c-5-5-9.4-10.7-13.2-16.8zM128 160h105.5l-20.1 17.2c-13.5 11.5-21.6 28.4-22.3 46.1-.7 17.8 6.1 35.2 18.7 47.7l78.2 78.2V432c0 17.7 14.3 32 32 32s32-14.3 32-32v-89.4c0-12.6-5.1-25-14.1-33.9l-61-61c.5-.4 1.2-.6 1.7-1.1l82.3-82.3c11.5-11.5 14.9-28.6 8.7-43.6-6.2-15-20.7-24.7-37-24.7H128c-17.7 0-32 14.3-32 32s14.3 32 32 32z"]
};
var faSkiing = {
prefix: 'fas',
iconName: 'skiing',
icon: [512, 512, [], "f7c9", "M432 96c26.5 0 48-21.5 48-48S458.5 0 432 0s-48 21.5-48 48 21.5 48 48 48zm73 356.1c-9.4-9.4-24.6-9.4-33.9 0-12.1 12.1-30.5 15.4-45.1 8.7l-135.8-70.2 49.2-73.8c12.7-19 10.2-44.5-6-60.6L293 215.7l-107-53.1c-2.9 19.9 3.4 40 17.7 54.4l75.1 75.2-45.9 68.8L35 258.7c-11.7-6-26.2-1.5-32.3 10.3-6.1 11.8-1.5 26.3 10.3 32.3l391.9 202.5c11.9 5.5 24.5 8.1 37.1 8.1 23.2 0 46-9 63-26 9.3-9.3 9.3-24.5 0-33.8zM120 91.6l-11.5 22.5c14.4 7.3 31.2 4.9 42.8-4.8l47.2 23.4c-.1.1-.1.2-.2.3l114.5 56.8 32.4-13 6.4 19.1c4 12.1 12.6 22 24 27.7l58.1 29c15.9 7.9 35 1.5 42.9-14.3 7.9-15.8 1.5-35-14.3-42.9l-52.1-26.1-17.1-51.2c-8.1-24.2-40.9-56.6-84.5-39.2l-81.2 32.5-62.5-31c.3-14.5-7.2-28.6-20.9-35.6l-11.1 21.7h-.2l-34.4-7c-1.8-.4-3.7.2-5 1.7-1.9 2.2-1.7 5.5.5 7.4l26.2 23z"]
};
var faSkiingNordic = {
prefix: 'fas',
iconName: 'skiing-nordic',
icon: [576, 512, [], "f7ca", "M336 96c26.5 0 48-21.5 48-48S362.5 0 336 0s-48 21.5-48 48 21.5 48 48 48zm216 320c-13.2 0-24 10.7-24 24 0 13.2-10.8 24-24 24h-69.5L460 285.6c11.7-4.7 20.1-16.2 20.1-29.6 0-17.7-14.3-32-32-32h-44L378 170.8c-12.5-25.5-35.5-44.2-61.8-50.9L245 98.7c-28.3-6.8-57.8-.5-80.8 17.1l-39.7 30.4c-14 10.7-16.7 30.8-5.9 44.9.7.9 1.7 1.3 2.4 2.1L66.9 464H24c-13.2 0-24 10.7-24 24s10.8 24 24 24h480c39.7 0 72-32.3 72-72 0-13.2-10.8-24-24-24zm-260.5 48h-96.9l43.1-91-22-13c-12.1-7.2-21.9-16.9-29.5-27.8L123.7 464H99.5l52.3-261.4c4.1-1 8.1-2.9 11.7-5.6l39.7-30.4c7.7-5.9 17.4-8 25.3-6.1l14.7 4.4-37.5 87.4c-12.6 29.5-1.3 64 26.3 80.3l85 50.2-25.5 81.2zm110.6 0h-43.6l23.6-75.5c5.9-20.8-2.9-43.1-21.6-54.4L299.3 298l31.3-78.3 20.3 41.4c8 16.3 24.9 26.9 43.1 26.9h33.3l-25.2 176z"]
};
var faSkull = {
prefix: 'fas',
iconName: 'skull',
icon: [512, 512, [], "f54c", "M256 0C114.6 0 0 100.3 0 224c0 70.1 36.9 132.6 94.5 173.7 9.6 6.9 15.2 18.1 13.5 29.9l-9.4 66.2c-1.4 9.6 6 18.2 15.7 18.2H192v-56c0-4.4 3.6-8 8-8h16c4.4 0 8 3.6 8 8v56h64v-56c0-4.4 3.6-8 8-8h16c4.4 0 8 3.6 8 8v56h77.7c9.7 0 17.1-8.6 15.7-18.2l-9.4-66.2c-1.7-11.7 3.8-23 13.5-29.9C475.1 356.6 512 294.1 512 224 512 100.3 397.4 0 256 0zm-96 320c-35.3 0-64-28.7-64-64s28.7-64 64-64 64 28.7 64 64-28.7 64-64 64zm192 0c-35.3 0-64-28.7-64-64s28.7-64 64-64 64 28.7 64 64-28.7 64-64 64z"]
};
var faSkullCrossbones = {
prefix: 'fas',
iconName: 'skull-crossbones',
icon: [448, 512, [], "f714", "M439.15 453.06L297.17 384l141.99-69.06c7.9-3.95 11.11-13.56 7.15-21.46L432 264.85c-3.95-7.9-13.56-11.11-21.47-7.16L224 348.41 37.47 257.69c-7.9-3.95-17.51-.75-21.47 7.16L1.69 293.48c-3.95 7.9-.75 17.51 7.15 21.46L150.83 384 8.85 453.06c-7.9 3.95-11.11 13.56-7.15 21.47l14.31 28.63c3.95 7.9 13.56 11.11 21.47 7.15L224 419.59l186.53 90.72c7.9 3.95 17.51.75 21.47-7.15l14.31-28.63c3.95-7.91.74-17.52-7.16-21.47zM150 237.28l-5.48 25.87c-2.67 12.62 5.42 24.85 16.45 24.85h126.08c11.03 0 19.12-12.23 16.45-24.85l-5.5-25.87c41.78-22.41 70-62.75 70-109.28C368 57.31 303.53 0 224 0S80 57.31 80 128c0 46.53 28.22 86.87 70 109.28zM280 112c17.65 0 32 14.35 32 32s-14.35 32-32 32-32-14.35-32-32 14.35-32 32-32zm-112 0c17.65 0 32 14.35 32 32s-14.35 32-32 32-32-14.35-32-32 14.35-32 32-32z"]
};
var faSlash = {
prefix: 'fas',
iconName: 'slash',
icon: [640, 512, [], "f715", "M594.53 508.63L6.18 53.9c-6.97-5.42-8.23-15.47-2.81-22.45L23.01 6.18C28.43-.8 38.49-2.06 45.47 3.37L633.82 458.1c6.97 5.42 8.23 15.47 2.81 22.45l-19.64 25.27c-5.42 6.98-15.48 8.23-22.46 2.81z"]
};
var faSleigh = {
prefix: 'fas',
iconName: 'sleigh',
icon: [640, 512, [], "f7cc", "M612.7 350.7l-9.3-7.4c-6.9-5.5-17-4.4-22.5 2.5l-10 12.5c-5.5 6.9-4.4 17 2.5 22.5l9.3 7.4c5.9 4.7 9.2 11.7 9.2 19.2 0 13.6-11 24.6-24.6 24.6H48c-8.8 0-16 7.2-16 16v16c0 8.8 7.2 16 16 16h516c39 0 73.7-29.3 75.9-68.3 1.4-23.8-8.7-46.3-27.2-61zM32 224c0 59.6 40.9 109.2 96 123.5V400h64v-48h192v48h64v-48c53 0 96-43 96-96v-96c17.7 0 32-14.3 32-32s-14.3-32-32-32h-96v64c0 35.3-28.7 64-64 64h-20.7c-65.8 0-125.9-37.2-155.3-96-29.4-58.8-89.6-96-155.3-96H32C14.3 32 0 46.3 0 64s14.3 32 32 32v128z"]
};
var faSlidersH = {
prefix: 'fas',
iconName: 'sliders-h',
icon: [512, 512, [], "f1de", "M496 384H160v-16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v16H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h80v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16h336c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm0-160h-80v-16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v16H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h336v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16h80c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm0-160H288V48c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v16H16C7.2 64 0 71.2 0 80v32c0 8.8 7.2 16 16 16h208v16c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-16h208c8.8 0 16-7.2 16-16V80c0-8.8-7.2-16-16-16z"]
};
var faSmile = {
prefix: 'fas',
iconName: 'smile',
icon: [496, 512, [], "f118", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm80 168c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm-160 0c17.7 0 32 14.3 32 32s-14.3 32-32 32-32-14.3-32-32 14.3-32 32-32zm194.8 170.2C334.3 380.4 292.5 400 248 400s-86.3-19.6-114.8-53.8c-13.6-16.3 11-36.7 24.6-20.5 22.4 26.9 55.2 42.2 90.2 42.2s67.8-15.4 90.2-42.2c13.4-16.2 38.1 4.2 24.6 20.5z"]
};
var faSmileBeam = {
prefix: 'fas',
iconName: 'smile-beam',
icon: [496, 512, [], "f5b8", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM112 223.4c3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.7 8.6-10.8 11.9-14.9 4.5l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.3 7.4-15.8 4-15.1-4.5zm250.8 122.8C334.3 380.4 292.5 400 248 400s-86.3-19.6-114.8-53.8c-13.5-16.3 11-36.7 24.6-20.5 22.4 26.9 55.2 42.2 90.2 42.2s67.8-15.4 90.2-42.2c13.6-16.2 38.1 4.3 24.6 20.5zm6.2-118.3l-9.5-17c-7.7-13.7-19.2-21.6-31.5-21.6s-23.8 7.9-31.5 21.6l-9.5 17c-4.1 7.3-15.6 4-14.9-4.5 3.3-42.1 32.2-71.4 56-71.4s52.7 29.3 56 71.4c.6 8.6-11 11.9-15.1 4.5z"]
};
var faSmileWink = {
prefix: 'fas',
iconName: 'smile-wink',
icon: [496, 512, [], "f4da", "M0 256c0 137 111 248 248 248s248-111 248-248S385 8 248 8 0 119 0 256zm200-48c0 17.7-14.3 32-32 32s-32-14.3-32-32 14.3-32 32-32 32 14.3 32 32zm158.5 16.5c-14.8-13.2-46.2-13.2-61 0L288 233c-8.3 7.4-21.6.4-19.8-10.8 4-25.2 34.2-42.1 59.9-42.1S384 197 388 222.2c1.7 11.1-11.4 18.3-19.8 10.8l-9.7-8.5zM157.8 325.8C180.2 352.7 213 368 248 368s67.8-15.4 90.2-42.2c13.6-16.2 38.1 4.2 24.6 20.5C334.3 380.4 292.5 400 248 400s-86.3-19.6-114.8-53.8c-13.5-16.3 11.2-36.7 24.6-20.4z"]
};
var faSmog = {
prefix: 'fas',
iconName: 'smog',
icon: [640, 512, [], "f75f", "M624 368H80c-8.8 0-16 7.2-16 16v16c0 8.8 7.2 16 16 16h544c8.8 0 16-7.2 16-16v-16c0-8.8-7.2-16-16-16zm-480 96H16c-8.8 0-16 7.2-16 16v16c0 8.8 7.2 16 16 16h128c8.8 0 16-7.2 16-16v-16c0-8.8-7.2-16-16-16zm416 0H224c-8.8 0-16 7.2-16 16v16c0 8.8 7.2 16 16 16h336c8.8 0 16-7.2 16-16v-16c0-8.8-7.2-16-16-16zM144 288h156.1c22.5 19.7 51.6 32 83.9 32s61.3-12.3 83.9-32H528c61.9 0 112-50.1 112-112S589.9 64 528 64c-18 0-34.7 4.6-49.7 12.1C454 31 406.8 0 352 0c-41 0-77.8 17.3-104 44.8C221.8 17.3 185 0 144 0 64.5 0 0 64.5 0 144s64.5 144 144 144z"]
};
var faSmoking = {
prefix: 'fas',
iconName: 'smoking',
icon: [640, 512, [], "f48d", "M632 352h-48c-4.4 0-8 3.6-8 8v144c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8V360c0-4.4-3.6-8-8-8zM553.3 87.1c-5.7-3.8-9.3-10-9.3-16.8V8c0-4.4-3.6-8-8-8h-48c-4.4 0-8 3.6-8 8v62.3c0 22 10.2 43.4 28.6 55.4 42.2 27.3 67.4 73.8 67.4 124V280c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8v-30.3c0-65.5-32.4-126.2-86.7-162.6zM432 352H48c-26.5 0-48 21.5-48 48v64c0 26.5 21.5 48 48 48h384c8.8 0 16-7.2 16-16V368c0-8.8-7.2-16-16-16zm-32 112H224v-64h176v64zm87.7-322.4C463.8 125 448 99.3 448 70.3V8c0-4.4-3.6-8-8-8h-48c-4.4 0-8 3.6-8 8v66.4c0 43.7 24.6 81.6 60.3 106.7 22.4 15.7 35.7 41.2 35.7 68.6V280c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8v-30.3c0-43.3-21-83.4-56.3-108.1zM536 352h-48c-4.4 0-8 3.6-8 8v144c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8V360c0-4.4-3.6-8-8-8z"]
};
var faSmokingBan = {
prefix: 'fas',
iconName: 'smoking-ban',
icon: [512, 512, [], "f54d", "M96 304c0 8.8 7.2 16 16 16h117.5l-96-96H112c-8.8 0-16 7.2-16 16v64zM256 0C114.6 0 0 114.6 0 256s114.6 256 256 256 256-114.6 256-256S397.4 0 256 0zm0 448c-105.9 0-192-86.1-192-192 0-41.4 13.3-79.7 35.7-111.1l267.4 267.4C335.7 434.7 297.4 448 256 448zm45.2-192H384v32h-50.8l-32-32zm111.1 111.1L365.2 320H400c8.8 0 16-7.2 16-16v-64c0-8.8-7.2-16-16-16H269.2L144.9 99.7C176.3 77.3 214.6 64 256 64c105.9 0 192 86.1 192 192 0 41.4-13.3 79.7-35.7 111.1zM320.6 128c-15.6 0-28.6-11.2-31.4-25.9-.7-3.6-4-6.1-7.7-6.1h-16.2c-5 0-8.7 4.5-8 9.4 4.6 30.9 31.2 54.6 63.3 54.6 15.6 0 28.6 11.2 31.4 25.9.7 3.6 4 6.1 7.7 6.1h16.2c5 0 8.7-4.5 8-9.4-4.6-30.9-31.2-54.6-63.3-54.6z"]
};
var faSms = {
prefix: 'fas',
iconName: 'sms',
icon: [512, 512, [], "f7cd", "M256 32C114.6 32 0 125.1 0 240c0 49.6 21.4 95 57 130.7C44.5 421.1 2.7 466 2.2 466.5c-2.2 2.3-2.8 5.7-1.5 8.7 1.3 3 4.1 4.8 7.3 4.8 66.3 0 116-31.8 140.6-51.4 32.7 12.3 69 19.4 107.4 19.4 141.4 0 256-93.1 256-208S397.4 32 256 32zM128.2 304H116c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h12.3c6 0 10.4-3.5 10.4-6.6 0-1.3-.8-2.7-2.1-3.8l-21.9-18.8c-8.5-7.2-13.3-17.5-13.3-28.1 0-21.3 19-38.6 42.4-38.6H156c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8h-12.3c-6 0-10.4 3.5-10.4 6.6 0 1.3.8 2.7 2.1 3.8l21.9 18.8c8.5 7.2 13.3 17.5 13.3 28.1.1 21.3-19 38.6-42.4 38.6zm191.8-8c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8v-68.2l-24.8 55.8c-2.9 5.9-11.4 5.9-14.3 0L224 227.8V296c0 4.4-3.6 8-8 8h-16c-4.4 0-8-3.6-8-8V192c0-8.8 7.2-16 16-16h16c6.1 0 11.6 3.4 14.3 8.8l17.7 35.4 17.7-35.4c2.7-5.4 8.3-8.8 14.3-8.8h16c8.8 0 16 7.2 16 16v104zm48.3 8H356c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h12.3c6 0 10.4-3.5 10.4-6.6 0-1.3-.8-2.7-2.1-3.8l-21.9-18.8c-8.5-7.2-13.3-17.5-13.3-28.1 0-21.3 19-38.6 42.4-38.6H396c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8h-12.3c-6 0-10.4 3.5-10.4 6.6 0 1.3.8 2.7 2.1 3.8l21.9 18.8c8.5 7.2 13.3 17.5 13.3 28.1.1 21.3-18.9 38.6-42.3 38.6z"]
};
var faSnowboarding = {
prefix: 'fas',
iconName: 'snowboarding',
icon: [512, 512, [], "f7ce", "M432 96c26.5 0 48-21.5 48-48S458.5 0 432 0s-48 21.5-48 48 21.5 48 48 48zm28.8 153.6c5.8 4.3 12.5 6.4 19.2 6.4 9.7 0 19.3-4.4 25.6-12.8 10.6-14.1 7.8-34.2-6.4-44.8l-111.4-83.5c-13.8-10.3-29.1-18.4-45.4-23.8l-63.7-21.2-26.1-52.1C244.7 2 225.5-4.4 209.7 3.5c-15.8 7.9-22.2 27.1-14.3 42.9l29.1 58.1c5.7 11.4 15.6 19.9 27.7 24l16.4 5.5-41.2 20.6c-21.8 10.9-35.4 32.8-35.4 57.2v53.1l-74.1 24.7c-16.8 5.6-25.8 23.7-20.2 40.5 1.7 5.2 4.9 9.4 8.7 12.9l-38.7-14.1c-9.7-3.5-17.4-10.6-21.8-20-5.6-12-19.9-17.2-31.9-11.6s-17.2 19.9-11.6 31.9c9.8 21 27.1 36.9 48.9 44.8l364.8 132.7c9.7 3.5 19.7 5.3 29.7 5.3 12.5 0 24.9-2.7 36.5-8.2 12-5.6 17.2-19.9 11.6-31.9S474 454.7 462 460.3c-9.3 4.4-19.8 4.8-29.5 1.3l-90.8-33.1c8.7-4.1 15.6-11.8 17.8-21.9l21.9-102c3.9-18.2-3.2-37.2-18.1-48.4l-52-39 66-30.5 83.5 62.9zm-144.4 51.7l-19.7 92c-1.5 7.1-.1 13.9 2.8 20l-169.4-61.6c2.7-.2 5.4-.4 8-1.3l85-28.4c19.6-6.5 32.8-24.8 32.8-45.5V256l60.5 45.3z"]
};
var faSnowflake = {
prefix: 'fas',
iconName: 'snowflake',
icon: [448, 512, [], "f2dc", "M440.3 345.2l-33.8-19.5 26-7c8.2-2.2 13.1-10.7 10.9-18.9l-4-14.9c-2.2-8.2-10.7-13.1-18.9-10.9l-70.8 19-63.9-37 63.8-36.9 70.8 19c8.2 2.2 16.7-2.7 18.9-10.9l4-14.9c2.2-8.2-2.7-16.7-10.9-18.9l-26-7 33.8-19.5c7.4-4.3 9.9-13.7 5.7-21.1L430.4 119c-4.3-7.4-13.7-9.9-21.1-5.7l-33.8 19.5 7-26c2.2-8.2-2.7-16.7-10.9-18.9l-14.9-4c-8.2-2.2-16.7 2.7-18.9 10.9l-19 70.8-62.8 36.2v-77.5l53.7-53.7c6.2-6.2 6.2-16.4 0-22.6l-11.3-11.3c-6.2-6.2-16.4-6.2-22.6 0L256 56.4V16c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v40.4l-19.7-19.7c-6.2-6.2-16.4-6.2-22.6 0L138.3 48c-6.3 6.2-6.3 16.4 0 22.6l53.7 53.7v77.5l-62.8-36.2-19-70.8c-2.2-8.2-10.7-13.1-18.9-10.9l-14.9 4c-8.2 2.2-13.1 10.7-10.9 18.9l7 26-33.8-19.5c-7.4-4.3-16.8-1.7-21.1 5.7L2.1 145.7c-4.3 7.4-1.7 16.8 5.7 21.1l33.8 19.5-26 7c-8.3 2.2-13.2 10.7-11 19l4 14.9c2.2 8.2 10.7 13.1 18.9 10.9l70.8-19 63.8 36.9-63.8 36.9-70.8-19c-8.2-2.2-16.7 2.7-18.9 10.9l-4 14.9c-2.2 8.2 2.7 16.7 10.9 18.9l26 7-33.8 19.6c-7.4 4.3-9.9 13.7-5.7 21.1l15.5 26.8c4.3 7.4 13.7 9.9 21.1 5.7l33.8-19.5-7 26c-2.2 8.2 2.7 16.7 10.9 18.9l14.9 4c8.2 2.2 16.7-2.7 18.9-10.9l19-70.8 62.8-36.2v77.5l-53.7 53.7c-6.3 6.2-6.3 16.4 0 22.6l11.3 11.3c6.2 6.2 16.4 6.2 22.6 0l19.7-19.7V496c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-40.4l19.7 19.7c6.2 6.2 16.4 6.2 22.6 0l11.3-11.3c6.2-6.2 6.2-16.4 0-22.6L256 387.7v-77.5l62.8 36.2 19 70.8c2.2 8.2 10.7 13.1 18.9 10.9l14.9-4c8.2-2.2 13.1-10.7 10.9-18.9l-7-26 33.8 19.5c7.4 4.3 16.8 1.7 21.1-5.7l15.5-26.8c4.3-7.3 1.8-16.8-5.6-21z"]
};
var faSnowman = {
prefix: 'fas',
iconName: 'snowman',
icon: [512, 512, [], "f7d0", "M510.9 152.3l-5.9-14.5c-3.3-8-12.6-11.9-20.8-8.7L456 140.6v-29c0-8.6-7.2-15.6-16-15.6h-16c-8.8 0-16 7-16 15.6v46.9c0 .5.3 1 .3 1.5l-56.4 23c-5.9-10-13.3-18.9-22-26.6 13.6-16.6 22-37.4 22-60.5 0-53-43-96-96-96s-96 43-96 96c0 23.1 8.5 43.9 22 60.5-8.7 7.7-16 16.6-22 26.6l-56.4-23c.1-.5.3-1 .3-1.5v-46.9C104 103 96.8 96 88 96H72c-8.8 0-16 7-16 15.6v29l-28.1-11.5c-8.2-3.2-17.5.7-20.8 8.7l-5.9 14.5c-3.3 8 .7 17.1 8.9 20.3l135.2 55.2c-.4 4-1.2 8-1.2 12.2 0 10.1 1.7 19.6 4.2 28.9C120.9 296.4 104 334.2 104 376c0 54 28.4 100.9 70.8 127.8 9.3 5.9 20.3 8.2 31.3 8.2h99.2c13.3 0 26.3-4.1 37.2-11.7 46.5-32.3 74.4-89.4 62.9-152.6-5.5-30.2-20.5-57.6-41.6-79 2.5-9.2 4.2-18.7 4.2-28.7 0-4.2-.8-8.1-1.2-12.2L502 172.6c8.1-3.1 12.1-12.2 8.9-20.3zM224 96c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm32 272c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm0-64c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm0-64c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16zm0-88s-16-23.2-16-32 7.2-16 16-16 16 7.2 16 16-16 32-16 32zm32-56c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16z"]
};
var faSnowplow = {
prefix: 'fas',
iconName: 'snowplow',
icon: [640, 512, [], "f7d2", "M120 376c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm80 0c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm80 0c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm80 0c-13.3 0-24 10.7-24 24s10.7 24 24 24 24-10.7 24-24-10.7-24-24-24zm238.6 49.4c-14.5-14.5-22.6-34.1-22.6-54.6V269.2c0-20.5 8.1-40.1 22.6-54.6l36.7-36.7c6.2-6.2 6.2-16.4 0-22.6l-22.6-22.6c-6.2-6.2-16.4-6.2-22.6 0l-36.7 36.7c-26.5 26.5-41.4 62.4-41.4 99.9V288h-64v-50.9c0-8.7-1.8-17.2-5.2-25.2L364.5 29.1C356.9 11.4 339.6 0 320.3 0H176c-26.5 0-48 21.5-48 48v112h-16c-26.5 0-48 21.5-48 48v91.2C26.3 317.2 0 355.4 0 400c0 61.9 50.1 112 112 112h256c61.9 0 112-50.1 112-112 0-17.3-4.2-33.4-11.2-48H512v18.7c0 37.5 14.9 73.4 41.4 99.9l36.7 36.7c6.2 6.2 16.4 6.2 22.6 0l22.6-22.6c6.2-6.2 6.2-16.4 0-22.6l-36.7-36.7zM192 64h117.8l68.6 160H256l-64-64V64zm176 384H112c-26.5 0-48-21.5-48-48s21.5-48 48-48h256c26.5 0 48 21.5 48 48s-21.5 48-48 48z"]
};
var faSoap = {
prefix: 'fas',
iconName: 'soap',
icon: [512, 512, [], "e06e", "M416,192a95.42,95.42,0,0,1-30.94,70.21A95.8,95.8,0,0,1,352,448H160a96,96,0,0,1,0-192h88.91A95.3,95.3,0,0,1,224,192H96A96,96,0,0,0,0,288V416a96,96,0,0,0,96,96H416a96,96,0,0,0,96-96V288A96,96,0,0,0,416,192Zm-96,64a64,64,0,1,0-64-64A64,64,0,0,0,320,256ZM208,96a48,48,0,1,0-48-48A48,48,0,0,0,208,96ZM384,64a32,32,0,1,0-32-32A32,32,0,0,0,384,64ZM160,288a64,64,0,0,0,0,128H352a64,64,0,0,0,0-128Z"]
};
var faSocks = {
prefix: 'fas',
iconName: 'socks',
icon: [512, 512, [], "f696", "M214.66 311.01L288 256V96H128v176l-86.65 64.61c-39.4 29.56-53.86 84.42-29.21 127.06C30.39 495.25 63.27 512 96.08 512c20.03 0 40.25-6.25 57.52-19.2l21.86-16.39c-29.85-55.38-13.54-125.84 39.2-165.4zM288 32c0-11.05 3.07-21.3 8.02-30.38C293.4.92 290.85 0 288 0H160c-17.67 0-32 14.33-32 32v32h160V32zM480 0H352c-17.67 0-32 14.33-32 32v32h192V32c0-17.67-14.33-32-32-32zM320 272l-86.13 64.61c-39.4 29.56-53.86 84.42-29.21 127.06 18.25 31.58 50.61 48.33 83.42 48.33 20.03 0 40.25-6.25 57.52-19.2l115.2-86.4A127.997 127.997 0 0 0 512 304V96H320v176z"]
};
var faSolarPanel = {
prefix: 'fas',
iconName: 'solar-panel',
icon: [640, 512, [], "f5ba", "M431.98 448.01l-47.97.05V416h-128v32.21l-47.98.05c-8.82.01-15.97 7.16-15.98 15.99l-.05 31.73c-.01 8.85 7.17 16.03 16.02 16.02l223.96-.26c8.82-.01 15.97-7.16 15.98-15.98l.04-31.73c.01-8.85-7.17-16.03-16.02-16.02zM585.2 26.74C582.58 11.31 568.99 0 553.06 0H86.93C71 0 57.41 11.31 54.79 26.74-3.32 369.16.04 348.08.03 352c-.03 17.32 14.29 32 32.6 32h574.74c18.23 0 32.51-14.56 32.59-31.79.02-4.08 3.35 16.95-54.76-325.47zM259.83 64h120.33l9.77 96H250.06l9.77-96zm-75.17 256H71.09L90.1 208h105.97l-11.41 112zm16.29-160H98.24l16.29-96h96.19l-9.77 96zm32.82 160l11.4-112h149.65l11.4 112H233.77zm195.5-256h96.19l16.29 96H439.04l-9.77-96zm26.06 256l-11.4-112H549.9l19.01 112H455.33z"]
};
var faSort = {
prefix: 'fas',
iconName: 'sort',
icon: [320, 512, [], "f0dc", "M41 288h238c21.4 0 32.1 25.9 17 41L177 448c-9.4 9.4-24.6 9.4-33.9 0L24 329c-15.1-15.1-4.4-41 17-41zm255-105L177 64c-9.4-9.4-24.6-9.4-33.9 0L24 183c-15.1 15.1-4.4 41 17 41h238c21.4 0 32.1-25.9 17-41z"]
};
var faSortAlphaDown = {
prefix: 'fas',
iconName: 'sort-alpha-down',
icon: [448, 512, [], "f15d", "M176 352h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.36 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352zm240-64H288a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h56l-61.26 70.45A32 32 0 0 0 272 446.37V464a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-56l61.26-70.45A32 32 0 0 0 432 321.63V304a16 16 0 0 0-16-16zm31.06-85.38l-59.27-160A16 16 0 0 0 372.72 32h-41.44a16 16 0 0 0-15.07 10.62l-59.27 160A16 16 0 0 0 272 224h24.83a16 16 0 0 0 15.23-11.08l4.42-12.92h71l4.41 12.92A16 16 0 0 0 407.16 224H432a16 16 0 0 0 15.06-21.38zM335.61 144L352 96l16.39 48z"]
};
var faSortAlphaDownAlt = {
prefix: 'fas',
iconName: 'sort-alpha-down-alt',
icon: [448, 512, [], "f881", "M176 352h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.36 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352zm112-128h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-56l61.26-70.45A32 32 0 0 0 432 65.63V48a16 16 0 0 0-16-16H288a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h56l-61.26 70.45A32 32 0 0 0 272 190.37V208a16 16 0 0 0 16 16zm159.06 234.62l-59.27-160A16 16 0 0 0 372.72 288h-41.44a16 16 0 0 0-15.07 10.62l-59.27 160A16 16 0 0 0 272 480h24.83a16 16 0 0 0 15.23-11.08l4.42-12.92h71l4.41 12.92A16 16 0 0 0 407.16 480H432a16 16 0 0 0 15.06-21.38zM335.61 400L352 352l16.39 48z"]
};
var faSortAlphaUp = {
prefix: 'fas',
iconName: 'sort-alpha-up',
icon: [448, 512, [], "f15e", "M16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.38-17.24 11.31-27.31l-80-96a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.78 160 16 160zm400 128H288a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h56l-61.26 70.45A32 32 0 0 0 272 446.37V464a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-56l61.26-70.45A32 32 0 0 0 432 321.63V304a16 16 0 0 0-16-16zm31.06-85.38l-59.27-160A16 16 0 0 0 372.72 32h-41.44a16 16 0 0 0-15.07 10.62l-59.27 160A16 16 0 0 0 272 224h24.83a16 16 0 0 0 15.23-11.08l4.42-12.92h71l4.41 12.92A16 16 0 0 0 407.16 224H432a16 16 0 0 0 15.06-21.38zM335.61 144L352 96l16.39 48z"]
};
var faSortAlphaUpAlt = {
prefix: 'fas',
iconName: 'sort-alpha-up-alt',
icon: [448, 512, [], "f882", "M16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.38-17.24 11.31-27.31l-80-96a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.78 160 16 160zm272 64h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-56l61.26-70.45A32 32 0 0 0 432 65.63V48a16 16 0 0 0-16-16H288a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h56l-61.26 70.45A32 32 0 0 0 272 190.37V208a16 16 0 0 0 16 16zm159.06 234.62l-59.27-160A16 16 0 0 0 372.72 288h-41.44a16 16 0 0 0-15.07 10.62l-59.27 160A16 16 0 0 0 272 480h24.83a16 16 0 0 0 15.23-11.08l4.42-12.92h71l4.41 12.92A16 16 0 0 0 407.16 480H432a16 16 0 0 0 15.06-21.38zM335.61 400L352 352l16.39 48z"]
};
var faSortAmountDown = {
prefix: 'fas',
iconName: 'sort-amount-down',
icon: [512, 512, [], "f160", "M304 416h-64a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h64a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-128-64h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.37 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352zm256-192H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h192a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-64 128H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM496 32H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h256a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faSortAmountDownAlt = {
prefix: 'fas',
iconName: 'sort-amount-down-alt',
icon: [512, 512, [], "f884", "M240 96h64a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16h-64a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm0 128h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm256 192H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h256a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-256-64h192a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm-64 0h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.37 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352z"]
};
var faSortAmountUp = {
prefix: 'fas',
iconName: 'sort-amount-up',
icon: [512, 512, [], "f161", "M304 416h-64a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h64a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.38-17.24 11.31-27.31l-80-96a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.77 160 16 160zm416 0H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h192a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-64 128H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM496 32H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h256a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faSortAmountUpAlt = {
prefix: 'fas',
iconName: 'sort-amount-up-alt',
icon: [512, 512, [], "f885", "M240 96h64a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16h-64a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm0 128h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm256 192H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h256a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-256-64h192a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H240a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zM16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.39-17.24 11.31-27.31l-80-96a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.78 160 16 160z"]
};
var faSortDown = {
prefix: 'fas',
iconName: 'sort-down',
icon: [320, 512, [], "f0dd", "M41 288h238c21.4 0 32.1 25.9 17 41L177 448c-9.4 9.4-24.6 9.4-33.9 0L24 329c-15.1-15.1-4.4-41 17-41z"]
};
var faSortNumericDown = {
prefix: 'fas',
iconName: 'sort-numeric-down',
icon: [448, 512, [], "f162", "M304 96h16v64h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-16V48a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 304 96zm26.15 162.91a79 79 0 0 0-55 54.17c-14.25 51.05 21.21 97.77 68.85 102.53a84.07 84.07 0 0 1-20.85 12.91c-7.57 3.4-10.8 12.47-8.18 20.34l9.9 20c2.87 8.63 12.53 13.49 20.9 9.91 58-24.76 86.25-61.61 86.25-132V336c-.02-51.21-48.4-91.34-101.85-77.09zM352 356a20 20 0 1 1 20-20 20 20 0 0 1-20 20zm-176-4h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.36 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352z"]
};
var faSortNumericDownAlt = {
prefix: 'fas',
iconName: 'sort-numeric-down-alt',
icon: [448, 512, [], "f886", "M176 352h-48V48a16 16 0 0 0-16-16H80a16 16 0 0 0-16 16v304H16c-14.19 0-21.36 17.24-11.29 27.31l80 96a16 16 0 0 0 22.62 0l80-96C197.35 369.26 190.22 352 176 352zm224 64h-16V304a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 304 352h16v64h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM330.17 34.91a79 79 0 0 0-55 54.17c-14.27 51.05 21.19 97.77 68.83 102.53a84.07 84.07 0 0 1-20.85 12.91c-7.57 3.4-10.8 12.47-8.18 20.34l9.9 20c2.87 8.63 12.53 13.49 20.9 9.91 58-24.77 86.25-61.61 86.25-132V112c-.02-51.21-48.4-91.34-101.85-77.09zM352 132a20 20 0 1 1 20-20 20 20 0 0 1-20 20z"]
};
var faSortNumericUp = {
prefix: 'fas',
iconName: 'sort-numeric-up',
icon: [448, 512, [], "f163", "M330.17 258.91a79 79 0 0 0-55 54.17c-14.27 51.05 21.19 97.77 68.83 102.53a84.07 84.07 0 0 1-20.85 12.91c-7.57 3.4-10.8 12.47-8.18 20.34l9.9 20c2.87 8.63 12.53 13.49 20.9 9.91 58-24.76 86.25-61.61 86.25-132V336c-.02-51.21-48.4-91.34-101.85-77.09zM352 356a20 20 0 1 1 20-20 20 20 0 0 1-20 20zM304 96h16v64h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-16V48a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 304 96zM107.31 36.69a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.78 160 16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.38-17.24 11.31-27.31z"]
};
var faSortNumericUpAlt = {
prefix: 'fas',
iconName: 'sort-numeric-up-alt',
icon: [448, 512, [], "f887", "M107.31 36.69a16 16 0 0 0-22.62 0l-80 96C-5.35 142.74 1.78 160 16 160h48v304a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V160h48c14.21 0 21.38-17.24 11.31-27.31zM400 416h-16V304a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 304 352h16v64h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM330.17 34.91a79 79 0 0 0-55 54.17c-14.27 51.05 21.19 97.77 68.83 102.53a84.07 84.07 0 0 1-20.85 12.91c-7.57 3.4-10.8 12.47-8.18 20.34l9.9 20c2.87 8.63 12.53 13.49 20.9 9.91 58-24.77 86.25-61.61 86.25-132V112c-.02-51.21-48.4-91.34-101.85-77.09zM352 132a20 20 0 1 1 20-20 20 20 0 0 1-20 20z"]
};
var faSortUp = {
prefix: 'fas',
iconName: 'sort-up',
icon: [320, 512, [], "f0de", "M279 224H41c-21.4 0-32.1-25.9-17-41L143 64c9.4-9.4 24.6-9.4 33.9 0l119 119c15.2 15.1 4.5 41-16.9 41z"]
};
var faSpa = {
prefix: 'fas',
iconName: 'spa',
icon: [576, 512, [], "f5bb", "M568.25 192c-29.04.13-135.01 6.16-213.84 83-33.12 29.63-53.36 63.3-66.41 94.86-13.05-31.56-33.29-65.23-66.41-94.86-78.83-76.84-184.8-82.87-213.84-83-4.41-.02-7.79 3.4-7.75 7.82.23 27.92 7.14 126.14 88.77 199.3C172.79 480.94 256 480 288 480s115.19.95 199.23-80.88c81.64-73.17 88.54-171.38 88.77-199.3.04-4.42-3.34-7.84-7.75-7.82zM287.98 302.6c12.82-18.85 27.6-35.78 44.09-50.52 19.09-18.61 39.58-33.3 60.26-45.18-16.44-70.5-51.72-133.05-96.73-172.22-4.11-3.58-11.02-3.58-15.14 0-44.99 39.14-80.27 101.63-96.74 172.07 20.37 11.7 40.5 26.14 59.22 44.39a282.768 282.768 0 0 1 45.04 51.46z"]
};
var faSpaceShuttle = {
prefix: 'fas',
iconName: 'space-shuttle',
icon: [640, 512, [], "f197", "M592.604 208.244C559.735 192.836 515.777 184 472 184H186.327c-4.952-6.555-10.585-11.978-16.72-16H376C229.157 137.747 219.403 32 96.003 32H96v128H80V32c-26.51 0-48 28.654-48 64v64c-23.197 0-32 10.032-32 24v40c0 13.983 8.819 24 32 24v16c-23.197 0-32 10.032-32 24v40c0 13.983 8.819 24 32 24v64c0 35.346 21.49 64 48 64V352h16v128h.003c123.4 0 133.154-105.747 279.997-136H169.606c6.135-4.022 11.768-9.445 16.72-16H472c43.777 0 87.735-8.836 120.604-24.244C622.282 289.845 640 271.992 640 256s-17.718-33.845-47.396-47.756zM488 296a8 8 0 0 1-8-8v-64a8 8 0 0 1 8-8c31.909 0 31.942 80 0 80z"]
};
var faSpellCheck = {
prefix: 'fas',
iconName: 'spell-check',
icon: [576, 512, [], "f891", "M272 256h91.36c43.2 0 82-32.2 84.51-75.34a79.82 79.82 0 0 0-25.26-63.07 79.81 79.81 0 0 0 9.06-44.91C427.9 30.57 389.3 0 347 0h-75a16 16 0 0 0-16 16v224a16 16 0 0 0 16 16zm40-200h40a24 24 0 0 1 0 48h-40zm0 96h56a24 24 0 0 1 0 48h-56zM155.12 22.25A32 32 0 0 0 124.64 0H99.36a32 32 0 0 0-30.48 22.25L.59 235.73A16 16 0 0 0 16 256h24.93a16 16 0 0 0 15.42-11.73L68.29 208h87.42l11.94 36.27A16 16 0 0 0 183.07 256H208a16 16 0 0 0 15.42-20.27zM89.37 144L112 75.3l22.63 68.7zm482 132.48l-45.21-45.3a15.88 15.88 0 0 0-22.59 0l-151.5 151.5-55.41-55.5a15.88 15.88 0 0 0-22.59 0l-45.3 45.3a16 16 0 0 0 0 22.59l112 112.21a15.89 15.89 0 0 0 22.6 0l208-208.21a16 16 0 0 0-.02-22.59z"]
};
var faSpider = {
prefix: 'fas',
iconName: 'spider',
icon: [576, 512, [], "f717", "M151.17 167.35L177.1 176h4.67l5.22-26.12c.72-3.58 1.8-7.58 3.21-11.79l-20.29-40.58 23.8-71.39c2.79-8.38-1.73-17.44-10.12-20.24L168.42.82c-8.38-2.8-17.45 1.73-20.24 10.12l-25.89 77.68a32.04 32.04 0 0 0 1.73 24.43l27.15 54.3zm422.14 182.03l-52.75-79.12a32.002 32.002 0 0 0-26.62-14.25H416l68.99-24.36a32.03 32.03 0 0 0 16.51-12.61l53.6-80.41c4.9-7.35 2.91-17.29-4.44-22.19l-13.31-8.88c-7.35-4.9-17.29-2.91-22.19 4.44l-50.56 75.83L404.1 208H368l-10.37-51.85C355.44 145.18 340.26 96 288 96c-52.26 0-67.44 49.18-69.63 60.15L208 208h-36.1l-60.49-20.17L60.84 112c-4.9-7.35-14.83-9.34-22.19-4.44l-13.31 8.88c-7.35 4.9-9.34 14.83-4.44 22.19l53.6 80.41a32.03 32.03 0 0 0 16.51 12.61L160 256H82.06a32.02 32.02 0 0 0-26.63 14.25L2.69 349.38c-4.9 7.35-2.92 17.29 4.44 22.19l13.31 8.88c7.35 4.9 17.29 2.91 22.19-4.44l48-72h47.06l-60.83 97.33A31.988 31.988 0 0 0 72 418.3V496c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-73.11l74.08-118.53c-1.01 14.05-2.08 28.11-2.08 42.21C192 399.64 232.76 448 288 448s96-48.36 96-101.43c0-14.1-1.08-28.16-2.08-42.21L456 422.89V496c0 8.84 7.16 16 16 16h16c8.84 0 16-7.16 16-16v-77.71c0-6-1.69-11.88-4.86-16.96L438.31 304h47.06l48 72c4.9 7.35 14.84 9.34 22.19 4.44l13.31-8.88c7.36-4.9 9.34-14.83 4.44-22.18zM406.09 97.51l-20.29 40.58c1.41 4.21 2.49 8.21 3.21 11.79l5.22 26.12h4.67l25.93-8.65 27.15-54.3a31.995 31.995 0 0 0 1.73-24.43l-25.89-77.68C425.03 2.56 415.96-1.98 407.58.82l-15.17 5.06c-8.38 2.8-12.91 11.86-10.12 20.24l23.8 71.39z"]
};
var faSpinner = {
prefix: 'fas',
iconName: 'spinner',
icon: [512, 512, [], "f110", "M304 48c0 26.51-21.49 48-48 48s-48-21.49-48-48 21.49-48 48-48 48 21.49 48 48zm-48 368c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.49-48-48-48zm208-208c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.49-48-48-48zM96 256c0-26.51-21.49-48-48-48S0 229.49 0 256s21.49 48 48 48 48-21.49 48-48zm12.922 99.078c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48c0-26.509-21.491-48-48-48zm294.156 0c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48c0-26.509-21.49-48-48-48zM108.922 60.922c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.491-48-48-48z"]
};
var faSplotch = {
prefix: 'fas',
iconName: 'splotch',
icon: [512, 512, [], "f5bc", "M472.29 195.89l-67.06-22.95c-19.28-6.6-33.54-20.92-38.14-38.3L351.1 74.19c-11.58-43.77-76.57-57.13-109.98-22.62l-46.14 47.67c-13.26 13.71-33.54 20.93-54.2 19.31l-71.88-5.62c-52.05-4.07-86.93 44.88-59.03 82.83l38.54 52.42c11.08 15.07 12.82 33.86 4.64 50.24L24.62 355.4c-20.59 41.25 22.84 84.87 73.49 73.81l69.96-15.28c20.11-4.39 41.45 0 57.07 11.73l54.32 40.83c39.32 29.56 101.04 7.57 104.45-37.22l4.7-61.86c1.35-17.79 12.8-33.86 30.63-42.99l62-31.74c44.88-22.96 39.59-80.17-8.95-96.79z"]
};
var faSprayCan = {
prefix: 'fas',
iconName: 'spray-can',
icon: [512, 512, [], "f5bd", "M224 32c0-17.67-14.33-32-32-32h-64c-17.67 0-32 14.33-32 32v96h128V32zm256 96c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32zm-256 32H96c-53.02 0-96 42.98-96 96v224c0 17.67 14.33 32 32 32h256c17.67 0 32-14.33 32-32V256c0-53.02-42.98-96-96-96zm-64 256c-44.18 0-80-35.82-80-80s35.82-80 80-80 80 35.82 80 80-35.82 80-80 80zM480 96c17.67 0 32-14.33 32-32s-14.33-32-32-32-32 14.33-32 32 14.33 32 32 32zm-96 32c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32zm-96-96c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32zm96 0c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32zm96 192c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32z"]
};
var faSquare = {
prefix: 'fas',
iconName: 'square',
icon: [448, 512, [], "f0c8", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48z"]
};
var faSquareFull = {
prefix: 'fas',
iconName: 'square-full',
icon: [512, 512, [], "f45c", "M512 512H0V0h512v512z"]
};
var faSquareRootAlt = {
prefix: 'fas',
iconName: 'square-root-alt',
icon: [576, 512, [], "f698", "M571.31 251.31l-22.62-22.62c-6.25-6.25-16.38-6.25-22.63 0L480 274.75l-46.06-46.06c-6.25-6.25-16.38-6.25-22.63 0l-22.62 22.62c-6.25 6.25-6.25 16.38 0 22.63L434.75 320l-46.06 46.06c-6.25 6.25-6.25 16.38 0 22.63l22.62 22.62c6.25 6.25 16.38 6.25 22.63 0L480 365.25l46.06 46.06c6.25 6.25 16.38 6.25 22.63 0l22.62-22.62c6.25-6.25 6.25-16.38 0-22.63L525.25 320l46.06-46.06c6.25-6.25 6.25-16.38 0-22.63zM552 0H307.65c-14.54 0-27.26 9.8-30.95 23.87l-84.79 322.8-58.41-106.1A32.008 32.008 0 0 0 105.47 224H24c-13.25 0-24 10.74-24 24v48c0 13.25 10.75 24 24 24h43.62l88.88 163.73C168.99 503.5 186.3 512 204.94 512c17.27 0 44.44-9 54.28-41.48L357.03 96H552c13.25 0 24-10.75 24-24V24c0-13.26-10.75-24-24-24z"]
};
var faStamp = {
prefix: 'fas',
iconName: 'stamp',
icon: [512, 512, [], "f5bf", "M32 512h448v-64H32v64zm384-256h-66.56c-16.26 0-29.44-13.18-29.44-29.44v-9.46c0-27.37 8.88-53.41 21.46-77.72 9.11-17.61 12.9-38.39 9.05-60.42-6.77-38.78-38.47-70.7-77.26-77.45C212.62-9.04 160 37.33 160 96c0 14.16 3.12 27.54 8.69 39.58C182.02 164.43 192 194.7 192 226.49v.07c0 16.26-13.18 29.44-29.44 29.44H96c-53.02 0-96 42.98-96 96v32c0 17.67 14.33 32 32 32h448c17.67 0 32-14.33 32-32v-32c0-53.02-42.98-96-96-96z"]
};
var faStar = {
prefix: 'fas',
iconName: 'star',
icon: [576, 512, [], "f005", "M259.3 17.8L194 150.2 47.9 171.5c-26.2 3.8-36.7 36.1-17.7 54.6l105.7 103-25 145.5c-4.5 26.3 23.2 46 46.4 33.7L288 439.6l130.7 68.7c23.2 12.2 50.9-7.4 46.4-33.7l-25-145.5 105.7-103c19-18.5 8.5-50.8-17.7-54.6L382 150.2 316.7 17.8c-11.7-23.6-45.6-23.9-57.4 0z"]
};
var faStarAndCrescent = {
prefix: 'fas',
iconName: 'star-and-crescent',
icon: [512, 512, [], "f699", "M340.47 466.36c-1.45 0-6.89.46-9.18.46-116.25 0-210.82-94.57-210.82-210.82S215.04 45.18 331.29 45.18c2.32 0 7.7.46 9.18.46 7.13 0 13.33-5.03 14.75-12.07 1.46-7.25-2.55-14.49-9.47-17.09C316.58 5.54 286.39 0 256 0 114.84 0 0 114.84 0 256s114.84 256 256 256c30.23 0 60.28-5.49 89.32-16.32 5.96-2.02 10.28-7.64 10.28-14.26 0-8.09-6.39-15.06-15.13-15.06zm162.99-252.5l-76.38-11.1-34.16-69.21c-1.83-3.7-5.38-5.55-8.93-5.55s-7.1 1.85-8.93 5.55l-34.16 69.21-76.38 11.1c-8.17 1.18-11.43 11.22-5.52 16.99l55.27 53.87-13.05 76.07c-1.11 6.44 4.01 11.66 9.81 11.66 1.53 0 3.11-.36 4.64-1.17L384 335.37l68.31 35.91c1.53.8 3.11 1.17 4.64 1.17 5.8 0 10.92-5.23 9.81-11.66l-13.05-76.07 55.27-53.87c5.91-5.77 2.65-15.81-5.52-16.99z"]
};
var faStarHalf = {
prefix: 'fas',
iconName: 'star-half',
icon: [576, 512, [], "f089", "M288 0c-11.4 0-22.8 5.9-28.7 17.8L194 150.2 47.9 171.4c-26.2 3.8-36.7 36.1-17.7 54.6l105.7 103-25 145.5c-4.5 26.1 23 46 46.4 33.7L288 439.6V0z"]
};
var faStarHalfAlt = {
prefix: 'fas',
iconName: 'star-half-alt',
icon: [536, 512, [], "f5c0", "M508.55 171.51L362.18 150.2 296.77 17.81C290.89 5.98 279.42 0 267.95 0c-11.4 0-22.79 5.9-28.69 17.81l-65.43 132.38-146.38 21.29c-26.25 3.8-36.77 36.09-17.74 54.59l105.89 103-25.06 145.48C86.98 495.33 103.57 512 122.15 512c4.93 0 10-1.17 14.87-3.75l130.95-68.68 130.94 68.7c4.86 2.55 9.92 3.71 14.83 3.71 18.6 0 35.22-16.61 31.66-37.4l-25.03-145.49 105.91-102.98c19.04-18.5 8.52-50.8-17.73-54.6zm-121.74 123.2l-18.12 17.62 4.28 24.88 19.52 113.45-102.13-53.59-22.38-11.74.03-317.19 51.03 103.29 11.18 22.63 25.01 3.64 114.23 16.63-82.65 80.38z"]
};
var faStarOfDavid = {
prefix: 'fas',
iconName: 'star-of-david',
icon: [464, 512, [], "f69a", "M405.68 256l53.21-89.39C473.3 142.4 455.48 112 426.88 112H319.96l-55.95-93.98C256.86 6.01 244.43 0 232 0s-24.86 6.01-32.01 18.02L144.04 112H37.11c-28.6 0-46.42 30.4-32.01 54.61L58.32 256 5.1 345.39C-9.31 369.6 8.51 400 37.11 400h106.93l55.95 93.98C207.14 505.99 219.57 512 232 512s24.86-6.01 32.01-18.02L319.96 400h106.93c28.6 0 46.42-30.4 32.01-54.61L405.68 256zm-12.78-88l-19.8 33.26L353.3 168h39.6zm-52.39 88l-52.39 88H175.88l-52.39-88 52.38-88h112.25l52.39 88zM232 73.72L254.79 112h-45.57L232 73.72zM71.1 168h39.6l-19.8 33.26L71.1 168zm0 176l19.8-33.26L110.7 344H71.1zM232 438.28L209.21 400h45.57L232 438.28zM353.29 344l19.8-33.26L392.9 344h-39.61z"]
};
var faStarOfLife = {
prefix: 'fas',
iconName: 'star-of-life',
icon: [480, 512, [], "f621", "M471.99 334.43L336.06 256l135.93-78.43c7.66-4.42 10.28-14.2 5.86-21.86l-32.02-55.43c-4.42-7.65-14.21-10.28-21.87-5.86l-135.93 78.43V16c0-8.84-7.17-16-16.01-16h-64.04c-8.84 0-16.01 7.16-16.01 16v156.86L56.04 94.43c-7.66-4.42-17.45-1.79-21.87 5.86L2.15 155.71c-4.42 7.65-1.8 17.44 5.86 21.86L143.94 256 8.01 334.43c-7.66 4.42-10.28 14.21-5.86 21.86l32.02 55.43c4.42 7.65 14.21 10.27 21.87 5.86l135.93-78.43V496c0 8.84 7.17 16 16.01 16h64.04c8.84 0 16.01-7.16 16.01-16V339.14l135.93 78.43c7.66 4.42 17.45 1.8 21.87-5.86l32.02-55.43c4.42-7.65 1.8-17.43-5.86-21.85z"]
};
var faStepBackward = {
prefix: 'fas',
iconName: 'step-backward',
icon: [448, 512, [], "f048", "M64 468V44c0-6.6 5.4-12 12-12h48c6.6 0 12 5.4 12 12v176.4l195.5-181C352.1 22.3 384 36.6 384 64v384c0 27.4-31.9 41.7-52.5 24.6L136 292.7V468c0 6.6-5.4 12-12 12H76c-6.6 0-12-5.4-12-12z"]
};
var faStepForward = {
prefix: 'fas',
iconName: 'step-forward',
icon: [448, 512, [], "f051", "M384 44v424c0 6.6-5.4 12-12 12h-48c-6.6 0-12-5.4-12-12V291.6l-195.5 181C95.9 489.7 64 475.4 64 448V64c0-27.4 31.9-41.7 52.5-24.6L312 219.3V44c0-6.6 5.4-12 12-12h48c6.6 0 12 5.4 12 12z"]
};
var faStethoscope = {
prefix: 'fas',
iconName: 'stethoscope',
icon: [512, 512, [], "f0f1", "M447.1 112c-34.2.5-62.3 28.4-63 62.6-.5 24.3 12.5 45.6 32 56.8V344c0 57.3-50.2 104-112 104-60 0-109.2-44.1-111.9-99.2C265 333.8 320 269.2 320 192V36.6c0-11.4-8.1-21.3-19.3-23.5L237.8.5c-13-2.6-25.6 5.8-28.2 18.8L206.4 35c-2.6 13 5.8 25.6 18.8 28.2l30.7 6.1v121.4c0 52.9-42.2 96.7-95.1 97.2-53.4.5-96.9-42.7-96.9-96V69.4l30.7-6.1c13-2.6 21.4-15.2 18.8-28.2l-3.1-15.7C107.7 6.4 95.1-2 82.1.6L19.3 13C8.1 15.3 0 25.1 0 36.6V192c0 77.3 55.1 142 128.1 156.8C130.7 439.2 208.6 512 304 512c97 0 176-75.4 176-168V231.4c19.1-11.1 32-31.7 32-55.4 0-35.7-29.2-64.5-64.9-64zm.9 80c-8.8 0-16-7.2-16-16s7.2-16 16-16 16 7.2 16 16-7.2 16-16 16z"]
};
var faStickyNote = {
prefix: 'fas',
iconName: 'sticky-note',
icon: [448, 512, [], "f249", "M312 320h136V56c0-13.3-10.7-24-24-24H24C10.7 32 0 42.7 0 56v400c0 13.3 10.7 24 24 24h264V344c0-13.2 10.8-24 24-24zm129 55l-98 98c-4.5 4.5-10.6 7-17 7h-6V352h128v6.1c0 6.3-2.5 12.4-7 16.9z"]
};
var faStop = {
prefix: 'fas',
iconName: 'stop',
icon: [448, 512, [], "f04d", "M400 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48z"]
};
var faStopCircle = {
prefix: 'fas',
iconName: 'stop-circle',
icon: [512, 512, [], "f28d", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm96 328c0 8.8-7.2 16-16 16H176c-8.8 0-16-7.2-16-16V176c0-8.8 7.2-16 16-16h160c8.8 0 16 7.2 16 16v160z"]
};
var faStopwatch = {
prefix: 'fas',
iconName: 'stopwatch',
icon: [448, 512, [], "f2f2", "M432 304c0 114.9-93.1 208-208 208S16 418.9 16 304c0-104 76.3-190.2 176-205.5V64h-28c-6.6 0-12-5.4-12-12V12c0-6.6 5.4-12 12-12h120c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-28v34.5c37.5 5.8 71.7 21.6 99.7 44.6l27.5-27.5c4.7-4.7 12.3-4.7 17 0l28.3 28.3c4.7 4.7 4.7 12.3 0 17l-29.4 29.4-.6.6C419.7 223.3 432 262.2 432 304zm-176 36V188.5c0-6.6-5.4-12-12-12h-40c-6.6 0-12 5.4-12 12V340c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12z"]
};
var faStopwatch20 = {
prefix: 'fas',
iconName: 'stopwatch-20',
icon: [448, 512, [], "e06f", "M398.5,190.91l.59-.61,26.59-26.58a16,16,0,0,0,0-22.63L403,118.41a16,16,0,0,0-22.63,0l-24.68,24.68A206.68,206.68,0,0,0,256,98.5V64h32a16,16,0,0,0,16-16V16A16,16,0,0,0,288,0H160a16.05,16.05,0,0,0-16,16V48a16.05,16.05,0,0,0,16,16h32V98.5A207.92,207.92,0,0,0,16.09,297.57C12.64,411.5,106.76,510.22,220.72,512,337.13,513.77,432,420,432,304A206,206,0,0,0,398.5,190.91ZM204.37,377.55a8.2,8.2,0,0,1,8.32,8.07v22.31a8.2,8.2,0,0,1-8.32,8.07H121.52a16.46,16.46,0,0,1-16.61-17.62c2.78-35.22,14.67-57.41,38.45-91.37,20.42-29.19,27.1-37.32,27.1-62.34,0-16.92-1.79-24.27-12.21-24.27-9.39,0-12.69,7.4-12.69,22.68v5.23a8.2,8.2,0,0,1-8.33,8.07h-24.9a8.2,8.2,0,0,1-8.33-8.07v-4.07c0-27.3,8.48-60.24,56.43-60.24,43,0,55.57,25.85,55.57,61,0,35.58-12.44,51.21-34.35,81.31-11.56,15-24.61,35.57-26.41,51.2ZM344,352.32c0,35.16-12.3,63.68-57.23,63.68C243.19,416,232,386.48,232,352.55V247.22c0-40.73,19.58-63.22,56.2-63.22C325,184,344,206.64,344,245.3ZM287.87,221.73c-9.41,0-13.23,7.5-13.23,20V357.68c0,13.11,3.59,20.59,13.23,20.59s13-8,13-21.27V241.06C300.89,229.79,297.88,221.73,287.87,221.73Z"]
};
var faStore = {
prefix: 'fas',
iconName: 'store',
icon: [616, 512, [], "f54e", "M602 118.6L537.1 15C531.3 5.7 521 0 510 0H106C95 0 84.7 5.7 78.9 15L14 118.6c-33.5 53.5-3.8 127.9 58.8 136.4 4.5.6 9.1.9 13.7.9 29.6 0 55.8-13 73.8-33.1 18 20.1 44.3 33.1 73.8 33.1 29.6 0 55.8-13 73.8-33.1 18 20.1 44.3 33.1 73.8 33.1 29.6 0 55.8-13 73.8-33.1 18.1 20.1 44.3 33.1 73.8 33.1 4.7 0 9.2-.3 13.7-.9 62.8-8.4 92.6-82.8 59-136.4zM529.5 288c-10 0-19.9-1.5-29.5-3.8V384H116v-99.8c-9.6 2.2-19.5 3.8-29.5 3.8-6 0-12.1-.4-18-1.2-5.6-.8-11.1-2.1-16.4-3.6V480c0 17.7 14.3 32 32 32h448c17.7 0 32-14.3 32-32V283.2c-5.4 1.6-10.8 2.9-16.4 3.6-6.1.8-12.1 1.2-18.2 1.2z"]
};
var faStoreAlt = {
prefix: 'fas',
iconName: 'store-alt',
icon: [640, 512, [], "f54f", "M320 384H128V224H64v256c0 17.7 14.3 32 32 32h256c17.7 0 32-14.3 32-32V224h-64v160zm314.6-241.8l-85.3-128c-6-8.9-16-14.2-26.7-14.2H117.4c-10.7 0-20.7 5.3-26.6 14.2l-85.3 128c-14.2 21.3 1 49.8 26.6 49.8H608c25.5 0 40.7-28.5 26.6-49.8zM512 496c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16V224h-64v272z"]
};
var faStoreAltSlash = {
prefix: 'fas',
iconName: 'store-alt-slash',
icon: [640, 512, [], "e070", "M17.89,123.62,5.51,142.2c-14.2,21.3,1,49.8,26.59,49.8h74.26ZM576,413.42V224H512V364L384,265V224H330.92l-41.4-32H608c25.5,0,40.7-28.5,26.59-49.8l-85.29-128A32.18,32.18,0,0,0,522.6,0H117.42A31.87,31.87,0,0,0,90.81,14.2l-10.66,16L45.46,3.38A16,16,0,0,0,23,6.19L3.37,31.46A16,16,0,0,0,6.18,53.91L594.53,508.63A16,16,0,0,0,617,505.81l19.64-25.26a16,16,0,0,0-2.81-22.45ZM320,384H128V224H64V480a32,32,0,0,0,32,32H352a32,32,0,0,0,32-32V406.59l-64-49.47Z"]
};
var faStoreSlash = {
prefix: 'fas',
iconName: 'store-slash',
icon: [640, 512, [], "e071", "M121.51,384V284.2a119.43,119.43,0,0,1-28,3.8,123.46,123.46,0,0,1-17.1-1.2,114.88,114.88,0,0,1-15.58-3.6V480c0,17.7,13.59,32,30.4,32H505.75L348.42,384Zm-28-128.09c25.1,0,47.29-10.72,64-27.24L24,120.05c-30.52,53.39-2.45,126.53,56.49,135A95.68,95.68,0,0,0,93.48,255.91ZM602.13,458.09,547.2,413.41V283.2a93.5,93.5,0,0,1-15.57,3.6,127.31,127.31,0,0,1-17.29,1.2,114.89,114.89,0,0,1-28-3.8v79.68L348.52,251.77a88.06,88.06,0,0,0,25.41,4.14c28.11,0,53-13,70.11-33.11,17.19,20.11,42.08,33.11,70.11,33.11a94.31,94.31,0,0,0,13-.91c59.66-8.41,88-82.8,56.06-136.4L521.55,15A30.1,30.1,0,0,0,495.81,0H112A30.11,30.11,0,0,0,86.27,15L76.88,30.78,43.19,3.38A14.68,14.68,0,0,0,21.86,6.19L3.2,31.45A16.58,16.58,0,0,0,5.87,53.91L564.81,508.63a14.69,14.69,0,0,0,21.33-2.82l18.66-25.26A16.58,16.58,0,0,0,602.13,458.09Z"]
};
var faStream = {
prefix: 'fas',
iconName: 'stream',
icon: [512, 512, [], "f550", "M16 128h416c8.84 0 16-7.16 16-16V48c0-8.84-7.16-16-16-16H16C7.16 32 0 39.16 0 48v64c0 8.84 7.16 16 16 16zm480 80H80c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h416c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16zm-64 176H16c-8.84 0-16 7.16-16 16v64c0 8.84 7.16 16 16 16h416c8.84 0 16-7.16 16-16v-64c0-8.84-7.16-16-16-16z"]
};
var faStreetView = {
prefix: 'fas',
iconName: 'street-view',
icon: [512, 512, [], "f21d", "M367.9 329.76c-4.62 5.3-9.78 10.1-15.9 13.65v22.94c66.52 9.34 112 28.05 112 49.65 0 30.93-93.12 56-208 56S48 446.93 48 416c0-21.6 45.48-40.3 112-49.65v-22.94c-6.12-3.55-11.28-8.35-15.9-13.65C58.87 345.34 0 378.05 0 416c0 53.02 114.62 96 256 96s256-42.98 256-96c0-37.95-58.87-70.66-144.1-86.24zM256 128c35.35 0 64-28.65 64-64S291.35 0 256 0s-64 28.65-64 64 28.65 64 64 64zm-64 192v96c0 17.67 14.33 32 32 32h64c17.67 0 32-14.33 32-32v-96c17.67 0 32-14.33 32-32v-96c0-26.51-21.49-48-48-48h-11.8c-11.07 5.03-23.26 8-36.2 8s-25.13-2.97-36.2-8H208c-26.51 0-48 21.49-48 48v96c0 17.67 14.33 32 32 32z"]
};
var faStrikethrough = {
prefix: 'fas',
iconName: 'strikethrough',
icon: [512, 512, [], "f0cc", "M496 224H293.9l-87.17-26.83A43.55 43.55 0 0 1 219.55 112h66.79A49.89 49.89 0 0 1 331 139.58a16 16 0 0 0 21.46 7.15l42.94-21.47a16 16 0 0 0 7.16-21.46l-.53-1A128 128 0 0 0 287.51 32h-68a123.68 123.68 0 0 0-123 135.64c2 20.89 10.1 39.83 21.78 56.36H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h480a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm-180.24 96A43 43 0 0 1 336 356.45 43.59 43.59 0 0 1 292.45 400h-66.79A49.89 49.89 0 0 1 181 372.42a16 16 0 0 0-21.46-7.15l-42.94 21.47a16 16 0 0 0-7.16 21.46l.53 1A128 128 0 0 0 224.49 480h68a123.68 123.68 0 0 0 123-135.64 114.25 114.25 0 0 0-5.34-24.36z"]
};
var faStroopwafel = {
prefix: 'fas',
iconName: 'stroopwafel',
icon: [512, 512, [], "f551", "M188.12 210.74L142.86 256l45.25 45.25L233.37 256l-45.25-45.26zm113.13-22.62L256 142.86l-45.25 45.25L256 233.37l45.25-45.25zm-90.5 135.76L256 369.14l45.26-45.26L256 278.63l-45.25 45.25zM256 0C114.62 0 0 114.62 0 256s114.62 256 256 256 256-114.62 256-256S397.38 0 256 0zm186.68 295.6l-11.31 11.31c-3.12 3.12-8.19 3.12-11.31 0l-28.29-28.29-45.25 45.25 33.94 33.94 16.97-16.97c3.12-3.12 8.19-3.12 11.31 0l11.31 11.31c3.12 3.12 3.12 8.19 0 11.31l-16.97 16.97 16.97 16.97c3.12 3.12 3.12 8.19 0 11.31l-11.31 11.31c-3.12 3.12-8.19 3.12-11.31 0l-16.97-16.97-16.97 16.97c-3.12 3.12-8.19 3.12-11.31 0l-11.31-11.31c-3.12-3.12-3.12-8.19 0-11.31l16.97-16.97-33.94-33.94-45.26 45.26 28.29 28.29c3.12 3.12 3.12 8.19 0 11.31l-11.31 11.31c-3.12 3.12-8.19 3.12-11.31 0L256 414.39l-28.29 28.29c-3.12 3.12-8.19 3.12-11.31 0l-11.31-11.31c-3.12-3.12-3.12-8.19 0-11.31l28.29-28.29-45.25-45.26-33.94 33.94 16.97 16.97c3.12 3.12 3.12 8.19 0 11.31l-11.31 11.31c-3.12 3.12-8.19 3.12-11.31 0l-16.97-16.97-16.97 16.97c-3.12 3.12-8.19 3.12-11.31 0l-11.31-11.31c-3.12-3.12-3.12-8.19 0-11.31l16.97-16.97-16.97-16.97c-3.12-3.12-3.12-8.19 0-11.31l11.31-11.31c3.12-3.12 8.19-3.12 11.31 0l16.97 16.97 33.94-33.94-45.25-45.25-28.29 28.29c-3.12 3.12-8.19 3.12-11.31 0L69.32 295.6c-3.12-3.12-3.12-8.19 0-11.31L97.61 256l-28.29-28.29c-3.12-3.12-3.12-8.19 0-11.31l11.31-11.31c3.12-3.12 8.19-3.12 11.31 0l28.29 28.29 45.25-45.26-33.94-33.94-16.97 16.97c-3.12 3.12-8.19 3.12-11.31 0l-11.31-11.31c-3.12-3.12-3.12-8.19 0-11.31l16.97-16.97-16.97-16.97c-3.12-3.12-3.12-8.19 0-11.31l11.31-11.31c3.12-3.12 8.19-3.12 11.31 0l16.97 16.97 16.97-16.97c3.12-3.12 8.19-3.12 11.31 0l11.31 11.31c3.12 3.12 3.12 8.19 0 11.31l-16.97 16.97 33.94 33.94 45.26-45.25-28.29-28.29c-3.12-3.12-3.12-8.19 0-11.31l11.31-11.31c3.12-3.12 8.19-3.12 11.31 0L256 97.61l28.29-28.29c3.12-3.12 8.19-3.12 11.31 0l11.31 11.31c3.12 3.12 3.12 8.19 0 11.31l-28.29 28.29 45.26 45.25 33.94-33.94-16.97-16.97c-3.12-3.12-3.12-8.19 0-11.31l11.31-11.31c3.12-3.12 8.19-3.12 11.31 0l16.97 16.97 16.97-16.97c3.12-3.12 8.19-3.12 11.31 0l11.31 11.31c3.12 3.12 3.12 8.19 0 11.31l-16.97 16.97 16.97 16.97c3.12 3.12 3.12 8.19 0 11.31l-11.31 11.31c-3.12 3.12-8.19 3.12-11.31 0l-16.97-16.97-33.94 33.94 45.25 45.26 28.29-28.29c3.12-3.12 8.19-3.12 11.31 0l11.31 11.31c3.12 3.12 3.12 8.19 0 11.31L414.39 256l28.29 28.28a8.015 8.015 0 0 1 0 11.32zM278.63 256l45.26 45.25L369.14 256l-45.25-45.26L278.63 256z"]
};
var faSubscript = {
prefix: 'fas',
iconName: 'subscript',
icon: [512, 512, [], "f12c", "M496 448h-16V304a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 400 352h16v96h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM336 64h-67a16 16 0 0 0-13.14 6.87l-79.9 115-79.9-115A16 16 0 0 0 83 64H16A16 16 0 0 0 0 80v48a16 16 0 0 0 16 16h33.48l77.81 112-77.81 112H16a16 16 0 0 0-16 16v48a16 16 0 0 0 16 16h67a16 16 0 0 0 13.14-6.87l79.9-115 79.9 115A16 16 0 0 0 269 448h67a16 16 0 0 0 16-16v-48a16 16 0 0 0-16-16h-33.48l-77.81-112 77.81-112H336a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16z"]
};
var faSubway = {
prefix: 'fas',
iconName: 'subway',
icon: [448, 512, [], "f239", "M448 96v256c0 51.815-61.624 96-130.022 96l62.98 49.721C386.905 502.417 383.562 512 376 512H72c-7.578 0-10.892-9.594-4.957-14.279L130.022 448C61.82 448 0 403.954 0 352V96C0 42.981 64 0 128 0h192c65 0 128 42.981 128 96zM200 232V120c0-13.255-10.745-24-24-24H72c-13.255 0-24 10.745-24 24v112c0 13.255 10.745 24 24 24h104c13.255 0 24-10.745 24-24zm200 0V120c0-13.255-10.745-24-24-24H272c-13.255 0-24 10.745-24 24v112c0 13.255 10.745 24 24 24h104c13.255 0 24-10.745 24-24zm-48 56c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.49-48-48-48zm-256 0c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.49-48-48-48z"]
};
var faSuitcase = {
prefix: 'fas',
iconName: 'suitcase',
icon: [512, 512, [], "f0f2", "M128 480h256V80c0-26.5-21.5-48-48-48H176c-26.5 0-48 21.5-48 48v400zm64-384h128v32H192V96zm320 80v256c0 26.5-21.5 48-48 48h-48V128h48c26.5 0 48 21.5 48 48zM96 480H48c-26.5 0-48-21.5-48-48V176c0-26.5 21.5-48 48-48h48v352z"]
};
var faSuitcaseRolling = {
prefix: 'fas',
iconName: 'suitcase-rolling',
icon: [384, 512, [], "f5c1", "M336 160H48c-26.51 0-48 21.49-48 48v224c0 26.51 21.49 48 48 48h16v16c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-16h128v16c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-16h16c26.51 0 48-21.49 48-48V208c0-26.51-21.49-48-48-48zm-16 216c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h240c4.42 0 8 3.58 8 8v16zm0-96c0 4.42-3.58 8-8 8H72c-4.42 0-8-3.58-8-8v-16c0-4.42 3.58-8 8-8h240c4.42 0 8 3.58 8 8v16zM144 48h96v80h48V48c0-26.51-21.49-48-48-48h-96c-26.51 0-48 21.49-48 48v80h48V48z"]
};
var faSun = {
prefix: 'fas',
iconName: 'sun',
icon: [512, 512, [], "f185", "M256 160c-52.9 0-96 43.1-96 96s43.1 96 96 96 96-43.1 96-96-43.1-96-96-96zm246.4 80.5l-94.7-47.3 33.5-100.4c4.5-13.6-8.4-26.5-21.9-21.9l-100.4 33.5-47.4-94.8c-6.4-12.8-24.6-12.8-31 0l-47.3 94.7L92.7 70.8c-13.6-4.5-26.5 8.4-21.9 21.9l33.5 100.4-94.7 47.4c-12.8 6.4-12.8 24.6 0 31l94.7 47.3-33.5 100.5c-4.5 13.6 8.4 26.5 21.9 21.9l100.4-33.5 47.3 94.7c6.4 12.8 24.6 12.8 31 0l47.3-94.7 100.4 33.5c13.6 4.5 26.5-8.4 21.9-21.9l-33.5-100.4 94.7-47.3c13-6.5 13-24.7.2-31.1zm-155.9 106c-49.9 49.9-131.1 49.9-181 0-49.9-49.9-49.9-131.1 0-181 49.9-49.9 131.1-49.9 181 0 49.9 49.9 49.9 131.1 0 181z"]
};
var faSuperscript = {
prefix: 'fas',
iconName: 'superscript',
icon: [512, 512, [], "f12b", "M496 160h-16V16a16 16 0 0 0-16-16h-48a16 16 0 0 0-14.29 8.83l-16 32A16 16 0 0 0 400 64h16v96h-16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h96a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zM336 64h-67a16 16 0 0 0-13.14 6.87l-79.9 115-79.9-115A16 16 0 0 0 83 64H16A16 16 0 0 0 0 80v48a16 16 0 0 0 16 16h33.48l77.81 112-77.81 112H16a16 16 0 0 0-16 16v48a16 16 0 0 0 16 16h67a16 16 0 0 0 13.14-6.87l79.9-115 79.9 115A16 16 0 0 0 269 448h67a16 16 0 0 0 16-16v-48a16 16 0 0 0-16-16h-33.48l-77.81-112 77.81-112H336a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16z"]
};
var faSurprise = {
prefix: 'fas',
iconName: 'surprise',
icon: [496, 512, [], "f5c2", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zM136 208c0-17.7 14.3-32 32-32s32 14.3 32 32-14.3 32-32 32-32-14.3-32-32zm112 208c-35.3 0-64-28.7-64-64s28.7-64 64-64 64 28.7 64 64-28.7 64-64 64zm80-176c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faSwatchbook = {
prefix: 'fas',
iconName: 'swatchbook',
icon: [512, 512, [], "f5c3", "M434.66,167.71h0L344.5,77.36a31.83,31.83,0,0,0-45-.07h0l-.07.07L224,152.88V424L434.66,212.9A32,32,0,0,0,434.66,167.71ZM480,320H373.09L186.68,506.51c-2.06,2.07-4.5,3.58-6.68,5.49H480a32,32,0,0,0,32-32V352A32,32,0,0,0,480,320ZM192,32A32,32,0,0,0,160,0H32A32,32,0,0,0,0,32V416a96,96,0,0,0,192,0ZM96,440a24,24,0,1,1,24-24A24,24,0,0,1,96,440Zm32-184H64V192h64Zm0-128H64V64h64Z"]
};
var faSwimmer = {
prefix: 'fas',
iconName: 'swimmer',
icon: [640, 512, [], "f5c4", "M189.61 310.58c3.54 3.26 15.27 9.42 34.39 9.42s30.86-6.16 34.39-9.42c16.02-14.77 34.5-22.58 53.46-22.58h16.3c18.96 0 37.45 7.81 53.46 22.58 3.54 3.26 15.27 9.42 34.39 9.42s30.86-6.16 34.39-9.42c14.86-13.71 31.88-21.12 49.39-22.16l-112.84-80.6 18-12.86c3.64-2.58 8.28-3.52 12.62-2.61l100.35 21.53c25.91 5.53 51.44-10.97 57-36.88 5.55-25.92-10.95-51.44-36.88-57L437.68 98.47c-30.73-6.58-63.02.12-88.56 18.38l-80.02 57.17c-10.38 7.39-19.36 16.44-26.72 26.94L173.75 299c5.47 3.23 10.82 6.93 15.86 11.58zM624 352h-16c-26.04 0-45.8-8.42-56.09-17.9-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C461.8 343.58 442.04 352 416 352s-45.8-8.42-56.09-17.9c-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C269.8 343.58 250.04 352 224 352s-45.8-8.42-56.09-17.9c-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C77.8 343.58 58.04 352 32 352H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h16c38.62 0 72.72-12.19 96-31.84 23.28 19.66 57.38 31.84 96 31.84s72.72-12.19 96-31.84c23.28 19.66 57.38 31.84 96 31.84s72.72-12.19 96-31.84c23.28 19.66 57.38 31.84 96 31.84h16c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm-512-96c44.18 0 80-35.82 80-80s-35.82-80-80-80-80 35.82-80 80 35.82 80 80 80z"]
};
var faSwimmingPool = {
prefix: 'fas',
iconName: 'swimming-pool',
icon: [640, 512, [], "f5c5", "M624 416h-16c-26.04 0-45.8-8.42-56.09-17.9-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C461.8 407.58 442.04 416 416 416s-45.8-8.42-56.09-17.9c-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C269.8 407.58 250.04 416 224 416s-45.8-8.42-56.09-17.9c-8.9-8.21-19.66-14.1-31.77-14.1h-16.3c-12.11 0-22.87 5.89-31.77 14.1C77.8 407.58 58.04 416 32 416H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h16c38.62 0 72.72-12.19 96-31.84 23.28 19.66 57.38 31.84 96 31.84s72.72-12.19 96-31.84c23.28 19.66 57.38 31.84 96 31.84s72.72-12.19 96-31.84c23.28 19.66 57.38 31.84 96 31.84h16c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm-400-32v-96h192v96c19.12 0 30.86-6.16 34.39-9.42 9.17-8.46 19.2-14.34 29.61-18.07V128c0-17.64 14.36-32 32-32s32 14.36 32 32v16c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-16c0-52.94-43.06-96-96-96s-96 43.06-96 96v96H224v-96c0-17.64 14.36-32 32-32s32 14.36 32 32v16c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-16c0-52.94-43.06-96-96-96s-96 43.06-96 96v228.5c10.41 3.73 20.44 9.62 29.61 18.07 3.53 3.27 15.27 9.43 34.39 9.43z"]
};
var faSynagogue = {
prefix: 'fas',
iconName: 'synagogue',
icon: [640, 512, [], "f69b", "M70 196.51L6.67 268.29A26.643 26.643 0 0 0 0 285.93V512h128V239.58l-38-43.07c-5.31-6.01-14.69-6.01-20 0zm563.33 71.78L570 196.51c-5.31-6.02-14.69-6.02-20 0l-38 43.07V512h128V285.93c0-6.5-2.37-12.77-6.67-17.64zM339.99 7.01c-11.69-9.35-28.29-9.35-39.98 0l-128 102.4A32.005 32.005 0 0 0 160 134.4V512h96v-92.57c0-31.88 21.78-61.43 53.25-66.55C349.34 346.35 384 377.13 384 416v96h96V134.4c0-9.72-4.42-18.92-12.01-24.99l-128-102.4zm52.07 215.55c1.98 3.15-.29 7.24-4 7.24h-38.94L324 269.79c-1.85 2.95-6.15 2.95-8 0l-25.12-39.98h-38.94c-3.72 0-5.98-4.09-4-7.24l19.2-30.56-19.2-30.56c-1.98-3.15.29-7.24 4-7.24h38.94l25.12-40c1.85-2.95 6.15-2.95 8 0l25.12 39.98h38.95c3.71 0 5.98 4.09 4 7.24L372.87 192l19.19 30.56z"]
};
var faSync = {
prefix: 'fas',
iconName: 'sync',
icon: [512, 512, [], "f021", "M440.65 12.57l4 82.77A247.16 247.16 0 0 0 255.83 8C134.73 8 33.91 94.92 12.29 209.82A12 12 0 0 0 24.09 224h49.05a12 12 0 0 0 11.67-9.26 175.91 175.91 0 0 1 317-56.94l-101.46-4.86a12 12 0 0 0-12.57 12v47.41a12 12 0 0 0 12 12H500a12 12 0 0 0 12-12V12a12 12 0 0 0-12-12h-47.37a12 12 0 0 0-11.98 12.57zM255.83 432a175.61 175.61 0 0 1-146-77.8l101.8 4.87a12 12 0 0 0 12.57-12v-47.4a12 12 0 0 0-12-12H12a12 12 0 0 0-12 12V500a12 12 0 0 0 12 12h47.35a12 12 0 0 0 12-12.6l-4.15-82.57A247.17 247.17 0 0 0 255.83 504c121.11 0 221.93-86.92 243.55-201.82a12 12 0 0 0-11.8-14.18h-49.05a12 12 0 0 0-11.67 9.26A175.86 175.86 0 0 1 255.83 432z"]
};
var faSyncAlt = {
prefix: 'fas',
iconName: 'sync-alt',
icon: [512, 512, [], "f2f1", "M370.72 133.28C339.458 104.008 298.888 87.962 255.848 88c-77.458.068-144.328 53.178-162.791 126.85-1.344 5.363-6.122 9.15-11.651 9.15H24.103c-7.498 0-13.194-6.807-11.807-14.176C33.933 94.924 134.813 8 256 8c66.448 0 126.791 26.136 171.315 68.685L463.03 40.97C478.149 25.851 504 36.559 504 57.941V192c0 13.255-10.745 24-24 24H345.941c-21.382 0-32.09-25.851-16.971-40.971l41.75-41.749zM32 296h134.059c21.382 0 32.09 25.851 16.971 40.971l-41.75 41.75c31.262 29.273 71.835 45.319 114.876 45.28 77.418-.07 144.315-53.144 162.787-126.849 1.344-5.363 6.122-9.15 11.651-9.15h57.304c7.498 0 13.194 6.807 11.807 14.176C478.067 417.076 377.187 504 256 504c-66.448 0-126.791-26.136-171.315-68.685L48.97 471.03C33.851 486.149 8 475.441 8 454.059V320c0-13.255 10.745-24 24-24z"]
};
var faSyringe = {
prefix: 'fas',
iconName: 'syringe',
icon: [512, 512, [], "f48e", "M201.5 174.8l55.7 55.8c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0l-55.7-55.8-45.3 45.3 55.8 55.8c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0L111 265.2l-26.4 26.4c-17.3 17.3-25.6 41.1-23 65.4l7.1 63.6L2.3 487c-3.1 3.1-3.1 8.2 0 11.3l11.3 11.3c3.1 3.1 8.2 3.1 11.3 0l66.3-66.3 63.6 7.1c23.9 2.6 47.9-5.4 65.4-23l181.9-181.9-135.7-135.7-64.9 65zm308.2-93.3L430.5 2.3c-3.1-3.1-8.2-3.1-11.3 0l-11.3 11.3c-3.1 3.1-3.1 8.2 0 11.3l28.3 28.3-45.3 45.3-56.6-56.6-17-17c-3.1-3.1-8.2-3.1-11.3 0l-33.9 33.9c-3.1 3.1-3.1 8.2 0 11.3l17 17L424.8 223l17 17c3.1 3.1 8.2 3.1 11.3 0l33.9-34c3.1-3.1 3.1-8.2 0-11.3l-73.5-73.5 45.3-45.3 28.3 28.3c3.1 3.1 8.2 3.1 11.3 0l11.3-11.3c3.1-3.2 3.1-8.2 0-11.4z"]
};
var faTable = {
prefix: 'fas',
iconName: 'table',
icon: [512, 512, [], "f0ce", "M464 32H48C21.49 32 0 53.49 0 80v352c0 26.51 21.49 48 48 48h416c26.51 0 48-21.49 48-48V80c0-26.51-21.49-48-48-48zM224 416H64v-96h160v96zm0-160H64v-96h160v96zm224 160H288v-96h160v96zm0-160H288v-96h160v96z"]
};
var faTableTennis = {
prefix: 'fas',
iconName: 'table-tennis',
icon: [512, 512, [], "f45d", "M496.2 296.5C527.7 218.7 512 126.2 449 63.1 365.1-21 229-21 145.1 63.1l-56 56.1 211.5 211.5c46.1-62.1 131.5-77.4 195.6-34.2zm-217.9 79.7L57.9 155.9c-27.3 45.3-21.7 105 17.3 144.1l34.5 34.6L6.7 424c-8.6 7.5-9.1 20.7-1 28.8l53.4 53.5c8 8.1 21.2 7.6 28.7-1L177.1 402l35.7 35.7c19.7 19.7 44.6 30.5 70.3 33.3-7.1-17-11-35.6-11-55.1-.1-13.8 2.5-27 6.2-39.7zM416 320c-53 0-96 43-96 96s43 96 96 96 96-43 96-96-43-96-96-96z"]
};
var faTablet = {
prefix: 'fas',
iconName: 'tablet',
icon: [448, 512, [], "f10a", "M400 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM224 480c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32z"]
};
var faTabletAlt = {
prefix: 'fas',
iconName: 'tablet-alt',
icon: [448, 512, [], "f3fa", "M400 0H48C21.5 0 0 21.5 0 48v416c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V48c0-26.5-21.5-48-48-48zM224 480c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm176-108c0 6.6-5.4 12-12 12H60c-6.6 0-12-5.4-12-12V60c0-6.6 5.4-12 12-12h328c6.6 0 12 5.4 12 12v312z"]
};
var faTablets = {
prefix: 'fas',
iconName: 'tablets',
icon: [640, 512, [], "f490", "M160 192C78.9 192 12.5 250.5.1 326.7c-.8 4.8 3.3 9.3 8.3 9.3h303.3c5 0 9.1-4.5 8.3-9.3C307.5 250.5 241.1 192 160 192zm151.6 176H8.4c-5 0-9.1 4.5-8.3 9.3C12.5 453.5 78.9 512 160 512s147.5-58.5 159.9-134.7c.8-4.8-3.3-9.3-8.3-9.3zM593.4 46.6c-56.5-56.5-144.2-61.4-206.9-16-4 2.9-4.3 8.9-.8 12.3L597 254.3c3.5 3.5 9.5 3.2 12.3-.8 45.5-62.7 40.6-150.4-15.9-206.9zM363 65.7c-3.5-3.5-9.5-3.2-12.3.8-45.4 62.7-40.5 150.4 15.9 206.9 56.5 56.5 144.2 61.4 206.9 15.9 4-2.9 4.3-8.9.8-12.3L363 65.7z"]
};
var faTachometerAlt = {
prefix: 'fas',
iconName: 'tachometer-alt',
icon: [576, 512, [], "f3fd", "M288 32C128.94 32 0 160.94 0 320c0 52.8 14.25 102.26 39.06 144.8 5.61 9.62 16.3 15.2 27.44 15.2h443c11.14 0 21.83-5.58 27.44-15.2C561.75 422.26 576 372.8 576 320c0-159.06-128.94-288-288-288zm0 64c14.71 0 26.58 10.13 30.32 23.65-1.11 2.26-2.64 4.23-3.45 6.67l-9.22 27.67c-5.13 3.49-10.97 6.01-17.64 6.01-17.67 0-32-14.33-32-32S270.33 96 288 96zM96 384c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm48-160c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm246.77-72.41l-61.33 184C343.13 347.33 352 364.54 352 384c0 11.72-3.38 22.55-8.88 32H232.88c-5.5-9.45-8.88-20.28-8.88-32 0-33.94 26.5-61.43 59.9-63.59l61.34-184.01c4.17-12.56 17.73-19.45 30.36-15.17 12.57 4.19 19.35 17.79 15.17 30.36zm14.66 57.2l15.52-46.55c3.47-1.29 7.13-2.23 11.05-2.23 17.67 0 32 14.33 32 32s-14.33 32-32 32c-11.38-.01-20.89-6.28-26.57-15.22zM480 384c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faTag = {
prefix: 'fas',
iconName: 'tag',
icon: [512, 512, [], "f02b", "M0 252.118V48C0 21.49 21.49 0 48 0h204.118a48 48 0 0 1 33.941 14.059l211.882 211.882c18.745 18.745 18.745 49.137 0 67.882L293.823 497.941c-18.745 18.745-49.137 18.745-67.882 0L14.059 286.059A48 48 0 0 1 0 252.118zM112 64c-26.51 0-48 21.49-48 48s21.49 48 48 48 48-21.49 48-48-21.49-48-48-48z"]
};
var faTags = {
prefix: 'fas',
iconName: 'tags',
icon: [640, 512, [], "f02c", "M497.941 225.941L286.059 14.059A48 48 0 0 0 252.118 0H48C21.49 0 0 21.49 0 48v204.118a48 48 0 0 0 14.059 33.941l211.882 211.882c18.744 18.745 49.136 18.746 67.882 0l204.118-204.118c18.745-18.745 18.745-49.137 0-67.882zM112 160c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm513.941 133.823L421.823 497.941c-18.745 18.745-49.137 18.745-67.882 0l-.36-.36L527.64 323.522c16.999-16.999 26.36-39.6 26.36-63.64s-9.362-46.641-26.36-63.64L331.397 0h48.721a48 48 0 0 1 33.941 14.059l211.882 211.882c18.745 18.745 18.745 49.137 0 67.882z"]
};
var faTape = {
prefix: 'fas',
iconName: 'tape',
icon: [640, 512, [], "f4db", "M224 192c-35.3 0-64 28.7-64 64s28.7 64 64 64 64-28.7 64-64-28.7-64-64-64zm400 224H380.6c41.5-40.7 67.4-97.3 67.4-160 0-123.7-100.3-224-224-224S0 132.3 0 256s100.3 224 224 224h400c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm-400-64c-53 0-96-43-96-96s43-96 96-96 96 43 96 96-43 96-96 96z"]
};
var faTasks = {
prefix: 'fas',
iconName: 'tasks',
icon: [512, 512, [], "f0ae", "M139.61 35.5a12 12 0 0 0-17 0L58.93 98.81l-22.7-22.12a12 12 0 0 0-17 0L3.53 92.41a12 12 0 0 0 0 17l47.59 47.4a12.78 12.78 0 0 0 17.61 0l15.59-15.62L156.52 69a12.09 12.09 0 0 0 .09-17zm0 159.19a12 12 0 0 0-17 0l-63.68 63.72-22.7-22.1a12 12 0 0 0-17 0L3.53 252a12 12 0 0 0 0 17L51 316.5a12.77 12.77 0 0 0 17.6 0l15.7-15.69 72.2-72.22a12 12 0 0 0 .09-16.9zM64 368c-26.49 0-48.59 21.5-48.59 48S37.53 464 64 464a48 48 0 0 0 0-96zm432 16H208a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h288a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16zm0-320H208a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h288a16 16 0 0 0 16-16V80a16 16 0 0 0-16-16zm0 160H208a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h288a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faTaxi = {
prefix: 'fas',
iconName: 'taxi',
icon: [512, 512, [], "f1ba", "M462 241.64l-22-84.84c-9.6-35.2-41.6-60.8-76.8-60.8H352V64c0-17.67-14.33-32-32-32H192c-17.67 0-32 14.33-32 32v32h-11.2c-35.2 0-67.2 25.6-76.8 60.8l-22 84.84C21.41 248.04 0 273.47 0 304v48c0 23.63 12.95 44.04 32 55.12V448c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-32h256v32c0 17.67 14.33 32 32 32h32c17.67 0 32-14.33 32-32v-40.88c19.05-11.09 32-31.5 32-55.12v-48c0-30.53-21.41-55.96-50-62.36zM96 352c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm20.55-112l17.2-66.36c2.23-8.16 9.59-13.64 15.06-13.64h214.4c5.47 0 12.83 5.48 14.85 12.86L395.45 240h-278.9zM416 352c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faTeeth = {
prefix: 'fas',
iconName: 'teeth',
icon: [640, 512, [], "f62e", "M544 0H96C42.98 0 0 42.98 0 96v320c0 53.02 42.98 96 96 96h448c53.02 0 96-42.98 96-96V96c0-53.02-42.98-96-96-96zM160 368c0 26.51-21.49 48-48 48s-48-21.49-48-48v-64c0-8.84 7.16-16 16-16h64c8.84 0 16 7.16 16 16v64zm0-128c0 8.84-7.16 16-16 16H80c-8.84 0-16-7.16-16-16v-64c0-26.51 21.49-48 48-48s48 21.49 48 48v64zm144 120c0 30.93-25.07 56-56 56s-56-25.07-56-56v-56c0-8.84 7.16-16 16-16h80c8.84 0 16 7.16 16 16v56zm0-120c0 8.84-7.16 16-16 16h-80c-8.84 0-16-7.16-16-16v-88c0-30.93 25.07-56 56-56s56 25.07 56 56v88zm144 120c0 30.93-25.07 56-56 56s-56-25.07-56-56v-56c0-8.84 7.16-16 16-16h80c8.84 0 16 7.16 16 16v56zm0-120c0 8.84-7.16 16-16 16h-80c-8.84 0-16-7.16-16-16v-88c0-30.93 25.07-56 56-56s56 25.07 56 56v88zm128 128c0 26.51-21.49 48-48 48s-48-21.49-48-48v-64c0-8.84 7.16-16 16-16h64c8.84 0 16 7.16 16 16v64zm0-128c0 8.84-7.16 16-16 16h-64c-8.84 0-16-7.16-16-16v-64c0-26.51 21.49-48 48-48s48 21.49 48 48v64z"]
};
var faTeethOpen = {
prefix: 'fas',
iconName: 'teeth-open',
icon: [640, 512, [], "f62f", "M544 0H96C42.98 0 0 42.98 0 96v64c0 35.35 28.66 64 64 64h512c35.34 0 64-28.65 64-64V96c0-53.02-42.98-96-96-96zM160 176c0 8.84-7.16 16-16 16H80c-8.84 0-16-7.16-16-16v-32c0-26.51 21.49-48 48-48s48 21.49 48 48v32zm144 0c0 8.84-7.16 16-16 16h-80c-8.84 0-16-7.16-16-16v-56c0-30.93 25.07-56 56-56s56 25.07 56 56v56zm144 0c0 8.84-7.16 16-16 16h-80c-8.84 0-16-7.16-16-16v-56c0-30.93 25.07-56 56-56s56 25.07 56 56v56zm128 0c0 8.84-7.16 16-16 16h-64c-8.84 0-16-7.16-16-16v-32c0-26.51 21.49-48 48-48s48 21.49 48 48v32zm0 144H64c-35.34 0-64 28.65-64 64v32c0 53.02 42.98 96 96 96h448c53.02 0 96-42.98 96-96v-32c0-35.35-28.66-64-64-64zm-416 80c0 26.51-21.49 48-48 48s-48-21.49-48-48v-32c0-8.84 7.16-16 16-16h64c8.84 0 16 7.16 16 16v32zm144-8c0 30.93-25.07 56-56 56s-56-25.07-56-56v-24c0-8.84 7.16-16 16-16h80c8.84 0 16 7.16 16 16v24zm144 0c0 30.93-25.07 56-56 56s-56-25.07-56-56v-24c0-8.84 7.16-16 16-16h80c8.84 0 16 7.16 16 16v24zm128 8c0 26.51-21.49 48-48 48s-48-21.49-48-48v-32c0-8.84 7.16-16 16-16h64c8.84 0 16 7.16 16 16v32z"]
};
var faTemperatureHigh = {
prefix: 'fas',
iconName: 'temperature-high',
icon: [512, 512, [], "f769", "M416 0c-52.9 0-96 43.1-96 96s43.1 96 96 96 96-43.1 96-96-43.1-96-96-96zm0 128c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm-160-16C256 50.1 205.9 0 144 0S32 50.1 32 112v166.5C12.3 303.2 0 334 0 368c0 79.5 64.5 144 144 144s144-64.5 144-144c0-34-12.3-64.9-32-89.5V112zM144 448c-44.1 0-80-35.9-80-80 0-25.5 12.2-48.9 32-63.8V112c0-26.5 21.5-48 48-48s48 21.5 48 48v192.2c19.8 14.8 32 38.3 32 63.8 0 44.1-35.9 80-80 80zm16-125.1V112c0-8.8-7.2-16-16-16s-16 7.2-16 16v210.9c-18.6 6.6-32 24.2-32 45.1 0 26.5 21.5 48 48 48s48-21.5 48-48c0-20.9-13.4-38.5-32-45.1z"]
};
var faTemperatureLow = {
prefix: 'fas',
iconName: 'temperature-low',
icon: [512, 512, [], "f76b", "M416 0c-52.9 0-96 43.1-96 96s43.1 96 96 96 96-43.1 96-96-43.1-96-96-96zm0 128c-17.7 0-32-14.3-32-32s14.3-32 32-32 32 14.3 32 32-14.3 32-32 32zm-160-16C256 50.1 205.9 0 144 0S32 50.1 32 112v166.5C12.3 303.2 0 334 0 368c0 79.5 64.5 144 144 144s144-64.5 144-144c0-34-12.3-64.9-32-89.5V112zM144 448c-44.1 0-80-35.9-80-80 0-25.5 12.2-48.9 32-63.8V112c0-26.5 21.5-48 48-48s48 21.5 48 48v192.2c19.8 14.8 32 38.3 32 63.8 0 44.1-35.9 80-80 80zm16-125.1V304c0-8.8-7.2-16-16-16s-16 7.2-16 16v18.9c-18.6 6.6-32 24.2-32 45.1 0 26.5 21.5 48 48 48s48-21.5 48-48c0-20.9-13.4-38.5-32-45.1z"]
};
var faTenge = {
prefix: 'fas',
iconName: 'tenge',
icon: [384, 512, [], "f7d7", "M372 160H12c-6.6 0-12 5.4-12 12v56c0 6.6 5.4 12 12 12h140v228c0 6.6 5.4 12 12 12h56c6.6 0 12-5.4 12-12V240h140c6.6 0 12-5.4 12-12v-56c0-6.6-5.4-12-12-12zm0-128H12C5.4 32 0 37.4 0 44v56c0 6.6 5.4 12 12 12h360c6.6 0 12-5.4 12-12V44c0-6.6-5.4-12-12-12z"]
};
var faTerminal = {
prefix: 'fas',
iconName: 'terminal',
icon: [640, 512, [], "f120", "M257.981 272.971L63.638 467.314c-9.373 9.373-24.569 9.373-33.941 0L7.029 444.647c-9.357-9.357-9.375-24.522-.04-33.901L161.011 256 6.99 101.255c-9.335-9.379-9.317-24.544.04-33.901l22.667-22.667c9.373-9.373 24.569-9.373 33.941 0L257.981 239.03c9.373 9.372 9.373 24.568 0 33.941zM640 456v-32c0-13.255-10.745-24-24-24H312c-13.255 0-24 10.745-24 24v32c0 13.255 10.745 24 24 24h304c13.255 0 24-10.745 24-24z"]
};
var faTextHeight = {
prefix: 'fas',
iconName: 'text-height',
icon: [576, 512, [], "f034", "M304 32H16A16 16 0 0 0 0 48v96a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-32h56v304H80a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h160a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-40V112h56v32a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zm256 336h-48V144h48c14.31 0 21.33-17.31 11.31-27.31l-80-80a16 16 0 0 0-22.62 0l-80 80C379.36 126 384.36 144 400 144h48v224h-48c-14.31 0-21.32 17.31-11.31 27.31l80 80a16 16 0 0 0 22.62 0l80-80C580.64 386 575.64 368 560 368z"]
};
var faTextWidth = {
prefix: 'fas',
iconName: 'text-width',
icon: [448, 512, [], "f035", "M432 32H16A16 16 0 0 0 0 48v80a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16v-16h120v112h-24a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h128a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16h-24V112h120v16a16 16 0 0 0 16 16h32a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zm-68.69 260.69C354 283.36 336 288.36 336 304v48H112v-48c0-14.31-17.31-21.32-27.31-11.31l-80 80a16 16 0 0 0 0 22.62l80 80C94 484.64 112 479.64 112 464v-48h224v48c0 14.31 17.31 21.33 27.31 11.31l80-80a16 16 0 0 0 0-22.62z"]
};
var faTh = {
prefix: 'fas',
iconName: 'th',
icon: [512, 512, [], "f00a", "M149.333 56v80c0 13.255-10.745 24-24 24H24c-13.255 0-24-10.745-24-24V56c0-13.255 10.745-24 24-24h101.333c13.255 0 24 10.745 24 24zm181.334 240v-80c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24h101.333c13.256 0 24.001-10.745 24.001-24zm32-240v80c0 13.255 10.745 24 24 24H488c13.255 0 24-10.745 24-24V56c0-13.255-10.745-24-24-24H386.667c-13.255 0-24 10.745-24 24zm-32 80V56c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24h101.333c13.256 0 24.001-10.745 24.001-24zm-205.334 56H24c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24h101.333c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24zM0 376v80c0 13.255 10.745 24 24 24h101.333c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H24c-13.255 0-24 10.745-24 24zm386.667-56H488c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H386.667c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24zm0 160H488c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H386.667c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24zM181.333 376v80c0 13.255 10.745 24 24 24h101.333c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24z"]
};
var faThLarge = {
prefix: 'fas',
iconName: 'th-large',
icon: [512, 512, [], "f009", "M296 32h192c13.255 0 24 10.745 24 24v160c0 13.255-10.745 24-24 24H296c-13.255 0-24-10.745-24-24V56c0-13.255 10.745-24 24-24zm-80 0H24C10.745 32 0 42.745 0 56v160c0 13.255 10.745 24 24 24h192c13.255 0 24-10.745 24-24V56c0-13.255-10.745-24-24-24zM0 296v160c0 13.255 10.745 24 24 24h192c13.255 0 24-10.745 24-24V296c0-13.255-10.745-24-24-24H24c-13.255 0-24 10.745-24 24zm296 184h192c13.255 0 24-10.745 24-24V296c0-13.255-10.745-24-24-24H296c-13.255 0-24 10.745-24 24v160c0 13.255 10.745 24 24 24z"]
};
var faThList = {
prefix: 'fas',
iconName: 'th-list',
icon: [512, 512, [], "f00b", "M149.333 216v80c0 13.255-10.745 24-24 24H24c-13.255 0-24-10.745-24-24v-80c0-13.255 10.745-24 24-24h101.333c13.255 0 24 10.745 24 24zM0 376v80c0 13.255 10.745 24 24 24h101.333c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H24c-13.255 0-24 10.745-24 24zM125.333 32H24C10.745 32 0 42.745 0 56v80c0 13.255 10.745 24 24 24h101.333c13.255 0 24-10.745 24-24V56c0-13.255-10.745-24-24-24zm80 448H488c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24zm-24-424v80c0 13.255 10.745 24 24 24H488c13.255 0 24-10.745 24-24V56c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24zm24 264H488c13.255 0 24-10.745 24-24v-80c0-13.255-10.745-24-24-24H205.333c-13.255 0-24 10.745-24 24v80c0 13.255 10.745 24 24 24z"]
};
var faTheaterMasks = {
prefix: 'fas',
iconName: 'theater-masks',
icon: [640, 512, [], "f630", "M206.86 245.15c-35.88 10.45-59.95 41.2-57.53 74.1 11.4-12.72 28.81-23.7 49.9-30.92l7.63-43.18zM95.81 295L64.08 115.49c-.29-1.62.28-2.62.24-2.65 57.76-32.06 123.12-49.01 189.01-49.01 1.61 0 3.23.17 4.85.19 13.95-13.47 31.73-22.83 51.59-26 18.89-3.02 38.05-4.55 57.18-5.32-9.99-13.95-24.48-24.23-41.77-27C301.27 1.89 277.24 0 253.32 0 176.66 0 101.02 19.42 33.2 57.06 9.03 70.48-3.92 98.48 1.05 126.58l31.73 179.51c14.23 80.52 136.33 142.08 204.45 142.08 3.59 0 6.75-.46 10.01-.8-13.52-17.08-28.94-40.48-39.5-67.58-47.61-12.98-106.06-51.62-111.93-84.79zm97.55-137.46c-.73-4.12-2.23-7.87-4.07-11.4-8.25 8.91-20.67 15.75-35.32 18.32-14.65 2.58-28.67.4-39.48-5.17-.52 3.94-.64 7.98.09 12.1 3.84 21.7 24.58 36.19 46.34 32.37 21.75-3.82 36.28-24.52 32.44-46.22zM606.8 120.9c-88.98-49.38-191.43-67.41-291.98-51.35-27.31 4.36-49.08 26.26-54.04 54.36l-31.73 179.51c-15.39 87.05 95.28 196.27 158.31 207.35 63.03 11.09 204.47-53.79 219.86-140.84l31.73-179.51c4.97-28.11-7.98-56.11-32.15-69.52zm-273.24 96.8c3.84-21.7 24.58-36.19 46.34-32.36 21.76 3.83 36.28 24.52 32.45 46.22-.73 4.12-2.23 7.87-4.07 11.4-8.25-8.91-20.67-15.75-35.32-18.32-14.65-2.58-28.67-.4-39.48 5.17-.53-3.95-.65-7.99.08-12.11zm70.47 198.76c-55.68-9.79-93.52-59.27-89.04-112.9 20.6 25.54 56.21 46.17 99.49 53.78 43.28 7.61 83.82.37 111.93-16.6-14.18 51.94-66.71 85.51-122.38 75.72zm130.3-151.34c-8.25-8.91-20.68-15.75-35.33-18.32-14.65-2.58-28.67-.4-39.48 5.17-.52-3.94-.64-7.98.09-12.1 3.84-21.7 24.58-36.19 46.34-32.37 21.75 3.83 36.28 24.52 32.45 46.22-.73 4.13-2.23 7.88-4.07 11.4z"]
};
var faThermometer = {
prefix: 'fas',
iconName: 'thermometer',
icon: [512, 512, [], "f491", "M476.8 20.4c-37.5-30.7-95.5-26.3-131.9 10.2l-45.7 46 50.5 50.5c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0l-50.4-50.5-45.1 45.4 50.3 50.4c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0L209 167.4l-45.1 45.4L214 263c3.1 3.1 3.1 8.2 0 11.3l-11.3 11.3c-3.1 3.1-8.2 3.1-11.3 0l-50.1-50.2L96 281.1V382L7 471c-9.4 9.4-9.4 24.6 0 33.9 9.4 9.4 24.6 9.4 33.9 0l89-89h99.9L484 162.6c34.9-34.9 42.2-101.5-7.2-142.2z"]
};
var faThermometerEmpty = {
prefix: 'fas',
iconName: 'thermometer-empty',
icon: [256, 512, [], "f2cb", "M192 384c0 35.346-28.654 64-64 64s-64-28.654-64-64c0-35.346 28.654-64 64-64s64 28.654 64 64zm32-84.653c19.912 22.563 32 52.194 32 84.653 0 70.696-57.303 128-128 128-.299 0-.609-.001-.909-.003C56.789 511.509-.357 453.636.002 383.333.166 351.135 12.225 321.755 32 299.347V96c0-53.019 42.981-96 96-96s96 42.981 96 96v203.347zM208 384c0-34.339-19.37-52.19-32-66.502V96c0-26.467-21.533-48-48-48S80 69.533 80 96v221.498c-12.732 14.428-31.825 32.1-31.999 66.08-.224 43.876 35.563 80.116 79.423 80.42L128 464c44.112 0 80-35.888 80-80z"]
};
var faThermometerFull = {
prefix: 'fas',
iconName: 'thermometer-full',
icon: [256, 512, [], "f2c7", "M224 96c0-53.019-42.981-96-96-96S32 42.981 32 96v203.347C12.225 321.756.166 351.136.002 383.333c-.359 70.303 56.787 128.176 127.089 128.664.299.002.61.003.909.003 70.698 0 128-57.304 128-128 0-32.459-12.088-62.09-32-84.653V96zm-96 368l-.576-.002c-43.86-.304-79.647-36.544-79.423-80.42.173-33.98 19.266-51.652 31.999-66.08V96c0-26.467 21.533-48 48-48s48 21.533 48 48v221.498c12.63 14.312 32 32.164 32 66.502 0 44.112-35.888 80-80 80zm64-80c0 35.346-28.654 64-64 64s-64-28.654-64-64c0-23.685 12.876-44.349 32-55.417V96c0-17.673 14.327-32 32-32s32 14.327 32 32v232.583c19.124 11.068 32 31.732 32 55.417z"]
};
var faThermometerHalf = {
prefix: 'fas',
iconName: 'thermometer-half',
icon: [256, 512, [], "f2c9", "M192 384c0 35.346-28.654 64-64 64s-64-28.654-64-64c0-23.685 12.876-44.349 32-55.417V224c0-17.673 14.327-32 32-32s32 14.327 32 32v104.583c19.124 11.068 32 31.732 32 55.417zm32-84.653c19.912 22.563 32 52.194 32 84.653 0 70.696-57.303 128-128 128-.299 0-.609-.001-.909-.003C56.789 511.509-.357 453.636.002 383.333.166 351.135 12.225 321.755 32 299.347V96c0-53.019 42.981-96 96-96s96 42.981 96 96v203.347zM208 384c0-34.339-19.37-52.19-32-66.502V96c0-26.467-21.533-48-48-48S80 69.533 80 96v221.498c-12.732 14.428-31.825 32.1-31.999 66.08-.224 43.876 35.563 80.116 79.423 80.42L128 464c44.112 0 80-35.888 80-80z"]
};
var faThermometerQuarter = {
prefix: 'fas',
iconName: 'thermometer-quarter',
icon: [256, 512, [], "f2ca", "M192 384c0 35.346-28.654 64-64 64s-64-28.654-64-64c0-23.685 12.876-44.349 32-55.417V288c0-17.673 14.327-32 32-32s32 14.327 32 32v40.583c19.124 11.068 32 31.732 32 55.417zm32-84.653c19.912 22.563 32 52.194 32 84.653 0 70.696-57.303 128-128 128-.299 0-.609-.001-.909-.003C56.789 511.509-.357 453.636.002 383.333.166 351.135 12.225 321.755 32 299.347V96c0-53.019 42.981-96 96-96s96 42.981 96 96v203.347zM208 384c0-34.339-19.37-52.19-32-66.502V96c0-26.467-21.533-48-48-48S80 69.533 80 96v221.498c-12.732 14.428-31.825 32.1-31.999 66.08-.224 43.876 35.563 80.116 79.423 80.42L128 464c44.112 0 80-35.888 80-80z"]
};
var faThermometerThreeQuarters = {
prefix: 'fas',
iconName: 'thermometer-three-quarters',
icon: [256, 512, [], "f2c8", "M192 384c0 35.346-28.654 64-64 64-35.346 0-64-28.654-64-64 0-23.685 12.876-44.349 32-55.417V160c0-17.673 14.327-32 32-32s32 14.327 32 32v168.583c19.124 11.068 32 31.732 32 55.417zm32-84.653c19.912 22.563 32 52.194 32 84.653 0 70.696-57.303 128-128 128-.299 0-.609-.001-.909-.003C56.789 511.509-.357 453.636.002 383.333.166 351.135 12.225 321.755 32 299.347V96c0-53.019 42.981-96 96-96s96 42.981 96 96v203.347zM208 384c0-34.339-19.37-52.19-32-66.502V96c0-26.467-21.533-48-48-48S80 69.533 80 96v221.498c-12.732 14.428-31.825 32.1-31.999 66.08-.224 43.876 35.563 80.116 79.423 80.42L128 464c44.112 0 80-35.888 80-80z"]
};
var faThumbsDown = {
prefix: 'fas',
iconName: 'thumbs-down',
icon: [512, 512, [], "f165", "M0 56v240c0 13.255 10.745 24 24 24h80c13.255 0 24-10.745 24-24V56c0-13.255-10.745-24-24-24H24C10.745 32 0 42.745 0 56zm40 200c0-13.255 10.745-24 24-24s24 10.745 24 24-10.745 24-24 24-24-10.745-24-24zm272 256c-20.183 0-29.485-39.293-33.931-57.795-5.206-21.666-10.589-44.07-25.393-58.902-32.469-32.524-49.503-73.967-89.117-113.111a11.98 11.98 0 0 1-3.558-8.521V59.901c0-6.541 5.243-11.878 11.783-11.998 15.831-.29 36.694-9.079 52.651-16.178C256.189 17.598 295.709.017 343.995 0h2.844c42.777 0 93.363.413 113.774 29.737 8.392 12.057 10.446 27.034 6.148 44.632 16.312 17.053 25.063 48.863 16.382 74.757 17.544 23.432 19.143 56.132 9.308 79.469l.11.11c11.893 11.949 19.523 31.259 19.439 49.197-.156 30.352-26.157 58.098-59.553 58.098H350.723C358.03 364.34 384 388.132 384 430.548 384 504 336 512 312 512z"]
};
var faThumbsUp = {
prefix: 'fas',
iconName: 'thumbs-up',
icon: [512, 512, [], "f164", "M104 224H24c-13.255 0-24 10.745-24 24v240c0 13.255 10.745 24 24 24h80c13.255 0 24-10.745 24-24V248c0-13.255-10.745-24-24-24zM64 472c-13.255 0-24-10.745-24-24s10.745-24 24-24 24 10.745 24 24-10.745 24-24 24zM384 81.452c0 42.416-25.97 66.208-33.277 94.548h101.723c33.397 0 59.397 27.746 59.553 58.098.084 17.938-7.546 37.249-19.439 49.197l-.11.11c9.836 23.337 8.237 56.037-9.308 79.469 8.681 25.895-.069 57.704-16.382 74.757 4.298 17.598 2.244 32.575-6.148 44.632C440.202 511.587 389.616 512 346.839 512l-2.845-.001c-48.287-.017-87.806-17.598-119.56-31.725-15.957-7.099-36.821-15.887-52.651-16.178-6.54-.12-11.783-5.457-11.783-11.998v-213.77c0-3.2 1.282-6.271 3.558-8.521 39.614-39.144 56.648-80.587 89.117-113.111 14.804-14.832 20.188-37.236 25.393-58.902C282.515 39.293 291.817 0 312 0c24 0 72 8 72 81.452z"]
};
var faThumbtack = {
prefix: 'fas',
iconName: 'thumbtack',
icon: [384, 512, [], "f08d", "M298.028 214.267L285.793 96H328c13.255 0 24-10.745 24-24V24c0-13.255-10.745-24-24-24H56C42.745 0 32 10.745 32 24v48c0 13.255 10.745 24 24 24h42.207L85.972 214.267C37.465 236.82 0 277.261 0 328c0 13.255 10.745 24 24 24h136v104.007c0 1.242.289 2.467.845 3.578l24 48c2.941 5.882 11.364 5.893 14.311 0l24-48a8.008 8.008 0 0 0 .845-3.578V352h136c13.255 0 24-10.745 24-24-.001-51.183-37.983-91.42-85.973-113.733z"]
};
var faTicketAlt = {
prefix: 'fas',
iconName: 'ticket-alt',
icon: [576, 512, [], "f3ff", "M128 160h320v192H128V160zm400 96c0 26.51 21.49 48 48 48v96c0 26.51-21.49 48-48 48H48c-26.51 0-48-21.49-48-48v-96c26.51 0 48-21.49 48-48s-21.49-48-48-48v-96c0-26.51 21.49-48 48-48h480c26.51 0 48 21.49 48 48v96c-26.51 0-48 21.49-48 48zm-48-104c0-13.255-10.745-24-24-24H120c-13.255 0-24 10.745-24 24v208c0 13.255 10.745 24 24 24h336c13.255 0 24-10.745 24-24V152z"]
};
var faTimes = {
prefix: 'fas',
iconName: 'times',
icon: [352, 512, [], "f00d", "M242.72 256l100.07-100.07c12.28-12.28 12.28-32.19 0-44.48l-22.24-22.24c-12.28-12.28-32.19-12.28-44.48 0L176 189.28 75.93 89.21c-12.28-12.28-32.19-12.28-44.48 0L9.21 111.45c-12.28 12.28-12.28 32.19 0 44.48L109.28 256 9.21 356.07c-12.28 12.28-12.28 32.19 0 44.48l22.24 22.24c12.28 12.28 32.2 12.28 44.48 0L176 322.72l100.07 100.07c12.28 12.28 32.2 12.28 44.48 0l22.24-22.24c12.28-12.28 12.28-32.19 0-44.48L242.72 256z"]
};
var faTimesCircle = {
prefix: 'fas',
iconName: 'times-circle',
icon: [512, 512, [], "f057", "M256 8C119 8 8 119 8 256s111 248 248 248 248-111 248-248S393 8 256 8zm121.6 313.1c4.7 4.7 4.7 12.3 0 17L338 377.6c-4.7 4.7-12.3 4.7-17 0L256 312l-65.1 65.6c-4.7 4.7-12.3 4.7-17 0L134.4 338c-4.7-4.7-4.7-12.3 0-17l65.6-65-65.6-65.1c-4.7-4.7-4.7-12.3 0-17l39.6-39.6c4.7-4.7 12.3-4.7 17 0l65 65.7 65.1-65.6c4.7-4.7 12.3-4.7 17 0l39.6 39.6c4.7 4.7 4.7 12.3 0 17L312 256l65.6 65.1z"]
};
var faTint = {
prefix: 'fas',
iconName: 'tint',
icon: [352, 512, [], "f043", "M205.22 22.09c-7.94-28.78-49.44-30.12-58.44 0C100.01 179.85 0 222.72 0 333.91 0 432.35 78.72 512 176 512s176-79.65 176-178.09c0-111.75-99.79-153.34-146.78-311.82zM176 448c-61.75 0-112-50.25-112-112 0-8.84 7.16-16 16-16s16 7.16 16 16c0 44.11 35.89 80 80 80 8.84 0 16 7.16 16 16s-7.16 16-16 16z"]
};
var faTintSlash = {
prefix: 'fas',
iconName: 'tint-slash',
icon: [640, 512, [], "f5c7", "M633.82 458.1L494.97 350.78c.52-5.57 1.03-11.16 1.03-16.87 0-111.76-99.79-153.34-146.78-311.82-7.94-28.78-49.44-30.12-58.44 0-15.52 52.34-36.87 91.96-58.49 125.68L45.47 3.37C38.49-2.05 28.43-.8 23.01 6.18L3.37 31.45C-2.05 38.42-.8 48.47 6.18 53.9l588.36 454.73c6.98 5.43 17.03 4.17 22.46-2.81l19.64-25.27c5.41-6.97 4.16-17.02-2.82-22.45zM144 333.91C144 432.35 222.72 512 320 512c44.71 0 85.37-16.96 116.4-44.7L162.72 255.78c-11.41 23.5-18.72 48.35-18.72 78.13z"]
};
var faTired = {
prefix: 'fas',
iconName: 'tired',
icon: [496, 512, [], "f5c8", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm33.8 189.7l80-48c11.6-6.9 24 7.7 15.4 18L343.6 208l33.6 40.3c8.7 10.4-3.9 24.8-15.4 18l-80-48c-7.7-4.7-7.7-15.9 0-20.6zm-163-30c-8.6-10.3 3.8-24.9 15.4-18l80 48c7.8 4.7 7.8 15.9 0 20.6l-80 48c-11.5 6.8-24-7.6-15.4-18l33.6-40.3-33.6-40.3zM248 288c51.9 0 115.3 43.8 123.2 106.7 1.7 13.6-8 24.6-17.7 20.4-25.9-11.1-64.4-17.4-105.5-17.4s-79.6 6.3-105.5 17.4c-9.8 4.2-19.4-7-17.7-20.4C132.7 331.8 196.1 288 248 288z"]
};
var faToggleOff = {
prefix: 'fas',
iconName: 'toggle-off',
icon: [576, 512, [], "f204", "M384 64H192C85.961 64 0 149.961 0 256s85.961 192 192 192h192c106.039 0 192-85.961 192-192S490.039 64 384 64zM64 256c0-70.741 57.249-128 128-128 70.741 0 128 57.249 128 128 0 70.741-57.249 128-128 128-70.741 0-128-57.249-128-128zm320 128h-48.905c65.217-72.858 65.236-183.12 0-256H384c70.741 0 128 57.249 128 128 0 70.74-57.249 128-128 128z"]
};
var faToggleOn = {
prefix: 'fas',
iconName: 'toggle-on',
icon: [576, 512, [], "f205", "M384 64H192C86 64 0 150 0 256s86 192 192 192h192c106 0 192-86 192-192S490 64 384 64zm0 320c-70.8 0-128-57.3-128-128 0-70.8 57.3-128 128-128 70.8 0 128 57.3 128 128 0 70.8-57.3 128-128 128z"]
};
var faToilet = {
prefix: 'fas',
iconName: 'toilet',
icon: [384, 512, [], "f7d8", "M368 48c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16H16C7.2 0 0 7.2 0 16v16c0 8.8 7.2 16 16 16h16v156.7C11.8 214.8 0 226.9 0 240c0 67.2 34.6 126.2 86.8 160.5l-21.4 70.2C59.1 491.2 74.5 512 96 512h192c21.5 0 36.9-20.8 30.6-41.3l-21.4-70.2C349.4 366.2 384 307.2 384 240c0-13.1-11.8-25.2-32-35.3V48h16zM80 72c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H88c-4.4 0-8-3.6-8-8V72zm112 200c-77.1 0-139.6-14.3-139.6-32s62.5-32 139.6-32 139.6 14.3 139.6 32-62.5 32-139.6 32z"]
};
var faToiletPaper = {
prefix: 'fas',
iconName: 'toilet-paper',
icon: [576, 512, [], "f71e", "M128 0C74.98 0 32 85.96 32 192v172.07c0 41.12-9.8 62.77-31.17 126.87C-2.62 501.3 5.09 512 16.01 512h280.92c13.77 0 26-8.81 30.36-21.88 12.83-38.48 24.71-72.4 24.71-126.05V192c0-83.6 23.67-153.52 60.44-192H128zM96 224c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16zm64 0c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16zm64 0c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16zm64 0c-8.84 0-16-7.16-16-16s7.16-16 16-16 16 7.16 16 16-7.16 16-16 16zM480 0c-53.02 0-96 85.96-96 192s42.98 192 96 192 96-85.96 96-192S533.02 0 480 0zm0 256c-17.67 0-32-28.65-32-64s14.33-64 32-64 32 28.65 32 64-14.33 64-32 64z"]
};
var faToiletPaperSlash = {
prefix: 'fas',
iconName: 'toilet-paper-slash',
icon: [640, 512, [], "e072", "M64,192V364.13c0,41.12-9.75,62.75-31.12,126.87A16,16,0,0,0,48,512H328.86a31.87,31.87,0,0,0,30.38-21.87c9.31-27.83,18-53.35,22.18-85.55l-316-244.25C64.53,170.66,64,181.19,64,192ZM633.82,458.09l-102-78.81C575.28,360.91,608,284.32,608,192,608,86,565,0,512,0s-96,86-96,192c0,42,7,80.4,18.43,112L384,265V192c0-83.62,23.63-153.5,60.5-192H160c-23.33,0-44.63,16.83-61.26,44.53L45.46,3.38A16,16,0,0,0,23,6.19L3.37,31.45A16,16,0,0,0,6.18,53.91L594.54,508.63A16,16,0,0,0,617,505.81l19.64-25.26A16,16,0,0,0,633.82,458.09ZM512,256c-17.63,0-32-28.62-32-64s14.37-64,32-64,32,28.63,32,64S529.62,256,512,256Z"]
};
var faToolbox = {
prefix: 'fas',
iconName: 'toolbox',
icon: [512, 512, [], "f552", "M502.63 214.63l-45.25-45.25c-6-6-14.14-9.37-22.63-9.37H384V80c0-26.51-21.49-48-48-48H176c-26.51 0-48 21.49-48 48v80H77.25c-8.49 0-16.62 3.37-22.63 9.37L9.37 214.63c-6 6-9.37 14.14-9.37 22.63V320h128v-16c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v16h128v-16c0-8.84 7.16-16 16-16h32c8.84 0 16 7.16 16 16v16h128v-82.75c0-8.48-3.37-16.62-9.37-22.62zM320 160H192V96h128v64zm64 208c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16v-16H192v16c0 8.84-7.16 16-16 16h-32c-8.84 0-16-7.16-16-16v-16H0v96c0 17.67 14.33 32 32 32h448c17.67 0 32-14.33 32-32v-96H384v16z"]
};
var faTools = {
prefix: 'fas',
iconName: 'tools',
icon: [512, 512, [], "f7d9", "M501.1 395.7L384 278.6c-23.1-23.1-57.6-27.6-85.4-13.9L192 158.1V96L64 0 0 64l96 128h62.1l106.6 106.6c-13.6 27.8-9.2 62.3 13.9 85.4l117.1 117.1c14.6 14.6 38.2 14.6 52.7 0l52.7-52.7c14.5-14.6 14.5-38.2 0-52.7zM331.7 225c28.3 0 54.9 11 74.9 31l19.4 19.4c15.8-6.9 30.8-16.5 43.8-29.5 37.1-37.1 49.7-89.3 37.9-136.7-2.2-9-13.5-12.1-20.1-5.5l-74.4 74.4-67.9-11.3L334 98.9l74.4-74.4c6.6-6.6 3.4-17.9-5.7-20.2-47.4-11.7-99.6.9-136.6 37.9-28.5 28.5-41.9 66.1-41.2 103.6l82.1 82.1c8.1-1.9 16.5-2.9 24.7-2.9zm-103.9 82l-56.7-56.7L18.7 402.8c-25 25-25 65.5 0 90.5s65.5 25 90.5 0l123.6-123.6c-7.6-19.9-9.9-41.6-5-62.7zM64 472c-13.2 0-24-10.8-24-24 0-13.3 10.7-24 24-24s24 10.7 24 24c0 13.2-10.7 24-24 24z"]
};
var faTooth = {
prefix: 'fas',
iconName: 'tooth',
icon: [448, 512, [], "f5c9", "M443.98 96.25c-11.01-45.22-47.11-82.06-92.01-93.72-32.19-8.36-63 5.1-89.14 24.33-3.25 2.39-6.96 3.73-10.5 5.48l28.32 18.21c7.42 4.77 9.58 14.67 4.8 22.11-4.46 6.95-14.27 9.86-22.11 4.8L162.83 12.84c-20.7-10.85-43.38-16.4-66.81-10.31-44.9 11.67-81 48.5-92.01 93.72-10.13 41.62-.42 80.81 21.5 110.43 23.36 31.57 32.68 68.66 36.29 107.35 4.4 47.16 10.33 94.16 20.94 140.32l7.8 33.95c3.19 13.87 15.49 23.7 29.67 23.7 13.97 0 26.15-9.55 29.54-23.16l34.47-138.42c4.56-18.32 20.96-31.16 39.76-31.16s35.2 12.85 39.76 31.16l34.47 138.42c3.39 13.61 15.57 23.16 29.54 23.16 14.18 0 26.48-9.83 29.67-23.7l7.8-33.95c10.61-46.15 16.53-93.16 20.94-140.32 3.61-38.7 12.93-75.78 36.29-107.35 21.95-29.61 31.66-68.8 21.53-110.43z"]
};
var faTorah = {
prefix: 'fas',
iconName: 'torah',
icon: [640, 512, [], "f6a0", "M320.05 366.48l17.72-29.64h-35.46zm99.21-166H382.4l18.46 30.82zM48 0C21.49 0 0 14.33 0 32v448c0 17.67 21.49 32 48 32s48-14.33 48-32V32C96 14.33 74.51 0 48 0zm172.74 311.5h36.85l-18.46-30.82zm161.71 0h36.86l-18.45-30.8zM128 464h384V48H128zm66.77-278.13a21.22 21.22 0 0 1 18.48-10.71h59.45l29.13-48.71a21.13 21.13 0 0 1 18.22-10.37A20.76 20.76 0 0 1 338 126.29l29.25 48.86h59.52a21.12 21.12 0 0 1 18.1 32L415.63 256 445 305a20.69 20.69 0 0 1 .24 21.12 21.25 21.25 0 0 1-18.48 10.72h-59.47l-29.13 48.7a21.13 21.13 0 0 1-18.16 10.4 20.79 20.79 0 0 1-18-10.22l-29.25-48.88h-59.5a21.11 21.11 0 0 1-18.1-32L224.36 256 195 207a20.7 20.7 0 0 1-.23-21.13zM592 0c-26.51 0-48 14.33-48 32v448c0 17.67 21.49 32 48 32s48-14.33 48-32V32c0-17.67-21.49-32-48-32zM320 145.53l-17.78 29.62h35.46zm-62.45 55h-36.81l18.44 30.8zm29.58 111h65.79L386.09 256l-33.23-55.52h-65.79L253.9 256z"]
};
var faToriiGate = {
prefix: 'fas',
iconName: 'torii-gate',
icon: [512, 512, [], "f6a1", "M376.45 32h-240.9A303.17 303.17 0 0 1 0 0v96c0 17.67 14.33 32 32 32h32v64H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h48v240c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16V256h256v240c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16V256h48c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16h-48v-64h32c17.67 0 32-14.33 32-32V0a303.17 303.17 0 0 1-135.55 32zM128 128h96v64h-96v-64zm256 64h-96v-64h96v64z"]
};
var faTractor = {
prefix: 'fas',
iconName: 'tractor',
icon: [640, 512, [], "f722", "M528 336c-48.6 0-88 39.4-88 88s39.4 88 88 88 88-39.4 88-88-39.4-88-88-88zm0 112c-13.23 0-24-10.77-24-24s10.77-24 24-24 24 10.77 24 24-10.77 24-24 24zm80-288h-64v-40.2c0-14.12 4.7-27.76 13.15-38.84 4.42-5.8 3.55-14.06-1.32-19.49L534.2 37.3c-6.66-7.45-18.32-6.92-24.7.78C490.58 60.9 480 89.81 480 119.8V160H377.67L321.58 29.14A47.914 47.914 0 0 0 277.45 0H144c-26.47 0-48 21.53-48 48v146.52c-8.63-6.73-20.96-6.46-28.89 1.47L36 227.1c-8.59 8.59-8.59 22.52 0 31.11l5.06 5.06c-4.99 9.26-8.96 18.82-11.91 28.72H22c-12.15 0-22 9.85-22 22v44c0 12.15 9.85 22 22 22h7.14c2.96 9.91 6.92 19.46 11.91 28.73l-5.06 5.06c-8.59 8.59-8.59 22.52 0 31.11L67.1 476c8.59 8.59 22.52 8.59 31.11 0l5.06-5.06c9.26 4.99 18.82 8.96 28.72 11.91V490c0 12.15 9.85 22 22 22h44c12.15 0 22-9.85 22-22v-7.14c9.9-2.95 19.46-6.92 28.72-11.91l5.06 5.06c8.59 8.59 22.52 8.59 31.11 0l31.11-31.11c8.59-8.59 8.59-22.52 0-31.11l-5.06-5.06c4.99-9.26 8.96-18.82 11.91-28.72H330c12.15 0 22-9.85 22-22v-6h80.54c21.91-28.99 56.32-48 95.46-48 18.64 0 36.07 4.61 51.8 12.2l50.82-50.82c6-6 9.37-14.14 9.37-22.63V192c.01-17.67-14.32-32-31.99-32zM176 416c-44.18 0-80-35.82-80-80s35.82-80 80-80 80 35.82 80 80-35.82 80-80 80zm22-256h-38V64h106.89l41.15 96H198z"]
};
var faTrademark = {
prefix: 'fas',
iconName: 'trademark',
icon: [640, 512, [], "f25c", "M260.6 96H12c-6.6 0-12 5.4-12 12v43.1c0 6.6 5.4 12 12 12h85.1V404c0 6.6 5.4 12 12 12h54.3c6.6 0 12-5.4 12-12V163.1h85.1c6.6 0 12-5.4 12-12V108c.1-6.6-5.3-12-11.9-12zM640 403l-24-296c-.5-6.2-5.7-11-12-11h-65.4c-5.1 0-9.7 3.3-11.3 8.1l-43.8 127.1c-7.2 20.6-16.1 52.8-16.1 52.8h-.9s-8.9-32.2-16.1-52.8l-43.8-127.1c-1.7-4.8-6.2-8.1-11.3-8.1h-65.4c-6.2 0-11.4 4.8-12 11l-24.4 296c-.6 7 4.9 13 12 13H360c6.3 0 11.5-4.9 12-11.2l9.1-132.9c1.8-24.2 0-53.7 0-53.7h.9s10.7 33.6 17.9 53.7l30.7 84.7c1.7 4.7 6.2 7.9 11.3 7.9h50.3c5.1 0 9.6-3.2 11.3-7.9l30.7-84.7c7.2-20.1 17.9-53.7 17.9-53.7h.9s-1.8 29.5 0 53.7l9.1 132.9c.4 6.3 5.7 11.2 12 11.2H628c7 0 12.5-6 12-13z"]
};
var faTrafficLight = {
prefix: 'fas',
iconName: 'traffic-light',
icon: [384, 512, [], "f637", "M384 192h-64v-37.88c37.2-13.22 64-48.38 64-90.12h-64V32c0-17.67-14.33-32-32-32H96C78.33 0 64 14.33 64 32v32H0c0 41.74 26.8 76.9 64 90.12V192H0c0 41.74 26.8 76.9 64 90.12V320H0c0 42.84 28.25 78.69 66.99 91.05C79.42 468.72 130.6 512 192 512s112.58-43.28 125.01-100.95C355.75 398.69 384 362.84 384 320h-64v-37.88c37.2-13.22 64-48.38 64-90.12zM192 416c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm0-128c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm0-128c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48z"]
};
var faTrailer = {
prefix: 'fas',
iconName: 'trailer',
icon: [640, 512, [], "e041", "M624,320H544V80a16,16,0,0,0-16-16H16A16,16,0,0,0,0,80V368a16,16,0,0,0,16,16H65.61c7.83-54.21,54-96,110.39-96s102.56,41.79,110.39,96H624a16,16,0,0,0,16-16V336A16,16,0,0,0,624,320ZM96,243.68a176.29,176.29,0,0,0-32,20.71V136a8,8,0,0,1,8-8H88a8,8,0,0,1,8,8Zm96-18.54c-5.31-.49-10.57-1.14-16-1.14s-10.69.65-16,1.14V136a8,8,0,0,1,8-8h16a8,8,0,0,1,8,8Zm96,39.25a176.29,176.29,0,0,0-32-20.71V136a8,8,0,0,1,8-8h16a8,8,0,0,1,8,8ZM384,320H352V136a8,8,0,0,1,8-8h16a8,8,0,0,1,8,8Zm96,0H448V136a8,8,0,0,1,8-8h16a8,8,0,0,1,8,8Zm-304,0a80,80,0,1,0,80,80A80,80,0,0,0,176,320Zm0,112a32,32,0,1,1,32-32A32,32,0,0,1,176,432Z"]
};
var faTrain = {
prefix: 'fas',
iconName: 'train',
icon: [448, 512, [], "f238", "M448 96v256c0 51.815-61.624 96-130.022 96l62.98 49.721C386.905 502.417 383.562 512 376 512H72c-7.578 0-10.892-9.594-4.957-14.279L130.022 448C61.82 448 0 403.954 0 352V96C0 42.981 64 0 128 0h192c65 0 128 42.981 128 96zm-48 136V120c0-13.255-10.745-24-24-24H72c-13.255 0-24 10.745-24 24v112c0 13.255 10.745 24 24 24h304c13.255 0 24-10.745 24-24zm-176 64c-30.928 0-56 25.072-56 56s25.072 56 56 56 56-25.072 56-56-25.072-56-56-56z"]
};
var faTram = {
prefix: 'fas',
iconName: 'tram',
icon: [512, 512, [], "f7da", "M288 64c17.7 0 32-14.3 32-32S305.7 0 288 0s-32 14.3-32 32 14.3 32 32 32zm223.5-12.1c-2.3-8.6-11-13.6-19.6-11.3l-480 128c-8.5 2.3-13.6 11-11.3 19.6C2.5 195.3 8.9 200 16 200c1.4 0 2.8-.2 4.1-.5L240 140.8V224H64c-17.7 0-32 14.3-32 32v224c0 17.7 14.3 32 32 32h384c17.7 0 32-14.3 32-32V256c0-17.7-14.3-32-32-32H272v-91.7l228.1-60.8c8.6-2.3 13.6-11.1 11.4-19.6zM176 384H80v-96h96v96zm160-96h96v96h-96v-96zm-32 0v96h-96v-96h96zM192 96c17.7 0 32-14.3 32-32s-14.3-32-32-32-32 14.3-32 32 14.3 32 32 32z"]
};
var faTransgender = {
prefix: 'fas',
iconName: 'transgender',
icon: [384, 512, [], "f224", "M372 0h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-80.7 80.7C198.5 104.1 172.2 96 144 96 64.5 96 0 160.5 0 240c0 68.5 47.9 125.9 112 140.4V408H76c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v28c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-28h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-27.6c64.1-14.6 112-71.9 112-140.4 0-28.2-8.1-54.5-22.1-76.7l80.7-80.7 16.9 16.9c7.6 7.6 20.5 2.2 20.5-8.5V12c0-6.6-5.4-12-12-12zM144 320c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faTransgenderAlt = {
prefix: 'fas',
iconName: 'transgender-alt',
icon: [480, 512, [], "f225", "M468 0h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-80.7 80.7C294.5 104.1 268.2 96 240 96c-28.2 0-54.5 8.1-76.7 22.1l-16.5-16.5 19.8-19.8c4.7-4.7 4.7-12.3 0-17l-28.3-28.3c-4.7-4.7-12.3-4.7-17 0l-19.8 19.8-19-19 16.9-16.9C107.1 12.9 101.7 0 91 0H12C5.4 0 0 5.4 0 12v79c0 10.7 12.9 16 20.5 8.5l16.9-16.9 19 19-19.8 19.8c-4.7 4.7-4.7 12.3 0 17l28.3 28.3c4.7 4.7 12.3 4.7 17 0l19.8-19.8 16.5 16.5C104.1 185.5 96 211.8 96 240c0 68.5 47.9 125.9 112 140.4V408h-36c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v28c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-28h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-27.6c64.1-14.6 112-71.9 112-140.4 0-28.2-8.1-54.5-22.1-76.7l80.7-80.7 16.9 16.9c7.6 7.6 20.5 2.2 20.5-8.5V12c0-6.6-5.4-12-12-12zM240 320c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faTrash = {
prefix: 'fas',
iconName: 'trash',
icon: [448, 512, [], "f1f8", "M432 32H312l-9.4-18.7A24 24 0 0 0 281.1 0H166.8a23.72 23.72 0 0 0-21.4 13.3L136 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16zM53.2 467a48 48 0 0 0 47.9 45h245.8a48 48 0 0 0 47.9-45L416 128H32z"]
};
var faTrashAlt = {
prefix: 'fas',
iconName: 'trash-alt',
icon: [448, 512, [], "f2ed", "M32 464a48 48 0 0 0 48 48h288a48 48 0 0 0 48-48V128H32zm272-256a16 16 0 0 1 32 0v224a16 16 0 0 1-32 0zm-96 0a16 16 0 0 1 32 0v224a16 16 0 0 1-32 0zm-96 0a16 16 0 0 1 32 0v224a16 16 0 0 1-32 0zM432 32H312l-9.4-18.7A24 24 0 0 0 281.1 0H166.8a23.72 23.72 0 0 0-21.4 13.3L136 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faTrashRestore = {
prefix: 'fas',
iconName: 'trash-restore',
icon: [448, 512, [], "f829", "M53.2 467a48 48 0 0 0 47.9 45h245.8a48 48 0 0 0 47.9-45L416 128H32zm70.11-175.8l89.38-94.26a15.41 15.41 0 0 1 22.62 0l89.38 94.26c10.08 10.62 2.94 28.8-11.32 28.8H256v112a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16V320h-57.37c-14.26 0-21.4-18.18-11.32-28.8zM432 32H312l-9.4-18.7A24 24 0 0 0 281.1 0H166.8a23.72 23.72 0 0 0-21.4 13.3L136 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faTrashRestoreAlt = {
prefix: 'fas',
iconName: 'trash-restore-alt',
icon: [448, 512, [], "f82a", "M32 464a48 48 0 0 0 48 48h288a48 48 0 0 0 48-48V128H32zm91.31-172.8l89.38-94.26a15.41 15.41 0 0 1 22.62 0l89.38 94.26c10.08 10.62 2.94 28.8-11.32 28.8H256v112a16 16 0 0 1-16 16h-32a16 16 0 0 1-16-16V320h-57.37c-14.26 0-21.4-18.18-11.32-28.8zM432 32H312l-9.4-18.7A24 24 0 0 0 281.1 0H166.8a23.72 23.72 0 0 0-21.4 13.3L136 32H16A16 16 0 0 0 0 48v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16V48a16 16 0 0 0-16-16z"]
};
var faTree = {
prefix: 'fas',
iconName: 'tree',
icon: [384, 512, [], "f1bb", "M378.31 378.49L298.42 288h30.63c9.01 0 16.98-5 20.78-13.06 3.8-8.04 2.55-17.26-3.28-24.05L268.42 160h28.89c9.1 0 17.3-5.35 20.86-13.61 3.52-8.13 1.86-17.59-4.24-24.08L203.66 4.83c-6.03-6.45-17.28-6.45-23.32 0L70.06 122.31c-6.1 6.49-7.75 15.95-4.24 24.08C69.38 154.65 77.59 160 86.69 160h28.89l-78.14 90.91c-5.81 6.78-7.06 15.99-3.27 24.04C37.97 283 45.93 288 54.95 288h30.63L5.69 378.49c-6 6.79-7.36 16.09-3.56 24.26 3.75 8.05 12 13.25 21.01 13.25H160v24.45l-30.29 48.4c-5.32 10.64 2.42 23.16 14.31 23.16h95.96c11.89 0 19.63-12.52 14.31-23.16L224 440.45V416h136.86c9.01 0 17.26-5.2 21.01-13.25 3.8-8.17 2.44-17.47-3.56-24.26z"]
};
var faTrophy = {
prefix: 'fas',
iconName: 'trophy',
icon: [576, 512, [], "f091", "M552 64H448V24c0-13.3-10.7-24-24-24H152c-13.3 0-24 10.7-24 24v40H24C10.7 64 0 74.7 0 88v56c0 35.7 22.5 72.4 61.9 100.7 31.5 22.7 69.8 37.1 110 41.7C203.3 338.5 240 360 240 360v72h-48c-35.3 0-64 20.7-64 56v12c0 6.6 5.4 12 12 12h296c6.6 0 12-5.4 12-12v-12c0-35.3-28.7-56-64-56h-48v-72s36.7-21.5 68.1-73.6c40.3-4.6 78.6-19 110-41.7 39.3-28.3 61.9-65 61.9-100.7V88c0-13.3-10.7-24-24-24zM99.3 192.8C74.9 175.2 64 155.6 64 144v-16h64.2c1 32.6 5.8 61.2 12.8 86.2-15.1-5.2-29.2-12.4-41.7-21.4zM512 144c0 16.1-17.7 36.1-35.3 48.8-12.5 9-26.7 16.2-41.8 21.4 7-25 11.8-53.6 12.8-86.2H512v16z"]
};
var faTruck = {
prefix: 'fas',
iconName: 'truck',
icon: [640, 512, [], "f0d1", "M624 352h-16V243.9c0-12.7-5.1-24.9-14.1-33.9L494 110.1c-9-9-21.2-14.1-33.9-14.1H416V48c0-26.5-21.5-48-48-48H48C21.5 0 0 21.5 0 48v320c0 26.5 21.5 48 48 48h16c0 53 43 96 96 96s96-43 96-96h128c0 53 43 96 96 96s96-43 96-96h48c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM160 464c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm320 0c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48zm80-208H416V144h44.1l99.9 99.9V256z"]
};
var faTruckLoading = {
prefix: 'fas',
iconName: 'truck-loading',
icon: [640, 512, [], "f4de", "M50.2 375.6c2.3 8.5 11.1 13.6 19.6 11.3l216.4-58c8.5-2.3 13.6-11.1 11.3-19.6l-49.7-185.5c-2.3-8.5-11.1-13.6-19.6-11.3L151 133.3l24.8 92.7-61.8 16.5-24.8-92.7-77.3 20.7C3.4 172.8-1.7 181.6.6 190.1l49.6 185.5zM384 0c-17.7 0-32 14.3-32 32v323.6L5.9 450c-4.3 1.2-6.8 5.6-5.6 9.8l12.6 46.3c1.2 4.3 5.6 6.8 9.8 5.6l393.7-107.4C418.8 464.1 467.6 512 528 512c61.9 0 112-50.1 112-112V0H384zm144 448c-26.5 0-48-21.5-48-48s21.5-48 48-48 48 21.5 48 48-21.5 48-48 48z"]
};
var faTruckMonster = {
prefix: 'fas',
iconName: 'truck-monster',
icon: [640, 512, [], "f63b", "M624 224h-16v-64c0-17.67-14.33-32-32-32h-73.6L419.22 24.02A64.025 64.025 0 0 0 369.24 0H256c-17.67 0-32 14.33-32 32v96H48c-8.84 0-16 7.16-16 16v80H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h16.72c29.21-38.65 75.1-64 127.28-64s98.07 25.35 127.28 64h65.45c29.21-38.65 75.1-64 127.28-64s98.07 25.35 127.28 64H624c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zm-336-96V64h81.24l51.2 64H288zm304 224h-5.2c-2.2-7.33-5.07-14.28-8.65-20.89l3.67-3.67c6.25-6.25 6.25-16.38 0-22.63l-22.63-22.63c-6.25-6.25-16.38-6.25-22.63 0l-3.67 3.67A110.85 110.85 0 0 0 512 277.2V272c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v5.2c-7.33 2.2-14.28 5.07-20.89 8.65l-3.67-3.67c-6.25-6.25-16.38-6.25-22.63 0l-22.63 22.63c-6.25 6.25-6.25 16.38 0 22.63l3.67 3.67A110.85 110.85 0 0 0 373.2 352H368c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h5.2c2.2 7.33 5.07 14.28 8.65 20.89l-3.67 3.67c-6.25 6.25-6.25 16.38 0 22.63l22.63 22.63c6.25 6.25 16.38 6.25 22.63 0l3.67-3.67c6.61 3.57 13.57 6.45 20.9 8.65v5.2c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-5.2c7.33-2.2 14.28-5.07 20.9-8.65l3.67 3.67c6.25 6.25 16.38 6.25 22.63 0l22.63-22.63c6.25-6.25 6.25-16.38 0-22.63l-3.67-3.67a110.85 110.85 0 0 0 8.65-20.89h5.2c8.84 0 16-7.16 16-16v-32c-.02-8.84-7.18-16-16.02-16zm-112 80c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48zm-208-80h-5.2c-2.2-7.33-5.07-14.28-8.65-20.89l3.67-3.67c6.25-6.25 6.25-16.38 0-22.63l-22.63-22.63c-6.25-6.25-16.38-6.25-22.63 0l-3.67 3.67A110.85 110.85 0 0 0 192 277.2V272c0-8.84-7.16-16-16-16h-32c-8.84 0-16 7.16-16 16v5.2c-7.33 2.2-14.28 5.07-20.89 8.65l-3.67-3.67c-6.25-6.25-16.38-6.25-22.63 0L58.18 304.8c-6.25 6.25-6.25 16.38 0 22.63l3.67 3.67a110.85 110.85 0 0 0-8.65 20.89H48c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h5.2c2.2 7.33 5.07 14.28 8.65 20.89l-3.67 3.67c-6.25 6.25-6.25 16.38 0 22.63l22.63 22.63c6.25 6.25 16.38 6.25 22.63 0l3.67-3.67c6.61 3.57 13.57 6.45 20.9 8.65v5.2c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-5.2c7.33-2.2 14.28-5.07 20.9-8.65l3.67 3.67c6.25 6.25 16.38 6.25 22.63 0l22.63-22.63c6.25-6.25 6.25-16.38 0-22.63l-3.67-3.67a110.85 110.85 0 0 0 8.65-20.89h5.2c8.84 0 16-7.16 16-16v-32C288 359.16 280.84 352 272 352zm-112 80c-26.51 0-48-21.49-48-48s21.49-48 48-48 48 21.49 48 48-21.49 48-48 48z"]
};
var faTruckMoving = {
prefix: 'fas',
iconName: 'truck-moving',
icon: [640, 512, [], "f4df", "M621.3 237.3l-58.5-58.5c-12-12-28.3-18.7-45.3-18.7H480V64c0-17.7-14.3-32-32-32H32C14.3 32 0 46.3 0 64v336c0 44.2 35.8 80 80 80 26.3 0 49.4-12.9 64-32.4 14.6 19.6 37.7 32.4 64 32.4 44.2 0 80-35.8 80-80 0-5.5-.6-10.8-1.6-16h163.2c-1.1 5.2-1.6 10.5-1.6 16 0 44.2 35.8 80 80 80s80-35.8 80-80c0-5.5-.6-10.8-1.6-16H624c8.8 0 16-7.2 16-16v-85.5c0-17-6.7-33.2-18.7-45.2zM80 432c-17.6 0-32-14.4-32-32s14.4-32 32-32 32 14.4 32 32-14.4 32-32 32zm128 0c-17.6 0-32-14.4-32-32s14.4-32 32-32 32 14.4 32 32-14.4 32-32 32zm272-224h37.5c4.3 0 8.3 1.7 11.3 4.7l43.3 43.3H480v-48zm48 224c-17.6 0-32-14.4-32-32s14.4-32 32-32 32 14.4 32 32-14.4 32-32 32z"]
};
var faTruckPickup = {
prefix: 'fas',
iconName: 'truck-pickup',
icon: [640, 512, [], "f63c", "M624 288h-16v-64c0-17.67-14.33-32-32-32h-48L419.22 56.02A64.025 64.025 0 0 0 369.24 32H256c-17.67 0-32 14.33-32 32v128H64c-17.67 0-32 14.33-32 32v64H16c-8.84 0-16 7.16-16 16v32c0 8.84 7.16 16 16 16h49.61c-.76 5.27-1.61 10.52-1.61 16 0 61.86 50.14 112 112 112s112-50.14 112-112c0-5.48-.85-10.73-1.61-16h67.23c-.76 5.27-1.61 10.52-1.61 16 0 61.86 50.14 112 112 112s112-50.14 112-112c0-5.48-.85-10.73-1.61-16H624c8.84 0 16-7.16 16-16v-32c0-8.84-7.16-16-16-16zM288 96h81.24l76.8 96H288V96zM176 416c-26.47 0-48-21.53-48-48s21.53-48 48-48 48 21.53 48 48-21.53 48-48 48zm288 0c-26.47 0-48-21.53-48-48s21.53-48 48-48 48 21.53 48 48-21.53 48-48 48z"]
};
var faTshirt = {
prefix: 'fas',
iconName: 'tshirt',
icon: [640, 512, [], "f553", "M631.2 96.5L436.5 0C416.4 27.8 371.9 47.2 320 47.2S223.6 27.8 203.5 0L8.8 96.5c-7.9 4-11.1 13.6-7.2 21.5l57.2 114.5c4 7.9 13.6 11.1 21.5 7.2l56.6-27.7c10.6-5.2 23 2.5 23 14.4V480c0 17.7 14.3 32 32 32h256c17.7 0 32-14.3 32-32V226.3c0-11.8 12.4-19.6 23-14.4l56.6 27.7c7.9 4 17.5.8 21.5-7.2L638.3 118c4-7.9.8-17.6-7.1-21.5z"]
};
var faTty = {
prefix: 'fas',
iconName: 'tty',
icon: [512, 512, [], "f1e4", "M5.37 103.822c138.532-138.532 362.936-138.326 501.262 0 6.078 6.078 7.074 15.496 2.583 22.681l-43.214 69.138a18.332 18.332 0 0 1-22.356 7.305l-86.422-34.569a18.335 18.335 0 0 1-11.434-18.846L351.741 90c-62.145-22.454-130.636-21.986-191.483 0l5.953 59.532a18.331 18.331 0 0 1-11.434 18.846l-86.423 34.568a18.334 18.334 0 0 1-22.356-7.305L2.787 126.502a18.333 18.333 0 0 1 2.583-22.68zM96 308v-40c0-6.627-5.373-12-12-12H44c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm-336 96v-40c0-6.627-5.373-12-12-12H92c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zM96 500v-40c0-6.627-5.373-12-12-12H44c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12zm288 0v-40c0-6.627-5.373-12-12-12H140c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h232c6.627 0 12-5.373 12-12zm96 0v-40c0-6.627-5.373-12-12-12h-40c-6.627 0-12 5.373-12 12v40c0 6.627 5.373 12 12 12h40c6.627 0 12-5.373 12-12z"]
};
var faTv = {
prefix: 'fas',
iconName: 'tv',
icon: [640, 512, [], "f26c", "M592 0H48A48 48 0 0 0 0 48v320a48 48 0 0 0 48 48h240v32H112a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16H352v-32h240a48 48 0 0 0 48-48V48a48 48 0 0 0-48-48zm-16 352H64V64h512z"]
};
var faUmbrella = {
prefix: 'fas',
iconName: 'umbrella',
icon: [576, 512, [], "f0e9", "M575.7 280.8C547.1 144.5 437.3 62.6 320 49.9V32c0-17.7-14.3-32-32-32s-32 14.3-32 32v17.9C138.3 62.6 29.5 144.5.3 280.8c-2.2 10.1 8.5 21.3 18.7 11.4 52-55 107.7-52.4 158.6 37 5.3 9.5 14.9 8.6 19.7 0 20.2-35.4 44.9-73.2 90.7-73.2 58.5 0 88.2 68.8 90.7 73.2 4.8 8.6 14.4 9.5 19.7 0 51-89.5 107.1-91.4 158.6-37 10.3 10 20.9-1.3 18.7-11.4zM256 301.7V432c0 8.8-7.2 16-16 16-7.8 0-13.2-5.3-15.1-10.7-5.9-16.7-24.1-25.4-40.8-19.5-16.7 5.9-25.4 24.2-19.5 40.8 11.2 31.9 41.6 53.3 75.4 53.3 44.1 0 80-35.9 80-80V301.6c-9.1-7.9-19.8-13.6-32-13.6-12.3.1-22.4 4.8-32 13.7z"]
};
var faUmbrellaBeach = {
prefix: 'fas',
iconName: 'umbrella-beach',
icon: [640, 512, [], "f5ca", "M115.38 136.9l102.11 37.18c35.19-81.54 86.21-144.29 139-173.7-95.88-4.89-188.78 36.96-248.53 111.8-6.69 8.4-2.66 21.05 7.42 24.72zm132.25 48.16l238.48 86.83c35.76-121.38 18.7-231.66-42.63-253.98-7.4-2.7-15.13-4-23.09-4-58.02.01-128.27 69.17-172.76 171.15zM521.48 60.5c6.22 16.3 10.83 34.6 13.2 55.19 5.74 49.89-1.42 108.23-18.95 166.98l102.62 37.36c10.09 3.67 21.31-3.43 21.57-14.17 2.32-95.69-41.91-187.44-118.44-245.36zM560 447.98H321.06L386 269.5l-60.14-21.9-72.9 200.37H16c-8.84 0-16 7.16-16 16.01v32.01C0 504.83 7.16 512 16 512h544c8.84 0 16-7.17 16-16.01v-32.01c0-8.84-7.16-16-16-16z"]
};
var faUnderline = {
prefix: 'fas',
iconName: 'underline',
icon: [448, 512, [], "f0cd", "M32 64h32v160c0 88.22 71.78 160 160 160s160-71.78 160-160V64h32a16 16 0 0 0 16-16V16a16 16 0 0 0-16-16H272a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h32v160a80 80 0 0 1-160 0V64h32a16 16 0 0 0 16-16V16a16 16 0 0 0-16-16H32a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16zm400 384H16a16 16 0 0 0-16 16v32a16 16 0 0 0 16 16h416a16 16 0 0 0 16-16v-32a16 16 0 0 0-16-16z"]
};
var faUndo = {
prefix: 'fas',
iconName: 'undo',
icon: [512, 512, [], "f0e2", "M212.333 224.333H12c-6.627 0-12-5.373-12-12V12C0 5.373 5.373 0 12 0h48c6.627 0 12 5.373 12 12v78.112C117.773 39.279 184.26 7.47 258.175 8.007c136.906.994 246.448 111.623 246.157 248.532C504.041 393.258 393.12 504 256.333 504c-64.089 0-122.496-24.313-166.51-64.215-5.099-4.622-5.334-12.554-.467-17.42l33.967-33.967c4.474-4.474 11.662-4.717 16.401-.525C170.76 415.336 211.58 432 256.333 432c97.268 0 176-78.716 176-176 0-97.267-78.716-176-176-176-58.496 0-110.28 28.476-142.274 72.333h98.274c6.627 0 12 5.373 12 12v48c0 6.627-5.373 12-12 12z"]
};
var faUndoAlt = {
prefix: 'fas',
iconName: 'undo-alt',
icon: [512, 512, [], "f2ea", "M255.545 8c-66.269.119-126.438 26.233-170.86 68.685L48.971 40.971C33.851 25.851 8 36.559 8 57.941V192c0 13.255 10.745 24 24 24h134.059c21.382 0 32.09-25.851 16.971-40.971l-41.75-41.75c30.864-28.899 70.801-44.907 113.23-45.273 92.398-.798 170.283 73.977 169.484 169.442C423.236 348.009 349.816 424 256 424c-41.127 0-79.997-14.678-110.63-41.556-4.743-4.161-11.906-3.908-16.368.553L89.34 422.659c-4.872 4.872-4.631 12.815.482 17.433C133.798 479.813 192.074 504 256 504c136.966 0 247.999-111.033 248-247.998C504.001 119.193 392.354 7.755 255.545 8z"]
};
var faUniversalAccess = {
prefix: 'fas',
iconName: 'universal-access',
icon: [512, 512, [], "f29a", "M256 48c114.953 0 208 93.029 208 208 0 114.953-93.029 208-208 208-114.953 0-208-93.029-208-208 0-114.953 93.029-208 208-208m0-40C119.033 8 8 119.033 8 256s111.033 248 248 248 248-111.033 248-248S392.967 8 256 8zm0 56C149.961 64 64 149.961 64 256s85.961 192 192 192 192-85.961 192-192S362.039 64 256 64zm0 44c19.882 0 36 16.118 36 36s-16.118 36-36 36-36-16.118-36-36 16.118-36 36-36zm117.741 98.023c-28.712 6.779-55.511 12.748-82.14 15.807.851 101.023 12.306 123.052 25.037 155.621 3.617 9.26-.957 19.698-10.217 23.315-9.261 3.617-19.699-.957-23.316-10.217-8.705-22.308-17.086-40.636-22.261-78.549h-9.686c-5.167 37.851-13.534 56.208-22.262 78.549-3.615 9.255-14.05 13.836-23.315 10.217-9.26-3.617-13.834-14.056-10.217-23.315 12.713-32.541 24.185-54.541 25.037-155.621-26.629-3.058-53.428-9.027-82.141-15.807-8.6-2.031-13.926-10.648-11.895-19.249s10.647-13.926 19.249-11.895c96.686 22.829 124.283 22.783 220.775 0 8.599-2.03 17.218 3.294 19.249 11.895 2.029 8.601-3.297 17.219-11.897 19.249z"]
};
var faUniversity = {
prefix: 'fas',
iconName: 'university',
icon: [512, 512, [], "f19c", "M496 128v16a8 8 0 0 1-8 8h-24v12c0 6.627-5.373 12-12 12H60c-6.627 0-12-5.373-12-12v-12H24a8 8 0 0 1-8-8v-16a8 8 0 0 1 4.941-7.392l232-88a7.996 7.996 0 0 1 6.118 0l232 88A8 8 0 0 1 496 128zm-24 304H40c-13.255 0-24 10.745-24 24v16a8 8 0 0 0 8 8h464a8 8 0 0 0 8-8v-16c0-13.255-10.745-24-24-24zM96 192v192H60c-6.627 0-12 5.373-12 12v20h416v-20c0-6.627-5.373-12-12-12h-36V192h-64v192h-64V192h-64v192h-64V192H96z"]
};
var faUnlink = {
prefix: 'fas',
iconName: 'unlink',
icon: [512, 512, [], "f127", "M304.083 405.907c4.686 4.686 4.686 12.284 0 16.971l-44.674 44.674c-59.263 59.262-155.693 59.266-214.961 0-59.264-59.265-59.264-155.696 0-214.96l44.675-44.675c4.686-4.686 12.284-4.686 16.971 0l39.598 39.598c4.686 4.686 4.686 12.284 0 16.971l-44.675 44.674c-28.072 28.073-28.072 73.75 0 101.823 28.072 28.072 73.75 28.073 101.824 0l44.674-44.674c4.686-4.686 12.284-4.686 16.971 0l39.597 39.598zm-56.568-260.216c4.686 4.686 12.284 4.686 16.971 0l44.674-44.674c28.072-28.075 73.75-28.073 101.824 0 28.072 28.073 28.072 73.75 0 101.823l-44.675 44.674c-4.686 4.686-4.686 12.284 0 16.971l39.598 39.598c4.686 4.686 12.284 4.686 16.971 0l44.675-44.675c59.265-59.265 59.265-155.695 0-214.96-59.266-59.264-155.695-59.264-214.961 0l-44.674 44.674c-4.686 4.686-4.686 12.284 0 16.971l39.597 39.598zm234.828 359.28l22.627-22.627c9.373-9.373 9.373-24.569 0-33.941L63.598 7.029c-9.373-9.373-24.569-9.373-33.941 0L7.029 29.657c-9.373 9.373-9.373 24.569 0 33.941l441.373 441.373c9.373 9.372 24.569 9.372 33.941 0z"]
};
var faUnlock = {
prefix: 'fas',
iconName: 'unlock',
icon: [448, 512, [], "f09c", "M400 256H152V152.9c0-39.6 31.7-72.5 71.3-72.9 40-.4 72.7 32.1 72.7 72v16c0 13.3 10.7 24 24 24h32c13.3 0 24-10.7 24-24v-16C376 68 307.5-.3 223.5 0 139.5.3 72 69.5 72 153.5V256H48c-26.5 0-48 21.5-48 48v160c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V304c0-26.5-21.5-48-48-48z"]
};
var faUnlockAlt = {
prefix: 'fas',
iconName: 'unlock-alt',
icon: [448, 512, [], "f13e", "M400 256H152V152.9c0-39.6 31.7-72.5 71.3-72.9 40-.4 72.7 32.1 72.7 72v16c0 13.3 10.7 24 24 24h32c13.3 0 24-10.7 24-24v-16C376 68 307.5-.3 223.5 0 139.5.3 72 69.5 72 153.5V256H48c-26.5 0-48 21.5-48 48v160c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48V304c0-26.5-21.5-48-48-48zM264 408c0 22.1-17.9 40-40 40s-40-17.9-40-40v-48c0-22.1 17.9-40 40-40s40 17.9 40 40v48z"]
};
var faUpload = {
prefix: 'fas',
iconName: 'upload',
icon: [512, 512, [], "f093", "M296 384h-80c-13.3 0-24-10.7-24-24V192h-87.7c-17.8 0-26.7-21.5-14.1-34.1L242.3 5.7c7.5-7.5 19.8-7.5 27.3 0l152.2 152.2c12.6 12.6 3.7 34.1-14.1 34.1H320v168c0 13.3-10.7 24-24 24zm216-8v112c0 13.3-10.7 24-24 24H24c-13.3 0-24-10.7-24-24V376c0-13.3 10.7-24 24-24h136v8c0 30.9 25.1 56 56 56h80c30.9 0 56-25.1 56-56v-8h136c13.3 0 24 10.7 24 24zm-124 88c0-11-9-20-20-20s-20 9-20 20 9 20 20 20 20-9 20-20zm64 0c0-11-9-20-20-20s-20 9-20 20 9 20 20 20 20-9 20-20z"]
};
var faUser = {
prefix: 'fas',
iconName: 'user',
icon: [448, 512, [], "f007", "M224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-74.2-60.2-134.4-134.4-134.4z"]
};
var faUserAlt = {
prefix: 'fas',
iconName: 'user-alt',
icon: [512, 512, [], "f406", "M256 288c79.5 0 144-64.5 144-144S335.5 0 256 0 112 64.5 112 144s64.5 144 144 144zm128 32h-55.1c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16H128C57.3 320 0 377.3 0 448v16c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48v-16c0-70.7-57.3-128-128-128z"]
};
var faUserAltSlash = {
prefix: 'fas',
iconName: 'user-alt-slash',
icon: [640, 512, [], "f4fa", "M633.8 458.1L389.6 269.3C433.8 244.7 464 198.1 464 144 464 64.5 399.5 0 320 0c-67.1 0-123 46.1-139 108.2L45.5 3.4C38.5-2 28.5-.8 23 6.2L3.4 31.4c-5.4 7-4.2 17 2.8 22.4l588.4 454.7c7 5.4 17 4.2 22.5-2.8l19.6-25.3c5.4-6.8 4.1-16.9-2.9-22.3zM198.4 320C124.2 320 64 380.2 64 454.4v9.6c0 26.5 21.5 48 48 48h382.2L245.8 320h-47.4z"]
};
var faUserAstronaut = {
prefix: 'fas',
iconName: 'user-astronaut',
icon: [448, 512, [], "f4fb", "M64 224h13.5c24.7 56.5 80.9 96 146.5 96s121.8-39.5 146.5-96H384c8.8 0 16-7.2 16-16v-96c0-8.8-7.2-16-16-16h-13.5C345.8 39.5 289.6 0 224 0S102.2 39.5 77.5 96H64c-8.8 0-16 7.2-16 16v96c0 8.8 7.2 16 16 16zm40-88c0-22.1 21.5-40 48-40h144c26.5 0 48 17.9 48 40v24c0 53-43 96-96 96h-48c-53 0-96-43-96-96v-24zm72 72l12-36 36-12-36-12-12-36-12 36-36 12 36 12 12 36zm151.6 113.4C297.7 340.7 262.2 352 224 352s-73.7-11.3-103.6-30.6C52.9 328.5 0 385 0 454.4v9.6c0 26.5 21.5 48 48 48h80v-64c0-17.7 14.3-32 32-32h128c17.7 0 32 14.3 32 32v64h80c26.5 0 48-21.5 48-48v-9.6c0-69.4-52.9-125.9-120.4-133zM272 448c-8.8 0-16 7.2-16 16s7.2 16 16 16 16-7.2 16-16-7.2-16-16-16zm-96 0c-8.8 0-16 7.2-16 16v48h32v-48c0-8.8-7.2-16-16-16z"]
};
var faUserCheck = {
prefix: 'fas',
iconName: 'user-check',
icon: [640, 512, [], "f4fc", "M224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-74.2-60.2-134.4-134.4-134.4zm323-128.4l-27.8-28.1c-4.6-4.7-12.1-4.7-16.8-.1l-104.8 104-45.5-45.8c-4.6-4.7-12.1-4.7-16.8-.1l-28.1 27.9c-4.7 4.6-4.7 12.1-.1 16.8l81.7 82.3c4.6 4.7 12.1 4.7 16.8.1l141.3-140.2c4.6-4.7 4.7-12.2.1-16.8z"]
};
var faUserCircle = {
prefix: 'fas',
iconName: 'user-circle',
icon: [496, 512, [], "f2bd", "M248 8C111 8 0 119 0 256s111 248 248 248 248-111 248-248S385 8 248 8zm0 96c48.6 0 88 39.4 88 88s-39.4 88-88 88-88-39.4-88-88 39.4-88 88-88zm0 344c-58.7 0-111.3-26.6-146.5-68.2 18.8-35.4 55.6-59.8 98.5-59.8 2.4 0 4.8.4 7.1 1.1 13 4.2 26.6 6.9 40.9 6.9 14.3 0 28-2.7 40.9-6.9 2.3-.7 4.7-1.1 7.1-1.1 42.9 0 79.7 24.4 98.5 59.8C359.3 421.4 306.7 448 248 448z"]
};
var faUserClock = {
prefix: 'fas',
iconName: 'user-clock',
icon: [640, 512, [], "f4fd", "M496 224c-79.6 0-144 64.4-144 144s64.4 144 144 144 144-64.4 144-144-64.4-144-144-144zm64 150.3c0 5.3-4.4 9.7-9.7 9.7h-60.6c-5.3 0-9.7-4.4-9.7-9.7v-76.6c0-5.3 4.4-9.7 9.7-9.7h12.6c5.3 0 9.7 4.4 9.7 9.7V352h38.3c5.3 0 9.7 4.4 9.7 9.7v12.6zM320 368c0-27.8 6.7-54.1 18.2-77.5-8-1.5-16.2-2.5-24.6-2.5h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h347.1c-45.3-31.9-75.1-84.5-75.1-144zm-96-112c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128z"]
};
var faUserCog = {
prefix: 'fas',
iconName: 'user-cog',
icon: [640, 512, [], "f4fe", "M610.5 373.3c2.6-14.1 2.6-28.5 0-42.6l25.8-14.9c3-1.7 4.3-5.2 3.3-8.5-6.7-21.6-18.2-41.2-33.2-57.4-2.3-2.5-6-3.1-9-1.4l-25.8 14.9c-10.9-9.3-23.4-16.5-36.9-21.3v-29.8c0-3.4-2.4-6.4-5.7-7.1-22.3-5-45-4.8-66.2 0-3.3.7-5.7 3.7-5.7 7.1v29.8c-13.5 4.8-26 12-36.9 21.3l-25.8-14.9c-2.9-1.7-6.7-1.1-9 1.4-15 16.2-26.5 35.8-33.2 57.4-1 3.3.4 6.8 3.3 8.5l25.8 14.9c-2.6 14.1-2.6 28.5 0 42.6l-25.8 14.9c-3 1.7-4.3 5.2-3.3 8.5 6.7 21.6 18.2 41.1 33.2 57.4 2.3 2.5 6 3.1 9 1.4l25.8-14.9c10.9 9.3 23.4 16.5 36.9 21.3v29.8c0 3.4 2.4 6.4 5.7 7.1 22.3 5 45 4.8 66.2 0 3.3-.7 5.7-3.7 5.7-7.1v-29.8c13.5-4.8 26-12 36.9-21.3l25.8 14.9c2.9 1.7 6.7 1.1 9-1.4 15-16.2 26.5-35.8 33.2-57.4 1-3.3-.4-6.8-3.3-8.5l-25.8-14.9zM496 400.5c-26.8 0-48.5-21.8-48.5-48.5s21.8-48.5 48.5-48.5 48.5 21.8 48.5 48.5-21.7 48.5-48.5 48.5zM224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm201.2 226.5c-2.3-1.2-4.6-2.6-6.8-3.9l-7.9 4.6c-6 3.4-12.8 5.3-19.6 5.3-10.9 0-21.4-4.6-28.9-12.6-18.3-19.8-32.3-43.9-40.2-69.6-5.5-17.7 1.9-36.4 17.9-45.7l7.9-4.6c-.1-2.6-.1-5.2 0-7.8l-7.9-4.6c-16-9.2-23.4-28-17.9-45.7.9-2.9 2.2-5.8 3.2-8.7-3.8-.3-7.5-1.2-11.4-1.2h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c10.1 0 19.5-3.2 27.2-8.5-1.2-3.8-2-7.7-2-11.8v-9.2z"]
};
var faUserEdit = {
prefix: 'fas',
iconName: 'user-edit',
icon: [640, 512, [], "f4ff", "M224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h274.9c-2.4-6.8-3.4-14-2.6-21.3l6.8-60.9 1.2-11.1 7.9-7.9 77.3-77.3c-24.5-27.7-60-45.5-99.9-45.5zm45.3 145.3l-6.8 61c-1.1 10.2 7.5 18.8 17.6 17.6l60.9-6.8 137.9-137.9-71.7-71.7-137.9 137.8zM633 268.9L595.1 231c-9.3-9.3-24.5-9.3-33.8 0l-37.8 37.8-4.1 4.1 71.8 71.7 41.8-41.8c9.3-9.4 9.3-24.5 0-33.9z"]
};
var faUserFriends = {
prefix: 'fas',
iconName: 'user-friends',
icon: [640, 512, [], "f500", "M192 256c61.9 0 112-50.1 112-112S253.9 32 192 32 80 82.1 80 144s50.1 112 112 112zm76.8 32h-8.3c-20.8 10-43.9 16-68.5 16s-47.6-6-68.5-16h-8.3C51.6 288 0 339.6 0 403.2V432c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48v-28.8c0-63.6-51.6-115.2-115.2-115.2zM480 256c53 0 96-43 96-96s-43-96-96-96-96 43-96 96 43 96 96 96zm48 32h-3.8c-13.9 4.8-28.6 8-44.2 8s-30.3-3.2-44.2-8H432c-20.4 0-39.2 5.9-55.7 15.4 24.4 26.3 39.7 61.2 39.7 99.8v38.4c0 2.2-.5 4.3-.6 6.4H592c26.5 0 48-21.5 48-48 0-61.9-50.1-112-112-112z"]
};
var faUserGraduate = {
prefix: 'fas',
iconName: 'user-graduate',
icon: [448, 512, [], "f501", "M319.4 320.6L224 416l-95.4-95.4C57.1 323.7 0 382.2 0 454.4v9.6c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-9.6c0-72.2-57.1-130.7-128.6-133.8zM13.6 79.8l6.4 1.5v58.4c-7 4.2-12 11.5-12 20.3 0 8.4 4.6 15.4 11.1 19.7L3.5 242c-1.7 6.9 2.1 14 7.6 14h41.8c5.5 0 9.3-7.1 7.6-14l-15.6-62.3C51.4 175.4 56 168.4 56 160c0-8.8-5-16.1-12-20.3V87.1l66 15.9c-8.6 17.2-14 36.4-14 57 0 70.7 57.3 128 128 128s128-57.3 128-128c0-20.6-5.3-39.8-14-57l96.3-23.2c18.2-4.4 18.2-27.1 0-31.5l-190.4-46c-13-3.1-26.7-3.1-39.7 0L13.6 48.2c-18.1 4.4-18.1 27.2 0 31.6z"]
};
var faUserInjured = {
prefix: 'fas',
iconName: 'user-injured',
icon: [448, 512, [], "f728", "M277.37 11.98C261.08 4.47 243.11 0 224 0c-53.69 0-99.5 33.13-118.51 80h81.19l90.69-68.02zM342.51 80c-7.9-19.47-20.67-36.2-36.49-49.52L239.99 80h102.52zM224 256c70.69 0 128-57.31 128-128 0-5.48-.95-10.7-1.61-16H97.61c-.67 5.3-1.61 10.52-1.61 16 0 70.69 57.31 128 128 128zM80 299.7V512h128.26l-98.45-221.52A132.835 132.835 0 0 0 80 299.7zM0 464c0 26.51 21.49 48 48 48V320.24C18.88 344.89 0 381.26 0 422.4V464zm256-48h-55.38l42.67 96H256c26.47 0 48-21.53 48-48s-21.53-48-48-48zm57.6-128h-16.71c-22.24 10.18-46.88 16-72.89 16s-50.65-5.82-72.89-16h-7.37l42.67 96H256c44.11 0 80 35.89 80 80 0 18.08-6.26 34.59-16.41 48H400c26.51 0 48-21.49 48-48v-41.6c0-74.23-60.17-134.4-134.4-134.4z"]
};
var faUserLock = {
prefix: 'fas',
iconName: 'user-lock',
icon: [640, 512, [], "f502", "M224 256A128 128 0 1 0 96 128a128 128 0 0 0 128 128zm96 64a63.08 63.08 0 0 1 8.1-30.5c-4.8-.5-9.5-1.5-14.5-1.5h-16.7a174.08 174.08 0 0 1-145.8 0h-16.7A134.43 134.43 0 0 0 0 422.4V464a48 48 0 0 0 48 48h280.9a63.54 63.54 0 0 1-8.9-32zm288-32h-32v-80a80 80 0 0 0-160 0v80h-32a32 32 0 0 0-32 32v160a32 32 0 0 0 32 32h224a32 32 0 0 0 32-32V320a32 32 0 0 0-32-32zM496 432a32 32 0 1 1 32-32 32 32 0 0 1-32 32zm32-144h-64v-80a32 32 0 0 1 64 0z"]
};
var faUserMd = {
prefix: 'fas',
iconName: 'user-md',
icon: [448, 512, [], "f0f0", "M224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zM104 424c0 13.3 10.7 24 24 24s24-10.7 24-24-10.7-24-24-24-24 10.7-24 24zm216-135.4v49c36.5 7.4 64 39.8 64 78.4v41.7c0 7.6-5.4 14.2-12.9 15.7l-32.2 6.4c-4.3.9-8.5-1.9-9.4-6.3l-3.1-15.7c-.9-4.3 1.9-8.6 6.3-9.4l19.3-3.9V416c0-62.8-96-65.1-96 1.9v26.7l19.3 3.9c4.3.9 7.1 5.1 6.3 9.4l-3.1 15.7c-.9 4.3-5.1 7.1-9.4 6.3l-31.2-4.2c-7.9-1.1-13.8-7.8-13.8-15.9V416c0-38.6 27.5-70.9 64-78.4v-45.2c-2.2.7-4.4 1.1-6.6 1.9-18 6.3-37.3 9.8-57.4 9.8s-39.4-3.5-57.4-9.8c-7.4-2.6-14.9-4.2-22.6-5.2v81.6c23.1 6.9 40 28.1 40 53.4 0 30.9-25.1 56-56 56s-56-25.1-56-56c0-25.3 16.9-46.5 40-53.4v-80.4C48.5 301 0 355.8 0 422.4v44.8C0 491.9 20.1 512 44.8 512h358.4c24.7 0 44.8-20.1 44.8-44.8v-44.8c0-72-56.8-130.3-128-133.8z"]
};
var faUserMinus = {
prefix: 'fas',
iconName: 'user-minus',
icon: [640, 512, [], "f503", "M624 208H432c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h192c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm-400 48c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-74.2-60.2-134.4-134.4-134.4z"]
};
var faUserNinja = {
prefix: 'fas',
iconName: 'user-ninja',
icon: [448, 512, [], "f504", "M325.4 289.2L224 390.6 122.6 289.2C54 295.3 0 352.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-70.2-54-127.1-122.6-133.2zM32 192c27.3 0 51.8-11.5 69.2-29.7 15.1 53.9 64 93.7 122.8 93.7 70.7 0 128-57.3 128-128S294.7 0 224 0c-50.4 0-93.6 29.4-114.5 71.8C92.1 47.8 64 32 32 32c0 33.4 17.1 62.8 43.1 80-26 17.2-43.1 46.6-43.1 80zm144-96h96c17.7 0 32 14.3 32 32H144c0-17.7 14.3-32 32-32z"]
};
var faUserNurse = {
prefix: 'fas',
iconName: 'user-nurse',
icon: [448, 512, [], "f82f", "M319.41,320,224,415.39,128.59,320C57.1,323.1,0,381.6,0,453.79A58.21,58.21,0,0,0,58.21,512H389.79A58.21,58.21,0,0,0,448,453.79C448,381.6,390.9,323.1,319.41,320ZM224,304A128,128,0,0,0,352,176V65.82a32,32,0,0,0-20.76-30L246.47,4.07a64,64,0,0,0-44.94,0L116.76,35.86A32,32,0,0,0,96,65.82V176A128,128,0,0,0,224,304ZM184,71.67a5,5,0,0,1,5-5h21.67V45a5,5,0,0,1,5-5h16.66a5,5,0,0,1,5,5V66.67H259a5,5,0,0,1,5,5V88.33a5,5,0,0,1-5,5H237.33V115a5,5,0,0,1-5,5H215.67a5,5,0,0,1-5-5V93.33H189a5,5,0,0,1-5-5ZM144,160H304v16a80,80,0,0,1-160,0Z"]
};
var faUserPlus = {
prefix: 'fas',
iconName: 'user-plus',
icon: [640, 512, [], "f234", "M624 208h-64v-64c0-8.8-7.2-16-16-16h-32c-8.8 0-16 7.2-16 16v64h-64c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h64v64c0 8.8 7.2 16 16 16h32c8.8 0 16-7.2 16-16v-64h64c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zm-400 48c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-74.2-60.2-134.4-134.4-134.4z"]
};
var faUserSecret = {
prefix: 'fas',
iconName: 'user-secret',
icon: [448, 512, [], "f21b", "M383.9 308.3l23.9-62.6c4-10.5-3.7-21.7-15-21.7h-58.5c11-18.9 17.8-40.6 17.8-64v-.3c39.2-7.8 64-19.1 64-31.7 0-13.3-27.3-25.1-70.1-33-9.2-32.8-27-65.8-40.6-82.8-9.5-11.9-25.9-15.6-39.5-8.8l-27.6 13.8c-9 4.5-19.6 4.5-28.6 0L182.1 3.4c-13.6-6.8-30-3.1-39.5 8.8-13.5 17-31.4 50-40.6 82.8-42.7 7.9-70 19.7-70 33 0 12.6 24.8 23.9 64 31.7v.3c0 23.4 6.8 45.1 17.8 64H56.3c-11.5 0-19.2 11.7-14.7 22.3l25.8 60.2C27.3 329.8 0 372.7 0 422.4v44.8C0 491.9 20.1 512 44.8 512h358.4c24.7 0 44.8-20.1 44.8-44.8v-44.8c0-48.4-25.8-90.4-64.1-114.1zM176 480l-41.6-192 49.6 32 24 40-32 120zm96 0l-32-120 24-40 49.6-32L272 480zm41.7-298.5c-3.9 11.9-7 24.6-16.5 33.4-10.1 9.3-48 22.4-64-25-2.8-8.4-15.4-8.4-18.3 0-17 50.2-56 32.4-64 25-9.5-8.8-12.7-21.5-16.5-33.4-.8-2.5-6.3-5.7-6.3-5.8v-10.8c28.3 3.6 61 5.8 96 5.8s67.7-2.1 96-5.8v10.8c-.1.1-5.6 3.2-6.4 5.8z"]
};
var faUserShield = {
prefix: 'fas',
iconName: 'user-shield',
icon: [640, 512, [], "f505", "M622.3 271.1l-115.2-45c-4.1-1.6-12.6-3.7-22.2 0l-115.2 45c-10.7 4.2-17.7 14-17.7 24.9 0 111.6 68.7 188.8 132.9 213.9 9.6 3.7 18 1.6 22.2 0C558.4 489.9 640 420.5 640 296c0-10.9-7-20.7-17.7-24.9zM496 462.4V273.3l95.5 37.3c-5.6 87.1-60.9 135.4-95.5 151.8zM224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm96 40c0-2.5.8-4.8 1.1-7.2-2.5-.1-4.9-.8-7.5-.8h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c6.8 0 13.3-1.5 19.2-4-54-42.9-99.2-116.7-99.2-212z"]
};
var faUserSlash = {
prefix: 'fas',
iconName: 'user-slash',
icon: [640, 512, [], "f506", "M633.8 458.1L362.3 248.3C412.1 230.7 448 183.8 448 128 448 57.3 390.7 0 320 0c-67.1 0-121.5 51.8-126.9 117.4L45.5 3.4C38.5-2 28.5-.8 23 6.2L3.4 31.4c-5.4 7-4.2 17 2.8 22.4l588.4 454.7c7 5.4 17 4.2 22.5-2.8l19.6-25.3c5.4-6.8 4.1-16.9-2.9-22.3zM96 422.4V464c0 26.5 21.5 48 48 48h350.2L207.4 290.3C144.2 301.3 96 356 96 422.4z"]
};
var faUserTag = {
prefix: 'fas',
iconName: 'user-tag',
icon: [640, 512, [], "f507", "M630.6 364.9l-90.3-90.2c-12-12-28.3-18.7-45.3-18.7h-79.3c-17.7 0-32 14.3-32 32v79.2c0 17 6.7 33.2 18.7 45.2l90.3 90.2c12.5 12.5 32.8 12.5 45.3 0l92.5-92.5c12.6-12.5 12.6-32.7.1-45.2zm-182.8-21c-13.3 0-24-10.7-24-24s10.7-24 24-24 24 10.7 24 24c0 13.2-10.7 24-24 24zm-223.8-88c70.7 0 128-57.3 128-128C352 57.3 294.7 0 224 0S96 57.3 96 128c0 70.6 57.3 127.9 128 127.9zm127.8 111.2V294c-12.2-3.6-24.9-6.2-38.2-6.2h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 287.9 0 348.1 0 422.3v41.6c0 26.5 21.5 48 48 48h352c15.5 0 29.1-7.5 37.9-18.9l-58-58c-18.1-18.1-28.1-42.2-28.1-67.9z"]
};
var faUserTie = {
prefix: 'fas',
iconName: 'user-tie',
icon: [448, 512, [], "f508", "M224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm95.8 32.6L272 480l-32-136 32-56h-96l32 56-32 136-47.8-191.4C56.9 292 0 350.3 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-72.1-56.9-130.4-128.2-133.8z"]
};
var faUserTimes = {
prefix: 'fas',
iconName: 'user-times',
icon: [640, 512, [], "f235", "M589.6 240l45.6-45.6c6.3-6.3 6.3-16.5 0-22.8l-22.8-22.8c-6.3-6.3-16.5-6.3-22.8 0L544 194.4l-45.6-45.6c-6.3-6.3-16.5-6.3-22.8 0l-22.8 22.8c-6.3 6.3-6.3 16.5 0 22.8l45.6 45.6-45.6 45.6c-6.3 6.3-6.3 16.5 0 22.8l22.8 22.8c6.3 6.3 16.5 6.3 22.8 0l45.6-45.6 45.6 45.6c6.3 6.3 16.5 6.3 22.8 0l22.8-22.8c6.3-6.3 6.3-16.5 0-22.8L589.6 240zM224 256c70.7 0 128-57.3 128-128S294.7 0 224 0 96 57.3 96 128s57.3 128 128 128zm89.6 32h-16.7c-22.2 10.2-46.9 16-72.9 16s-50.6-5.8-72.9-16h-16.7C60.2 288 0 348.2 0 422.4V464c0 26.5 21.5 48 48 48h352c26.5 0 48-21.5 48-48v-41.6c0-74.2-60.2-134.4-134.4-134.4z"]
};
var faUsers = {
prefix: 'fas',
iconName: 'users',
icon: [640, 512, [], "f0c0", "M96 224c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm448 0c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm32 32h-64c-17.6 0-33.5 7.1-45.1 18.6 40.3 22.1 68.9 62 75.1 109.4h66c17.7 0 32-14.3 32-32v-32c0-35.3-28.7-64-64-64zm-256 0c61.9 0 112-50.1 112-112S381.9 32 320 32 208 82.1 208 144s50.1 112 112 112zm76.8 32h-8.3c-20.8 10-43.9 16-68.5 16s-47.6-6-68.5-16h-8.3C179.6 288 128 339.6 128 403.2V432c0 26.5 21.5 48 48 48h288c26.5 0 48-21.5 48-48v-28.8c0-63.6-51.6-115.2-115.2-115.2zm-223.7-13.4C161.5 263.1 145.6 256 128 256H64c-35.3 0-64 28.7-64 64v32c0 17.7 14.3 32 32 32h65.9c6.3-47.4 34.9-87.3 75.2-109.4z"]
};
var faUsersCog = {
prefix: 'fas',
iconName: 'users-cog',
icon: [640, 512, [], "f509", "M610.5 341.3c2.6-14.1 2.6-28.5 0-42.6l25.8-14.9c3-1.7 4.3-5.2 3.3-8.5-6.7-21.6-18.2-41.2-33.2-57.4-2.3-2.5-6-3.1-9-1.4l-25.8 14.9c-10.9-9.3-23.4-16.5-36.9-21.3v-29.8c0-3.4-2.4-6.4-5.7-7.1-22.3-5-45-4.8-66.2 0-3.3.7-5.7 3.7-5.7 7.1v29.8c-13.5 4.8-26 12-36.9 21.3l-25.8-14.9c-2.9-1.7-6.7-1.1-9 1.4-15 16.2-26.5 35.8-33.2 57.4-1 3.3.4 6.8 3.3 8.5l25.8 14.9c-2.6 14.1-2.6 28.5 0 42.6l-25.8 14.9c-3 1.7-4.3 5.2-3.3 8.5 6.7 21.6 18.2 41.1 33.2 57.4 2.3 2.5 6 3.1 9 1.4l25.8-14.9c10.9 9.3 23.4 16.5 36.9 21.3v29.8c0 3.4 2.4 6.4 5.7 7.1 22.3 5 45 4.8 66.2 0 3.3-.7 5.7-3.7 5.7-7.1v-29.8c13.5-4.8 26-12 36.9-21.3l25.8 14.9c2.9 1.7 6.7 1.1 9-1.4 15-16.2 26.5-35.8 33.2-57.4 1-3.3-.4-6.8-3.3-8.5l-25.8-14.9zM496 368.5c-26.8 0-48.5-21.8-48.5-48.5s21.8-48.5 48.5-48.5 48.5 21.8 48.5 48.5-21.7 48.5-48.5 48.5zM96 224c35.3 0 64-28.7 64-64s-28.7-64-64-64-64 28.7-64 64 28.7 64 64 64zm224 32c1.9 0 3.7-.5 5.6-.6 8.3-21.7 20.5-42.1 36.3-59.2 7.4-8 17.9-12.6 28.9-12.6 6.9 0 13.7 1.8 19.6 5.3l7.9 4.6c.8-.5 1.6-.9 2.4-1.4 7-14.6 11.2-30.8 11.2-48 0-61.9-50.1-112-112-112S208 82.1 208 144c0 61.9 50.1 112 112 112zm105.2 194.5c-2.3-1.2-4.6-2.6-6.8-3.9-8.2 4.8-15.3 9.8-27.5 9.8-10.9 0-21.4-4.6-28.9-12.6-18.3-19.8-32.3-43.9-40.2-69.6-10.7-34.5 24.9-49.7 25.8-50.3-.1-2.6-.1-5.2 0-7.8l-7.9-4.6c-3.8-2.2-7-5-9.8-8.1-3.3.2-6.5.6-9.8.6-24.6 0-47.6-6-68.5-16h-8.3C179.6 288 128 339.6 128 403.2V432c0 26.5 21.5 48 48 48h255.4c-3.7-6-6.2-12.8-6.2-20.3v-9.2zM173.1 274.6C161.5 263.1 145.6 256 128 256H64c-35.3 0-64 28.7-64 64v32c0 17.7 14.3 32 32 32h65.9c6.3-47.4 34.9-87.3 75.2-109.4z"]
};
var faUsersSlash = {
prefix: 'fas',
iconName: 'users-slash',
icon: [640, 512, [], "e073", "M132.65,212.32,36.21,137.78A63.4,63.4,0,0,0,32,160a63.84,63.84,0,0,0,100.65,52.32Zm40.44,62.28A63.79,63.79,0,0,0,128,256H64A64.06,64.06,0,0,0,0,320v32a32,32,0,0,0,32,32H97.91A146.62,146.62,0,0,1,173.09,274.6ZM544,224a64,64,0,1,0-64-64A64.06,64.06,0,0,0,544,224ZM500.56,355.11a114.24,114.24,0,0,0-84.47-65.28L361,247.23c41.46-16.3,71-55.92,71-103.23A111.93,111.93,0,0,0,320,32c-57.14,0-103.69,42.83-110.6,98.08L45.46,3.38A16,16,0,0,0,23,6.19L3.37,31.46A16,16,0,0,0,6.18,53.91L594.53,508.63A16,16,0,0,0,617,505.82l19.64-25.27a16,16,0,0,0-2.81-22.45ZM128,403.21V432a48,48,0,0,0,48,48H464a47.45,47.45,0,0,0,12.57-1.87L232,289.13C173.74,294.83,128,343.42,128,403.21ZM576,256H512a63.79,63.79,0,0,0-45.09,18.6A146.29,146.29,0,0,1,542,384h66a32,32,0,0,0,32-32V320A64.06,64.06,0,0,0,576,256Z"]
};
var faUtensilSpoon = {
prefix: 'fas',
iconName: 'utensil-spoon',
icon: [512, 512, [], "f2e5", "M480.1 31.9c-55-55.1-164.9-34.5-227.8 28.5-49.3 49.3-55.1 110-28.8 160.4L9 413.2c-11.6 10.5-12.1 28.5-1 39.5L59.3 504c11 11 29.1 10.5 39.5-1.1l192.4-214.4c50.4 26.3 111.1 20.5 160.4-28.8 63-62.9 83.6-172.8 28.5-227.8z"]
};
var faUtensils = {
prefix: 'fas',
iconName: 'utensils',
icon: [416, 512, [], "f2e7", "M207.9 15.2c.8 4.7 16.1 94.5 16.1 128.8 0 52.3-27.8 89.6-68.9 104.6L168 486.7c.7 13.7-10.2 25.3-24 25.3H80c-13.7 0-24.7-11.5-24-25.3l12.9-238.1C27.7 233.6 0 196.2 0 144 0 109.6 15.3 19.9 16.1 15.2 19.3-5.1 61.4-5.4 64 16.3v141.2c1.3 3.4 15.1 3.2 16 0 1.4-25.3 7.9-139.2 8-141.8 3.3-20.8 44.7-20.8 47.9 0 .2 2.7 6.6 116.5 8 141.8.9 3.2 14.8 3.4 16 0V16.3c2.6-21.6 44.8-21.4 48-1.1zm119.2 285.7l-15 185.1c-1.2 14 9.9 26 23.9 26h56c13.3 0 24-10.7 24-24V24c0-13.2-10.7-24-24-24-82.5 0-221.4 178.5-64.9 300.9z"]
};
var faVectorSquare = {
prefix: 'fas',
iconName: 'vector-square',
icon: [512, 512, [], "f5cb", "M512 128V32c0-17.67-14.33-32-32-32h-96c-17.67 0-32 14.33-32 32H160c0-17.67-14.33-32-32-32H32C14.33 0 0 14.33 0 32v96c0 17.67 14.33 32 32 32v192c-17.67 0-32 14.33-32 32v96c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32h192c0 17.67 14.33 32 32 32h96c17.67 0 32-14.33 32-32v-96c0-17.67-14.33-32-32-32V160c17.67 0 32-14.33 32-32zm-96-64h32v32h-32V64zM64 64h32v32H64V64zm32 384H64v-32h32v32zm352 0h-32v-32h32v32zm-32-96h-32c-17.67 0-32 14.33-32 32v32H160v-32c0-17.67-14.33-32-32-32H96V160h32c17.67 0 32-14.33 32-32V96h192v32c0 17.67 14.33 32 32 32h32v192z"]
};
var faVenus = {
prefix: 'fas',
iconName: 'venus',
icon: [288, 512, [], "f221", "M288 176c0-79.5-64.5-144-144-144S0 96.5 0 176c0 68.5 47.9 125.9 112 140.4V368H76c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v36c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-36h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-51.6c64.1-14.5 112-71.9 112-140.4zm-224 0c0-44.1 35.9-80 80-80s80 35.9 80 80-35.9 80-80 80-80-35.9-80-80z"]
};
var faVenusDouble = {
prefix: 'fas',
iconName: 'venus-double',
icon: [512, 512, [], "f226", "M288 176c0-79.5-64.5-144-144-144S0 96.5 0 176c0 68.5 47.9 125.9 112 140.4V368H76c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v36c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-36h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-51.6c64.1-14.5 112-71.9 112-140.4zm-224 0c0-44.1 35.9-80 80-80s80 35.9 80 80-35.9 80-80 80-80-35.9-80-80zm336 140.4V368h36c6.6 0 12 5.4 12 12v40c0 6.6-5.4 12-12 12h-36v36c0 6.6-5.4 12-12 12h-40c-6.6 0-12-5.4-12-12v-36h-36c-6.6 0-12-5.4-12-12v-40c0-6.6 5.4-12 12-12h36v-51.6c-21.2-4.8-40.6-14.3-57.2-27.3 14-16.7 25-36 32.1-57.1 14.5 14.8 34.7 24 57.1 24 44.1 0 80-35.9 80-80s-35.9-80-80-80c-22.3 0-42.6 9.2-57.1 24-7.1-21.1-18-40.4-32.1-57.1C303.4 43.6 334.3 32 368 32c79.5 0 144 64.5 144 144 0 68.5-47.9 125.9-112 140.4z"]
};
var faVenusMars = {
prefix: 'fas',
iconName: 'venus-mars',
icon: [576, 512, [], "f228", "M564 0h-79c-10.7 0-16 12.9-8.5 20.5l16.9 16.9-48.7 48.7C422.5 72.1 396.2 64 368 64c-33.7 0-64.6 11.6-89.2 30.9 14 16.7 25 36 32.1 57.1 14.5-14.8 34.7-24 57.1-24 44.1 0 80 35.9 80 80s-35.9 80-80 80c-22.3 0-42.6-9.2-57.1-24-7.1 21.1-18 40.4-32.1 57.1 24.5 19.4 55.5 30.9 89.2 30.9 79.5 0 144-64.5 144-144 0-28.2-8.1-54.5-22.1-76.7l48.7-48.7 16.9 16.9c2.4 2.4 5.4 3.5 8.4 3.5 6.2 0 12.1-4.8 12.1-12V12c0-6.6-5.4-12-12-12zM144 64C64.5 64 0 128.5 0 208c0 68.5 47.9 125.9 112 140.4V400H76c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h36v36c0 6.6 5.4 12 12 12h40c6.6 0 12-5.4 12-12v-36h36c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-36v-51.6c64.1-14.6 112-71.9 112-140.4 0-79.5-64.5-144-144-144zm0 224c-44.1 0-80-35.9-80-80s35.9-80 80-80 80 35.9 80 80-35.9 80-80 80z"]
};
var faVial = {
prefix: 'fas',
iconName: 'vial',
icon: [480, 512, [], "f492", "M477.7 186.1L309.5 18.3c-3.1-3.1-8.2-3.1-11.3 0l-34 33.9c-3.1 3.1-3.1 8.2 0 11.3l11.2 11.1L33 316.5c-38.8 38.7-45.1 102-9.4 143.5 20.6 24 49.5 36 78.4 35.9 26.4 0 52.8-10 72.9-30.1l246.3-245.7 11.2 11.1c3.1 3.1 8.2 3.1 11.3 0l34-33.9c3.1-3 3.1-8.1 0-11.2zM318 256H161l148-147.7 78.5 78.3L318 256z"]
};
var faVials = {
prefix: 'fas',
iconName: 'vials',
icon: [640, 512, [], "f493", "M72 64h24v240c0 44.1 35.9 80 80 80s80-35.9 80-80V64h24c4.4 0 8-3.6 8-8V8c0-4.4-3.6-8-8-8H72c-4.4 0-8 3.6-8 8v48c0 4.4 3.6 8 8 8zm72 0h64v96h-64V64zm480 384H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h608c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM360 64h24v240c0 44.1 35.9 80 80 80s80-35.9 80-80V64h24c4.4 0 8-3.6 8-8V8c0-4.4-3.6-8-8-8H360c-4.4 0-8 3.6-8 8v48c0 4.4 3.6 8 8 8zm72 0h64v96h-64V64z"]
};
var faVideo = {
prefix: 'fas',
iconName: 'video',
icon: [576, 512, [], "f03d", "M336.2 64H47.8C21.4 64 0 85.4 0 111.8v288.4C0 426.6 21.4 448 47.8 448h288.4c26.4 0 47.8-21.4 47.8-47.8V111.8c0-26.4-21.4-47.8-47.8-47.8zm189.4 37.7L416 177.3v157.4l109.6 75.5c21.2 14.6 50.4-.3 50.4-25.8V127.5c0-25.4-29.1-40.4-50.4-25.8z"]
};
var faVideoSlash = {
prefix: 'fas',
iconName: 'video-slash',
icon: [640, 512, [], "f4e2", "M633.8 458.1l-55-42.5c15.4-1.4 29.2-13.7 29.2-31.1v-257c0-25.5-29.1-40.4-50.4-25.8L448 177.3v137.2l-32-24.7v-178c0-26.4-21.4-47.8-47.8-47.8H123.9L45.5 3.4C38.5-2 28.5-.8 23 6.2L3.4 31.4c-5.4 7-4.2 17 2.8 22.4L42.7 82 416 370.6l178.5 138c7 5.4 17 4.2 22.5-2.8l19.6-25.3c5.5-6.9 4.2-17-2.8-22.4zM32 400.2c0 26.4 21.4 47.8 47.8 47.8h288.4c11.2 0 21.4-4 29.6-10.5L32 154.7v245.5z"]
};
var faVihara = {
prefix: 'fas',
iconName: 'vihara',
icon: [640, 512, [], "f6a7", "M632.88 400.71L544 352v-64l55.16-17.69c11.79-5.9 11.79-22.72 0-28.62L480 192v-64l27.31-16.3c7.72-7.72 5.61-20.74-4.16-25.62L320 0 136.85 86.07c-9.77 4.88-11.88 17.9-4.16 25.62L160 128v64L40.84 241.69c-11.79 5.9-11.79 22.72 0 28.62L96 288v64L7.12 400.71c-5.42 3.62-7.7 9.63-7 15.29.62 5.01 3.57 9.75 8.72 12.33L64 448v48c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-48h160v48c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-48h160v48c0 8.84 7.16 16 16 16h32c8.84 0 16-7.16 16-16v-48l55.15-19.67c5.16-2.58 8.1-7.32 8.72-12.33.71-5.67-1.57-11.68-6.99-15.29zM224 128h192v64H224v-64zm-64 224v-64h320v64H160z"]
};
var faVirus = {
prefix: 'fas',
iconName: 'virus',
icon: [512, 512, [], "e074", "M483.55,227.55H462c-50.68,0-76.07-61.27-40.23-97.11L437,115.19A28.44,28.44,0,0,0,396.8,75L381.56,90.22c-35.84,35.83-97.11,10.45-97.11-40.23V28.44a28.45,28.45,0,0,0-56.9,0V50c0,50.68-61.27,76.06-97.11,40.23L115.2,75A28.44,28.44,0,0,0,75,115.19l15.25,15.25c35.84,35.84,10.45,97.11-40.23,97.11H28.45a28.45,28.45,0,1,0,0,56.89H50c50.68,0,76.07,61.28,40.23,97.12L75,396.8A28.45,28.45,0,0,0,115.2,437l15.24-15.25c35.84-35.84,97.11-10.45,97.11,40.23v21.54a28.45,28.45,0,0,0,56.9,0V462c0-50.68,61.27-76.07,97.11-40.23L396.8,437A28.45,28.45,0,0,0,437,396.8l-15.25-15.24c-35.84-35.84-10.45-97.12,40.23-97.12h21.54a28.45,28.45,0,1,0,0-56.89ZM224,272a48,48,0,1,1,48-48A48,48,0,0,1,224,272Zm80,56a24,24,0,1,1,24-24A24,24,0,0,1,304,328Z"]
};
var faVirusSlash = {
prefix: 'fas',
iconName: 'virus-slash',
icon: [640, 512, [], "e075", "M114,227.6H92.4C76.7,227.6,64,240.3,64,256s12.7,28.4,28.4,28.4H114c50.7,0,76.1,61.3,40.2,97.1L139,396.8 c-11.5,10.7-12.2,28.7-1.6,40.2s28.7,12.2,40.2,1.6c0.5-0.5,1.1-1,1.6-1.6l15.2-15.2c35.8-35.8,97.1-10.5,97.1,40.2v21.5 c0,15.7,12.8,28.4,28.5,28.4c15.7,0,28.4-12.7,28.4-28.4V462c0-26.6,17-45.9,38.2-53.4l-244.5-189 C133.7,224.7,123.9,227.5,114,227.6z M617,505.8l19.6-25.3c5.4-7,4.2-17-2.8-22.5L470.6,332c4.2-25.4,24.9-47.5,55.4-47.5h21.5 c15.7,0,28.4-12.7,28.4-28.4s-12.7-28.4-28.4-28.4H526c-50.7,0-76.1-61.3-40.2-97.1l15.2-15.3c10.7-11.5,10-29.5-1.6-40.2 c-10.9-10.1-27.7-10.1-38.6,0l-15.2,15.2c-35.8,35.8-97.1,10.5-97.1-40.2V28.5C348.4,12.7,335.7,0,320,0 c-15.7,0-28.4,12.7-28.4,28.4V50c0,50.7-61.3,76.1-97.1,40.2L179.2,75c-11.1-11.1-29.4-10.6-40.5,0.5L45.5,3.4 c-7-5.4-17-4.2-22.5,2.8L3.4,31.5c-5.4,7-4.2,17,2.8,22.5l588.4,454.7C601.5,514.1,611.6,512.8,617,505.8z M335.4,227.5l-62.9-48.6 c4.9-1.8,10.2-2.8,15.4-2.9c26.5,0,48,21.5,48,48C336,225.2,335.5,226.3,335.4,227.5z"]
};
var faViruses = {
prefix: 'fas',
iconName: 'viruses',
icon: [640, 512, [], "e076", "M624,352H611.88c-28.51,0-42.79-34.47-22.63-54.63l8.58-8.57a16,16,0,1,0-22.63-22.63l-8.57,8.58C546.47,294.91,512,280.63,512,252.12V240a16,16,0,0,0-32,0v12.12c0,28.51-34.47,42.79-54.63,22.63l-8.57-8.58a16,16,0,0,0-22.63,22.63l8.58,8.57c20.16,20.16,5.88,54.63-22.63,54.63H368a16,16,0,0,0,0,32h12.12c28.51,0,42.79,34.47,22.63,54.63l-8.58,8.57a16,16,0,1,0,22.63,22.63l8.57-8.58c20.16-20.16,54.63-5.88,54.63,22.63V496a16,16,0,0,0,32,0V483.88c0-28.51,34.47-42.79,54.63-22.63l8.57,8.58a16,16,0,1,0,22.63-22.63l-8.58-8.57C569.09,418.47,583.37,384,611.88,384H624a16,16,0,0,0,0-32ZM480,384a32,32,0,1,1,32-32A32,32,0,0,1,480,384ZM346.51,213.33h16.16a21.33,21.33,0,0,0,0-42.66H346.51c-38,0-57.05-46-30.17-72.84l11.43-11.44A21.33,21.33,0,0,0,297.6,56.23L286.17,67.66c-26.88,26.88-72.84,7.85-72.84-30.17V21.33a21.33,21.33,0,0,0-42.66,0V37.49c0,38-46,57.05-72.84,30.17L86.4,56.23A21.33,21.33,0,0,0,56.23,86.39L67.66,97.83c26.88,26.88,7.85,72.84-30.17,72.84H21.33a21.33,21.33,0,0,0,0,42.66H37.49c38,0,57.05,46,30.17,72.84L56.23,297.6A21.33,21.33,0,1,0,86.4,327.77l11.43-11.43c26.88-26.88,72.84-7.85,72.84,30.17v16.16a21.33,21.33,0,0,0,42.66,0V346.51c0-38,46-57.05,72.84-30.17l11.43,11.43a21.33,21.33,0,0,0,30.17-30.17l-11.43-11.43C289.46,259.29,308.49,213.33,346.51,213.33ZM160,192a32,32,0,1,1,32-32A32,32,0,0,1,160,192Zm80,32a16,16,0,1,1,16-16A16,16,0,0,1,240,224Z"]
};
var faVoicemail = {
prefix: 'fas',
iconName: 'voicemail',
icon: [640, 512, [], "f897", "M496 128a144 144 0 0 0-119.74 224H263.74A144 144 0 1 0 144 416h352a144 144 0 0 0 0-288zM64 272a80 80 0 1 1 80 80 80 80 0 0 1-80-80zm432 80a80 80 0 1 1 80-80 80 80 0 0 1-80 80z"]
};
var faVolleyballBall = {
prefix: 'fas',
iconName: 'volleyball-ball',
icon: [512, 512, [], "f45f", "M231.39 243.48a285.56 285.56 0 0 0-22.7-105.7c-90.8 42.4-157.5 122.4-180.3 216.8a249 249 0 0 0 56.9 81.1 333.87 333.87 0 0 1 146.1-192.2zm-36.9-134.4a284.23 284.23 0 0 0-57.4-70.7c-91 49.8-144.8 152.9-125 262.2 33.4-83.1 98.4-152 182.4-191.5zm187.6 165.1c8.6-99.8-27.3-197.5-97.5-264.4-14.7-1.7-51.6-5.5-98.9 8.5A333.87 333.87 0 0 1 279.19 241a285 285 0 0 0 102.9 33.18zm-124.7 9.5a286.33 286.33 0 0 0-80.2 72.6c82 57.3 184.5 75.1 277.5 47.8a247.15 247.15 0 0 0 42.2-89.9 336.1 336.1 0 0 1-80.9 10.4c-54.6-.1-108.9-14.1-158.6-40.9zm-98.3 99.7c-15.2 26-25.7 54.4-32.1 84.2a247.07 247.07 0 0 0 289-22.1c-112.9 16.1-203.3-24.8-256.9-62.1zm180.3-360.6c55.3 70.4 82.5 161.2 74.6 253.6a286.59 286.59 0 0 0 89.7-14.2c0-2 .3-4 .3-6 0-107.8-68.7-199.1-164.6-233.4z"]
};
var faVolumeDown = {
prefix: 'fas',
iconName: 'volume-down',
icon: [384, 512, [], "f027", "M215.03 72.04L126.06 161H24c-13.26 0-24 10.74-24 24v144c0 13.25 10.74 24 24 24h102.06l88.97 88.95c15.03 15.03 40.97 4.47 40.97-16.97V89.02c0-21.47-25.96-31.98-40.97-16.98zm123.2 108.08c-11.58-6.33-26.19-2.16-32.61 9.45-6.39 11.61-2.16 26.2 9.45 32.61C327.98 229.28 336 242.62 336 257c0 14.38-8.02 27.72-20.92 34.81-11.61 6.41-15.84 21-9.45 32.61 6.43 11.66 21.05 15.8 32.61 9.45 28.23-15.55 45.77-45 45.77-76.88s-17.54-61.32-45.78-76.87z"]
};
var faVolumeMute = {
prefix: 'fas',
iconName: 'volume-mute',
icon: [512, 512, [], "f6a9", "M215.03 71.05L126.06 160H24c-13.26 0-24 10.74-24 24v144c0 13.25 10.74 24 24 24h102.06l88.97 88.95c15.03 15.03 40.97 4.47 40.97-16.97V88.02c0-21.46-25.96-31.98-40.97-16.97zM461.64 256l45.64-45.64c6.3-6.3 6.3-16.52 0-22.82l-22.82-22.82c-6.3-6.3-16.52-6.3-22.82 0L416 210.36l-45.64-45.64c-6.3-6.3-16.52-6.3-22.82 0l-22.82 22.82c-6.3 6.3-6.3 16.52 0 22.82L370.36 256l-45.63 45.63c-6.3 6.3-6.3 16.52 0 22.82l22.82 22.82c6.3 6.3 16.52 6.3 22.82 0L416 301.64l45.64 45.64c6.3 6.3 16.52 6.3 22.82 0l22.82-22.82c6.3-6.3 6.3-16.52 0-22.82L461.64 256z"]
};
var faVolumeOff = {
prefix: 'fas',
iconName: 'volume-off',
icon: [256, 512, [], "f026", "M215 71l-89 89H24a24 24 0 0 0-24 24v144a24 24 0 0 0 24 24h102.06L215 441c15 15 41 4.47 41-17V88c0-21.47-26-32-41-17z"]
};
var faVolumeUp = {
prefix: 'fas',
iconName: 'volume-up',
icon: [576, 512, [], "f028", "M215.03 71.05L126.06 160H24c-13.26 0-24 10.74-24 24v144c0 13.25 10.74 24 24 24h102.06l88.97 88.95c15.03 15.03 40.97 4.47 40.97-16.97V88.02c0-21.46-25.96-31.98-40.97-16.97zm233.32-51.08c-11.17-7.33-26.18-4.24-33.51 6.95-7.34 11.17-4.22 26.18 6.95 33.51 66.27 43.49 105.82 116.6 105.82 195.58 0 78.98-39.55 152.09-105.82 195.58-11.17 7.32-14.29 22.34-6.95 33.5 7.04 10.71 21.93 14.56 33.51 6.95C528.27 439.58 576 351.33 576 256S528.27 72.43 448.35 19.97zM480 256c0-63.53-32.06-121.94-85.77-156.24-11.19-7.14-26.03-3.82-33.12 7.46s-3.78 26.21 7.41 33.36C408.27 165.97 432 209.11 432 256s-23.73 90.03-63.48 115.42c-11.19 7.14-14.5 22.07-7.41 33.36 6.51 10.36 21.12 15.14 33.12 7.46C447.94 377.94 480 319.54 480 256zm-141.77-76.87c-11.58-6.33-26.19-2.16-32.61 9.45-6.39 11.61-2.16 26.2 9.45 32.61C327.98 228.28 336 241.63 336 256c0 14.38-8.02 27.72-20.92 34.81-11.61 6.41-15.84 21-9.45 32.61 6.43 11.66 21.05 15.8 32.61 9.45 28.23-15.55 45.77-45 45.77-76.88s-17.54-61.32-45.78-76.86z"]
};
var faVoteYea = {
prefix: 'fas',
iconName: 'vote-yea',
icon: [640, 512, [], "f772", "M608 320h-64v64h22.4c5.3 0 9.6 3.6 9.6 8v16c0 4.4-4.3 8-9.6 8H73.6c-5.3 0-9.6-3.6-9.6-8v-16c0-4.4 4.3-8 9.6-8H96v-64H32c-17.7 0-32 14.3-32 32v96c0 17.7 14.3 32 32 32h576c17.7 0 32-14.3 32-32v-96c0-17.7-14.3-32-32-32zm-96 64V64.3c0-17.9-14.5-32.3-32.3-32.3H160.4C142.5 32 128 46.5 128 64.3V384h384zM211.2 202l25.5-25.3c4.2-4.2 11-4.2 15.2.1l41.3 41.6 95.2-94.4c4.2-4.2 11-4.2 15.2.1l25.3 25.5c4.2 4.2 4.2 11-.1 15.2L300.5 292c-4.2 4.2-11 4.2-15.2-.1l-74.1-74.7c-4.3-4.2-4.2-11 0-15.2z"]
};
var faVrCardboard = {
prefix: 'fas',
iconName: 'vr-cardboard',
icon: [640, 512, [], "f729", "M608 64H32C14.33 64 0 78.33 0 96v320c0 17.67 14.33 32 32 32h160.22c25.19 0 48.03-14.77 58.36-37.74l27.74-61.64C286.21 331.08 302.35 320 320 320s33.79 11.08 41.68 28.62l27.74 61.64C399.75 433.23 422.6 448 447.78 448H608c17.67 0 32-14.33 32-32V96c0-17.67-14.33-32-32-32zM160 304c-35.35 0-64-28.65-64-64s28.65-64 64-64 64 28.65 64 64-28.65 64-64 64zm320 0c-35.35 0-64-28.65-64-64s28.65-64 64-64 64 28.65 64 64-28.65 64-64 64z"]
};
var faWalking = {
prefix: 'fas',
iconName: 'walking',
icon: [320, 512, [], "f554", "M208 96c26.5 0 48-21.5 48-48S234.5 0 208 0s-48 21.5-48 48 21.5 48 48 48zm94.5 149.1l-23.3-11.8-9.7-29.4c-14.7-44.6-55.7-75.8-102.2-75.9-36-.1-55.9 10.1-93.3 25.2-21.6 8.7-39.3 25.2-49.7 46.2L17.6 213c-7.8 15.8-1.5 35 14.2 42.9 15.6 7.9 34.6 1.5 42.5-14.3L81 228c3.5-7 9.3-12.5 16.5-15.4l26.8-10.8-15.2 60.7c-5.2 20.8.4 42.9 14.9 58.8l59.9 65.4c7.2 7.9 12.3 17.4 14.9 27.7l18.3 73.3c4.3 17.1 21.7 27.6 38.8 23.3 17.1-4.3 27.6-21.7 23.3-38.8l-22.2-89c-2.6-10.3-7.7-19.9-14.9-27.7l-45.5-49.7 17.2-68.7 5.5 16.5c5.3 16.1 16.7 29.4 31.7 37l23.3 11.8c15.6 7.9 34.6 1.5 42.5-14.3 7.7-15.7 1.4-35.1-14.3-43zM73.6 385.8c-3.2 8.1-8 15.4-14.2 21.5l-50 50.1c-12.5 12.5-12.5 32.8 0 45.3s32.7 12.5 45.2 0l59.4-59.4c6.1-6.1 10.9-13.4 14.2-21.5l13.5-33.8c-55.3-60.3-38.7-41.8-47.4-53.7l-20.7 51.5z"]
};
var faWallet = {
prefix: 'fas',
iconName: 'wallet',
icon: [512, 512, [], "f555", "M461.2 128H80c-8.84 0-16-7.16-16-16s7.16-16 16-16h384c8.84 0 16-7.16 16-16 0-26.51-21.49-48-48-48H64C28.65 32 0 60.65 0 96v320c0 35.35 28.65 64 64 64h397.2c28.02 0 50.8-21.53 50.8-48V176c0-26.47-22.78-48-50.8-48zM416 336c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32z"]
};
var faWarehouse = {
prefix: 'fas',
iconName: 'warehouse',
icon: [640, 512, [], "f494", "M504 352H136.4c-4.4 0-8 3.6-8 8l-.1 48c0 4.4 3.6 8 8 8H504c4.4 0 8-3.6 8-8v-48c0-4.4-3.6-8-8-8zm0 96H136.1c-4.4 0-8 3.6-8 8l-.1 48c0 4.4 3.6 8 8 8h368c4.4 0 8-3.6 8-8v-48c0-4.4-3.6-8-8-8zm0-192H136.6c-4.4 0-8 3.6-8 8l-.1 48c0 4.4 3.6 8 8 8H504c4.4 0 8-3.6 8-8v-48c0-4.4-3.6-8-8-8zm106.5-139L338.4 3.7a48.15 48.15 0 0 0-36.9 0L29.5 117C11.7 124.5 0 141.9 0 161.3V504c0 4.4 3.6 8 8 8h80c4.4 0 8-3.6 8-8V256c0-17.6 14.6-32 32.6-32h382.8c18 0 32.6 14.4 32.6 32v248c0 4.4 3.6 8 8 8h80c4.4 0 8-3.6 8-8V161.3c0-19.4-11.7-36.8-29.5-44.3z"]
};
var faWater = {
prefix: 'fas',
iconName: 'water',
icon: [576, 512, [], "f773", "M562.1 383.9c-21.5-2.4-42.1-10.5-57.9-22.9-14.1-11.1-34.2-11.3-48.2 0-37.9 30.4-107.2 30.4-145.7-1.5-13.5-11.2-33-9.1-46.7 1.8-38 30.1-106.9 30-145.2-1.7-13.5-11.2-33.3-8.9-47.1 2-15.5 12.2-36 20.1-57.7 22.4-7.9.8-13.6 7.8-13.6 15.7v32.2c0 9.1 7.6 16.8 16.7 16 28.8-2.5 56.1-11.4 79.4-25.9 56.5 34.6 137 34.1 192 0 56.5 34.6 137 34.1 192 0 23.3 14.2 50.9 23.3 79.1 25.8 9.1.8 16.7-6.9 16.7-16v-31.6c.1-8-5.7-15.4-13.8-16.3zm0-144c-21.5-2.4-42.1-10.5-57.9-22.9-14.1-11.1-34.2-11.3-48.2 0-37.9 30.4-107.2 30.4-145.7-1.5-13.5-11.2-33-9.1-46.7 1.8-38 30.1-106.9 30-145.2-1.7-13.5-11.2-33.3-8.9-47.1 2-15.5 12.2-36 20.1-57.7 22.4-7.9.8-13.6 7.8-13.6 15.7v32.2c0 9.1 7.6 16.8 16.7 16 28.8-2.5 56.1-11.4 79.4-25.9 56.5 34.6 137 34.1 192 0 56.5 34.6 137 34.1 192 0 23.3 14.2 50.9 23.3 79.1 25.8 9.1.8 16.7-6.9 16.7-16v-31.6c.1-8-5.7-15.4-13.8-16.3zm0-144C540.6 93.4 520 85.4 504.2 73 490.1 61.9 470 61.7 456 73c-37.9 30.4-107.2 30.4-145.7-1.5-13.5-11.2-33-9.1-46.7 1.8-38 30.1-106.9 30-145.2-1.7-13.5-11.2-33.3-8.9-47.1 2-15.5 12.2-36 20.1-57.7 22.4-7.9.8-13.6 7.8-13.6 15.7v32.2c0 9.1 7.6 16.8 16.7 16 28.8-2.5 56.1-11.4 79.4-25.9 56.5 34.6 137 34.1 192 0 56.5 34.6 137 34.1 192 0 23.3 14.2 50.9 23.3 79.1 25.8 9.1.8 16.7-6.9 16.7-16v-31.6c.1-8-5.7-15.4-13.8-16.3z"]
};
var faWaveSquare = {
prefix: 'fas',
iconName: 'wave-square',
icon: [640, 512, [], "f83e", "M476 480H324a36 36 0 0 1-36-36V96h-96v156a36 36 0 0 1-36 36H16a16 16 0 0 1-16-16v-32a16 16 0 0 1 16-16h112V68a36 36 0 0 1 36-36h152a36 36 0 0 1 36 36v348h96V260a36 36 0 0 1 36-36h140a16 16 0 0 1 16 16v32a16 16 0 0 1-16 16H512v156a36 36 0 0 1-36 36z"]
};
var faWeight = {
prefix: 'fas',
iconName: 'weight',
icon: [512, 512, [], "f496", "M448 64h-25.98C438.44 92.28 448 125.01 448 160c0 105.87-86.13 192-192 192S64 265.87 64 160c0-34.99 9.56-67.72 25.98-96H64C28.71 64 0 92.71 0 128v320c0 35.29 28.71 64 64 64h384c35.29 0 64-28.71 64-64V128c0-35.29-28.71-64-64-64zM256 320c88.37 0 160-71.63 160-160S344.37 0 256 0 96 71.63 96 160s71.63 160 160 160zm-.3-151.94l33.58-78.36c3.5-8.17 12.94-11.92 21.03-8.41 8.12 3.48 11.88 12.89 8.41 21l-33.67 78.55C291.73 188 296 197.45 296 208c0 22.09-17.91 40-40 40s-40-17.91-40-40c0-21.98 17.76-39.77 39.7-39.94z"]
};
var faWeightHanging = {
prefix: 'fas',
iconName: 'weight-hanging',
icon: [512, 512, [], "f5cd", "M510.28 445.86l-73.03-292.13c-3.8-15.19-16.44-25.72-30.87-25.72h-60.25c3.57-10.05 5.88-20.72 5.88-32 0-53.02-42.98-96-96-96s-96 42.98-96 96c0 11.28 2.3 21.95 5.88 32h-60.25c-14.43 0-27.08 10.54-30.87 25.72L1.72 445.86C-6.61 479.17 16.38 512 48.03 512h415.95c31.64 0 54.63-32.83 46.3-66.14zM256 128c-17.64 0-32-14.36-32-32s14.36-32 32-32 32 14.36 32 32-14.36 32-32 32z"]
};
var faWheelchair = {
prefix: 'fas',
iconName: 'wheelchair',
icon: [512, 512, [], "f193", "M496.101 385.669l14.227 28.663c3.929 7.915.697 17.516-7.218 21.445l-65.465 32.886c-16.049 7.967-35.556 1.194-43.189-15.055L331.679 320H192c-15.925 0-29.426-11.71-31.679-27.475C126.433 55.308 128.38 70.044 128 64c0-36.358 30.318-65.635 67.052-63.929 33.271 1.545 60.048 28.905 60.925 62.201.868 32.933-23.152 60.423-54.608 65.039l4.67 32.69H336c8.837 0 16 7.163 16 16v32c0 8.837-7.163 16-16 16H215.182l4.572 32H352a32 32 0 0 1 28.962 18.392L438.477 396.8l36.178-18.349c7.915-3.929 17.517-.697 21.446 7.218zM311.358 352h-24.506c-7.788 54.204-54.528 96-110.852 96-61.757 0-112-50.243-112-112 0-41.505 22.694-77.809 56.324-97.156-3.712-25.965-6.844-47.86-9.488-66.333C45.956 198.464 0 261.963 0 336c0 97.047 78.953 176 176 176 71.87 0 133.806-43.308 161.11-105.192L311.358 352z"]
};
var faWifi = {
prefix: 'fas',
iconName: 'wifi',
icon: [640, 512, [], "f1eb", "M634.91 154.88C457.74-8.99 182.19-8.93 5.09 154.88c-6.66 6.16-6.79 16.59-.35 22.98l34.24 33.97c6.14 6.1 16.02 6.23 22.4.38 145.92-133.68 371.3-133.71 517.25 0 6.38 5.85 16.26 5.71 22.4-.38l34.24-33.97c6.43-6.39 6.3-16.82-.36-22.98zM320 352c-35.35 0-64 28.65-64 64s28.65 64 64 64 64-28.65 64-64-28.65-64-64-64zm202.67-83.59c-115.26-101.93-290.21-101.82-405.34 0-6.9 6.1-7.12 16.69-.57 23.15l34.44 33.99c6 5.92 15.66 6.32 22.05.8 83.95-72.57 209.74-72.41 293.49 0 6.39 5.52 16.05 5.13 22.05-.8l34.44-33.99c6.56-6.46 6.33-17.06-.56-23.15z"]
};
var faWind = {
prefix: 'fas',
iconName: 'wind',
icon: [512, 512, [], "f72e", "M156.7 256H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h142.2c15.9 0 30.8 10.9 33.4 26.6 3.3 20-12.1 37.4-31.6 37.4-14.1 0-26.1-9.2-30.4-21.9-2.1-6.3-8.6-10.1-15.2-10.1H81.6c-9.8 0-17.7 8.8-15.9 18.4 8.6 44.1 47.6 77.6 94.2 77.6 57.1 0 102.7-50.1 95.2-108.6C249 291 205.4 256 156.7 256zM16 224h336c59.7 0 106.8-54.8 93.8-116.7-7.6-36.2-36.9-65.5-73.1-73.1-55.4-11.6-105.1 24.9-114.9 75.5-1.9 9.6 6.1 18.3 15.8 18.3h32.8c6.7 0 13.1-3.8 15.2-10.1C325.9 105.2 337.9 96 352 96c19.4 0 34.9 17.4 31.6 37.4-2.6 15.7-17.4 26.6-33.4 26.6H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16zm384 32H243.7c19.3 16.6 33.2 38.8 39.8 64H400c26.5 0 48 21.5 48 48s-21.5 48-48 48c-17.9 0-33.3-9.9-41.6-24.4-2.9-5-8.7-7.6-14.5-7.6h-33.8c-10.9 0-19 10.8-15.3 21.1 17.8 50.6 70.5 84.8 129.4 72.3 41.2-8.7 75.1-41.6 84.7-82.7C526 321.5 470.5 256 400 256z"]
};
var faWindowClose = {
prefix: 'fas',
iconName: 'window-close',
icon: [512, 512, [], "f410", "M464 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm-83.6 290.5c4.8 4.8 4.8 12.6 0 17.4l-40.5 40.5c-4.8 4.8-12.6 4.8-17.4 0L256 313.3l-66.5 67.1c-4.8 4.8-12.6 4.8-17.4 0l-40.5-40.5c-4.8-4.8-4.8-12.6 0-17.4l67.1-66.5-67.1-66.5c-4.8-4.8-4.8-12.6 0-17.4l40.5-40.5c4.8-4.8 12.6-4.8 17.4 0l66.5 67.1 66.5-67.1c4.8-4.8 12.6-4.8 17.4 0l40.5 40.5c4.8 4.8 4.8 12.6 0 17.4L313.3 256l67.1 66.5z"]
};
var faWindowMaximize = {
prefix: 'fas',
iconName: 'window-maximize',
icon: [512, 512, [], "f2d0", "M464 32H48C21.5 32 0 53.5 0 80v352c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48V80c0-26.5-21.5-48-48-48zm-16 160H64v-84c0-6.6 5.4-12 12-12h360c6.6 0 12 5.4 12 12v84z"]
};
var faWindowMinimize = {
prefix: 'fas',
iconName: 'window-minimize',
icon: [512, 512, [], "f2d1", "M464 352H48c-26.5 0-48 21.5-48 48v32c0 26.5 21.5 48 48 48h416c26.5 0 48-21.5 48-48v-32c0-26.5-21.5-48-48-48z"]
};
var faWindowRestore = {
prefix: 'fas',
iconName: 'window-restore',
icon: [512, 512, [], "f2d2", "M512 48v288c0 26.5-21.5 48-48 48h-48V176c0-44.1-35.9-80-80-80H128V48c0-26.5 21.5-48 48-48h288c26.5 0 48 21.5 48 48zM384 176v288c0 26.5-21.5 48-48 48H48c-26.5 0-48-21.5-48-48V176c0-26.5 21.5-48 48-48h288c26.5 0 48 21.5 48 48zm-68 28c0-6.6-5.4-12-12-12H76c-6.6 0-12 5.4-12 12v52h252v-52z"]
};
var faWineBottle = {
prefix: 'fas',
iconName: 'wine-bottle',
icon: [512, 512, [], "f72f", "M507.31 72.57L439.43 4.69c-6.25-6.25-16.38-6.25-22.63 0l-22.63 22.63c-6.25 6.25-6.25 16.38 0 22.63l-76.67 76.67c-46.58-19.7-102.4-10.73-140.37 27.23L18.75 312.23c-24.99 24.99-24.99 65.52 0 90.51l90.51 90.51c24.99 24.99 65.52 24.99 90.51 0l158.39-158.39c37.96-37.96 46.93-93.79 27.23-140.37l76.67-76.67c6.25 6.25 16.38 6.25 22.63 0l22.63-22.63c6.24-6.24 6.24-16.37-.01-22.62zM179.22 423.29l-90.51-90.51 122.04-122.04 90.51 90.51-122.04 122.04z"]
};
var faWineGlass = {
prefix: 'fas',
iconName: 'wine-glass',
icon: [288, 512, [], "f4e3", "M216 464h-40V346.81c68.47-15.89 118.05-79.91 111.4-154.16l-15.95-178.1C270.71 6.31 263.9 0 255.74 0H32.26c-8.15 0-14.97 6.31-15.7 14.55L.6 192.66C-6.05 266.91 43.53 330.93 112 346.82V464H72c-22.09 0-40 17.91-40 40 0 4.42 3.58 8 8 8h208c4.42 0 8-3.58 8-8 0-22.09-17.91-40-40-40z"]
};
var faWineGlassAlt = {
prefix: 'fas',
iconName: 'wine-glass-alt',
icon: [288, 512, [], "f5ce", "M216 464h-40V346.81c68.47-15.89 118.05-79.91 111.4-154.16l-15.95-178.1C270.71 6.31 263.9 0 255.74 0H32.26c-8.15 0-14.97 6.31-15.7 14.55L.6 192.66C-6.05 266.91 43.53 330.93 112 346.82V464H72c-22.09 0-40 17.91-40 40 0 4.42 3.58 8 8 8h208c4.42 0 8-3.58 8-8 0-22.09-17.91-40-40-40zM61.75 48h164.5l7.17 80H54.58l7.17-80z"]
};
var faWonSign = {
prefix: 'fas',
iconName: 'won-sign',
icon: [576, 512, [], "f159", "M564 192c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-48l18.6-80.6c1.7-7.5-4-14.7-11.7-14.7h-46.1c-5.7 0-10.6 4-11.7 9.5L450.7 128H340.8l-19.7-86c-1.3-5.5-6.1-9.3-11.7-9.3h-44c-5.6 0-10.4 3.8-11.7 9.3l-20 86H125l-17.5-85.7c-1.1-5.6-6.1-9.6-11.8-9.6H53.6c-7.7 0-13.4 7.1-11.7 14.6L60 128H12c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h62.3l7.2 32H12c-6.6 0-12 5.4-12 12v40c0 6.6 5.4 12 12 12h83.9l40.9 182.6c1.2 5.5 6.1 9.4 11.7 9.4h56.8c5.6 0 10.4-3.9 11.7-9.3L259.3 288h55.1l42.4 182.7c1.3 5.4 6.1 9.3 11.7 9.3h56.8c5.6 0 10.4-3.9 11.7-9.3L479.1 288H564c6.6 0 12-5.4 12-12v-40c0-6.6-5.4-12-12-12h-70.1l7.4-32zM183.8 342c-6.2 25.8-6.8 47.2-7.3 47.2h-1.1s-1.7-22-6.8-47.2l-11-54h38.8zm27.5-118h-66.8l-6.5-32h80.8zm62.9 0l2-8.6c1.9-8 3.5-16 4.8-23.4h11.8c1.3 7.4 2.9 15.4 4.8 23.4l2 8.6zm130.9 118c-5.1 25.2-6.8 47.2-6.8 47.2h-1.1c-.6 0-1.1-21.4-7.3-47.2l-12.4-54h39.1zm25.2-118h-67.4l-7.3-32h81.6z"]
};
var faWrench = {
prefix: 'fas',
iconName: 'wrench',
icon: [512, 512, [], "f0ad", "M507.73 109.1c-2.24-9.03-13.54-12.09-20.12-5.51l-74.36 74.36-67.88-11.31-11.31-67.88 74.36-74.36c6.62-6.62 3.43-17.9-5.66-20.16-47.38-11.74-99.55.91-136.58 37.93-39.64 39.64-50.55 97.1-34.05 147.2L18.74 402.76c-24.99 24.99-24.99 65.51 0 90.5 24.99 24.99 65.51 24.99 90.5 0l213.21-213.21c50.12 16.71 107.47 5.68 147.37-34.22 37.07-37.07 49.7-89.32 37.91-136.73zM64 472c-13.25 0-24-10.75-24-24 0-13.26 10.75-24 24-24s24 10.74 24 24c0 13.25-10.75 24-24 24z"]
};
var faXRay = {
prefix: 'fas',
iconName: 'x-ray',
icon: [640, 512, [], "f497", "M240 384c-8.8 0-16 7.2-16 16s7.2 16 16 16 16-7.2 16-16-7.2-16-16-16zm160 32c8.8 0 16-7.2 16-16s-7.2-16-16-16-16 7.2-16 16 7.2 16 16 16zM624 0H16C7.2 0 0 7.2 0 16v32c0 8.8 7.2 16 16 16h608c8.8 0 16-7.2 16-16V16c0-8.8-7.2-16-16-16zm0 448h-48V96H64v352H16c-8.8 0-16 7.2-16 16v32c0 8.8 7.2 16 16 16h608c8.8 0 16-7.2 16-16v-32c0-8.8-7.2-16-16-16zM480 248c0 4.4-3.6 8-8 8H336v32h104c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H336v32h64c26.5 0 48 21.5 48 48s-21.5 48-48 48-48-21.5-48-48v-16h-64v16c0 26.5-21.5 48-48 48s-48-21.5-48-48 21.5-48 48-48h64v-32H200c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h104v-32H168c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h136v-32H200c-4.4 0-8-3.6-8-8v-16c0-4.4 3.6-8 8-8h104v-24c0-4.4 3.6-8 8-8h16c4.4 0 8 3.6 8 8v24h104c4.4 0 8 3.6 8 8v16c0 4.4-3.6 8-8 8H336v32h136c4.4 0 8 3.6 8 8v16z"]
};
var faYenSign = {
prefix: 'fas',
iconName: 'yen-sign',
icon: [384, 512, [], "f157", "M351.2 32h-65.3c-4.6 0-8.8 2.6-10.8 6.7l-55.4 113.2c-14.5 34.7-27.1 71.9-27.1 71.9h-1.3s-12.6-37.2-27.1-71.9L108.8 38.7c-2-4.1-6.2-6.7-10.8-6.7H32.8c-9.1 0-14.8 9.7-10.6 17.6L102.3 200H44c-6.6 0-12 5.4-12 12v32c0 6.6 5.4 12 12 12h88.2l19.8 37.2V320H44c-6.6 0-12 5.4-12 12v32c0 6.6 5.4 12 12 12h108v92c0 6.6 5.4 12 12 12h56c6.6 0 12-5.4 12-12v-92h108c6.6 0 12-5.4 12-12v-32c0-6.6-5.4-12-12-12H232v-26.8l19.8-37.2H340c6.6 0 12-5.4 12-12v-32c0-6.6-5.4-12-12-12h-58.3l80.1-150.4c4.3-7.9-1.5-17.6-10.6-17.6z"]
};
var faYinYang = {
prefix: 'fas',
iconName: 'yin-yang',
icon: [496, 512, [], "f6ad", "M248 8C111.03 8 0 119.03 0 256s111.03 248 248 248 248-111.03 248-248S384.97 8 248 8zm0 376c-17.67 0-32-14.33-32-32s14.33-32 32-32 32 14.33 32 32-14.33 32-32 32zm0-128c-53.02 0-96 42.98-96 96s42.98 96 96 96c-106.04 0-192-85.96-192-192S141.96 64 248 64c53.02 0 96 42.98 96 96s-42.98 96-96 96zm0-128c-17.67 0-32 14.33-32 32s14.33 32 32 32 32-14.33 32-32-14.33-32-32-32z"]
};
var _iconsCache = {
faAd: faAd,
faAddressBook: faAddressBook,
faAddressCard: faAddressCard,
faAdjust: faAdjust,
faAirFreshener: faAirFreshener,
faAlignCenter: faAlignCenter,
faAlignJustify: faAlignJustify,
faAlignLeft: faAlignLeft,
faAlignRight: faAlignRight,
faAllergies: faAllergies,
faAmbulance: faAmbulance,
faAmericanSignLanguageInterpreting: faAmericanSignLanguageInterpreting,
faAnchor: faAnchor,
faAngleDoubleDown: faAngleDoubleDown,
faAngleDoubleLeft: faAngleDoubleLeft,
faAngleDoubleRight: faAngleDoubleRight,
faAngleDoubleUp: faAngleDoubleUp,
faAngleDown: faAngleDown,
faAngleLeft: faAngleLeft,
faAngleRight: faAngleRight,
faAngleUp: faAngleUp,
faAngry: faAngry,
faAnkh: faAnkh,
faAppleAlt: faAppleAlt,
faArchive: faArchive,
faArchway: faArchway,
faArrowAltCircleDown: faArrowAltCircleDown,
faArrowAltCircleLeft: faArrowAltCircleLeft,
faArrowAltCircleRight: faArrowAltCircleRight,
faArrowAltCircleUp: faArrowAltCircleUp,
faArrowCircleDown: faArrowCircleDown,
faArrowCircleLeft: faArrowCircleLeft,
faArrowCircleRight: faArrowCircleRight,
faArrowCircleUp: faArrowCircleUp,
faArrowDown: faArrowDown,
faArrowLeft: faArrowLeft,
faArrowRight: faArrowRight,
faArrowUp: faArrowUp,
faArrowsAlt: faArrowsAlt,
faArrowsAltH: faArrowsAltH,
faArrowsAltV: faArrowsAltV,
faAssistiveListeningSystems: faAssistiveListeningSystems,
faAsterisk: faAsterisk,
faAt: faAt,
faAtlas: faAtlas,
faAtom: faAtom,
faAudioDescription: faAudioDescription,
faAward: faAward,
faBaby: faBaby,
faBabyCarriage: faBabyCarriage,
faBackspace: faBackspace,
faBackward: faBackward,
faBacon: faBacon,
faBacteria: faBacteria,
faBacterium: faBacterium,
faBahai: faBahai,
faBalanceScale: faBalanceScale,
faBalanceScaleLeft: faBalanceScaleLeft,
faBalanceScaleRight: faBalanceScaleRight,
faBan: faBan,
faBandAid: faBandAid,
faBarcode: faBarcode,
faBars: faBars,
faBaseballBall: faBaseballBall,
faBasketballBall: faBasketballBall,
faBath: faBath,
faBatteryEmpty: faBatteryEmpty,
faBatteryFull: faBatteryFull,
faBatteryHalf: faBatteryHalf,
faBatteryQuarter: faBatteryQuarter,
faBatteryThreeQuarters: faBatteryThreeQuarters,
faBed: faBed,
faBeer: faBeer,
faBell: faBell,
faBellSlash: faBellSlash,
faBezierCurve: faBezierCurve,
faBible: faBible,
faBicycle: faBicycle,
faBiking: faBiking,
faBinoculars: faBinoculars,
faBiohazard: faBiohazard,
faBirthdayCake: faBirthdayCake,
faBlender: faBlender,
faBlenderPhone: faBlenderPhone,
faBlind: faBlind,
faBlog: faBlog,
faBold: faBold,
faBolt: faBolt,
faBomb: faBomb,
faBone: faBone,
faBong: faBong,
faBook: faBook,
faBookDead: faBookDead,
faBookMedical: faBookMedical,
faBookOpen: faBookOpen,
faBookReader: faBookReader,
faBookmark: faBookmark,
faBorderAll: faBorderAll,
faBorderNone: faBorderNone,
faBorderStyle: faBorderStyle,
faBowlingBall: faBowlingBall,
faBox: faBox,
faBoxOpen: faBoxOpen,
faBoxTissue: faBoxTissue,
faBoxes: faBoxes,
faBraille: faBraille,
faBrain: faBrain,
faBreadSlice: faBreadSlice,
faBriefcase: faBriefcase,
faBriefcaseMedical: faBriefcaseMedical,
faBroadcastTower: faBroadcastTower,
faBroom: faBroom,
faBrush: faBrush,
faBug: faBug,
faBuilding: faBuilding,
faBullhorn: faBullhorn,
faBullseye: faBullseye,
faBurn: faBurn,
faBus: faBus,
faBusAlt: faBusAlt,
faBusinessTime: faBusinessTime,
faCalculator: faCalculator,
faCalendar: faCalendar,
faCalendarAlt: faCalendarAlt,
faCalendarCheck: faCalendarCheck,
faCalendarDay: faCalendarDay,
faCalendarMinus: faCalendarMinus,
faCalendarPlus: faCalendarPlus,
faCalendarTimes: faCalendarTimes,
faCalendarWeek: faCalendarWeek,
faCamera: faCamera,
faCameraRetro: faCameraRetro,
faCampground: faCampground,
faCandyCane: faCandyCane,
faCannabis: faCannabis,
faCapsules: faCapsules,
faCar: faCar,
faCarAlt: faCarAlt,
faCarBattery: faCarBattery,
faCarCrash: faCarCrash,
faCarSide: faCarSide,
faCaravan: faCaravan,
faCaretDown: faCaretDown,
faCaretLeft: faCaretLeft,
faCaretRight: faCaretRight,
faCaretSquareDown: faCaretSquareDown,
faCaretSquareLeft: faCaretSquareLeft,
faCaretSquareRight: faCaretSquareRight,
faCaretSquareUp: faCaretSquareUp,
faCaretUp: faCaretUp,
faCarrot: faCarrot,
faCartArrowDown: faCartArrowDown,
faCartPlus: faCartPlus,
faCashRegister: faCashRegister,
faCat: faCat,
faCertificate: faCertificate,
faChair: faChair,
faChalkboard: faChalkboard,
faChalkboardTeacher: faChalkboardTeacher,
faChargingStation: faChargingStation,
faChartArea: faChartArea,
faChartBar: faChartBar,
faChartLine: faChartLine,
faChartPie: faChartPie,
faCheck: faCheck,
faCheckCircle: faCheckCircle,
faCheckDouble: faCheckDouble,
faCheckSquare: faCheckSquare,
faCheese: faCheese,
faChess: faChess,
faChessBishop: faChessBishop,
faChessBoard: faChessBoard,
faChessKing: faChessKing,
faChessKnight: faChessKnight,
faChessPawn: faChessPawn,
faChessQueen: faChessQueen,
faChessRook: faChessRook,
faChevronCircleDown: faChevronCircleDown,
faChevronCircleLeft: faChevronCircleLeft,
faChevronCircleRight: faChevronCircleRight,
faChevronCircleUp: faChevronCircleUp,
faChevronDown: faChevronDown,
faChevronLeft: faChevronLeft,
faChevronRight: faChevronRight,
faChevronUp: faChevronUp,
faChild: faChild,
faChurch: faChurch,
faCircle: faCircle,
faCircleNotch: faCircleNotch,
faCity: faCity,
faClinicMedical: faClinicMedical,
faClipboard: faClipboard,
faClipboardCheck: faClipboardCheck,
faClipboardList: faClipboardList,
faClock: faClock,
faClone: faClone,
faClosedCaptioning: faClosedCaptioning,
faCloud: faCloud,
faCloudDownloadAlt: faCloudDownloadAlt,
faCloudMeatball: faCloudMeatball,
faCloudMoon: faCloudMoon,
faCloudMoonRain: faCloudMoonRain,
faCloudRain: faCloudRain,
faCloudShowersHeavy: faCloudShowersHeavy,
faCloudSun: faCloudSun,
faCloudSunRain: faCloudSunRain,
faCloudUploadAlt: faCloudUploadAlt,
faCocktail: faCocktail,
faCode: faCode,
faCodeBranch: faCodeBranch,
faCoffee: faCoffee,
faCog: faCog,
faCogs: faCogs,
faCoins: faCoins,
faColumns: faColumns,
faComment: faComment,
faCommentAlt: faCommentAlt,
faCommentDollar: faCommentDollar,
faCommentDots: faCommentDots,
faCommentMedical: faCommentMedical,
faCommentSlash: faCommentSlash,
faComments: faComments,
faCommentsDollar: faCommentsDollar,
faCompactDisc: faCompactDisc,
faCompass: faCompass,
faCompress: faCompress,
faCompressAlt: faCompressAlt,
faCompressArrowsAlt: faCompressArrowsAlt,
faConciergeBell: faConciergeBell,
faCookie: faCookie,
faCookieBite: faCookieBite,
faCopy: faCopy,
faCopyright: faCopyright,
faCouch: faCouch,
faCreditCard: faCreditCard,
faCrop: faCrop,
faCropAlt: faCropAlt,
faCross: faCross,
faCrosshairs: faCrosshairs,
faCrow: faCrow,
faCrown: faCrown,
faCrutch: faCrutch,
faCube: faCube,
faCubes: faCubes,
faCut: faCut,
faDatabase: faDatabase,
faDeaf: faDeaf,
faDemocrat: faDemocrat,
faDesktop: faDesktop,
faDharmachakra: faDharmachakra,
faDiagnoses: faDiagnoses,
faDice: faDice,
faDiceD20: faDiceD20,
faDiceD6: faDiceD6,
faDiceFive: faDiceFive,
faDiceFour: faDiceFour,
faDiceOne: faDiceOne,
faDiceSix: faDiceSix,
faDiceThree: faDiceThree,
faDiceTwo: faDiceTwo,
faDigitalTachograph: faDigitalTachograph,
faDirections: faDirections,
faDisease: faDisease,
faDivide: faDivide,
faDizzy: faDizzy,
faDna: faDna,
faDog: faDog,
faDollarSign: faDollarSign,
faDolly: faDolly,
faDollyFlatbed: faDollyFlatbed,
faDonate: faDonate,
faDoorClosed: faDoorClosed,
faDoorOpen: faDoorOpen,
faDotCircle: faDotCircle,
faDove: faDove,
faDownload: faDownload,
faDraftingCompass: faDraftingCompass,
faDragon: faDragon,
faDrawPolygon: faDrawPolygon,
faDrum: faDrum,
faDrumSteelpan: faDrumSteelpan,
faDrumstickBite: faDrumstickBite,
faDumbbell: faDumbbell,
faDumpster: faDumpster,
faDumpsterFire: faDumpsterFire,
faDungeon: faDungeon,
faEdit: faEdit,
faEgg: faEgg,
faEject: faEject,
faEllipsisH: faEllipsisH,
faEllipsisV: faEllipsisV,
faEnvelope: faEnvelope,
faEnvelopeOpen: faEnvelopeOpen,
faEnvelopeOpenText: faEnvelopeOpenText,
faEnvelopeSquare: faEnvelopeSquare,
faEquals: faEquals,
faEraser: faEraser,
faEthernet: faEthernet,
faEuroSign: faEuroSign,
faExchangeAlt: faExchangeAlt,
faExclamation: faExclamation,
faExclamationCircle: faExclamationCircle,
faExclamationTriangle: faExclamationTriangle,
faExpand: faExpand,
faExpandAlt: faExpandAlt,
faExpandArrowsAlt: faExpandArrowsAlt,
faExternalLinkAlt: faExternalLinkAlt,
faExternalLinkSquareAlt: faExternalLinkSquareAlt,
faEye: faEye,
faEyeDropper: faEyeDropper,
faEyeSlash: faEyeSlash,
faFan: faFan,
faFastBackward: faFastBackward,
faFastForward: faFastForward,
faFaucet: faFaucet,
faFax: faFax,
faFeather: faFeather,
faFeatherAlt: faFeatherAlt,
faFemale: faFemale,
faFighterJet: faFighterJet,
faFile: faFile,
faFileAlt: faFileAlt,
faFileArchive: faFileArchive,
faFileAudio: faFileAudio,
faFileCode: faFileCode,
faFileContract: faFileContract,
faFileCsv: faFileCsv,
faFileDownload: faFileDownload,
faFileExcel: faFileExcel,
faFileExport: faFileExport,
faFileImage: faFileImage,
faFileImport: faFileImport,
faFileInvoice: faFileInvoice,
faFileInvoiceDollar: faFileInvoiceDollar,
faFileMedical: faFileMedical,
faFileMedicalAlt: faFileMedicalAlt,
faFilePdf: faFilePdf,
faFilePowerpoint: faFilePowerpoint,
faFilePrescription: faFilePrescription,
faFileSignature: faFileSignature,
faFileUpload: faFileUpload,
faFileVideo: faFileVideo,
faFileWord: faFileWord,
faFill: faFill,
faFillDrip: faFillDrip,
faFilm: faFilm,
faFilter: faFilter,
faFingerprint: faFingerprint,
faFire: faFire,
faFireAlt: faFireAlt,
faFireExtinguisher: faFireExtinguisher,
faFirstAid: faFirstAid,
faFish: faFish,
faFistRaised: faFistRaised,
faFlag: faFlag,
faFlagCheckered: faFlagCheckered,
faFlagUsa: faFlagUsa,
faFlask: faFlask,
faFlushed: faFlushed,
faFolder: faFolder,
faFolderMinus: faFolderMinus,
faFolderOpen: faFolderOpen,
faFolderPlus: faFolderPlus,
faFont: faFont,
faFontAwesomeLogoFull: faFontAwesomeLogoFull,
faFootballBall: faFootballBall,
faForward: faForward,
faFrog: faFrog,
faFrown: faFrown,
faFrownOpen: faFrownOpen,
faFunnelDollar: faFunnelDollar,
faFutbol: faFutbol,
faGamepad: faGamepad,
faGasPump: faGasPump,
faGavel: faGavel,
faGem: faGem,
faGenderless: faGenderless,
faGhost: faGhost,
faGift: faGift,
faGifts: faGifts,
faGlassCheers: faGlassCheers,
faGlassMartini: faGlassMartini,
faGlassMartiniAlt: faGlassMartiniAlt,
faGlassWhiskey: faGlassWhiskey,
faGlasses: faGlasses,
faGlobe: faGlobe,
faGlobeAfrica: faGlobeAfrica,
faGlobeAmericas: faGlobeAmericas,
faGlobeAsia: faGlobeAsia,
faGlobeEurope: faGlobeEurope,
faGolfBall: faGolfBall,
faGopuram: faGopuram,
faGraduationCap: faGraduationCap,
faGreaterThan: faGreaterThan,
faGreaterThanEqual: faGreaterThanEqual,
faGrimace: faGrimace,
faGrin: faGrin,
faGrinAlt: faGrinAlt,
faGrinBeam: faGrinBeam,
faGrinBeamSweat: faGrinBeamSweat,
faGrinHearts: faGrinHearts,
faGrinSquint: faGrinSquint,
faGrinSquintTears: faGrinSquintTears,
faGrinStars: faGrinStars,
faGrinTears: faGrinTears,
faGrinTongue: faGrinTongue,
faGrinTongueSquint: faGrinTongueSquint,
faGrinTongueWink: faGrinTongueWink,
faGrinWink: faGrinWink,
faGripHorizontal: faGripHorizontal,
faGripLines: faGripLines,
faGripLinesVertical: faGripLinesVertical,
faGripVertical: faGripVertical,
faGuitar: faGuitar,
faHSquare: faHSquare,
faHamburger: faHamburger,
faHammer: faHammer,
faHamsa: faHamsa,
faHandHolding: faHandHolding,
faHandHoldingHeart: faHandHoldingHeart,
faHandHoldingMedical: faHandHoldingMedical,
faHandHoldingUsd: faHandHoldingUsd,
faHandHoldingWater: faHandHoldingWater,
faHandLizard: faHandLizard,
faHandMiddleFinger: faHandMiddleFinger,
faHandPaper: faHandPaper,
faHandPeace: faHandPeace,
faHandPointDown: faHandPointDown,
faHandPointLeft: faHandPointLeft,
faHandPointRight: faHandPointRight,
faHandPointUp: faHandPointUp,
faHandPointer: faHandPointer,
faHandRock: faHandRock,
faHandScissors: faHandScissors,
faHandSparkles: faHandSparkles,
faHandSpock: faHandSpock,
faHands: faHands,
faHandsHelping: faHandsHelping,
faHandsWash: faHandsWash,
faHandshake: faHandshake,
faHandshakeAltSlash: faHandshakeAltSlash,
faHandshakeSlash: faHandshakeSlash,
faHanukiah: faHanukiah,
faHardHat: faHardHat,
faHashtag: faHashtag,
faHatCowboy: faHatCowboy,
faHatCowboySide: faHatCowboySide,
faHatWizard: faHatWizard,
faHdd: faHdd,
faHeadSideCough: faHeadSideCough,
faHeadSideCoughSlash: faHeadSideCoughSlash,
faHeadSideMask: faHeadSideMask,
faHeadSideVirus: faHeadSideVirus,
faHeading: faHeading,
faHeadphones: faHeadphones,
faHeadphonesAlt: faHeadphonesAlt,
faHeadset: faHeadset,
faHeart: faHeart,
faHeartBroken: faHeartBroken,
faHeartbeat: faHeartbeat,
faHelicopter: faHelicopter,
faHighlighter: faHighlighter,
faHiking: faHiking,
faHippo: faHippo,
faHistory: faHistory,
faHockeyPuck: faHockeyPuck,
faHollyBerry: faHollyBerry,
faHome: faHome,
faHorse: faHorse,
faHorseHead: faHorseHead,
faHospital: faHospital,
faHospitalAlt: faHospitalAlt,
faHospitalSymbol: faHospitalSymbol,
faHospitalUser: faHospitalUser,
faHotTub: faHotTub,
faHotdog: faHotdog,
faHotel: faHotel,
faHourglass: faHourglass,
faHourglassEnd: faHourglassEnd,
faHourglassHalf: faHourglassHalf,
faHourglassStart: faHourglassStart,
faHouseDamage: faHouseDamage,
faHouseUser: faHouseUser,
faHryvnia: faHryvnia,
faICursor: faICursor,
faIceCream: faIceCream,
faIcicles: faIcicles,
faIcons: faIcons,
faIdBadge: faIdBadge,
faIdCard: faIdCard,
faIdCardAlt: faIdCardAlt,
faIgloo: faIgloo,
faImage: faImage,
faImages: faImages,
faInbox: faInbox,
faIndent: faIndent,
faIndustry: faIndustry,
faInfinity: faInfinity,
faInfo: faInfo,
faInfoCircle: faInfoCircle,
faItalic: faItalic,
faJedi: faJedi,
faJoint: faJoint,
faJournalWhills: faJournalWhills,
faKaaba: faKaaba,
faKey: faKey,
faKeyboard: faKeyboard,
faKhanda: faKhanda,
faKiss: faKiss,
faKissBeam: faKissBeam,
faKissWinkHeart: faKissWinkHeart,
faKiwiBird: faKiwiBird,
faLandmark: faLandmark,
faLanguage: faLanguage,
faLaptop: faLaptop,
faLaptopCode: faLaptopCode,
faLaptopHouse: faLaptopHouse,
faLaptopMedical: faLaptopMedical,
faLaugh: faLaugh,
faLaughBeam: faLaughBeam,
faLaughSquint: faLaughSquint,
faLaughWink: faLaughWink,
faLayerGroup: faLayerGroup,
faLeaf: faLeaf,
faLemon: faLemon,
faLessThan: faLessThan,
faLessThanEqual: faLessThanEqual,
faLevelDownAlt: faLevelDownAlt,
faLevelUpAlt: faLevelUpAlt,
faLifeRing: faLifeRing,
faLightbulb: faLightbulb,
faLink: faLink,
faLiraSign: faLiraSign,
faList: faList,
faListAlt: faListAlt,
faListOl: faListOl,
faListUl: faListUl,
faLocationArrow: faLocationArrow,
faLock: faLock,
faLockOpen: faLockOpen,
faLongArrowAltDown: faLongArrowAltDown,
faLongArrowAltLeft: faLongArrowAltLeft,
faLongArrowAltRight: faLongArrowAltRight,
faLongArrowAltUp: faLongArrowAltUp,
faLowVision: faLowVision,
faLuggageCart: faLuggageCart,
faLungs: faLungs,
faLungsVirus: faLungsVirus,
faMagic: faMagic,
faMagnet: faMagnet,
faMailBulk: faMailBulk,
faMale: faMale,
faMap: faMap,
faMapMarked: faMapMarked,
faMapMarkedAlt: faMapMarkedAlt,
faMapMarker: faMapMarker,
faMapMarkerAlt: faMapMarkerAlt,
faMapPin: faMapPin,
faMapSigns: faMapSigns,
faMarker: faMarker,
faMars: faMars,
faMarsDouble: faMarsDouble,
faMarsStroke: faMarsStroke,
faMarsStrokeH: faMarsStrokeH,
faMarsStrokeV: faMarsStrokeV,
faMask: faMask,
faMedal: faMedal,
faMedkit: faMedkit,
faMeh: faMeh,
faMehBlank: faMehBlank,
faMehRollingEyes: faMehRollingEyes,
faMemory: faMemory,
faMenorah: faMenorah,
faMercury: faMercury,
faMeteor: faMeteor,
faMicrochip: faMicrochip,
faMicrophone: faMicrophone,
faMicrophoneAlt: faMicrophoneAlt,
faMicrophoneAltSlash: faMicrophoneAltSlash,
faMicrophoneSlash: faMicrophoneSlash,
faMicroscope: faMicroscope,
faMinus: faMinus,
faMinusCircle: faMinusCircle,
faMinusSquare: faMinusSquare,
faMitten: faMitten,
faMobile: faMobile,
faMobileAlt: faMobileAlt,
faMoneyBill: faMoneyBill,
faMoneyBillAlt: faMoneyBillAlt,
faMoneyBillWave: faMoneyBillWave,
faMoneyBillWaveAlt: faMoneyBillWaveAlt,
faMoneyCheck: faMoneyCheck,
faMoneyCheckAlt: faMoneyCheckAlt,
faMonument: faMonument,
faMoon: faMoon,
faMortarPestle: faMortarPestle,
faMosque: faMosque,
faMotorcycle: faMotorcycle,
faMountain: faMountain,
faMouse: faMouse,
faMousePointer: faMousePointer,
faMugHot: faMugHot,
faMusic: faMusic,
faNetworkWired: faNetworkWired,
faNeuter: faNeuter,
faNewspaper: faNewspaper,
faNotEqual: faNotEqual,
faNotesMedical: faNotesMedical,
faObjectGroup: faObjectGroup,
faObjectUngroup: faObjectUngroup,
faOilCan: faOilCan,
faOm: faOm,
faOtter: faOtter,
faOutdent: faOutdent,
faPager: faPager,
faPaintBrush: faPaintBrush,
faPaintRoller: faPaintRoller,
faPalette: faPalette,
faPallet: faPallet,
faPaperPlane: faPaperPlane,
faPaperclip: faPaperclip,
faParachuteBox: faParachuteBox,
faParagraph: faParagraph,
faParking: faParking,
faPassport: faPassport,
faPastafarianism: faPastafarianism,
faPaste: faPaste,
faPause: faPause,
faPauseCircle: faPauseCircle,
faPaw: faPaw,
faPeace: faPeace,
faPen: faPen,
faPenAlt: faPenAlt,
faPenFancy: faPenFancy,
faPenNib: faPenNib,
faPenSquare: faPenSquare,
faPencilAlt: faPencilAlt,
faPencilRuler: faPencilRuler,
faPeopleArrows: faPeopleArrows,
faPeopleCarry: faPeopleCarry,
faPepperHot: faPepperHot,
faPercent: faPercent,
faPercentage: faPercentage,
faPersonBooth: faPersonBooth,
faPhone: faPhone,
faPhoneAlt: faPhoneAlt,
faPhoneSlash: faPhoneSlash,
faPhoneSquare: faPhoneSquare,
faPhoneSquareAlt: faPhoneSquareAlt,
faPhoneVolume: faPhoneVolume,
faPhotoVideo: faPhotoVideo,
faPiggyBank: faPiggyBank,
faPills: faPills,
faPizzaSlice: faPizzaSlice,
faPlaceOfWorship: faPlaceOfWorship,
faPlane: faPlane,
faPlaneArrival: faPlaneArrival,
faPlaneDeparture: faPlaneDeparture,
faPlaneSlash: faPlaneSlash,
faPlay: faPlay,
faPlayCircle: faPlayCircle,
faPlug: faPlug,
faPlus: faPlus,
faPlusCircle: faPlusCircle,
faPlusSquare: faPlusSquare,
faPodcast: faPodcast,
faPoll: faPoll,
faPollH: faPollH,
faPoo: faPoo,
faPooStorm: faPooStorm,
faPoop: faPoop,
faPortrait: faPortrait,
faPoundSign: faPoundSign,
faPowerOff: faPowerOff,
faPray: faPray,
faPrayingHands: faPrayingHands,
faPrescription: faPrescription,
faPrescriptionBottle: faPrescriptionBottle,
faPrescriptionBottleAlt: faPrescriptionBottleAlt,
faPrint: faPrint,
faProcedures: faProcedures,
faProjectDiagram: faProjectDiagram,
faPumpMedical: faPumpMedical,
faPumpSoap: faPumpSoap,
faPuzzlePiece: faPuzzlePiece,
faQrcode: faQrcode,
faQuestion: faQuestion,
faQuestionCircle: faQuestionCircle,
faQuidditch: faQuidditch,
faQuoteLeft: faQuoteLeft,
faQuoteRight: faQuoteRight,
faQuran: faQuran,
faRadiation: faRadiation,
faRadiationAlt: faRadiationAlt,
faRainbow: faRainbow,
faRandom: faRandom,
faReceipt: faReceipt,
faRecordVinyl: faRecordVinyl,
faRecycle: faRecycle,
faRedo: faRedo,
faRedoAlt: faRedoAlt,
faRegistered: faRegistered,
faRemoveFormat: faRemoveFormat,
faReply: faReply,
faReplyAll: faReplyAll,
faRepublican: faRepublican,
faRestroom: faRestroom,
faRetweet: faRetweet,
faRibbon: faRibbon,
faRing: faRing,
faRoad: faRoad,
faRobot: faRobot,
faRocket: faRocket,
faRoute: faRoute,
faRss: faRss,
faRssSquare: faRssSquare,
faRubleSign: faRubleSign,
faRuler: faRuler,
faRulerCombined: faRulerCombined,
faRulerHorizontal: faRulerHorizontal,
faRulerVertical: faRulerVertical,
faRunning: faRunning,
faRupeeSign: faRupeeSign,
faSadCry: faSadCry,
faSadTear: faSadTear,
faSatellite: faSatellite,
faSatelliteDish: faSatelliteDish,
faSave: faSave,
faSchool: faSchool,
faScrewdriver: faScrewdriver,
faScroll: faScroll,
faSdCard: faSdCard,
faSearch: faSearch,
faSearchDollar: faSearchDollar,
faSearchLocation: faSearchLocation,
faSearchMinus: faSearchMinus,
faSearchPlus: faSearchPlus,
faSeedling: faSeedling,
faServer: faServer,
faShapes: faShapes,
faShare: faShare,
faShareAlt: faShareAlt,
faShareAltSquare: faShareAltSquare,
faShareSquare: faShareSquare,
faShekelSign: faShekelSign,
faShieldAlt: faShieldAlt,
faShieldVirus: faShieldVirus,
faShip: faShip,
faShippingFast: faShippingFast,
faShoePrints: faShoePrints,
faShoppingBag: faShoppingBag,
faShoppingBasket: faShoppingBasket,
faShoppingCart: faShoppingCart,
faShower: faShower,
faShuttleVan: faShuttleVan,
faSign: faSign,
faSignInAlt: faSignInAlt,
faSignLanguage: faSignLanguage,
faSignOutAlt: faSignOutAlt,
faSignal: faSignal,
faSignature: faSignature,
faSimCard: faSimCard,
faSink: faSink,
faSitemap: faSitemap,
faSkating: faSkating,
faSkiing: faSkiing,
faSkiingNordic: faSkiingNordic,
faSkull: faSkull,
faSkullCrossbones: faSkullCrossbones,
faSlash: faSlash,
faSleigh: faSleigh,
faSlidersH: faSlidersH,
faSmile: faSmile,
faSmileBeam: faSmileBeam,
faSmileWink: faSmileWink,
faSmog: faSmog,
faSmoking: faSmoking,
faSmokingBan: faSmokingBan,
faSms: faSms,
faSnowboarding: faSnowboarding,
faSnowflake: faSnowflake,
faSnowman: faSnowman,
faSnowplow: faSnowplow,
faSoap: faSoap,
faSocks: faSocks,
faSolarPanel: faSolarPanel,
faSort: faSort,
faSortAlphaDown: faSortAlphaDown,
faSortAlphaDownAlt: faSortAlphaDownAlt,
faSortAlphaUp: faSortAlphaUp,
faSortAlphaUpAlt: faSortAlphaUpAlt,
faSortAmountDown: faSortAmountDown,
faSortAmountDownAlt: faSortAmountDownAlt,
faSortAmountUp: faSortAmountUp,
faSortAmountUpAlt: faSortAmountUpAlt,
faSortDown: faSortDown,
faSortNumericDown: faSortNumericDown,
faSortNumericDownAlt: faSortNumericDownAlt,
faSortNumericUp: faSortNumericUp,
faSortNumericUpAlt: faSortNumericUpAlt,
faSortUp: faSortUp,
faSpa: faSpa,
faSpaceShuttle: faSpaceShuttle,
faSpellCheck: faSpellCheck,
faSpider: faSpider,
faSpinner: faSpinner,
faSplotch: faSplotch,
faSprayCan: faSprayCan,
faSquare: faSquare,
faSquareFull: faSquareFull,
faSquareRootAlt: faSquareRootAlt,
faStamp: faStamp,
faStar: faStar,
faStarAndCrescent: faStarAndCrescent,
faStarHalf: faStarHalf,
faStarHalfAlt: faStarHalfAlt,
faStarOfDavid: faStarOfDavid,
faStarOfLife: faStarOfLife,
faStepBackward: faStepBackward,
faStepForward: faStepForward,
faStethoscope: faStethoscope,
faStickyNote: faStickyNote,
faStop: faStop,
faStopCircle: faStopCircle,
faStopwatch: faStopwatch,
faStopwatch20: faStopwatch20,
faStore: faStore,
faStoreAlt: faStoreAlt,
faStoreAltSlash: faStoreAltSlash,
faStoreSlash: faStoreSlash,
faStream: faStream,
faStreetView: faStreetView,
faStrikethrough: faStrikethrough,
faStroopwafel: faStroopwafel,
faSubscript: faSubscript,
faSubway: faSubway,
faSuitcase: faSuitcase,
faSuitcaseRolling: faSuitcaseRolling,
faSun: faSun,
faSuperscript: faSuperscript,
faSurprise: faSurprise,
faSwatchbook: faSwatchbook,
faSwimmer: faSwimmer,
faSwimmingPool: faSwimmingPool,
faSynagogue: faSynagogue,
faSync: faSync,
faSyncAlt: faSyncAlt,
faSyringe: faSyringe,
faTable: faTable,
faTableTennis: faTableTennis,
faTablet: faTablet,
faTabletAlt: faTabletAlt,
faTablets: faTablets,
faTachometerAlt: faTachometerAlt,
faTag: faTag,
faTags: faTags,
faTape: faTape,
faTasks: faTasks,
faTaxi: faTaxi,
faTeeth: faTeeth,
faTeethOpen: faTeethOpen,
faTemperatureHigh: faTemperatureHigh,
faTemperatureLow: faTemperatureLow,
faTenge: faTenge,
faTerminal: faTerminal,
faTextHeight: faTextHeight,
faTextWidth: faTextWidth,
faTh: faTh,
faThLarge: faThLarge,
faThList: faThList,
faTheaterMasks: faTheaterMasks,
faThermometer: faThermometer,
faThermometerEmpty: faThermometerEmpty,
faThermometerFull: faThermometerFull,
faThermometerHalf: faThermometerHalf,
faThermometerQuarter: faThermometerQuarter,
faThermometerThreeQuarters: faThermometerThreeQuarters,
faThumbsDown: faThumbsDown,
faThumbsUp: faThumbsUp,
faThumbtack: faThumbtack,
faTicketAlt: faTicketAlt,
faTimes: faTimes,
faTimesCircle: faTimesCircle,
faTint: faTint,
faTintSlash: faTintSlash,
faTired: faTired,
faToggleOff: faToggleOff,
faToggleOn: faToggleOn,
faToilet: faToilet,
faToiletPaper: faToiletPaper,
faToiletPaperSlash: faToiletPaperSlash,
faToolbox: faToolbox,
faTools: faTools,
faTooth: faTooth,
faTorah: faTorah,
faToriiGate: faToriiGate,
faTractor: faTractor,
faTrademark: faTrademark,
faTrafficLight: faTrafficLight,
faTrailer: faTrailer,
faTrain: faTrain,
faTram: faTram,
faTransgender: faTransgender,
faTransgenderAlt: faTransgenderAlt,
faTrash: faTrash,
faTrashAlt: faTrashAlt,
faTrashRestore: faTrashRestore,
faTrashRestoreAlt: faTrashRestoreAlt,
faTree: faTree,
faTrophy: faTrophy,
faTruck: faTruck,
faTruckLoading: faTruckLoading,
faTruckMonster: faTruckMonster,
faTruckMoving: faTruckMoving,
faTruckPickup: faTruckPickup,
faTshirt: faTshirt,
faTty: faTty,
faTv: faTv,
faUmbrella: faUmbrella,
faUmbrellaBeach: faUmbrellaBeach,
faUnderline: faUnderline,
faUndo: faUndo,
faUndoAlt: faUndoAlt,
faUniversalAccess: faUniversalAccess,
faUniversity: faUniversity,
faUnlink: faUnlink,
faUnlock: faUnlock,
faUnlockAlt: faUnlockAlt,
faUpload: faUpload,
faUser: faUser,
faUserAlt: faUserAlt,
faUserAltSlash: faUserAltSlash,
faUserAstronaut: faUserAstronaut,
faUserCheck: faUserCheck,
faUserCircle: faUserCircle,
faUserClock: faUserClock,
faUserCog: faUserCog,
faUserEdit: faUserEdit,
faUserFriends: faUserFriends,
faUserGraduate: faUserGraduate,
faUserInjured: faUserInjured,
faUserLock: faUserLock,
faUserMd: faUserMd,
faUserMinus: faUserMinus,
faUserNinja: faUserNinja,
faUserNurse: faUserNurse,
faUserPlus: faUserPlus,
faUserSecret: faUserSecret,
faUserShield: faUserShield,
faUserSlash: faUserSlash,
faUserTag: faUserTag,
faUserTie: faUserTie,
faUserTimes: faUserTimes,
faUsers: faUsers,
faUsersCog: faUsersCog,
faUsersSlash: faUsersSlash,
faUtensilSpoon: faUtensilSpoon,
faUtensils: faUtensils,
faVectorSquare: faVectorSquare,
faVenus: faVenus,
faVenusDouble: faVenusDouble,
faVenusMars: faVenusMars,
faVial: faVial,
faVials: faVials,
faVideo: faVideo,
faVideoSlash: faVideoSlash,
faVihara: faVihara,
faVirus: faVirus,
faVirusSlash: faVirusSlash,
faViruses: faViruses,
faVoicemail: faVoicemail,
faVolleyballBall: faVolleyballBall,
faVolumeDown: faVolumeDown,
faVolumeMute: faVolumeMute,
faVolumeOff: faVolumeOff,
faVolumeUp: faVolumeUp,
faVoteYea: faVoteYea,
faVrCardboard: faVrCardboard,
faWalking: faWalking,
faWallet: faWallet,
faWarehouse: faWarehouse,
faWater: faWater,
faWaveSquare: faWaveSquare,
faWeight: faWeight,
faWeightHanging: faWeightHanging,
faWheelchair: faWheelchair,
faWifi: faWifi,
faWind: faWind,
faWindowClose: faWindowClose,
faWindowMaximize: faWindowMaximize,
faWindowMinimize: faWindowMinimize,
faWindowRestore: faWindowRestore,
faWineBottle: faWineBottle,
faWineGlass: faWineGlass,
faWineGlassAlt: faWineGlassAlt,
faWonSign: faWonSign,
faWrench: faWrench,
faXRay: faXRay,
faYenSign: faYenSign,
faYinYang: faYinYang
};
/***/ }),
/***/ "./node_modules/@tweenjs/tween.js/dist/tween.esm.js":
/*!**********************************************************!*\
!*** ./node_modules/@tweenjs/tween.js/dist/tween.esm.js ***!
\**********************************************************/
/*! exports provided: default */
/***/ (function(module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
var version = '18.5.0';
/**
* Tween.js - Licensed under the MIT license
* https://github.com/tweenjs/tween.js
* ----------------------------------------------
*
* See https://github.com/tweenjs/tween.js/graphs/contributors for the full list of contributors.
* Thank you all, you're awesome!
*/
var _Group = function () {
this._tweens = {};
this._tweensAddedDuringUpdate = {};
};
_Group.prototype = {
getAll: function () {
return Object.keys(this._tweens).map(function (tweenId) {
return this._tweens[tweenId];
}.bind(this));
},
removeAll: function () {
this._tweens = {};
},
add: function (tween) {
this._tweens[tween.getId()] = tween;
this._tweensAddedDuringUpdate[tween.getId()] = tween;
},
remove: function (tween) {
delete this._tweens[tween.getId()];
delete this._tweensAddedDuringUpdate[tween.getId()];
},
update: function (time, preserve) {
var tweenIds = Object.keys(this._tweens);
if (tweenIds.length === 0) {
return false;
}
time = time !== undefined ? time : TWEEN.now();
// Tweens are updated in "batches". If you add a new tween during an
// update, then the new tween will be updated in the next batch.
// If you remove a tween during an update, it may or may not be updated.
// However, if the removed tween was added during the current batch,
// then it will not be updated.
while (tweenIds.length > 0) {
this._tweensAddedDuringUpdate = {};
for (var i = 0; i < tweenIds.length; i++) {
var tween = this._tweens[tweenIds[i]];
if (tween && tween.update(time) === false) {
tween._isPlaying = false;
if (!preserve) {
delete this._tweens[tweenIds[i]];
}
}
}
tweenIds = Object.keys(this._tweensAddedDuringUpdate);
}
return true;
}
};
var TWEEN = new _Group();
TWEEN.Group = _Group;
TWEEN._nextId = 0;
TWEEN.nextId = function () {
return TWEEN._nextId++;
};
// Include a performance.now polyfill.
// In node.js, use process.hrtime.
if (typeof (self) === 'undefined' && typeof (process) !== 'undefined' && process.hrtime) {
TWEEN.now = function () {
var time = process.hrtime();
// Convert [seconds, nanoseconds] to milliseconds.
return time[0] * 1000 + time[1] / 1000000;
};
}
// In a browser, use self.performance.now if it is available.
else if (typeof (self) !== 'undefined' &&
self.performance !== undefined &&
self.performance.now !== undefined) {
// This must be bound, because directly assigning this function
// leads to an invocation exception in Chrome.
TWEEN.now = self.performance.now.bind(self.performance);
}
// Use Date.now if it is available.
else if (Date.now !== undefined) {
TWEEN.now = Date.now;
}
// Otherwise, use 'new Date().getTime()'.
else {
TWEEN.now = function () {
return new Date().getTime();
};
}
TWEEN.Tween = function (object, group) {
this._isPaused = false;
this._pauseStart = null;
this._object = object;
this._valuesStart = {};
this._valuesEnd = {};
this._valuesStartRepeat = {};
this._duration = 1000;
this._repeat = 0;
this._repeatDelayTime = undefined;
this._yoyo = false;
this._isPlaying = false;
this._reversed = false;
this._delayTime = 0;
this._startTime = null;
this._easingFunction = TWEEN.Easing.Linear.None;
this._interpolationFunction = TWEEN.Interpolation.Linear;
this._chainedTweens = [];
this._onStartCallback = null;
this._onStartCallbackFired = false;
this._onUpdateCallback = null;
this._onRepeatCallback = null;
this._onCompleteCallback = null;
this._onStopCallback = null;
this._group = group || TWEEN;
this._id = TWEEN.nextId();
};
TWEEN.Tween.prototype = {
getId: function () {
return this._id;
},
isPlaying: function () {
return this._isPlaying;
},
isPaused: function () {
return this._isPaused;
},
to: function (properties, duration) {
this._valuesEnd = Object.create(properties);
if (duration !== undefined) {
this._duration = duration;
}
return this;
},
duration: function duration(d) {
this._duration = d;
return this;
},
start: function (time) {
this._group.add(this);
this._isPlaying = true;
this._isPaused = false;
this._onStartCallbackFired = false;
this._startTime = time !== undefined ? typeof time === 'string' ? TWEEN.now() + parseFloat(time) : time : TWEEN.now();
this._startTime += this._delayTime;
for (var property in this._valuesEnd) {
// Check if an Array was provided as property value
if (this._valuesEnd[property] instanceof Array) {
if (this._valuesEnd[property].length === 0) {
continue;
}
// Create a local copy of the Array with the start value at the front
this._valuesEnd[property] = [this._object[property]].concat(this._valuesEnd[property]);
}
// If `to()` specifies a property that doesn't exist in the source object,
// we should not set that property in the object
if (this._object[property] === undefined) {
continue;
}
// Save the starting value, but only once.
if (typeof(this._valuesStart[property]) === 'undefined') {
this._valuesStart[property] = this._object[property];
}
if ((this._valuesStart[property] instanceof Array) === false) {
this._valuesStart[property] *= 1.0; // Ensures we're using numbers, not strings
}
this._valuesStartRepeat[property] = this._valuesStart[property] || 0;
}
return this;
},
stop: function () {
if (!this._isPlaying) {
return this;
}
this._group.remove(this);
this._isPlaying = false;
this._isPaused = false;
if (this._onStopCallback !== null) {
this._onStopCallback(this._object);
}
this.stopChainedTweens();
return this;
},
end: function () {
this.update(Infinity);
return this;
},
pause: function(time) {
if (this._isPaused || !this._isPlaying) {
return this;
}
this._isPaused = true;
this._pauseStart = time === undefined ? TWEEN.now() : time;
this._group.remove(this);
return this;
},
resume: function(time) {
if (!this._isPaused || !this._isPlaying) {
return this;
}
this._isPaused = false;
this._startTime += (time === undefined ? TWEEN.now() : time)
- this._pauseStart;
this._pauseStart = 0;
this._group.add(this);
return this;
},
stopChainedTweens: function () {
for (var i = 0, numChainedTweens = this._chainedTweens.length; i < numChainedTweens; i++) {
this._chainedTweens[i].stop();
}
},
group: function (group) {
this._group = group;
return this;
},
delay: function (amount) {
this._delayTime = amount;
return this;
},
repeat: function (times) {
this._repeat = times;
return this;
},
repeatDelay: function (amount) {
this._repeatDelayTime = amount;
return this;
},
yoyo: function (yoyo) {
this._yoyo = yoyo;
return this;
},
easing: function (easingFunction) {
this._easingFunction = easingFunction;
return this;
},
interpolation: function (interpolationFunction) {
this._interpolationFunction = interpolationFunction;
return this;
},
chain: function () {
this._chainedTweens = arguments;
return this;
},
onStart: function (callback) {
this._onStartCallback = callback;
return this;
},
onUpdate: function (callback) {
this._onUpdateCallback = callback;
return this;
},
onRepeat: function onRepeat(callback) {
this._onRepeatCallback = callback;
return this;
},
onComplete: function (callback) {
this._onCompleteCallback = callback;
return this;
},
onStop: function (callback) {
this._onStopCallback = callback;
return this;
},
update: function (time) {
var property;
var elapsed;
var value;
if (time < this._startTime) {
return true;
}
if (this._onStartCallbackFired === false) {
if (this._onStartCallback !== null) {
this._onStartCallback(this._object);
}
this._onStartCallbackFired = true;
}
elapsed = (time - this._startTime) / this._duration;
elapsed = (this._duration === 0 || elapsed > 1) ? 1 : elapsed;
value = this._easingFunction(elapsed);
for (property in this._valuesEnd) {
// Don't update properties that do not exist in the source object
if (this._valuesStart[property] === undefined) {
continue;
}
var start = this._valuesStart[property] || 0;
var end = this._valuesEnd[property];
if (end instanceof Array) {
this._object[property] = this._interpolationFunction(end, value);
} else {
// Parses relative end values with start as base (e.g.: +10, -3)
if (typeof (end) === 'string') {
if (end.charAt(0) === '+' || end.charAt(0) === '-') {
end = start + parseFloat(end);
} else {
end = parseFloat(end);
}
}
// Protect against non numeric properties.
if (typeof (end) === 'number') {
this._object[property] = start + (end - start) * value;
}
}
}
if (this._onUpdateCallback !== null) {
this._onUpdateCallback(this._object, elapsed);
}
if (elapsed === 1) {
if (this._repeat > 0) {
if (isFinite(this._repeat)) {
this._repeat--;
}
// Reassign starting values, restart by making startTime = now
for (property in this._valuesStartRepeat) {
if (typeof (this._valuesEnd[property]) === 'string') {
this._valuesStartRepeat[property] = this._valuesStartRepeat[property] + parseFloat(this._valuesEnd[property]);
}
if (this._yoyo) {
var tmp = this._valuesStartRepeat[property];
this._valuesStartRepeat[property] = this._valuesEnd[property];
this._valuesEnd[property] = tmp;
}
this._valuesStart[property] = this._valuesStartRepeat[property];
}
if (this._yoyo) {
this._reversed = !this._reversed;
}
if (this._repeatDelayTime !== undefined) {
this._startTime = time + this._repeatDelayTime;
} else {
this._startTime = time + this._delayTime;
}
if (this._onRepeatCallback !== null) {
this._onRepeatCallback(this._object);
}
return true;
} else {
if (this._onCompleteCallback !== null) {
this._onCompleteCallback(this._object);
}
for (var i = 0, numChainedTweens = this._chainedTweens.length; i < numChainedTweens; i++) {
// Make the chained tweens start exactly at the time they should,
// even if the `update()` method was called way past the duration of the tween
this._chainedTweens[i].start(this._startTime + this._duration);
}
return false;
}
}
return true;
}
};
TWEEN.Easing = {
Linear: {
None: function (k) {
return k;
}
},
Quadratic: {
In: function (k) {
return k * k;
},
Out: function (k) {
return k * (2 - k);
},
InOut: function (k) {
if ((k *= 2) < 1) {
return 0.5 * k * k;
}
return - 0.5 * (--k * (k - 2) - 1);
}
},
Cubic: {
In: function (k) {
return k * k * k;
},
Out: function (k) {
return --k * k * k + 1;
},
InOut: function (k) {
if ((k *= 2) < 1) {
return 0.5 * k * k * k;
}
return 0.5 * ((k -= 2) * k * k + 2);
}
},
Quartic: {
In: function (k) {
return k * k * k * k;
},
Out: function (k) {
return 1 - (--k * k * k * k);
},
InOut: function (k) {
if ((k *= 2) < 1) {
return 0.5 * k * k * k * k;
}
return - 0.5 * ((k -= 2) * k * k * k - 2);
}
},
Quintic: {
In: function (k) {
return k * k * k * k * k;
},
Out: function (k) {
return --k * k * k * k * k + 1;
},
InOut: function (k) {
if ((k *= 2) < 1) {
return 0.5 * k * k * k * k * k;
}
return 0.5 * ((k -= 2) * k * k * k * k + 2);
}
},
Sinusoidal: {
In: function (k) {
return 1 - Math.cos(k * Math.PI / 2);
},
Out: function (k) {
return Math.sin(k * Math.PI / 2);
},
InOut: function (k) {
return 0.5 * (1 - Math.cos(Math.PI * k));
}
},
Exponential: {
In: function (k) {
return k === 0 ? 0 : Math.pow(1024, k - 1);
},
Out: function (k) {
return k === 1 ? 1 : 1 - Math.pow(2, - 10 * k);
},
InOut: function (k) {
if (k === 0) {
return 0;
}
if (k === 1) {
return 1;
}
if ((k *= 2) < 1) {
return 0.5 * Math.pow(1024, k - 1);
}
return 0.5 * (- Math.pow(2, - 10 * (k - 1)) + 2);
}
},
Circular: {
In: function (k) {
return 1 - Math.sqrt(1 - k * k);
},
Out: function (k) {
return Math.sqrt(1 - (--k * k));
},
InOut: function (k) {
if ((k *= 2) < 1) {
return - 0.5 * (Math.sqrt(1 - k * k) - 1);
}
return 0.5 * (Math.sqrt(1 - (k -= 2) * k) + 1);
}
},
Elastic: {
In: function (k) {
if (k === 0) {
return 0;
}
if (k === 1) {
return 1;
}
return -Math.pow(2, 10 * (k - 1)) * Math.sin((k - 1.1) * 5 * Math.PI);
},
Out: function (k) {
if (k === 0) {
return 0;
}
if (k === 1) {
return 1;
}
return Math.pow(2, -10 * k) * Math.sin((k - 0.1) * 5 * Math.PI) + 1;
},
InOut: function (k) {
if (k === 0) {
return 0;
}
if (k === 1) {
return 1;
}
k *= 2;
if (k < 1) {
return -0.5 * Math.pow(2, 10 * (k - 1)) * Math.sin((k - 1.1) * 5 * Math.PI);
}
return 0.5 * Math.pow(2, -10 * (k - 1)) * Math.sin((k - 1.1) * 5 * Math.PI) + 1;
}
},
Back: {
In: function (k) {
var s = 1.70158;
return k * k * ((s + 1) * k - s);
},
Out: function (k) {
var s = 1.70158;
return --k * k * ((s + 1) * k + s) + 1;
},
InOut: function (k) {
var s = 1.70158 * 1.525;
if ((k *= 2) < 1) {
return 0.5 * (k * k * ((s + 1) * k - s));
}
return 0.5 * ((k -= 2) * k * ((s + 1) * k + s) + 2);
}
},
Bounce: {
In: function (k) {
return 1 - TWEEN.Easing.Bounce.Out(1 - k);
},
Out: function (k) {
if (k < (1 / 2.75)) {
return 7.5625 * k * k;
} else if (k < (2 / 2.75)) {
return 7.5625 * (k -= (1.5 / 2.75)) * k + 0.75;
} else if (k < (2.5 / 2.75)) {
return 7.5625 * (k -= (2.25 / 2.75)) * k + 0.9375;
} else {
return 7.5625 * (k -= (2.625 / 2.75)) * k + 0.984375;
}
},
InOut: function (k) {
if (k < 0.5) {
return TWEEN.Easing.Bounce.In(k * 2) * 0.5;
}
return TWEEN.Easing.Bounce.Out(k * 2 - 1) * 0.5 + 0.5;
}
}
};
TWEEN.Interpolation = {
Linear: function (v, k) {
var m = v.length - 1;
var f = m * k;
var i = Math.floor(f);
var fn = TWEEN.Interpolation.Utils.Linear;
if (k < 0) {
return fn(v[0], v[1], f);
}
if (k > 1) {
return fn(v[m], v[m - 1], m - f);
}
return fn(v[i], v[i + 1 > m ? m : i + 1], f - i);
},
Bezier: function (v, k) {
var b = 0;
var n = v.length - 1;
var pw = Math.pow;
var bn = TWEEN.Interpolation.Utils.Bernstein;
for (var i = 0; i <= n; i++) {
b += pw(1 - k, n - i) * pw(k, i) * v[i] * bn(n, i);
}
return b;
},
CatmullRom: function (v, k) {
var m = v.length - 1;
var f = m * k;
var i = Math.floor(f);
var fn = TWEEN.Interpolation.Utils.CatmullRom;
if (v[0] === v[m]) {
if (k < 0) {
i = Math.floor(f = m * (1 + k));
}
return fn(v[(i - 1 + m) % m], v[i], v[(i + 1) % m], v[(i + 2) % m], f - i);
} else {
if (k < 0) {
return v[0] - (fn(v[0], v[0], v[1], v[1], -f) - v[0]);
}
if (k > 1) {
return v[m] - (fn(v[m], v[m], v[m - 1], v[m - 1], f - m) - v[m]);
}
return fn(v[i ? i - 1 : 0], v[i], v[m < i + 1 ? m : i + 1], v[m < i + 2 ? m : i + 2], f - i);
}
},
Utils: {
Linear: function (p0, p1, t) {
return (p1 - p0) * t + p0;
},
Bernstein: function (n, i) {
var fc = TWEEN.Interpolation.Utils.Factorial;
return fc(n) / fc(i) / fc(n - i);
},
Factorial: (function () {
var a = [1];
return function (n) {
var s = 1;
if (a[n]) {
return a[n];
}
for (var i = n; i > 1; i--) {
s *= i;
}
a[n] = s;
return s;
};
})(),
CatmullRom: function (p0, p1, p2, p3, t) {
var v0 = (p2 - p0) * 0.5;
var v1 = (p3 - p1) * 0.5;
var t2 = t * t;
var t3 = t * t2;
return (2 * p1 - 2 * p2 + v0 + v1) * t3 + (- 3 * p1 + 3 * p2 - 2 * v0 - v1) * t2 + v0 * t + p1;
}
}
};
TWEEN.version = version;
/* harmony default export */ __webpack_exports__["default"] = (TWEEN);
/***/ }),
/***/ "./node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds/index.js":
/*!*****************************************************************************!*\
!*** ./node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds/index.js ***!
\*****************************************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
var MILLISECONDS_IN_MINUTE = 60000;
/**
* Google Chrome as of 67.0.3396.87 introduced timezones with offset that includes seconds.
* They usually appear for dates that denote time before the timezones were introduced
* (e.g. for 'Europe/Prague' timezone the offset is GMT+00:57:44 before 1 October 1891
* and GMT+01:00:00 after that date)
*
* Date#getTimezoneOffset returns the offset in minutes and would return 57 for the example above,
* which would lead to incorrect calculations.
*
* This function returns the timezone offset in milliseconds that takes seconds in account.
*/
module.exports = function getTimezoneOffsetInMilliseconds(dirtyDate) {
var date = new Date(dirtyDate.getTime());
var baseTimezoneOffset = date.getTimezoneOffset();
date.setSeconds(0, 0);
var millisecondsPartOfTimezoneOffset = date.getTime() % MILLISECONDS_IN_MINUTE;
return baseTimezoneOffset * MILLISECONDS_IN_MINUTE + millisecondsPartOfTimezoneOffset;
};
/***/ }),
/***/ "./node_modules/date-fns/add_days/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/add_days/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Add the specified number of days to the given date.
*
* @description
* Add the specified number of days to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of days to be added
* @returns {Date} the new date with the days added
*
* @example
* // Add 10 days to 1 September 2014:
* var result = addDays(new Date(2014, 8, 1), 10)
* //=> Thu Sep 11 2014 00:00:00
*/
function addDays(dirtyDate, dirtyAmount) {
var date = parse(dirtyDate);
var amount = Number(dirtyAmount);
date.setDate(date.getDate() + amount);
return date;
}
module.exports = addDays;
/***/ }),
/***/ "./node_modules/date-fns/add_hours/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/add_hours/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMilliseconds = __webpack_require__(/*! ../add_milliseconds/index.js */ "./node_modules/date-fns/add_milliseconds/index.js");
var MILLISECONDS_IN_HOUR = 3600000;
/**
* @category Hour Helpers
* @summary Add the specified number of hours to the given date.
*
* @description
* Add the specified number of hours to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of hours to be added
* @returns {Date} the new date with the hours added
*
* @example
* // Add 2 hours to 10 July 2014 23:00:00:
* var result = addHours(new Date(2014, 6, 10, 23, 0), 2)
* //=> Fri Jul 11 2014 01:00:00
*/
function addHours(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMilliseconds(dirtyDate, amount * MILLISECONDS_IN_HOUR);
}
module.exports = addHours;
/***/ }),
/***/ "./node_modules/date-fns/add_iso_years/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/add_iso_years/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
var setISOYear = __webpack_require__(/*! ../set_iso_year/index.js */ "./node_modules/date-fns/set_iso_year/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Add the specified number of ISO week-numbering years to the given date.
*
* @description
* Add the specified number of ISO week-numbering years to the given date.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of ISO week-numbering years to be added
* @returns {Date} the new date with the ISO week-numbering years added
*
* @example
* // Add 5 ISO week-numbering years to 2 July 2010:
* var result = addISOYears(new Date(2010, 6, 2), 5)
* //=> Fri Jun 26 2015 00:00:00
*/
function addISOYears(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return setISOYear(dirtyDate, getISOYear(dirtyDate) + amount);
}
module.exports = addISOYears;
/***/ }),
/***/ "./node_modules/date-fns/add_milliseconds/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/add_milliseconds/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Millisecond Helpers
* @summary Add the specified number of milliseconds to the given date.
*
* @description
* Add the specified number of milliseconds to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of milliseconds to be added
* @returns {Date} the new date with the milliseconds added
*
* @example
* // Add 750 milliseconds to 10 July 2014 12:45:30.000:
* var result = addMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)
* //=> Thu Jul 10 2014 12:45:30.750
*/
function addMilliseconds(dirtyDate, dirtyAmount) {
var timestamp = parse(dirtyDate).getTime();
var amount = Number(dirtyAmount);
return new Date(timestamp + amount);
}
module.exports = addMilliseconds;
/***/ }),
/***/ "./node_modules/date-fns/add_minutes/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/add_minutes/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMilliseconds = __webpack_require__(/*! ../add_milliseconds/index.js */ "./node_modules/date-fns/add_milliseconds/index.js");
var MILLISECONDS_IN_MINUTE = 60000;
/**
* @category Minute Helpers
* @summary Add the specified number of minutes to the given date.
*
* @description
* Add the specified number of minutes to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of minutes to be added
* @returns {Date} the new date with the minutes added
*
* @example
* // Add 30 minutes to 10 July 2014 12:00:00:
* var result = addMinutes(new Date(2014, 6, 10, 12, 0), 30)
* //=> Thu Jul 10 2014 12:30:00
*/
function addMinutes(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMilliseconds(dirtyDate, amount * MILLISECONDS_IN_MINUTE);
}
module.exports = addMinutes;
/***/ }),
/***/ "./node_modules/date-fns/add_months/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/add_months/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var getDaysInMonth = __webpack_require__(/*! ../get_days_in_month/index.js */ "./node_modules/date-fns/get_days_in_month/index.js");
/**
* @category Month Helpers
* @summary Add the specified number of months to the given date.
*
* @description
* Add the specified number of months to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of months to be added
* @returns {Date} the new date with the months added
*
* @example
* // Add 5 months to 1 September 2014:
* var result = addMonths(new Date(2014, 8, 1), 5)
* //=> Sun Feb 01 2015 00:00:00
*/
function addMonths(dirtyDate, dirtyAmount) {
var date = parse(dirtyDate);
var amount = Number(dirtyAmount);
var desiredMonth = date.getMonth() + amount;
var dateWithDesiredMonth = new Date(0);
dateWithDesiredMonth.setFullYear(date.getFullYear(), desiredMonth, 1);
dateWithDesiredMonth.setHours(0, 0, 0, 0);
var daysInMonth = getDaysInMonth(dateWithDesiredMonth);
// Set the last day of the new month
// if the original date was the last day of the longer month
date.setMonth(desiredMonth, Math.min(daysInMonth, date.getDate()));
return date;
}
module.exports = addMonths;
/***/ }),
/***/ "./node_modules/date-fns/add_quarters/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/add_quarters/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMonths = __webpack_require__(/*! ../add_months/index.js */ "./node_modules/date-fns/add_months/index.js");
/**
* @category Quarter Helpers
* @summary Add the specified number of year quarters to the given date.
*
* @description
* Add the specified number of year quarters to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of quarters to be added
* @returns {Date} the new date with the quarters added
*
* @example
* // Add 1 quarter to 1 September 2014:
* var result = addQuarters(new Date(2014, 8, 1), 1)
* //=> Mon Dec 01 2014 00:00:00
*/
function addQuarters(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
var months = amount * 3;
return addMonths(dirtyDate, months);
}
module.exports = addQuarters;
/***/ }),
/***/ "./node_modules/date-fns/add_seconds/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/add_seconds/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMilliseconds = __webpack_require__(/*! ../add_milliseconds/index.js */ "./node_modules/date-fns/add_milliseconds/index.js");
/**
* @category Second Helpers
* @summary Add the specified number of seconds to the given date.
*
* @description
* Add the specified number of seconds to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of seconds to be added
* @returns {Date} the new date with the seconds added
*
* @example
* // Add 30 seconds to 10 July 2014 12:45:00:
* var result = addSeconds(new Date(2014, 6, 10, 12, 45, 0), 30)
* //=> Thu Jul 10 2014 12:45:30
*/
function addSeconds(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMilliseconds(dirtyDate, amount * 1000);
}
module.exports = addSeconds;
/***/ }),
/***/ "./node_modules/date-fns/add_weeks/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/add_weeks/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addDays = __webpack_require__(/*! ../add_days/index.js */ "./node_modules/date-fns/add_days/index.js");
/**
* @category Week Helpers
* @summary Add the specified number of weeks to the given date.
*
* @description
* Add the specified number of week to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of weeks to be added
* @returns {Date} the new date with the weeks added
*
* @example
* // Add 4 weeks to 1 September 2014:
* var result = addWeeks(new Date(2014, 8, 1), 4)
* //=> Mon Sep 29 2014 00:00:00
*/
function addWeeks(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
var days = amount * 7;
return addDays(dirtyDate, days);
}
module.exports = addWeeks;
/***/ }),
/***/ "./node_modules/date-fns/add_years/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/add_years/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMonths = __webpack_require__(/*! ../add_months/index.js */ "./node_modules/date-fns/add_months/index.js");
/**
* @category Year Helpers
* @summary Add the specified number of years to the given date.
*
* @description
* Add the specified number of years to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of years to be added
* @returns {Date} the new date with the years added
*
* @example
* // Add 5 years to 1 September 2014:
* var result = addYears(new Date(2014, 8, 1), 5)
* //=> Sun Sep 01 2019 00:00:00
*/
function addYears(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMonths(dirtyDate, amount * 12);
}
module.exports = addYears;
/***/ }),
/***/ "./node_modules/date-fns/are_ranges_overlapping/index.js":
/*!***************************************************************!*\
!*** ./node_modules/date-fns/are_ranges_overlapping/index.js ***!
\***************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Range Helpers
* @summary Is the given date range overlapping with another date range?
*
* @description
* Is the given date range overlapping with another date range?
*
* @param {Date|String|Number} initialRangeStartDate - the start of the initial range
* @param {Date|String|Number} initialRangeEndDate - the end of the initial range
* @param {Date|String|Number} comparedRangeStartDate - the start of the range to compare it with
* @param {Date|String|Number} comparedRangeEndDate - the end of the range to compare it with
* @returns {Boolean} whether the date ranges are overlapping
* @throws {Error} startDate of a date range cannot be after its endDate
*
* @example
* // For overlapping date ranges:
* areRangesOverlapping(
* new Date(2014, 0, 10), new Date(2014, 0, 20), new Date(2014, 0, 17), new Date(2014, 0, 21)
* )
* //=> true
*
* @example
* // For non-overlapping date ranges:
* areRangesOverlapping(
* new Date(2014, 0, 10), new Date(2014, 0, 20), new Date(2014, 0, 21), new Date(2014, 0, 22)
* )
* //=> false
*/
function areRangesOverlapping(dirtyInitialRangeStartDate, dirtyInitialRangeEndDate, dirtyComparedRangeStartDate, dirtyComparedRangeEndDate) {
var initialStartTime = parse(dirtyInitialRangeStartDate).getTime();
var initialEndTime = parse(dirtyInitialRangeEndDate).getTime();
var comparedStartTime = parse(dirtyComparedRangeStartDate).getTime();
var comparedEndTime = parse(dirtyComparedRangeEndDate).getTime();
if (initialStartTime > initialEndTime || comparedStartTime > comparedEndTime) {
throw new Error('The start of the range cannot be after the end of the range');
}
return initialStartTime < comparedEndTime && comparedStartTime < initialEndTime;
}
module.exports = areRangesOverlapping;
/***/ }),
/***/ "./node_modules/date-fns/closest_index_to/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/closest_index_to/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Return an index of the closest date from the array comparing to the given date.
*
* @description
* Return an index of the closest date from the array comparing to the given date.
*
* @param {Date|String|Number} dateToCompare - the date to compare with
* @param {Date[]|String[]|Number[]} datesArray - the array to search
* @returns {Number} an index of the date closest to the given date
* @throws {TypeError} the second argument must be an instance of Array
*
* @example
* // Which date is closer to 6 September 2015?
* var dateToCompare = new Date(2015, 8, 6)
* var datesArray = [
* new Date(2015, 0, 1),
* new Date(2016, 0, 1),
* new Date(2017, 0, 1)
* ]
* var result = closestIndexTo(dateToCompare, datesArray)
* //=> 1
*/
function closestIndexTo(dirtyDateToCompare, dirtyDatesArray) {
if (!(dirtyDatesArray instanceof Array)) {
throw new TypeError(toString.call(dirtyDatesArray) + ' is not an instance of Array');
}
var dateToCompare = parse(dirtyDateToCompare);
var timeToCompare = dateToCompare.getTime();
var result;
var minDistance;
dirtyDatesArray.forEach(function (dirtyDate, index) {
var currentDate = parse(dirtyDate);
var distance = Math.abs(timeToCompare - currentDate.getTime());
if (result === undefined || distance < minDistance) {
result = index;
minDistance = distance;
}
});
return result;
}
module.exports = closestIndexTo;
/***/ }),
/***/ "./node_modules/date-fns/closest_to/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/closest_to/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Return a date from the array closest to the given date.
*
* @description
* Return a date from the array closest to the given date.
*
* @param {Date|String|Number} dateToCompare - the date to compare with
* @param {Date[]|String[]|Number[]} datesArray - the array to search
* @returns {Date} the date from the array closest to the given date
* @throws {TypeError} the second argument must be an instance of Array
*
* @example
* // Which date is closer to 6 September 2015: 1 January 2000 or 1 January 2030?
* var dateToCompare = new Date(2015, 8, 6)
* var result = closestTo(dateToCompare, [
* new Date(2000, 0, 1),
* new Date(2030, 0, 1)
* ])
* //=> Tue Jan 01 2030 00:00:00
*/
function closestTo(dirtyDateToCompare, dirtyDatesArray) {
if (!(dirtyDatesArray instanceof Array)) {
throw new TypeError(toString.call(dirtyDatesArray) + ' is not an instance of Array');
}
var dateToCompare = parse(dirtyDateToCompare);
var timeToCompare = dateToCompare.getTime();
var result;
var minDistance;
dirtyDatesArray.forEach(function (dirtyDate) {
var currentDate = parse(dirtyDate);
var distance = Math.abs(timeToCompare - currentDate.getTime());
if (result === undefined || distance < minDistance) {
result = currentDate;
minDistance = distance;
}
});
return result;
}
module.exports = closestTo;
/***/ }),
/***/ "./node_modules/date-fns/compare_asc/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/compare_asc/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Compare the two dates and return -1, 0 or 1.
*
* @description
* Compare the two dates and return 1 if the first date is after the second,
* -1 if the first date is before the second or 0 if dates are equal.
*
* @param {Date|String|Number} dateLeft - the first date to compare
* @param {Date|String|Number} dateRight - the second date to compare
* @returns {Number} the result of the comparison
*
* @example
* // Compare 11 February 1987 and 10 July 1989:
* var result = compareAsc(
* new Date(1987, 1, 11),
* new Date(1989, 6, 10)
* )
* //=> -1
*
* @example
* // Sort the array of dates:
* var result = [
* new Date(1995, 6, 2),
* new Date(1987, 1, 11),
* new Date(1989, 6, 10)
* ].sort(compareAsc)
* //=> [
* // Wed Feb 11 1987 00:00:00,
* // Mon Jul 10 1989 00:00:00,
* // Sun Jul 02 1995 00:00:00
* // ]
*/
function compareAsc(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var timeLeft = dateLeft.getTime();
var dateRight = parse(dirtyDateRight);
var timeRight = dateRight.getTime();
if (timeLeft < timeRight) {
return -1;
}
else if (timeLeft > timeRight) {
return 1;
}
else {
return 0;
}
}
module.exports = compareAsc;
/***/ }),
/***/ "./node_modules/date-fns/compare_desc/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/compare_desc/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Compare the two dates reverse chronologically and return -1, 0 or 1.
*
* @description
* Compare the two dates and return -1 if the first date is after the second,
* 1 if the first date is before the second or 0 if dates are equal.
*
* @param {Date|String|Number} dateLeft - the first date to compare
* @param {Date|String|Number} dateRight - the second date to compare
* @returns {Number} the result of the comparison
*
* @example
* // Compare 11 February 1987 and 10 July 1989 reverse chronologically:
* var result = compareDesc(
* new Date(1987, 1, 11),
* new Date(1989, 6, 10)
* )
* //=> 1
*
* @example
* // Sort the array of dates in reverse chronological order:
* var result = [
* new Date(1995, 6, 2),
* new Date(1987, 1, 11),
* new Date(1989, 6, 10)
* ].sort(compareDesc)
* //=> [
* // Sun Jul 02 1995 00:00:00,
* // Mon Jul 10 1989 00:00:00,
* // Wed Feb 11 1987 00:00:00
* // ]
*/
function compareDesc(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var timeLeft = dateLeft.getTime();
var dateRight = parse(dirtyDateRight);
var timeRight = dateRight.getTime();
if (timeLeft > timeRight) {
return -1;
}
else if (timeLeft < timeRight) {
return 1;
}
else {
return 0;
}
}
module.exports = compareDesc;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_days/index.js":
/*!********************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_days/index.js ***!
\********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
var MILLISECONDS_IN_MINUTE = 60000;
var MILLISECONDS_IN_DAY = 86400000;
/**
* @category Day Helpers
* @summary Get the number of calendar days between the given dates.
*
* @description
* Get the number of calendar days between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar days
*
* @example
* // How many calendar days are between
* // 2 July 2011 23:00:00 and 2 July 2012 00:00:00?
* var result = differenceInCalendarDays(
* new Date(2012, 6, 2, 0, 0),
* new Date(2011, 6, 2, 23, 0)
* )
* //=> 366
*/
function differenceInCalendarDays(dirtyDateLeft, dirtyDateRight) {
var startOfDayLeft = startOfDay(dirtyDateLeft);
var startOfDayRight = startOfDay(dirtyDateRight);
var timestampLeft = startOfDayLeft.getTime() -
startOfDayLeft.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
var timestampRight = startOfDayRight.getTime() -
startOfDayRight.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
// Round the number of days to the nearest integer
// because the number of milliseconds in a day is not constant
// (e.g. it's different in the day of the daylight saving time clock shift)
return Math.round((timestampLeft - timestampRight) / MILLISECONDS_IN_DAY);
}
module.exports = differenceInCalendarDays;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_iso_weeks/index.js":
/*!*************************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_iso_weeks/index.js ***!
\*************************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
var MILLISECONDS_IN_MINUTE = 60000;
var MILLISECONDS_IN_WEEK = 604800000;
/**
* @category ISO Week Helpers
* @summary Get the number of calendar ISO weeks between the given dates.
*
* @description
* Get the number of calendar ISO weeks between the given dates.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar ISO weeks
*
* @example
* // How many calendar ISO weeks are between 6 July 2014 and 21 July 2014?
* var result = differenceInCalendarISOWeeks(
* new Date(2014, 6, 21),
* new Date(2014, 6, 6)
* )
* //=> 3
*/
function differenceInCalendarISOWeeks(dirtyDateLeft, dirtyDateRight) {
var startOfISOWeekLeft = startOfISOWeek(dirtyDateLeft);
var startOfISOWeekRight = startOfISOWeek(dirtyDateRight);
var timestampLeft = startOfISOWeekLeft.getTime() -
startOfISOWeekLeft.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
var timestampRight = startOfISOWeekRight.getTime() -
startOfISOWeekRight.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
// Round the number of days to the nearest integer
// because the number of milliseconds in a week is not constant
// (e.g. it's different in the week of the daylight saving time clock shift)
return Math.round((timestampLeft - timestampRight) / MILLISECONDS_IN_WEEK);
}
module.exports = differenceInCalendarISOWeeks;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_iso_years/index.js":
/*!*************************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_iso_years/index.js ***!
\*************************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Get the number of calendar ISO week-numbering years between the given dates.
*
* @description
* Get the number of calendar ISO week-numbering years between the given dates.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar ISO week-numbering years
*
* @example
* // How many calendar ISO week-numbering years are 1 January 2010 and 1 January 2012?
* var result = differenceInCalendarISOYears(
* new Date(2012, 0, 1),
* new Date(2010, 0, 1)
* )
* //=> 2
*/
function differenceInCalendarISOYears(dirtyDateLeft, dirtyDateRight) {
return getISOYear(dirtyDateLeft) - getISOYear(dirtyDateRight);
}
module.exports = differenceInCalendarISOYears;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_months/index.js":
/*!**********************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_months/index.js ***!
\**********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Get the number of calendar months between the given dates.
*
* @description
* Get the number of calendar months between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar months
*
* @example
* // How many calendar months are between 31 January 2014 and 1 September 2014?
* var result = differenceInCalendarMonths(
* new Date(2014, 8, 1),
* new Date(2014, 0, 31)
* )
* //=> 8
*/
function differenceInCalendarMonths(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var yearDiff = dateLeft.getFullYear() - dateRight.getFullYear();
var monthDiff = dateLeft.getMonth() - dateRight.getMonth();
return yearDiff * 12 + monthDiff;
}
module.exports = differenceInCalendarMonths;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_quarters/index.js":
/*!************************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_quarters/index.js ***!
\************************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getQuarter = __webpack_require__(/*! ../get_quarter/index.js */ "./node_modules/date-fns/get_quarter/index.js");
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Quarter Helpers
* @summary Get the number of calendar quarters between the given dates.
*
* @description
* Get the number of calendar quarters between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar quarters
*
* @example
* // How many calendar quarters are between 31 December 2013 and 2 July 2014?
* var result = differenceInCalendarQuarters(
* new Date(2014, 6, 2),
* new Date(2013, 11, 31)
* )
* //=> 3
*/
function differenceInCalendarQuarters(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var yearDiff = dateLeft.getFullYear() - dateRight.getFullYear();
var quarterDiff = getQuarter(dateLeft) - getQuarter(dateRight);
return yearDiff * 4 + quarterDiff;
}
module.exports = differenceInCalendarQuarters;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_weeks/index.js":
/*!*********************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_weeks/index.js ***!
\*********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfWeek = __webpack_require__(/*! ../start_of_week/index.js */ "./node_modules/date-fns/start_of_week/index.js");
var MILLISECONDS_IN_MINUTE = 60000;
var MILLISECONDS_IN_WEEK = 604800000;
/**
* @category Week Helpers
* @summary Get the number of calendar weeks between the given dates.
*
* @description
* Get the number of calendar weeks between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Number} the number of calendar weeks
*
* @example
* // How many calendar weeks are between 5 July 2014 and 20 July 2014?
* var result = differenceInCalendarWeeks(
* new Date(2014, 6, 20),
* new Date(2014, 6, 5)
* )
* //=> 3
*
* @example
* // If the week starts on Monday,
* // how many calendar weeks are between 5 July 2014 and 20 July 2014?
* var result = differenceInCalendarWeeks(
* new Date(2014, 6, 20),
* new Date(2014, 6, 5),
* {weekStartsOn: 1}
* )
* //=> 2
*/
function differenceInCalendarWeeks(dirtyDateLeft, dirtyDateRight, dirtyOptions) {
var startOfWeekLeft = startOfWeek(dirtyDateLeft, dirtyOptions);
var startOfWeekRight = startOfWeek(dirtyDateRight, dirtyOptions);
var timestampLeft = startOfWeekLeft.getTime() -
startOfWeekLeft.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
var timestampRight = startOfWeekRight.getTime() -
startOfWeekRight.getTimezoneOffset() * MILLISECONDS_IN_MINUTE;
// Round the number of days to the nearest integer
// because the number of milliseconds in a week is not constant
// (e.g. it's different in the week of the daylight saving time clock shift)
return Math.round((timestampLeft - timestampRight) / MILLISECONDS_IN_WEEK);
}
module.exports = differenceInCalendarWeeks;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_calendar_years/index.js":
/*!*********************************************************************!*\
!*** ./node_modules/date-fns/difference_in_calendar_years/index.js ***!
\*********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Get the number of calendar years between the given dates.
*
* @description
* Get the number of calendar years between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of calendar years
*
* @example
* // How many calendar years are between 31 December 2013 and 11 February 2015?
* var result = differenceInCalendarYears(
* new Date(2015, 1, 11),
* new Date(2013, 11, 31)
* )
* //=> 2
*/
function differenceInCalendarYears(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
return dateLeft.getFullYear() - dateRight.getFullYear();
}
module.exports = differenceInCalendarYears;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_days/index.js":
/*!***********************************************************!*\
!*** ./node_modules/date-fns/difference_in_days/index.js ***!
\***********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInCalendarDays = __webpack_require__(/*! ../difference_in_calendar_days/index.js */ "./node_modules/date-fns/difference_in_calendar_days/index.js");
var compareAsc = __webpack_require__(/*! ../compare_asc/index.js */ "./node_modules/date-fns/compare_asc/index.js");
/**
* @category Day Helpers
* @summary Get the number of full days between the given dates.
*
* @description
* Get the number of full days between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full days
*
* @example
* // How many full days are between
* // 2 July 2011 23:00:00 and 2 July 2012 00:00:00?
* var result = differenceInDays(
* new Date(2012, 6, 2, 0, 0),
* new Date(2011, 6, 2, 23, 0)
* )
* //=> 365
*/
function differenceInDays(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var sign = compareAsc(dateLeft, dateRight);
var difference = Math.abs(differenceInCalendarDays(dateLeft, dateRight));
dateLeft.setDate(dateLeft.getDate() - sign * difference);
// Math.abs(diff in full days - diff in calendar days) === 1 if last calendar day is not full
// If so, result must be decreased by 1 in absolute value
var isLastDayNotFull = compareAsc(dateLeft, dateRight) === -sign;
return sign * (difference - isLastDayNotFull);
}
module.exports = differenceInDays;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_hours/index.js":
/*!************************************************************!*\
!*** ./node_modules/date-fns/difference_in_hours/index.js ***!
\************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var differenceInMilliseconds = __webpack_require__(/*! ../difference_in_milliseconds/index.js */ "./node_modules/date-fns/difference_in_milliseconds/index.js");
var MILLISECONDS_IN_HOUR = 3600000;
/**
* @category Hour Helpers
* @summary Get the number of hours between the given dates.
*
* @description
* Get the number of hours between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of hours
*
* @example
* // How many hours are between 2 July 2014 06:50:00 and 2 July 2014 19:00:00?
* var result = differenceInHours(
* new Date(2014, 6, 2, 19, 0),
* new Date(2014, 6, 2, 6, 50)
* )
* //=> 12
*/
function differenceInHours(dirtyDateLeft, dirtyDateRight) {
var diff = differenceInMilliseconds(dirtyDateLeft, dirtyDateRight) / MILLISECONDS_IN_HOUR;
return diff > 0 ? Math.floor(diff) : Math.ceil(diff);
}
module.exports = differenceInHours;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_iso_years/index.js":
/*!****************************************************************!*\
!*** ./node_modules/date-fns/difference_in_iso_years/index.js ***!
\****************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInCalendarISOYears = __webpack_require__(/*! ../difference_in_calendar_iso_years/index.js */ "./node_modules/date-fns/difference_in_calendar_iso_years/index.js");
var compareAsc = __webpack_require__(/*! ../compare_asc/index.js */ "./node_modules/date-fns/compare_asc/index.js");
var subISOYears = __webpack_require__(/*! ../sub_iso_years/index.js */ "./node_modules/date-fns/sub_iso_years/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Get the number of full ISO week-numbering years between the given dates.
*
* @description
* Get the number of full ISO week-numbering years between the given dates.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full ISO week-numbering years
*
* @example
* // How many full ISO week-numbering years are between 1 January 2010 and 1 January 2012?
* var result = differenceInISOYears(
* new Date(2012, 0, 1),
* new Date(2010, 0, 1)
* )
* //=> 1
*/
function differenceInISOYears(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var sign = compareAsc(dateLeft, dateRight);
var difference = Math.abs(differenceInCalendarISOYears(dateLeft, dateRight));
dateLeft = subISOYears(dateLeft, sign * difference);
// Math.abs(diff in full ISO years - diff in calendar ISO years) === 1
// if last calendar ISO year is not full
// If so, result must be decreased by 1 in absolute value
var isLastISOYearNotFull = compareAsc(dateLeft, dateRight) === -sign;
return sign * (difference - isLastISOYearNotFull);
}
module.exports = differenceInISOYears;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_milliseconds/index.js":
/*!*******************************************************************!*\
!*** ./node_modules/date-fns/difference_in_milliseconds/index.js ***!
\*******************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Millisecond Helpers
* @summary Get the number of milliseconds between the given dates.
*
* @description
* Get the number of milliseconds between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of milliseconds
*
* @example
* // How many milliseconds are between
* // 2 July 2014 12:30:20.600 and 2 July 2014 12:30:21.700?
* var result = differenceInMilliseconds(
* new Date(2014, 6, 2, 12, 30, 21, 700),
* new Date(2014, 6, 2, 12, 30, 20, 600)
* )
* //=> 1100
*/
function differenceInMilliseconds(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
return dateLeft.getTime() - dateRight.getTime();
}
module.exports = differenceInMilliseconds;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_minutes/index.js":
/*!**************************************************************!*\
!*** ./node_modules/date-fns/difference_in_minutes/index.js ***!
\**************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var differenceInMilliseconds = __webpack_require__(/*! ../difference_in_milliseconds/index.js */ "./node_modules/date-fns/difference_in_milliseconds/index.js");
var MILLISECONDS_IN_MINUTE = 60000;
/**
* @category Minute Helpers
* @summary Get the number of minutes between the given dates.
*
* @description
* Get the number of minutes between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of minutes
*
* @example
* // How many minutes are between 2 July 2014 12:07:59 and 2 July 2014 12:20:00?
* var result = differenceInMinutes(
* new Date(2014, 6, 2, 12, 20, 0),
* new Date(2014, 6, 2, 12, 7, 59)
* )
* //=> 12
*/
function differenceInMinutes(dirtyDateLeft, dirtyDateRight) {
var diff = differenceInMilliseconds(dirtyDateLeft, dirtyDateRight) / MILLISECONDS_IN_MINUTE;
return diff > 0 ? Math.floor(diff) : Math.ceil(diff);
}
module.exports = differenceInMinutes;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_months/index.js":
/*!*************************************************************!*\
!*** ./node_modules/date-fns/difference_in_months/index.js ***!
\*************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInCalendarMonths = __webpack_require__(/*! ../difference_in_calendar_months/index.js */ "./node_modules/date-fns/difference_in_calendar_months/index.js");
var compareAsc = __webpack_require__(/*! ../compare_asc/index.js */ "./node_modules/date-fns/compare_asc/index.js");
/**
* @category Month Helpers
* @summary Get the number of full months between the given dates.
*
* @description
* Get the number of full months between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full months
*
* @example
* // How many full months are between 31 January 2014 and 1 September 2014?
* var result = differenceInMonths(
* new Date(2014, 8, 1),
* new Date(2014, 0, 31)
* )
* //=> 7
*/
function differenceInMonths(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var sign = compareAsc(dateLeft, dateRight);
var difference = Math.abs(differenceInCalendarMonths(dateLeft, dateRight));
dateLeft.setMonth(dateLeft.getMonth() - sign * difference);
// Math.abs(diff in full months - diff in calendar months) === 1 if last calendar month is not full
// If so, result must be decreased by 1 in absolute value
var isLastMonthNotFull = compareAsc(dateLeft, dateRight) === -sign;
return sign * (difference - isLastMonthNotFull);
}
module.exports = differenceInMonths;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_quarters/index.js":
/*!***************************************************************!*\
!*** ./node_modules/date-fns/difference_in_quarters/index.js ***!
\***************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var differenceInMonths = __webpack_require__(/*! ../difference_in_months/index.js */ "./node_modules/date-fns/difference_in_months/index.js");
/**
* @category Quarter Helpers
* @summary Get the number of full quarters between the given dates.
*
* @description
* Get the number of full quarters between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full quarters
*
* @example
* // How many full quarters are between 31 December 2013 and 2 July 2014?
* var result = differenceInQuarters(
* new Date(2014, 6, 2),
* new Date(2013, 11, 31)
* )
* //=> 2
*/
function differenceInQuarters(dirtyDateLeft, dirtyDateRight) {
var diff = differenceInMonths(dirtyDateLeft, dirtyDateRight) / 3;
return diff > 0 ? Math.floor(diff) : Math.ceil(diff);
}
module.exports = differenceInQuarters;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_seconds/index.js":
/*!**************************************************************!*\
!*** ./node_modules/date-fns/difference_in_seconds/index.js ***!
\**************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var differenceInMilliseconds = __webpack_require__(/*! ../difference_in_milliseconds/index.js */ "./node_modules/date-fns/difference_in_milliseconds/index.js");
/**
* @category Second Helpers
* @summary Get the number of seconds between the given dates.
*
* @description
* Get the number of seconds between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of seconds
*
* @example
* // How many seconds are between
* // 2 July 2014 12:30:07.999 and 2 July 2014 12:30:20.000?
* var result = differenceInSeconds(
* new Date(2014, 6, 2, 12, 30, 20, 0),
* new Date(2014, 6, 2, 12, 30, 7, 999)
* )
* //=> 12
*/
function differenceInSeconds(dirtyDateLeft, dirtyDateRight) {
var diff = differenceInMilliseconds(dirtyDateLeft, dirtyDateRight) / 1000;
return diff > 0 ? Math.floor(diff) : Math.ceil(diff);
}
module.exports = differenceInSeconds;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_weeks/index.js":
/*!************************************************************!*\
!*** ./node_modules/date-fns/difference_in_weeks/index.js ***!
\************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var differenceInDays = __webpack_require__(/*! ../difference_in_days/index.js */ "./node_modules/date-fns/difference_in_days/index.js");
/**
* @category Week Helpers
* @summary Get the number of full weeks between the given dates.
*
* @description
* Get the number of full weeks between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full weeks
*
* @example
* // How many full weeks are between 5 July 2014 and 20 July 2014?
* var result = differenceInWeeks(
* new Date(2014, 6, 20),
* new Date(2014, 6, 5)
* )
* //=> 2
*/
function differenceInWeeks(dirtyDateLeft, dirtyDateRight) {
var diff = differenceInDays(dirtyDateLeft, dirtyDateRight) / 7;
return diff > 0 ? Math.floor(diff) : Math.ceil(diff);
}
module.exports = differenceInWeeks;
/***/ }),
/***/ "./node_modules/date-fns/difference_in_years/index.js":
/*!************************************************************!*\
!*** ./node_modules/date-fns/difference_in_years/index.js ***!
\************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInCalendarYears = __webpack_require__(/*! ../difference_in_calendar_years/index.js */ "./node_modules/date-fns/difference_in_calendar_years/index.js");
var compareAsc = __webpack_require__(/*! ../compare_asc/index.js */ "./node_modules/date-fns/compare_asc/index.js");
/**
* @category Year Helpers
* @summary Get the number of full years between the given dates.
*
* @description
* Get the number of full years between the given dates.
*
* @param {Date|String|Number} dateLeft - the later date
* @param {Date|String|Number} dateRight - the earlier date
* @returns {Number} the number of full years
*
* @example
* // How many full years are between 31 December 2013 and 11 February 2015?
* var result = differenceInYears(
* new Date(2015, 1, 11),
* new Date(2013, 11, 31)
* )
* //=> 1
*/
function differenceInYears(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
var sign = compareAsc(dateLeft, dateRight);
var difference = Math.abs(differenceInCalendarYears(dateLeft, dateRight));
dateLeft.setFullYear(dateLeft.getFullYear() - sign * difference);
// Math.abs(diff in full years - diff in calendar years) === 1 if last calendar year is not full
// If so, result must be decreased by 1 in absolute value
var isLastYearNotFull = compareAsc(dateLeft, dateRight) === -sign;
return sign * (difference - isLastYearNotFull);
}
module.exports = differenceInYears;
/***/ }),
/***/ "./node_modules/date-fns/distance_in_words/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/distance_in_words/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var compareDesc = __webpack_require__(/*! ../compare_desc/index.js */ "./node_modules/date-fns/compare_desc/index.js");
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInSeconds = __webpack_require__(/*! ../difference_in_seconds/index.js */ "./node_modules/date-fns/difference_in_seconds/index.js");
var differenceInMonths = __webpack_require__(/*! ../difference_in_months/index.js */ "./node_modules/date-fns/difference_in_months/index.js");
var enLocale = __webpack_require__(/*! ../locale/en/index.js */ "./node_modules/date-fns/locale/en/index.js");
var MINUTES_IN_DAY = 1440;
var MINUTES_IN_ALMOST_TWO_DAYS = 2520;
var MINUTES_IN_MONTH = 43200;
var MINUTES_IN_TWO_MONTHS = 86400;
/**
* @category Common Helpers
* @summary Return the distance between the given dates in words.
*
* @description
* Return the distance between the given dates in words.
*
* | Distance between dates | Result |
* |-------------------------------------------------------------------|---------------------|
* | 0 ... 30 secs | less than a minute |
* | 30 secs ... 1 min 30 secs | 1 minute |
* | 1 min 30 secs ... 44 mins 30 secs | [2..44] minutes |
* | 44 mins ... 30 secs ... 89 mins 30 secs | about 1 hour |
* | 89 mins 30 secs ... 23 hrs 59 mins 30 secs | about [2..24] hours |
* | 23 hrs 59 mins 30 secs ... 41 hrs 59 mins 30 secs | 1 day |
* | 41 hrs 59 mins 30 secs ... 29 days 23 hrs 59 mins 30 secs | [2..30] days |
* | 29 days 23 hrs 59 mins 30 secs ... 44 days 23 hrs 59 mins 30 secs | about 1 month |
* | 44 days 23 hrs 59 mins 30 secs ... 59 days 23 hrs 59 mins 30 secs | about 2 months |
* | 59 days 23 hrs 59 mins 30 secs ... 1 yr | [2..12] months |
* | 1 yr ... 1 yr 3 months | about 1 year |
* | 1 yr 3 months ... 1 yr 9 month s | over 1 year |
* | 1 yr 9 months ... 2 yrs | almost 2 years |
* | N yrs ... N yrs 3 months | about N years |
* | N yrs 3 months ... N yrs 9 months | over N years |
* | N yrs 9 months ... N+1 yrs | almost N+1 years |
*
* With `options.includeSeconds == true`:
* | Distance between dates | Result |
* |------------------------|----------------------|
* | 0 secs ... 5 secs | less than 5 seconds |
* | 5 secs ... 10 secs | less than 10 seconds |
* | 10 secs ... 20 secs | less than 20 seconds |
* | 20 secs ... 40 secs | half a minute |
* | 40 secs ... 60 secs | less than a minute |
* | 60 secs ... 90 secs | 1 minute |
*
* @param {Date|String|Number} dateToCompare - the date to compare with
* @param {Date|String|Number} date - the other date
* @param {Object} [options] - the object with options
* @param {Boolean} [options.includeSeconds=false] - distances less than a minute are more detailed
* @param {Boolean} [options.addSuffix=false] - result indicates if the second date is earlier or later than the first
* @param {Object} [options.locale=enLocale] - the locale object
* @returns {String} the distance in words
*
* @example
* // What is the distance between 2 July 2014 and 1 January 2015?
* var result = distanceInWords(
* new Date(2014, 6, 2),
* new Date(2015, 0, 1)
* )
* //=> '6 months'
*
* @example
* // What is the distance between 1 January 2015 00:00:15
* // and 1 January 2015 00:00:00, including seconds?
* var result = distanceInWords(
* new Date(2015, 0, 1, 0, 0, 15),
* new Date(2015, 0, 1, 0, 0, 0),
* {includeSeconds: true}
* )
* //=> 'less than 20 seconds'
*
* @example
* // What is the distance from 1 January 2016
* // to 1 January 2015, with a suffix?
* var result = distanceInWords(
* new Date(2016, 0, 1),
* new Date(2015, 0, 1),
* {addSuffix: true}
* )
* //=> 'about 1 year ago'
*
* @example
* // What is the distance between 1 August 2016 and 1 January 2015 in Esperanto?
* var eoLocale = require('date-fns/locale/eo')
* var result = distanceInWords(
* new Date(2016, 7, 1),
* new Date(2015, 0, 1),
* {locale: eoLocale}
* )
* //=> 'pli ol 1 jaro'
*/
function distanceInWords(dirtyDateToCompare, dirtyDate, dirtyOptions) {
var options = dirtyOptions || {};
var comparison = compareDesc(dirtyDateToCompare, dirtyDate);
var locale = options.locale;
var localize = enLocale.distanceInWords.localize;
if (locale && locale.distanceInWords && locale.distanceInWords.localize) {
localize = locale.distanceInWords.localize;
}
var localizeOptions = {
addSuffix: Boolean(options.addSuffix),
comparison: comparison
};
var dateLeft, dateRight;
if (comparison > 0) {
dateLeft = parse(dirtyDateToCompare);
dateRight = parse(dirtyDate);
}
else {
dateLeft = parse(dirtyDate);
dateRight = parse(dirtyDateToCompare);
}
var seconds = differenceInSeconds(dateRight, dateLeft);
var offset = dateRight.getTimezoneOffset() - dateLeft.getTimezoneOffset();
var minutes = Math.round(seconds / 60) - offset;
var months;
// 0 up to 2 mins
if (minutes < 2) {
if (options.includeSeconds) {
if (seconds < 5) {
return localize('lessThanXSeconds', 5, localizeOptions);
}
else if (seconds < 10) {
return localize('lessThanXSeconds', 10, localizeOptions);
}
else if (seconds < 20) {
return localize('lessThanXSeconds', 20, localizeOptions);
}
else if (seconds < 40) {
return localize('halfAMinute', null, localizeOptions);
}
else if (seconds < 60) {
return localize('lessThanXMinutes', 1, localizeOptions);
}
else {
return localize('xMinutes', 1, localizeOptions);
}
}
else {
if (minutes === 0) {
return localize('lessThanXMinutes', 1, localizeOptions);
}
else {
return localize('xMinutes', minutes, localizeOptions);
}
}
// 2 mins up to 0.75 hrs
}
else if (minutes < 45) {
return localize('xMinutes', minutes, localizeOptions);
// 0.75 hrs up to 1.5 hrs
}
else if (minutes < 90) {
return localize('aboutXHours', 1, localizeOptions);
// 1.5 hrs up to 24 hrs
}
else if (minutes < MINUTES_IN_DAY) {
var hours = Math.round(minutes / 60);
return localize('aboutXHours', hours, localizeOptions);
// 1 day up to 1.75 days
}
else if (minutes < MINUTES_IN_ALMOST_TWO_DAYS) {
return localize('xDays', 1, localizeOptions);
// 1.75 days up to 30 days
}
else if (minutes < MINUTES_IN_MONTH) {
var days = Math.round(minutes / MINUTES_IN_DAY);
return localize('xDays', days, localizeOptions);
// 1 month up to 2 months
}
else if (minutes < MINUTES_IN_TWO_MONTHS) {
months = Math.round(minutes / MINUTES_IN_MONTH);
return localize('aboutXMonths', months, localizeOptions);
}
months = differenceInMonths(dateRight, dateLeft);
// 2 months up to 12 months
if (months < 12) {
var nearestMonth = Math.round(minutes / MINUTES_IN_MONTH);
return localize('xMonths', nearestMonth, localizeOptions);
// 1 year up to max Date
}
else {
var monthsSinceStartOfYear = months % 12;
var years = Math.floor(months / 12);
// N years up to 1 years 3 months
if (monthsSinceStartOfYear < 3) {
return localize('aboutXYears', years, localizeOptions);
// N years 3 months up to N years 9 months
}
else if (monthsSinceStartOfYear < 9) {
return localize('overXYears', years, localizeOptions);
// N years 9 months up to N year 12 months
}
else {
return localize('almostXYears', years + 1, localizeOptions);
}
}
}
module.exports = distanceInWords;
/***/ }),
/***/ "./node_modules/date-fns/distance_in_words_strict/index.js":
/*!*****************************************************************!*\
!*** ./node_modules/date-fns/distance_in_words_strict/index.js ***!
\*****************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var compareDesc = __webpack_require__(/*! ../compare_desc/index.js */ "./node_modules/date-fns/compare_desc/index.js");
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var differenceInSeconds = __webpack_require__(/*! ../difference_in_seconds/index.js */ "./node_modules/date-fns/difference_in_seconds/index.js");
var enLocale = __webpack_require__(/*! ../locale/en/index.js */ "./node_modules/date-fns/locale/en/index.js");
var MINUTES_IN_DAY = 1440;
var MINUTES_IN_MONTH = 43200;
var MINUTES_IN_YEAR = 525600;
/**
* @category Common Helpers
* @summary Return the distance between the given dates in words.
*
* @description
* Return the distance between the given dates in words, using strict units.
* This is like `distanceInWords`, but does not use helpers like 'almost', 'over',
* 'less than' and the like.
*
* | Distance between dates | Result |
* |------------------------|---------------------|
* | 0 ... 59 secs | [0..59] seconds |
* | 1 ... 59 mins | [1..59] minutes |
* | 1 ... 23 hrs | [1..23] hours |
* | 1 ... 29 days | [1..29] days |
* | 1 ... 11 months | [1..11] months |
* | 1 ... N years | [1..N] years |
*
* @param {Date|String|Number} dateToCompare - the date to compare with
* @param {Date|String|Number} date - the other date
* @param {Object} [options] - the object with options
* @param {Boolean} [options.addSuffix=false] - result indicates if the second date is earlier or later than the first
* @param {'s'|'m'|'h'|'d'|'M'|'Y'} [options.unit] - if specified, will force a unit
* @param {'floor'|'ceil'|'round'} [options.partialMethod='floor'] - which way to round partial units
* @param {Object} [options.locale=enLocale] - the locale object
* @returns {String} the distance in words
*
* @example
* // What is the distance between 2 July 2014 and 1 January 2015?
* var result = distanceInWordsStrict(
* new Date(2014, 6, 2),
* new Date(2015, 0, 2)
* )
* //=> '6 months'
*
* @example
* // What is the distance between 1 January 2015 00:00:15
* // and 1 January 2015 00:00:00?
* var result = distanceInWordsStrict(
* new Date(2015, 0, 1, 0, 0, 15),
* new Date(2015, 0, 1, 0, 0, 0),
* )
* //=> '15 seconds'
*
* @example
* // What is the distance from 1 January 2016
* // to 1 January 2015, with a suffix?
* var result = distanceInWordsStrict(
* new Date(2016, 0, 1),
* new Date(2015, 0, 1),
* {addSuffix: true}
* )
* //=> '1 year ago'
*
* @example
* // What is the distance from 1 January 2016
* // to 1 January 2015, in minutes?
* var result = distanceInWordsStrict(
* new Date(2016, 0, 1),
* new Date(2015, 0, 1),
* {unit: 'm'}
* )
* //=> '525600 minutes'
*
* @example
* // What is the distance from 1 January 2016
* // to 28 January 2015, in months, rounded up?
* var result = distanceInWordsStrict(
* new Date(2015, 0, 28),
* new Date(2015, 0, 1),
* {unit: 'M', partialMethod: 'ceil'}
* )
* //=> '1 month'
*
* @example
* // What is the distance between 1 August 2016 and 1 January 2015 in Esperanto?
* var eoLocale = require('date-fns/locale/eo')
* var result = distanceInWordsStrict(
* new Date(2016, 7, 1),
* new Date(2015, 0, 1),
* {locale: eoLocale}
* )
* //=> '1 jaro'
*/
function distanceInWordsStrict(dirtyDateToCompare, dirtyDate, dirtyOptions) {
var options = dirtyOptions || {};
var comparison = compareDesc(dirtyDateToCompare, dirtyDate);
var locale = options.locale;
var localize = enLocale.distanceInWords.localize;
if (locale && locale.distanceInWords && locale.distanceInWords.localize) {
localize = locale.distanceInWords.localize;
}
var localizeOptions = {
addSuffix: Boolean(options.addSuffix),
comparison: comparison
};
var dateLeft, dateRight;
if (comparison > 0) {
dateLeft = parse(dirtyDateToCompare);
dateRight = parse(dirtyDate);
}
else {
dateLeft = parse(dirtyDate);
dateRight = parse(dirtyDateToCompare);
}
var unit;
var mathPartial = Math[options.partialMethod ? String(options.partialMethod) : 'floor'];
var seconds = differenceInSeconds(dateRight, dateLeft);
var offset = dateRight.getTimezoneOffset() - dateLeft.getTimezoneOffset();
var minutes = mathPartial(seconds / 60) - offset;
var hours, days, months, years;
if (options.unit) {
unit = String(options.unit);
}
else {
if (minutes < 1) {
unit = 's';
}
else if (minutes < 60) {
unit = 'm';
}
else if (minutes < MINUTES_IN_DAY) {
unit = 'h';
}
else if (minutes < MINUTES_IN_MONTH) {
unit = 'd';
}
else if (minutes < MINUTES_IN_YEAR) {
unit = 'M';
}
else {
unit = 'Y';
}
}
// 0 up to 60 seconds
if (unit === 's') {
return localize('xSeconds', seconds, localizeOptions);
// 1 up to 60 mins
}
else if (unit === 'm') {
return localize('xMinutes', minutes, localizeOptions);
// 1 up to 24 hours
}
else if (unit === 'h') {
hours = mathPartial(minutes / 60);
return localize('xHours', hours, localizeOptions);
// 1 up to 30 days
}
else if (unit === 'd') {
days = mathPartial(minutes / MINUTES_IN_DAY);
return localize('xDays', days, localizeOptions);
// 1 up to 12 months
}
else if (unit === 'M') {
months = mathPartial(minutes / MINUTES_IN_MONTH);
return localize('xMonths', months, localizeOptions);
// 1 year up to max Date
}
else if (unit === 'Y') {
years = mathPartial(minutes / MINUTES_IN_YEAR);
return localize('xYears', years, localizeOptions);
}
throw new Error('Unknown unit: ' + unit);
}
module.exports = distanceInWordsStrict;
/***/ }),
/***/ "./node_modules/date-fns/distance_in_words_to_now/index.js":
/*!*****************************************************************!*\
!*** ./node_modules/date-fns/distance_in_words_to_now/index.js ***!
\*****************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var distanceInWords = __webpack_require__(/*! ../distance_in_words/index.js */ "./node_modules/date-fns/distance_in_words/index.js");
/**
* @category Common Helpers
* @summary Return the distance between the given date and now in words.
*
* @description
* Return the distance between the given date and now in words.
*
* | Distance to now | Result |
* |-------------------------------------------------------------------|---------------------|
* | 0 ... 30 secs | less than a minute |
* | 30 secs ... 1 min 30 secs | 1 minute |
* | 1 min 30 secs ... 44 mins 30 secs | [2..44] minutes |
* | 44 mins ... 30 secs ... 89 mins 30 secs | about 1 hour |
* | 89 mins 30 secs ... 23 hrs 59 mins 30 secs | about [2..24] hours |
* | 23 hrs 59 mins 30 secs ... 41 hrs 59 mins 30 secs | 1 day |
* | 41 hrs 59 mins 30 secs ... 29 days 23 hrs 59 mins 30 secs | [2..30] days |
* | 29 days 23 hrs 59 mins 30 secs ... 44 days 23 hrs 59 mins 30 secs | about 1 month |
* | 44 days 23 hrs 59 mins 30 secs ... 59 days 23 hrs 59 mins 30 secs | about 2 months |
* | 59 days 23 hrs 59 mins 30 secs ... 1 yr | [2..12] months |
* | 1 yr ... 1 yr 3 months | about 1 year |
* | 1 yr 3 months ... 1 yr 9 month s | over 1 year |
* | 1 yr 9 months ... 2 yrs | almost 2 years |
* | N yrs ... N yrs 3 months | about N years |
* | N yrs 3 months ... N yrs 9 months | over N years |
* | N yrs 9 months ... N+1 yrs | almost N+1 years |
*
* With `options.includeSeconds == true`:
* | Distance to now | Result |
* |---------------------|----------------------|
* | 0 secs ... 5 secs | less than 5 seconds |
* | 5 secs ... 10 secs | less than 10 seconds |
* | 10 secs ... 20 secs | less than 20 seconds |
* | 20 secs ... 40 secs | half a minute |
* | 40 secs ... 60 secs | less than a minute |
* | 60 secs ... 90 secs | 1 minute |
*
* @param {Date|String|Number} date - the given date
* @param {Object} [options] - the object with options
* @param {Boolean} [options.includeSeconds=false] - distances less than a minute are more detailed
* @param {Boolean} [options.addSuffix=false] - result specifies if the second date is earlier or later than the first
* @param {Object} [options.locale=enLocale] - the locale object
* @returns {String} the distance in words
*
* @example
* // If today is 1 January 2015, what is the distance to 2 July 2014?
* var result = distanceInWordsToNow(
* new Date(2014, 6, 2)
* )
* //=> '6 months'
*
* @example
* // If now is 1 January 2015 00:00:00,
* // what is the distance to 1 January 2015 00:00:15, including seconds?
* var result = distanceInWordsToNow(
* new Date(2015, 0, 1, 0, 0, 15),
* {includeSeconds: true}
* )
* //=> 'less than 20 seconds'
*
* @example
* // If today is 1 January 2015,
* // what is the distance to 1 January 2016, with a suffix?
* var result = distanceInWordsToNow(
* new Date(2016, 0, 1),
* {addSuffix: true}
* )
* //=> 'in about 1 year'
*
* @example
* // If today is 1 January 2015,
* // what is the distance to 1 August 2016 in Esperanto?
* var eoLocale = require('date-fns/locale/eo')
* var result = distanceInWordsToNow(
* new Date(2016, 7, 1),
* {locale: eoLocale}
* )
* //=> 'pli ol 1 jaro'
*/
function distanceInWordsToNow(dirtyDate, dirtyOptions) {
return distanceInWords(Date.now(), dirtyDate, dirtyOptions);
}
module.exports = distanceInWordsToNow;
/***/ }),
/***/ "./node_modules/date-fns/each_day/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/each_day/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Return the array of dates within the specified range.
*
* @description
* Return the array of dates within the specified range.
*
* @param {Date|String|Number} startDate - the first date
* @param {Date|String|Number} endDate - the last date
* @param {Number} [step=1] - the step between each day
* @returns {Date[]} the array with starts of days from the day of startDate to the day of endDate
* @throws {Error} startDate cannot be after endDate
*
* @example
* // Each day between 6 October 2014 and 10 October 2014:
* var result = eachDay(
* new Date(2014, 9, 6),
* new Date(2014, 9, 10)
* )
* //=> [
* // Mon Oct 06 2014 00:00:00,
* // Tue Oct 07 2014 00:00:00,
* // Wed Oct 08 2014 00:00:00,
* // Thu Oct 09 2014 00:00:00,
* // Fri Oct 10 2014 00:00:00
* // ]
*/
function eachDay(dirtyStartDate, dirtyEndDate, dirtyStep) {
var startDate = parse(dirtyStartDate);
var endDate = parse(dirtyEndDate);
var step = dirtyStep !== undefined ? dirtyStep : 1;
var endTime = endDate.getTime();
if (startDate.getTime() > endTime) {
throw new Error('The first date cannot be after the second date');
}
var dates = [];
var currentDate = startDate;
currentDate.setHours(0, 0, 0, 0);
while (currentDate.getTime() <= endTime) {
dates.push(parse(currentDate));
currentDate.setDate(currentDate.getDate() + step);
}
return dates;
}
module.exports = eachDay;
/***/ }),
/***/ "./node_modules/date-fns/end_of_day/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/end_of_day/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Return the end of a day for the given date.
*
* @description
* Return the end of a day for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a day
*
* @example
* // The end of a day for 2 September 2014 11:55:00:
* var result = endOfDay(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 02 2014 23:59:59.999
*/
function endOfDay(dirtyDate) {
var date = parse(dirtyDate);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfDay;
/***/ }),
/***/ "./node_modules/date-fns/end_of_hour/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/end_of_hour/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Hour Helpers
* @summary Return the end of an hour for the given date.
*
* @description
* Return the end of an hour for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of an hour
*
* @example
* // The end of an hour for 2 September 2014 11:55:00:
* var result = endOfHour(new Date(2014, 8, 2, 11, 55))
* //=> Tue Sep 02 2014 11:59:59.999
*/
function endOfHour(dirtyDate) {
var date = parse(dirtyDate);
date.setMinutes(59, 59, 999);
return date;
}
module.exports = endOfHour;
/***/ }),
/***/ "./node_modules/date-fns/end_of_iso_week/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/end_of_iso_week/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var endOfWeek = __webpack_require__(/*! ../end_of_week/index.js */ "./node_modules/date-fns/end_of_week/index.js");
/**
* @category ISO Week Helpers
* @summary Return the end of an ISO week for the given date.
*
* @description
* Return the end of an ISO week for the given date.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of an ISO week
*
* @example
* // The end of an ISO week for 2 September 2014 11:55:00:
* var result = endOfISOWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Sun Sep 07 2014 23:59:59.999
*/
function endOfISOWeek(dirtyDate) {
return endOfWeek(dirtyDate, { weekStartsOn: 1 });
}
module.exports = endOfISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/end_of_iso_year/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/end_of_iso_year/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Return the end of an ISO week-numbering year for the given date.
*
* @description
* Return the end of an ISO week-numbering year,
* which always starts 3 days before the year's first Thursday.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of an ISO week-numbering year
*
* @example
* // The end of an ISO week-numbering year for 2 July 2005:
* var result = endOfISOYear(new Date(2005, 6, 2))
* //=> Sun Jan 01 2006 23:59:59.999
*/
function endOfISOYear(dirtyDate) {
var year = getISOYear(dirtyDate);
var fourthOfJanuaryOfNextYear = new Date(0);
fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4);
fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0);
var date = startOfISOWeek(fourthOfJanuaryOfNextYear);
date.setMilliseconds(date.getMilliseconds() - 1);
return date;
}
module.exports = endOfISOYear;
/***/ }),
/***/ "./node_modules/date-fns/end_of_minute/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/end_of_minute/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Minute Helpers
* @summary Return the end of a minute for the given date.
*
* @description
* Return the end of a minute for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a minute
*
* @example
* // The end of a minute for 1 December 2014 22:15:45.400:
* var result = endOfMinute(new Date(2014, 11, 1, 22, 15, 45, 400))
* //=> Mon Dec 01 2014 22:15:59.999
*/
function endOfMinute(dirtyDate) {
var date = parse(dirtyDate);
date.setSeconds(59, 999);
return date;
}
module.exports = endOfMinute;
/***/ }),
/***/ "./node_modules/date-fns/end_of_month/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/end_of_month/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Return the end of a month for the given date.
*
* @description
* Return the end of a month for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a month
*
* @example
* // The end of a month for 2 September 2014 11:55:00:
* var result = endOfMonth(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 30 2014 23:59:59.999
*/
function endOfMonth(dirtyDate) {
var date = parse(dirtyDate);
var month = date.getMonth();
date.setFullYear(date.getFullYear(), month + 1, 0);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfMonth;
/***/ }),
/***/ "./node_modules/date-fns/end_of_quarter/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/end_of_quarter/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Quarter Helpers
* @summary Return the end of a year quarter for the given date.
*
* @description
* Return the end of a year quarter for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a quarter
*
* @example
* // The end of a quarter for 2 September 2014 11:55:00:
* var result = endOfQuarter(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 30 2014 23:59:59.999
*/
function endOfQuarter(dirtyDate) {
var date = parse(dirtyDate);
var currentMonth = date.getMonth();
var month = currentMonth - currentMonth % 3 + 3;
date.setMonth(month, 0);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfQuarter;
/***/ }),
/***/ "./node_modules/date-fns/end_of_second/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/end_of_second/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Second Helpers
* @summary Return the end of a second for the given date.
*
* @description
* Return the end of a second for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a second
*
* @example
* // The end of a second for 1 December 2014 22:15:45.400:
* var result = endOfSecond(new Date(2014, 11, 1, 22, 15, 45, 400))
* //=> Mon Dec 01 2014 22:15:45.999
*/
function endOfSecond(dirtyDate) {
var date = parse(dirtyDate);
date.setMilliseconds(999);
return date;
}
module.exports = endOfSecond;
/***/ }),
/***/ "./node_modules/date-fns/end_of_today/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/end_of_today/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var endOfDay = __webpack_require__(/*! ../end_of_day/index.js */ "./node_modules/date-fns/end_of_day/index.js");
/**
* @category Day Helpers
* @summary Return the end of today.
*
* @description
* Return the end of today.
*
* @returns {Date} the end of today
*
* @example
* // If today is 6 October 2014:
* var result = endOfToday()
* //=> Mon Oct 6 2014 23:59:59.999
*/
function endOfToday() {
return endOfDay(new Date());
}
module.exports = endOfToday;
/***/ }),
/***/ "./node_modules/date-fns/end_of_tomorrow/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/end_of_tomorrow/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
/**
* @category Day Helpers
* @summary Return the end of tomorrow.
*
* @description
* Return the end of tomorrow.
*
* @returns {Date} the end of tomorrow
*
* @example
* // If today is 6 October 2014:
* var result = endOfTomorrow()
* //=> Tue Oct 7 2014 23:59:59.999
*/
function endOfTomorrow() {
var now = new Date();
var year = now.getFullYear();
var month = now.getMonth();
var day = now.getDate();
var date = new Date(0);
date.setFullYear(year, month, day + 1);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfTomorrow;
/***/ }),
/***/ "./node_modules/date-fns/end_of_week/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/end_of_week/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Week Helpers
* @summary Return the end of a week for the given date.
*
* @description
* Return the end of a week for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Date} the end of a week
*
* @example
* // The end of a week for 2 September 2014 11:55:00:
* var result = endOfWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Sat Sep 06 2014 23:59:59.999
*
* @example
* // If the week starts on Monday, the end of the week for 2 September 2014 11:55:00:
* var result = endOfWeek(new Date(2014, 8, 2, 11, 55, 0), {weekStartsOn: 1})
* //=> Sun Sep 07 2014 23:59:59.999
*/
function endOfWeek(dirtyDate, dirtyOptions) {
var weekStartsOn = dirtyOptions ? (Number(dirtyOptions.weekStartsOn) || 0) : 0;
var date = parse(dirtyDate);
var day = date.getDay();
var diff = (day < weekStartsOn ? -7 : 0) + 6 - (day - weekStartsOn);
date.setDate(date.getDate() + diff);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfWeek;
/***/ }),
/***/ "./node_modules/date-fns/end_of_year/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/end_of_year/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Return the end of a year for the given date.
*
* @description
* Return the end of a year for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of a year
*
* @example
* // The end of a year for 2 September 2014 11:55:00:
* var result = endOfYear(new Date(2014, 8, 2, 11, 55, 00))
* //=> Wed Dec 31 2014 23:59:59.999
*/
function endOfYear(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
date.setFullYear(year + 1, 0, 0);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfYear;
/***/ }),
/***/ "./node_modules/date-fns/end_of_yesterday/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/end_of_yesterday/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
/**
* @category Day Helpers
* @summary Return the end of yesterday.
*
* @description
* Return the end of yesterday.
*
* @returns {Date} the end of yesterday
*
* @example
* // If today is 6 October 2014:
* var result = endOfYesterday()
* //=> Sun Oct 5 2014 23:59:59.999
*/
function endOfYesterday() {
var now = new Date();
var year = now.getFullYear();
var month = now.getMonth();
var day = now.getDate();
var date = new Date(0);
date.setFullYear(year, month, day - 1);
date.setHours(23, 59, 59, 999);
return date;
}
module.exports = endOfYesterday;
/***/ }),
/***/ "./node_modules/date-fns/format/index.js":
/*!***********************************************!*\
!*** ./node_modules/date-fns/format/index.js ***!
\***********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getDayOfYear = __webpack_require__(/*! ../get_day_of_year/index.js */ "./node_modules/date-fns/get_day_of_year/index.js");
var getISOWeek = __webpack_require__(/*! ../get_iso_week/index.js */ "./node_modules/date-fns/get_iso_week/index.js");
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var isValid = __webpack_require__(/*! ../is_valid/index.js */ "./node_modules/date-fns/is_valid/index.js");
var enLocale = __webpack_require__(/*! ../locale/en/index.js */ "./node_modules/date-fns/locale/en/index.js");
/**
* @category Common Helpers
* @summary Format the date.
*
* @description
* Return the formatted date string in the given format.
*
* Accepted tokens:
* | Unit | Token | Result examples |
* |-------------------------|-------|----------------------------------|
* | Month | M | 1, 2, ..., 12 |
* | | Mo | 1st, 2nd, ..., 12th |
* | | MM | 01, 02, ..., 12 |
* | | MMM | Jan, Feb, ..., Dec |
* | | MMMM | January, February, ..., December |
* | Quarter | Q | 1, 2, 3, 4 |
* | | Qo | 1st, 2nd, 3rd, 4th |
* | Day of month | D | 1, 2, ..., 31 |
* | | Do | 1st, 2nd, ..., 31st |
* | | DD | 01, 02, ..., 31 |
* | Day of year | DDD | 1, 2, ..., 366 |
* | | DDDo | 1st, 2nd, ..., 366th |
* | | DDDD | 001, 002, ..., 366 |
* | Day of week | d | 0, 1, ..., 6 |
* | | do | 0th, 1st, ..., 6th |
* | | dd | Su, Mo, ..., Sa |
* | | ddd | Sun, Mon, ..., Sat |
* | | dddd | Sunday, Monday, ..., Saturday |
* | Day of ISO week | E | 1, 2, ..., 7 |
* | ISO week | W | 1, 2, ..., 53 |
* | | Wo | 1st, 2nd, ..., 53rd |
* | | WW | 01, 02, ..., 53 |
* | Year | YY | 00, 01, ..., 99 |
* | | YYYY | 1900, 1901, ..., 2099 |
* | ISO week-numbering year | GG | 00, 01, ..., 99 |
* | | GGGG | 1900, 1901, ..., 2099 |
* | AM/PM | A | AM, PM |
* | | a | am, pm |
* | | aa | a.m., p.m. |
* | Hour | H | 0, 1, ... 23 |
* | | HH | 00, 01, ... 23 |
* | | h | 1, 2, ..., 12 |
* | | hh | 01, 02, ..., 12 |
* | Minute | m | 0, 1, ..., 59 |
* | | mm | 00, 01, ..., 59 |
* | Second | s | 0, 1, ..., 59 |
* | | ss | 00, 01, ..., 59 |
* | 1/10 of second | S | 0, 1, ..., 9 |
* | 1/100 of second | SS | 00, 01, ..., 99 |
* | Millisecond | SSS | 000, 001, ..., 999 |
* | Timezone | Z | -01:00, +00:00, ... +12:00 |
* | | ZZ | -0100, +0000, ..., +1200 |
* | Seconds timestamp | X | 512969520 |
* | Milliseconds timestamp | x | 512969520900 |
*
* The characters wrapped in square brackets are escaped.
*
* The result may vary by locale.
*
* @param {Date|String|Number} date - the original date
* @param {String} [format='YYYY-MM-DDTHH:mm:ss.SSSZ'] - the string of tokens
* @param {Object} [options] - the object with options
* @param {Object} [options.locale=enLocale] - the locale object
* @returns {String} the formatted date string
*
* @example
* // Represent 11 February 2014 in middle-endian format:
* var result = format(
* new Date(2014, 1, 11),
* 'MM/DD/YYYY'
* )
* //=> '02/11/2014'
*
* @example
* // Represent 2 July 2014 in Esperanto:
* var eoLocale = require('date-fns/locale/eo')
* var result = format(
* new Date(2014, 6, 2),
* 'Do [de] MMMM YYYY',
* {locale: eoLocale}
* )
* //=> '2-a de julio 2014'
*/
function format(dirtyDate, dirtyFormatStr, dirtyOptions) {
var formatStr = dirtyFormatStr ? String(dirtyFormatStr) : 'YYYY-MM-DDTHH:mm:ss.SSSZ';
var options = dirtyOptions || {};
var locale = options.locale;
var localeFormatters = enLocale.format.formatters;
var formattingTokensRegExp = enLocale.format.formattingTokensRegExp;
if (locale && locale.format && locale.format.formatters) {
localeFormatters = locale.format.formatters;
if (locale.format.formattingTokensRegExp) {
formattingTokensRegExp = locale.format.formattingTokensRegExp;
}
}
var date = parse(dirtyDate);
if (!isValid(date)) {
return 'Invalid Date';
}
var formatFn = buildFormatFn(formatStr, localeFormatters, formattingTokensRegExp);
return formatFn(date);
}
var formatters = {
// Month: 1, 2, ..., 12
'M': function (date) {
return date.getMonth() + 1;
},
// Month: 01, 02, ..., 12
'MM': function (date) {
return addLeadingZeros(date.getMonth() + 1, 2);
},
// Quarter: 1, 2, 3, 4
'Q': function (date) {
return Math.ceil((date.getMonth() + 1) / 3);
},
// Day of month: 1, 2, ..., 31
'D': function (date) {
return date.getDate();
},
// Day of month: 01, 02, ..., 31
'DD': function (date) {
return addLeadingZeros(date.getDate(), 2);
},
// Day of year: 1, 2, ..., 366
'DDD': function (date) {
return getDayOfYear(date);
},
// Day of year: 001, 002, ..., 366
'DDDD': function (date) {
return addLeadingZeros(getDayOfYear(date), 3);
},
// Day of week: 0, 1, ..., 6
'd': function (date) {
return date.getDay();
},
// Day of ISO week: 1, 2, ..., 7
'E': function (date) {
return date.getDay() || 7;
},
// ISO week: 1, 2, ..., 53
'W': function (date) {
return getISOWeek(date);
},
// ISO week: 01, 02, ..., 53
'WW': function (date) {
return addLeadingZeros(getISOWeek(date), 2);
},
// Year: 00, 01, ..., 99
'YY': function (date) {
return addLeadingZeros(date.getFullYear(), 4).substr(2);
},
// Year: 1900, 1901, ..., 2099
'YYYY': function (date) {
return addLeadingZeros(date.getFullYear(), 4);
},
// ISO week-numbering year: 00, 01, ..., 99
'GG': function (date) {
return String(getISOYear(date)).substr(2);
},
// ISO week-numbering year: 1900, 1901, ..., 2099
'GGGG': function (date) {
return getISOYear(date);
},
// Hour: 0, 1, ... 23
'H': function (date) {
return date.getHours();
},
// Hour: 00, 01, ..., 23
'HH': function (date) {
return addLeadingZeros(date.getHours(), 2);
},
// Hour: 1, 2, ..., 12
'h': function (date) {
var hours = date.getHours();
if (hours === 0) {
return 12;
}
else if (hours > 12) {
return hours % 12;
}
else {
return hours;
}
},
// Hour: 01, 02, ..., 12
'hh': function (date) {
return addLeadingZeros(formatters['h'](date), 2);
},
// Minute: 0, 1, ..., 59
'm': function (date) {
return date.getMinutes();
},
// Minute: 00, 01, ..., 59
'mm': function (date) {
return addLeadingZeros(date.getMinutes(), 2);
},
// Second: 0, 1, ..., 59
's': function (date) {
return date.getSeconds();
},
// Second: 00, 01, ..., 59
'ss': function (date) {
return addLeadingZeros(date.getSeconds(), 2);
},
// 1/10 of second: 0, 1, ..., 9
'S': function (date) {
return Math.floor(date.getMilliseconds() / 100);
},
// 1/100 of second: 00, 01, ..., 99
'SS': function (date) {
return addLeadingZeros(Math.floor(date.getMilliseconds() / 10), 2);
},
// Millisecond: 000, 001, ..., 999
'SSS': function (date) {
return addLeadingZeros(date.getMilliseconds(), 3);
},
// Timezone: -01:00, +00:00, ... +12:00
'Z': function (date) {
return formatTimezone(date.getTimezoneOffset(), ':');
},
// Timezone: -0100, +0000, ... +1200
'ZZ': function (date) {
return formatTimezone(date.getTimezoneOffset());
},
// Seconds timestamp: 512969520
'X': function (date) {
return Math.floor(date.getTime() / 1000);
},
// Milliseconds timestamp: 512969520900
'x': function (date) {
return date.getTime();
}
};
function buildFormatFn(formatStr, localeFormatters, formattingTokensRegExp) {
var array = formatStr.match(formattingTokensRegExp);
var length = array.length;
var i;
var formatter;
for (i = 0; i < length; i++) {
formatter = localeFormatters[array[i]] || formatters[array[i]];
if (formatter) {
array[i] = formatter;
}
else {
array[i] = removeFormattingTokens(array[i]);
}
}
return function (date) {
var output = '';
for (var i = 0; i < length; i++) {
if (array[i] instanceof Function) {
output += array[i](date, formatters);
}
else {
output += array[i];
}
}
return output;
};
}
function removeFormattingTokens(input) {
if (input.match(/\[[\s\S]/)) {
return input.replace(/^\[|]$/g, '');
}
return input.replace(/\\/g, '');
}
function formatTimezone(offset, delimeter) {
delimeter = delimeter || '';
var sign = offset > 0 ? '-' : '+';
var absOffset = Math.abs(offset);
var hours = Math.floor(absOffset / 60);
var minutes = absOffset % 60;
return sign + addLeadingZeros(hours, 2) + delimeter + addLeadingZeros(minutes, 2);
}
function addLeadingZeros(number, targetLength) {
var output = Math.abs(number).toString();
while (output.length < targetLength) {
output = '0' + output;
}
return output;
}
module.exports = format;
/***/ }),
/***/ "./node_modules/date-fns/get_date/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/get_date/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Get the day of the month of the given date.
*
* @description
* Get the day of the month of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the day of month
*
* @example
* // Which day of the month is 29 February 2012?
* var result = getDate(new Date(2012, 1, 29))
* //=> 29
*/
function getDate(dirtyDate) {
var date = parse(dirtyDate);
var dayOfMonth = date.getDate();
return dayOfMonth;
}
module.exports = getDate;
/***/ }),
/***/ "./node_modules/date-fns/get_day/index.js":
/*!************************************************!*\
!*** ./node_modules/date-fns/get_day/index.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Get the day of the week of the given date.
*
* @description
* Get the day of the week of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the day of week
*
* @example
* // Which day of the week is 29 February 2012?
* var result = getDay(new Date(2012, 1, 29))
* //=> 3
*/
function getDay(dirtyDate) {
var date = parse(dirtyDate);
var day = date.getDay();
return day;
}
module.exports = getDay;
/***/ }),
/***/ "./node_modules/date-fns/get_day_of_year/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/get_day_of_year/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var startOfYear = __webpack_require__(/*! ../start_of_year/index.js */ "./node_modules/date-fns/start_of_year/index.js");
var differenceInCalendarDays = __webpack_require__(/*! ../difference_in_calendar_days/index.js */ "./node_modules/date-fns/difference_in_calendar_days/index.js");
/**
* @category Day Helpers
* @summary Get the day of the year of the given date.
*
* @description
* Get the day of the year of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the day of year
*
* @example
* // Which day of the year is 2 July 2014?
* var result = getDayOfYear(new Date(2014, 6, 2))
* //=> 183
*/
function getDayOfYear(dirtyDate) {
var date = parse(dirtyDate);
var diff = differenceInCalendarDays(date, startOfYear(date));
var dayOfYear = diff + 1;
return dayOfYear;
}
module.exports = getDayOfYear;
/***/ }),
/***/ "./node_modules/date-fns/get_days_in_month/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/get_days_in_month/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Get the number of days in a month of the given date.
*
* @description
* Get the number of days in a month of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the number of days in a month
*
* @example
* // How many days are in February 2000?
* var result = getDaysInMonth(new Date(2000, 1))
* //=> 29
*/
function getDaysInMonth(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
var monthIndex = date.getMonth();
var lastDayOfMonth = new Date(0);
lastDayOfMonth.setFullYear(year, monthIndex + 1, 0);
lastDayOfMonth.setHours(0, 0, 0, 0);
return lastDayOfMonth.getDate();
}
module.exports = getDaysInMonth;
/***/ }),
/***/ "./node_modules/date-fns/get_days_in_year/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/get_days_in_year/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isLeapYear = __webpack_require__(/*! ../is_leap_year/index.js */ "./node_modules/date-fns/is_leap_year/index.js");
/**
* @category Year Helpers
* @summary Get the number of days in a year of the given date.
*
* @description
* Get the number of days in a year of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the number of days in a year
*
* @example
* // How many days are in 2012?
* var result = getDaysInYear(new Date(2012, 0, 1))
* //=> 366
*/
function getDaysInYear(dirtyDate) {
return isLeapYear(dirtyDate) ? 366 : 365;
}
module.exports = getDaysInYear;
/***/ }),
/***/ "./node_modules/date-fns/get_hours/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/get_hours/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Hour Helpers
* @summary Get the hours of the given date.
*
* @description
* Get the hours of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the hours
*
* @example
* // Get the hours of 29 February 2012 11:45:00:
* var result = getHours(new Date(2012, 1, 29, 11, 45))
* //=> 11
*/
function getHours(dirtyDate) {
var date = parse(dirtyDate);
var hours = date.getHours();
return hours;
}
module.exports = getHours;
/***/ }),
/***/ "./node_modules/date-fns/get_iso_day/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/get_iso_day/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Get the day of the ISO week of the given date.
*
* @description
* Get the day of the ISO week of the given date,
* which is 7 for Sunday, 1 for Monday etc.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the day of ISO week
*
* @example
* // Which day of the ISO week is 26 February 2012?
* var result = getISODay(new Date(2012, 1, 26))
* //=> 7
*/
function getISODay(dirtyDate) {
var date = parse(dirtyDate);
var day = date.getDay();
if (day === 0) {
day = 7;
}
return day;
}
module.exports = getISODay;
/***/ }),
/***/ "./node_modules/date-fns/get_iso_week/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/get_iso_week/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
var startOfISOYear = __webpack_require__(/*! ../start_of_iso_year/index.js */ "./node_modules/date-fns/start_of_iso_year/index.js");
var MILLISECONDS_IN_WEEK = 604800000;
/**
* @category ISO Week Helpers
* @summary Get the ISO week of the given date.
*
* @description
* Get the ISO week of the given date.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the ISO week
*
* @example
* // Which week of the ISO-week numbering year is 2 January 2005?
* var result = getISOWeek(new Date(2005, 0, 2))
* //=> 53
*/
function getISOWeek(dirtyDate) {
var date = parse(dirtyDate);
var diff = startOfISOWeek(date).getTime() - startOfISOYear(date).getTime();
// Round the number of days to the nearest integer
// because the number of milliseconds in a week is not constant
// (e.g. it's different in the week of the daylight saving time clock shift)
return Math.round(diff / MILLISECONDS_IN_WEEK) + 1;
}
module.exports = getISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/get_iso_weeks_in_year/index.js":
/*!**************************************************************!*\
!*** ./node_modules/date-fns/get_iso_weeks_in_year/index.js ***!
\**************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfISOYear = __webpack_require__(/*! ../start_of_iso_year/index.js */ "./node_modules/date-fns/start_of_iso_year/index.js");
var addWeeks = __webpack_require__(/*! ../add_weeks/index.js */ "./node_modules/date-fns/add_weeks/index.js");
var MILLISECONDS_IN_WEEK = 604800000;
/**
* @category ISO Week-Numbering Year Helpers
* @summary Get the number of weeks in an ISO week-numbering year of the given date.
*
* @description
* Get the number of weeks in an ISO week-numbering year of the given date.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the number of ISO weeks in a year
*
* @example
* // How many weeks are in ISO week-numbering year 2015?
* var result = getISOWeeksInYear(new Date(2015, 1, 11))
* //=> 53
*/
function getISOWeeksInYear(dirtyDate) {
var thisYear = startOfISOYear(dirtyDate);
var nextYear = startOfISOYear(addWeeks(thisYear, 60));
var diff = nextYear.valueOf() - thisYear.valueOf();
// Round the number of weeks to the nearest integer
// because the number of milliseconds in a week is not constant
// (e.g. it's different in the week of the daylight saving time clock shift)
return Math.round(diff / MILLISECONDS_IN_WEEK);
}
module.exports = getISOWeeksInYear;
/***/ }),
/***/ "./node_modules/date-fns/get_iso_year/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/get_iso_year/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Get the ISO week-numbering year of the given date.
*
* @description
* Get the ISO week-numbering year of the given date,
* which always starts 3 days before the year's first Thursday.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the ISO week-numbering year
*
* @example
* // Which ISO-week numbering year is 2 January 2005?
* var result = getISOYear(new Date(2005, 0, 2))
* //=> 2004
*/
function getISOYear(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
var fourthOfJanuaryOfNextYear = new Date(0);
fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4);
fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0);
var startOfNextYear = startOfISOWeek(fourthOfJanuaryOfNextYear);
var fourthOfJanuaryOfThisYear = new Date(0);
fourthOfJanuaryOfThisYear.setFullYear(year, 0, 4);
fourthOfJanuaryOfThisYear.setHours(0, 0, 0, 0);
var startOfThisYear = startOfISOWeek(fourthOfJanuaryOfThisYear);
if (date.getTime() >= startOfNextYear.getTime()) {
return year + 1;
}
else if (date.getTime() >= startOfThisYear.getTime()) {
return year;
}
else {
return year - 1;
}
}
module.exports = getISOYear;
/***/ }),
/***/ "./node_modules/date-fns/get_milliseconds/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/get_milliseconds/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Millisecond Helpers
* @summary Get the milliseconds of the given date.
*
* @description
* Get the milliseconds of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the milliseconds
*
* @example
* // Get the milliseconds of 29 February 2012 11:45:05.123:
* var result = getMilliseconds(new Date(2012, 1, 29, 11, 45, 5, 123))
* //=> 123
*/
function getMilliseconds(dirtyDate) {
var date = parse(dirtyDate);
var milliseconds = date.getMilliseconds();
return milliseconds;
}
module.exports = getMilliseconds;
/***/ }),
/***/ "./node_modules/date-fns/get_minutes/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/get_minutes/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Minute Helpers
* @summary Get the minutes of the given date.
*
* @description
* Get the minutes of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the minutes
*
* @example
* // Get the minutes of 29 February 2012 11:45:05:
* var result = getMinutes(new Date(2012, 1, 29, 11, 45, 5))
* //=> 45
*/
function getMinutes(dirtyDate) {
var date = parse(dirtyDate);
var minutes = date.getMinutes();
return minutes;
}
module.exports = getMinutes;
/***/ }),
/***/ "./node_modules/date-fns/get_month/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/get_month/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Get the month of the given date.
*
* @description
* Get the month of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the month
*
* @example
* // Which month is 29 February 2012?
* var result = getMonth(new Date(2012, 1, 29))
* //=> 1
*/
function getMonth(dirtyDate) {
var date = parse(dirtyDate);
var month = date.getMonth();
return month;
}
module.exports = getMonth;
/***/ }),
/***/ "./node_modules/date-fns/get_overlapping_days_in_ranges/index.js":
/*!***********************************************************************!*\
!*** ./node_modules/date-fns/get_overlapping_days_in_ranges/index.js ***!
\***********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var MILLISECONDS_IN_DAY = 24 * 60 * 60 * 1000;
/**
* @category Range Helpers
* @summary Get the number of days that overlap in two date ranges
*
* @description
* Get the number of days that overlap in two date ranges
*
* @param {Date|String|Number} initialRangeStartDate - the start of the initial range
* @param {Date|String|Number} initialRangeEndDate - the end of the initial range
* @param {Date|String|Number} comparedRangeStartDate - the start of the range to compare it with
* @param {Date|String|Number} comparedRangeEndDate - the end of the range to compare it with
* @returns {Number} the number of days that overlap in two date ranges
* @throws {Error} startDate of a date range cannot be after its endDate
*
* @example
* // For overlapping date ranges adds 1 for each started overlapping day:
* getOverlappingDaysInRanges(
* new Date(2014, 0, 10), new Date(2014, 0, 20), new Date(2014, 0, 17), new Date(2014, 0, 21)
* )
* //=> 3
*
* @example
* // For non-overlapping date ranges returns 0:
* getOverlappingDaysInRanges(
* new Date(2014, 0, 10), new Date(2014, 0, 20), new Date(2014, 0, 21), new Date(2014, 0, 22)
* )
* //=> 0
*/
function getOverlappingDaysInRanges(dirtyInitialRangeStartDate, dirtyInitialRangeEndDate, dirtyComparedRangeStartDate, dirtyComparedRangeEndDate) {
var initialStartTime = parse(dirtyInitialRangeStartDate).getTime();
var initialEndTime = parse(dirtyInitialRangeEndDate).getTime();
var comparedStartTime = parse(dirtyComparedRangeStartDate).getTime();
var comparedEndTime = parse(dirtyComparedRangeEndDate).getTime();
if (initialStartTime > initialEndTime || comparedStartTime > comparedEndTime) {
throw new Error('The start of the range cannot be after the end of the range');
}
var isOverlapping = initialStartTime < comparedEndTime && comparedStartTime < initialEndTime;
if (!isOverlapping) {
return 0;
}
var overlapStartDate = comparedStartTime < initialStartTime
? initialStartTime
: comparedStartTime;
var overlapEndDate = comparedEndTime > initialEndTime
? initialEndTime
: comparedEndTime;
var differenceInMs = overlapEndDate - overlapStartDate;
return Math.ceil(differenceInMs / MILLISECONDS_IN_DAY);
}
module.exports = getOverlappingDaysInRanges;
/***/ }),
/***/ "./node_modules/date-fns/get_quarter/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/get_quarter/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Quarter Helpers
* @summary Get the year quarter of the given date.
*
* @description
* Get the year quarter of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the quarter
*
* @example
* // Which quarter is 2 July 2014?
* var result = getQuarter(new Date(2014, 6, 2))
* //=> 3
*/
function getQuarter(dirtyDate) {
var date = parse(dirtyDate);
var quarter = Math.floor(date.getMonth() / 3) + 1;
return quarter;
}
module.exports = getQuarter;
/***/ }),
/***/ "./node_modules/date-fns/get_seconds/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/get_seconds/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Second Helpers
* @summary Get the seconds of the given date.
*
* @description
* Get the seconds of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the seconds
*
* @example
* // Get the seconds of 29 February 2012 11:45:05.123:
* var result = getSeconds(new Date(2012, 1, 29, 11, 45, 5, 123))
* //=> 5
*/
function getSeconds(dirtyDate) {
var date = parse(dirtyDate);
var seconds = date.getSeconds();
return seconds;
}
module.exports = getSeconds;
/***/ }),
/***/ "./node_modules/date-fns/get_time/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/get_time/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Timestamp Helpers
* @summary Get the milliseconds timestamp of the given date.
*
* @description
* Get the milliseconds timestamp of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the timestamp
*
* @example
* // Get the timestamp of 29 February 2012 11:45:05.123:
* var result = getTime(new Date(2012, 1, 29, 11, 45, 5, 123))
* //=> 1330515905123
*/
function getTime(dirtyDate) {
var date = parse(dirtyDate);
var timestamp = date.getTime();
return timestamp;
}
module.exports = getTime;
/***/ }),
/***/ "./node_modules/date-fns/get_year/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/get_year/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Get the year of the given date.
*
* @description
* Get the year of the given date.
*
* @param {Date|String|Number} date - the given date
* @returns {Number} the year
*
* @example
* // Which year is 2 July 2014?
* var result = getYear(new Date(2014, 6, 2))
* //=> 2014
*/
function getYear(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
return year;
}
module.exports = getYear;
/***/ }),
/***/ "./node_modules/date-fns/index.js":
/*!****************************************!*\
!*** ./node_modules/date-fns/index.js ***!
\****************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
module.exports = {
addDays: __webpack_require__(/*! ./add_days/index.js */ "./node_modules/date-fns/add_days/index.js"),
addHours: __webpack_require__(/*! ./add_hours/index.js */ "./node_modules/date-fns/add_hours/index.js"),
addISOYears: __webpack_require__(/*! ./add_iso_years/index.js */ "./node_modules/date-fns/add_iso_years/index.js"),
addMilliseconds: __webpack_require__(/*! ./add_milliseconds/index.js */ "./node_modules/date-fns/add_milliseconds/index.js"),
addMinutes: __webpack_require__(/*! ./add_minutes/index.js */ "./node_modules/date-fns/add_minutes/index.js"),
addMonths: __webpack_require__(/*! ./add_months/index.js */ "./node_modules/date-fns/add_months/index.js"),
addQuarters: __webpack_require__(/*! ./add_quarters/index.js */ "./node_modules/date-fns/add_quarters/index.js"),
addSeconds: __webpack_require__(/*! ./add_seconds/index.js */ "./node_modules/date-fns/add_seconds/index.js"),
addWeeks: __webpack_require__(/*! ./add_weeks/index.js */ "./node_modules/date-fns/add_weeks/index.js"),
addYears: __webpack_require__(/*! ./add_years/index.js */ "./node_modules/date-fns/add_years/index.js"),
areRangesOverlapping: __webpack_require__(/*! ./are_ranges_overlapping/index.js */ "./node_modules/date-fns/are_ranges_overlapping/index.js"),
closestIndexTo: __webpack_require__(/*! ./closest_index_to/index.js */ "./node_modules/date-fns/closest_index_to/index.js"),
closestTo: __webpack_require__(/*! ./closest_to/index.js */ "./node_modules/date-fns/closest_to/index.js"),
compareAsc: __webpack_require__(/*! ./compare_asc/index.js */ "./node_modules/date-fns/compare_asc/index.js"),
compareDesc: __webpack_require__(/*! ./compare_desc/index.js */ "./node_modules/date-fns/compare_desc/index.js"),
differenceInCalendarDays: __webpack_require__(/*! ./difference_in_calendar_days/index.js */ "./node_modules/date-fns/difference_in_calendar_days/index.js"),
differenceInCalendarISOWeeks: __webpack_require__(/*! ./difference_in_calendar_iso_weeks/index.js */ "./node_modules/date-fns/difference_in_calendar_iso_weeks/index.js"),
differenceInCalendarISOYears: __webpack_require__(/*! ./difference_in_calendar_iso_years/index.js */ "./node_modules/date-fns/difference_in_calendar_iso_years/index.js"),
differenceInCalendarMonths: __webpack_require__(/*! ./difference_in_calendar_months/index.js */ "./node_modules/date-fns/difference_in_calendar_months/index.js"),
differenceInCalendarQuarters: __webpack_require__(/*! ./difference_in_calendar_quarters/index.js */ "./node_modules/date-fns/difference_in_calendar_quarters/index.js"),
differenceInCalendarWeeks: __webpack_require__(/*! ./difference_in_calendar_weeks/index.js */ "./node_modules/date-fns/difference_in_calendar_weeks/index.js"),
differenceInCalendarYears: __webpack_require__(/*! ./difference_in_calendar_years/index.js */ "./node_modules/date-fns/difference_in_calendar_years/index.js"),
differenceInDays: __webpack_require__(/*! ./difference_in_days/index.js */ "./node_modules/date-fns/difference_in_days/index.js"),
differenceInHours: __webpack_require__(/*! ./difference_in_hours/index.js */ "./node_modules/date-fns/difference_in_hours/index.js"),
differenceInISOYears: __webpack_require__(/*! ./difference_in_iso_years/index.js */ "./node_modules/date-fns/difference_in_iso_years/index.js"),
differenceInMilliseconds: __webpack_require__(/*! ./difference_in_milliseconds/index.js */ "./node_modules/date-fns/difference_in_milliseconds/index.js"),
differenceInMinutes: __webpack_require__(/*! ./difference_in_minutes/index.js */ "./node_modules/date-fns/difference_in_minutes/index.js"),
differenceInMonths: __webpack_require__(/*! ./difference_in_months/index.js */ "./node_modules/date-fns/difference_in_months/index.js"),
differenceInQuarters: __webpack_require__(/*! ./difference_in_quarters/index.js */ "./node_modules/date-fns/difference_in_quarters/index.js"),
differenceInSeconds: __webpack_require__(/*! ./difference_in_seconds/index.js */ "./node_modules/date-fns/difference_in_seconds/index.js"),
differenceInWeeks: __webpack_require__(/*! ./difference_in_weeks/index.js */ "./node_modules/date-fns/difference_in_weeks/index.js"),
differenceInYears: __webpack_require__(/*! ./difference_in_years/index.js */ "./node_modules/date-fns/difference_in_years/index.js"),
distanceInWords: __webpack_require__(/*! ./distance_in_words/index.js */ "./node_modules/date-fns/distance_in_words/index.js"),
distanceInWordsStrict: __webpack_require__(/*! ./distance_in_words_strict/index.js */ "./node_modules/date-fns/distance_in_words_strict/index.js"),
distanceInWordsToNow: __webpack_require__(/*! ./distance_in_words_to_now/index.js */ "./node_modules/date-fns/distance_in_words_to_now/index.js"),
eachDay: __webpack_require__(/*! ./each_day/index.js */ "./node_modules/date-fns/each_day/index.js"),
endOfDay: __webpack_require__(/*! ./end_of_day/index.js */ "./node_modules/date-fns/end_of_day/index.js"),
endOfHour: __webpack_require__(/*! ./end_of_hour/index.js */ "./node_modules/date-fns/end_of_hour/index.js"),
endOfISOWeek: __webpack_require__(/*! ./end_of_iso_week/index.js */ "./node_modules/date-fns/end_of_iso_week/index.js"),
endOfISOYear: __webpack_require__(/*! ./end_of_iso_year/index.js */ "./node_modules/date-fns/end_of_iso_year/index.js"),
endOfMinute: __webpack_require__(/*! ./end_of_minute/index.js */ "./node_modules/date-fns/end_of_minute/index.js"),
endOfMonth: __webpack_require__(/*! ./end_of_month/index.js */ "./node_modules/date-fns/end_of_month/index.js"),
endOfQuarter: __webpack_require__(/*! ./end_of_quarter/index.js */ "./node_modules/date-fns/end_of_quarter/index.js"),
endOfSecond: __webpack_require__(/*! ./end_of_second/index.js */ "./node_modules/date-fns/end_of_second/index.js"),
endOfToday: __webpack_require__(/*! ./end_of_today/index.js */ "./node_modules/date-fns/end_of_today/index.js"),
endOfTomorrow: __webpack_require__(/*! ./end_of_tomorrow/index.js */ "./node_modules/date-fns/end_of_tomorrow/index.js"),
endOfWeek: __webpack_require__(/*! ./end_of_week/index.js */ "./node_modules/date-fns/end_of_week/index.js"),
endOfYear: __webpack_require__(/*! ./end_of_year/index.js */ "./node_modules/date-fns/end_of_year/index.js"),
endOfYesterday: __webpack_require__(/*! ./end_of_yesterday/index.js */ "./node_modules/date-fns/end_of_yesterday/index.js"),
format: __webpack_require__(/*! ./format/index.js */ "./node_modules/date-fns/format/index.js"),
getDate: __webpack_require__(/*! ./get_date/index.js */ "./node_modules/date-fns/get_date/index.js"),
getDay: __webpack_require__(/*! ./get_day/index.js */ "./node_modules/date-fns/get_day/index.js"),
getDayOfYear: __webpack_require__(/*! ./get_day_of_year/index.js */ "./node_modules/date-fns/get_day_of_year/index.js"),
getDaysInMonth: __webpack_require__(/*! ./get_days_in_month/index.js */ "./node_modules/date-fns/get_days_in_month/index.js"),
getDaysInYear: __webpack_require__(/*! ./get_days_in_year/index.js */ "./node_modules/date-fns/get_days_in_year/index.js"),
getHours: __webpack_require__(/*! ./get_hours/index.js */ "./node_modules/date-fns/get_hours/index.js"),
getISODay: __webpack_require__(/*! ./get_iso_day/index.js */ "./node_modules/date-fns/get_iso_day/index.js"),
getISOWeek: __webpack_require__(/*! ./get_iso_week/index.js */ "./node_modules/date-fns/get_iso_week/index.js"),
getISOWeeksInYear: __webpack_require__(/*! ./get_iso_weeks_in_year/index.js */ "./node_modules/date-fns/get_iso_weeks_in_year/index.js"),
getISOYear: __webpack_require__(/*! ./get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js"),
getMilliseconds: __webpack_require__(/*! ./get_milliseconds/index.js */ "./node_modules/date-fns/get_milliseconds/index.js"),
getMinutes: __webpack_require__(/*! ./get_minutes/index.js */ "./node_modules/date-fns/get_minutes/index.js"),
getMonth: __webpack_require__(/*! ./get_month/index.js */ "./node_modules/date-fns/get_month/index.js"),
getOverlappingDaysInRanges: __webpack_require__(/*! ./get_overlapping_days_in_ranges/index.js */ "./node_modules/date-fns/get_overlapping_days_in_ranges/index.js"),
getQuarter: __webpack_require__(/*! ./get_quarter/index.js */ "./node_modules/date-fns/get_quarter/index.js"),
getSeconds: __webpack_require__(/*! ./get_seconds/index.js */ "./node_modules/date-fns/get_seconds/index.js"),
getTime: __webpack_require__(/*! ./get_time/index.js */ "./node_modules/date-fns/get_time/index.js"),
getYear: __webpack_require__(/*! ./get_year/index.js */ "./node_modules/date-fns/get_year/index.js"),
isAfter: __webpack_require__(/*! ./is_after/index.js */ "./node_modules/date-fns/is_after/index.js"),
isBefore: __webpack_require__(/*! ./is_before/index.js */ "./node_modules/date-fns/is_before/index.js"),
isDate: __webpack_require__(/*! ./is_date/index.js */ "./node_modules/date-fns/is_date/index.js"),
isEqual: __webpack_require__(/*! ./is_equal/index.js */ "./node_modules/date-fns/is_equal/index.js"),
isFirstDayOfMonth: __webpack_require__(/*! ./is_first_day_of_month/index.js */ "./node_modules/date-fns/is_first_day_of_month/index.js"),
isFriday: __webpack_require__(/*! ./is_friday/index.js */ "./node_modules/date-fns/is_friday/index.js"),
isFuture: __webpack_require__(/*! ./is_future/index.js */ "./node_modules/date-fns/is_future/index.js"),
isLastDayOfMonth: __webpack_require__(/*! ./is_last_day_of_month/index.js */ "./node_modules/date-fns/is_last_day_of_month/index.js"),
isLeapYear: __webpack_require__(/*! ./is_leap_year/index.js */ "./node_modules/date-fns/is_leap_year/index.js"),
isMonday: __webpack_require__(/*! ./is_monday/index.js */ "./node_modules/date-fns/is_monday/index.js"),
isPast: __webpack_require__(/*! ./is_past/index.js */ "./node_modules/date-fns/is_past/index.js"),
isSameDay: __webpack_require__(/*! ./is_same_day/index.js */ "./node_modules/date-fns/is_same_day/index.js"),
isSameHour: __webpack_require__(/*! ./is_same_hour/index.js */ "./node_modules/date-fns/is_same_hour/index.js"),
isSameISOWeek: __webpack_require__(/*! ./is_same_iso_week/index.js */ "./node_modules/date-fns/is_same_iso_week/index.js"),
isSameISOYear: __webpack_require__(/*! ./is_same_iso_year/index.js */ "./node_modules/date-fns/is_same_iso_year/index.js"),
isSameMinute: __webpack_require__(/*! ./is_same_minute/index.js */ "./node_modules/date-fns/is_same_minute/index.js"),
isSameMonth: __webpack_require__(/*! ./is_same_month/index.js */ "./node_modules/date-fns/is_same_month/index.js"),
isSameQuarter: __webpack_require__(/*! ./is_same_quarter/index.js */ "./node_modules/date-fns/is_same_quarter/index.js"),
isSameSecond: __webpack_require__(/*! ./is_same_second/index.js */ "./node_modules/date-fns/is_same_second/index.js"),
isSameWeek: __webpack_require__(/*! ./is_same_week/index.js */ "./node_modules/date-fns/is_same_week/index.js"),
isSameYear: __webpack_require__(/*! ./is_same_year/index.js */ "./node_modules/date-fns/is_same_year/index.js"),
isSaturday: __webpack_require__(/*! ./is_saturday/index.js */ "./node_modules/date-fns/is_saturday/index.js"),
isSunday: __webpack_require__(/*! ./is_sunday/index.js */ "./node_modules/date-fns/is_sunday/index.js"),
isThisHour: __webpack_require__(/*! ./is_this_hour/index.js */ "./node_modules/date-fns/is_this_hour/index.js"),
isThisISOWeek: __webpack_require__(/*! ./is_this_iso_week/index.js */ "./node_modules/date-fns/is_this_iso_week/index.js"),
isThisISOYear: __webpack_require__(/*! ./is_this_iso_year/index.js */ "./node_modules/date-fns/is_this_iso_year/index.js"),
isThisMinute: __webpack_require__(/*! ./is_this_minute/index.js */ "./node_modules/date-fns/is_this_minute/index.js"),
isThisMonth: __webpack_require__(/*! ./is_this_month/index.js */ "./node_modules/date-fns/is_this_month/index.js"),
isThisQuarter: __webpack_require__(/*! ./is_this_quarter/index.js */ "./node_modules/date-fns/is_this_quarter/index.js"),
isThisSecond: __webpack_require__(/*! ./is_this_second/index.js */ "./node_modules/date-fns/is_this_second/index.js"),
isThisWeek: __webpack_require__(/*! ./is_this_week/index.js */ "./node_modules/date-fns/is_this_week/index.js"),
isThisYear: __webpack_require__(/*! ./is_this_year/index.js */ "./node_modules/date-fns/is_this_year/index.js"),
isThursday: __webpack_require__(/*! ./is_thursday/index.js */ "./node_modules/date-fns/is_thursday/index.js"),
isToday: __webpack_require__(/*! ./is_today/index.js */ "./node_modules/date-fns/is_today/index.js"),
isTomorrow: __webpack_require__(/*! ./is_tomorrow/index.js */ "./node_modules/date-fns/is_tomorrow/index.js"),
isTuesday: __webpack_require__(/*! ./is_tuesday/index.js */ "./node_modules/date-fns/is_tuesday/index.js"),
isValid: __webpack_require__(/*! ./is_valid/index.js */ "./node_modules/date-fns/is_valid/index.js"),
isWednesday: __webpack_require__(/*! ./is_wednesday/index.js */ "./node_modules/date-fns/is_wednesday/index.js"),
isWeekend: __webpack_require__(/*! ./is_weekend/index.js */ "./node_modules/date-fns/is_weekend/index.js"),
isWithinRange: __webpack_require__(/*! ./is_within_range/index.js */ "./node_modules/date-fns/is_within_range/index.js"),
isYesterday: __webpack_require__(/*! ./is_yesterday/index.js */ "./node_modules/date-fns/is_yesterday/index.js"),
lastDayOfISOWeek: __webpack_require__(/*! ./last_day_of_iso_week/index.js */ "./node_modules/date-fns/last_day_of_iso_week/index.js"),
lastDayOfISOYear: __webpack_require__(/*! ./last_day_of_iso_year/index.js */ "./node_modules/date-fns/last_day_of_iso_year/index.js"),
lastDayOfMonth: __webpack_require__(/*! ./last_day_of_month/index.js */ "./node_modules/date-fns/last_day_of_month/index.js"),
lastDayOfQuarter: __webpack_require__(/*! ./last_day_of_quarter/index.js */ "./node_modules/date-fns/last_day_of_quarter/index.js"),
lastDayOfWeek: __webpack_require__(/*! ./last_day_of_week/index.js */ "./node_modules/date-fns/last_day_of_week/index.js"),
lastDayOfYear: __webpack_require__(/*! ./last_day_of_year/index.js */ "./node_modules/date-fns/last_day_of_year/index.js"),
max: __webpack_require__(/*! ./max/index.js */ "./node_modules/date-fns/max/index.js"),
min: __webpack_require__(/*! ./min/index.js */ "./node_modules/date-fns/min/index.js"),
parse: __webpack_require__(/*! ./parse/index.js */ "./node_modules/date-fns/parse/index.js"),
setDate: __webpack_require__(/*! ./set_date/index.js */ "./node_modules/date-fns/set_date/index.js"),
setDay: __webpack_require__(/*! ./set_day/index.js */ "./node_modules/date-fns/set_day/index.js"),
setDayOfYear: __webpack_require__(/*! ./set_day_of_year/index.js */ "./node_modules/date-fns/set_day_of_year/index.js"),
setHours: __webpack_require__(/*! ./set_hours/index.js */ "./node_modules/date-fns/set_hours/index.js"),
setISODay: __webpack_require__(/*! ./set_iso_day/index.js */ "./node_modules/date-fns/set_iso_day/index.js"),
setISOWeek: __webpack_require__(/*! ./set_iso_week/index.js */ "./node_modules/date-fns/set_iso_week/index.js"),
setISOYear: __webpack_require__(/*! ./set_iso_year/index.js */ "./node_modules/date-fns/set_iso_year/index.js"),
setMilliseconds: __webpack_require__(/*! ./set_milliseconds/index.js */ "./node_modules/date-fns/set_milliseconds/index.js"),
setMinutes: __webpack_require__(/*! ./set_minutes/index.js */ "./node_modules/date-fns/set_minutes/index.js"),
setMonth: __webpack_require__(/*! ./set_month/index.js */ "./node_modules/date-fns/set_month/index.js"),
setQuarter: __webpack_require__(/*! ./set_quarter/index.js */ "./node_modules/date-fns/set_quarter/index.js"),
setSeconds: __webpack_require__(/*! ./set_seconds/index.js */ "./node_modules/date-fns/set_seconds/index.js"),
setYear: __webpack_require__(/*! ./set_year/index.js */ "./node_modules/date-fns/set_year/index.js"),
startOfDay: __webpack_require__(/*! ./start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js"),
startOfHour: __webpack_require__(/*! ./start_of_hour/index.js */ "./node_modules/date-fns/start_of_hour/index.js"),
startOfISOWeek: __webpack_require__(/*! ./start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js"),
startOfISOYear: __webpack_require__(/*! ./start_of_iso_year/index.js */ "./node_modules/date-fns/start_of_iso_year/index.js"),
startOfMinute: __webpack_require__(/*! ./start_of_minute/index.js */ "./node_modules/date-fns/start_of_minute/index.js"),
startOfMonth: __webpack_require__(/*! ./start_of_month/index.js */ "./node_modules/date-fns/start_of_month/index.js"),
startOfQuarter: __webpack_require__(/*! ./start_of_quarter/index.js */ "./node_modules/date-fns/start_of_quarter/index.js"),
startOfSecond: __webpack_require__(/*! ./start_of_second/index.js */ "./node_modules/date-fns/start_of_second/index.js"),
startOfToday: __webpack_require__(/*! ./start_of_today/index.js */ "./node_modules/date-fns/start_of_today/index.js"),
startOfTomorrow: __webpack_require__(/*! ./start_of_tomorrow/index.js */ "./node_modules/date-fns/start_of_tomorrow/index.js"),
startOfWeek: __webpack_require__(/*! ./start_of_week/index.js */ "./node_modules/date-fns/start_of_week/index.js"),
startOfYear: __webpack_require__(/*! ./start_of_year/index.js */ "./node_modules/date-fns/start_of_year/index.js"),
startOfYesterday: __webpack_require__(/*! ./start_of_yesterday/index.js */ "./node_modules/date-fns/start_of_yesterday/index.js"),
subDays: __webpack_require__(/*! ./sub_days/index.js */ "./node_modules/date-fns/sub_days/index.js"),
subHours: __webpack_require__(/*! ./sub_hours/index.js */ "./node_modules/date-fns/sub_hours/index.js"),
subISOYears: __webpack_require__(/*! ./sub_iso_years/index.js */ "./node_modules/date-fns/sub_iso_years/index.js"),
subMilliseconds: __webpack_require__(/*! ./sub_milliseconds/index.js */ "./node_modules/date-fns/sub_milliseconds/index.js"),
subMinutes: __webpack_require__(/*! ./sub_minutes/index.js */ "./node_modules/date-fns/sub_minutes/index.js"),
subMonths: __webpack_require__(/*! ./sub_months/index.js */ "./node_modules/date-fns/sub_months/index.js"),
subQuarters: __webpack_require__(/*! ./sub_quarters/index.js */ "./node_modules/date-fns/sub_quarters/index.js"),
subSeconds: __webpack_require__(/*! ./sub_seconds/index.js */ "./node_modules/date-fns/sub_seconds/index.js"),
subWeeks: __webpack_require__(/*! ./sub_weeks/index.js */ "./node_modules/date-fns/sub_weeks/index.js"),
subYears: __webpack_require__(/*! ./sub_years/index.js */ "./node_modules/date-fns/sub_years/index.js")
};
/***/ }),
/***/ "./node_modules/date-fns/is_after/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/is_after/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Is the first date after the second one?
*
* @description
* Is the first date after the second one?
*
* @param {Date|String|Number} date - the date that should be after the other one to return true
* @param {Date|String|Number} dateToCompare - the date to compare with
* @returns {Boolean} the first date is after the second date
*
* @example
* // Is 10 July 1989 after 11 February 1987?
* var result = isAfter(new Date(1989, 6, 10), new Date(1987, 1, 11))
* //=> true
*/
function isAfter(dirtyDate, dirtyDateToCompare) {
var date = parse(dirtyDate);
var dateToCompare = parse(dirtyDateToCompare);
return date.getTime() > dateToCompare.getTime();
}
module.exports = isAfter;
/***/ }),
/***/ "./node_modules/date-fns/is_before/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/is_before/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Is the first date before the second one?
*
* @description
* Is the first date before the second one?
*
* @param {Date|String|Number} date - the date that should be before the other one to return true
* @param {Date|String|Number} dateToCompare - the date to compare with
* @returns {Boolean} the first date is before the second date
*
* @example
* // Is 10 July 1989 before 11 February 1987?
* var result = isBefore(new Date(1989, 6, 10), new Date(1987, 1, 11))
* //=> false
*/
function isBefore(dirtyDate, dirtyDateToCompare) {
var date = parse(dirtyDate);
var dateToCompare = parse(dirtyDateToCompare);
return date.getTime() < dateToCompare.getTime();
}
module.exports = isBefore;
/***/ }),
/***/ "./node_modules/date-fns/is_date/index.js":
/*!************************************************!*\
!*** ./node_modules/date-fns/is_date/index.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
/**
* @category Common Helpers
* @summary Is the given argument an instance of Date?
*
* @description
* Is the given argument an instance of Date?
*
* @param {*} argument - the argument to check
* @returns {Boolean} the given argument is an instance of Date
*
* @example
* // Is 'mayonnaise' a Date?
* var result = isDate('mayonnaise')
* //=> false
*/
function isDate(argument) {
return argument instanceof Date;
}
module.exports = isDate;
/***/ }),
/***/ "./node_modules/date-fns/is_equal/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/is_equal/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Are the given dates equal?
*
* @description
* Are the given dates equal?
*
* @param {Date|String|Number} dateLeft - the first date to compare
* @param {Date|String|Number} dateRight - the second date to compare
* @returns {Boolean} the dates are equal
*
* @example
* // Are 2 July 2014 06:30:45.000 and 2 July 2014 06:30:45.500 equal?
* var result = isEqual(
* new Date(2014, 6, 2, 6, 30, 45, 0)
* new Date(2014, 6, 2, 6, 30, 45, 500)
* )
* //=> false
*/
function isEqual(dirtyLeftDate, dirtyRightDate) {
var dateLeft = parse(dirtyLeftDate);
var dateRight = parse(dirtyRightDate);
return dateLeft.getTime() === dateRight.getTime();
}
module.exports = isEqual;
/***/ }),
/***/ "./node_modules/date-fns/is_first_day_of_month/index.js":
/*!**************************************************************!*\
!*** ./node_modules/date-fns/is_first_day_of_month/index.js ***!
\**************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Is the given date the first day of a month?
*
* @description
* Is the given date the first day of a month?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is the first day of a month
*
* @example
* // Is 1 September 2014 the first day of a month?
* var result = isFirstDayOfMonth(new Date(2014, 8, 1))
* //=> true
*/
function isFirstDayOfMonth(dirtyDate) {
return parse(dirtyDate).getDate() === 1;
}
module.exports = isFirstDayOfMonth;
/***/ }),
/***/ "./node_modules/date-fns/is_friday/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/is_friday/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Friday?
*
* @description
* Is the given date Friday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Friday
*
* @example
* // Is 26 September 2014 Friday?
* var result = isFriday(new Date(2014, 8, 26))
* //=> true
*/
function isFriday(dirtyDate) {
return parse(dirtyDate).getDay() === 5;
}
module.exports = isFriday;
/***/ }),
/***/ "./node_modules/date-fns/is_future/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/is_future/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Is the given date in the future?
*
* @description
* Is the given date in the future?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in the future
*
* @example
* // If today is 6 October 2014, is 31 December 2014 in the future?
* var result = isFuture(new Date(2014, 11, 31))
* //=> true
*/
function isFuture(dirtyDate) {
return parse(dirtyDate).getTime() > new Date().getTime();
}
module.exports = isFuture;
/***/ }),
/***/ "./node_modules/date-fns/is_last_day_of_month/index.js":
/*!*************************************************************!*\
!*** ./node_modules/date-fns/is_last_day_of_month/index.js ***!
\*************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var endOfDay = __webpack_require__(/*! ../end_of_day/index.js */ "./node_modules/date-fns/end_of_day/index.js");
var endOfMonth = __webpack_require__(/*! ../end_of_month/index.js */ "./node_modules/date-fns/end_of_month/index.js");
/**
* @category Month Helpers
* @summary Is the given date the last day of a month?
*
* @description
* Is the given date the last day of a month?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is the last day of a month
*
* @example
* // Is 28 February 2014 the last day of a month?
* var result = isLastDayOfMonth(new Date(2014, 1, 28))
* //=> true
*/
function isLastDayOfMonth(dirtyDate) {
var date = parse(dirtyDate);
return endOfDay(date).getTime() === endOfMonth(date).getTime();
}
module.exports = isLastDayOfMonth;
/***/ }),
/***/ "./node_modules/date-fns/is_leap_year/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_leap_year/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Is the given date in the leap year?
*
* @description
* Is the given date in the leap year?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in the leap year
*
* @example
* // Is 1 September 2012 in the leap year?
* var result = isLeapYear(new Date(2012, 8, 1))
* //=> true
*/
function isLeapYear(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
return year % 400 === 0 || year % 4 === 0 && year % 100 !== 0;
}
module.exports = isLeapYear;
/***/ }),
/***/ "./node_modules/date-fns/is_monday/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/is_monday/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Monday?
*
* @description
* Is the given date Monday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Monday
*
* @example
* // Is 22 September 2014 Monday?
* var result = isMonday(new Date(2014, 8, 22))
* //=> true
*/
function isMonday(dirtyDate) {
return parse(dirtyDate).getDay() === 1;
}
module.exports = isMonday;
/***/ }),
/***/ "./node_modules/date-fns/is_past/index.js":
/*!************************************************!*\
!*** ./node_modules/date-fns/is_past/index.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Is the given date in the past?
*
* @description
* Is the given date in the past?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in the past
*
* @example
* // If today is 6 October 2014, is 2 July 2014 in the past?
* var result = isPast(new Date(2014, 6, 2))
* //=> true
*/
function isPast(dirtyDate) {
return parse(dirtyDate).getTime() < new Date().getTime();
}
module.exports = isPast;
/***/ }),
/***/ "./node_modules/date-fns/is_same_day/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/is_same_day/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
/**
* @category Day Helpers
* @summary Are the given dates in the same day?
*
* @description
* Are the given dates in the same day?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same day
*
* @example
* // Are 4 September 06:00:00 and 4 September 18:00:00 in the same day?
* var result = isSameDay(
* new Date(2014, 8, 4, 6, 0),
* new Date(2014, 8, 4, 18, 0)
* )
* //=> true
*/
function isSameDay(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfDay = startOfDay(dirtyDateLeft);
var dateRightStartOfDay = startOfDay(dirtyDateRight);
return dateLeftStartOfDay.getTime() === dateRightStartOfDay.getTime();
}
module.exports = isSameDay;
/***/ }),
/***/ "./node_modules/date-fns/is_same_hour/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_same_hour/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfHour = __webpack_require__(/*! ../start_of_hour/index.js */ "./node_modules/date-fns/start_of_hour/index.js");
/**
* @category Hour Helpers
* @summary Are the given dates in the same hour?
*
* @description
* Are the given dates in the same hour?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same hour
*
* @example
* // Are 4 September 2014 06:00:00 and 4 September 06:30:00 in the same hour?
* var result = isSameHour(
* new Date(2014, 8, 4, 6, 0),
* new Date(2014, 8, 4, 6, 30)
* )
* //=> true
*/
function isSameHour(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfHour = startOfHour(dirtyDateLeft);
var dateRightStartOfHour = startOfHour(dirtyDateRight);
return dateLeftStartOfHour.getTime() === dateRightStartOfHour.getTime();
}
module.exports = isSameHour;
/***/ }),
/***/ "./node_modules/date-fns/is_same_iso_week/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/is_same_iso_week/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameWeek = __webpack_require__(/*! ../is_same_week/index.js */ "./node_modules/date-fns/is_same_week/index.js");
/**
* @category ISO Week Helpers
* @summary Are the given dates in the same ISO week?
*
* @description
* Are the given dates in the same ISO week?
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same ISO week
*
* @example
* // Are 1 September 2014 and 7 September 2014 in the same ISO week?
* var result = isSameISOWeek(
* new Date(2014, 8, 1),
* new Date(2014, 8, 7)
* )
* //=> true
*/
function isSameISOWeek(dirtyDateLeft, dirtyDateRight) {
return isSameWeek(dirtyDateLeft, dirtyDateRight, { weekStartsOn: 1 });
}
module.exports = isSameISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/is_same_iso_year/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/is_same_iso_year/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfISOYear = __webpack_require__(/*! ../start_of_iso_year/index.js */ "./node_modules/date-fns/start_of_iso_year/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Are the given dates in the same ISO week-numbering year?
*
* @description
* Are the given dates in the same ISO week-numbering year?
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same ISO week-numbering year
*
* @example
* // Are 29 December 2003 and 2 January 2005 in the same ISO week-numbering year?
* var result = isSameISOYear(
* new Date(2003, 11, 29),
* new Date(2005, 0, 2)
* )
* //=> true
*/
function isSameISOYear(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfYear = startOfISOYear(dirtyDateLeft);
var dateRightStartOfYear = startOfISOYear(dirtyDateRight);
return dateLeftStartOfYear.getTime() === dateRightStartOfYear.getTime();
}
module.exports = isSameISOYear;
/***/ }),
/***/ "./node_modules/date-fns/is_same_minute/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/is_same_minute/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfMinute = __webpack_require__(/*! ../start_of_minute/index.js */ "./node_modules/date-fns/start_of_minute/index.js");
/**
* @category Minute Helpers
* @summary Are the given dates in the same minute?
*
* @description
* Are the given dates in the same minute?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same minute
*
* @example
* // Are 4 September 2014 06:30:00 and 4 September 2014 06:30:15
* // in the same minute?
* var result = isSameMinute(
* new Date(2014, 8, 4, 6, 30),
* new Date(2014, 8, 4, 6, 30, 15)
* )
* //=> true
*/
function isSameMinute(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfMinute = startOfMinute(dirtyDateLeft);
var dateRightStartOfMinute = startOfMinute(dirtyDateRight);
return dateLeftStartOfMinute.getTime() === dateRightStartOfMinute.getTime();
}
module.exports = isSameMinute;
/***/ }),
/***/ "./node_modules/date-fns/is_same_month/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/is_same_month/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Are the given dates in the same month?
*
* @description
* Are the given dates in the same month?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same month
*
* @example
* // Are 2 September 2014 and 25 September 2014 in the same month?
* var result = isSameMonth(
* new Date(2014, 8, 2),
* new Date(2014, 8, 25)
* )
* //=> true
*/
function isSameMonth(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
return dateLeft.getFullYear() === dateRight.getFullYear() &&
dateLeft.getMonth() === dateRight.getMonth();
}
module.exports = isSameMonth;
/***/ }),
/***/ "./node_modules/date-fns/is_same_quarter/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/is_same_quarter/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfQuarter = __webpack_require__(/*! ../start_of_quarter/index.js */ "./node_modules/date-fns/start_of_quarter/index.js");
/**
* @category Quarter Helpers
* @summary Are the given dates in the same year quarter?
*
* @description
* Are the given dates in the same year quarter?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same quarter
*
* @example
* // Are 1 January 2014 and 8 March 2014 in the same quarter?
* var result = isSameQuarter(
* new Date(2014, 0, 1),
* new Date(2014, 2, 8)
* )
* //=> true
*/
function isSameQuarter(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfQuarter = startOfQuarter(dirtyDateLeft);
var dateRightStartOfQuarter = startOfQuarter(dirtyDateRight);
return dateLeftStartOfQuarter.getTime() === dateRightStartOfQuarter.getTime();
}
module.exports = isSameQuarter;
/***/ }),
/***/ "./node_modules/date-fns/is_same_second/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/is_same_second/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfSecond = __webpack_require__(/*! ../start_of_second/index.js */ "./node_modules/date-fns/start_of_second/index.js");
/**
* @category Second Helpers
* @summary Are the given dates in the same second?
*
* @description
* Are the given dates in the same second?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same second
*
* @example
* // Are 4 September 2014 06:30:15.000 and 4 September 2014 06:30.15.500
* // in the same second?
* var result = isSameSecond(
* new Date(2014, 8, 4, 6, 30, 15),
* new Date(2014, 8, 4, 6, 30, 15, 500)
* )
* //=> true
*/
function isSameSecond(dirtyDateLeft, dirtyDateRight) {
var dateLeftStartOfSecond = startOfSecond(dirtyDateLeft);
var dateRightStartOfSecond = startOfSecond(dirtyDateRight);
return dateLeftStartOfSecond.getTime() === dateRightStartOfSecond.getTime();
}
module.exports = isSameSecond;
/***/ }),
/***/ "./node_modules/date-fns/is_same_week/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_same_week/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfWeek = __webpack_require__(/*! ../start_of_week/index.js */ "./node_modules/date-fns/start_of_week/index.js");
/**
* @category Week Helpers
* @summary Are the given dates in the same week?
*
* @description
* Are the given dates in the same week?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Boolean} the dates are in the same week
*
* @example
* // Are 31 August 2014 and 4 September 2014 in the same week?
* var result = isSameWeek(
* new Date(2014, 7, 31),
* new Date(2014, 8, 4)
* )
* //=> true
*
* @example
* // If week starts with Monday,
* // are 31 August 2014 and 4 September 2014 in the same week?
* var result = isSameWeek(
* new Date(2014, 7, 31),
* new Date(2014, 8, 4),
* {weekStartsOn: 1}
* )
* //=> false
*/
function isSameWeek(dirtyDateLeft, dirtyDateRight, dirtyOptions) {
var dateLeftStartOfWeek = startOfWeek(dirtyDateLeft, dirtyOptions);
var dateRightStartOfWeek = startOfWeek(dirtyDateRight, dirtyOptions);
return dateLeftStartOfWeek.getTime() === dateRightStartOfWeek.getTime();
}
module.exports = isSameWeek;
/***/ }),
/***/ "./node_modules/date-fns/is_same_year/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_same_year/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Are the given dates in the same year?
*
* @description
* Are the given dates in the same year?
*
* @param {Date|String|Number} dateLeft - the first date to check
* @param {Date|String|Number} dateRight - the second date to check
* @returns {Boolean} the dates are in the same year
*
* @example
* // Are 2 September 2014 and 25 September 2014 in the same year?
* var result = isSameYear(
* new Date(2014, 8, 2),
* new Date(2014, 8, 25)
* )
* //=> true
*/
function isSameYear(dirtyDateLeft, dirtyDateRight) {
var dateLeft = parse(dirtyDateLeft);
var dateRight = parse(dirtyDateRight);
return dateLeft.getFullYear() === dateRight.getFullYear();
}
module.exports = isSameYear;
/***/ }),
/***/ "./node_modules/date-fns/is_saturday/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/is_saturday/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Saturday?
*
* @description
* Is the given date Saturday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Saturday
*
* @example
* // Is 27 September 2014 Saturday?
* var result = isSaturday(new Date(2014, 8, 27))
* //=> true
*/
function isSaturday(dirtyDate) {
return parse(dirtyDate).getDay() === 6;
}
module.exports = isSaturday;
/***/ }),
/***/ "./node_modules/date-fns/is_sunday/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/is_sunday/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Sunday?
*
* @description
* Is the given date Sunday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Sunday
*
* @example
* // Is 21 September 2014 Sunday?
* var result = isSunday(new Date(2014, 8, 21))
* //=> true
*/
function isSunday(dirtyDate) {
return parse(dirtyDate).getDay() === 0;
}
module.exports = isSunday;
/***/ }),
/***/ "./node_modules/date-fns/is_this_hour/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_this_hour/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameHour = __webpack_require__(/*! ../is_same_hour/index.js */ "./node_modules/date-fns/is_same_hour/index.js");
/**
* @category Hour Helpers
* @summary Is the given date in the same hour as the current date?
*
* @description
* Is the given date in the same hour as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this hour
*
* @example
* // If now is 25 September 2014 18:30:15.500,
* // is 25 September 2014 18:00:00 in this hour?
* var result = isThisHour(new Date(2014, 8, 25, 18))
* //=> true
*/
function isThisHour(dirtyDate) {
return isSameHour(new Date(), dirtyDate);
}
module.exports = isThisHour;
/***/ }),
/***/ "./node_modules/date-fns/is_this_iso_week/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/is_this_iso_week/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameISOWeek = __webpack_require__(/*! ../is_same_iso_week/index.js */ "./node_modules/date-fns/is_same_iso_week/index.js");
/**
* @category ISO Week Helpers
* @summary Is the given date in the same ISO week as the current date?
*
* @description
* Is the given date in the same ISO week as the current date?
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this ISO week
*
* @example
* // If today is 25 September 2014, is 22 September 2014 in this ISO week?
* var result = isThisISOWeek(new Date(2014, 8, 22))
* //=> true
*/
function isThisISOWeek(dirtyDate) {
return isSameISOWeek(new Date(), dirtyDate);
}
module.exports = isThisISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/is_this_iso_year/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/is_this_iso_year/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameISOYear = __webpack_require__(/*! ../is_same_iso_year/index.js */ "./node_modules/date-fns/is_same_iso_year/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Is the given date in the same ISO week-numbering year as the current date?
*
* @description
* Is the given date in the same ISO week-numbering year as the current date?
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this ISO week-numbering year
*
* @example
* // If today is 25 September 2014,
* // is 30 December 2013 in this ISO week-numbering year?
* var result = isThisISOYear(new Date(2013, 11, 30))
* //=> true
*/
function isThisISOYear(dirtyDate) {
return isSameISOYear(new Date(), dirtyDate);
}
module.exports = isThisISOYear;
/***/ }),
/***/ "./node_modules/date-fns/is_this_minute/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/is_this_minute/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameMinute = __webpack_require__(/*! ../is_same_minute/index.js */ "./node_modules/date-fns/is_same_minute/index.js");
/**
* @category Minute Helpers
* @summary Is the given date in the same minute as the current date?
*
* @description
* Is the given date in the same minute as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this minute
*
* @example
* // If now is 25 September 2014 18:30:15.500,
* // is 25 September 2014 18:30:00 in this minute?
* var result = isThisMinute(new Date(2014, 8, 25, 18, 30))
* //=> true
*/
function isThisMinute(dirtyDate) {
return isSameMinute(new Date(), dirtyDate);
}
module.exports = isThisMinute;
/***/ }),
/***/ "./node_modules/date-fns/is_this_month/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/is_this_month/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameMonth = __webpack_require__(/*! ../is_same_month/index.js */ "./node_modules/date-fns/is_same_month/index.js");
/**
* @category Month Helpers
* @summary Is the given date in the same month as the current date?
*
* @description
* Is the given date in the same month as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this month
*
* @example
* // If today is 25 September 2014, is 15 September 2014 in this month?
* var result = isThisMonth(new Date(2014, 8, 15))
* //=> true
*/
function isThisMonth(dirtyDate) {
return isSameMonth(new Date(), dirtyDate);
}
module.exports = isThisMonth;
/***/ }),
/***/ "./node_modules/date-fns/is_this_quarter/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/is_this_quarter/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameQuarter = __webpack_require__(/*! ../is_same_quarter/index.js */ "./node_modules/date-fns/is_same_quarter/index.js");
/**
* @category Quarter Helpers
* @summary Is the given date in the same quarter as the current date?
*
* @description
* Is the given date in the same quarter as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this quarter
*
* @example
* // If today is 25 September 2014, is 2 July 2014 in this quarter?
* var result = isThisQuarter(new Date(2014, 6, 2))
* //=> true
*/
function isThisQuarter(dirtyDate) {
return isSameQuarter(new Date(), dirtyDate);
}
module.exports = isThisQuarter;
/***/ }),
/***/ "./node_modules/date-fns/is_this_second/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/is_this_second/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameSecond = __webpack_require__(/*! ../is_same_second/index.js */ "./node_modules/date-fns/is_same_second/index.js");
/**
* @category Second Helpers
* @summary Is the given date in the same second as the current date?
*
* @description
* Is the given date in the same second as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this second
*
* @example
* // If now is 25 September 2014 18:30:15.500,
* // is 25 September 2014 18:30:15.000 in this second?
* var result = isThisSecond(new Date(2014, 8, 25, 18, 30, 15))
* //=> true
*/
function isThisSecond(dirtyDate) {
return isSameSecond(new Date(), dirtyDate);
}
module.exports = isThisSecond;
/***/ }),
/***/ "./node_modules/date-fns/is_this_week/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_this_week/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameWeek = __webpack_require__(/*! ../is_same_week/index.js */ "./node_modules/date-fns/is_same_week/index.js");
/**
* @category Week Helpers
* @summary Is the given date in the same week as the current date?
*
* @description
* Is the given date in the same week as the current date?
*
* @param {Date|String|Number} date - the date to check
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Boolean} the date is in this week
*
* @example
* // If today is 25 September 2014, is 21 September 2014 in this week?
* var result = isThisWeek(new Date(2014, 8, 21))
* //=> true
*
* @example
* // If today is 25 September 2014 and week starts with Monday
* // is 21 September 2014 in this week?
* var result = isThisWeek(new Date(2014, 8, 21), {weekStartsOn: 1})
* //=> false
*/
function isThisWeek(dirtyDate, dirtyOptions) {
return isSameWeek(new Date(), dirtyDate, dirtyOptions);
}
module.exports = isThisWeek;
/***/ }),
/***/ "./node_modules/date-fns/is_this_year/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_this_year/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isSameYear = __webpack_require__(/*! ../is_same_year/index.js */ "./node_modules/date-fns/is_same_year/index.js");
/**
* @category Year Helpers
* @summary Is the given date in the same year as the current date?
*
* @description
* Is the given date in the same year as the current date?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is in this year
*
* @example
* // If today is 25 September 2014, is 2 July 2014 in this year?
* var result = isThisYear(new Date(2014, 6, 2))
* //=> true
*/
function isThisYear(dirtyDate) {
return isSameYear(new Date(), dirtyDate);
}
module.exports = isThisYear;
/***/ }),
/***/ "./node_modules/date-fns/is_thursday/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/is_thursday/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Thursday?
*
* @description
* Is the given date Thursday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Thursday
*
* @example
* // Is 25 September 2014 Thursday?
* var result = isThursday(new Date(2014, 8, 25))
* //=> true
*/
function isThursday(dirtyDate) {
return parse(dirtyDate).getDay() === 4;
}
module.exports = isThursday;
/***/ }),
/***/ "./node_modules/date-fns/is_today/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/is_today/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
/**
* @category Day Helpers
* @summary Is the given date today?
*
* @description
* Is the given date today?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is today
*
* @example
* // If today is 6 October 2014, is 6 October 14:00:00 today?
* var result = isToday(new Date(2014, 9, 6, 14, 0))
* //=> true
*/
function isToday(dirtyDate) {
return startOfDay(dirtyDate).getTime() === startOfDay(new Date()).getTime();
}
module.exports = isToday;
/***/ }),
/***/ "./node_modules/date-fns/is_tomorrow/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/is_tomorrow/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
/**
* @category Day Helpers
* @summary Is the given date tomorrow?
*
* @description
* Is the given date tomorrow?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is tomorrow
*
* @example
* // If today is 6 October 2014, is 7 October 14:00:00 tomorrow?
* var result = isTomorrow(new Date(2014, 9, 7, 14, 0))
* //=> true
*/
function isTomorrow(dirtyDate) {
var tomorrow = new Date();
tomorrow.setDate(tomorrow.getDate() + 1);
return startOfDay(dirtyDate).getTime() === startOfDay(tomorrow).getTime();
}
module.exports = isTomorrow;
/***/ }),
/***/ "./node_modules/date-fns/is_tuesday/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/is_tuesday/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Tuesday?
*
* @description
* Is the given date Tuesday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Tuesday
*
* @example
* // Is 23 September 2014 Tuesday?
* var result = isTuesday(new Date(2014, 8, 23))
* //=> true
*/
function isTuesday(dirtyDate) {
return parse(dirtyDate).getDay() === 2;
}
module.exports = isTuesday;
/***/ }),
/***/ "./node_modules/date-fns/is_valid/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/is_valid/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var isDate = __webpack_require__(/*! ../is_date/index.js */ "./node_modules/date-fns/is_date/index.js");
/**
* @category Common Helpers
* @summary Is the given date valid?
*
* @description
* Returns false if argument is Invalid Date and true otherwise.
* Invalid Date is a Date, whose time value is NaN.
*
* Time value of Date: http://es5.github.io/#x15.9.1.1
*
* @param {Date} date - the date to check
* @returns {Boolean} the date is valid
* @throws {TypeError} argument must be an instance of Date
*
* @example
* // For the valid date:
* var result = isValid(new Date(2014, 1, 31))
* //=> true
*
* @example
* // For the invalid date:
* var result = isValid(new Date(''))
* //=> false
*/
function isValid(dirtyDate) {
if (isDate(dirtyDate)) {
return !isNaN(dirtyDate);
}
else {
throw new TypeError(toString.call(dirtyDate) + ' is not an instance of Date');
}
}
module.exports = isValid;
/***/ }),
/***/ "./node_modules/date-fns/is_wednesday/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_wednesday/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Is the given date Wednesday?
*
* @description
* Is the given date Wednesday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is Wednesday
*
* @example
* // Is 24 September 2014 Wednesday?
* var result = isWednesday(new Date(2014, 8, 24))
* //=> true
*/
function isWednesday(dirtyDate) {
return parse(dirtyDate).getDay() === 3;
}
module.exports = isWednesday;
/***/ }),
/***/ "./node_modules/date-fns/is_weekend/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/is_weekend/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Weekday Helpers
* @summary Does the given date fall on a weekend?
*
* @description
* Does the given date fall on a weekend?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date falls on a weekend
*
* @example
* // Does 5 October 2014 fall on a weekend?
* var result = isWeekend(new Date(2014, 9, 5))
* //=> true
*/
function isWeekend(dirtyDate) {
var date = parse(dirtyDate);
var day = date.getDay();
return day === 0 || day === 6;
}
module.exports = isWeekend;
/***/ }),
/***/ "./node_modules/date-fns/is_within_range/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/is_within_range/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Range Helpers
* @summary Is the given date within the range?
*
* @description
* Is the given date within the range?
*
* @param {Date|String|Number} date - the date to check
* @param {Date|String|Number} startDate - the start of range
* @param {Date|String|Number} endDate - the end of range
* @returns {Boolean} the date is within the range
* @throws {Error} startDate cannot be after endDate
*
* @example
* // For the date within the range:
* isWithinRange(
* new Date(2014, 0, 3), new Date(2014, 0, 1), new Date(2014, 0, 7)
* )
* //=> true
*
* @example
* // For the date outside of the range:
* isWithinRange(
* new Date(2014, 0, 10), new Date(2014, 0, 1), new Date(2014, 0, 7)
* )
* //=> false
*/
function isWithinRange(dirtyDate, dirtyStartDate, dirtyEndDate) {
var time = parse(dirtyDate).getTime();
var startTime = parse(dirtyStartDate).getTime();
var endTime = parse(dirtyEndDate).getTime();
if (startTime > endTime) {
throw new Error('The start of the range cannot be after the end of the range');
}
return time >= startTime && time <= endTime;
}
module.exports = isWithinRange;
/***/ }),
/***/ "./node_modules/date-fns/is_yesterday/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/is_yesterday/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
/**
* @category Day Helpers
* @summary Is the given date yesterday?
*
* @description
* Is the given date yesterday?
*
* @param {Date|String|Number} date - the date to check
* @returns {Boolean} the date is yesterday
*
* @example
* // If today is 6 October 2014, is 5 October 14:00:00 yesterday?
* var result = isYesterday(new Date(2014, 9, 5, 14, 0))
* //=> true
*/
function isYesterday(dirtyDate) {
var yesterday = new Date();
yesterday.setDate(yesterday.getDate() - 1);
return startOfDay(dirtyDate).getTime() === startOfDay(yesterday).getTime();
}
module.exports = isYesterday;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_iso_week/index.js":
/*!*************************************************************!*\
!*** ./node_modules/date-fns/last_day_of_iso_week/index.js ***!
\*************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var lastDayOfWeek = __webpack_require__(/*! ../last_day_of_week/index.js */ "./node_modules/date-fns/last_day_of_week/index.js");
/**
* @category ISO Week Helpers
* @summary Return the last day of an ISO week for the given date.
*
* @description
* Return the last day of an ISO week for the given date.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the last day of an ISO week
*
* @example
* // The last day of an ISO week for 2 September 2014 11:55:00:
* var result = lastDayOfISOWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Sun Sep 07 2014 00:00:00
*/
function lastDayOfISOWeek(dirtyDate) {
return lastDayOfWeek(dirtyDate, { weekStartsOn: 1 });
}
module.exports = lastDayOfISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_iso_year/index.js":
/*!*************************************************************!*\
!*** ./node_modules/date-fns/last_day_of_iso_year/index.js ***!
\*************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Return the last day of an ISO week-numbering year for the given date.
*
* @description
* Return the last day of an ISO week-numbering year,
* which always starts 3 days before the year's first Thursday.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the end of an ISO week-numbering year
*
* @example
* // The last day of an ISO week-numbering year for 2 July 2005:
* var result = lastDayOfISOYear(new Date(2005, 6, 2))
* //=> Sun Jan 01 2006 00:00:00
*/
function lastDayOfISOYear(dirtyDate) {
var year = getISOYear(dirtyDate);
var fourthOfJanuary = new Date(0);
fourthOfJanuary.setFullYear(year + 1, 0, 4);
fourthOfJanuary.setHours(0, 0, 0, 0);
var date = startOfISOWeek(fourthOfJanuary);
date.setDate(date.getDate() - 1);
return date;
}
module.exports = lastDayOfISOYear;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_month/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/last_day_of_month/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Return the last day of a month for the given date.
*
* @description
* Return the last day of a month for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the last day of a month
*
* @example
* // The last day of a month for 2 September 2014 11:55:00:
* var result = lastDayOfMonth(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 30 2014 00:00:00
*/
function lastDayOfMonth(dirtyDate) {
var date = parse(dirtyDate);
var month = date.getMonth();
date.setFullYear(date.getFullYear(), month + 1, 0);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = lastDayOfMonth;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_quarter/index.js":
/*!************************************************************!*\
!*** ./node_modules/date-fns/last_day_of_quarter/index.js ***!
\************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Quarter Helpers
* @summary Return the last day of a year quarter for the given date.
*
* @description
* Return the last day of a year quarter for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the last day of a quarter
*
* @example
* // The last day of a quarter for 2 September 2014 11:55:00:
* var result = lastDayOfQuarter(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 30 2014 00:00:00
*/
function lastDayOfQuarter(dirtyDate) {
var date = parse(dirtyDate);
var currentMonth = date.getMonth();
var month = currentMonth - currentMonth % 3 + 3;
date.setMonth(month, 0);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = lastDayOfQuarter;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_week/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/last_day_of_week/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Week Helpers
* @summary Return the last day of a week for the given date.
*
* @description
* Return the last day of a week for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Date} the last day of a week
*
* @example
* // The last day of a week for 2 September 2014 11:55:00:
* var result = lastDayOfWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Sat Sep 06 2014 00:00:00
*
* @example
* // If the week starts on Monday, the last day of the week for 2 September 2014 11:55:00:
* var result = lastDayOfWeek(new Date(2014, 8, 2, 11, 55, 0), {weekStartsOn: 1})
* //=> Sun Sep 07 2014 00:00:00
*/
function lastDayOfWeek(dirtyDate, dirtyOptions) {
var weekStartsOn = dirtyOptions ? (Number(dirtyOptions.weekStartsOn) || 0) : 0;
var date = parse(dirtyDate);
var day = date.getDay();
var diff = (day < weekStartsOn ? -7 : 0) + 6 - (day - weekStartsOn);
date.setHours(0, 0, 0, 0);
date.setDate(date.getDate() + diff);
return date;
}
module.exports = lastDayOfWeek;
/***/ }),
/***/ "./node_modules/date-fns/last_day_of_year/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/last_day_of_year/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Return the last day of a year for the given date.
*
* @description
* Return the last day of a year for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the last day of a year
*
* @example
* // The last day of a year for 2 September 2014 11:55:00:
* var result = lastDayOfYear(new Date(2014, 8, 2, 11, 55, 00))
* //=> Wed Dec 31 2014 00:00:00
*/
function lastDayOfYear(dirtyDate) {
var date = parse(dirtyDate);
var year = date.getFullYear();
date.setFullYear(year + 1, 0, 0);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = lastDayOfYear;
/***/ }),
/***/ "./node_modules/date-fns/locale/_lib/build_formatting_tokens_reg_exp/index.js":
/*!************************************************************************************!*\
!*** ./node_modules/date-fns/locale/_lib/build_formatting_tokens_reg_exp/index.js ***!
\************************************************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
var commonFormatterKeys = [
'M', 'MM', 'Q', 'D', 'DD', 'DDD', 'DDDD', 'd',
'E', 'W', 'WW', 'YY', 'YYYY', 'GG', 'GGGG',
'H', 'HH', 'h', 'hh', 'm', 'mm',
's', 'ss', 'S', 'SS', 'SSS',
'Z', 'ZZ', 'X', 'x'
];
function buildFormattingTokensRegExp(formatters) {
var formatterKeys = [];
for (var key in formatters) {
if (formatters.hasOwnProperty(key)) {
formatterKeys.push(key);
}
}
var formattingTokens = commonFormatterKeys
.concat(formatterKeys)
.sort()
.reverse();
var formattingTokensRegExp = new RegExp('(\\[[^\\[]*\\])|(\\\\)?' + '(' + formattingTokens.join('|') + '|.)', 'g');
return formattingTokensRegExp;
}
module.exports = buildFormattingTokensRegExp;
/***/ }),
/***/ "./node_modules/date-fns/locale/en/build_distance_in_words_locale/index.js":
/*!*********************************************************************************!*\
!*** ./node_modules/date-fns/locale/en/build_distance_in_words_locale/index.js ***!
\*********************************************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
function buildDistanceInWordsLocale() {
var distanceInWordsLocale = {
lessThanXSeconds: {
one: 'less than a second',
other: 'less than {{count}} seconds'
},
xSeconds: {
one: '1 second',
other: '{{count}} seconds'
},
halfAMinute: 'half a minute',
lessThanXMinutes: {
one: 'less than a minute',
other: 'less than {{count}} minutes'
},
xMinutes: {
one: '1 minute',
other: '{{count}} minutes'
},
aboutXHours: {
one: 'about 1 hour',
other: 'about {{count}} hours'
},
xHours: {
one: '1 hour',
other: '{{count}} hours'
},
xDays: {
one: '1 day',
other: '{{count}} days'
},
aboutXMonths: {
one: 'about 1 month',
other: 'about {{count}} months'
},
xMonths: {
one: '1 month',
other: '{{count}} months'
},
aboutXYears: {
one: 'about 1 year',
other: 'about {{count}} years'
},
xYears: {
one: '1 year',
other: '{{count}} years'
},
overXYears: {
one: 'over 1 year',
other: 'over {{count}} years'
},
almostXYears: {
one: 'almost 1 year',
other: 'almost {{count}} years'
}
};
function localize(token, count, options) {
options = options || {};
var result;
if (typeof distanceInWordsLocale[token] === 'string') {
result = distanceInWordsLocale[token];
}
else if (count === 1) {
result = distanceInWordsLocale[token].one;
}
else {
result = distanceInWordsLocale[token].other.replace('{{count}}', count);
}
if (options.addSuffix) {
if (options.comparison > 0) {
return 'in ' + result;
}
else {
return result + ' ago';
}
}
return result;
}
return {
localize: localize
};
}
module.exports = buildDistanceInWordsLocale;
/***/ }),
/***/ "./node_modules/date-fns/locale/en/build_format_locale/index.js":
/*!**********************************************************************!*\
!*** ./node_modules/date-fns/locale/en/build_format_locale/index.js ***!
\**********************************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var buildFormattingTokensRegExp = __webpack_require__(/*! ../../_lib/build_formatting_tokens_reg_exp/index.js */ "./node_modules/date-fns/locale/_lib/build_formatting_tokens_reg_exp/index.js");
function buildFormatLocale() {
// Note: in English, the names of days of the week and months are capitalized.
// If you are making a new locale based on this one, check if the same is true for the language you're working on.
// Generally, formatted dates should look like they are in the middle of a sentence,
// e.g. in Spanish language the weekdays and months should be in the lowercase.
var months3char = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'];
var monthsFull = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
var weekdays2char = ['Su', 'Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa'];
var weekdays3char = ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'];
var weekdaysFull = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
var meridiemUppercase = ['AM', 'PM'];
var meridiemLowercase = ['am', 'pm'];
var meridiemFull = ['a.m.', 'p.m.'];
var formatters = {
// Month: Jan, Feb, ..., Dec
'MMM': function (date) {
return months3char[date.getMonth()];
},
// Month: January, February, ..., December
'MMMM': function (date) {
return monthsFull[date.getMonth()];
},
// Day of week: Su, Mo, ..., Sa
'dd': function (date) {
return weekdays2char[date.getDay()];
},
// Day of week: Sun, Mon, ..., Sat
'ddd': function (date) {
return weekdays3char[date.getDay()];
},
// Day of week: Sunday, Monday, ..., Saturday
'dddd': function (date) {
return weekdaysFull[date.getDay()];
},
// AM, PM
'A': function (date) {
return (date.getHours() / 12) >= 1 ? meridiemUppercase[1] : meridiemUppercase[0];
},
// am, pm
'a': function (date) {
return (date.getHours() / 12) >= 1 ? meridiemLowercase[1] : meridiemLowercase[0];
},
// a.m., p.m.
'aa': function (date) {
return (date.getHours() / 12) >= 1 ? meridiemFull[1] : meridiemFull[0];
}
};
// Generate ordinal version of formatters: M -> Mo, D -> Do, etc.
var ordinalFormatters = ['M', 'D', 'DDD', 'd', 'Q', 'W'];
ordinalFormatters.forEach(function (formatterToken) {
formatters[formatterToken + 'o'] = function (date, formatters) {
return ordinal(formatters[formatterToken](date));
};
});
return {
formatters: formatters,
formattingTokensRegExp: buildFormattingTokensRegExp(formatters)
};
}
function ordinal(number) {
var rem100 = number % 100;
if (rem100 > 20 || rem100 < 10) {
switch (rem100 % 10) {
case 1:
return number + 'st';
case 2:
return number + 'nd';
case 3:
return number + 'rd';
}
}
return number + 'th';
}
module.exports = buildFormatLocale;
/***/ }),
/***/ "./node_modules/date-fns/locale/en/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/locale/en/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var buildDistanceInWordsLocale = __webpack_require__(/*! ./build_distance_in_words_locale/index.js */ "./node_modules/date-fns/locale/en/build_distance_in_words_locale/index.js");
var buildFormatLocale = __webpack_require__(/*! ./build_format_locale/index.js */ "./node_modules/date-fns/locale/en/build_format_locale/index.js");
/**
* @category Locales
* @summary English locale.
*/
module.exports = {
distanceInWords: buildDistanceInWordsLocale(),
format: buildFormatLocale()
};
/***/ }),
/***/ "./node_modules/date-fns/max/index.js":
/*!********************************************!*\
!*** ./node_modules/date-fns/max/index.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Return the latest of the given dates.
*
* @description
* Return the latest of the given dates.
*
* @param {...(Date|String|Number)} dates - the dates to compare
* @returns {Date} the latest of the dates
*
* @example
* // Which of these dates is the latest?
* var result = max(
* new Date(1989, 6, 10),
* new Date(1987, 1, 11),
* new Date(1995, 6, 2),
* new Date(1990, 0, 1)
* )
* //=> Sun Jul 02 1995 00:00:00
*/
function max() {
var dirtyDates = Array.prototype.slice.call(arguments);
var dates = dirtyDates.map(function (dirtyDate) {
return parse(dirtyDate);
});
var latestTimestamp = Math.max.apply(null, dates);
return new Date(latestTimestamp);
}
module.exports = max;
/***/ }),
/***/ "./node_modules/date-fns/min/index.js":
/*!********************************************!*\
!*** ./node_modules/date-fns/min/index.js ***!
\********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Common Helpers
* @summary Return the earliest of the given dates.
*
* @description
* Return the earliest of the given dates.
*
* @param {...(Date|String|Number)} dates - the dates to compare
* @returns {Date} the earliest of the dates
*
* @example
* // Which of these dates is the earliest?
* var result = min(
* new Date(1989, 6, 10),
* new Date(1987, 1, 11),
* new Date(1995, 6, 2),
* new Date(1990, 0, 1)
* )
* //=> Wed Feb 11 1987 00:00:00
*/
function min() {
var dirtyDates = Array.prototype.slice.call(arguments);
var dates = dirtyDates.map(function (dirtyDate) {
return parse(dirtyDate);
});
var earliestTimestamp = Math.min.apply(null, dates);
return new Date(earliestTimestamp);
}
module.exports = min;
/***/ }),
/***/ "./node_modules/date-fns/parse/index.js":
/*!**********************************************!*\
!*** ./node_modules/date-fns/parse/index.js ***!
\**********************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getTimezoneOffsetInMilliseconds = __webpack_require__(/*! ../_lib/getTimezoneOffsetInMilliseconds/index.js */ "./node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds/index.js");
var isDate = __webpack_require__(/*! ../is_date/index.js */ "./node_modules/date-fns/is_date/index.js");
var MILLISECONDS_IN_HOUR = 3600000;
var MILLISECONDS_IN_MINUTE = 60000;
var DEFAULT_ADDITIONAL_DIGITS = 2;
var parseTokenDateTimeDelimeter = /[T ]/;
var parseTokenPlainTime = /:/;
// year tokens
var parseTokenYY = /^(\d{2})$/;
var parseTokensYYY = [
/^([+-]\d{2})$/,
/^([+-]\d{3})$/,
/^([+-]\d{4})$/ // 2 additional digits
];
var parseTokenYYYY = /^(\d{4})/;
var parseTokensYYYYY = [
/^([+-]\d{4})/,
/^([+-]\d{5})/,
/^([+-]\d{6})/ // 2 additional digits
];
// date tokens
var parseTokenMM = /^-(\d{2})$/;
var parseTokenDDD = /^-?(\d{3})$/;
var parseTokenMMDD = /^-?(\d{2})-?(\d{2})$/;
var parseTokenWww = /^-?W(\d{2})$/;
var parseTokenWwwD = /^-?W(\d{2})-?(\d{1})$/;
// time tokens
var parseTokenHH = /^(\d{2}([.,]\d*)?)$/;
var parseTokenHHMM = /^(\d{2}):?(\d{2}([.,]\d*)?)$/;
var parseTokenHHMMSS = /^(\d{2}):?(\d{2}):?(\d{2}([.,]\d*)?)$/;
// timezone tokens
var parseTokenTimezone = /([Z+-].*)$/;
var parseTokenTimezoneZ = /^(Z)$/;
var parseTokenTimezoneHH = /^([+-])(\d{2})$/;
var parseTokenTimezoneHHMM = /^([+-])(\d{2}):?(\d{2})$/;
/**
* @category Common Helpers
* @summary Convert the given argument to an instance of Date.
*
* @description
* Convert the given argument to an instance of Date.
*
* If the argument is an instance of Date, the function returns its clone.
*
* If the argument is a number, it is treated as a timestamp.
*
* If an argument is a string, the function tries to parse it.
* Function accepts complete ISO 8601 formats as well as partial implementations.
* ISO 8601: http://en.wikipedia.org/wiki/ISO_8601
*
* If all above fails, the function passes the given argument to Date constructor.
*
* @param {Date|String|Number} argument - the value to convert
* @param {Object} [options] - the object with options
* @param {0 | 1 | 2} [options.additionalDigits=2] - the additional number of digits in the extended year format
* @returns {Date} the parsed date in the local time zone
*
* @example
* // Convert string '2014-02-11T11:30:30' to date:
* var result = parse('2014-02-11T11:30:30')
* //=> Tue Feb 11 2014 11:30:30
*
* @example
* // Parse string '+02014101',
* // if the additional number of digits in the extended year format is 1:
* var result = parse('+02014101', {additionalDigits: 1})
* //=> Fri Apr 11 2014 00:00:00
*/
function parse(argument, dirtyOptions) {
if (isDate(argument)) {
// Prevent the date to lose the milliseconds when passed to new Date() in IE10
return new Date(argument.getTime());
}
else if (typeof argument !== 'string') {
return new Date(argument);
}
var options = dirtyOptions || {};
var additionalDigits = options.additionalDigits;
if (additionalDigits == null) {
additionalDigits = DEFAULT_ADDITIONAL_DIGITS;
}
else {
additionalDigits = Number(additionalDigits);
}
var dateStrings = splitDateString(argument);
var parseYearResult = parseYear(dateStrings.date, additionalDigits);
var year = parseYearResult.year;
var restDateString = parseYearResult.restDateString;
var date = parseDate(restDateString, year);
if (date) {
var timestamp = date.getTime();
var time = 0;
var offset;
if (dateStrings.time) {
time = parseTime(dateStrings.time);
}
if (dateStrings.timezone) {
offset = parseTimezone(dateStrings.timezone) * MILLISECONDS_IN_MINUTE;
}
else {
var fullTime = timestamp + time;
var fullTimeDate = new Date(fullTime);
offset = getTimezoneOffsetInMilliseconds(fullTimeDate);
// Adjust time when it's coming from DST
var fullTimeDateNextDay = new Date(fullTime);
fullTimeDateNextDay.setDate(fullTimeDate.getDate() + 1);
var offsetDiff = getTimezoneOffsetInMilliseconds(fullTimeDateNextDay) -
getTimezoneOffsetInMilliseconds(fullTimeDate);
if (offsetDiff > 0) {
offset += offsetDiff;
}
}
return new Date(timestamp + time + offset);
}
else {
return new Date(argument);
}
}
function splitDateString(dateString) {
var dateStrings = {};
var array = dateString.split(parseTokenDateTimeDelimeter);
var timeString;
if (parseTokenPlainTime.test(array[0])) {
dateStrings.date = null;
timeString = array[0];
}
else {
dateStrings.date = array[0];
timeString = array[1];
}
if (timeString) {
var token = parseTokenTimezone.exec(timeString);
if (token) {
dateStrings.time = timeString.replace(token[1], '');
dateStrings.timezone = token[1];
}
else {
dateStrings.time = timeString;
}
}
return dateStrings;
}
function parseYear(dateString, additionalDigits) {
var parseTokenYYY = parseTokensYYY[additionalDigits];
var parseTokenYYYYY = parseTokensYYYYY[additionalDigits];
var token;
// YYYY or ±YYYYY
token = parseTokenYYYY.exec(dateString) || parseTokenYYYYY.exec(dateString);
if (token) {
var yearString = token[1];
return {
year: parseInt(yearString, 10),
restDateString: dateString.slice(yearString.length)
};
}
// YY or ±YYY
token = parseTokenYY.exec(dateString) || parseTokenYYY.exec(dateString);
if (token) {
var centuryString = token[1];
return {
year: parseInt(centuryString, 10) * 100,
restDateString: dateString.slice(centuryString.length)
};
}
// Invalid ISO-formatted year
return {
year: null
};
}
function parseDate(dateString, year) {
// Invalid ISO-formatted year
if (year === null) {
return null;
}
var token;
var date;
var month;
var week;
// YYYY
if (dateString.length === 0) {
date = new Date(0);
date.setUTCFullYear(year);
return date;
}
// YYYY-MM
token = parseTokenMM.exec(dateString);
if (token) {
date = new Date(0);
month = parseInt(token[1], 10) - 1;
date.setUTCFullYear(year, month);
return date;
}
// YYYY-DDD or YYYYDDD
token = parseTokenDDD.exec(dateString);
if (token) {
date = new Date(0);
var dayOfYear = parseInt(token[1], 10);
date.setUTCFullYear(year, 0, dayOfYear);
return date;
}
// YYYY-MM-DD or YYYYMMDD
token = parseTokenMMDD.exec(dateString);
if (token) {
date = new Date(0);
month = parseInt(token[1], 10) - 1;
var day = parseInt(token[2], 10);
date.setUTCFullYear(year, month, day);
return date;
}
// YYYY-Www or YYYYWww
token = parseTokenWww.exec(dateString);
if (token) {
week = parseInt(token[1], 10) - 1;
return dayOfISOYear(year, week);
}
// YYYY-Www-D or YYYYWwwD
token = parseTokenWwwD.exec(dateString);
if (token) {
week = parseInt(token[1], 10) - 1;
var dayOfWeek = parseInt(token[2], 10) - 1;
return dayOfISOYear(year, week, dayOfWeek);
}
// Invalid ISO-formatted date
return null;
}
function parseTime(timeString) {
var token;
var hours;
var minutes;
// hh
token = parseTokenHH.exec(timeString);
if (token) {
hours = parseFloat(token[1].replace(',', '.'));
return (hours % 24) * MILLISECONDS_IN_HOUR;
}
// hh:mm or hhmm
token = parseTokenHHMM.exec(timeString);
if (token) {
hours = parseInt(token[1], 10);
minutes = parseFloat(token[2].replace(',', '.'));
return (hours % 24) * MILLISECONDS_IN_HOUR +
minutes * MILLISECONDS_IN_MINUTE;
}
// hh:mm:ss or hhmmss
token = parseTokenHHMMSS.exec(timeString);
if (token) {
hours = parseInt(token[1], 10);
minutes = parseInt(token[2], 10);
var seconds = parseFloat(token[3].replace(',', '.'));
return (hours % 24) * MILLISECONDS_IN_HOUR +
minutes * MILLISECONDS_IN_MINUTE +
seconds * 1000;
}
// Invalid ISO-formatted time
return null;
}
function parseTimezone(timezoneString) {
var token;
var absoluteOffset;
// Z
token = parseTokenTimezoneZ.exec(timezoneString);
if (token) {
return 0;
}
// ±hh
token = parseTokenTimezoneHH.exec(timezoneString);
if (token) {
absoluteOffset = parseInt(token[2], 10) * 60;
return (token[1] === '+') ? -absoluteOffset : absoluteOffset;
}
// ±hh:mm or ±hhmm
token = parseTokenTimezoneHHMM.exec(timezoneString);
if (token) {
absoluteOffset = parseInt(token[2], 10) * 60 + parseInt(token[3], 10);
return (token[1] === '+') ? -absoluteOffset : absoluteOffset;
}
return 0;
}
function dayOfISOYear(isoYear, week, day) {
week = week || 0;
day = day || 0;
var date = new Date(0);
date.setUTCFullYear(isoYear, 0, 4);
var fourthOfJanuaryDay = date.getUTCDay() || 7;
var diff = week * 7 + day + 1 - fourthOfJanuaryDay;
date.setUTCDate(date.getUTCDate() + diff);
return date;
}
module.exports = parse;
/***/ }),
/***/ "./node_modules/date-fns/set_date/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/set_date/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Set the day of the month to the given date.
*
* @description
* Set the day of the month to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} dayOfMonth - the day of the month of the new date
* @returns {Date} the new date with the day of the month setted
*
* @example
* // Set the 30th day of the month to 1 September 2014:
* var result = setDate(new Date(2014, 8, 1), 30)
* //=> Tue Sep 30 2014 00:00:00
*/
function setDate(dirtyDate, dirtyDayOfMonth) {
var date = parse(dirtyDate);
var dayOfMonth = Number(dirtyDayOfMonth);
date.setDate(dayOfMonth);
return date;
}
module.exports = setDate;
/***/ }),
/***/ "./node_modules/date-fns/set_day/index.js":
/*!************************************************!*\
!*** ./node_modules/date-fns/set_day/index.js ***!
\************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var addDays = __webpack_require__(/*! ../add_days/index.js */ "./node_modules/date-fns/add_days/index.js");
/**
* @category Weekday Helpers
* @summary Set the day of the week to the given date.
*
* @description
* Set the day of the week to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} day - the day of the week of the new date
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Date} the new date with the day of the week setted
*
* @example
* // Set Sunday to 1 September 2014:
* var result = setDay(new Date(2014, 8, 1), 0)
* //=> Sun Aug 31 2014 00:00:00
*
* @example
* // If week starts with Monday, set Sunday to 1 September 2014:
* var result = setDay(new Date(2014, 8, 1), 0, {weekStartsOn: 1})
* //=> Sun Sep 07 2014 00:00:00
*/
function setDay(dirtyDate, dirtyDay, dirtyOptions) {
var weekStartsOn = dirtyOptions ? (Number(dirtyOptions.weekStartsOn) || 0) : 0;
var date = parse(dirtyDate);
var day = Number(dirtyDay);
var currentDay = date.getDay();
var remainder = day % 7;
var dayIndex = (remainder + 7) % 7;
var diff = (dayIndex < weekStartsOn ? 7 : 0) + day - currentDay;
return addDays(date, diff);
}
module.exports = setDay;
/***/ }),
/***/ "./node_modules/date-fns/set_day_of_year/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/set_day_of_year/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Set the day of the year to the given date.
*
* @description
* Set the day of the year to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} dayOfYear - the day of the year of the new date
* @returns {Date} the new date with the day of the year setted
*
* @example
* // Set the 2nd day of the year to 2 July 2014:
* var result = setDayOfYear(new Date(2014, 6, 2), 2)
* //=> Thu Jan 02 2014 00:00:00
*/
function setDayOfYear(dirtyDate, dirtyDayOfYear) {
var date = parse(dirtyDate);
var dayOfYear = Number(dirtyDayOfYear);
date.setMonth(0);
date.setDate(dayOfYear);
return date;
}
module.exports = setDayOfYear;
/***/ }),
/***/ "./node_modules/date-fns/set_hours/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/set_hours/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Hour Helpers
* @summary Set the hours to the given date.
*
* @description
* Set the hours to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} hours - the hours of the new date
* @returns {Date} the new date with the hours setted
*
* @example
* // Set 4 hours to 1 September 2014 11:30:00:
* var result = setHours(new Date(2014, 8, 1, 11, 30), 4)
* //=> Mon Sep 01 2014 04:30:00
*/
function setHours(dirtyDate, dirtyHours) {
var date = parse(dirtyDate);
var hours = Number(dirtyHours);
date.setHours(hours);
return date;
}
module.exports = setHours;
/***/ }),
/***/ "./node_modules/date-fns/set_iso_day/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/set_iso_day/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var addDays = __webpack_require__(/*! ../add_days/index.js */ "./node_modules/date-fns/add_days/index.js");
var getISODay = __webpack_require__(/*! ../get_iso_day/index.js */ "./node_modules/date-fns/get_iso_day/index.js");
/**
* @category Weekday Helpers
* @summary Set the day of the ISO week to the given date.
*
* @description
* Set the day of the ISO week to the given date.
* ISO week starts with Monday.
* 7 is the index of Sunday, 1 is the index of Monday etc.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} day - the day of the ISO week of the new date
* @returns {Date} the new date with the day of the ISO week setted
*
* @example
* // Set Sunday to 1 September 2014:
* var result = setISODay(new Date(2014, 8, 1), 7)
* //=> Sun Sep 07 2014 00:00:00
*/
function setISODay(dirtyDate, dirtyDay) {
var date = parse(dirtyDate);
var day = Number(dirtyDay);
var currentDay = getISODay(date);
var diff = day - currentDay;
return addDays(date, diff);
}
module.exports = setISODay;
/***/ }),
/***/ "./node_modules/date-fns/set_iso_week/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/set_iso_week/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var getISOWeek = __webpack_require__(/*! ../get_iso_week/index.js */ "./node_modules/date-fns/get_iso_week/index.js");
/**
* @category ISO Week Helpers
* @summary Set the ISO week to the given date.
*
* @description
* Set the ISO week to the given date, saving the weekday number.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} isoWeek - the ISO week of the new date
* @returns {Date} the new date with the ISO week setted
*
* @example
* // Set the 53rd ISO week to 7 August 2004:
* var result = setISOWeek(new Date(2004, 7, 7), 53)
* //=> Sat Jan 01 2005 00:00:00
*/
function setISOWeek(dirtyDate, dirtyISOWeek) {
var date = parse(dirtyDate);
var isoWeek = Number(dirtyISOWeek);
var diff = getISOWeek(date) - isoWeek;
date.setDate(date.getDate() - diff * 7);
return date;
}
module.exports = setISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/set_iso_year/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/set_iso_year/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var startOfISOYear = __webpack_require__(/*! ../start_of_iso_year/index.js */ "./node_modules/date-fns/start_of_iso_year/index.js");
var differenceInCalendarDays = __webpack_require__(/*! ../difference_in_calendar_days/index.js */ "./node_modules/date-fns/difference_in_calendar_days/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Set the ISO week-numbering year to the given date.
*
* @description
* Set the ISO week-numbering year to the given date,
* saving the week number and the weekday number.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} isoYear - the ISO week-numbering year of the new date
* @returns {Date} the new date with the ISO week-numbering year setted
*
* @example
* // Set ISO week-numbering year 2007 to 29 December 2008:
* var result = setISOYear(new Date(2008, 11, 29), 2007)
* //=> Mon Jan 01 2007 00:00:00
*/
function setISOYear(dirtyDate, dirtyISOYear) {
var date = parse(dirtyDate);
var isoYear = Number(dirtyISOYear);
var diff = differenceInCalendarDays(date, startOfISOYear(date));
var fourthOfJanuary = new Date(0);
fourthOfJanuary.setFullYear(isoYear, 0, 4);
fourthOfJanuary.setHours(0, 0, 0, 0);
date = startOfISOYear(fourthOfJanuary);
date.setDate(date.getDate() + diff);
return date;
}
module.exports = setISOYear;
/***/ }),
/***/ "./node_modules/date-fns/set_milliseconds/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/set_milliseconds/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Millisecond Helpers
* @summary Set the milliseconds to the given date.
*
* @description
* Set the milliseconds to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} milliseconds - the milliseconds of the new date
* @returns {Date} the new date with the milliseconds setted
*
* @example
* // Set 300 milliseconds to 1 September 2014 11:30:40.500:
* var result = setMilliseconds(new Date(2014, 8, 1, 11, 30, 40, 500), 300)
* //=> Mon Sep 01 2014 11:30:40.300
*/
function setMilliseconds(dirtyDate, dirtyMilliseconds) {
var date = parse(dirtyDate);
var milliseconds = Number(dirtyMilliseconds);
date.setMilliseconds(milliseconds);
return date;
}
module.exports = setMilliseconds;
/***/ }),
/***/ "./node_modules/date-fns/set_minutes/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/set_minutes/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Minute Helpers
* @summary Set the minutes to the given date.
*
* @description
* Set the minutes to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} minutes - the minutes of the new date
* @returns {Date} the new date with the minutes setted
*
* @example
* // Set 45 minutes to 1 September 2014 11:30:40:
* var result = setMinutes(new Date(2014, 8, 1, 11, 30, 40), 45)
* //=> Mon Sep 01 2014 11:45:40
*/
function setMinutes(dirtyDate, dirtyMinutes) {
var date = parse(dirtyDate);
var minutes = Number(dirtyMinutes);
date.setMinutes(minutes);
return date;
}
module.exports = setMinutes;
/***/ }),
/***/ "./node_modules/date-fns/set_month/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/set_month/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var getDaysInMonth = __webpack_require__(/*! ../get_days_in_month/index.js */ "./node_modules/date-fns/get_days_in_month/index.js");
/**
* @category Month Helpers
* @summary Set the month to the given date.
*
* @description
* Set the month to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} month - the month of the new date
* @returns {Date} the new date with the month setted
*
* @example
* // Set February to 1 September 2014:
* var result = setMonth(new Date(2014, 8, 1), 1)
* //=> Sat Feb 01 2014 00:00:00
*/
function setMonth(dirtyDate, dirtyMonth) {
var date = parse(dirtyDate);
var month = Number(dirtyMonth);
var year = date.getFullYear();
var day = date.getDate();
var dateWithDesiredMonth = new Date(0);
dateWithDesiredMonth.setFullYear(year, month, 15);
dateWithDesiredMonth.setHours(0, 0, 0, 0);
var daysInMonth = getDaysInMonth(dateWithDesiredMonth);
// Set the last day of the new month
// if the original date was the last day of the longer month
date.setMonth(month, Math.min(day, daysInMonth));
return date;
}
module.exports = setMonth;
/***/ }),
/***/ "./node_modules/date-fns/set_quarter/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/set_quarter/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
var setMonth = __webpack_require__(/*! ../set_month/index.js */ "./node_modules/date-fns/set_month/index.js");
/**
* @category Quarter Helpers
* @summary Set the year quarter to the given date.
*
* @description
* Set the year quarter to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} quarter - the quarter of the new date
* @returns {Date} the new date with the quarter setted
*
* @example
* // Set the 2nd quarter to 2 July 2014:
* var result = setQuarter(new Date(2014, 6, 2), 2)
* //=> Wed Apr 02 2014 00:00:00
*/
function setQuarter(dirtyDate, dirtyQuarter) {
var date = parse(dirtyDate);
var quarter = Number(dirtyQuarter);
var oldQuarter = Math.floor(date.getMonth() / 3) + 1;
var diff = quarter - oldQuarter;
return setMonth(date, date.getMonth() + diff * 3);
}
module.exports = setQuarter;
/***/ }),
/***/ "./node_modules/date-fns/set_seconds/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/set_seconds/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Second Helpers
* @summary Set the seconds to the given date.
*
* @description
* Set the seconds to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} seconds - the seconds of the new date
* @returns {Date} the new date with the seconds setted
*
* @example
* // Set 45 seconds to 1 September 2014 11:30:40:
* var result = setSeconds(new Date(2014, 8, 1, 11, 30, 40), 45)
* //=> Mon Sep 01 2014 11:30:45
*/
function setSeconds(dirtyDate, dirtySeconds) {
var date = parse(dirtyDate);
var seconds = Number(dirtySeconds);
date.setSeconds(seconds);
return date;
}
module.exports = setSeconds;
/***/ }),
/***/ "./node_modules/date-fns/set_year/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/set_year/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Set the year to the given date.
*
* @description
* Set the year to the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} year - the year of the new date
* @returns {Date} the new date with the year setted
*
* @example
* // Set year 2013 to 1 September 2014:
* var result = setYear(new Date(2014, 8, 1), 2013)
* //=> Sun Sep 01 2013 00:00:00
*/
function setYear(dirtyDate, dirtyYear) {
var date = parse(dirtyDate);
var year = Number(dirtyYear);
date.setFullYear(year);
return date;
}
module.exports = setYear;
/***/ }),
/***/ "./node_modules/date-fns/start_of_day/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/start_of_day/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Day Helpers
* @summary Return the start of a day for the given date.
*
* @description
* Return the start of a day for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a day
*
* @example
* // The start of a day for 2 September 2014 11:55:00:
* var result = startOfDay(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Sep 02 2014 00:00:00
*/
function startOfDay(dirtyDate) {
var date = parse(dirtyDate);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfDay;
/***/ }),
/***/ "./node_modules/date-fns/start_of_hour/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/start_of_hour/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Hour Helpers
* @summary Return the start of an hour for the given date.
*
* @description
* Return the start of an hour for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of an hour
*
* @example
* // The start of an hour for 2 September 2014 11:55:00:
* var result = startOfHour(new Date(2014, 8, 2, 11, 55))
* //=> Tue Sep 02 2014 11:00:00
*/
function startOfHour(dirtyDate) {
var date = parse(dirtyDate);
date.setMinutes(0, 0, 0);
return date;
}
module.exports = startOfHour;
/***/ }),
/***/ "./node_modules/date-fns/start_of_iso_week/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/start_of_iso_week/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfWeek = __webpack_require__(/*! ../start_of_week/index.js */ "./node_modules/date-fns/start_of_week/index.js");
/**
* @category ISO Week Helpers
* @summary Return the start of an ISO week for the given date.
*
* @description
* Return the start of an ISO week for the given date.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of an ISO week
*
* @example
* // The start of an ISO week for 2 September 2014 11:55:00:
* var result = startOfISOWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Mon Sep 01 2014 00:00:00
*/
function startOfISOWeek(dirtyDate) {
return startOfWeek(dirtyDate, { weekStartsOn: 1 });
}
module.exports = startOfISOWeek;
/***/ }),
/***/ "./node_modules/date-fns/start_of_iso_year/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/start_of_iso_year/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var getISOYear = __webpack_require__(/*! ../get_iso_year/index.js */ "./node_modules/date-fns/get_iso_year/index.js");
var startOfISOWeek = __webpack_require__(/*! ../start_of_iso_week/index.js */ "./node_modules/date-fns/start_of_iso_week/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Return the start of an ISO week-numbering year for the given date.
*
* @description
* Return the start of an ISO week-numbering year,
* which always starts 3 days before the year's first Thursday.
* The result will be in the local timezone.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of an ISO year
*
* @example
* // The start of an ISO week-numbering year for 2 July 2005:
* var result = startOfISOYear(new Date(2005, 6, 2))
* //=> Mon Jan 03 2005 00:00:00
*/
function startOfISOYear(dirtyDate) {
var year = getISOYear(dirtyDate);
var fourthOfJanuary = new Date(0);
fourthOfJanuary.setFullYear(year, 0, 4);
fourthOfJanuary.setHours(0, 0, 0, 0);
var date = startOfISOWeek(fourthOfJanuary);
return date;
}
module.exports = startOfISOYear;
/***/ }),
/***/ "./node_modules/date-fns/start_of_minute/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/start_of_minute/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Minute Helpers
* @summary Return the start of a minute for the given date.
*
* @description
* Return the start of a minute for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a minute
*
* @example
* // The start of a minute for 1 December 2014 22:15:45.400:
* var result = startOfMinute(new Date(2014, 11, 1, 22, 15, 45, 400))
* //=> Mon Dec 01 2014 22:15:00
*/
function startOfMinute(dirtyDate) {
var date = parse(dirtyDate);
date.setSeconds(0, 0);
return date;
}
module.exports = startOfMinute;
/***/ }),
/***/ "./node_modules/date-fns/start_of_month/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/start_of_month/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Month Helpers
* @summary Return the start of a month for the given date.
*
* @description
* Return the start of a month for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a month
*
* @example
* // The start of a month for 2 September 2014 11:55:00:
* var result = startOfMonth(new Date(2014, 8, 2, 11, 55, 0))
* //=> Mon Sep 01 2014 00:00:00
*/
function startOfMonth(dirtyDate) {
var date = parse(dirtyDate);
date.setDate(1);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfMonth;
/***/ }),
/***/ "./node_modules/date-fns/start_of_quarter/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/start_of_quarter/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Quarter Helpers
* @summary Return the start of a year quarter for the given date.
*
* @description
* Return the start of a year quarter for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a quarter
*
* @example
* // The start of a quarter for 2 September 2014 11:55:00:
* var result = startOfQuarter(new Date(2014, 8, 2, 11, 55, 0))
* //=> Tue Jul 01 2014 00:00:00
*/
function startOfQuarter(dirtyDate) {
var date = parse(dirtyDate);
var currentMonth = date.getMonth();
var month = currentMonth - currentMonth % 3;
date.setMonth(month, 1);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfQuarter;
/***/ }),
/***/ "./node_modules/date-fns/start_of_second/index.js":
/*!********************************************************!*\
!*** ./node_modules/date-fns/start_of_second/index.js ***!
\********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Second Helpers
* @summary Return the start of a second for the given date.
*
* @description
* Return the start of a second for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a second
*
* @example
* // The start of a second for 1 December 2014 22:15:45.400:
* var result = startOfSecond(new Date(2014, 11, 1, 22, 15, 45, 400))
* //=> Mon Dec 01 2014 22:15:45.000
*/
function startOfSecond(dirtyDate) {
var date = parse(dirtyDate);
date.setMilliseconds(0);
return date;
}
module.exports = startOfSecond;
/***/ }),
/***/ "./node_modules/date-fns/start_of_today/index.js":
/*!*******************************************************!*\
!*** ./node_modules/date-fns/start_of_today/index.js ***!
\*******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var startOfDay = __webpack_require__(/*! ../start_of_day/index.js */ "./node_modules/date-fns/start_of_day/index.js");
/**
* @category Day Helpers
* @summary Return the start of today.
*
* @description
* Return the start of today.
*
* @returns {Date} the start of today
*
* @example
* // If today is 6 October 2014:
* var result = startOfToday()
* //=> Mon Oct 6 2014 00:00:00
*/
function startOfToday() {
return startOfDay(new Date());
}
module.exports = startOfToday;
/***/ }),
/***/ "./node_modules/date-fns/start_of_tomorrow/index.js":
/*!**********************************************************!*\
!*** ./node_modules/date-fns/start_of_tomorrow/index.js ***!
\**********************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
/**
* @category Day Helpers
* @summary Return the start of tomorrow.
*
* @description
* Return the start of tomorrow.
*
* @returns {Date} the start of tomorrow
*
* @example
* // If today is 6 October 2014:
* var result = startOfTomorrow()
* //=> Tue Oct 7 2014 00:00:00
*/
function startOfTomorrow() {
var now = new Date();
var year = now.getFullYear();
var month = now.getMonth();
var day = now.getDate();
var date = new Date(0);
date.setFullYear(year, month, day + 1);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfTomorrow;
/***/ }),
/***/ "./node_modules/date-fns/start_of_week/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/start_of_week/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Week Helpers
* @summary Return the start of a week for the given date.
*
* @description
* Return the start of a week for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @param {Object} [options] - the object with options
* @param {Number} [options.weekStartsOn=0] - the index of the first day of the week (0 - Sunday)
* @returns {Date} the start of a week
*
* @example
* // The start of a week for 2 September 2014 11:55:00:
* var result = startOfWeek(new Date(2014, 8, 2, 11, 55, 0))
* //=> Sun Aug 31 2014 00:00:00
*
* @example
* // If the week starts on Monday, the start of the week for 2 September 2014 11:55:00:
* var result = startOfWeek(new Date(2014, 8, 2, 11, 55, 0), {weekStartsOn: 1})
* //=> Mon Sep 01 2014 00:00:00
*/
function startOfWeek(dirtyDate, dirtyOptions) {
var weekStartsOn = dirtyOptions ? (Number(dirtyOptions.weekStartsOn) || 0) : 0;
var date = parse(dirtyDate);
var day = date.getDay();
var diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;
date.setDate(date.getDate() - diff);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfWeek;
/***/ }),
/***/ "./node_modules/date-fns/start_of_year/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/start_of_year/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var parse = __webpack_require__(/*! ../parse/index.js */ "./node_modules/date-fns/parse/index.js");
/**
* @category Year Helpers
* @summary Return the start of a year for the given date.
*
* @description
* Return the start of a year for the given date.
* The result will be in the local timezone.
*
* @param {Date|String|Number} date - the original date
* @returns {Date} the start of a year
*
* @example
* // The start of a year for 2 September 2014 11:55:00:
* var result = startOfYear(new Date(2014, 8, 2, 11, 55, 00))
* //=> Wed Jan 01 2014 00:00:00
*/
function startOfYear(dirtyDate) {
var cleanDate = parse(dirtyDate);
var date = new Date(0);
date.setFullYear(cleanDate.getFullYear(), 0, 1);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfYear;
/***/ }),
/***/ "./node_modules/date-fns/start_of_yesterday/index.js":
/*!***********************************************************!*\
!*** ./node_modules/date-fns/start_of_yesterday/index.js ***!
\***********************************************************/
/*! no static exports found */
/***/ (function(module, exports) {
/**
* @category Day Helpers
* @summary Return the start of yesterday.
*
* @description
* Return the start of yesterday.
*
* @returns {Date} the start of yesterday
*
* @example
* // If today is 6 October 2014:
* var result = startOfYesterday()
* //=> Sun Oct 5 2014 00:00:00
*/
function startOfYesterday() {
var now = new Date();
var year = now.getFullYear();
var month = now.getMonth();
var day = now.getDate();
var date = new Date(0);
date.setFullYear(year, month, day - 1);
date.setHours(0, 0, 0, 0);
return date;
}
module.exports = startOfYesterday;
/***/ }),
/***/ "./node_modules/date-fns/sub_days/index.js":
/*!*************************************************!*\
!*** ./node_modules/date-fns/sub_days/index.js ***!
\*************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addDays = __webpack_require__(/*! ../add_days/index.js */ "./node_modules/date-fns/add_days/index.js");
/**
* @category Day Helpers
* @summary Subtract the specified number of days from the given date.
*
* @description
* Subtract the specified number of days from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of days to be subtracted
* @returns {Date} the new date with the days subtracted
*
* @example
* // Subtract 10 days from 1 September 2014:
* var result = subDays(new Date(2014, 8, 1), 10)
* //=> Fri Aug 22 2014 00:00:00
*/
function subDays(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addDays(dirtyDate, -amount);
}
module.exports = subDays;
/***/ }),
/***/ "./node_modules/date-fns/sub_hours/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/sub_hours/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addHours = __webpack_require__(/*! ../add_hours/index.js */ "./node_modules/date-fns/add_hours/index.js");
/**
* @category Hour Helpers
* @summary Subtract the specified number of hours from the given date.
*
* @description
* Subtract the specified number of hours from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of hours to be subtracted
* @returns {Date} the new date with the hours subtracted
*
* @example
* // Subtract 2 hours from 11 July 2014 01:00:00:
* var result = subHours(new Date(2014, 6, 11, 1, 0), 2)
* //=> Thu Jul 10 2014 23:00:00
*/
function subHours(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addHours(dirtyDate, -amount);
}
module.exports = subHours;
/***/ }),
/***/ "./node_modules/date-fns/sub_iso_years/index.js":
/*!******************************************************!*\
!*** ./node_modules/date-fns/sub_iso_years/index.js ***!
\******************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addISOYears = __webpack_require__(/*! ../add_iso_years/index.js */ "./node_modules/date-fns/add_iso_years/index.js");
/**
* @category ISO Week-Numbering Year Helpers
* @summary Subtract the specified number of ISO week-numbering years from the given date.
*
* @description
* Subtract the specified number of ISO week-numbering years from the given date.
*
* ISO week-numbering year: http://en.wikipedia.org/wiki/ISO_week_date
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of ISO week-numbering years to be subtracted
* @returns {Date} the new date with the ISO week-numbering years subtracted
*
* @example
* // Subtract 5 ISO week-numbering years from 1 September 2014:
* var result = subISOYears(new Date(2014, 8, 1), 5)
* //=> Mon Aug 31 2009 00:00:00
*/
function subISOYears(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addISOYears(dirtyDate, -amount);
}
module.exports = subISOYears;
/***/ }),
/***/ "./node_modules/date-fns/sub_milliseconds/index.js":
/*!*********************************************************!*\
!*** ./node_modules/date-fns/sub_milliseconds/index.js ***!
\*********************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMilliseconds = __webpack_require__(/*! ../add_milliseconds/index.js */ "./node_modules/date-fns/add_milliseconds/index.js");
/**
* @category Millisecond Helpers
* @summary Subtract the specified number of milliseconds from the given date.
*
* @description
* Subtract the specified number of milliseconds from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of milliseconds to be subtracted
* @returns {Date} the new date with the milliseconds subtracted
*
* @example
* // Subtract 750 milliseconds from 10 July 2014 12:45:30.000:
* var result = subMilliseconds(new Date(2014, 6, 10, 12, 45, 30, 0), 750)
* //=> Thu Jul 10 2014 12:45:29.250
*/
function subMilliseconds(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMilliseconds(dirtyDate, -amount);
}
module.exports = subMilliseconds;
/***/ }),
/***/ "./node_modules/date-fns/sub_minutes/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/sub_minutes/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMinutes = __webpack_require__(/*! ../add_minutes/index.js */ "./node_modules/date-fns/add_minutes/index.js");
/**
* @category Minute Helpers
* @summary Subtract the specified number of minutes from the given date.
*
* @description
* Subtract the specified number of minutes from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of minutes to be subtracted
* @returns {Date} the new date with the mintues subtracted
*
* @example
* // Subtract 30 minutes from 10 July 2014 12:00:00:
* var result = subMinutes(new Date(2014, 6, 10, 12, 0), 30)
* //=> Thu Jul 10 2014 11:30:00
*/
function subMinutes(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMinutes(dirtyDate, -amount);
}
module.exports = subMinutes;
/***/ }),
/***/ "./node_modules/date-fns/sub_months/index.js":
/*!***************************************************!*\
!*** ./node_modules/date-fns/sub_months/index.js ***!
\***************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addMonths = __webpack_require__(/*! ../add_months/index.js */ "./node_modules/date-fns/add_months/index.js");
/**
* @category Month Helpers
* @summary Subtract the specified number of months from the given date.
*
* @description
* Subtract the specified number of months from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of months to be subtracted
* @returns {Date} the new date with the months subtracted
*
* @example
* // Subtract 5 months from 1 February 2015:
* var result = subMonths(new Date(2015, 1, 1), 5)
* //=> Mon Sep 01 2014 00:00:00
*/
function subMonths(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addMonths(dirtyDate, -amount);
}
module.exports = subMonths;
/***/ }),
/***/ "./node_modules/date-fns/sub_quarters/index.js":
/*!*****************************************************!*\
!*** ./node_modules/date-fns/sub_quarters/index.js ***!
\*****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addQuarters = __webpack_require__(/*! ../add_quarters/index.js */ "./node_modules/date-fns/add_quarters/index.js");
/**
* @category Quarter Helpers
* @summary Subtract the specified number of year quarters from the given date.
*
* @description
* Subtract the specified number of year quarters from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of quarters to be subtracted
* @returns {Date} the new date with the quarters subtracted
*
* @example
* // Subtract 3 quarters from 1 September 2014:
* var result = subQuarters(new Date(2014, 8, 1), 3)
* //=> Sun Dec 01 2013 00:00:00
*/
function subQuarters(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addQuarters(dirtyDate, -amount);
}
module.exports = subQuarters;
/***/ }),
/***/ "./node_modules/date-fns/sub_seconds/index.js":
/*!****************************************************!*\
!*** ./node_modules/date-fns/sub_seconds/index.js ***!
\****************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addSeconds = __webpack_require__(/*! ../add_seconds/index.js */ "./node_modules/date-fns/add_seconds/index.js");
/**
* @category Second Helpers
* @summary Subtract the specified number of seconds from the given date.
*
* @description
* Subtract the specified number of seconds from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of seconds to be subtracted
* @returns {Date} the new date with the seconds subtracted
*
* @example
* // Subtract 30 seconds from 10 July 2014 12:45:00:
* var result = subSeconds(new Date(2014, 6, 10, 12, 45, 0), 30)
* //=> Thu Jul 10 2014 12:44:30
*/
function subSeconds(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addSeconds(dirtyDate, -amount);
}
module.exports = subSeconds;
/***/ }),
/***/ "./node_modules/date-fns/sub_weeks/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/sub_weeks/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addWeeks = __webpack_require__(/*! ../add_weeks/index.js */ "./node_modules/date-fns/add_weeks/index.js");
/**
* @category Week Helpers
* @summary Subtract the specified number of weeks from the given date.
*
* @description
* Subtract the specified number of weeks from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of weeks to be subtracted
* @returns {Date} the new date with the weeks subtracted
*
* @example
* // Subtract 4 weeks from 1 September 2014:
* var result = subWeeks(new Date(2014, 8, 1), 4)
* //=> Mon Aug 04 2014 00:00:00
*/
function subWeeks(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addWeeks(dirtyDate, -amount);
}
module.exports = subWeeks;
/***/ }),
/***/ "./node_modules/date-fns/sub_years/index.js":
/*!**************************************************!*\
!*** ./node_modules/date-fns/sub_years/index.js ***!
\**************************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
var addYears = __webpack_require__(/*! ../add_years/index.js */ "./node_modules/date-fns/add_years/index.js");
/**
* @category Year Helpers
* @summary Subtract the specified number of years from the given date.
*
* @description
* Subtract the specified number of years from the given date.
*
* @param {Date|String|Number} date - the date to be changed
* @param {Number} amount - the amount of years to be subtracted
* @returns {Date} the new date with the years subtracted
*
* @example
* // Subtract 5 years from 1 September 2014:
* var result = subYears(new Date(2014, 8, 1), 5)
* //=> Tue Sep 01 2009 00:00:00
*/
function subYears(dirtyDate, dirtyAmount) {
var amount = Number(dirtyAmount);
return addYears(dirtyDate, -amount);
}
module.exports = subYears;
/***/ }),
/***/ "./node_modules/lodash/lodash.js":
/*!***************************************!*\
!*** ./node_modules/lodash/lodash.js ***!
\***************************************/
/*! no static exports found */
/***/ (function(module, exports, __webpack_require__) {
/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**
* @license
* Lodash
* Copyright OpenJS Foundation and other contributors
* Released under MIT license
* Based on Underscore.js 1.8.3
* Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
*/
;(function() {
/** Used as a safe reference for `undefined` in pre-ES5 environments. */
var undefined;
/** Used as the semantic version number. */
var VERSION = '4.17.19';
/** Used as the size to enable large array optimizations. */
var LARGE_ARRAY_SIZE = 200;
/** Error message constants. */
var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
FUNC_ERROR_TEXT = 'Expected a function';
/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED = '__lodash_hash_undefined__';
/** Used as the maximum memoize cache size. */
var MAX_MEMOIZE_SIZE = 500;
/** Used as the internal argument placeholder. */
var PLACEHOLDER = '__lodash_placeholder__';
/** Used to compose bitmasks for cloning. */
var CLONE_DEEP_FLAG = 1,
CLONE_FLAT_FLAG = 2,
CLONE_SYMBOLS_FLAG = 4;
/** Used to compose bitmasks for value comparisons. */
var COMPARE_PARTIAL_FLAG = 1,
COMPARE_UNORDERED_FLAG = 2;
/** Used to compose bitmasks for function metadata. */
var WRAP_BIND_FLAG = 1,
WRAP_BIND_KEY_FLAG = 2,
WRAP_CURRY_BOUND_FLAG = 4,
WRAP_CURRY_FLAG = 8,
WRAP_CURRY_RIGHT_FLAG = 16,
WRAP_PARTIAL_FLAG = 32,
WRAP_PARTIAL_RIGHT_FLAG = 64,
WRAP_ARY_FLAG = 128,
WRAP_REARG_FLAG = 256,
WRAP_FLIP_FLAG = 512;
/** Used as default options for `_.truncate`. */
var DEFAULT_TRUNC_LENGTH = 30,
DEFAULT_TRUNC_OMISSION = '...';
/** Used to detect hot functions by number of calls within a span of milliseconds. */
var HOT_COUNT = 800,
HOT_SPAN = 16;
/** Used to indicate the type of lazy iteratees. */
var LAZY_FILTER_FLAG = 1,
LAZY_MAP_FLAG = 2,
LAZY_WHILE_FLAG = 3;
/** Used as references for various `Number` constants. */
var INFINITY = 1 / 0,
MAX_SAFE_INTEGER = 9007199254740991,
MAX_INTEGER = 1.7976931348623157e+308,
NAN = 0 / 0;
/** Used as references for the maximum length and index of an array. */
var MAX_ARRAY_LENGTH = 4294967295,
MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
/** Used to associate wrap methods with their bit flags. */
var wrapFlags = [
['ary', WRAP_ARY_FLAG],
['bind', WRAP_BIND_FLAG],
['bindKey', WRAP_BIND_KEY_FLAG],
['curry', WRAP_CURRY_FLAG],
['curryRight', WRAP_CURRY_RIGHT_FLAG],
['flip', WRAP_FLIP_FLAG],
['partial', WRAP_PARTIAL_FLAG],
['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
['rearg', WRAP_REARG_FLAG]
];
/** `Object#toString` result references. */
var argsTag = '[object Arguments]',
arrayTag = '[object Array]',
asyncTag = '[object AsyncFunction]',
boolTag = '[object Boolean]',
dateTag = '[object Date]',
domExcTag = '[object DOMException]',
errorTag = '[object Error]',
funcTag = '[object Function]',
genTag = '[object GeneratorFunction]',
mapTag = '[object Map]',
numberTag = '[object Number]',
nullTag = '[object Null]',
objectTag = '[object Object]',
promiseTag = '[object Promise]',
proxyTag = '[object Proxy]',
regexpTag = '[object RegExp]',
setTag = '[object Set]',
stringTag = '[object String]',
symbolTag = '[object Symbol]',
undefinedTag = '[object Undefined]',
weakMapTag = '[object WeakMap]',
weakSetTag = '[object WeakSet]';
var arrayBufferTag = '[object ArrayBuffer]',
dataViewTag = '[object DataView]',
float32Tag = '[object Float32Array]',
float64Tag = '[object Float64Array]',
int8Tag = '[object Int8Array]',
int16Tag = '[object Int16Array]',
int32Tag = '[object Int32Array]',
uint8Tag = '[object Uint8Array]',
uint8ClampedTag = '[object Uint8ClampedArray]',
uint16Tag = '[object Uint16Array]',
uint32Tag = '[object Uint32Array]';
/** Used to match empty string literals in compiled template source. */
var reEmptyStringLeading = /\b__p \+= '';/g,
reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
/** Used to match HTML entities and HTML characters. */
var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
reUnescapedHtml = /[&<>"']/g,
reHasEscapedHtml = RegExp(reEscapedHtml.source),
reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
/** Used to match template delimiters. */
var reEscape = /<%-([\s\S]+?)%>/g,
reEvaluate = /<%([\s\S]+?)%>/g,
reInterpolate = /<%=([\s\S]+?)%>/g;
/** Used to match property names within property paths. */
var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
reIsPlainProp = /^\w*$/,
rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
/**
* Used to match `RegExp`
* [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
*/
var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
reHasRegExpChar = RegExp(reRegExpChar.source);
/** Used to match leading and trailing whitespace. */
var reTrim = /^\s+|\s+$/g,
reTrimStart = /^\s+/,
reTrimEnd = /\s+$/;
/** Used to match wrap detail comments. */
var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
reSplitDetails = /,? & /;
/** Used to match words composed of alphanumeric characters. */
var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
/** Used to match backslashes in property paths. */
var reEscapeChar = /\\(\\)?/g;
/**
* Used to match
* [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
*/
var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
/** Used to match `RegExp` flags from their coerced string values. */
var reFlags = /\w*$/;
/** Used to detect bad signed hexadecimal string values. */
var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
/** Used to detect binary string values. */
var reIsBinary = /^0b[01]+$/i;
/** Used to detect host constructors (Safari). */
var reIsHostCtor = /^\[object .+?Constructor\]$/;
/** Used to detect octal string values. */
var reIsOctal = /^0o[0-7]+$/i;
/** Used to detect unsigned integer values. */
var reIsUint = /^(?:0|[1-9]\d*)$/;
/** Used to match Latin Unicode letters (excluding mathematical operators). */
var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
/** Used to ensure capturing order of template delimiters. */
var reNoMatch = /($^)/;
/** Used to match unescaped characters in compiled string literals. */
var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
/** Used to compose unicode character classes. */
var rsAstralRange = '\\ud800-\\udfff',
rsComboMarksRange = '\\u0300-\\u036f',
reComboHalfMarksRange = '\\ufe20-\\ufe2f',
rsComboSymbolsRange = '\\u20d0-\\u20ff',
rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
rsDingbatRange = '\\u2700-\\u27bf',
rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
rsPunctuationRange = '\\u2000-\\u206f',
rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
rsVarRange = '\\ufe0e\\ufe0f',
rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
/** Used to compose unicode capture groups. */
var rsApos = "['\u2019]",
rsAstral = '[' + rsAstralRange + ']',
rsBreak = '[' + rsBreakRange + ']',
rsCombo = '[' + rsComboRange + ']',
rsDigits = '\\d+',
rsDingbat = '[' + rsDingbatRange + ']',
rsLower = '[' + rsLowerRange + ']',
rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
rsFitz = '\\ud83c[\\udffb-\\udfff]',
rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
rsNonAstral = '[^' + rsAstralRange + ']',
rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
rsUpper = '[' + rsUpperRange + ']',
rsZWJ = '\\u200d';
/** Used to compose unicode regexes. */
var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
reOptMod = rsModifier + '?',
rsOptVar = '[' + rsVarRange + ']?',
rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])',
rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])',
rsSeq = rsOptVar + reOptMod + rsOptJoin,
rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
/** Used to match apostrophes. */
var reApos = RegExp(rsApos, 'g');
/**
* Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
* [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
*/
var reComboMark = RegExp(rsCombo, 'g');
/** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
/** Used to match complex or compound words. */
var reUnicodeWord = RegExp([
rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
rsUpper + '+' + rsOptContrUpper,
rsOrdUpper,
rsOrdLower,
rsDigits,
rsEmoji
].join('|'), 'g');
/** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
/** Used to detect strings that need a more robust regexp to match words. */
var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
/** Used to assign default `context` object properties. */
var contextProps = [
'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
'_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
];
/** Used to make template sourceURLs easier to identify. */
var templateCounter = -1;
/** Used to identify `toStringTag` values of typed arrays. */
var typedArrayTags = {};
typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
typedArrayTags[uint32Tag] = true;
typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
typedArrayTags[errorTag] = typedArrayTags[funcTag] =
typedArrayTags[mapTag] = typedArrayTags[numberTag] =
typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
typedArrayTags[setTag] = typedArrayTags[stringTag] =
typedArrayTags[weakMapTag] = false;
/** Used to identify `toStringTag` values supported by `_.clone`. */
var cloneableTags = {};
cloneableTags[argsTag] = cloneableTags[arrayTag] =
cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
cloneableTags[boolTag] = cloneableTags[dateTag] =
cloneableTags[float32Tag] = cloneableTags[float64Tag] =
cloneableTags[int8Tag] = cloneableTags[int16Tag] =
cloneableTags[int32Tag] = cloneableTags[mapTag] =
cloneableTags[numberTag] = cloneableTags[objectTag] =
cloneableTags[regexpTag] = cloneableTags[setTag] =
cloneableTags[stringTag] = cloneableTags[symbolTag] =
cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
cloneableTags[errorTag] = cloneableTags[funcTag] =
cloneableTags[weakMapTag] = false;
/** Used to map Latin Unicode letters to basic Latin letters. */
var deburredLetters = {
// Latin-1 Supplement block.
'\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
'\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
'\xc7': 'C', '\xe7': 'c',
'\xd0': 'D', '\xf0': 'd',
'\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
'\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
'\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
'\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
'\xd1': 'N', '\xf1': 'n',
'\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
'\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
'\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
'\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
'\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
'\xc6': 'Ae', '\xe6': 'ae',
'\xde': 'Th', '\xfe': 'th',
'\xdf': 'ss',
// Latin Extended-A block.
'\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
'\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
'\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
'\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
'\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
'\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
'\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
'\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
'\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
'\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
'\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
'\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
'\u0134': 'J', '\u0135': 'j',
'\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
'\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
'\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
'\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
'\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
'\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
'\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
'\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
'\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
'\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
'\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
'\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
'\u0163': 't', '\u0165': 't', '\u0167': 't',
'\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
'\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
'\u0174': 'W', '\u0175': 'w',
'\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
'\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
'\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
'\u0132': 'IJ', '\u0133': 'ij',
'\u0152': 'Oe', '\u0153': 'oe',
'\u0149': "'n", '\u017f': 's'
};
/** Used to map characters to HTML entities. */
var htmlEscapes = {
'&': '&',
'<': '<',
'>': '>',
'"': '"',
"'": '''
};
/** Used to map HTML entities to characters. */
var htmlUnescapes = {
'&': '&',
'<': '<',
'>': '>',
'"': '"',
''': "'"
};
/** Used to escape characters for inclusion in compiled string literals. */
var stringEscapes = {
'\\': '\\',
"'": "'",
'\n': 'n',
'\r': 'r',
'\u2028': 'u2028',
'\u2029': 'u2029'
};
/** Built-in method references without a dependency on `root`. */
var freeParseFloat = parseFloat,
freeParseInt = parseInt;
/** Detect free variable `global` from Node.js. */
var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
/** Detect free variable `self`. */
var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */
var root = freeGlobal || freeSelf || Function('return this')();
/** Detect free variable `exports`. */
var freeExports = true && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */
var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */
var moduleExports = freeModule && freeModule.exports === freeExports;
/** Detect free variable `process` from Node.js. */
var freeProcess = moduleExports && freeGlobal.process;
/** Used to access faster Node.js helpers. */
var nodeUtil = (function() {
try {
// Use `util.types` for Node.js 10+.
var types = freeModule && freeModule.require && freeModule.require('util').types;
if (types) {
return types;
}
// Legacy `process.binding('util')` for Node.js < 10.
return freeProcess && freeProcess.binding && freeProcess.binding('util');
} catch (e) {}
}());
/* Node.js helper references. */
var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
nodeIsDate = nodeUtil && nodeUtil.isDate,
nodeIsMap = nodeUtil && nodeUtil.isMap,
nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
nodeIsSet = nodeUtil && nodeUtil.isSet,
nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
/*--------------------------------------------------------------------------*/
/**
* A faster alternative to `Function#apply`, this function invokes `func`
* with the `this` binding of `thisArg` and the arguments of `args`.
*
* @private
* @param {Function} func The function to invoke.
* @param {*} thisArg The `this` binding of `func`.
* @param {Array} args The arguments to invoke `func` with.
* @returns {*} Returns the result of `func`.
*/
function apply(func, thisArg, args) {
switch (args.length) {
case 0: return func.call(thisArg);
case 1: return func.call(thisArg, args[0]);
case 2: return func.call(thisArg, args[0], args[1]);
case 3: return func.call(thisArg, args[0], args[1], args[2]);
}
return func.apply(thisArg, args);
}
/**
* A specialized version of `baseAggregator` for arrays.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform keys.
* @param {Object} accumulator The initial aggregated object.
* @returns {Function} Returns `accumulator`.
*/
function arrayAggregator(array, setter, iteratee, accumulator) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
var value = array[index];
setter(accumulator, value, iteratee(value), array);
}
return accumulator;
}
/**
* A specialized version of `_.forEach` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns `array`.
*/
function arrayEach(array, iteratee) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (iteratee(array[index], index, array) === false) {
break;
}
}
return array;
}
/**
* A specialized version of `_.forEachRight` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns `array`.
*/
function arrayEachRight(array, iteratee) {
var length = array == null ? 0 : array.length;
while (length--) {
if (iteratee(array[length], length, array) === false) {
break;
}
}
return array;
}
/**
* A specialized version of `_.every` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`.
*/
function arrayEvery(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (!predicate(array[index], index, array)) {
return false;
}
}
return true;
}
/**
* A specialized version of `_.filter` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
*/
function arrayFilter(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (predicate(value, index, array)) {
result[resIndex++] = value;
}
}
return result;
}
/**
* A specialized version of `_.includes` for arrays without support for
* specifying an index to search from.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludes(array, value) {
var length = array == null ? 0 : array.length;
return !!length && baseIndexOf(array, value, 0) > -1;
}
/**
* This function is like `arrayIncludes` except that it accepts a comparator.
*
* @private
* @param {Array} [array] The array to inspect.
* @param {*} target The value to search for.
* @param {Function} comparator The comparator invoked per element.
* @returns {boolean} Returns `true` if `target` is found, else `false`.
*/
function arrayIncludesWith(array, value, comparator) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (comparator(value, array[index])) {
return true;
}
}
return false;
}
/**
* A specialized version of `_.map` for arrays without support for iteratee
* shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
*/
function arrayMap(array, iteratee) {
var index = -1,
length = array == null ? 0 : array.length,
result = Array(length);
while (++index < length) {
result[index] = iteratee(array[index], index, array);
}
return result;
}
/**
* Appends the elements of `values` to `array`.
*
* @private
* @param {Array} array The array to modify.
* @param {Array} values The values to append.
* @returns {Array} Returns `array`.
*/
function arrayPush(array, values) {
var index = -1,
length = values.length,
offset = array.length;
while (++index < length) {
array[offset + index] = values[index];
}
return array;
}
/**
* A specialized version of `_.reduce` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @param {boolean} [initAccum] Specify using the first element of `array` as
* the initial value.
* @returns {*} Returns the accumulated value.
*/
function arrayReduce(array, iteratee, accumulator, initAccum) {
var index = -1,
length = array == null ? 0 : array.length;
if (initAccum && length) {
accumulator = array[++index];
}
while (++index < length) {
accumulator = iteratee(accumulator, array[index], index, array);
}
return accumulator;
}
/**
* A specialized version of `_.reduceRight` for arrays without support for
* iteratee shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @param {boolean} [initAccum] Specify using the last element of `array` as
* the initial value.
* @returns {*} Returns the accumulated value.
*/
function arrayReduceRight(array, iteratee, accumulator, initAccum) {
var length = array == null ? 0 : array.length;
if (initAccum && length) {
accumulator = array[--length];
}
while (length--) {
accumulator = iteratee(accumulator, array[length], length, array);
}
return accumulator;
}
/**
* A specialized version of `_.some` for arrays without support for iteratee
* shorthands.
*
* @private
* @param {Array} [array] The array to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
*/
function arraySome(array, predicate) {
var index = -1,
length = array == null ? 0 : array.length;
while (++index < length) {
if (predicate(array[index], index, array)) {
return true;
}
}
return false;
}
/**
* Gets the size of an ASCII `string`.
*
* @private
* @param {string} string The string inspect.
* @returns {number} Returns the string size.
*/
var asciiSize = baseProperty('length');
/**
* Converts an ASCII `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function asciiToArray(string) {
return string.split('');
}
/**
* Splits an ASCII `string` into an array of its words.
*
* @private
* @param {string} The string to inspect.
* @returns {Array} Returns the words of `string`.
*/
function asciiWords(string) {
return string.match(reAsciiWord) || [];
}
/**
* The base implementation of methods like `_.findKey` and `_.findLastKey`,
* without support for iteratee shorthands, which iterates over `collection`
* using `eachFunc`.
*
* @private
* @param {Array|Object} collection The collection to inspect.
* @param {Function} predicate The function invoked per iteration.
* @param {Function} eachFunc The function to iterate over `collection`.
* @returns {*} Returns the found element or its key, else `undefined`.
*/
function baseFindKey(collection, predicate, eachFunc) {
var result;
eachFunc(collection, function(value, key, collection) {
if (predicate(value, key, collection)) {
result = key;
return false;
}
});
return result;
}
/**
* The base implementation of `_.findIndex` and `_.findLastIndex` without
* support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} predicate The function invoked per iteration.
* @param {number} fromIndex The index to search from.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseFindIndex(array, predicate, fromIndex, fromRight) {
var length = array.length,
index = fromIndex + (fromRight ? 1 : -1);
while ((fromRight ? index-- : ++index < length)) {
if (predicate(array[index], index, array)) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.indexOf` without `fromIndex` bounds checks.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseIndexOf(array, value, fromIndex) {
return value === value
? strictIndexOf(array, value, fromIndex)
: baseFindIndex(array, baseIsNaN, fromIndex);
}
/**
* This function is like `baseIndexOf` except that it accepts a comparator.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @param {Function} comparator The comparator invoked per element.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function baseIndexOfWith(array, value, fromIndex, comparator) {
var index = fromIndex - 1,
length = array.length;
while (++index < length) {
if (comparator(array[index], value)) {
return index;
}
}
return -1;
}
/**
* The base implementation of `_.isNaN` without support for number objects.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
*/
function baseIsNaN(value) {
return value !== value;
}
/**
* The base implementation of `_.mean` and `_.meanBy` without support for
* iteratee shorthands.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {number} Returns the mean.
*/
function baseMean(array, iteratee) {
var length = array == null ? 0 : array.length;
return length ? (baseSum(array, iteratee) / length) : NAN;
}
/**
* The base implementation of `_.property` without support for deep paths.
*
* @private
* @param {string} key The key of the property to get.
* @returns {Function} Returns the new accessor function.
*/
function baseProperty(key) {
return function(object) {
return object == null ? undefined : object[key];
};
}
/**
* The base implementation of `_.propertyOf` without support for deep paths.
*
* @private
* @param {Object} object The object to query.
* @returns {Function} Returns the new accessor function.
*/
function basePropertyOf(object) {
return function(key) {
return object == null ? undefined : object[key];
};
}
/**
* The base implementation of `_.reduce` and `_.reduceRight`, without support
* for iteratee shorthands, which iterates over `collection` using `eachFunc`.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {*} accumulator The initial value.
* @param {boolean} initAccum Specify using the first or last element of
* `collection` as the initial value.
* @param {Function} eachFunc The function to iterate over `collection`.
* @returns {*} Returns the accumulated value.
*/
function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
eachFunc(collection, function(value, index, collection) {
accumulator = initAccum
? (initAccum = false, value)
: iteratee(accumulator, value, index, collection);
});
return accumulator;
}
/**
* The base implementation of `_.sortBy` which uses `comparer` to define the
* sort order of `array` and replaces criteria objects with their corresponding
* values.
*
* @private
* @param {Array} array The array to sort.
* @param {Function} comparer The function to define sort order.
* @returns {Array} Returns `array`.
*/
function baseSortBy(array, comparer) {
var length = array.length;
array.sort(comparer);
while (length--) {
array[length] = array[length].value;
}
return array;
}
/**
* The base implementation of `_.sum` and `_.sumBy` without support for
* iteratee shorthands.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {number} Returns the sum.
*/
function baseSum(array, iteratee) {
var result,
index = -1,
length = array.length;
while (++index < length) {
var current = iteratee(array[index]);
if (current !== undefined) {
result = result === undefined ? current : (result + current);
}
}
return result;
}
/**
* The base implementation of `_.times` without support for iteratee shorthands
* or max array length checks.
*
* @private
* @param {number} n The number of times to invoke `iteratee`.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the array of results.
*/
function baseTimes(n, iteratee) {
var index = -1,
result = Array(n);
while (++index < n) {
result[index] = iteratee(index);
}
return result;
}
/**
* The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
* of key-value pairs for `object` corresponding to the property names of `props`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} props The property names to get values for.
* @returns {Object} Returns the key-value pairs.
*/
function baseToPairs(object, props) {
return arrayMap(props, function(key) {
return [key, object[key]];
});
}
/**
* The base implementation of `_.unary` without support for storing metadata.
*
* @private
* @param {Function} func The function to cap arguments for.
* @returns {Function} Returns the new capped function.
*/
function baseUnary(func) {
return function(value) {
return func(value);
};
}
/**
* The base implementation of `_.values` and `_.valuesIn` which creates an
* array of `object` property values corresponding to the property names
* of `props`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} props The property names to get values for.
* @returns {Object} Returns the array of property values.
*/
function baseValues(object, props) {
return arrayMap(props, function(key) {
return object[key];
});
}
/**
* Checks if a `cache` value for `key` exists.
*
* @private
* @param {Object} cache The cache to query.
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function cacheHas(cache, key) {
return cache.has(key);
}
/**
* Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
* that is not found in the character symbols.
*
* @private
* @param {Array} strSymbols The string symbols to inspect.
* @param {Array} chrSymbols The character symbols to find.
* @returns {number} Returns the index of the first unmatched string symbol.
*/
function charsStartIndex(strSymbols, chrSymbols) {
var index = -1,
length = strSymbols.length;
while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
return index;
}
/**
* Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
* that is not found in the character symbols.
*
* @private
* @param {Array} strSymbols The string symbols to inspect.
* @param {Array} chrSymbols The character symbols to find.
* @returns {number} Returns the index of the last unmatched string symbol.
*/
function charsEndIndex(strSymbols, chrSymbols) {
var index = strSymbols.length;
while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
return index;
}
/**
* Gets the number of `placeholder` occurrences in `array`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} placeholder The placeholder to search for.
* @returns {number} Returns the placeholder count.
*/
function countHolders(array, placeholder) {
var length = array.length,
result = 0;
while (length--) {
if (array[length] === placeholder) {
++result;
}
}
return result;
}
/**
* Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
* letters to basic Latin letters.
*
* @private
* @param {string} letter The matched letter to deburr.
* @returns {string} Returns the deburred letter.
*/
var deburrLetter = basePropertyOf(deburredLetters);
/**
* Used by `_.escape` to convert characters to HTML entities.
*
* @private
* @param {string} chr The matched character to escape.
* @returns {string} Returns the escaped character.
*/
var escapeHtmlChar = basePropertyOf(htmlEscapes);
/**
* Used by `_.template` to escape characters for inclusion in compiled string literals.
*
* @private
* @param {string} chr The matched character to escape.
* @returns {string} Returns the escaped character.
*/
function escapeStringChar(chr) {
return '\\' + stringEscapes[chr];
}
/**
* Gets the value at `key` of `object`.
*
* @private
* @param {Object} [object] The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function getValue(object, key) {
return object == null ? undefined : object[key];
}
/**
* Checks if `string` contains Unicode symbols.
*
* @private
* @param {string} string The string to inspect.
* @returns {boolean} Returns `true` if a symbol is found, else `false`.
*/
function hasUnicode(string) {
return reHasUnicode.test(string);
}
/**
* Checks if `string` contains a word composed of Unicode symbols.
*
* @private
* @param {string} string The string to inspect.
* @returns {boolean} Returns `true` if a word is found, else `false`.
*/
function hasUnicodeWord(string) {
return reHasUnicodeWord.test(string);
}
/**
* Converts `iterator` to an array.
*
* @private
* @param {Object} iterator The iterator to convert.
* @returns {Array} Returns the converted array.
*/
function iteratorToArray(iterator) {
var data,
result = [];
while (!(data = iterator.next()).done) {
result.push(data.value);
}
return result;
}
/**
* Converts `map` to its key-value pairs.
*
* @private
* @param {Object} map The map to convert.
* @returns {Array} Returns the key-value pairs.
*/
function mapToArray(map) {
var index = -1,
result = Array(map.size);
map.forEach(function(value, key) {
result[++index] = [key, value];
});
return result;
}
/**
* Creates a unary function that invokes `func` with its argument transformed.
*
* @private
* @param {Function} func The function to wrap.
* @param {Function} transform The argument transform.
* @returns {Function} Returns the new function.
*/
function overArg(func, transform) {
return function(arg) {
return func(transform(arg));
};
}
/**
* Replaces all `placeholder` elements in `array` with an internal placeholder
* and returns an array of their indexes.
*
* @private
* @param {Array} array The array to modify.
* @param {*} placeholder The placeholder to replace.
* @returns {Array} Returns the new array of placeholder indexes.
*/
function replaceHolders(array, placeholder) {
var index = -1,
length = array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (value === placeholder || value === PLACEHOLDER) {
array[index] = PLACEHOLDER;
result[resIndex++] = index;
}
}
return result;
}
/**
* Converts `set` to an array of its values.
*
* @private
* @param {Object} set The set to convert.
* @returns {Array} Returns the values.
*/
function setToArray(set) {
var index = -1,
result = Array(set.size);
set.forEach(function(value) {
result[++index] = value;
});
return result;
}
/**
* Converts `set` to its value-value pairs.
*
* @private
* @param {Object} set The set to convert.
* @returns {Array} Returns the value-value pairs.
*/
function setToPairs(set) {
var index = -1,
result = Array(set.size);
set.forEach(function(value) {
result[++index] = [value, value];
});
return result;
}
/**
* A specialized version of `_.indexOf` which performs strict equality
* comparisons of values, i.e. `===`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function strictIndexOf(array, value, fromIndex) {
var index = fromIndex - 1,
length = array.length;
while (++index < length) {
if (array[index] === value) {
return index;
}
}
return -1;
}
/**
* A specialized version of `_.lastIndexOf` which performs strict equality
* comparisons of values, i.e. `===`.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} fromIndex The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function strictLastIndexOf(array, value, fromIndex) {
var index = fromIndex + 1;
while (index--) {
if (array[index] === value) {
return index;
}
}
return index;
}
/**
* Gets the number of symbols in `string`.
*
* @private
* @param {string} string The string to inspect.
* @returns {number} Returns the string size.
*/
function stringSize(string) {
return hasUnicode(string)
? unicodeSize(string)
: asciiSize(string);
}
/**
* Converts `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function stringToArray(string) {
return hasUnicode(string)
? unicodeToArray(string)
: asciiToArray(string);
}
/**
* Used by `_.unescape` to convert HTML entities to characters.
*
* @private
* @param {string} chr The matched character to unescape.
* @returns {string} Returns the unescaped character.
*/
var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
/**
* Gets the size of a Unicode `string`.
*
* @private
* @param {string} string The string inspect.
* @returns {number} Returns the string size.
*/
function unicodeSize(string) {
var result = reUnicode.lastIndex = 0;
while (reUnicode.test(string)) {
++result;
}
return result;
}
/**
* Converts a Unicode `string` to an array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the converted array.
*/
function unicodeToArray(string) {
return string.match(reUnicode) || [];
}
/**
* Splits a Unicode `string` into an array of its words.
*
* @private
* @param {string} The string to inspect.
* @returns {Array} Returns the words of `string`.
*/
function unicodeWords(string) {
return string.match(reUnicodeWord) || [];
}
/*--------------------------------------------------------------------------*/
/**
* Create a new pristine `lodash` function using the `context` object.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Util
* @param {Object} [context=root] The context object.
* @returns {Function} Returns a new `lodash` function.
* @example
*
* _.mixin({ 'foo': _.constant('foo') });
*
* var lodash = _.runInContext();
* lodash.mixin({ 'bar': lodash.constant('bar') });
*
* _.isFunction(_.foo);
* // => true
* _.isFunction(_.bar);
* // => false
*
* lodash.isFunction(lodash.foo);
* // => false
* lodash.isFunction(lodash.bar);
* // => true
*
* // Create a suped-up `defer` in Node.js.
* var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
*/
var runInContext = (function runInContext(context) {
context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
/** Built-in constructor references. */
var Array = context.Array,
Date = context.Date,
Error = context.Error,
Function = context.Function,
Math = context.Math,
Object = context.Object,
RegExp = context.RegExp,
String = context.String,
TypeError = context.TypeError;
/** Used for built-in method references. */
var arrayProto = Array.prototype,
funcProto = Function.prototype,
objectProto = Object.prototype;
/** Used to detect overreaching core-js shims. */
var coreJsData = context['__core-js_shared__'];
/** Used to resolve the decompiled source of functions. */
var funcToString = funcProto.toString;
/** Used to check objects for own properties. */
var hasOwnProperty = objectProto.hasOwnProperty;
/** Used to generate unique IDs. */
var idCounter = 0;
/** Used to detect methods masquerading as native. */
var maskSrcKey = (function() {
var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
return uid ? ('Symbol(src)_1.' + uid) : '';
}());
/**
* Used to resolve the
* [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
* of values.
*/
var nativeObjectToString = objectProto.toString;
/** Used to infer the `Object` constructor. */
var objectCtorString = funcToString.call(Object);
/** Used to restore the original `_` reference in `_.noConflict`. */
var oldDash = root._;
/** Used to detect if a method is native. */
var reIsNative = RegExp('^' +
funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
.replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
);
/** Built-in value references. */
var Buffer = moduleExports ? context.Buffer : undefined,
Symbol = context.Symbol,
Uint8Array = context.Uint8Array,
allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
getPrototype = overArg(Object.getPrototypeOf, Object),
objectCreate = Object.create,
propertyIsEnumerable = objectProto.propertyIsEnumerable,
splice = arrayProto.splice,
spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
symIterator = Symbol ? Symbol.iterator : undefined,
symToStringTag = Symbol ? Symbol.toStringTag : undefined;
var defineProperty = (function() {
try {
var func = getNative(Object, 'defineProperty');
func({}, '', {});
return func;
} catch (e) {}
}());
/** Mocked built-ins. */
var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
ctxNow = Date && Date.now !== root.Date.now && Date.now,
ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
/* Built-in method references for those with the same name as other `lodash` methods. */
var nativeCeil = Math.ceil,
nativeFloor = Math.floor,
nativeGetSymbols = Object.getOwnPropertySymbols,
nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
nativeIsFinite = context.isFinite,
nativeJoin = arrayProto.join,
nativeKeys = overArg(Object.keys, Object),
nativeMax = Math.max,
nativeMin = Math.min,
nativeNow = Date.now,
nativeParseInt = context.parseInt,
nativeRandom = Math.random,
nativeReverse = arrayProto.reverse;
/* Built-in method references that are verified to be native. */
var DataView = getNative(context, 'DataView'),
Map = getNative(context, 'Map'),
Promise = getNative(context, 'Promise'),
Set = getNative(context, 'Set'),
WeakMap = getNative(context, 'WeakMap'),
nativeCreate = getNative(Object, 'create');
/** Used to store function metadata. */
var metaMap = WeakMap && new WeakMap;
/** Used to lookup unminified function names. */
var realNames = {};
/** Used to detect maps, sets, and weakmaps. */
var dataViewCtorString = toSource(DataView),
mapCtorString = toSource(Map),
promiseCtorString = toSource(Promise),
setCtorString = toSource(Set),
weakMapCtorString = toSource(WeakMap);
/** Used to convert symbols to primitives and strings. */
var symbolProto = Symbol ? Symbol.prototype : undefined,
symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
symbolToString = symbolProto ? symbolProto.toString : undefined;
/*------------------------------------------------------------------------*/
/**
* Creates a `lodash` object which wraps `value` to enable implicit method
* chain sequences. Methods that operate on and return arrays, collections,
* and functions can be chained together. Methods that retrieve a single value
* or may return a primitive value will automatically end the chain sequence
* and return the unwrapped value. Otherwise, the value must be unwrapped
* with `_#value`.
*
* Explicit chain sequences, which must be unwrapped with `_#value`, may be
* enabled using `_.chain`.
*
* The execution of chained methods is lazy, that is, it's deferred until
* `_#value` is implicitly or explicitly called.
*
* Lazy evaluation allows several methods to support shortcut fusion.
* Shortcut fusion is an optimization to merge iteratee calls; this avoids
* the creation of intermediate arrays and can greatly reduce the number of
* iteratee executions. Sections of a chain sequence qualify for shortcut
* fusion if the section is applied to an array and iteratees accept only
* one argument. The heuristic for whether a section qualifies for shortcut
* fusion is subject to change.
*
* Chaining is supported in custom builds as long as the `_#value` method is
* directly or indirectly included in the build.
*
* In addition to lodash methods, wrappers have `Array` and `String` methods.
*
* The wrapper `Array` methods are:
* `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
*
* The wrapper `String` methods are:
* `replace` and `split`
*
* The wrapper methods that support shortcut fusion are:
* `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
* `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
* `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
*
* The chainable wrapper methods are:
* `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
* `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
* `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
* `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
* `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
* `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
* `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
* `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
* `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
* `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
* `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
* `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
* `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
* `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
* `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
* `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
* `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
* `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
* `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
* `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
* `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
* `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
* `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
* `zipObject`, `zipObjectDeep`, and `zipWith`
*
* The wrapper methods that are **not** chainable by default are:
* `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
* `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
* `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
* `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
* `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
* `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
* `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
* `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
* `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
* `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
* `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
* `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
* `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
* `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
* `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
* `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
* `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
* `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
* `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
* `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
* `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
* `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
* `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
* `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
* `upperFirst`, `value`, and `words`
*
* @name _
* @constructor
* @category Seq
* @param {*} value The value to wrap in a `lodash` instance.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* function square(n) {
* return n * n;
* }
*
* var wrapped = _([1, 2, 3]);
*
* // Returns an unwrapped value.
* wrapped.reduce(_.add);
* // => 6
*
* // Returns a wrapped value.
* var squares = wrapped.map(square);
*
* _.isArray(squares);
* // => false
*
* _.isArray(squares.value());
* // => true
*/
function lodash(value) {
if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
if (value instanceof LodashWrapper) {
return value;
}
if (hasOwnProperty.call(value, '__wrapped__')) {
return wrapperClone(value);
}
}
return new LodashWrapper(value);
}
/**
* The base implementation of `_.create` without support for assigning
* properties to the created object.
*
* @private
* @param {Object} proto The object to inherit from.
* @returns {Object} Returns the new object.
*/
var baseCreate = (function() {
function object() {}
return function(proto) {
if (!isObject(proto)) {
return {};
}
if (objectCreate) {
return objectCreate(proto);
}
object.prototype = proto;
var result = new object;
object.prototype = undefined;
return result;
};
}());
/**
* The function whose prototype chain sequence wrappers inherit from.
*
* @private
*/
function baseLodash() {
// No operation performed.
}
/**
* The base constructor for creating `lodash` wrapper objects.
*
* @private
* @param {*} value The value to wrap.
* @param {boolean} [chainAll] Enable explicit method chain sequences.
*/
function LodashWrapper(value, chainAll) {
this.__wrapped__ = value;
this.__actions__ = [];
this.__chain__ = !!chainAll;
this.__index__ = 0;
this.__values__ = undefined;
}
/**
* By default, the template delimiters used by lodash are like those in
* embedded Ruby (ERB) as well as ES2015 template strings. Change the
* following template settings to use alternative delimiters.
*
* @static
* @memberOf _
* @type {Object}
*/
lodash.templateSettings = {
/**
* Used to detect `data` property values to be HTML-escaped.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'escape': reEscape,
/**
* Used to detect code to be evaluated.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'evaluate': reEvaluate,
/**
* Used to detect `data` property values to inject.
*
* @memberOf _.templateSettings
* @type {RegExp}
*/
'interpolate': reInterpolate,
/**
* Used to reference the data object in the template text.
*
* @memberOf _.templateSettings
* @type {string}
*/
'variable': '',
/**
* Used to import variables into the compiled template.
*
* @memberOf _.templateSettings
* @type {Object}
*/
'imports': {
/**
* A reference to the `lodash` function.
*
* @memberOf _.templateSettings.imports
* @type {Function}
*/
'_': lodash
}
};
// Ensure wrappers are instances of `baseLodash`.
lodash.prototype = baseLodash.prototype;
lodash.prototype.constructor = lodash;
LodashWrapper.prototype = baseCreate(baseLodash.prototype);
LodashWrapper.prototype.constructor = LodashWrapper;
/*------------------------------------------------------------------------*/
/**
* Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
*
* @private
* @constructor
* @param {*} value The value to wrap.
*/
function LazyWrapper(value) {
this.__wrapped__ = value;
this.__actions__ = [];
this.__dir__ = 1;
this.__filtered__ = false;
this.__iteratees__ = [];
this.__takeCount__ = MAX_ARRAY_LENGTH;
this.__views__ = [];
}
/**
* Creates a clone of the lazy wrapper object.
*
* @private
* @name clone
* @memberOf LazyWrapper
* @returns {Object} Returns the cloned `LazyWrapper` object.
*/
function lazyClone() {
var result = new LazyWrapper(this.__wrapped__);
result.__actions__ = copyArray(this.__actions__);
result.__dir__ = this.__dir__;
result.__filtered__ = this.__filtered__;
result.__iteratees__ = copyArray(this.__iteratees__);
result.__takeCount__ = this.__takeCount__;
result.__views__ = copyArray(this.__views__);
return result;
}
/**
* Reverses the direction of lazy iteration.
*
* @private
* @name reverse
* @memberOf LazyWrapper
* @returns {Object} Returns the new reversed `LazyWrapper` object.
*/
function lazyReverse() {
if (this.__filtered__) {
var result = new LazyWrapper(this);
result.__dir__ = -1;
result.__filtered__ = true;
} else {
result = this.clone();
result.__dir__ *= -1;
}
return result;
}
/**
* Extracts the unwrapped value from its lazy wrapper.
*
* @private
* @name value
* @memberOf LazyWrapper
* @returns {*} Returns the unwrapped value.
*/
function lazyValue() {
var array = this.__wrapped__.value(),
dir = this.__dir__,
isArr = isArray(array),
isRight = dir < 0,
arrLength = isArr ? array.length : 0,
view = getView(0, arrLength, this.__views__),
start = view.start,
end = view.end,
length = end - start,
index = isRight ? end : (start - 1),
iteratees = this.__iteratees__,
iterLength = iteratees.length,
resIndex = 0,
takeCount = nativeMin(length, this.__takeCount__);
if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
return baseWrapperValue(array, this.__actions__);
}
var result = [];
outer:
while (length-- && resIndex < takeCount) {
index += dir;
var iterIndex = -1,
value = array[index];
while (++iterIndex < iterLength) {
var data = iteratees[iterIndex],
iteratee = data.iteratee,
type = data.type,
computed = iteratee(value);
if (type == LAZY_MAP_FLAG) {
value = computed;
} else if (!computed) {
if (type == LAZY_FILTER_FLAG) {
continue outer;
} else {
break outer;
}
}
}
result[resIndex++] = value;
}
return result;
}
// Ensure `LazyWrapper` is an instance of `baseLodash`.
LazyWrapper.prototype = baseCreate(baseLodash.prototype);
LazyWrapper.prototype.constructor = LazyWrapper;
/*------------------------------------------------------------------------*/
/**
* Creates a hash object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Hash(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the hash.
*
* @private
* @name clear
* @memberOf Hash
*/
function hashClear() {
this.__data__ = nativeCreate ? nativeCreate(null) : {};
this.size = 0;
}
/**
* Removes `key` and its value from the hash.
*
* @private
* @name delete
* @memberOf Hash
* @param {Object} hash The hash to modify.
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function hashDelete(key) {
var result = this.has(key) && delete this.__data__[key];
this.size -= result ? 1 : 0;
return result;
}
/**
* Gets the hash value for `key`.
*
* @private
* @name get
* @memberOf Hash
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function hashGet(key) {
var data = this.__data__;
if (nativeCreate) {
var result = data[key];
return result === HASH_UNDEFINED ? undefined : result;
}
return hasOwnProperty.call(data, key) ? data[key] : undefined;
}
/**
* Checks if a hash value for `key` exists.
*
* @private
* @name has
* @memberOf Hash
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function hashHas(key) {
var data = this.__data__;
return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
}
/**
* Sets the hash `key` to `value`.
*
* @private
* @name set
* @memberOf Hash
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the hash instance.
*/
function hashSet(key, value) {
var data = this.__data__;
this.size += this.has(key) ? 0 : 1;
data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
return this;
}
// Add methods to `Hash`.
Hash.prototype.clear = hashClear;
Hash.prototype['delete'] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
/*------------------------------------------------------------------------*/
/**
* Creates an list cache object.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function ListCache(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the list cache.
*
* @private
* @name clear
* @memberOf ListCache
*/
function listCacheClear() {
this.__data__ = [];
this.size = 0;
}
/**
* Removes `key` and its value from the list cache.
*
* @private
* @name delete
* @memberOf ListCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function listCacheDelete(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
return false;
}
var lastIndex = data.length - 1;
if (index == lastIndex) {
data.pop();
} else {
splice.call(data, index, 1);
}
--this.size;
return true;
}
/**
* Gets the list cache value for `key`.
*
* @private
* @name get
* @memberOf ListCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function listCacheGet(key) {
var data = this.__data__,
index = assocIndexOf(data, key);
return index < 0 ? undefined : data[index][1];
}
/**
* Checks if a list cache value for `key` exists.
*
* @private
* @name has
* @memberOf ListCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function listCacheHas(key) {
return assocIndexOf(this.__data__, key) > -1;
}
/**
* Sets the list cache `key` to `value`.
*
* @private
* @name set
* @memberOf ListCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the list cache instance.
*/
function listCacheSet(key, value) {
var data = this.__data__,
index = assocIndexOf(data, key);
if (index < 0) {
++this.size;
data.push([key, value]);
} else {
data[index][1] = value;
}
return this;
}
// Add methods to `ListCache`.
ListCache.prototype.clear = listCacheClear;
ListCache.prototype['delete'] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
/*------------------------------------------------------------------------*/
/**
* Creates a map cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function MapCache(entries) {
var index = -1,
length = entries == null ? 0 : entries.length;
this.clear();
while (++index < length) {
var entry = entries[index];
this.set(entry[0], entry[1]);
}
}
/**
* Removes all key-value entries from the map.
*
* @private
* @name clear
* @memberOf MapCache
*/
function mapCacheClear() {
this.size = 0;
this.__data__ = {
'hash': new Hash,
'map': new (Map || ListCache),
'string': new Hash
};
}
/**
* Removes `key` and its value from the map.
*
* @private
* @name delete
* @memberOf MapCache
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function mapCacheDelete(key) {
var result = getMapData(this, key)['delete'](key);
this.size -= result ? 1 : 0;
return result;
}
/**
* Gets the map value for `key`.
*
* @private
* @name get
* @memberOf MapCache
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function mapCacheGet(key) {
return getMapData(this, key).get(key);
}
/**
* Checks if a map value for `key` exists.
*
* @private
* @name has
* @memberOf MapCache
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function mapCacheHas(key) {
return getMapData(this, key).has(key);
}
/**
* Sets the map `key` to `value`.
*
* @private
* @name set
* @memberOf MapCache
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the map cache instance.
*/
function mapCacheSet(key, value) {
var data = getMapData(this, key),
size = data.size;
data.set(key, value);
this.size += data.size == size ? 0 : 1;
return this;
}
// Add methods to `MapCache`.
MapCache.prototype.clear = mapCacheClear;
MapCache.prototype['delete'] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
/*------------------------------------------------------------------------*/
/**
*
* Creates an array cache object to store unique values.
*
* @private
* @constructor
* @param {Array} [values] The values to cache.
*/
function SetCache(values) {
var index = -1,
length = values == null ? 0 : values.length;
this.__data__ = new MapCache;
while (++index < length) {
this.add(values[index]);
}
}
/**
* Adds `value` to the array cache.
*
* @private
* @name add
* @memberOf SetCache
* @alias push
* @param {*} value The value to cache.
* @returns {Object} Returns the cache instance.
*/
function setCacheAdd(value) {
this.__data__.set(value, HASH_UNDEFINED);
return this;
}
/**
* Checks if `value` is in the array cache.
*
* @private
* @name has
* @memberOf SetCache
* @param {*} value The value to search for.
* @returns {number} Returns `true` if `value` is found, else `false`.
*/
function setCacheHas(value) {
return this.__data__.has(value);
}
// Add methods to `SetCache`.
SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
/*------------------------------------------------------------------------*/
/**
* Creates a stack cache object to store key-value pairs.
*
* @private
* @constructor
* @param {Array} [entries] The key-value pairs to cache.
*/
function Stack(entries) {
var data = this.__data__ = new ListCache(entries);
this.size = data.size;
}
/**
* Removes all key-value entries from the stack.
*
* @private
* @name clear
* @memberOf Stack
*/
function stackClear() {
this.__data__ = new ListCache;
this.size = 0;
}
/**
* Removes `key` and its value from the stack.
*
* @private
* @name delete
* @memberOf Stack
* @param {string} key The key of the value to remove.
* @returns {boolean} Returns `true` if the entry was removed, else `false`.
*/
function stackDelete(key) {
var data = this.__data__,
result = data['delete'](key);
this.size = data.size;
return result;
}
/**
* Gets the stack value for `key`.
*
* @private
* @name get
* @memberOf Stack
* @param {string} key The key of the value to get.
* @returns {*} Returns the entry value.
*/
function stackGet(key) {
return this.__data__.get(key);
}
/**
* Checks if a stack value for `key` exists.
*
* @private
* @name has
* @memberOf Stack
* @param {string} key The key of the entry to check.
* @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
*/
function stackHas(key) {
return this.__data__.has(key);
}
/**
* Sets the stack `key` to `value`.
*
* @private
* @name set
* @memberOf Stack
* @param {string} key The key of the value to set.
* @param {*} value The value to set.
* @returns {Object} Returns the stack cache instance.
*/
function stackSet(key, value) {
var data = this.__data__;
if (data instanceof ListCache) {
var pairs = data.__data__;
if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
pairs.push([key, value]);
this.size = ++data.size;
return this;
}
data = this.__data__ = new MapCache(pairs);
}
data.set(key, value);
this.size = data.size;
return this;
}
// Add methods to `Stack`.
Stack.prototype.clear = stackClear;
Stack.prototype['delete'] = stackDelete;
Stack.prototype.get = stackGet;
Stack.prototype.has = stackHas;
Stack.prototype.set = stackSet;
/*------------------------------------------------------------------------*/
/**
* Creates an array of the enumerable property names of the array-like `value`.
*
* @private
* @param {*} value The value to query.
* @param {boolean} inherited Specify returning inherited property names.
* @returns {Array} Returns the array of property names.
*/
function arrayLikeKeys(value, inherited) {
var isArr = isArray(value),
isArg = !isArr && isArguments(value),
isBuff = !isArr && !isArg && isBuffer(value),
isType = !isArr && !isArg && !isBuff && isTypedArray(value),
skipIndexes = isArr || isArg || isBuff || isType,
result = skipIndexes ? baseTimes(value.length, String) : [],
length = result.length;
for (var key in value) {
if ((inherited || hasOwnProperty.call(value, key)) &&
!(skipIndexes && (
// Safari 9 has enumerable `arguments.length` in strict mode.
key == 'length' ||
// Node.js 0.10 has enumerable non-index properties on buffers.
(isBuff && (key == 'offset' || key == 'parent')) ||
// PhantomJS 2 has enumerable non-index properties on typed arrays.
(isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
// Skip index properties.
isIndex(key, length)
))) {
result.push(key);
}
}
return result;
}
/**
* A specialized version of `_.sample` for arrays.
*
* @private
* @param {Array} array The array to sample.
* @returns {*} Returns the random element.
*/
function arraySample(array) {
var length = array.length;
return length ? array[baseRandom(0, length - 1)] : undefined;
}
/**
* A specialized version of `_.sampleSize` for arrays.
*
* @private
* @param {Array} array The array to sample.
* @param {number} n The number of elements to sample.
* @returns {Array} Returns the random elements.
*/
function arraySampleSize(array, n) {
return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
}
/**
* A specialized version of `_.shuffle` for arrays.
*
* @private
* @param {Array} array The array to shuffle.
* @returns {Array} Returns the new shuffled array.
*/
function arrayShuffle(array) {
return shuffleSelf(copyArray(array));
}
/**
* This function is like `assignValue` except that it doesn't assign
* `undefined` values.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function assignMergeValue(object, key, value) {
if ((value !== undefined && !eq(object[key], value)) ||
(value === undefined && !(key in object))) {
baseAssignValue(object, key, value);
}
}
/**
* Assigns `value` to `key` of `object` if the existing value is not equivalent
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function assignValue(object, key, value) {
var objValue = object[key];
if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
(value === undefined && !(key in object))) {
baseAssignValue(object, key, value);
}
}
/**
* Gets the index at which the `key` is found in `array` of key-value pairs.
*
* @private
* @param {Array} array The array to inspect.
* @param {*} key The key to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
*/
function assocIndexOf(array, key) {
var length = array.length;
while (length--) {
if (eq(array[length][0], key)) {
return length;
}
}
return -1;
}
/**
* Aggregates elements of `collection` on `accumulator` with keys transformed
* by `iteratee` and values set by `setter`.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform keys.
* @param {Object} accumulator The initial aggregated object.
* @returns {Function} Returns `accumulator`.
*/
function baseAggregator(collection, setter, iteratee, accumulator) {
baseEach(collection, function(value, key, collection) {
setter(accumulator, value, iteratee(value), collection);
});
return accumulator;
}
/**
* The base implementation of `_.assign` without support for multiple sources
* or `customizer` functions.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @returns {Object} Returns `object`.
*/
function baseAssign(object, source) {
return object && copyObject(source, keys(source), object);
}
/**
* The base implementation of `_.assignIn` without support for multiple sources
* or `customizer` functions.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @returns {Object} Returns `object`.
*/
function baseAssignIn(object, source) {
return object && copyObject(source, keysIn(source), object);
}
/**
* The base implementation of `assignValue` and `assignMergeValue` without
* value checks.
*
* @private
* @param {Object} object The object to modify.
* @param {string} key The key of the property to assign.
* @param {*} value The value to assign.
*/
function baseAssignValue(object, key, value) {
if (key == '__proto__' && defineProperty) {
defineProperty(object, key, {
'configurable': true,
'enumerable': true,
'value': value,
'writable': true
});
} else {
object[key] = value;
}
}
/**
* The base implementation of `_.at` without support for individual paths.
*
* @private
* @param {Object} object The object to iterate over.
* @param {string[]} paths The property paths to pick.
* @returns {Array} Returns the picked elements.
*/
function baseAt(object, paths) {
var index = -1,
length = paths.length,
result = Array(length),
skip = object == null;
while (++index < length) {
result[index] = skip ? undefined : get(object, paths[index]);
}
return result;
}
/**
* The base implementation of `_.clamp` which doesn't coerce arguments.
*
* @private
* @param {number} number The number to clamp.
* @param {number} [lower] The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the clamped number.
*/
function baseClamp(number, lower, upper) {
if (number === number) {
if (upper !== undefined) {
number = number <= upper ? number : upper;
}
if (lower !== undefined) {
number = number >= lower ? number : lower;
}
}
return number;
}
/**
* The base implementation of `_.clone` and `_.cloneDeep` which tracks
* traversed objects.
*
* @private
* @param {*} value The value to clone.
* @param {boolean} bitmask The bitmask flags.
* 1 - Deep clone
* 2 - Flatten inherited properties
* 4 - Clone symbols
* @param {Function} [customizer] The function to customize cloning.
* @param {string} [key] The key of `value`.
* @param {Object} [object] The parent object of `value`.
* @param {Object} [stack] Tracks traversed objects and their clone counterparts.
* @returns {*} Returns the cloned value.
*/
function baseClone(value, bitmask, customizer, key, object, stack) {
var result,
isDeep = bitmask & CLONE_DEEP_FLAG,
isFlat = bitmask & CLONE_FLAT_FLAG,
isFull = bitmask & CLONE_SYMBOLS_FLAG;
if (customizer) {
result = object ? customizer(value, key, object, stack) : customizer(value);
}
if (result !== undefined) {
return result;
}
if (!isObject(value)) {
return value;
}
var isArr = isArray(value);
if (isArr) {
result = initCloneArray(value);
if (!isDeep) {
return copyArray(value, result);
}
} else {
var tag = getTag(value),
isFunc = tag == funcTag || tag == genTag;
if (isBuffer(value)) {
return cloneBuffer(value, isDeep);
}
if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
result = (isFlat || isFunc) ? {} : initCloneObject(value);
if (!isDeep) {
return isFlat
? copySymbolsIn(value, baseAssignIn(result, value))
: copySymbols(value, baseAssign(result, value));
}
} else {
if (!cloneableTags[tag]) {
return object ? value : {};
}
result = initCloneByTag(value, tag, isDeep);
}
}
// Check for circular references and return its corresponding clone.
stack || (stack = new Stack);
var stacked = stack.get(value);
if (stacked) {
return stacked;
}
stack.set(value, result);
if (isSet(value)) {
value.forEach(function(subValue) {
result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
});
} else if (isMap(value)) {
value.forEach(function(subValue, key) {
result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
});
}
var keysFunc = isFull
? (isFlat ? getAllKeysIn : getAllKeys)
: (isFlat ? keysIn : keys);
var props = isArr ? undefined : keysFunc(value);
arrayEach(props || value, function(subValue, key) {
if (props) {
key = subValue;
subValue = value[key];
}
// Recursively populate clone (susceptible to call stack limits).
assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
});
return result;
}
/**
* The base implementation of `_.conforms` which doesn't clone `source`.
*
* @private
* @param {Object} source The object of property predicates to conform to.
* @returns {Function} Returns the new spec function.
*/
function baseConforms(source) {
var props = keys(source);
return function(object) {
return baseConformsTo(object, source, props);
};
}
/**
* The base implementation of `_.conformsTo` which accepts `props` to check.
*
* @private
* @param {Object} object The object to inspect.
* @param {Object} source The object of property predicates to conform to.
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
*/
function baseConformsTo(object, source, props) {
var length = props.length;
if (object == null) {
return !length;
}
object = Object(object);
while (length--) {
var key = props[length],
predicate = source[key],
value = object[key];
if ((value === undefined && !(key in object)) || !predicate(value)) {
return false;
}
}
return true;
}
/**
* The base implementation of `_.delay` and `_.defer` which accepts `args`
* to provide to `func`.
*
* @private
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @param {Array} args The arguments to provide to `func`.
* @returns {number|Object} Returns the timer id or timeout object.
*/
function baseDelay(func, wait, args) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
return setTimeout(function() { func.apply(undefined, args); }, wait);
}
/**
* The base implementation of methods like `_.difference` without support
* for excluding multiple arrays or iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Array} values The values to exclude.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
*/
function baseDifference(array, values, iteratee, comparator) {
var index = -1,
includes = arrayIncludes,
isCommon = true,
length = array.length,
result = [],
valuesLength = values.length;
if (!length) {
return result;
}
if (iteratee) {
values = arrayMap(values, baseUnary(iteratee));
}
if (comparator) {
includes = arrayIncludesWith;
isCommon = false;
}
else if (values.length >= LARGE_ARRAY_SIZE) {
includes = cacheHas;
isCommon = false;
values = new SetCache(values);
}
outer:
while (++index < length) {
var value = array[index],
computed = iteratee == null ? value : iteratee(value);
value = (comparator || value !== 0) ? value : 0;
if (isCommon && computed === computed) {
var valuesIndex = valuesLength;
while (valuesIndex--) {
if (values[valuesIndex] === computed) {
continue outer;
}
}
result.push(value);
}
else if (!includes(values, computed, comparator)) {
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.forEach` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
*/
var baseEach = createBaseEach(baseForOwn);
/**
* The base implementation of `_.forEachRight` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
*/
var baseEachRight = createBaseEach(baseForOwnRight, true);
/**
* The base implementation of `_.every` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`
*/
function baseEvery(collection, predicate) {
var result = true;
baseEach(collection, function(value, index, collection) {
result = !!predicate(value, index, collection);
return result;
});
return result;
}
/**
* The base implementation of methods like `_.max` and `_.min` which accepts a
* `comparator` to determine the extremum value.
*
* @private
* @param {Array} array The array to iterate over.
* @param {Function} iteratee The iteratee invoked per iteration.
* @param {Function} comparator The comparator used to compare values.
* @returns {*} Returns the extremum value.
*/
function baseExtremum(array, iteratee, comparator) {
var index = -1,
length = array.length;
while (++index < length) {
var value = array[index],
current = iteratee(value);
if (current != null && (computed === undefined
? (current === current && !isSymbol(current))
: comparator(current, computed)
)) {
var computed = current,
result = value;
}
}
return result;
}
/**
* The base implementation of `_.fill` without an iteratee call guard.
*
* @private
* @param {Array} array The array to fill.
* @param {*} value The value to fill `array` with.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns `array`.
*/
function baseFill(array, value, start, end) {
var length = array.length;
start = toInteger(start);
if (start < 0) {
start = -start > length ? 0 : (length + start);
}
end = (end === undefined || end > length) ? length : toInteger(end);
if (end < 0) {
end += length;
}
end = start > end ? 0 : toLength(end);
while (start < end) {
array[start++] = value;
}
return array;
}
/**
* The base implementation of `_.filter` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
*/
function baseFilter(collection, predicate) {
var result = [];
baseEach(collection, function(value, index, collection) {
if (predicate(value, index, collection)) {
result.push(value);
}
});
return result;
}
/**
* The base implementation of `_.flatten` with support for restricting flattening.
*
* @private
* @param {Array} array The array to flatten.
* @param {number} depth The maximum recursion depth.
* @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
* @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
* @param {Array} [result=[]] The initial result value.
* @returns {Array} Returns the new flattened array.
*/
function baseFlatten(array, depth, predicate, isStrict, result) {
var index = -1,
length = array.length;
predicate || (predicate = isFlattenable);
result || (result = []);
while (++index < length) {
var value = array[index];
if (depth > 0 && predicate(value)) {
if (depth > 1) {
// Recursively flatten arrays (susceptible to call stack limits).
baseFlatten(value, depth - 1, predicate, isStrict, result);
} else {
arrayPush(result, value);
}
} else if (!isStrict) {
result[result.length] = value;
}
}
return result;
}
/**
* The base implementation of `baseForOwn` which iterates over `object`
* properties returned by `keysFunc` and invokes `iteratee` for each property.
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {Function} keysFunc The function to get the keys of `object`.
* @returns {Object} Returns `object`.
*/
var baseFor = createBaseFor();
/**
* This function is like `baseFor` except that it iterates over properties
* in the opposite order.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @param {Function} keysFunc The function to get the keys of `object`.
* @returns {Object} Returns `object`.
*/
var baseForRight = createBaseFor(true);
/**
* The base implementation of `_.forOwn` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Object} Returns `object`.
*/
function baseForOwn(object, iteratee) {
return object && baseFor(object, iteratee, keys);
}
/**
* The base implementation of `_.forOwnRight` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Object} Returns `object`.
*/
function baseForOwnRight(object, iteratee) {
return object && baseForRight(object, iteratee, keys);
}
/**
* The base implementation of `_.functions` which creates an array of
* `object` function property names filtered from `props`.
*
* @private
* @param {Object} object The object to inspect.
* @param {Array} props The property names to filter.
* @returns {Array} Returns the function names.
*/
function baseFunctions(object, props) {
return arrayFilter(props, function(key) {
return isFunction(object[key]);
});
}
/**
* The base implementation of `_.get` without support for default values.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @returns {*} Returns the resolved value.
*/
function baseGet(object, path) {
path = castPath(path, object);
var index = 0,
length = path.length;
while (object != null && index < length) {
object = object[toKey(path[index++])];
}
return (index && index == length) ? object : undefined;
}
/**
* The base implementation of `getAllKeys` and `getAllKeysIn` which uses
* `keysFunc` and `symbolsFunc` to get the enumerable property names and
* symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Function} keysFunc The function to get the keys of `object`.
* @param {Function} symbolsFunc The function to get the symbols of `object`.
* @returns {Array} Returns the array of property names and symbols.
*/
function baseGetAllKeys(object, keysFunc, symbolsFunc) {
var result = keysFunc(object);
return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
}
/**
* The base implementation of `getTag` without fallbacks for buggy environments.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the `toStringTag`.
*/
function baseGetTag(value) {
if (value == null) {
return value === undefined ? undefinedTag : nullTag;
}
return (symToStringTag && symToStringTag in Object(value))
? getRawTag(value)
: objectToString(value);
}
/**
* The base implementation of `_.gt` which doesn't coerce arguments.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than `other`,
* else `false`.
*/
function baseGt(value, other) {
return value > other;
}
/**
* The base implementation of `_.has` without support for deep paths.
*
* @private
* @param {Object} [object] The object to query.
* @param {Array|string} key The key to check.
* @returns {boolean} Returns `true` if `key` exists, else `false`.
*/
function baseHas(object, key) {
return object != null && hasOwnProperty.call(object, key);
}
/**
* The base implementation of `_.hasIn` without support for deep paths.
*
* @private
* @param {Object} [object] The object to query.
* @param {Array|string} key The key to check.
* @returns {boolean} Returns `true` if `key` exists, else `false`.
*/
function baseHasIn(object, key) {
return object != null && key in Object(object);
}
/**
* The base implementation of `_.inRange` which doesn't coerce arguments.
*
* @private
* @param {number} number The number to check.
* @param {number} start The start of the range.
* @param {number} end The end of the range.
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
*/
function baseInRange(number, start, end) {
return number >= nativeMin(start, end) && number < nativeMax(start, end);
}
/**
* The base implementation of methods like `_.intersection`, without support
* for iteratee shorthands, that accepts an array of arrays to inspect.
*
* @private
* @param {Array} arrays The arrays to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of shared values.
*/
function baseIntersection(arrays, iteratee, comparator) {
var includes = comparator ? arrayIncludesWith : arrayIncludes,
length = arrays[0].length,
othLength = arrays.length,
othIndex = othLength,
caches = Array(othLength),
maxLength = Infinity,
result = [];
while (othIndex--) {
var array = arrays[othIndex];
if (othIndex && iteratee) {
array = arrayMap(array, baseUnary(iteratee));
}
maxLength = nativeMin(array.length, maxLength);
caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
? new SetCache(othIndex && array)
: undefined;
}
array = arrays[0];
var index = -1,
seen = caches[0];
outer:
while (++index < length && result.length < maxLength) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
value = (comparator || value !== 0) ? value : 0;
if (!(seen
? cacheHas(seen, computed)
: includes(result, computed, comparator)
)) {
othIndex = othLength;
while (--othIndex) {
var cache = caches[othIndex];
if (!(cache
? cacheHas(cache, computed)
: includes(arrays[othIndex], computed, comparator))
) {
continue outer;
}
}
if (seen) {
seen.push(computed);
}
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.invert` and `_.invertBy` which inverts
* `object` with values transformed by `iteratee` and set by `setter`.
*
* @private
* @param {Object} object The object to iterate over.
* @param {Function} setter The function to set `accumulator` values.
* @param {Function} iteratee The iteratee to transform values.
* @param {Object} accumulator The initial inverted object.
* @returns {Function} Returns `accumulator`.
*/
function baseInverter(object, setter, iteratee, accumulator) {
baseForOwn(object, function(value, key, object) {
setter(accumulator, iteratee(value), key, object);
});
return accumulator;
}
/**
* The base implementation of `_.invoke` without support for individual
* method arguments.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path of the method to invoke.
* @param {Array} args The arguments to invoke the method with.
* @returns {*} Returns the result of the invoked method.
*/
function baseInvoke(object, path, args) {
path = castPath(path, object);
object = parent(object, path);
var func = object == null ? object : object[toKey(last(path))];
return func == null ? undefined : apply(func, object, args);
}
/**
* The base implementation of `_.isArguments`.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
*/
function baseIsArguments(value) {
return isObjectLike(value) && baseGetTag(value) == argsTag;
}
/**
* The base implementation of `_.isArrayBuffer` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
*/
function baseIsArrayBuffer(value) {
return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
}
/**
* The base implementation of `_.isDate` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
*/
function baseIsDate(value) {
return isObjectLike(value) && baseGetTag(value) == dateTag;
}
/**
* The base implementation of `_.isEqual` which supports partial comparisons
* and tracks traversed objects.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @param {boolean} bitmask The bitmask flags.
* 1 - Unordered comparison
* 2 - Partial comparison
* @param {Function} [customizer] The function to customize comparisons.
* @param {Object} [stack] Tracks traversed `value` and `other` objects.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
*/
function baseIsEqual(value, other, bitmask, customizer, stack) {
if (value === other) {
return true;
}
if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
return value !== value && other !== other;
}
return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
}
/**
* A specialized version of `baseIsEqual` for arrays and objects which performs
* deep comparisons and tracks traversed objects enabling objects with circular
* references to be compared.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} [stack] Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
var objIsArr = isArray(object),
othIsArr = isArray(other),
objTag = objIsArr ? arrayTag : getTag(object),
othTag = othIsArr ? arrayTag : getTag(other);
objTag = objTag == argsTag ? objectTag : objTag;
othTag = othTag == argsTag ? objectTag : othTag;
var objIsObj = objTag == objectTag,
othIsObj = othTag == objectTag,
isSameTag = objTag == othTag;
if (isSameTag && isBuffer(object)) {
if (!isBuffer(other)) {
return false;
}
objIsArr = true;
objIsObj = false;
}
if (isSameTag && !objIsObj) {
stack || (stack = new Stack);
return (objIsArr || isTypedArray(object))
? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
: equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
}
if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
if (objIsWrapped || othIsWrapped) {
var objUnwrapped = objIsWrapped ? object.value() : object,
othUnwrapped = othIsWrapped ? other.value() : other;
stack || (stack = new Stack);
return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
}
}
if (!isSameTag) {
return false;
}
stack || (stack = new Stack);
return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
}
/**
* The base implementation of `_.isMap` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
*/
function baseIsMap(value) {
return isObjectLike(value) && getTag(value) == mapTag;
}
/**
* The base implementation of `_.isMatch` without support for iteratee shorthands.
*
* @private
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @param {Array} matchData The property names, values, and compare flags to match.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
*/
function baseIsMatch(object, source, matchData, customizer) {
var index = matchData.length,
length = index,
noCustomizer = !customizer;
if (object == null) {
return !length;
}
object = Object(object);
while (index--) {
var data = matchData[index];
if ((noCustomizer && data[2])
? data[1] !== object[data[0]]
: !(data[0] in object)
) {
return false;
}
}
while (++index < length) {
data = matchData[index];
var key = data[0],
objValue = object[key],
srcValue = data[1];
if (noCustomizer && data[2]) {
if (objValue === undefined && !(key in object)) {
return false;
}
} else {
var stack = new Stack;
if (customizer) {
var result = customizer(objValue, srcValue, key, object, source, stack);
}
if (!(result === undefined
? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
: result
)) {
return false;
}
}
}
return true;
}
/**
* The base implementation of `_.isNative` without bad shim checks.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
*/
function baseIsNative(value) {
if (!isObject(value) || isMasked(value)) {
return false;
}
var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
return pattern.test(toSource(value));
}
/**
* The base implementation of `_.isRegExp` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
*/
function baseIsRegExp(value) {
return isObjectLike(value) && baseGetTag(value) == regexpTag;
}
/**
* The base implementation of `_.isSet` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
*/
function baseIsSet(value) {
return isObjectLike(value) && getTag(value) == setTag;
}
/**
* The base implementation of `_.isTypedArray` without Node.js optimizations.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
*/
function baseIsTypedArray(value) {
return isObjectLike(value) &&
isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
}
/**
* The base implementation of `_.iteratee`.
*
* @private
* @param {*} [value=_.identity] The value to convert to an iteratee.
* @returns {Function} Returns the iteratee.
*/
function baseIteratee(value) {
// Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
// See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
if (typeof value == 'function') {
return value;
}
if (value == null) {
return identity;
}
if (typeof value == 'object') {
return isArray(value)
? baseMatchesProperty(value[0], value[1])
: baseMatches(value);
}
return property(value);
}
/**
* The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function baseKeys(object) {
if (!isPrototype(object)) {
return nativeKeys(object);
}
var result = [];
for (var key in Object(object)) {
if (hasOwnProperty.call(object, key) && key != 'constructor') {
result.push(key);
}
}
return result;
}
/**
* The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function baseKeysIn(object) {
if (!isObject(object)) {
return nativeKeysIn(object);
}
var isProto = isPrototype(object),
result = [];
for (var key in object) {
if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
result.push(key);
}
}
return result;
}
/**
* The base implementation of `_.lt` which doesn't coerce arguments.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than `other`,
* else `false`.
*/
function baseLt(value, other) {
return value < other;
}
/**
* The base implementation of `_.map` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} iteratee The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
*/
function baseMap(collection, iteratee) {
var index = -1,
result = isArrayLike(collection) ? Array(collection.length) : [];
baseEach(collection, function(value, key, collection) {
result[++index] = iteratee(value, key, collection);
});
return result;
}
/**
* The base implementation of `_.matches` which doesn't clone `source`.
*
* @private
* @param {Object} source The object of property values to match.
* @returns {Function} Returns the new spec function.
*/
function baseMatches(source) {
var matchData = getMatchData(source);
if (matchData.length == 1 && matchData[0][2]) {
return matchesStrictComparable(matchData[0][0], matchData[0][1]);
}
return function(object) {
return object === source || baseIsMatch(object, source, matchData);
};
}
/**
* The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
*
* @private
* @param {string} path The path of the property to get.
* @param {*} srcValue The value to match.
* @returns {Function} Returns the new spec function.
*/
function baseMatchesProperty(path, srcValue) {
if (isKey(path) && isStrictComparable(srcValue)) {
return matchesStrictComparable(toKey(path), srcValue);
}
return function(object) {
var objValue = get(object, path);
return (objValue === undefined && objValue === srcValue)
? hasIn(object, path)
: baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
};
}
/**
* The base implementation of `_.merge` without support for multiple sources.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @param {number} srcIndex The index of `source`.
* @param {Function} [customizer] The function to customize merged values.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
*/
function baseMerge(object, source, srcIndex, customizer, stack) {
if (object === source) {
return;
}
baseFor(source, function(srcValue, key) {
stack || (stack = new Stack);
if (isObject(srcValue)) {
baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
}
else {
var newValue = customizer
? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)
: undefined;
if (newValue === undefined) {
newValue = srcValue;
}
assignMergeValue(object, key, newValue);
}
}, keysIn);
}
/**
* A specialized version of `baseMerge` for arrays and objects which performs
* deep merges and tracks traversed objects enabling objects with circular
* references to be merged.
*
* @private
* @param {Object} object The destination object.
* @param {Object} source The source object.
* @param {string} key The key of the value to merge.
* @param {number} srcIndex The index of `source`.
* @param {Function} mergeFunc The function to merge values.
* @param {Function} [customizer] The function to customize assigned values.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
*/
function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
var objValue = safeGet(object, key),
srcValue = safeGet(source, key),
stacked = stack.get(srcValue);
if (stacked) {
assignMergeValue(object, key, stacked);
return;
}
var newValue = customizer
? customizer(objValue, srcValue, (key + ''), object, source, stack)
: undefined;
var isCommon = newValue === undefined;
if (isCommon) {
var isArr = isArray(srcValue),
isBuff = !isArr && isBuffer(srcValue),
isTyped = !isArr && !isBuff && isTypedArray(srcValue);
newValue = srcValue;
if (isArr || isBuff || isTyped) {
if (isArray(objValue)) {
newValue = objValue;
}
else if (isArrayLikeObject(objValue)) {
newValue = copyArray(objValue);
}
else if (isBuff) {
isCommon = false;
newValue = cloneBuffer(srcValue, true);
}
else if (isTyped) {
isCommon = false;
newValue = cloneTypedArray(srcValue, true);
}
else {
newValue = [];
}
}
else if (isPlainObject(srcValue) || isArguments(srcValue)) {
newValue = objValue;
if (isArguments(objValue)) {
newValue = toPlainObject(objValue);
}
else if (!isObject(objValue) || isFunction(objValue)) {
newValue = initCloneObject(srcValue);
}
}
else {
isCommon = false;
}
}
if (isCommon) {
// Recursively merge objects and arrays (susceptible to call stack limits).
stack.set(srcValue, newValue);
mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
stack['delete'](srcValue);
}
assignMergeValue(object, key, newValue);
}
/**
* The base implementation of `_.nth` which doesn't coerce arguments.
*
* @private
* @param {Array} array The array to query.
* @param {number} n The index of the element to return.
* @returns {*} Returns the nth element of `array`.
*/
function baseNth(array, n) {
var length = array.length;
if (!length) {
return;
}
n += n < 0 ? length : 0;
return isIndex(n, length) ? array[n] : undefined;
}
/**
* The base implementation of `_.orderBy` without param guards.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
* @param {string[]} orders The sort orders of `iteratees`.
* @returns {Array} Returns the new sorted array.
*/
function baseOrderBy(collection, iteratees, orders) {
if (iteratees.length) {
iteratees = arrayMap(iteratees, function(iteratee) {
if (isArray(iteratee)) {
return function(value) {
return baseGet(value, iteratee.length === 1 ? iteratee[0] : iteratee);
}
}
return iteratee;
});
} else {
iteratees = [identity];
}
var index = -1;
iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
var result = baseMap(collection, function(value, key, collection) {
var criteria = arrayMap(iteratees, function(iteratee) {
return iteratee(value);
});
return { 'criteria': criteria, 'index': ++index, 'value': value };
});
return baseSortBy(result, function(object, other) {
return compareMultiple(object, other, orders);
});
}
/**
* The base implementation of `_.pick` without support for individual
* property identifiers.
*
* @private
* @param {Object} object The source object.
* @param {string[]} paths The property paths to pick.
* @returns {Object} Returns the new object.
*/
function basePick(object, paths) {
return basePickBy(object, paths, function(value, path) {
return hasIn(object, path);
});
}
/**
* The base implementation of `_.pickBy` without support for iteratee shorthands.
*
* @private
* @param {Object} object The source object.
* @param {string[]} paths The property paths to pick.
* @param {Function} predicate The function invoked per property.
* @returns {Object} Returns the new object.
*/
function basePickBy(object, paths, predicate) {
var index = -1,
length = paths.length,
result = {};
while (++index < length) {
var path = paths[index],
value = baseGet(object, path);
if (predicate(value, path)) {
baseSet(result, castPath(path, object), value);
}
}
return result;
}
/**
* A specialized version of `baseProperty` which supports deep paths.
*
* @private
* @param {Array|string} path The path of the property to get.
* @returns {Function} Returns the new accessor function.
*/
function basePropertyDeep(path) {
return function(object) {
return baseGet(object, path);
};
}
/**
* The base implementation of `_.pullAllBy` without support for iteratee
* shorthands.
*
* @private
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns `array`.
*/
function basePullAll(array, values, iteratee, comparator) {
var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
index = -1,
length = values.length,
seen = array;
if (array === values) {
values = copyArray(values);
}
if (iteratee) {
seen = arrayMap(array, baseUnary(iteratee));
}
while (++index < length) {
var fromIndex = 0,
value = values[index],
computed = iteratee ? iteratee(value) : value;
while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
if (seen !== array) {
splice.call(seen, fromIndex, 1);
}
splice.call(array, fromIndex, 1);
}
}
return array;
}
/**
* The base implementation of `_.pullAt` without support for individual
* indexes or capturing the removed elements.
*
* @private
* @param {Array} array The array to modify.
* @param {number[]} indexes The indexes of elements to remove.
* @returns {Array} Returns `array`.
*/
function basePullAt(array, indexes) {
var length = array ? indexes.length : 0,
lastIndex = length - 1;
while (length--) {
var index = indexes[length];
if (length == lastIndex || index !== previous) {
var previous = index;
if (isIndex(index)) {
splice.call(array, index, 1);
} else {
baseUnset(array, index);
}
}
}
return array;
}
/**
* The base implementation of `_.random` without support for returning
* floating-point numbers.
*
* @private
* @param {number} lower The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the random number.
*/
function baseRandom(lower, upper) {
return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
}
/**
* The base implementation of `_.range` and `_.rangeRight` which doesn't
* coerce arguments.
*
* @private
* @param {number} start The start of the range.
* @param {number} end The end of the range.
* @param {number} step The value to increment or decrement by.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Array} Returns the range of numbers.
*/
function baseRange(start, end, step, fromRight) {
var index = -1,
length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
result = Array(length);
while (length--) {
result[fromRight ? length : ++index] = start;
start += step;
}
return result;
}
/**
* The base implementation of `_.repeat` which doesn't coerce arguments.
*
* @private
* @param {string} string The string to repeat.
* @param {number} n The number of times to repeat the string.
* @returns {string} Returns the repeated string.
*/
function baseRepeat(string, n) {
var result = '';
if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
return result;
}
// Leverage the exponentiation by squaring algorithm for a faster repeat.
// See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
do {
if (n % 2) {
result += string;
}
n = nativeFloor(n / 2);
if (n) {
string += string;
}
} while (n);
return result;
}
/**
* The base implementation of `_.rest` which doesn't validate or coerce arguments.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @returns {Function} Returns the new function.
*/
function baseRest(func, start) {
return setToString(overRest(func, start, identity), func + '');
}
/**
* The base implementation of `_.sample`.
*
* @private
* @param {Array|Object} collection The collection to sample.
* @returns {*} Returns the random element.
*/
function baseSample(collection) {
return arraySample(values(collection));
}
/**
* The base implementation of `_.sampleSize` without param guards.
*
* @private
* @param {Array|Object} collection The collection to sample.
* @param {number} n The number of elements to sample.
* @returns {Array} Returns the random elements.
*/
function baseSampleSize(collection, n) {
var array = values(collection);
return shuffleSelf(array, baseClamp(n, 0, array.length));
}
/**
* The base implementation of `_.set`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @param {Function} [customizer] The function to customize path creation.
* @returns {Object} Returns `object`.
*/
function baseSet(object, path, value, customizer) {
if (!isObject(object)) {
return object;
}
path = castPath(path, object);
var index = -1,
length = path.length,
lastIndex = length - 1,
nested = object;
while (nested != null && ++index < length) {
var key = toKey(path[index]),
newValue = value;
if (key === '__proto__' || key === 'constructor' || key === 'prototype') {
return object;
}
if (index != lastIndex) {
var objValue = nested[key];
newValue = customizer ? customizer(objValue, key, nested) : undefined;
if (newValue === undefined) {
newValue = isObject(objValue)
? objValue
: (isIndex(path[index + 1]) ? [] : {});
}
}
assignValue(nested, key, newValue);
nested = nested[key];
}
return object;
}
/**
* The base implementation of `setData` without support for hot loop shorting.
*
* @private
* @param {Function} func The function to associate metadata with.
* @param {*} data The metadata.
* @returns {Function} Returns `func`.
*/
var baseSetData = !metaMap ? identity : function(func, data) {
metaMap.set(func, data);
return func;
};
/**
* The base implementation of `setToString` without support for hot loop shorting.
*
* @private
* @param {Function} func The function to modify.
* @param {Function} string The `toString` result.
* @returns {Function} Returns `func`.
*/
var baseSetToString = !defineProperty ? identity : function(func, string) {
return defineProperty(func, 'toString', {
'configurable': true,
'enumerable': false,
'value': constant(string),
'writable': true
});
};
/**
* The base implementation of `_.shuffle`.
*
* @private
* @param {Array|Object} collection The collection to shuffle.
* @returns {Array} Returns the new shuffled array.
*/
function baseShuffle(collection) {
return shuffleSelf(values(collection));
}
/**
* The base implementation of `_.slice` without an iteratee call guard.
*
* @private
* @param {Array} array The array to slice.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the slice of `array`.
*/
function baseSlice(array, start, end) {
var index = -1,
length = array.length;
if (start < 0) {
start = -start > length ? 0 : (length + start);
}
end = end > length ? length : end;
if (end < 0) {
end += length;
}
length = start > end ? 0 : ((end - start) >>> 0);
start >>>= 0;
var result = Array(length);
while (++index < length) {
result[index] = array[index + start];
}
return result;
}
/**
* The base implementation of `_.some` without support for iteratee shorthands.
*
* @private
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} predicate The function invoked per iteration.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
*/
function baseSome(collection, predicate) {
var result;
baseEach(collection, function(value, index, collection) {
result = predicate(value, index, collection);
return !result;
});
return !!result;
}
/**
* The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
* performs a binary search of `array` to determine the index at which `value`
* should be inserted into `array` in order to maintain its sort order.
*
* @private
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {boolean} [retHighest] Specify returning the highest qualified index.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
*/
function baseSortedIndex(array, value, retHighest) {
var low = 0,
high = array == null ? low : array.length;
if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
while (low < high) {
var mid = (low + high) >>> 1,
computed = array[mid];
if (computed !== null && !isSymbol(computed) &&
(retHighest ? (computed <= value) : (computed < value))) {
low = mid + 1;
} else {
high = mid;
}
}
return high;
}
return baseSortedIndexBy(array, value, identity, retHighest);
}
/**
* The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
* which invokes `iteratee` for `value` and each element of `array` to compute
* their sort ranking. The iteratee is invoked with one argument; (value).
*
* @private
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} iteratee The iteratee invoked per element.
* @param {boolean} [retHighest] Specify returning the highest qualified index.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
*/
function baseSortedIndexBy(array, value, iteratee, retHighest) {
var low = 0,
high = array == null ? 0 : array.length;
if (high === 0) {
return 0;
}
value = iteratee(value);
var valIsNaN = value !== value,
valIsNull = value === null,
valIsSymbol = isSymbol(value),
valIsUndefined = value === undefined;
while (low < high) {
var mid = nativeFloor((low + high) / 2),
computed = iteratee(array[mid]),
othIsDefined = computed !== undefined,
othIsNull = computed === null,
othIsReflexive = computed === computed,
othIsSymbol = isSymbol(computed);
if (valIsNaN) {
var setLow = retHighest || othIsReflexive;
} else if (valIsUndefined) {
setLow = othIsReflexive && (retHighest || othIsDefined);
} else if (valIsNull) {
setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
} else if (valIsSymbol) {
setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
} else if (othIsNull || othIsSymbol) {
setLow = false;
} else {
setLow = retHighest ? (computed <= value) : (computed < value);
}
if (setLow) {
low = mid + 1;
} else {
high = mid;
}
}
return nativeMin(high, MAX_ARRAY_INDEX);
}
/**
* The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
* support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
*/
function baseSortedUniq(array, iteratee) {
var index = -1,
length = array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
if (!index || !eq(computed, seen)) {
var seen = computed;
result[resIndex++] = value === 0 ? 0 : value;
}
}
return result;
}
/**
* The base implementation of `_.toNumber` which doesn't ensure correct
* conversions of binary, hexadecimal, or octal string values.
*
* @private
* @param {*} value The value to process.
* @returns {number} Returns the number.
*/
function baseToNumber(value) {
if (typeof value == 'number') {
return value;
}
if (isSymbol(value)) {
return NAN;
}
return +value;
}
/**
* The base implementation of `_.toString` which doesn't convert nullish
* values to empty strings.
*
* @private
* @param {*} value The value to process.
* @returns {string} Returns the string.
*/
function baseToString(value) {
// Exit early for strings to avoid a performance hit in some environments.
if (typeof value == 'string') {
return value;
}
if (isArray(value)) {
// Recursively convert values (susceptible to call stack limits).
return arrayMap(value, baseToString) + '';
}
if (isSymbol(value)) {
return symbolToString ? symbolToString.call(value) : '';
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
}
/**
* The base implementation of `_.uniqBy` without support for iteratee shorthands.
*
* @private
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new duplicate free array.
*/
function baseUniq(array, iteratee, comparator) {
var index = -1,
includes = arrayIncludes,
length = array.length,
isCommon = true,
result = [],
seen = result;
if (comparator) {
isCommon = false;
includes = arrayIncludesWith;
}
else if (length >= LARGE_ARRAY_SIZE) {
var set = iteratee ? null : createSet(array);
if (set) {
return setToArray(set);
}
isCommon = false;
includes = cacheHas;
seen = new SetCache;
}
else {
seen = iteratee ? [] : result;
}
outer:
while (++index < length) {
var value = array[index],
computed = iteratee ? iteratee(value) : value;
value = (comparator || value !== 0) ? value : 0;
if (isCommon && computed === computed) {
var seenIndex = seen.length;
while (seenIndex--) {
if (seen[seenIndex] === computed) {
continue outer;
}
}
if (iteratee) {
seen.push(computed);
}
result.push(value);
}
else if (!includes(seen, computed, comparator)) {
if (seen !== result) {
seen.push(computed);
}
result.push(value);
}
}
return result;
}
/**
* The base implementation of `_.unset`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The property path to unset.
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
*/
function baseUnset(object, path) {
path = castPath(path, object);
object = parent(object, path);
return object == null || delete object[toKey(last(path))];
}
/**
* The base implementation of `_.update`.
*
* @private
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to update.
* @param {Function} updater The function to produce the updated value.
* @param {Function} [customizer] The function to customize path creation.
* @returns {Object} Returns `object`.
*/
function baseUpdate(object, path, updater, customizer) {
return baseSet(object, path, updater(baseGet(object, path)), customizer);
}
/**
* The base implementation of methods like `_.dropWhile` and `_.takeWhile`
* without support for iteratee shorthands.
*
* @private
* @param {Array} array The array to query.
* @param {Function} predicate The function invoked per iteration.
* @param {boolean} [isDrop] Specify dropping elements instead of taking them.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Array} Returns the slice of `array`.
*/
function baseWhile(array, predicate, isDrop, fromRight) {
var length = array.length,
index = fromRight ? length : -1;
while ((fromRight ? index-- : ++index < length) &&
predicate(array[index], index, array)) {}
return isDrop
? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
: baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
}
/**
* The base implementation of `wrapperValue` which returns the result of
* performing a sequence of actions on the unwrapped `value`, where each
* successive action is supplied the return value of the previous.
*
* @private
* @param {*} value The unwrapped value.
* @param {Array} actions Actions to perform to resolve the unwrapped value.
* @returns {*} Returns the resolved value.
*/
function baseWrapperValue(value, actions) {
var result = value;
if (result instanceof LazyWrapper) {
result = result.value();
}
return arrayReduce(actions, function(result, action) {
return action.func.apply(action.thisArg, arrayPush([result], action.args));
}, result);
}
/**
* The base implementation of methods like `_.xor`, without support for
* iteratee shorthands, that accepts an array of arrays to inspect.
*
* @private
* @param {Array} arrays The arrays to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of values.
*/
function baseXor(arrays, iteratee, comparator) {
var length = arrays.length;
if (length < 2) {
return length ? baseUniq(arrays[0]) : [];
}
var index = -1,
result = Array(length);
while (++index < length) {
var array = arrays[index],
othIndex = -1;
while (++othIndex < length) {
if (othIndex != index) {
result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
}
}
}
return baseUniq(baseFlatten(result, 1), iteratee, comparator);
}
/**
* This base implementation of `_.zipObject` which assigns values using `assignFunc`.
*
* @private
* @param {Array} props The property identifiers.
* @param {Array} values The property values.
* @param {Function} assignFunc The function to assign values.
* @returns {Object} Returns the new object.
*/
function baseZipObject(props, values, assignFunc) {
var index = -1,
length = props.length,
valsLength = values.length,
result = {};
while (++index < length) {
var value = index < valsLength ? values[index] : undefined;
assignFunc(result, props[index], value);
}
return result;
}
/**
* Casts `value` to an empty array if it's not an array like object.
*
* @private
* @param {*} value The value to inspect.
* @returns {Array|Object} Returns the cast array-like object.
*/
function castArrayLikeObject(value) {
return isArrayLikeObject(value) ? value : [];
}
/**
* Casts `value` to `identity` if it's not a function.
*
* @private
* @param {*} value The value to inspect.
* @returns {Function} Returns cast function.
*/
function castFunction(value) {
return typeof value == 'function' ? value : identity;
}
/**
* Casts `value` to a path array if it's not one.
*
* @private
* @param {*} value The value to inspect.
* @param {Object} [object] The object to query keys on.
* @returns {Array} Returns the cast property path array.
*/
function castPath(value, object) {
if (isArray(value)) {
return value;
}
return isKey(value, object) ? [value] : stringToPath(toString(value));
}
/**
* A `baseRest` alias which can be replaced with `identity` by module
* replacement plugins.
*
* @private
* @type {Function}
* @param {Function} func The function to apply a rest parameter to.
* @returns {Function} Returns the new function.
*/
var castRest = baseRest;
/**
* Casts `array` to a slice if it's needed.
*
* @private
* @param {Array} array The array to inspect.
* @param {number} start The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the cast slice.
*/
function castSlice(array, start, end) {
var length = array.length;
end = end === undefined ? length : end;
return (!start && end >= length) ? array : baseSlice(array, start, end);
}
/**
* A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
*
* @private
* @param {number|Object} id The timer id or timeout object of the timer to clear.
*/
var clearTimeout = ctxClearTimeout || function(id) {
return root.clearTimeout(id);
};
/**
* Creates a clone of `buffer`.
*
* @private
* @param {Buffer} buffer The buffer to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Buffer} Returns the cloned buffer.
*/
function cloneBuffer(buffer, isDeep) {
if (isDeep) {
return buffer.slice();
}
var length = buffer.length,
result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
buffer.copy(result);
return result;
}
/**
* Creates a clone of `arrayBuffer`.
*
* @private
* @param {ArrayBuffer} arrayBuffer The array buffer to clone.
* @returns {ArrayBuffer} Returns the cloned array buffer.
*/
function cloneArrayBuffer(arrayBuffer) {
var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
new Uint8Array(result).set(new Uint8Array(arrayBuffer));
return result;
}
/**
* Creates a clone of `dataView`.
*
* @private
* @param {Object} dataView The data view to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned data view.
*/
function cloneDataView(dataView, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
}
/**
* Creates a clone of `regexp`.
*
* @private
* @param {Object} regexp The regexp to clone.
* @returns {Object} Returns the cloned regexp.
*/
function cloneRegExp(regexp) {
var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
result.lastIndex = regexp.lastIndex;
return result;
}
/**
* Creates a clone of the `symbol` object.
*
* @private
* @param {Object} symbol The symbol object to clone.
* @returns {Object} Returns the cloned symbol object.
*/
function cloneSymbol(symbol) {
return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
}
/**
* Creates a clone of `typedArray`.
*
* @private
* @param {Object} typedArray The typed array to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the cloned typed array.
*/
function cloneTypedArray(typedArray, isDeep) {
var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
}
/**
* Compares values to sort them in ascending order.
*
* @private
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {number} Returns the sort order indicator for `value`.
*/
function compareAscending(value, other) {
if (value !== other) {
var valIsDefined = value !== undefined,
valIsNull = value === null,
valIsReflexive = value === value,
valIsSymbol = isSymbol(value);
var othIsDefined = other !== undefined,
othIsNull = other === null,
othIsReflexive = other === other,
othIsSymbol = isSymbol(other);
if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
(valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
(valIsNull && othIsDefined && othIsReflexive) ||
(!valIsDefined && othIsReflexive) ||
!valIsReflexive) {
return 1;
}
if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
(othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
(othIsNull && valIsDefined && valIsReflexive) ||
(!othIsDefined && valIsReflexive) ||
!othIsReflexive) {
return -1;
}
}
return 0;
}
/**
* Used by `_.orderBy` to compare multiple properties of a value to another
* and stable sort them.
*
* If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
* specify an order of "desc" for descending or "asc" for ascending sort order
* of corresponding values.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {boolean[]|string[]} orders The order to sort by for each property.
* @returns {number} Returns the sort order indicator for `object`.
*/
function compareMultiple(object, other, orders) {
var index = -1,
objCriteria = object.criteria,
othCriteria = other.criteria,
length = objCriteria.length,
ordersLength = orders.length;
while (++index < length) {
var result = compareAscending(objCriteria[index], othCriteria[index]);
if (result) {
if (index >= ordersLength) {
return result;
}
var order = orders[index];
return result * (order == 'desc' ? -1 : 1);
}
}
// Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
// that causes it, under certain circumstances, to provide the same value for
// `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
// for more details.
//
// This also ensures a stable sort in V8 and other engines.
// See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
return object.index - other.index;
}
/**
* Creates an array that is the composition of partially applied arguments,
* placeholders, and provided arguments into a single array of arguments.
*
* @private
* @param {Array} args The provided arguments.
* @param {Array} partials The arguments to prepend to those provided.
* @param {Array} holders The `partials` placeholder indexes.
* @params {boolean} [isCurried] Specify composing for a curried function.
* @returns {Array} Returns the new array of composed arguments.
*/
function composeArgs(args, partials, holders, isCurried) {
var argsIndex = -1,
argsLength = args.length,
holdersLength = holders.length,
leftIndex = -1,
leftLength = partials.length,
rangeLength = nativeMax(argsLength - holdersLength, 0),
result = Array(leftLength + rangeLength),
isUncurried = !isCurried;
while (++leftIndex < leftLength) {
result[leftIndex] = partials[leftIndex];
}
while (++argsIndex < holdersLength) {
if (isUncurried || argsIndex < argsLength) {
result[holders[argsIndex]] = args[argsIndex];
}
}
while (rangeLength--) {
result[leftIndex++] = args[argsIndex++];
}
return result;
}
/**
* This function is like `composeArgs` except that the arguments composition
* is tailored for `_.partialRight`.
*
* @private
* @param {Array} args The provided arguments.
* @param {Array} partials The arguments to append to those provided.
* @param {Array} holders The `partials` placeholder indexes.
* @params {boolean} [isCurried] Specify composing for a curried function.
* @returns {Array} Returns the new array of composed arguments.
*/
function composeArgsRight(args, partials, holders, isCurried) {
var argsIndex = -1,
argsLength = args.length,
holdersIndex = -1,
holdersLength = holders.length,
rightIndex = -1,
rightLength = partials.length,
rangeLength = nativeMax(argsLength - holdersLength, 0),
result = Array(rangeLength + rightLength),
isUncurried = !isCurried;
while (++argsIndex < rangeLength) {
result[argsIndex] = args[argsIndex];
}
var offset = argsIndex;
while (++rightIndex < rightLength) {
result[offset + rightIndex] = partials[rightIndex];
}
while (++holdersIndex < holdersLength) {
if (isUncurried || argsIndex < argsLength) {
result[offset + holders[holdersIndex]] = args[argsIndex++];
}
}
return result;
}
/**
* Copies the values of `source` to `array`.
*
* @private
* @param {Array} source The array to copy values from.
* @param {Array} [array=[]] The array to copy values to.
* @returns {Array} Returns `array`.
*/
function copyArray(source, array) {
var index = -1,
length = source.length;
array || (array = Array(length));
while (++index < length) {
array[index] = source[index];
}
return array;
}
/**
* Copies properties of `source` to `object`.
*
* @private
* @param {Object} source The object to copy properties from.
* @param {Array} props The property identifiers to copy.
* @param {Object} [object={}] The object to copy properties to.
* @param {Function} [customizer] The function to customize copied values.
* @returns {Object} Returns `object`.
*/
function copyObject(source, props, object, customizer) {
var isNew = !object;
object || (object = {});
var index = -1,
length = props.length;
while (++index < length) {
var key = props[index];
var newValue = customizer
? customizer(object[key], source[key], key, object, source)
: undefined;
if (newValue === undefined) {
newValue = source[key];
}
if (isNew) {
baseAssignValue(object, key, newValue);
} else {
assignValue(object, key, newValue);
}
}
return object;
}
/**
* Copies own symbols of `source` to `object`.
*
* @private
* @param {Object} source The object to copy symbols from.
* @param {Object} [object={}] The object to copy symbols to.
* @returns {Object} Returns `object`.
*/
function copySymbols(source, object) {
return copyObject(source, getSymbols(source), object);
}
/**
* Copies own and inherited symbols of `source` to `object`.
*
* @private
* @param {Object} source The object to copy symbols from.
* @param {Object} [object={}] The object to copy symbols to.
* @returns {Object} Returns `object`.
*/
function copySymbolsIn(source, object) {
return copyObject(source, getSymbolsIn(source), object);
}
/**
* Creates a function like `_.groupBy`.
*
* @private
* @param {Function} setter The function to set accumulator values.
* @param {Function} [initializer] The accumulator object initializer.
* @returns {Function} Returns the new aggregator function.
*/
function createAggregator(setter, initializer) {
return function(collection, iteratee) {
var func = isArray(collection) ? arrayAggregator : baseAggregator,
accumulator = initializer ? initializer() : {};
return func(collection, setter, getIteratee(iteratee, 2), accumulator);
};
}
/**
* Creates a function like `_.assign`.
*
* @private
* @param {Function} assigner The function to assign values.
* @returns {Function} Returns the new assigner function.
*/
function createAssigner(assigner) {
return baseRest(function(object, sources) {
var index = -1,
length = sources.length,
customizer = length > 1 ? sources[length - 1] : undefined,
guard = length > 2 ? sources[2] : undefined;
customizer = (assigner.length > 3 && typeof customizer == 'function')
? (length--, customizer)
: undefined;
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
customizer = length < 3 ? undefined : customizer;
length = 1;
}
object = Object(object);
while (++index < length) {
var source = sources[index];
if (source) {
assigner(object, source, index, customizer);
}
}
return object;
});
}
/**
* Creates a `baseEach` or `baseEachRight` function.
*
* @private
* @param {Function} eachFunc The function to iterate over a collection.
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new base function.
*/
function createBaseEach(eachFunc, fromRight) {
return function(collection, iteratee) {
if (collection == null) {
return collection;
}
if (!isArrayLike(collection)) {
return eachFunc(collection, iteratee);
}
var length = collection.length,
index = fromRight ? length : -1,
iterable = Object(collection);
while ((fromRight ? index-- : ++index < length)) {
if (iteratee(iterable[index], index, iterable) === false) {
break;
}
}
return collection;
};
}
/**
* Creates a base function for methods like `_.forIn` and `_.forOwn`.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new base function.
*/
function createBaseFor(fromRight) {
return function(object, iteratee, keysFunc) {
var index = -1,
iterable = Object(object),
props = keysFunc(object),
length = props.length;
while (length--) {
var key = props[fromRight ? length : ++index];
if (iteratee(iterable[key], key, iterable) === false) {
break;
}
}
return object;
};
}
/**
* Creates a function that wraps `func` to invoke it with the optional `this`
* binding of `thisArg`.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} [thisArg] The `this` binding of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createBind(func, bitmask, thisArg) {
var isBind = bitmask & WRAP_BIND_FLAG,
Ctor = createCtor(func);
function wrapper() {
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
return fn.apply(isBind ? thisArg : this, arguments);
}
return wrapper;
}
/**
* Creates a function like `_.lowerFirst`.
*
* @private
* @param {string} methodName The name of the `String` case method to use.
* @returns {Function} Returns the new case function.
*/
function createCaseFirst(methodName) {
return function(string) {
string = toString(string);
var strSymbols = hasUnicode(string)
? stringToArray(string)
: undefined;
var chr = strSymbols
? strSymbols[0]
: string.charAt(0);
var trailing = strSymbols
? castSlice(strSymbols, 1).join('')
: string.slice(1);
return chr[methodName]() + trailing;
};
}
/**
* Creates a function like `_.camelCase`.
*
* @private
* @param {Function} callback The function to combine each word.
* @returns {Function} Returns the new compounder function.
*/
function createCompounder(callback) {
return function(string) {
return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
};
}
/**
* Creates a function that produces an instance of `Ctor` regardless of
* whether it was invoked as part of a `new` expression or by `call` or `apply`.
*
* @private
* @param {Function} Ctor The constructor to wrap.
* @returns {Function} Returns the new wrapped function.
*/
function createCtor(Ctor) {
return function() {
// Use a `switch` statement to work with class constructors. See
// http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
// for more details.
var args = arguments;
switch (args.length) {
case 0: return new Ctor;
case 1: return new Ctor(args[0]);
case 2: return new Ctor(args[0], args[1]);
case 3: return new Ctor(args[0], args[1], args[2]);
case 4: return new Ctor(args[0], args[1], args[2], args[3]);
case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
}
var thisBinding = baseCreate(Ctor.prototype),
result = Ctor.apply(thisBinding, args);
// Mimic the constructor's `return` behavior.
// See https://es5.github.io/#x13.2.2 for more details.
return isObject(result) ? result : thisBinding;
};
}
/**
* Creates a function that wraps `func` to enable currying.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {number} arity The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createCurry(func, bitmask, arity) {
var Ctor = createCtor(func);
function wrapper() {
var length = arguments.length,
args = Array(length),
index = length,
placeholder = getHolder(wrapper);
while (index--) {
args[index] = arguments[index];
}
var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
? []
: replaceHolders(args, placeholder);
length -= holders.length;
if (length < arity) {
return createRecurry(
func, bitmask, createHybrid, wrapper.placeholder, undefined,
args, holders, undefined, undefined, arity - length);
}
var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
return apply(fn, this, args);
}
return wrapper;
}
/**
* Creates a `_.find` or `_.findLast` function.
*
* @private
* @param {Function} findIndexFunc The function to find the collection index.
* @returns {Function} Returns the new find function.
*/
function createFind(findIndexFunc) {
return function(collection, predicate, fromIndex) {
var iterable = Object(collection);
if (!isArrayLike(collection)) {
var iteratee = getIteratee(predicate, 3);
collection = keys(collection);
predicate = function(key) { return iteratee(iterable[key], key, iterable); };
}
var index = findIndexFunc(collection, predicate, fromIndex);
return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
};
}
/**
* Creates a `_.flow` or `_.flowRight` function.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new flow function.
*/
function createFlow(fromRight) {
return flatRest(function(funcs) {
var length = funcs.length,
index = length,
prereq = LodashWrapper.prototype.thru;
if (fromRight) {
funcs.reverse();
}
while (index--) {
var func = funcs[index];
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
var wrapper = new LodashWrapper([], true);
}
}
index = wrapper ? index : length;
while (++index < length) {
func = funcs[index];
var funcName = getFuncName(func),
data = funcName == 'wrapper' ? getData(func) : undefined;
if (data && isLaziable(data[0]) &&
data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
!data[4].length && data[9] == 1
) {
wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
} else {
wrapper = (func.length == 1 && isLaziable(func))
? wrapper[funcName]()
: wrapper.thru(func);
}
}
return function() {
var args = arguments,
value = args[0];
if (wrapper && args.length == 1 && isArray(value)) {
return wrapper.plant(value).value();
}
var index = 0,
result = length ? funcs[index].apply(this, args) : value;
while (++index < length) {
result = funcs[index].call(this, result);
}
return result;
};
});
}
/**
* Creates a function that wraps `func` to invoke it with optional `this`
* binding of `thisArg`, partial application, and currying.
*
* @private
* @param {Function|string} func The function or method name to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to prepend to those provided to
* the new function.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [partialsRight] The arguments to append to those provided
* to the new function.
* @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
var isAry = bitmask & WRAP_ARY_FLAG,
isBind = bitmask & WRAP_BIND_FLAG,
isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
isFlip = bitmask & WRAP_FLIP_FLAG,
Ctor = isBindKey ? undefined : createCtor(func);
function wrapper() {
var length = arguments.length,
args = Array(length),
index = length;
while (index--) {
args[index] = arguments[index];
}
if (isCurried) {
var placeholder = getHolder(wrapper),
holdersCount = countHolders(args, placeholder);
}
if (partials) {
args = composeArgs(args, partials, holders, isCurried);
}
if (partialsRight) {
args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
}
length -= holdersCount;
if (isCurried && length < arity) {
var newHolders = replaceHolders(args, placeholder);
return createRecurry(
func, bitmask, createHybrid, wrapper.placeholder, thisArg,
args, newHolders, argPos, ary, arity - length
);
}
var thisBinding = isBind ? thisArg : this,
fn = isBindKey ? thisBinding[func] : func;
length = args.length;
if (argPos) {
args = reorder(args, argPos);
} else if (isFlip && length > 1) {
args.reverse();
}
if (isAry && ary < length) {
args.length = ary;
}
if (this && this !== root && this instanceof wrapper) {
fn = Ctor || createCtor(fn);
}
return fn.apply(thisBinding, args);
}
return wrapper;
}
/**
* Creates a function like `_.invertBy`.
*
* @private
* @param {Function} setter The function to set accumulator values.
* @param {Function} toIteratee The function to resolve iteratees.
* @returns {Function} Returns the new inverter function.
*/
function createInverter(setter, toIteratee) {
return function(object, iteratee) {
return baseInverter(object, setter, toIteratee(iteratee), {});
};
}
/**
* Creates a function that performs a mathematical operation on two values.
*
* @private
* @param {Function} operator The function to perform the operation.
* @param {number} [defaultValue] The value used for `undefined` arguments.
* @returns {Function} Returns the new mathematical operation function.
*/
function createMathOperation(operator, defaultValue) {
return function(value, other) {
var result;
if (value === undefined && other === undefined) {
return defaultValue;
}
if (value !== undefined) {
result = value;
}
if (other !== undefined) {
if (result === undefined) {
return other;
}
if (typeof value == 'string' || typeof other == 'string') {
value = baseToString(value);
other = baseToString(other);
} else {
value = baseToNumber(value);
other = baseToNumber(other);
}
result = operator(value, other);
}
return result;
};
}
/**
* Creates a function like `_.over`.
*
* @private
* @param {Function} arrayFunc The function to iterate over iteratees.
* @returns {Function} Returns the new over function.
*/
function createOver(arrayFunc) {
return flatRest(function(iteratees) {
iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
return baseRest(function(args) {
var thisArg = this;
return arrayFunc(iteratees, function(iteratee) {
return apply(iteratee, thisArg, args);
});
});
});
}
/**
* Creates the padding for `string` based on `length`. The `chars` string
* is truncated if the number of characters exceeds `length`.
*
* @private
* @param {number} length The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padding for `string`.
*/
function createPadding(length, chars) {
chars = chars === undefined ? ' ' : baseToString(chars);
var charsLength = chars.length;
if (charsLength < 2) {
return charsLength ? baseRepeat(chars, length) : chars;
}
var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
return hasUnicode(chars)
? castSlice(stringToArray(result), 0, length).join('')
: result.slice(0, length);
}
/**
* Creates a function that wraps `func` to invoke it with the `this` binding
* of `thisArg` and `partials` prepended to the arguments it receives.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {*} thisArg The `this` binding of `func`.
* @param {Array} partials The arguments to prepend to those provided to
* the new function.
* @returns {Function} Returns the new wrapped function.
*/
function createPartial(func, bitmask, thisArg, partials) {
var isBind = bitmask & WRAP_BIND_FLAG,
Ctor = createCtor(func);
function wrapper() {
var argsIndex = -1,
argsLength = arguments.length,
leftIndex = -1,
leftLength = partials.length,
args = Array(leftLength + argsLength),
fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
while (++leftIndex < leftLength) {
args[leftIndex] = partials[leftIndex];
}
while (argsLength--) {
args[leftIndex++] = arguments[++argsIndex];
}
return apply(fn, isBind ? thisArg : this, args);
}
return wrapper;
}
/**
* Creates a `_.range` or `_.rangeRight` function.
*
* @private
* @param {boolean} [fromRight] Specify iterating from right to left.
* @returns {Function} Returns the new range function.
*/
function createRange(fromRight) {
return function(start, end, step) {
if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
end = step = undefined;
}
// Ensure the sign of `-0` is preserved.
start = toFinite(start);
if (end === undefined) {
end = start;
start = 0;
} else {
end = toFinite(end);
}
step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
return baseRange(start, end, step, fromRight);
};
}
/**
* Creates a function that performs a relational operation on two values.
*
* @private
* @param {Function} operator The function to perform the operation.
* @returns {Function} Returns the new relational operation function.
*/
function createRelationalOperation(operator) {
return function(value, other) {
if (!(typeof value == 'string' && typeof other == 'string')) {
value = toNumber(value);
other = toNumber(other);
}
return operator(value, other);
};
}
/**
* Creates a function that wraps `func` to continue currying.
*
* @private
* @param {Function} func The function to wrap.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @param {Function} wrapFunc The function to create the `func` wrapper.
* @param {*} placeholder The placeholder value.
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to prepend to those provided to
* the new function.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
var isCurry = bitmask & WRAP_CURRY_FLAG,
newHolders = isCurry ? holders : undefined,
newHoldersRight = isCurry ? undefined : holders,
newPartials = isCurry ? partials : undefined,
newPartialsRight = isCurry ? undefined : partials;
bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
}
var newData = [
func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
newHoldersRight, argPos, ary, arity
];
var result = wrapFunc.apply(undefined, newData);
if (isLaziable(func)) {
setData(result, newData);
}
result.placeholder = placeholder;
return setWrapToString(result, func, bitmask);
}
/**
* Creates a function like `_.round`.
*
* @private
* @param {string} methodName The name of the `Math` method to use when rounding.
* @returns {Function} Returns the new round function.
*/
function createRound(methodName) {
var func = Math[methodName];
return function(number, precision) {
number = toNumber(number);
precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
if (precision && nativeIsFinite(number)) {
// Shift with exponential notation to avoid floating-point issues.
// See [MDN](https://mdn.io/round#Examples) for more details.
var pair = (toString(number) + 'e').split('e'),
value = func(pair[0] + 'e' + (+pair[1] + precision));
pair = (toString(value) + 'e').split('e');
return +(pair[0] + 'e' + (+pair[1] - precision));
}
return func(number);
};
}
/**
* Creates a set object of `values`.
*
* @private
* @param {Array} values The values to add to the set.
* @returns {Object} Returns the new set.
*/
var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
return new Set(values);
};
/**
* Creates a `_.toPairs` or `_.toPairsIn` function.
*
* @private
* @param {Function} keysFunc The function to get the keys of a given object.
* @returns {Function} Returns the new pairs function.
*/
function createToPairs(keysFunc) {
return function(object) {
var tag = getTag(object);
if (tag == mapTag) {
return mapToArray(object);
}
if (tag == setTag) {
return setToPairs(object);
}
return baseToPairs(object, keysFunc(object));
};
}
/**
* Creates a function that either curries or invokes `func` with optional
* `this` binding and partially applied arguments.
*
* @private
* @param {Function|string} func The function or method name to wrap.
* @param {number} bitmask The bitmask flags.
* 1 - `_.bind`
* 2 - `_.bindKey`
* 4 - `_.curry` or `_.curryRight` of a bound function
* 8 - `_.curry`
* 16 - `_.curryRight`
* 32 - `_.partial`
* 64 - `_.partialRight`
* 128 - `_.rearg`
* 256 - `_.ary`
* 512 - `_.flip`
* @param {*} [thisArg] The `this` binding of `func`.
* @param {Array} [partials] The arguments to be partially applied.
* @param {Array} [holders] The `partials` placeholder indexes.
* @param {Array} [argPos] The argument positions of the new function.
* @param {number} [ary] The arity cap of `func`.
* @param {number} [arity] The arity of `func`.
* @returns {Function} Returns the new wrapped function.
*/
function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
if (!isBindKey && typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
var length = partials ? partials.length : 0;
if (!length) {
bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
partials = holders = undefined;
}
ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
arity = arity === undefined ? arity : toInteger(arity);
length -= holders ? holders.length : 0;
if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
var partialsRight = partials,
holdersRight = holders;
partials = holders = undefined;
}
var data = isBindKey ? undefined : getData(func);
var newData = [
func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
argPos, ary, arity
];
if (data) {
mergeData(newData, data);
}
func = newData[0];
bitmask = newData[1];
thisArg = newData[2];
partials = newData[3];
holders = newData[4];
arity = newData[9] = newData[9] === undefined
? (isBindKey ? 0 : func.length)
: nativeMax(newData[9] - length, 0);
if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
}
if (!bitmask || bitmask == WRAP_BIND_FLAG) {
var result = createBind(func, bitmask, thisArg);
} else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
result = createCurry(func, bitmask, arity);
} else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
result = createPartial(func, bitmask, thisArg, partials);
} else {
result = createHybrid.apply(undefined, newData);
}
var setter = data ? baseSetData : setData;
return setWrapToString(setter(result, newData), func, bitmask);
}
/**
* Used by `_.defaults` to customize its `_.assignIn` use to assign properties
* of source objects to the destination object for all destination properties
* that resolve to `undefined`.
*
* @private
* @param {*} objValue The destination value.
* @param {*} srcValue The source value.
* @param {string} key The key of the property to assign.
* @param {Object} object The parent object of `objValue`.
* @returns {*} Returns the value to assign.
*/
function customDefaultsAssignIn(objValue, srcValue, key, object) {
if (objValue === undefined ||
(eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
return srcValue;
}
return objValue;
}
/**
* Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
* objects into destination objects that are passed thru.
*
* @private
* @param {*} objValue The destination value.
* @param {*} srcValue The source value.
* @param {string} key The key of the property to merge.
* @param {Object} object The parent object of `objValue`.
* @param {Object} source The parent object of `srcValue`.
* @param {Object} [stack] Tracks traversed source values and their merged
* counterparts.
* @returns {*} Returns the value to assign.
*/
function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
if (isObject(objValue) && isObject(srcValue)) {
// Recursively merge objects and arrays (susceptible to call stack limits).
stack.set(srcValue, objValue);
baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
stack['delete'](srcValue);
}
return objValue;
}
/**
* Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
* objects.
*
* @private
* @param {*} value The value to inspect.
* @param {string} key The key of the property to inspect.
* @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
*/
function customOmitClone(value) {
return isPlainObject(value) ? undefined : value;
}
/**
* A specialized version of `baseIsEqualDeep` for arrays with support for
* partial deep comparisons.
*
* @private
* @param {Array} array The array to compare.
* @param {Array} other The other array to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `array` and `other` objects.
* @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
*/
function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
arrLength = array.length,
othLength = other.length;
if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
return false;
}
// Check that cyclic values are equal.
var arrStacked = stack.get(array);
var othStacked = stack.get(other);
if (arrStacked && othStacked) {
return arrStacked == other && othStacked == array;
}
var index = -1,
result = true,
seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
stack.set(array, other);
stack.set(other, array);
// Ignore non-index properties.
while (++index < arrLength) {
var arrValue = array[index],
othValue = other[index];
if (customizer) {
var compared = isPartial
? customizer(othValue, arrValue, index, other, array, stack)
: customizer(arrValue, othValue, index, array, other, stack);
}
if (compared !== undefined) {
if (compared) {
continue;
}
result = false;
break;
}
// Recursively compare arrays (susceptible to call stack limits).
if (seen) {
if (!arraySome(other, function(othValue, othIndex) {
if (!cacheHas(seen, othIndex) &&
(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
return seen.push(othIndex);
}
})) {
result = false;
break;
}
} else if (!(
arrValue === othValue ||
equalFunc(arrValue, othValue, bitmask, customizer, stack)
)) {
result = false;
break;
}
}
stack['delete'](array);
stack['delete'](other);
return result;
}
/**
* A specialized version of `baseIsEqualDeep` for comparing objects of
* the same `toStringTag`.
*
* **Note:** This function only supports comparing values with tags of
* `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {string} tag The `toStringTag` of the objects to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
switch (tag) {
case dataViewTag:
if ((object.byteLength != other.byteLength) ||
(object.byteOffset != other.byteOffset)) {
return false;
}
object = object.buffer;
other = other.buffer;
case arrayBufferTag:
if ((object.byteLength != other.byteLength) ||
!equalFunc(new Uint8Array(object), new Uint8Array(other))) {
return false;
}
return true;
case boolTag:
case dateTag:
case numberTag:
// Coerce booleans to `1` or `0` and dates to milliseconds.
// Invalid dates are coerced to `NaN`.
return eq(+object, +other);
case errorTag:
return object.name == other.name && object.message == other.message;
case regexpTag:
case stringTag:
// Coerce regexes to strings and treat strings, primitives and objects,
// as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
// for more details.
return object == (other + '');
case mapTag:
var convert = mapToArray;
case setTag:
var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
convert || (convert = setToArray);
if (object.size != other.size && !isPartial) {
return false;
}
// Assume cyclic values are equal.
var stacked = stack.get(object);
if (stacked) {
return stacked == other;
}
bitmask |= COMPARE_UNORDERED_FLAG;
// Recursively compare objects (susceptible to call stack limits).
stack.set(object, other);
var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
stack['delete'](object);
return result;
case symbolTag:
if (symbolValueOf) {
return symbolValueOf.call(object) == symbolValueOf.call(other);
}
}
return false;
}
/**
* A specialized version of `baseIsEqualDeep` for objects with support for
* partial deep comparisons.
*
* @private
* @param {Object} object The object to compare.
* @param {Object} other The other object to compare.
* @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
* @param {Function} customizer The function to customize comparisons.
* @param {Function} equalFunc The function to determine equivalents of values.
* @param {Object} stack Tracks traversed `object` and `other` objects.
* @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
*/
function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
objProps = getAllKeys(object),
objLength = objProps.length,
othProps = getAllKeys(other),
othLength = othProps.length;
if (objLength != othLength && !isPartial) {
return false;
}
var index = objLength;
while (index--) {
var key = objProps[index];
if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
return false;
}
}
// Check that cyclic values are equal.
var objStacked = stack.get(object);
var othStacked = stack.get(other);
if (objStacked && othStacked) {
return objStacked == other && othStacked == object;
}
var result = true;
stack.set(object, other);
stack.set(other, object);
var skipCtor = isPartial;
while (++index < objLength) {
key = objProps[index];
var objValue = object[key],
othValue = other[key];
if (customizer) {
var compared = isPartial
? customizer(othValue, objValue, key, other, object, stack)
: customizer(objValue, othValue, key, object, other, stack);
}
// Recursively compare objects (susceptible to call stack limits).
if (!(compared === undefined
? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
: compared
)) {
result = false;
break;
}
skipCtor || (skipCtor = key == 'constructor');
}
if (result && !skipCtor) {
var objCtor = object.constructor,
othCtor = other.constructor;
// Non `Object` object instances with different constructors are not equal.
if (objCtor != othCtor &&
('constructor' in object && 'constructor' in other) &&
!(typeof objCtor == 'function' && objCtor instanceof objCtor &&
typeof othCtor == 'function' && othCtor instanceof othCtor)) {
result = false;
}
}
stack['delete'](object);
stack['delete'](other);
return result;
}
/**
* A specialized version of `baseRest` which flattens the rest array.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @returns {Function} Returns the new function.
*/
function flatRest(func) {
return setToString(overRest(func, undefined, flatten), func + '');
}
/**
* Creates an array of own enumerable property names and symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names and symbols.
*/
function getAllKeys(object) {
return baseGetAllKeys(object, keys, getSymbols);
}
/**
* Creates an array of own and inherited enumerable property names and
* symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names and symbols.
*/
function getAllKeysIn(object) {
return baseGetAllKeys(object, keysIn, getSymbolsIn);
}
/**
* Gets metadata for `func`.
*
* @private
* @param {Function} func The function to query.
* @returns {*} Returns the metadata for `func`.
*/
var getData = !metaMap ? noop : function(func) {
return metaMap.get(func);
};
/**
* Gets the name of `func`.
*
* @private
* @param {Function} func The function to query.
* @returns {string} Returns the function name.
*/
function getFuncName(func) {
var result = (func.name + ''),
array = realNames[result],
length = hasOwnProperty.call(realNames, result) ? array.length : 0;
while (length--) {
var data = array[length],
otherFunc = data.func;
if (otherFunc == null || otherFunc == func) {
return data.name;
}
}
return result;
}
/**
* Gets the argument placeholder value for `func`.
*
* @private
* @param {Function} func The function to inspect.
* @returns {*} Returns the placeholder value.
*/
function getHolder(func) {
var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
return object.placeholder;
}
/**
* Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
* this function returns the custom method, otherwise it returns `baseIteratee`.
* If arguments are provided, the chosen function is invoked with them and
* its result is returned.
*
* @private
* @param {*} [value] The value to convert to an iteratee.
* @param {number} [arity] The arity of the created iteratee.
* @returns {Function} Returns the chosen function or its result.
*/
function getIteratee() {
var result = lodash.iteratee || iteratee;
result = result === iteratee ? baseIteratee : result;
return arguments.length ? result(arguments[0], arguments[1]) : result;
}
/**
* Gets the data for `map`.
*
* @private
* @param {Object} map The map to query.
* @param {string} key The reference key.
* @returns {*} Returns the map data.
*/
function getMapData(map, key) {
var data = map.__data__;
return isKeyable(key)
? data[typeof key == 'string' ? 'string' : 'hash']
: data.map;
}
/**
* Gets the property names, values, and compare flags of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the match data of `object`.
*/
function getMatchData(object) {
var result = keys(object),
length = result.length;
while (length--) {
var key = result[length],
value = object[key];
result[length] = [key, value, isStrictComparable(value)];
}
return result;
}
/**
* Gets the native function at `key` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the method to get.
* @returns {*} Returns the function if it's native, else `undefined`.
*/
function getNative(object, key) {
var value = getValue(object, key);
return baseIsNative(value) ? value : undefined;
}
/**
* A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the raw `toStringTag`.
*/
function getRawTag(value) {
var isOwn = hasOwnProperty.call(value, symToStringTag),
tag = value[symToStringTag];
try {
value[symToStringTag] = undefined;
var unmasked = true;
} catch (e) {}
var result = nativeObjectToString.call(value);
if (unmasked) {
if (isOwn) {
value[symToStringTag] = tag;
} else {
delete value[symToStringTag];
}
}
return result;
}
/**
* Creates an array of the own enumerable symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of symbols.
*/
var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
if (object == null) {
return [];
}
object = Object(object);
return arrayFilter(nativeGetSymbols(object), function(symbol) {
return propertyIsEnumerable.call(object, symbol);
});
};
/**
* Creates an array of the own and inherited enumerable symbols of `object`.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of symbols.
*/
var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
var result = [];
while (object) {
arrayPush(result, getSymbols(object));
object = getPrototype(object);
}
return result;
};
/**
* Gets the `toStringTag` of `value`.
*
* @private
* @param {*} value The value to query.
* @returns {string} Returns the `toStringTag`.
*/
var getTag = baseGetTag;
// Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
(Map && getTag(new Map) != mapTag) ||
(Promise && getTag(Promise.resolve()) != promiseTag) ||
(Set && getTag(new Set) != setTag) ||
(WeakMap && getTag(new WeakMap) != weakMapTag)) {
getTag = function(value) {
var result = baseGetTag(value),
Ctor = result == objectTag ? value.constructor : undefined,
ctorString = Ctor ? toSource(Ctor) : '';
if (ctorString) {
switch (ctorString) {
case dataViewCtorString: return dataViewTag;
case mapCtorString: return mapTag;
case promiseCtorString: return promiseTag;
case setCtorString: return setTag;
case weakMapCtorString: return weakMapTag;
}
}
return result;
};
}
/**
* Gets the view, applying any `transforms` to the `start` and `end` positions.
*
* @private
* @param {number} start The start of the view.
* @param {number} end The end of the view.
* @param {Array} transforms The transformations to apply to the view.
* @returns {Object} Returns an object containing the `start` and `end`
* positions of the view.
*/
function getView(start, end, transforms) {
var index = -1,
length = transforms.length;
while (++index < length) {
var data = transforms[index],
size = data.size;
switch (data.type) {
case 'drop': start += size; break;
case 'dropRight': end -= size; break;
case 'take': end = nativeMin(end, start + size); break;
case 'takeRight': start = nativeMax(start, end - size); break;
}
}
return { 'start': start, 'end': end };
}
/**
* Extracts wrapper details from the `source` body comment.
*
* @private
* @param {string} source The source to inspect.
* @returns {Array} Returns the wrapper details.
*/
function getWrapDetails(source) {
var match = source.match(reWrapDetails);
return match ? match[1].split(reSplitDetails) : [];
}
/**
* Checks if `path` exists on `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @param {Function} hasFunc The function to check properties.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
*/
function hasPath(object, path, hasFunc) {
path = castPath(path, object);
var index = -1,
length = path.length,
result = false;
while (++index < length) {
var key = toKey(path[index]);
if (!(result = object != null && hasFunc(object, key))) {
break;
}
object = object[key];
}
if (result || ++index != length) {
return result;
}
length = object == null ? 0 : object.length;
return !!length && isLength(length) && isIndex(key, length) &&
(isArray(object) || isArguments(object));
}
/**
* Initializes an array clone.
*
* @private
* @param {Array} array The array to clone.
* @returns {Array} Returns the initialized clone.
*/
function initCloneArray(array) {
var length = array.length,
result = new array.constructor(length);
// Add properties assigned by `RegExp#exec`.
if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
result.index = array.index;
result.input = array.input;
}
return result;
}
/**
* Initializes an object clone.
*
* @private
* @param {Object} object The object to clone.
* @returns {Object} Returns the initialized clone.
*/
function initCloneObject(object) {
return (typeof object.constructor == 'function' && !isPrototype(object))
? baseCreate(getPrototype(object))
: {};
}
/**
* Initializes an object clone based on its `toStringTag`.
*
* **Note:** This function only supports cloning values with tags of
* `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
*
* @private
* @param {Object} object The object to clone.
* @param {string} tag The `toStringTag` of the object to clone.
* @param {boolean} [isDeep] Specify a deep clone.
* @returns {Object} Returns the initialized clone.
*/
function initCloneByTag(object, tag, isDeep) {
var Ctor = object.constructor;
switch (tag) {
case arrayBufferTag:
return cloneArrayBuffer(object);
case boolTag:
case dateTag:
return new Ctor(+object);
case dataViewTag:
return cloneDataView(object, isDeep);
case float32Tag: case float64Tag:
case int8Tag: case int16Tag: case int32Tag:
case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
return cloneTypedArray(object, isDeep);
case mapTag:
return new Ctor;
case numberTag:
case stringTag:
return new Ctor(object);
case regexpTag:
return cloneRegExp(object);
case setTag:
return new Ctor;
case symbolTag:
return cloneSymbol(object);
}
}
/**
* Inserts wrapper `details` in a comment at the top of the `source` body.
*
* @private
* @param {string} source The source to modify.
* @returns {Array} details The details to insert.
* @returns {string} Returns the modified source.
*/
function insertWrapDetails(source, details) {
var length = details.length;
if (!length) {
return source;
}
var lastIndex = length - 1;
details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
details = details.join(length > 2 ? ', ' : ' ');
return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
}
/**
* Checks if `value` is a flattenable `arguments` object or array.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
*/
function isFlattenable(value) {
return isArray(value) || isArguments(value) ||
!!(spreadableSymbol && value && value[spreadableSymbol]);
}
/**
* Checks if `value` is a valid array-like index.
*
* @private
* @param {*} value The value to check.
* @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
* @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
*/
function isIndex(value, length) {
var type = typeof value;
length = length == null ? MAX_SAFE_INTEGER : length;
return !!length &&
(type == 'number' ||
(type != 'symbol' && reIsUint.test(value))) &&
(value > -1 && value % 1 == 0 && value < length);
}
/**
* Checks if the given arguments are from an iteratee call.
*
* @private
* @param {*} value The potential iteratee value argument.
* @param {*} index The potential iteratee index or key argument.
* @param {*} object The potential iteratee object argument.
* @returns {boolean} Returns `true` if the arguments are from an iteratee call,
* else `false`.
*/
function isIterateeCall(value, index, object) {
if (!isObject(object)) {
return false;
}
var type = typeof index;
if (type == 'number'
? (isArrayLike(object) && isIndex(index, object.length))
: (type == 'string' && index in object)
) {
return eq(object[index], value);
}
return false;
}
/**
* Checks if `value` is a property name and not a property path.
*
* @private
* @param {*} value The value to check.
* @param {Object} [object] The object to query keys on.
* @returns {boolean} Returns `true` if `value` is a property name, else `false`.
*/
function isKey(value, object) {
if (isArray(value)) {
return false;
}
var type = typeof value;
if (type == 'number' || type == 'symbol' || type == 'boolean' ||
value == null || isSymbol(value)) {
return true;
}
return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
(object != null && value in Object(object));
}
/**
* Checks if `value` is suitable for use as unique object key.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is suitable, else `false`.
*/
function isKeyable(value) {
var type = typeof value;
return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
? (value !== '__proto__')
: (value === null);
}
/**
* Checks if `func` has a lazy counterpart.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` has a lazy counterpart,
* else `false`.
*/
function isLaziable(func) {
var funcName = getFuncName(func),
other = lodash[funcName];
if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
return false;
}
if (func === other) {
return true;
}
var data = getData(other);
return !!data && func === data[0];
}
/**
* Checks if `func` has its source masked.
*
* @private
* @param {Function} func The function to check.
* @returns {boolean} Returns `true` if `func` is masked, else `false`.
*/
function isMasked(func) {
return !!maskSrcKey && (maskSrcKey in func);
}
/**
* Checks if `func` is capable of being masked.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `func` is maskable, else `false`.
*/
var isMaskable = coreJsData ? isFunction : stubFalse;
/**
* Checks if `value` is likely a prototype object.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
*/
function isPrototype(value) {
var Ctor = value && value.constructor,
proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
return value === proto;
}
/**
* Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
*
* @private
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` if suitable for strict
* equality comparisons, else `false`.
*/
function isStrictComparable(value) {
return value === value && !isObject(value);
}
/**
* A specialized version of `matchesProperty` for source values suitable
* for strict equality comparisons, i.e. `===`.
*
* @private
* @param {string} key The key of the property to get.
* @param {*} srcValue The value to match.
* @returns {Function} Returns the new spec function.
*/
function matchesStrictComparable(key, srcValue) {
return function(object) {
if (object == null) {
return false;
}
return object[key] === srcValue &&
(srcValue !== undefined || (key in Object(object)));
};
}
/**
* A specialized version of `_.memoize` which clears the memoized function's
* cache when it exceeds `MAX_MEMOIZE_SIZE`.
*
* @private
* @param {Function} func The function to have its output memoized.
* @returns {Function} Returns the new memoized function.
*/
function memoizeCapped(func) {
var result = memoize(func, function(key) {
if (cache.size === MAX_MEMOIZE_SIZE) {
cache.clear();
}
return key;
});
var cache = result.cache;
return result;
}
/**
* Merges the function metadata of `source` into `data`.
*
* Merging metadata reduces the number of wrappers used to invoke a function.
* This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
* may be applied regardless of execution order. Methods like `_.ary` and
* `_.rearg` modify function arguments, making the order in which they are
* executed important, preventing the merging of metadata. However, we make
* an exception for a safe combined case where curried functions have `_.ary`
* and or `_.rearg` applied.
*
* @private
* @param {Array} data The destination metadata.
* @param {Array} source The source metadata.
* @returns {Array} Returns `data`.
*/
function mergeData(data, source) {
var bitmask = data[1],
srcBitmask = source[1],
newBitmask = bitmask | srcBitmask,
isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
var isCombo =
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
// Exit early if metadata can't be merged.
if (!(isCommon || isCombo)) {
return data;
}
// Use source `thisArg` if available.
if (srcBitmask & WRAP_BIND_FLAG) {
data[2] = source[2];
// Set when currying a bound function.
newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
}
// Compose partial arguments.
var value = source[3];
if (value) {
var partials = data[3];
data[3] = partials ? composeArgs(partials, value, source[4]) : value;
data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
}
// Compose partial right arguments.
value = source[5];
if (value) {
partials = data[5];
data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
}
// Use source `argPos` if available.
value = source[7];
if (value) {
data[7] = value;
}
// Use source `ary` if it's smaller.
if (srcBitmask & WRAP_ARY_FLAG) {
data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
}
// Use source `arity` if one is not provided.
if (data[9] == null) {
data[9] = source[9];
}
// Use source `func` and merge bitmasks.
data[0] = source[0];
data[1] = newBitmask;
return data;
}
/**
* This function is like
* [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
* except that it includes inherited enumerable properties.
*
* @private
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
*/
function nativeKeysIn(object) {
var result = [];
if (object != null) {
for (var key in Object(object)) {
result.push(key);
}
}
return result;
}
/**
* Converts `value` to a string using `Object.prototype.toString`.
*
* @private
* @param {*} value The value to convert.
* @returns {string} Returns the converted string.
*/
function objectToString(value) {
return nativeObjectToString.call(value);
}
/**
* A specialized version of `baseRest` which transforms the rest array.
*
* @private
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @param {Function} transform The rest array transform.
* @returns {Function} Returns the new function.
*/
function overRest(func, start, transform) {
start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
return function() {
var args = arguments,
index = -1,
length = nativeMax(args.length - start, 0),
array = Array(length);
while (++index < length) {
array[index] = args[start + index];
}
index = -1;
var otherArgs = Array(start + 1);
while (++index < start) {
otherArgs[index] = args[index];
}
otherArgs[start] = transform(array);
return apply(func, this, otherArgs);
};
}
/**
* Gets the parent value at `path` of `object`.
*
* @private
* @param {Object} object The object to query.
* @param {Array} path The path to get the parent value of.
* @returns {*} Returns the parent value.
*/
function parent(object, path) {
return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
}
/**
* Reorder `array` according to the specified indexes where the element at
* the first index is assigned as the first element, the element at
* the second index is assigned as the second element, and so on.
*
* @private
* @param {Array} array The array to reorder.
* @param {Array} indexes The arranged array indexes.
* @returns {Array} Returns `array`.
*/
function reorder(array, indexes) {
var arrLength = array.length,
length = nativeMin(indexes.length, arrLength),
oldArray = copyArray(array);
while (length--) {
var index = indexes[length];
array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
}
return array;
}
/**
* Gets the value at `key`, unless `key` is "__proto__" or "constructor".
*
* @private
* @param {Object} object The object to query.
* @param {string} key The key of the property to get.
* @returns {*} Returns the property value.
*/
function safeGet(object, key) {
if (key === 'constructor' && typeof object[key] === 'function') {
return;
}
if (key == '__proto__') {
return;
}
return object[key];
}
/**
* Sets metadata for `func`.
*
* **Note:** If this function becomes hot, i.e. is invoked a lot in a short
* period of time, it will trip its breaker and transition to an identity
* function to avoid garbage collection pauses in V8. See
* [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
* for more details.
*
* @private
* @param {Function} func The function to associate metadata with.
* @param {*} data The metadata.
* @returns {Function} Returns `func`.
*/
var setData = shortOut(baseSetData);
/**
* A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
*
* @private
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @returns {number|Object} Returns the timer id or timeout object.
*/
var setTimeout = ctxSetTimeout || function(func, wait) {
return root.setTimeout(func, wait);
};
/**
* Sets the `toString` method of `func` to return `string`.
*
* @private
* @param {Function} func The function to modify.
* @param {Function} string The `toString` result.
* @returns {Function} Returns `func`.
*/
var setToString = shortOut(baseSetToString);
/**
* Sets the `toString` method of `wrapper` to mimic the source of `reference`
* with wrapper details in a comment at the top of the source body.
*
* @private
* @param {Function} wrapper The function to modify.
* @param {Function} reference The reference function.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @returns {Function} Returns `wrapper`.
*/
function setWrapToString(wrapper, reference, bitmask) {
var source = (reference + '');
return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
}
/**
* Creates a function that'll short out and invoke `identity` instead
* of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
* milliseconds.
*
* @private
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new shortable function.
*/
function shortOut(func) {
var count = 0,
lastCalled = 0;
return function() {
var stamp = nativeNow(),
remaining = HOT_SPAN - (stamp - lastCalled);
lastCalled = stamp;
if (remaining > 0) {
if (++count >= HOT_COUNT) {
return arguments[0];
}
} else {
count = 0;
}
return func.apply(undefined, arguments);
};
}
/**
* A specialized version of `_.shuffle` which mutates and sets the size of `array`.
*
* @private
* @param {Array} array The array to shuffle.
* @param {number} [size=array.length] The size of `array`.
* @returns {Array} Returns `array`.
*/
function shuffleSelf(array, size) {
var index = -1,
length = array.length,
lastIndex = length - 1;
size = size === undefined ? length : size;
while (++index < size) {
var rand = baseRandom(index, lastIndex),
value = array[rand];
array[rand] = array[index];
array[index] = value;
}
array.length = size;
return array;
}
/**
* Converts `string` to a property path array.
*
* @private
* @param {string} string The string to convert.
* @returns {Array} Returns the property path array.
*/
var stringToPath = memoizeCapped(function(string) {
var result = [];
if (string.charCodeAt(0) === 46 /* . */) {
result.push('');
}
string.replace(rePropName, function(match, number, quote, subString) {
result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));
});
return result;
});
/**
* Converts `value` to a string key if it's not a string or symbol.
*
* @private
* @param {*} value The value to inspect.
* @returns {string|symbol} Returns the key.
*/
function toKey(value) {
if (typeof value == 'string' || isSymbol(value)) {
return value;
}
var result = (value + '');
return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
}
/**
* Converts `func` to its source code.
*
* @private
* @param {Function} func The function to convert.
* @returns {string} Returns the source code.
*/
function toSource(func) {
if (func != null) {
try {
return funcToString.call(func);
} catch (e) {}
try {
return (func + '');
} catch (e) {}
}
return '';
}
/**
* Updates wrapper `details` based on `bitmask` flags.
*
* @private
* @returns {Array} details The details to modify.
* @param {number} bitmask The bitmask flags. See `createWrap` for more details.
* @returns {Array} Returns `details`.
*/
function updateWrapDetails(details, bitmask) {
arrayEach(wrapFlags, function(pair) {
var value = '_.' + pair[0];
if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
details.push(value);
}
});
return details.sort();
}
/**
* Creates a clone of `wrapper`.
*
* @private
* @param {Object} wrapper The wrapper to clone.
* @returns {Object} Returns the cloned wrapper.
*/
function wrapperClone(wrapper) {
if (wrapper instanceof LazyWrapper) {
return wrapper.clone();
}
var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
result.__actions__ = copyArray(wrapper.__actions__);
result.__index__ = wrapper.__index__;
result.__values__ = wrapper.__values__;
return result;
}
/*------------------------------------------------------------------------*/
/**
* Creates an array of elements split into groups the length of `size`.
* If `array` can't be split evenly, the final chunk will be the remaining
* elements.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to process.
* @param {number} [size=1] The length of each chunk
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the new array of chunks.
* @example
*
* _.chunk(['a', 'b', 'c', 'd'], 2);
* // => [['a', 'b'], ['c', 'd']]
*
* _.chunk(['a', 'b', 'c', 'd'], 3);
* // => [['a', 'b', 'c'], ['d']]
*/
function chunk(array, size, guard) {
if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
size = 1;
} else {
size = nativeMax(toInteger(size), 0);
}
var length = array == null ? 0 : array.length;
if (!length || size < 1) {
return [];
}
var index = 0,
resIndex = 0,
result = Array(nativeCeil(length / size));
while (index < length) {
result[resIndex++] = baseSlice(array, index, (index += size));
}
return result;
}
/**
* Creates an array with all falsey values removed. The values `false`, `null`,
* `0`, `""`, `undefined`, and `NaN` are falsey.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to compact.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.compact([0, 1, false, 2, '', 3]);
* // => [1, 2, 3]
*/
function compact(array) {
var index = -1,
length = array == null ? 0 : array.length,
resIndex = 0,
result = [];
while (++index < length) {
var value = array[index];
if (value) {
result[resIndex++] = value;
}
}
return result;
}
/**
* Creates a new array concatenating `array` with any additional arrays
* and/or values.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to concatenate.
* @param {...*} [values] The values to concatenate.
* @returns {Array} Returns the new concatenated array.
* @example
*
* var array = [1];
* var other = _.concat(array, 2, [3], [[4]]);
*
* console.log(other);
* // => [1, 2, 3, [4]]
*
* console.log(array);
* // => [1]
*/
function concat() {
var length = arguments.length;
if (!length) {
return [];
}
var args = Array(length - 1),
array = arguments[0],
index = length;
while (index--) {
args[index - 1] = arguments[index];
}
return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
}
/**
* Creates an array of `array` values not included in the other given arrays
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. The order and references of result values are
* determined by the first array.
*
* **Note:** Unlike `_.pullAll`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @returns {Array} Returns the new array of filtered values.
* @see _.without, _.xor
* @example
*
* _.difference([2, 1], [2, 3]);
* // => [1]
*/
var difference = baseRest(function(array, values) {
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
: [];
});
/**
* This method is like `_.difference` except that it accepts `iteratee` which
* is invoked for each element of `array` and `values` to generate the criterion
* by which they're compared. The order and references of result values are
* determined by the first array. The iteratee is invoked with one argument:
* (value).
*
* **Note:** Unlike `_.pullAllBy`, this method returns a new array.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [1.2]
*
* // The `_.property` iteratee shorthand.
* _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
* // => [{ 'x': 2 }]
*/
var differenceBy = baseRest(function(array, values) {
var iteratee = last(values);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
: [];
});
/**
* This method is like `_.difference` except that it accepts `comparator`
* which is invoked to compare elements of `array` to `values`. The order and
* references of result values are determined by the first array. The comparator
* is invoked with two arguments: (arrVal, othVal).
*
* **Note:** Unlike `_.pullAllWith`, this method returns a new array.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...Array} [values] The values to exclude.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
*
* _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
* // => [{ 'x': 2, 'y': 1 }]
*/
var differenceWith = baseRest(function(array, values) {
var comparator = last(values);
if (isArrayLikeObject(comparator)) {
comparator = undefined;
}
return isArrayLikeObject(array)
? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
: [];
});
/**
* Creates a slice of `array` with `n` elements dropped from the beginning.
*
* @static
* @memberOf _
* @since 0.5.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to drop.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.drop([1, 2, 3]);
* // => [2, 3]
*
* _.drop([1, 2, 3], 2);
* // => [3]
*
* _.drop([1, 2, 3], 5);
* // => []
*
* _.drop([1, 2, 3], 0);
* // => [1, 2, 3]
*/
function drop(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
return baseSlice(array, n < 0 ? 0 : n, length);
}
/**
* Creates a slice of `array` with `n` elements dropped from the end.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to drop.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.dropRight([1, 2, 3]);
* // => [1, 2]
*
* _.dropRight([1, 2, 3], 2);
* // => [1]
*
* _.dropRight([1, 2, 3], 5);
* // => []
*
* _.dropRight([1, 2, 3], 0);
* // => [1, 2, 3]
*/
function dropRight(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
n = length - n;
return baseSlice(array, 0, n < 0 ? 0 : n);
}
/**
* Creates a slice of `array` excluding elements dropped from the end.
* Elements are dropped until `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.dropRightWhile(users, function(o) { return !o.active; });
* // => objects for ['barney']
*
* // The `_.matches` iteratee shorthand.
* _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
* // => objects for ['barney', 'fred']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.dropRightWhile(users, ['active', false]);
* // => objects for ['barney']
*
* // The `_.property` iteratee shorthand.
* _.dropRightWhile(users, 'active');
* // => objects for ['barney', 'fred', 'pebbles']
*/
function dropRightWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), true, true)
: [];
}
/**
* Creates a slice of `array` excluding elements dropped from the beginning.
* Elements are dropped until `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.dropWhile(users, function(o) { return !o.active; });
* // => objects for ['pebbles']
*
* // The `_.matches` iteratee shorthand.
* _.dropWhile(users, { 'user': 'barney', 'active': false });
* // => objects for ['fred', 'pebbles']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.dropWhile(users, ['active', false]);
* // => objects for ['pebbles']
*
* // The `_.property` iteratee shorthand.
* _.dropWhile(users, 'active');
* // => objects for ['barney', 'fred', 'pebbles']
*/
function dropWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), true)
: [];
}
/**
* Fills elements of `array` with `value` from `start` up to, but not
* including, `end`.
*
* **Note:** This method mutates `array`.
*
* @static
* @memberOf _
* @since 3.2.0
* @category Array
* @param {Array} array The array to fill.
* @param {*} value The value to fill `array` with.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns `array`.
* @example
*
* var array = [1, 2, 3];
*
* _.fill(array, 'a');
* console.log(array);
* // => ['a', 'a', 'a']
*
* _.fill(Array(3), 2);
* // => [2, 2, 2]
*
* _.fill([4, 6, 8, 10], '*', 1, 3);
* // => [4, '*', '*', 10]
*/
function fill(array, value, start, end) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
start = 0;
end = length;
}
return baseFill(array, value, start, end);
}
/**
* This method is like `_.find` except that it returns the index of the first
* element `predicate` returns truthy for instead of the element itself.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=0] The index to search from.
* @returns {number} Returns the index of the found element, else `-1`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.findIndex(users, function(o) { return o.user == 'barney'; });
* // => 0
*
* // The `_.matches` iteratee shorthand.
* _.findIndex(users, { 'user': 'fred', 'active': false });
* // => 1
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findIndex(users, ['active', false]);
* // => 0
*
* // The `_.property` iteratee shorthand.
* _.findIndex(users, 'active');
* // => 2
*/
function findIndex(array, predicate, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = fromIndex == null ? 0 : toInteger(fromIndex);
if (index < 0) {
index = nativeMax(length + index, 0);
}
return baseFindIndex(array, getIteratee(predicate, 3), index);
}
/**
* This method is like `_.findIndex` except that it iterates over elements
* of `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=array.length-1] The index to search from.
* @returns {number} Returns the index of the found element, else `-1`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
* // => 2
*
* // The `_.matches` iteratee shorthand.
* _.findLastIndex(users, { 'user': 'barney', 'active': true });
* // => 0
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findLastIndex(users, ['active', false]);
* // => 2
*
* // The `_.property` iteratee shorthand.
* _.findLastIndex(users, 'active');
* // => 0
*/
function findLastIndex(array, predicate, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = length - 1;
if (fromIndex !== undefined) {
index = toInteger(fromIndex);
index = fromIndex < 0
? nativeMax(length + index, 0)
: nativeMin(index, length - 1);
}
return baseFindIndex(array, getIteratee(predicate, 3), index, true);
}
/**
* Flattens `array` a single level deep.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to flatten.
* @returns {Array} Returns the new flattened array.
* @example
*
* _.flatten([1, [2, [3, [4]], 5]]);
* // => [1, 2, [3, [4]], 5]
*/
function flatten(array) {
var length = array == null ? 0 : array.length;
return length ? baseFlatten(array, 1) : [];
}
/**
* Recursively flattens `array`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to flatten.
* @returns {Array} Returns the new flattened array.
* @example
*
* _.flattenDeep([1, [2, [3, [4]], 5]]);
* // => [1, 2, 3, 4, 5]
*/
function flattenDeep(array) {
var length = array == null ? 0 : array.length;
return length ? baseFlatten(array, INFINITY) : [];
}
/**
* Recursively flatten `array` up to `depth` times.
*
* @static
* @memberOf _
* @since 4.4.0
* @category Array
* @param {Array} array The array to flatten.
* @param {number} [depth=1] The maximum recursion depth.
* @returns {Array} Returns the new flattened array.
* @example
*
* var array = [1, [2, [3, [4]], 5]];
*
* _.flattenDepth(array, 1);
* // => [1, 2, [3, [4]], 5]
*
* _.flattenDepth(array, 2);
* // => [1, 2, 3, [4], 5]
*/
function flattenDepth(array, depth) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
depth = depth === undefined ? 1 : toInteger(depth);
return baseFlatten(array, depth);
}
/**
* The inverse of `_.toPairs`; this method returns an object composed
* from key-value `pairs`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} pairs The key-value pairs.
* @returns {Object} Returns the new object.
* @example
*
* _.fromPairs([['a', 1], ['b', 2]]);
* // => { 'a': 1, 'b': 2 }
*/
function fromPairs(pairs) {
var index = -1,
length = pairs == null ? 0 : pairs.length,
result = {};
while (++index < length) {
var pair = pairs[index];
result[pair[0]] = pair[1];
}
return result;
}
/**
* Gets the first element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @alias first
* @category Array
* @param {Array} array The array to query.
* @returns {*} Returns the first element of `array`.
* @example
*
* _.head([1, 2, 3]);
* // => 1
*
* _.head([]);
* // => undefined
*/
function head(array) {
return (array && array.length) ? array[0] : undefined;
}
/**
* Gets the index at which the first occurrence of `value` is found in `array`
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. If `fromIndex` is negative, it's used as the
* offset from the end of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=0] The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.indexOf([1, 2, 1, 2], 2);
* // => 1
*
* // Search from the `fromIndex`.
* _.indexOf([1, 2, 1, 2], 2, 2);
* // => 3
*/
function indexOf(array, value, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = fromIndex == null ? 0 : toInteger(fromIndex);
if (index < 0) {
index = nativeMax(length + index, 0);
}
return baseIndexOf(array, value, index);
}
/**
* Gets all but the last element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.initial([1, 2, 3]);
* // => [1, 2]
*/
function initial(array) {
var length = array == null ? 0 : array.length;
return length ? baseSlice(array, 0, -1) : [];
}
/**
* Creates an array of unique values that are included in all given arrays
* using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons. The order and references of result values are
* determined by the first array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* _.intersection([2, 1], [2, 3]);
* // => [2]
*/
var intersection = baseRest(function(arrays) {
var mapped = arrayMap(arrays, castArrayLikeObject);
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped)
: [];
});
/**
* This method is like `_.intersection` except that it accepts `iteratee`
* which is invoked for each element of each `arrays` to generate the criterion
* by which they're compared. The order and references of result values are
* determined by the first array. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [2.1]
*
* // The `_.property` iteratee shorthand.
* _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }]
*/
var intersectionBy = baseRest(function(arrays) {
var iteratee = last(arrays),
mapped = arrayMap(arrays, castArrayLikeObject);
if (iteratee === last(mapped)) {
iteratee = undefined;
} else {
mapped.pop();
}
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped, getIteratee(iteratee, 2))
: [];
});
/**
* This method is like `_.intersection` except that it accepts `comparator`
* which is invoked to compare elements of `arrays`. The order and references
* of result values are determined by the first array. The comparator is
* invoked with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of intersecting values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.intersectionWith(objects, others, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }]
*/
var intersectionWith = baseRest(function(arrays) {
var comparator = last(arrays),
mapped = arrayMap(arrays, castArrayLikeObject);
comparator = typeof comparator == 'function' ? comparator : undefined;
if (comparator) {
mapped.pop();
}
return (mapped.length && mapped[0] === arrays[0])
? baseIntersection(mapped, undefined, comparator)
: [];
});
/**
* Converts all elements in `array` into a string separated by `separator`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to convert.
* @param {string} [separator=','] The element separator.
* @returns {string} Returns the joined string.
* @example
*
* _.join(['a', 'b', 'c'], '~');
* // => 'a~b~c'
*/
function join(array, separator) {
return array == null ? '' : nativeJoin.call(array, separator);
}
/**
* Gets the last element of `array`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @returns {*} Returns the last element of `array`.
* @example
*
* _.last([1, 2, 3]);
* // => 3
*/
function last(array) {
var length = array == null ? 0 : array.length;
return length ? array[length - 1] : undefined;
}
/**
* This method is like `_.indexOf` except that it iterates over elements of
* `array` from right to left.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=array.length-1] The index to search from.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.lastIndexOf([1, 2, 1, 2], 2);
* // => 3
*
* // Search from the `fromIndex`.
* _.lastIndexOf([1, 2, 1, 2], 2, 2);
* // => 1
*/
function lastIndexOf(array, value, fromIndex) {
var length = array == null ? 0 : array.length;
if (!length) {
return -1;
}
var index = length;
if (fromIndex !== undefined) {
index = toInteger(fromIndex);
index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
}
return value === value
? strictLastIndexOf(array, value, index)
: baseFindIndex(array, baseIsNaN, index, true);
}
/**
* Gets the element at index `n` of `array`. If `n` is negative, the nth
* element from the end is returned.
*
* @static
* @memberOf _
* @since 4.11.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=0] The index of the element to return.
* @returns {*} Returns the nth element of `array`.
* @example
*
* var array = ['a', 'b', 'c', 'd'];
*
* _.nth(array, 1);
* // => 'b'
*
* _.nth(array, -2);
* // => 'c';
*/
function nth(array, n) {
return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
}
/**
* Removes all given values from `array` using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
* to remove elements from an array by predicate.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {...*} [values] The values to remove.
* @returns {Array} Returns `array`.
* @example
*
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
*
* _.pull(array, 'a', 'c');
* console.log(array);
* // => ['b', 'b']
*/
var pull = baseRest(pullAll);
/**
* This method is like `_.pull` except that it accepts an array of values to remove.
*
* **Note:** Unlike `_.difference`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @returns {Array} Returns `array`.
* @example
*
* var array = ['a', 'b', 'c', 'a', 'b', 'c'];
*
* _.pullAll(array, ['a', 'c']);
* console.log(array);
* // => ['b', 'b']
*/
function pullAll(array, values) {
return (array && array.length && values && values.length)
? basePullAll(array, values)
: array;
}
/**
* This method is like `_.pullAll` except that it accepts `iteratee` which is
* invoked for each element of `array` and `values` to generate the criterion
* by which they're compared. The iteratee is invoked with one argument: (value).
*
* **Note:** Unlike `_.differenceBy`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns `array`.
* @example
*
* var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
*
* _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
* console.log(array);
* // => [{ 'x': 2 }]
*/
function pullAllBy(array, values, iteratee) {
return (array && array.length && values && values.length)
? basePullAll(array, values, getIteratee(iteratee, 2))
: array;
}
/**
* This method is like `_.pullAll` except that it accepts `comparator` which
* is invoked to compare elements of `array` to `values`. The comparator is
* invoked with two arguments: (arrVal, othVal).
*
* **Note:** Unlike `_.differenceWith`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Array
* @param {Array} array The array to modify.
* @param {Array} values The values to remove.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns `array`.
* @example
*
* var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
*
* _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
* console.log(array);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
*/
function pullAllWith(array, values, comparator) {
return (array && array.length && values && values.length)
? basePullAll(array, values, undefined, comparator)
: array;
}
/**
* Removes elements from `array` corresponding to `indexes` and returns an
* array of removed elements.
*
* **Note:** Unlike `_.at`, this method mutates `array`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {...(number|number[])} [indexes] The indexes of elements to remove.
* @returns {Array} Returns the new array of removed elements.
* @example
*
* var array = ['a', 'b', 'c', 'd'];
* var pulled = _.pullAt(array, [1, 3]);
*
* console.log(array);
* // => ['a', 'c']
*
* console.log(pulled);
* // => ['b', 'd']
*/
var pullAt = flatRest(function(array, indexes) {
var length = array == null ? 0 : array.length,
result = baseAt(array, indexes);
basePullAt(array, arrayMap(indexes, function(index) {
return isIndex(index, length) ? +index : index;
}).sort(compareAscending));
return result;
});
/**
* Removes all elements from `array` that `predicate` returns truthy for
* and returns an array of the removed elements. The predicate is invoked
* with three arguments: (value, index, array).
*
* **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
* to pull elements from an array by value.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Array
* @param {Array} array The array to modify.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new array of removed elements.
* @example
*
* var array = [1, 2, 3, 4];
* var evens = _.remove(array, function(n) {
* return n % 2 == 0;
* });
*
* console.log(array);
* // => [1, 3]
*
* console.log(evens);
* // => [2, 4]
*/
function remove(array, predicate) {
var result = [];
if (!(array && array.length)) {
return result;
}
var index = -1,
indexes = [],
length = array.length;
predicate = getIteratee(predicate, 3);
while (++index < length) {
var value = array[index];
if (predicate(value, index, array)) {
result.push(value);
indexes.push(index);
}
}
basePullAt(array, indexes);
return result;
}
/**
* Reverses `array` so that the first element becomes the last, the second
* element becomes the second to last, and so on.
*
* **Note:** This method mutates `array` and is based on
* [`Array#reverse`](https://mdn.io/Array/reverse).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to modify.
* @returns {Array} Returns `array`.
* @example
*
* var array = [1, 2, 3];
*
* _.reverse(array);
* // => [3, 2, 1]
*
* console.log(array);
* // => [3, 2, 1]
*/
function reverse(array) {
return array == null ? array : nativeReverse.call(array);
}
/**
* Creates a slice of `array` from `start` up to, but not including, `end`.
*
* **Note:** This method is used instead of
* [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
* returned.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to slice.
* @param {number} [start=0] The start position.
* @param {number} [end=array.length] The end position.
* @returns {Array} Returns the slice of `array`.
*/
function slice(array, start, end) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
start = 0;
end = length;
}
else {
start = start == null ? 0 : toInteger(start);
end = end === undefined ? length : toInteger(end);
}
return baseSlice(array, start, end);
}
/**
* Uses a binary search to determine the lowest index at which `value`
* should be inserted into `array` in order to maintain its sort order.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* _.sortedIndex([30, 50], 40);
* // => 1
*/
function sortedIndex(array, value) {
return baseSortedIndex(array, value);
}
/**
* This method is like `_.sortedIndex` except that it accepts `iteratee`
* which is invoked for `value` and each element of `array` to compute their
* sort ranking. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* var objects = [{ 'x': 4 }, { 'x': 5 }];
*
* _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
* // => 0
*
* // The `_.property` iteratee shorthand.
* _.sortedIndexBy(objects, { 'x': 4 }, 'x');
* // => 0
*/
function sortedIndexBy(array, value, iteratee) {
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
}
/**
* This method is like `_.indexOf` except that it performs a binary
* search on a sorted `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.sortedIndexOf([4, 5, 5, 5, 6], 5);
* // => 1
*/
function sortedIndexOf(array, value) {
var length = array == null ? 0 : array.length;
if (length) {
var index = baseSortedIndex(array, value);
if (index < length && eq(array[index], value)) {
return index;
}
}
return -1;
}
/**
* This method is like `_.sortedIndex` except that it returns the highest
* index at which `value` should be inserted into `array` in order to
* maintain its sort order.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* _.sortedLastIndex([4, 5, 5, 5, 6], 5);
* // => 4
*/
function sortedLastIndex(array, value) {
return baseSortedIndex(array, value, true);
}
/**
* This method is like `_.sortedLastIndex` except that it accepts `iteratee`
* which is invoked for `value` and each element of `array` to compute their
* sort ranking. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The sorted array to inspect.
* @param {*} value The value to evaluate.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {number} Returns the index at which `value` should be inserted
* into `array`.
* @example
*
* var objects = [{ 'x': 4 }, { 'x': 5 }];
*
* _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
* // => 1
*
* // The `_.property` iteratee shorthand.
* _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
* // => 1
*/
function sortedLastIndexBy(array, value, iteratee) {
return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
}
/**
* This method is like `_.lastIndexOf` except that it performs a binary
* search on a sorted `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {*} value The value to search for.
* @returns {number} Returns the index of the matched value, else `-1`.
* @example
*
* _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
* // => 3
*/
function sortedLastIndexOf(array, value) {
var length = array == null ? 0 : array.length;
if (length) {
var index = baseSortedIndex(array, value, true) - 1;
if (eq(array[index], value)) {
return index;
}
}
return -1;
}
/**
* This method is like `_.uniq` except that it's designed and optimized
* for sorted arrays.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.sortedUniq([1, 1, 2]);
* // => [1, 2]
*/
function sortedUniq(array) {
return (array && array.length)
? baseSortedUniq(array)
: [];
}
/**
* This method is like `_.uniqBy` except that it's designed and optimized
* for sorted arrays.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [iteratee] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
* // => [1.1, 2.3]
*/
function sortedUniqBy(array, iteratee) {
return (array && array.length)
? baseSortedUniq(array, getIteratee(iteratee, 2))
: [];
}
/**
* Gets all but the first element of `array`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to query.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.tail([1, 2, 3]);
* // => [2, 3]
*/
function tail(array) {
var length = array == null ? 0 : array.length;
return length ? baseSlice(array, 1, length) : [];
}
/**
* Creates a slice of `array` with `n` elements taken from the beginning.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to take.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.take([1, 2, 3]);
* // => [1]
*
* _.take([1, 2, 3], 2);
* // => [1, 2]
*
* _.take([1, 2, 3], 5);
* // => [1, 2, 3]
*
* _.take([1, 2, 3], 0);
* // => []
*/
function take(array, n, guard) {
if (!(array && array.length)) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
return baseSlice(array, 0, n < 0 ? 0 : n);
}
/**
* Creates a slice of `array` with `n` elements taken from the end.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {number} [n=1] The number of elements to take.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the slice of `array`.
* @example
*
* _.takeRight([1, 2, 3]);
* // => [3]
*
* _.takeRight([1, 2, 3], 2);
* // => [2, 3]
*
* _.takeRight([1, 2, 3], 5);
* // => [1, 2, 3]
*
* _.takeRight([1, 2, 3], 0);
* // => []
*/
function takeRight(array, n, guard) {
var length = array == null ? 0 : array.length;
if (!length) {
return [];
}
n = (guard || n === undefined) ? 1 : toInteger(n);
n = length - n;
return baseSlice(array, n < 0 ? 0 : n, length);
}
/**
* Creates a slice of `array` with elements taken from the end. Elements are
* taken until `predicate` returns falsey. The predicate is invoked with
* three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': false }
* ];
*
* _.takeRightWhile(users, function(o) { return !o.active; });
* // => objects for ['fred', 'pebbles']
*
* // The `_.matches` iteratee shorthand.
* _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
* // => objects for ['pebbles']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.takeRightWhile(users, ['active', false]);
* // => objects for ['fred', 'pebbles']
*
* // The `_.property` iteratee shorthand.
* _.takeRightWhile(users, 'active');
* // => []
*/
function takeRightWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3), false, true)
: [];
}
/**
* Creates a slice of `array` with elements taken from the beginning. Elements
* are taken until `predicate` returns falsey. The predicate is invoked with
* three arguments: (value, index, array).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Array
* @param {Array} array The array to query.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the slice of `array`.
* @example
*
* var users = [
* { 'user': 'barney', 'active': false },
* { 'user': 'fred', 'active': false },
* { 'user': 'pebbles', 'active': true }
* ];
*
* _.takeWhile(users, function(o) { return !o.active; });
* // => objects for ['barney', 'fred']
*
* // The `_.matches` iteratee shorthand.
* _.takeWhile(users, { 'user': 'barney', 'active': false });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.takeWhile(users, ['active', false]);
* // => objects for ['barney', 'fred']
*
* // The `_.property` iteratee shorthand.
* _.takeWhile(users, 'active');
* // => []
*/
function takeWhile(array, predicate) {
return (array && array.length)
? baseWhile(array, getIteratee(predicate, 3))
: [];
}
/**
* Creates an array of unique values, in order, from all given arrays using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of combined values.
* @example
*
* _.union([2], [1, 2]);
* // => [2, 1]
*/
var union = baseRest(function(arrays) {
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
});
/**
* This method is like `_.union` except that it accepts `iteratee` which is
* invoked for each element of each `arrays` to generate the criterion by
* which uniqueness is computed. Result values are chosen from the first
* array in which the value occurs. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of combined values.
* @example
*
* _.unionBy([2.1], [1.2, 2.3], Math.floor);
* // => [2.1, 1.2]
*
* // The `_.property` iteratee shorthand.
* _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }, { 'x': 2 }]
*/
var unionBy = baseRest(function(arrays) {
var iteratee = last(arrays);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
});
/**
* This method is like `_.union` except that it accepts `comparator` which
* is invoked to compare elements of `arrays`. Result values are chosen from
* the first array in which the value occurs. The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of combined values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.unionWith(objects, others, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
*/
var unionWith = baseRest(function(arrays) {
var comparator = last(arrays);
comparator = typeof comparator == 'function' ? comparator : undefined;
return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
});
/**
* Creates a duplicate-free version of an array, using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons, in which only the first occurrence of each element
* is kept. The order of result values is determined by the order they occur
* in the array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.uniq([2, 1, 2]);
* // => [2, 1]
*/
function uniq(array) {
return (array && array.length) ? baseUniq(array) : [];
}
/**
* This method is like `_.uniq` except that it accepts `iteratee` which is
* invoked for each element in `array` to generate the criterion by which
* uniqueness is computed. The order of result values is determined by the
* order they occur in the array. The iteratee is invoked with one argument:
* (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* _.uniqBy([2.1, 1.2, 2.3], Math.floor);
* // => [2.1, 1.2]
*
* // The `_.property` iteratee shorthand.
* _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 1 }, { 'x': 2 }]
*/
function uniqBy(array, iteratee) {
return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
}
/**
* This method is like `_.uniq` except that it accepts `comparator` which
* is invoked to compare elements of `array`. The order of result values is
* determined by the order they occur in the array.The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {Array} array The array to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new duplicate free array.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.uniqWith(objects, _.isEqual);
* // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
*/
function uniqWith(array, comparator) {
comparator = typeof comparator == 'function' ? comparator : undefined;
return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
}
/**
* This method is like `_.zip` except that it accepts an array of grouped
* elements and creates an array regrouping the elements to their pre-zip
* configuration.
*
* @static
* @memberOf _
* @since 1.2.0
* @category Array
* @param {Array} array The array of grouped elements to process.
* @returns {Array} Returns the new array of regrouped elements.
* @example
*
* var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
* // => [['a', 1, true], ['b', 2, false]]
*
* _.unzip(zipped);
* // => [['a', 'b'], [1, 2], [true, false]]
*/
function unzip(array) {
if (!(array && array.length)) {
return [];
}
var length = 0;
array = arrayFilter(array, function(group) {
if (isArrayLikeObject(group)) {
length = nativeMax(group.length, length);
return true;
}
});
return baseTimes(length, function(index) {
return arrayMap(array, baseProperty(index));
});
}
/**
* This method is like `_.unzip` except that it accepts `iteratee` to specify
* how regrouped values should be combined. The iteratee is invoked with the
* elements of each group: (...group).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Array
* @param {Array} array The array of grouped elements to process.
* @param {Function} [iteratee=_.identity] The function to combine
* regrouped values.
* @returns {Array} Returns the new array of regrouped elements.
* @example
*
* var zipped = _.zip([1, 2], [10, 20], [100, 200]);
* // => [[1, 10, 100], [2, 20, 200]]
*
* _.unzipWith(zipped, _.add);
* // => [3, 30, 300]
*/
function unzipWith(array, iteratee) {
if (!(array && array.length)) {
return [];
}
var result = unzip(array);
if (iteratee == null) {
return result;
}
return arrayMap(result, function(group) {
return apply(iteratee, undefined, group);
});
}
/**
* Creates an array excluding all given values using
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* for equality comparisons.
*
* **Note:** Unlike `_.pull`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {Array} array The array to inspect.
* @param {...*} [values] The values to exclude.
* @returns {Array} Returns the new array of filtered values.
* @see _.difference, _.xor
* @example
*
* _.without([2, 1, 2, 3], 1, 2);
* // => [3]
*/
var without = baseRest(function(array, values) {
return isArrayLikeObject(array)
? baseDifference(array, values)
: [];
});
/**
* Creates an array of unique values that is the
* [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
* of the given arrays. The order of result values is determined by the order
* they occur in the arrays.
*
* @static
* @memberOf _
* @since 2.4.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @returns {Array} Returns the new array of filtered values.
* @see _.difference, _.without
* @example
*
* _.xor([2, 1], [2, 3]);
* // => [1, 3]
*/
var xor = baseRest(function(arrays) {
return baseXor(arrayFilter(arrays, isArrayLikeObject));
});
/**
* This method is like `_.xor` except that it accepts `iteratee` which is
* invoked for each element of each `arrays` to generate the criterion by
* which by which they're compared. The order of result values is determined
* by the order they occur in the arrays. The iteratee is invoked with one
* argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
* // => [1.2, 3.4]
*
* // The `_.property` iteratee shorthand.
* _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
* // => [{ 'x': 2 }]
*/
var xorBy = baseRest(function(arrays) {
var iteratee = last(arrays);
if (isArrayLikeObject(iteratee)) {
iteratee = undefined;
}
return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
});
/**
* This method is like `_.xor` except that it accepts `comparator` which is
* invoked to compare elements of `arrays`. The order of result values is
* determined by the order they occur in the arrays. The comparator is invoked
* with two arguments: (arrVal, othVal).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Array
* @param {...Array} [arrays] The arrays to inspect.
* @param {Function} [comparator] The comparator invoked per element.
* @returns {Array} Returns the new array of filtered values.
* @example
*
* var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
* var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
*
* _.xorWith(objects, others, _.isEqual);
* // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
*/
var xorWith = baseRest(function(arrays) {
var comparator = last(arrays);
comparator = typeof comparator == 'function' ? comparator : undefined;
return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
});
/**
* Creates an array of grouped elements, the first of which contains the
* first elements of the given arrays, the second of which contains the
* second elements of the given arrays, and so on.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Array
* @param {...Array} [arrays] The arrays to process.
* @returns {Array} Returns the new array of grouped elements.
* @example
*
* _.zip(['a', 'b'], [1, 2], [true, false]);
* // => [['a', 1, true], ['b', 2, false]]
*/
var zip = baseRest(unzip);
/**
* This method is like `_.fromPairs` except that it accepts two arrays,
* one of property identifiers and one of corresponding values.
*
* @static
* @memberOf _
* @since 0.4.0
* @category Array
* @param {Array} [props=[]] The property identifiers.
* @param {Array} [values=[]] The property values.
* @returns {Object} Returns the new object.
* @example
*
* _.zipObject(['a', 'b'], [1, 2]);
* // => { 'a': 1, 'b': 2 }
*/
function zipObject(props, values) {
return baseZipObject(props || [], values || [], assignValue);
}
/**
* This method is like `_.zipObject` except that it supports property paths.
*
* @static
* @memberOf _
* @since 4.1.0
* @category Array
* @param {Array} [props=[]] The property identifiers.
* @param {Array} [values=[]] The property values.
* @returns {Object} Returns the new object.
* @example
*
* _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
* // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
*/
function zipObjectDeep(props, values) {
return baseZipObject(props || [], values || [], baseSet);
}
/**
* This method is like `_.zip` except that it accepts `iteratee` to specify
* how grouped values should be combined. The iteratee is invoked with the
* elements of each group: (...group).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Array
* @param {...Array} [arrays] The arrays to process.
* @param {Function} [iteratee=_.identity] The function to combine
* grouped values.
* @returns {Array} Returns the new array of grouped elements.
* @example
*
* _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
* return a + b + c;
* });
* // => [111, 222]
*/
var zipWith = baseRest(function(arrays) {
var length = arrays.length,
iteratee = length > 1 ? arrays[length - 1] : undefined;
iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
return unzipWith(arrays, iteratee);
});
/*------------------------------------------------------------------------*/
/**
* Creates a `lodash` wrapper instance that wraps `value` with explicit method
* chain sequences enabled. The result of such sequences must be unwrapped
* with `_#value`.
*
* @static
* @memberOf _
* @since 1.3.0
* @category Seq
* @param {*} value The value to wrap.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 40 },
* { 'user': 'pebbles', 'age': 1 }
* ];
*
* var youngest = _
* .chain(users)
* .sortBy('age')
* .map(function(o) {
* return o.user + ' is ' + o.age;
* })
* .head()
* .value();
* // => 'pebbles is 1'
*/
function chain(value) {
var result = lodash(value);
result.__chain__ = true;
return result;
}
/**
* This method invokes `interceptor` and returns `value`. The interceptor
* is invoked with one argument; (value). The purpose of this method is to
* "tap into" a method chain sequence in order to modify intermediate results.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Seq
* @param {*} value The value to provide to `interceptor`.
* @param {Function} interceptor The function to invoke.
* @returns {*} Returns `value`.
* @example
*
* _([1, 2, 3])
* .tap(function(array) {
* // Mutate input array.
* array.pop();
* })
* .reverse()
* .value();
* // => [2, 1]
*/
function tap(value, interceptor) {
interceptor(value);
return value;
}
/**
* This method is like `_.tap` except that it returns the result of `interceptor`.
* The purpose of this method is to "pass thru" values replacing intermediate
* results in a method chain sequence.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Seq
* @param {*} value The value to provide to `interceptor`.
* @param {Function} interceptor The function to invoke.
* @returns {*} Returns the result of `interceptor`.
* @example
*
* _(' abc ')
* .chain()
* .trim()
* .thru(function(value) {
* return [value];
* })
* .value();
* // => ['abc']
*/
function thru(value, interceptor) {
return interceptor(value);
}
/**
* This method is the wrapper version of `_.at`.
*
* @name at
* @memberOf _
* @since 1.0.0
* @category Seq
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
*
* _(object).at(['a[0].b.c', 'a[1]']).value();
* // => [3, 4]
*/
var wrapperAt = flatRest(function(paths) {
var length = paths.length,
start = length ? paths[0] : 0,
value = this.__wrapped__,
interceptor = function(object) { return baseAt(object, paths); };
if (length > 1 || this.__actions__.length ||
!(value instanceof LazyWrapper) || !isIndex(start)) {
return this.thru(interceptor);
}
value = value.slice(start, +start + (length ? 1 : 0));
value.__actions__.push({
'func': thru,
'args': [interceptor],
'thisArg': undefined
});
return new LodashWrapper(value, this.__chain__).thru(function(array) {
if (length && !array.length) {
array.push(undefined);
}
return array;
});
});
/**
* Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
*
* @name chain
* @memberOf _
* @since 0.1.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 40 }
* ];
*
* // A sequence without explicit chaining.
* _(users).head();
* // => { 'user': 'barney', 'age': 36 }
*
* // A sequence with explicit chaining.
* _(users)
* .chain()
* .head()
* .pick('user')
* .value();
* // => { 'user': 'barney' }
*/
function wrapperChain() {
return chain(this);
}
/**
* Executes the chain sequence and returns the wrapped result.
*
* @name commit
* @memberOf _
* @since 3.2.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var array = [1, 2];
* var wrapped = _(array).push(3);
*
* console.log(array);
* // => [1, 2]
*
* wrapped = wrapped.commit();
* console.log(array);
* // => [1, 2, 3]
*
* wrapped.last();
* // => 3
*
* console.log(array);
* // => [1, 2, 3]
*/
function wrapperCommit() {
return new LodashWrapper(this.value(), this.__chain__);
}
/**
* Gets the next value on a wrapped object following the
* [iterator protocol](https://mdn.io/iteration_protocols#iterator).
*
* @name next
* @memberOf _
* @since 4.0.0
* @category Seq
* @returns {Object} Returns the next iterator value.
* @example
*
* var wrapped = _([1, 2]);
*
* wrapped.next();
* // => { 'done': false, 'value': 1 }
*
* wrapped.next();
* // => { 'done': false, 'value': 2 }
*
* wrapped.next();
* // => { 'done': true, 'value': undefined }
*/
function wrapperNext() {
if (this.__values__ === undefined) {
this.__values__ = toArray(this.value());
}
var done = this.__index__ >= this.__values__.length,
value = done ? undefined : this.__values__[this.__index__++];
return { 'done': done, 'value': value };
}
/**
* Enables the wrapper to be iterable.
*
* @name Symbol.iterator
* @memberOf _
* @since 4.0.0
* @category Seq
* @returns {Object} Returns the wrapper object.
* @example
*
* var wrapped = _([1, 2]);
*
* wrapped[Symbol.iterator]() === wrapped;
* // => true
*
* Array.from(wrapped);
* // => [1, 2]
*/
function wrapperToIterator() {
return this;
}
/**
* Creates a clone of the chain sequence planting `value` as the wrapped value.
*
* @name plant
* @memberOf _
* @since 3.2.0
* @category Seq
* @param {*} value The value to plant.
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* function square(n) {
* return n * n;
* }
*
* var wrapped = _([1, 2]).map(square);
* var other = wrapped.plant([3, 4]);
*
* other.value();
* // => [9, 16]
*
* wrapped.value();
* // => [1, 4]
*/
function wrapperPlant(value) {
var result,
parent = this;
while (parent instanceof baseLodash) {
var clone = wrapperClone(parent);
clone.__index__ = 0;
clone.__values__ = undefined;
if (result) {
previous.__wrapped__ = clone;
} else {
result = clone;
}
var previous = clone;
parent = parent.__wrapped__;
}
previous.__wrapped__ = value;
return result;
}
/**
* This method is the wrapper version of `_.reverse`.
*
* **Note:** This method mutates the wrapped array.
*
* @name reverse
* @memberOf _
* @since 0.1.0
* @category Seq
* @returns {Object} Returns the new `lodash` wrapper instance.
* @example
*
* var array = [1, 2, 3];
*
* _(array).reverse().value()
* // => [3, 2, 1]
*
* console.log(array);
* // => [3, 2, 1]
*/
function wrapperReverse() {
var value = this.__wrapped__;
if (value instanceof LazyWrapper) {
var wrapped = value;
if (this.__actions__.length) {
wrapped = new LazyWrapper(this);
}
wrapped = wrapped.reverse();
wrapped.__actions__.push({
'func': thru,
'args': [reverse],
'thisArg': undefined
});
return new LodashWrapper(wrapped, this.__chain__);
}
return this.thru(reverse);
}
/**
* Executes the chain sequence to resolve the unwrapped value.
*
* @name value
* @memberOf _
* @since 0.1.0
* @alias toJSON, valueOf
* @category Seq
* @returns {*} Returns the resolved unwrapped value.
* @example
*
* _([1, 2, 3]).value();
* // => [1, 2, 3]
*/
function wrapperValue() {
return baseWrapperValue(this.__wrapped__, this.__actions__);
}
/*------------------------------------------------------------------------*/
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The corresponding value of
* each key is the number of times the key was returned by `iteratee`. The
* iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.5.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* _.countBy([6.1, 4.2, 6.3], Math.floor);
* // => { '4': 1, '6': 2 }
*
* // The `_.property` iteratee shorthand.
* _.countBy(['one', 'two', 'three'], 'length');
* // => { '3': 2, '5': 1 }
*/
var countBy = createAggregator(function(result, value, key) {
if (hasOwnProperty.call(result, key)) {
++result[key];
} else {
baseAssignValue(result, key, 1);
}
});
/**
* Checks if `predicate` returns truthy for **all** elements of `collection`.
* Iteration is stopped once `predicate` returns falsey. The predicate is
* invoked with three arguments: (value, index|key, collection).
*
* **Note:** This method returns `true` for
* [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
* [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
* elements of empty collections.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {boolean} Returns `true` if all elements pass the predicate check,
* else `false`.
* @example
*
* _.every([true, 1, null, 'yes'], Boolean);
* // => false
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': false }
* ];
*
* // The `_.matches` iteratee shorthand.
* _.every(users, { 'user': 'barney', 'active': false });
* // => false
*
* // The `_.matchesProperty` iteratee shorthand.
* _.every(users, ['active', false]);
* // => true
*
* // The `_.property` iteratee shorthand.
* _.every(users, 'active');
* // => false
*/
function every(collection, predicate, guard) {
var func = isArray(collection) ? arrayEvery : baseEvery;
if (guard && isIterateeCall(collection, predicate, guard)) {
predicate = undefined;
}
return func(collection, getIteratee(predicate, 3));
}
/**
* Iterates over elements of `collection`, returning an array of all elements
* `predicate` returns truthy for. The predicate is invoked with three
* arguments: (value, index|key, collection).
*
* **Note:** Unlike `_.remove`, this method returns a new array.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
* @see _.reject
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': true },
* { 'user': 'fred', 'age': 40, 'active': false }
* ];
*
* _.filter(users, function(o) { return !o.active; });
* // => objects for ['fred']
*
* // The `_.matches` iteratee shorthand.
* _.filter(users, { 'age': 36, 'active': true });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.filter(users, ['active', false]);
* // => objects for ['fred']
*
* // The `_.property` iteratee shorthand.
* _.filter(users, 'active');
* // => objects for ['barney']
*
* // Combining several predicates using `_.overEvery` or `_.overSome`.
* _.filter(users, _.overSome([{ 'age': 36 }, ['age', 40]]));
* // => objects for ['fred', 'barney']
*/
function filter(collection, predicate) {
var func = isArray(collection) ? arrayFilter : baseFilter;
return func(collection, getIteratee(predicate, 3));
}
/**
* Iterates over elements of `collection`, returning the first element
* `predicate` returns truthy for. The predicate is invoked with three
* arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=0] The index to search from.
* @returns {*} Returns the matched element, else `undefined`.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': true },
* { 'user': 'fred', 'age': 40, 'active': false },
* { 'user': 'pebbles', 'age': 1, 'active': true }
* ];
*
* _.find(users, function(o) { return o.age < 40; });
* // => object for 'barney'
*
* // The `_.matches` iteratee shorthand.
* _.find(users, { 'age': 1, 'active': true });
* // => object for 'pebbles'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.find(users, ['active', false]);
* // => object for 'fred'
*
* // The `_.property` iteratee shorthand.
* _.find(users, 'active');
* // => object for 'barney'
*/
var find = createFind(findIndex);
/**
* This method is like `_.find` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Collection
* @param {Array|Object} collection The collection to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param {number} [fromIndex=collection.length-1] The index to search from.
* @returns {*} Returns the matched element, else `undefined`.
* @example
*
* _.findLast([1, 2, 3, 4], function(n) {
* return n % 2 == 1;
* });
* // => 3
*/
var findLast = createFind(findLastIndex);
/**
* Creates a flattened array of values by running each element in `collection`
* thru `iteratee` and flattening the mapped results. The iteratee is invoked
* with three arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [n, n];
* }
*
* _.flatMap([1, 2], duplicate);
* // => [1, 1, 2, 2]
*/
function flatMap(collection, iteratee) {
return baseFlatten(map(collection, iteratee), 1);
}
/**
* This method is like `_.flatMap` except that it recursively flattens the
* mapped results.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [[[n, n]]];
* }
*
* _.flatMapDeep([1, 2], duplicate);
* // => [1, 1, 2, 2]
*/
function flatMapDeep(collection, iteratee) {
return baseFlatten(map(collection, iteratee), INFINITY);
}
/**
* This method is like `_.flatMap` except that it recursively flattens the
* mapped results up to `depth` times.
*
* @static
* @memberOf _
* @since 4.7.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {number} [depth=1] The maximum recursion depth.
* @returns {Array} Returns the new flattened array.
* @example
*
* function duplicate(n) {
* return [[[n, n]]];
* }
*
* _.flatMapDepth([1, 2], duplicate, 2);
* // => [[1, 1], [2, 2]]
*/
function flatMapDepth(collection, iteratee, depth) {
depth = depth === undefined ? 1 : toInteger(depth);
return baseFlatten(map(collection, iteratee), depth);
}
/**
* Iterates over elements of `collection` and invokes `iteratee` for each element.
* The iteratee is invoked with three arguments: (value, index|key, collection).
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* **Note:** As with other "Collections" methods, objects with a "length"
* property are iterated like arrays. To avoid this behavior use `_.forIn`
* or `_.forOwn` for object iteration.
*
* @static
* @memberOf _
* @since 0.1.0
* @alias each
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
* @see _.forEachRight
* @example
*
* _.forEach([1, 2], function(value) {
* console.log(value);
* });
* // => Logs `1` then `2`.
*
* _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
* console.log(key);
* });
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
*/
function forEach(collection, iteratee) {
var func = isArray(collection) ? arrayEach : baseEach;
return func(collection, getIteratee(iteratee, 3));
}
/**
* This method is like `_.forEach` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 2.0.0
* @alias eachRight
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array|Object} Returns `collection`.
* @see _.forEach
* @example
*
* _.forEachRight([1, 2], function(value) {
* console.log(value);
* });
* // => Logs `2` then `1`.
*/
function forEachRight(collection, iteratee) {
var func = isArray(collection) ? arrayEachRight : baseEachRight;
return func(collection, getIteratee(iteratee, 3));
}
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The order of grouped values
* is determined by the order they occur in `collection`. The corresponding
* value of each key is an array of elements responsible for generating the
* key. The iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* _.groupBy([6.1, 4.2, 6.3], Math.floor);
* // => { '4': [4.2], '6': [6.1, 6.3] }
*
* // The `_.property` iteratee shorthand.
* _.groupBy(['one', 'two', 'three'], 'length');
* // => { '3': ['one', 'two'], '5': ['three'] }
*/
var groupBy = createAggregator(function(result, value, key) {
if (hasOwnProperty.call(result, key)) {
result[key].push(value);
} else {
baseAssignValue(result, key, [value]);
}
});
/**
* Checks if `value` is in `collection`. If `collection` is a string, it's
* checked for a substring of `value`, otherwise
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* is used for equality comparisons. If `fromIndex` is negative, it's used as
* the offset from the end of `collection`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object|string} collection The collection to inspect.
* @param {*} value The value to search for.
* @param {number} [fromIndex=0] The index to search from.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
* @returns {boolean} Returns `true` if `value` is found, else `false`.
* @example
*
* _.includes([1, 2, 3], 1);
* // => true
*
* _.includes([1, 2, 3], 1, 2);
* // => false
*
* _.includes({ 'a': 1, 'b': 2 }, 1);
* // => true
*
* _.includes('abcd', 'bc');
* // => true
*/
function includes(collection, value, fromIndex, guard) {
collection = isArrayLike(collection) ? collection : values(collection);
fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
var length = collection.length;
if (fromIndex < 0) {
fromIndex = nativeMax(length + fromIndex, 0);
}
return isString(collection)
? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
: (!!length && baseIndexOf(collection, value, fromIndex) > -1);
}
/**
* Invokes the method at `path` of each element in `collection`, returning
* an array of the results of each invoked method. Any additional arguments
* are provided to each invoked method. If `path` is a function, it's invoked
* for, and `this` bound to, each element in `collection`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Array|Function|string} path The path of the method to invoke or
* the function invoked per iteration.
* @param {...*} [args] The arguments to invoke each method with.
* @returns {Array} Returns the array of results.
* @example
*
* _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
* // => [[1, 5, 7], [1, 2, 3]]
*
* _.invokeMap([123, 456], String.prototype.split, '');
* // => [['1', '2', '3'], ['4', '5', '6']]
*/
var invokeMap = baseRest(function(collection, path, args) {
var index = -1,
isFunc = typeof path == 'function',
result = isArrayLike(collection) ? Array(collection.length) : [];
baseEach(collection, function(value) {
result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
});
return result;
});
/**
* Creates an object composed of keys generated from the results of running
* each element of `collection` thru `iteratee`. The corresponding value of
* each key is the last element responsible for generating the key. The
* iteratee is invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The iteratee to transform keys.
* @returns {Object} Returns the composed aggregate object.
* @example
*
* var array = [
* { 'dir': 'left', 'code': 97 },
* { 'dir': 'right', 'code': 100 }
* ];
*
* _.keyBy(array, function(o) {
* return String.fromCharCode(o.code);
* });
* // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
*
* _.keyBy(array, 'dir');
* // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
*/
var keyBy = createAggregator(function(result, value, key) {
baseAssignValue(result, key, value);
});
/**
* Creates an array of values by running each element in `collection` thru
* `iteratee`. The iteratee is invoked with three arguments:
* (value, index|key, collection).
*
* Many lodash methods are guarded to work as iteratees for methods like
* `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
*
* The guarded methods are:
* `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
* `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
* `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
* `template`, `trim`, `trimEnd`, `trimStart`, and `words`
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new mapped array.
* @example
*
* function square(n) {
* return n * n;
* }
*
* _.map([4, 8], square);
* // => [16, 64]
*
* _.map({ 'a': 4, 'b': 8 }, square);
* // => [16, 64] (iteration order is not guaranteed)
*
* var users = [
* { 'user': 'barney' },
* { 'user': 'fred' }
* ];
*
* // The `_.property` iteratee shorthand.
* _.map(users, 'user');
* // => ['barney', 'fred']
*/
function map(collection, iteratee) {
var func = isArray(collection) ? arrayMap : baseMap;
return func(collection, getIteratee(iteratee, 3));
}
/**
* This method is like `_.sortBy` except that it allows specifying the sort
* orders of the iteratees to sort by. If `orders` is unspecified, all values
* are sorted in ascending order. Otherwise, specify an order of "desc" for
* descending or "asc" for ascending sort order of corresponding values.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
* The iteratees to sort by.
* @param {string[]} [orders] The sort orders of `iteratees`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
* @returns {Array} Returns the new sorted array.
* @example
*
* var users = [
* { 'user': 'fred', 'age': 48 },
* { 'user': 'barney', 'age': 34 },
* { 'user': 'fred', 'age': 40 },
* { 'user': 'barney', 'age': 36 }
* ];
*
* // Sort by `user` in ascending order and by `age` in descending order.
* _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
*/
function orderBy(collection, iteratees, orders, guard) {
if (collection == null) {
return [];
}
if (!isArray(iteratees)) {
iteratees = iteratees == null ? [] : [iteratees];
}
orders = guard ? undefined : orders;
if (!isArray(orders)) {
orders = orders == null ? [] : [orders];
}
return baseOrderBy(collection, iteratees, orders);
}
/**
* Creates an array of elements split into two groups, the first of which
* contains elements `predicate` returns truthy for, the second of which
* contains elements `predicate` returns falsey for. The predicate is
* invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 3.0.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the array of grouped elements.
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': true },
* { 'user': 'pebbles', 'age': 1, 'active': false }
* ];
*
* _.partition(users, function(o) { return o.active; });
* // => objects for [['fred'], ['barney', 'pebbles']]
*
* // The `_.matches` iteratee shorthand.
* _.partition(users, { 'age': 1, 'active': false });
* // => objects for [['pebbles'], ['barney', 'fred']]
*
* // The `_.matchesProperty` iteratee shorthand.
* _.partition(users, ['active', false]);
* // => objects for [['barney', 'pebbles'], ['fred']]
*
* // The `_.property` iteratee shorthand.
* _.partition(users, 'active');
* // => objects for [['fred'], ['barney', 'pebbles']]
*/
var partition = createAggregator(function(result, value, key) {
result[key ? 0 : 1].push(value);
}, function() { return [[], []]; });
/**
* Reduces `collection` to a value which is the accumulated result of running
* each element in `collection` thru `iteratee`, where each successive
* invocation is supplied the return value of the previous. If `accumulator`
* is not given, the first element of `collection` is used as the initial
* value. The iteratee is invoked with four arguments:
* (accumulator, value, index|key, collection).
*
* Many lodash methods are guarded to work as iteratees for methods like
* `_.reduce`, `_.reduceRight`, and `_.transform`.
*
* The guarded methods are:
* `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
* and `sortBy`
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @returns {*} Returns the accumulated value.
* @see _.reduceRight
* @example
*
* _.reduce([1, 2], function(sum, n) {
* return sum + n;
* }, 0);
* // => 3
*
* _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
* (result[value] || (result[value] = [])).push(key);
* return result;
* }, {});
* // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
*/
function reduce(collection, iteratee, accumulator) {
var func = isArray(collection) ? arrayReduce : baseReduce,
initAccum = arguments.length < 3;
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
}
/**
* This method is like `_.reduce` except that it iterates over elements of
* `collection` from right to left.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The initial value.
* @returns {*} Returns the accumulated value.
* @see _.reduce
* @example
*
* var array = [[0, 1], [2, 3], [4, 5]];
*
* _.reduceRight(array, function(flattened, other) {
* return flattened.concat(other);
* }, []);
* // => [4, 5, 2, 3, 0, 1]
*/
function reduceRight(collection, iteratee, accumulator) {
var func = isArray(collection) ? arrayReduceRight : baseReduce,
initAccum = arguments.length < 3;
return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
}
/**
* The opposite of `_.filter`; this method returns the elements of `collection`
* that `predicate` does **not** return truthy for.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {Array} Returns the new filtered array.
* @see _.filter
* @example
*
* var users = [
* { 'user': 'barney', 'age': 36, 'active': false },
* { 'user': 'fred', 'age': 40, 'active': true }
* ];
*
* _.reject(users, function(o) { return !o.active; });
* // => objects for ['fred']
*
* // The `_.matches` iteratee shorthand.
* _.reject(users, { 'age': 40, 'active': true });
* // => objects for ['barney']
*
* // The `_.matchesProperty` iteratee shorthand.
* _.reject(users, ['active', false]);
* // => objects for ['fred']
*
* // The `_.property` iteratee shorthand.
* _.reject(users, 'active');
* // => objects for ['barney']
*/
function reject(collection, predicate) {
var func = isArray(collection) ? arrayFilter : baseFilter;
return func(collection, negate(getIteratee(predicate, 3)));
}
/**
* Gets a random element from `collection`.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Collection
* @param {Array|Object} collection The collection to sample.
* @returns {*} Returns the random element.
* @example
*
* _.sample([1, 2, 3, 4]);
* // => 2
*/
function sample(collection) {
var func = isArray(collection) ? arraySample : baseSample;
return func(collection);
}
/**
* Gets `n` random elements at unique keys from `collection` up to the
* size of `collection`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Collection
* @param {Array|Object} collection The collection to sample.
* @param {number} [n=1] The number of elements to sample.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Array} Returns the random elements.
* @example
*
* _.sampleSize([1, 2, 3], 2);
* // => [3, 1]
*
* _.sampleSize([1, 2, 3], 4);
* // => [2, 3, 1]
*/
function sampleSize(collection, n, guard) {
if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
n = 1;
} else {
n = toInteger(n);
}
var func = isArray(collection) ? arraySampleSize : baseSampleSize;
return func(collection, n);
}
/**
* Creates an array of shuffled values, using a version of the
* [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to shuffle.
* @returns {Array} Returns the new shuffled array.
* @example
*
* _.shuffle([1, 2, 3, 4]);
* // => [4, 1, 3, 2]
*/
function shuffle(collection) {
var func = isArray(collection) ? arrayShuffle : baseShuffle;
return func(collection);
}
/**
* Gets the size of `collection` by returning its length for array-like
* values or the number of own enumerable string keyed properties for objects.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object|string} collection The collection to inspect.
* @returns {number} Returns the collection size.
* @example
*
* _.size([1, 2, 3]);
* // => 3
*
* _.size({ 'a': 1, 'b': 2 });
* // => 2
*
* _.size('pebbles');
* // => 7
*/
function size(collection) {
if (collection == null) {
return 0;
}
if (isArrayLike(collection)) {
return isString(collection) ? stringSize(collection) : collection.length;
}
var tag = getTag(collection);
if (tag == mapTag || tag == setTag) {
return collection.size;
}
return baseKeys(collection).length;
}
/**
* Checks if `predicate` returns truthy for **any** element of `collection`.
* Iteration is stopped once `predicate` returns truthy. The predicate is
* invoked with three arguments: (value, index|key, collection).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {boolean} Returns `true` if any element passes the predicate check,
* else `false`.
* @example
*
* _.some([null, 0, 'yes', false], Boolean);
* // => true
*
* var users = [
* { 'user': 'barney', 'active': true },
* { 'user': 'fred', 'active': false }
* ];
*
* // The `_.matches` iteratee shorthand.
* _.some(users, { 'user': 'barney', 'active': false });
* // => false
*
* // The `_.matchesProperty` iteratee shorthand.
* _.some(users, ['active', false]);
* // => true
*
* // The `_.property` iteratee shorthand.
* _.some(users, 'active');
* // => true
*/
function some(collection, predicate, guard) {
var func = isArray(collection) ? arraySome : baseSome;
if (guard && isIterateeCall(collection, predicate, guard)) {
predicate = undefined;
}
return func(collection, getIteratee(predicate, 3));
}
/**
* Creates an array of elements, sorted in ascending order by the results of
* running each element in a collection thru each iteratee. This method
* performs a stable sort, that is, it preserves the original sort order of
* equal elements. The iteratees are invoked with one argument: (value).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Collection
* @param {Array|Object} collection The collection to iterate over.
* @param {...(Function|Function[])} [iteratees=[_.identity]]
* The iteratees to sort by.
* @returns {Array} Returns the new sorted array.
* @example
*
* var users = [
* { 'user': 'fred', 'age': 48 },
* { 'user': 'barney', 'age': 36 },
* { 'user': 'fred', 'age': 30 },
* { 'user': 'barney', 'age': 34 }
* ];
*
* _.sortBy(users, [function(o) { return o.user; }]);
* // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 30]]
*
* _.sortBy(users, ['user', 'age']);
* // => objects for [['barney', 34], ['barney', 36], ['fred', 30], ['fred', 48]]
*/
var sortBy = baseRest(function(collection, iteratees) {
if (collection == null) {
return [];
}
var length = iteratees.length;
if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
iteratees = [];
} else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
iteratees = [iteratees[0]];
}
return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
});
/*------------------------------------------------------------------------*/
/**
* Gets the timestamp of the number of milliseconds that have elapsed since
* the Unix epoch (1 January 1970 00:00:00 UTC).
*
* @static
* @memberOf _
* @since 2.4.0
* @category Date
* @returns {number} Returns the timestamp.
* @example
*
* _.defer(function(stamp) {
* console.log(_.now() - stamp);
* }, _.now());
* // => Logs the number of milliseconds it took for the deferred invocation.
*/
var now = ctxNow || function() {
return root.Date.now();
};
/*------------------------------------------------------------------------*/
/**
* The opposite of `_.before`; this method creates a function that invokes
* `func` once it's called `n` or more times.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {number} n The number of calls before `func` is invoked.
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* var saves = ['profile', 'settings'];
*
* var done = _.after(saves.length, function() {
* console.log('done saving!');
* });
*
* _.forEach(saves, function(type) {
* asyncSave({ 'type': type, 'complete': done });
* });
* // => Logs 'done saving!' after the two async saves have completed.
*/
function after(n, func) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
n = toInteger(n);
return function() {
if (--n < 1) {
return func.apply(this, arguments);
}
};
}
/**
* Creates a function that invokes `func`, with up to `n` arguments,
* ignoring any additional arguments.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to cap arguments for.
* @param {number} [n=func.length] The arity cap.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new capped function.
* @example
*
* _.map(['6', '8', '10'], _.ary(parseInt, 1));
* // => [6, 8, 10]
*/
function ary(func, n, guard) {
n = guard ? undefined : n;
n = (func && n == null) ? func.length : n;
return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
}
/**
* Creates a function that invokes `func`, with the `this` binding and arguments
* of the created function, while it's called less than `n` times. Subsequent
* calls to the created function return the result of the last `func` invocation.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {number} n The number of calls at which `func` is no longer invoked.
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* jQuery(element).on('click', _.before(5, addContactToList));
* // => Allows adding up to 4 contacts to the list.
*/
function before(n, func) {
var result;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
n = toInteger(n);
return function() {
if (--n > 0) {
result = func.apply(this, arguments);
}
if (n <= 1) {
func = undefined;
}
return result;
};
}
/**
* Creates a function that invokes `func` with the `this` binding of `thisArg`
* and `partials` prepended to the arguments it receives.
*
* The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
* may be used as a placeholder for partially applied arguments.
*
* **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
* property of bound functions.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to bind.
* @param {*} thisArg The `this` binding of `func`.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new bound function.
* @example
*
* function greet(greeting, punctuation) {
* return greeting + ' ' + this.user + punctuation;
* }
*
* var object = { 'user': 'fred' };
*
* var bound = _.bind(greet, object, 'hi');
* bound('!');
* // => 'hi fred!'
*
* // Bound with placeholders.
* var bound = _.bind(greet, object, _, '!');
* bound('hi');
* // => 'hi fred!'
*/
var bind = baseRest(function(func, thisArg, partials) {
var bitmask = WRAP_BIND_FLAG;
if (partials.length) {
var holders = replaceHolders(partials, getHolder(bind));
bitmask |= WRAP_PARTIAL_FLAG;
}
return createWrap(func, bitmask, thisArg, partials, holders);
});
/**
* Creates a function that invokes the method at `object[key]` with `partials`
* prepended to the arguments it receives.
*
* This method differs from `_.bind` by allowing bound functions to reference
* methods that may be redefined or don't yet exist. See
* [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
* for more details.
*
* The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* @static
* @memberOf _
* @since 0.10.0
* @category Function
* @param {Object} object The object to invoke the method on.
* @param {string} key The key of the method.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new bound function.
* @example
*
* var object = {
* 'user': 'fred',
* 'greet': function(greeting, punctuation) {
* return greeting + ' ' + this.user + punctuation;
* }
* };
*
* var bound = _.bindKey(object, 'greet', 'hi');
* bound('!');
* // => 'hi fred!'
*
* object.greet = function(greeting, punctuation) {
* return greeting + 'ya ' + this.user + punctuation;
* };
*
* bound('!');
* // => 'hiya fred!'
*
* // Bound with placeholders.
* var bound = _.bindKey(object, 'greet', _, '!');
* bound('hi');
* // => 'hiya fred!'
*/
var bindKey = baseRest(function(object, key, partials) {
var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
if (partials.length) {
var holders = replaceHolders(partials, getHolder(bindKey));
bitmask |= WRAP_PARTIAL_FLAG;
}
return createWrap(key, bitmask, object, partials, holders);
});
/**
* Creates a function that accepts arguments of `func` and either invokes
* `func` returning its result, if at least `arity` number of arguments have
* been provided, or returns a function that accepts the remaining `func`
* arguments, and so on. The arity of `func` may be specified if `func.length`
* is not sufficient.
*
* The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
* may be used as a placeholder for provided arguments.
*
* **Note:** This method doesn't set the "length" property of curried functions.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Function
* @param {Function} func The function to curry.
* @param {number} [arity=func.length] The arity of `func`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new curried function.
* @example
*
* var abc = function(a, b, c) {
* return [a, b, c];
* };
*
* var curried = _.curry(abc);
*
* curried(1)(2)(3);
* // => [1, 2, 3]
*
* curried(1, 2)(3);
* // => [1, 2, 3]
*
* curried(1, 2, 3);
* // => [1, 2, 3]
*
* // Curried with placeholders.
* curried(1)(_, 3)(2);
* // => [1, 2, 3]
*/
function curry(func, arity, guard) {
arity = guard ? undefined : arity;
var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
result.placeholder = curry.placeholder;
return result;
}
/**
* This method is like `_.curry` except that arguments are applied to `func`
* in the manner of `_.partialRight` instead of `_.partial`.
*
* The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for provided arguments.
*
* **Note:** This method doesn't set the "length" property of curried functions.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to curry.
* @param {number} [arity=func.length] The arity of `func`.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the new curried function.
* @example
*
* var abc = function(a, b, c) {
* return [a, b, c];
* };
*
* var curried = _.curryRight(abc);
*
* curried(3)(2)(1);
* // => [1, 2, 3]
*
* curried(2, 3)(1);
* // => [1, 2, 3]
*
* curried(1, 2, 3);
* // => [1, 2, 3]
*
* // Curried with placeholders.
* curried(3)(1, _)(2);
* // => [1, 2, 3]
*/
function curryRight(func, arity, guard) {
arity = guard ? undefined : arity;
var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
result.placeholder = curryRight.placeholder;
return result;
}
/**
* Creates a debounced function that delays invoking `func` until after `wait`
* milliseconds have elapsed since the last time the debounced function was
* invoked. The debounced function comes with a `cancel` method to cancel
* delayed `func` invocations and a `flush` method to immediately invoke them.
* Provide `options` to indicate whether `func` should be invoked on the
* leading and/or trailing edge of the `wait` timeout. The `func` is invoked
* with the last arguments provided to the debounced function. Subsequent
* calls to the debounced function return the result of the last `func`
* invocation.
*
* **Note:** If `leading` and `trailing` options are `true`, `func` is
* invoked on the trailing edge of the timeout only if the debounced function
* is invoked more than once during the `wait` timeout.
*
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
*
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
* for details over the differences between `_.debounce` and `_.throttle`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to debounce.
* @param {number} [wait=0] The number of milliseconds to delay.
* @param {Object} [options={}] The options object.
* @param {boolean} [options.leading=false]
* Specify invoking on the leading edge of the timeout.
* @param {number} [options.maxWait]
* The maximum time `func` is allowed to be delayed before it's invoked.
* @param {boolean} [options.trailing=true]
* Specify invoking on the trailing edge of the timeout.
* @returns {Function} Returns the new debounced function.
* @example
*
* // Avoid costly calculations while the window size is in flux.
* jQuery(window).on('resize', _.debounce(calculateLayout, 150));
*
* // Invoke `sendMail` when clicked, debouncing subsequent calls.
* jQuery(element).on('click', _.debounce(sendMail, 300, {
* 'leading': true,
* 'trailing': false
* }));
*
* // Ensure `batchLog` is invoked once after 1 second of debounced calls.
* var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
* var source = new EventSource('/stream');
* jQuery(source).on('message', debounced);
*
* // Cancel the trailing debounced invocation.
* jQuery(window).on('popstate', debounced.cancel);
*/
function debounce(func, wait, options) {
var lastArgs,
lastThis,
maxWait,
result,
timerId,
lastCallTime,
lastInvokeTime = 0,
leading = false,
maxing = false,
trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
wait = toNumber(wait) || 0;
if (isObject(options)) {
leading = !!options.leading;
maxing = 'maxWait' in options;
maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
function invokeFunc(time) {
var args = lastArgs,
thisArg = lastThis;
lastArgs = lastThis = undefined;
lastInvokeTime = time;
result = func.apply(thisArg, args);
return result;
}
function leadingEdge(time) {
// Reset any `maxWait` timer.
lastInvokeTime = time;
// Start the timer for the trailing edge.
timerId = setTimeout(timerExpired, wait);
// Invoke the leading edge.
return leading ? invokeFunc(time) : result;
}
function remainingWait(time) {
var timeSinceLastCall = time - lastCallTime,
timeSinceLastInvoke = time - lastInvokeTime,
timeWaiting = wait - timeSinceLastCall;
return maxing
? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)
: timeWaiting;
}
function shouldInvoke(time) {
var timeSinceLastCall = time - lastCallTime,
timeSinceLastInvoke = time - lastInvokeTime;
// Either this is the first call, activity has stopped and we're at the
// trailing edge, the system time has gone backwards and we're treating
// it as the trailing edge, or we've hit the `maxWait` limit.
return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
(timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
}
function timerExpired() {
var time = now();
if (shouldInvoke(time)) {
return trailingEdge(time);
}
// Restart the timer.
timerId = setTimeout(timerExpired, remainingWait(time));
}
function trailingEdge(time) {
timerId = undefined;
// Only invoke if we have `lastArgs` which means `func` has been
// debounced at least once.
if (trailing && lastArgs) {
return invokeFunc(time);
}
lastArgs = lastThis = undefined;
return result;
}
function cancel() {
if (timerId !== undefined) {
clearTimeout(timerId);
}
lastInvokeTime = 0;
lastArgs = lastCallTime = lastThis = timerId = undefined;
}
function flush() {
return timerId === undefined ? result : trailingEdge(now());
}
function debounced() {
var time = now(),
isInvoking = shouldInvoke(time);
lastArgs = arguments;
lastThis = this;
lastCallTime = time;
if (isInvoking) {
if (timerId === undefined) {
return leadingEdge(lastCallTime);
}
if (maxing) {
// Handle invocations in a tight loop.
clearTimeout(timerId);
timerId = setTimeout(timerExpired, wait);
return invokeFunc(lastCallTime);
}
}
if (timerId === undefined) {
timerId = setTimeout(timerExpired, wait);
}
return result;
}
debounced.cancel = cancel;
debounced.flush = flush;
return debounced;
}
/**
* Defers invoking the `func` until the current call stack has cleared. Any
* additional arguments are provided to `func` when it's invoked.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to defer.
* @param {...*} [args] The arguments to invoke `func` with.
* @returns {number} Returns the timer id.
* @example
*
* _.defer(function(text) {
* console.log(text);
* }, 'deferred');
* // => Logs 'deferred' after one millisecond.
*/
var defer = baseRest(function(func, args) {
return baseDelay(func, 1, args);
});
/**
* Invokes `func` after `wait` milliseconds. Any additional arguments are
* provided to `func` when it's invoked.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to delay.
* @param {number} wait The number of milliseconds to delay invocation.
* @param {...*} [args] The arguments to invoke `func` with.
* @returns {number} Returns the timer id.
* @example
*
* _.delay(function(text) {
* console.log(text);
* }, 1000, 'later');
* // => Logs 'later' after one second.
*/
var delay = baseRest(function(func, wait, args) {
return baseDelay(func, toNumber(wait) || 0, args);
});
/**
* Creates a function that invokes `func` with arguments reversed.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to flip arguments for.
* @returns {Function} Returns the new flipped function.
* @example
*
* var flipped = _.flip(function() {
* return _.toArray(arguments);
* });
*
* flipped('a', 'b', 'c', 'd');
* // => ['d', 'c', 'b', 'a']
*/
function flip(func) {
return createWrap(func, WRAP_FLIP_FLAG);
}
/**
* Creates a function that memoizes the result of `func`. If `resolver` is
* provided, it determines the cache key for storing the result based on the
* arguments provided to the memoized function. By default, the first argument
* provided to the memoized function is used as the map cache key. The `func`
* is invoked with the `this` binding of the memoized function.
*
* **Note:** The cache is exposed as the `cache` property on the memoized
* function. Its creation may be customized by replacing the `_.memoize.Cache`
* constructor with one whose instances implement the
* [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
* method interface of `clear`, `delete`, `get`, `has`, and `set`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to have its output memoized.
* @param {Function} [resolver] The function to resolve the cache key.
* @returns {Function} Returns the new memoized function.
* @example
*
* var object = { 'a': 1, 'b': 2 };
* var other = { 'c': 3, 'd': 4 };
*
* var values = _.memoize(_.values);
* values(object);
* // => [1, 2]
*
* values(other);
* // => [3, 4]
*
* object.a = 2;
* values(object);
* // => [1, 2]
*
* // Modify the result cache.
* values.cache.set(object, ['a', 'b']);
* values(object);
* // => ['a', 'b']
*
* // Replace `_.memoize.Cache`.
* _.memoize.Cache = WeakMap;
*/
function memoize(func, resolver) {
if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
throw new TypeError(FUNC_ERROR_TEXT);
}
var memoized = function() {
var args = arguments,
key = resolver ? resolver.apply(this, args) : args[0],
cache = memoized.cache;
if (cache.has(key)) {
return cache.get(key);
}
var result = func.apply(this, args);
memoized.cache = cache.set(key, result) || cache;
return result;
};
memoized.cache = new (memoize.Cache || MapCache);
return memoized;
}
// Expose `MapCache`.
memoize.Cache = MapCache;
/**
* Creates a function that negates the result of the predicate `func`. The
* `func` predicate is invoked with the `this` binding and arguments of the
* created function.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} predicate The predicate to negate.
* @returns {Function} Returns the new negated function.
* @example
*
* function isEven(n) {
* return n % 2 == 0;
* }
*
* _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
* // => [1, 3, 5]
*/
function negate(predicate) {
if (typeof predicate != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
return function() {
var args = arguments;
switch (args.length) {
case 0: return !predicate.call(this);
case 1: return !predicate.call(this, args[0]);
case 2: return !predicate.call(this, args[0], args[1]);
case 3: return !predicate.call(this, args[0], args[1], args[2]);
}
return !predicate.apply(this, args);
};
}
/**
* Creates a function that is restricted to invoking `func` once. Repeat calls
* to the function return the value of the first invocation. The `func` is
* invoked with the `this` binding and arguments of the created function.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to restrict.
* @returns {Function} Returns the new restricted function.
* @example
*
* var initialize = _.once(createApplication);
* initialize();
* initialize();
* // => `createApplication` is invoked once
*/
function once(func) {
return before(2, func);
}
/**
* Creates a function that invokes `func` with its arguments transformed.
*
* @static
* @since 4.0.0
* @memberOf _
* @category Function
* @param {Function} func The function to wrap.
* @param {...(Function|Function[])} [transforms=[_.identity]]
* The argument transforms.
* @returns {Function} Returns the new function.
* @example
*
* function doubled(n) {
* return n * 2;
* }
*
* function square(n) {
* return n * n;
* }
*
* var func = _.overArgs(function(x, y) {
* return [x, y];
* }, [square, doubled]);
*
* func(9, 3);
* // => [81, 6]
*
* func(10, 5);
* // => [100, 10]
*/
var overArgs = castRest(function(func, transforms) {
transforms = (transforms.length == 1 && isArray(transforms[0]))
? arrayMap(transforms[0], baseUnary(getIteratee()))
: arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
var funcsLength = transforms.length;
return baseRest(function(args) {
var index = -1,
length = nativeMin(args.length, funcsLength);
while (++index < length) {
args[index] = transforms[index].call(this, args[index]);
}
return apply(func, this, args);
});
});
/**
* Creates a function that invokes `func` with `partials` prepended to the
* arguments it receives. This method is like `_.bind` except it does **not**
* alter the `this` binding.
*
* The `_.partial.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* **Note:** This method doesn't set the "length" property of partially
* applied functions.
*
* @static
* @memberOf _
* @since 0.2.0
* @category Function
* @param {Function} func The function to partially apply arguments to.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new partially applied function.
* @example
*
* function greet(greeting, name) {
* return greeting + ' ' + name;
* }
*
* var sayHelloTo = _.partial(greet, 'hello');
* sayHelloTo('fred');
* // => 'hello fred'
*
* // Partially applied with placeholders.
* var greetFred = _.partial(greet, _, 'fred');
* greetFred('hi');
* // => 'hi fred'
*/
var partial = baseRest(function(func, partials) {
var holders = replaceHolders(partials, getHolder(partial));
return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
});
/**
* This method is like `_.partial` except that partially applied arguments
* are appended to the arguments it receives.
*
* The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
* builds, may be used as a placeholder for partially applied arguments.
*
* **Note:** This method doesn't set the "length" property of partially
* applied functions.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Function
* @param {Function} func The function to partially apply arguments to.
* @param {...*} [partials] The arguments to be partially applied.
* @returns {Function} Returns the new partially applied function.
* @example
*
* function greet(greeting, name) {
* return greeting + ' ' + name;
* }
*
* var greetFred = _.partialRight(greet, 'fred');
* greetFred('hi');
* // => 'hi fred'
*
* // Partially applied with placeholders.
* var sayHelloTo = _.partialRight(greet, 'hello', _);
* sayHelloTo('fred');
* // => 'hello fred'
*/
var partialRight = baseRest(function(func, partials) {
var holders = replaceHolders(partials, getHolder(partialRight));
return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
});
/**
* Creates a function that invokes `func` with arguments arranged according
* to the specified `indexes` where the argument value at the first index is
* provided as the first argument, the argument value at the second index is
* provided as the second argument, and so on.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Function
* @param {Function} func The function to rearrange arguments for.
* @param {...(number|number[])} indexes The arranged argument indexes.
* @returns {Function} Returns the new function.
* @example
*
* var rearged = _.rearg(function(a, b, c) {
* return [a, b, c];
* }, [2, 0, 1]);
*
* rearged('b', 'c', 'a')
* // => ['a', 'b', 'c']
*/
var rearg = flatRest(function(func, indexes) {
return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
});
/**
* Creates a function that invokes `func` with the `this` binding of the
* created function and arguments from `start` and beyond provided as
* an array.
*
* **Note:** This method is based on the
* [rest parameter](https://mdn.io/rest_parameters).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to apply a rest parameter to.
* @param {number} [start=func.length-1] The start position of the rest parameter.
* @returns {Function} Returns the new function.
* @example
*
* var say = _.rest(function(what, names) {
* return what + ' ' + _.initial(names).join(', ') +
* (_.size(names) > 1 ? ', & ' : '') + _.last(names);
* });
*
* say('hello', 'fred', 'barney', 'pebbles');
* // => 'hello fred, barney, & pebbles'
*/
function rest(func, start) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
start = start === undefined ? start : toInteger(start);
return baseRest(func, start);
}
/**
* Creates a function that invokes `func` with the `this` binding of the
* create function and an array of arguments much like
* [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
*
* **Note:** This method is based on the
* [spread operator](https://mdn.io/spread_operator).
*
* @static
* @memberOf _
* @since 3.2.0
* @category Function
* @param {Function} func The function to spread arguments over.
* @param {number} [start=0] The start position of the spread.
* @returns {Function} Returns the new function.
* @example
*
* var say = _.spread(function(who, what) {
* return who + ' says ' + what;
* });
*
* say(['fred', 'hello']);
* // => 'fred says hello'
*
* var numbers = Promise.all([
* Promise.resolve(40),
* Promise.resolve(36)
* ]);
*
* numbers.then(_.spread(function(x, y) {
* return x + y;
* }));
* // => a Promise of 76
*/
function spread(func, start) {
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
start = start == null ? 0 : nativeMax(toInteger(start), 0);
return baseRest(function(args) {
var array = args[start],
otherArgs = castSlice(args, 0, start);
if (array) {
arrayPush(otherArgs, array);
}
return apply(func, this, otherArgs);
});
}
/**
* Creates a throttled function that only invokes `func` at most once per
* every `wait` milliseconds. The throttled function comes with a `cancel`
* method to cancel delayed `func` invocations and a `flush` method to
* immediately invoke them. Provide `options` to indicate whether `func`
* should be invoked on the leading and/or trailing edge of the `wait`
* timeout. The `func` is invoked with the last arguments provided to the
* throttled function. Subsequent calls to the throttled function return the
* result of the last `func` invocation.
*
* **Note:** If `leading` and `trailing` options are `true`, `func` is
* invoked on the trailing edge of the timeout only if the throttled function
* is invoked more than once during the `wait` timeout.
*
* If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
* until to the next tick, similar to `setTimeout` with a timeout of `0`.
*
* See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
* for details over the differences between `_.throttle` and `_.debounce`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {Function} func The function to throttle.
* @param {number} [wait=0] The number of milliseconds to throttle invocations to.
* @param {Object} [options={}] The options object.
* @param {boolean} [options.leading=true]
* Specify invoking on the leading edge of the timeout.
* @param {boolean} [options.trailing=true]
* Specify invoking on the trailing edge of the timeout.
* @returns {Function} Returns the new throttled function.
* @example
*
* // Avoid excessively updating the position while scrolling.
* jQuery(window).on('scroll', _.throttle(updatePosition, 100));
*
* // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
* var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
* jQuery(element).on('click', throttled);
*
* // Cancel the trailing throttled invocation.
* jQuery(window).on('popstate', throttled.cancel);
*/
function throttle(func, wait, options) {
var leading = true,
trailing = true;
if (typeof func != 'function') {
throw new TypeError(FUNC_ERROR_TEXT);
}
if (isObject(options)) {
leading = 'leading' in options ? !!options.leading : leading;
trailing = 'trailing' in options ? !!options.trailing : trailing;
}
return debounce(func, wait, {
'leading': leading,
'maxWait': wait,
'trailing': trailing
});
}
/**
* Creates a function that accepts up to one argument, ignoring any
* additional arguments.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Function
* @param {Function} func The function to cap arguments for.
* @returns {Function} Returns the new capped function.
* @example
*
* _.map(['6', '8', '10'], _.unary(parseInt));
* // => [6, 8, 10]
*/
function unary(func) {
return ary(func, 1);
}
/**
* Creates a function that provides `value` to `wrapper` as its first
* argument. Any additional arguments provided to the function are appended
* to those provided to the `wrapper`. The wrapper is invoked with the `this`
* binding of the created function.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Function
* @param {*} value The value to wrap.
* @param {Function} [wrapper=identity] The wrapper function.
* @returns {Function} Returns the new function.
* @example
*
* var p = _.wrap(_.escape, function(func, text) {
* return '' + func(text) + '
';
* });
*
* p('fred, barney, & pebbles');
* // => 'fred, barney, & pebbles
'
*/
function wrap(value, wrapper) {
return partial(castFunction(wrapper), value);
}
/*------------------------------------------------------------------------*/
/**
* Casts `value` as an array if it's not one.
*
* @static
* @memberOf _
* @since 4.4.0
* @category Lang
* @param {*} value The value to inspect.
* @returns {Array} Returns the cast array.
* @example
*
* _.castArray(1);
* // => [1]
*
* _.castArray({ 'a': 1 });
* // => [{ 'a': 1 }]
*
* _.castArray('abc');
* // => ['abc']
*
* _.castArray(null);
* // => [null]
*
* _.castArray(undefined);
* // => [undefined]
*
* _.castArray();
* // => []
*
* var array = [1, 2, 3];
* console.log(_.castArray(array) === array);
* // => true
*/
function castArray() {
if (!arguments.length) {
return [];
}
var value = arguments[0];
return isArray(value) ? value : [value];
}
/**
* Creates a shallow clone of `value`.
*
* **Note:** This method is loosely based on the
* [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
* and supports cloning arrays, array buffers, booleans, date objects, maps,
* numbers, `Object` objects, regexes, sets, strings, symbols, and typed
* arrays. The own enumerable properties of `arguments` objects are cloned
* as plain objects. An empty object is returned for uncloneable values such
* as error objects, functions, DOM nodes, and WeakMaps.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to clone.
* @returns {*} Returns the cloned value.
* @see _.cloneDeep
* @example
*
* var objects = [{ 'a': 1 }, { 'b': 2 }];
*
* var shallow = _.clone(objects);
* console.log(shallow[0] === objects[0]);
* // => true
*/
function clone(value) {
return baseClone(value, CLONE_SYMBOLS_FLAG);
}
/**
* This method is like `_.clone` except that it accepts `customizer` which
* is invoked to produce the cloned value. If `customizer` returns `undefined`,
* cloning is handled by the method instead. The `customizer` is invoked with
* up to four arguments; (value [, index|key, object, stack]).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to clone.
* @param {Function} [customizer] The function to customize cloning.
* @returns {*} Returns the cloned value.
* @see _.cloneDeepWith
* @example
*
* function customizer(value) {
* if (_.isElement(value)) {
* return value.cloneNode(false);
* }
* }
*
* var el = _.cloneWith(document.body, customizer);
*
* console.log(el === document.body);
* // => false
* console.log(el.nodeName);
* // => 'BODY'
* console.log(el.childNodes.length);
* // => 0
*/
function cloneWith(value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
}
/**
* This method is like `_.clone` except that it recursively clones `value`.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Lang
* @param {*} value The value to recursively clone.
* @returns {*} Returns the deep cloned value.
* @see _.clone
* @example
*
* var objects = [{ 'a': 1 }, { 'b': 2 }];
*
* var deep = _.cloneDeep(objects);
* console.log(deep[0] === objects[0]);
* // => false
*/
function cloneDeep(value) {
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
}
/**
* This method is like `_.cloneWith` except that it recursively clones `value`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to recursively clone.
* @param {Function} [customizer] The function to customize cloning.
* @returns {*} Returns the deep cloned value.
* @see _.cloneWith
* @example
*
* function customizer(value) {
* if (_.isElement(value)) {
* return value.cloneNode(true);
* }
* }
*
* var el = _.cloneDeepWith(document.body, customizer);
*
* console.log(el === document.body);
* // => false
* console.log(el.nodeName);
* // => 'BODY'
* console.log(el.childNodes.length);
* // => 20
*/
function cloneDeepWith(value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
}
/**
* Checks if `object` conforms to `source` by invoking the predicate
* properties of `source` with the corresponding property values of `object`.
*
* **Note:** This method is equivalent to `_.conforms` when `source` is
* partially applied.
*
* @static
* @memberOf _
* @since 4.14.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property predicates to conform to.
* @returns {boolean} Returns `true` if `object` conforms, else `false`.
* @example
*
* var object = { 'a': 1, 'b': 2 };
*
* _.conformsTo(object, { 'b': function(n) { return n > 1; } });
* // => true
*
* _.conformsTo(object, { 'b': function(n) { return n > 2; } });
* // => false
*/
function conformsTo(object, source) {
return source == null || baseConformsTo(object, source, keys(source));
}
/**
* Performs a
* [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
* comparison between two values to determine if they are equivalent.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.eq(object, object);
* // => true
*
* _.eq(object, other);
* // => false
*
* _.eq('a', 'a');
* // => true
*
* _.eq('a', Object('a'));
* // => false
*
* _.eq(NaN, NaN);
* // => true
*/
function eq(value, other) {
return value === other || (value !== value && other !== other);
}
/**
* Checks if `value` is greater than `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than `other`,
* else `false`.
* @see _.lt
* @example
*
* _.gt(3, 1);
* // => true
*
* _.gt(3, 3);
* // => false
*
* _.gt(1, 3);
* // => false
*/
var gt = createRelationalOperation(baseGt);
/**
* Checks if `value` is greater than or equal to `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is greater than or equal to
* `other`, else `false`.
* @see _.lte
* @example
*
* _.gte(3, 1);
* // => true
*
* _.gte(3, 3);
* // => true
*
* _.gte(1, 3);
* // => false
*/
var gte = createRelationalOperation(function(value, other) {
return value >= other;
});
/**
* Checks if `value` is likely an `arguments` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an `arguments` object,
* else `false`.
* @example
*
* _.isArguments(function() { return arguments; }());
* // => true
*
* _.isArguments([1, 2, 3]);
* // => false
*/
var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
!propertyIsEnumerable.call(value, 'callee');
};
/**
* Checks if `value` is classified as an `Array` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array, else `false`.
* @example
*
* _.isArray([1, 2, 3]);
* // => true
*
* _.isArray(document.body.children);
* // => false
*
* _.isArray('abc');
* // => false
*
* _.isArray(_.noop);
* // => false
*/
var isArray = Array.isArray;
/**
* Checks if `value` is classified as an `ArrayBuffer` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
* @example
*
* _.isArrayBuffer(new ArrayBuffer(2));
* // => true
*
* _.isArrayBuffer(new Array(2));
* // => false
*/
var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
/**
* Checks if `value` is array-like. A value is considered array-like if it's
* not a function and has a `value.length` that's an integer greater than or
* equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is array-like, else `false`.
* @example
*
* _.isArrayLike([1, 2, 3]);
* // => true
*
* _.isArrayLike(document.body.children);
* // => true
*
* _.isArrayLike('abc');
* // => true
*
* _.isArrayLike(_.noop);
* // => false
*/
function isArrayLike(value) {
return value != null && isLength(value.length) && !isFunction(value);
}
/**
* This method is like `_.isArrayLike` except that it also checks if `value`
* is an object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an array-like object,
* else `false`.
* @example
*
* _.isArrayLikeObject([1, 2, 3]);
* // => true
*
* _.isArrayLikeObject(document.body.children);
* // => true
*
* _.isArrayLikeObject('abc');
* // => false
*
* _.isArrayLikeObject(_.noop);
* // => false
*/
function isArrayLikeObject(value) {
return isObjectLike(value) && isArrayLike(value);
}
/**
* Checks if `value` is classified as a boolean primitive or object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
* @example
*
* _.isBoolean(false);
* // => true
*
* _.isBoolean(null);
* // => false
*/
function isBoolean(value) {
return value === true || value === false ||
(isObjectLike(value) && baseGetTag(value) == boolTag);
}
/**
* Checks if `value` is a buffer.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
* @example
*
* _.isBuffer(new Buffer(2));
* // => true
*
* _.isBuffer(new Uint8Array(2));
* // => false
*/
var isBuffer = nativeIsBuffer || stubFalse;
/**
* Checks if `value` is classified as a `Date` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a date object, else `false`.
* @example
*
* _.isDate(new Date);
* // => true
*
* _.isDate('Mon April 23 2012');
* // => false
*/
var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
/**
* Checks if `value` is likely a DOM element.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
* @example
*
* _.isElement(document.body);
* // => true
*
* _.isElement('');
* // => false
*/
function isElement(value) {
return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
}
/**
* Checks if `value` is an empty object, collection, map, or set.
*
* Objects are considered empty if they have no own enumerable string keyed
* properties.
*
* Array-like values such as `arguments` objects, arrays, buffers, strings, or
* jQuery-like collections are considered empty if they have a `length` of `0`.
* Similarly, maps and sets are considered empty if they have a `size` of `0`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is empty, else `false`.
* @example
*
* _.isEmpty(null);
* // => true
*
* _.isEmpty(true);
* // => true
*
* _.isEmpty(1);
* // => true
*
* _.isEmpty([1, 2, 3]);
* // => false
*
* _.isEmpty({ 'a': 1 });
* // => false
*/
function isEmpty(value) {
if (value == null) {
return true;
}
if (isArrayLike(value) &&
(isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
isBuffer(value) || isTypedArray(value) || isArguments(value))) {
return !value.length;
}
var tag = getTag(value);
if (tag == mapTag || tag == setTag) {
return !value.size;
}
if (isPrototype(value)) {
return !baseKeys(value).length;
}
for (var key in value) {
if (hasOwnProperty.call(value, key)) {
return false;
}
}
return true;
}
/**
* Performs a deep comparison between two values to determine if they are
* equivalent.
*
* **Note:** This method supports comparing arrays, array buffers, booleans,
* date objects, error objects, maps, numbers, `Object` objects, regexes,
* sets, strings, symbols, and typed arrays. `Object` objects are compared
* by their own, not inherited, enumerable properties. Functions and DOM
* nodes are compared by strict equality, i.e. `===`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* var object = { 'a': 1 };
* var other = { 'a': 1 };
*
* _.isEqual(object, other);
* // => true
*
* object === other;
* // => false
*/
function isEqual(value, other) {
return baseIsEqual(value, other);
}
/**
* This method is like `_.isEqual` except that it accepts `customizer` which
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
* are handled by the method instead. The `customizer` is invoked with up to
* six arguments: (objValue, othValue [, index|key, object, other, stack]).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if the values are equivalent, else `false`.
* @example
*
* function isGreeting(value) {
* return /^h(?:i|ello)$/.test(value);
* }
*
* function customizer(objValue, othValue) {
* if (isGreeting(objValue) && isGreeting(othValue)) {
* return true;
* }
* }
*
* var array = ['hello', 'goodbye'];
* var other = ['hi', 'goodbye'];
*
* _.isEqualWith(array, other, customizer);
* // => true
*/
function isEqualWith(value, other, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
var result = customizer ? customizer(value, other) : undefined;
return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
}
/**
* Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
* `SyntaxError`, `TypeError`, or `URIError` object.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an error object, else `false`.
* @example
*
* _.isError(new Error);
* // => true
*
* _.isError(Error);
* // => false
*/
function isError(value) {
if (!isObjectLike(value)) {
return false;
}
var tag = baseGetTag(value);
return tag == errorTag || tag == domExcTag ||
(typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
}
/**
* Checks if `value` is a finite primitive number.
*
* **Note:** This method is based on
* [`Number.isFinite`](https://mdn.io/Number/isFinite).
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
* @example
*
* _.isFinite(3);
* // => true
*
* _.isFinite(Number.MIN_VALUE);
* // => true
*
* _.isFinite(Infinity);
* // => false
*
* _.isFinite('3');
* // => false
*/
function isFinite(value) {
return typeof value == 'number' && nativeIsFinite(value);
}
/**
* Checks if `value` is classified as a `Function` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a function, else `false`.
* @example
*
* _.isFunction(_);
* // => true
*
* _.isFunction(/abc/);
* // => false
*/
function isFunction(value) {
if (!isObject(value)) {
return false;
}
// The use of `Object#toString` avoids issues with the `typeof` operator
// in Safari 9 which returns 'object' for typed arrays and other constructors.
var tag = baseGetTag(value);
return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
}
/**
* Checks if `value` is an integer.
*
* **Note:** This method is based on
* [`Number.isInteger`](https://mdn.io/Number/isInteger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an integer, else `false`.
* @example
*
* _.isInteger(3);
* // => true
*
* _.isInteger(Number.MIN_VALUE);
* // => false
*
* _.isInteger(Infinity);
* // => false
*
* _.isInteger('3');
* // => false
*/
function isInteger(value) {
return typeof value == 'number' && value == toInteger(value);
}
/**
* Checks if `value` is a valid array-like length.
*
* **Note:** This method is loosely based on
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
* @example
*
* _.isLength(3);
* // => true
*
* _.isLength(Number.MIN_VALUE);
* // => false
*
* _.isLength(Infinity);
* // => false
*
* _.isLength('3');
* // => false
*/
function isLength(value) {
return typeof value == 'number' &&
value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
}
/**
* Checks if `value` is the
* [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
* of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is an object, else `false`.
* @example
*
* _.isObject({});
* // => true
*
* _.isObject([1, 2, 3]);
* // => true
*
* _.isObject(_.noop);
* // => true
*
* _.isObject(null);
* // => false
*/
function isObject(value) {
var type = typeof value;
return value != null && (type == 'object' || type == 'function');
}
/**
* Checks if `value` is object-like. A value is object-like if it's not `null`
* and has a `typeof` result of "object".
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is object-like, else `false`.
* @example
*
* _.isObjectLike({});
* // => true
*
* _.isObjectLike([1, 2, 3]);
* // => true
*
* _.isObjectLike(_.noop);
* // => false
*
* _.isObjectLike(null);
* // => false
*/
function isObjectLike(value) {
return value != null && typeof value == 'object';
}
/**
* Checks if `value` is classified as a `Map` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a map, else `false`.
* @example
*
* _.isMap(new Map);
* // => true
*
* _.isMap(new WeakMap);
* // => false
*/
var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
/**
* Performs a partial deep comparison between `object` and `source` to
* determine if `object` contains equivalent property values.
*
* **Note:** This method is equivalent to `_.matches` when `source` is
* partially applied.
*
* Partial comparisons will match empty array and empty object `source`
* values against any array or object value, respectively. See `_.isEqual`
* for a list of supported value comparisons.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
* @example
*
* var object = { 'a': 1, 'b': 2 };
*
* _.isMatch(object, { 'b': 2 });
* // => true
*
* _.isMatch(object, { 'b': 1 });
* // => false
*/
function isMatch(object, source) {
return object === source || baseIsMatch(object, source, getMatchData(source));
}
/**
* This method is like `_.isMatch` except that it accepts `customizer` which
* is invoked to compare values. If `customizer` returns `undefined`, comparisons
* are handled by the method instead. The `customizer` is invoked with five
* arguments: (objValue, srcValue, index|key, object, source).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {Object} object The object to inspect.
* @param {Object} source The object of property values to match.
* @param {Function} [customizer] The function to customize comparisons.
* @returns {boolean} Returns `true` if `object` is a match, else `false`.
* @example
*
* function isGreeting(value) {
* return /^h(?:i|ello)$/.test(value);
* }
*
* function customizer(objValue, srcValue) {
* if (isGreeting(objValue) && isGreeting(srcValue)) {
* return true;
* }
* }
*
* var object = { 'greeting': 'hello' };
* var source = { 'greeting': 'hi' };
*
* _.isMatchWith(object, source, customizer);
* // => true
*/
function isMatchWith(object, source, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return baseIsMatch(object, source, getMatchData(source), customizer);
}
/**
* Checks if `value` is `NaN`.
*
* **Note:** This method is based on
* [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
* global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
* `undefined` and other non-number values.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
* @example
*
* _.isNaN(NaN);
* // => true
*
* _.isNaN(new Number(NaN));
* // => true
*
* isNaN(undefined);
* // => true
*
* _.isNaN(undefined);
* // => false
*/
function isNaN(value) {
// An `NaN` primitive is the only value that is not equal to itself.
// Perform the `toStringTag` check first to avoid errors with some
// ActiveX objects in IE.
return isNumber(value) && value != +value;
}
/**
* Checks if `value` is a pristine native function.
*
* **Note:** This method can't reliably detect native functions in the presence
* of the core-js package because core-js circumvents this kind of detection.
* Despite multiple requests, the core-js maintainer has made it clear: any
* attempt to fix the detection will be obstructed. As a result, we're left
* with little choice but to throw an error. Unfortunately, this also affects
* packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
* which rely on core-js.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a native function,
* else `false`.
* @example
*
* _.isNative(Array.prototype.push);
* // => true
*
* _.isNative(_);
* // => false
*/
function isNative(value) {
if (isMaskable(value)) {
throw new Error(CORE_ERROR_TEXT);
}
return baseIsNative(value);
}
/**
* Checks if `value` is `null`.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `null`, else `false`.
* @example
*
* _.isNull(null);
* // => true
*
* _.isNull(void 0);
* // => false
*/
function isNull(value) {
return value === null;
}
/**
* Checks if `value` is `null` or `undefined`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is nullish, else `false`.
* @example
*
* _.isNil(null);
* // => true
*
* _.isNil(void 0);
* // => true
*
* _.isNil(NaN);
* // => false
*/
function isNil(value) {
return value == null;
}
/**
* Checks if `value` is classified as a `Number` primitive or object.
*
* **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
* classified as numbers, use the `_.isFinite` method.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a number, else `false`.
* @example
*
* _.isNumber(3);
* // => true
*
* _.isNumber(Number.MIN_VALUE);
* // => true
*
* _.isNumber(Infinity);
* // => true
*
* _.isNumber('3');
* // => false
*/
function isNumber(value) {
return typeof value == 'number' ||
(isObjectLike(value) && baseGetTag(value) == numberTag);
}
/**
* Checks if `value` is a plain object, that is, an object created by the
* `Object` constructor or one with a `[[Prototype]]` of `null`.
*
* @static
* @memberOf _
* @since 0.8.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* _.isPlainObject(new Foo);
* // => false
*
* _.isPlainObject([1, 2, 3]);
* // => false
*
* _.isPlainObject({ 'x': 0, 'y': 0 });
* // => true
*
* _.isPlainObject(Object.create(null));
* // => true
*/
function isPlainObject(value) {
if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
return false;
}
var proto = getPrototype(value);
if (proto === null) {
return true;
}
var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
return typeof Ctor == 'function' && Ctor instanceof Ctor &&
funcToString.call(Ctor) == objectCtorString;
}
/**
* Checks if `value` is classified as a `RegExp` object.
*
* @static
* @memberOf _
* @since 0.1.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
* @example
*
* _.isRegExp(/abc/);
* // => true
*
* _.isRegExp('/abc/');
* // => false
*/
var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
/**
* Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
* double precision number which isn't the result of a rounded unsafe integer.
*
* **Note:** This method is based on
* [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
* @example
*
* _.isSafeInteger(3);
* // => true
*
* _.isSafeInteger(Number.MIN_VALUE);
* // => false
*
* _.isSafeInteger(Infinity);
* // => false
*
* _.isSafeInteger('3');
* // => false
*/
function isSafeInteger(value) {
return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
}
/**
* Checks if `value` is classified as a `Set` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a set, else `false`.
* @example
*
* _.isSet(new Set);
* // => true
*
* _.isSet(new WeakSet);
* // => false
*/
var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
/**
* Checks if `value` is classified as a `String` primitive or object.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a string, else `false`.
* @example
*
* _.isString('abc');
* // => true
*
* _.isString(1);
* // => false
*/
function isString(value) {
return typeof value == 'string' ||
(!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
}
/**
* Checks if `value` is classified as a `Symbol` primitive or object.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
* @example
*
* _.isSymbol(Symbol.iterator);
* // => true
*
* _.isSymbol('abc');
* // => false
*/
function isSymbol(value) {
return typeof value == 'symbol' ||
(isObjectLike(value) && baseGetTag(value) == symbolTag);
}
/**
* Checks if `value` is classified as a typed array.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
* @example
*
* _.isTypedArray(new Uint8Array);
* // => true
*
* _.isTypedArray([]);
* // => false
*/
var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
/**
* Checks if `value` is `undefined`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
* @example
*
* _.isUndefined(void 0);
* // => true
*
* _.isUndefined(null);
* // => false
*/
function isUndefined(value) {
return value === undefined;
}
/**
* Checks if `value` is classified as a `WeakMap` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
* @example
*
* _.isWeakMap(new WeakMap);
* // => true
*
* _.isWeakMap(new Map);
* // => false
*/
function isWeakMap(value) {
return isObjectLike(value) && getTag(value) == weakMapTag;
}
/**
* Checks if `value` is classified as a `WeakSet` object.
*
* @static
* @memberOf _
* @since 4.3.0
* @category Lang
* @param {*} value The value to check.
* @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
* @example
*
* _.isWeakSet(new WeakSet);
* // => true
*
* _.isWeakSet(new Set);
* // => false
*/
function isWeakSet(value) {
return isObjectLike(value) && baseGetTag(value) == weakSetTag;
}
/**
* Checks if `value` is less than `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than `other`,
* else `false`.
* @see _.gt
* @example
*
* _.lt(1, 3);
* // => true
*
* _.lt(3, 3);
* // => false
*
* _.lt(3, 1);
* // => false
*/
var lt = createRelationalOperation(baseLt);
/**
* Checks if `value` is less than or equal to `other`.
*
* @static
* @memberOf _
* @since 3.9.0
* @category Lang
* @param {*} value The value to compare.
* @param {*} other The other value to compare.
* @returns {boolean} Returns `true` if `value` is less than or equal to
* `other`, else `false`.
* @see _.gte
* @example
*
* _.lte(1, 3);
* // => true
*
* _.lte(3, 3);
* // => true
*
* _.lte(3, 1);
* // => false
*/
var lte = createRelationalOperation(function(value, other) {
return value <= other;
});
/**
* Converts `value` to an array.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Lang
* @param {*} value The value to convert.
* @returns {Array} Returns the converted array.
* @example
*
* _.toArray({ 'a': 1, 'b': 2 });
* // => [1, 2]
*
* _.toArray('abc');
* // => ['a', 'b', 'c']
*
* _.toArray(1);
* // => []
*
* _.toArray(null);
* // => []
*/
function toArray(value) {
if (!value) {
return [];
}
if (isArrayLike(value)) {
return isString(value) ? stringToArray(value) : copyArray(value);
}
if (symIterator && value[symIterator]) {
return iteratorToArray(value[symIterator]());
}
var tag = getTag(value),
func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
return func(value);
}
/**
* Converts `value` to a finite number.
*
* @static
* @memberOf _
* @since 4.12.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted number.
* @example
*
* _.toFinite(3.2);
* // => 3.2
*
* _.toFinite(Number.MIN_VALUE);
* // => 5e-324
*
* _.toFinite(Infinity);
* // => 1.7976931348623157e+308
*
* _.toFinite('3.2');
* // => 3.2
*/
function toFinite(value) {
if (!value) {
return value === 0 ? value : 0;
}
value = toNumber(value);
if (value === INFINITY || value === -INFINITY) {
var sign = (value < 0 ? -1 : 1);
return sign * MAX_INTEGER;
}
return value === value ? value : 0;
}
/**
* Converts `value` to an integer.
*
* **Note:** This method is loosely based on
* [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toInteger(3.2);
* // => 3
*
* _.toInteger(Number.MIN_VALUE);
* // => 0
*
* _.toInteger(Infinity);
* // => 1.7976931348623157e+308
*
* _.toInteger('3.2');
* // => 3
*/
function toInteger(value) {
var result = toFinite(value),
remainder = result % 1;
return result === result ? (remainder ? result - remainder : result) : 0;
}
/**
* Converts `value` to an integer suitable for use as the length of an
* array-like object.
*
* **Note:** This method is based on
* [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toLength(3.2);
* // => 3
*
* _.toLength(Number.MIN_VALUE);
* // => 0
*
* _.toLength(Infinity);
* // => 4294967295
*
* _.toLength('3.2');
* // => 3
*/
function toLength(value) {
return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
}
/**
* Converts `value` to a number.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to process.
* @returns {number} Returns the number.
* @example
*
* _.toNumber(3.2);
* // => 3.2
*
* _.toNumber(Number.MIN_VALUE);
* // => 5e-324
*
* _.toNumber(Infinity);
* // => Infinity
*
* _.toNumber('3.2');
* // => 3.2
*/
function toNumber(value) {
if (typeof value == 'number') {
return value;
}
if (isSymbol(value)) {
return NAN;
}
if (isObject(value)) {
var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
value = isObject(other) ? (other + '') : other;
}
if (typeof value != 'string') {
return value === 0 ? value : +value;
}
value = value.replace(reTrim, '');
var isBinary = reIsBinary.test(value);
return (isBinary || reIsOctal.test(value))
? freeParseInt(value.slice(2), isBinary ? 2 : 8)
: (reIsBadHex.test(value) ? NAN : +value);
}
/**
* Converts `value` to a plain object flattening inherited enumerable string
* keyed properties of `value` to own properties of the plain object.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {Object} Returns the converted plain object.
* @example
*
* function Foo() {
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.assign({ 'a': 1 }, new Foo);
* // => { 'a': 1, 'b': 2 }
*
* _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
* // => { 'a': 1, 'b': 2, 'c': 3 }
*/
function toPlainObject(value) {
return copyObject(value, keysIn(value));
}
/**
* Converts `value` to a safe integer. A safe integer can be compared and
* represented correctly.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {number} Returns the converted integer.
* @example
*
* _.toSafeInteger(3.2);
* // => 3
*
* _.toSafeInteger(Number.MIN_VALUE);
* // => 0
*
* _.toSafeInteger(Infinity);
* // => 9007199254740991
*
* _.toSafeInteger('3.2');
* // => 3
*/
function toSafeInteger(value) {
return value
? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
: (value === 0 ? value : 0);
}
/**
* Converts `value` to a string. An empty string is returned for `null`
* and `undefined` values. The sign of `-0` is preserved.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Lang
* @param {*} value The value to convert.
* @returns {string} Returns the converted string.
* @example
*
* _.toString(null);
* // => ''
*
* _.toString(-0);
* // => '-0'
*
* _.toString([1, 2, 3]);
* // => '1,2,3'
*/
function toString(value) {
return value == null ? '' : baseToString(value);
}
/*------------------------------------------------------------------------*/
/**
* Assigns own enumerable string keyed properties of source objects to the
* destination object. Source objects are applied from left to right.
* Subsequent sources overwrite property assignments of previous sources.
*
* **Note:** This method mutates `object` and is loosely based on
* [`Object.assign`](https://mdn.io/Object/assign).
*
* @static
* @memberOf _
* @since 0.10.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.assignIn
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* function Bar() {
* this.c = 3;
* }
*
* Foo.prototype.b = 2;
* Bar.prototype.d = 4;
*
* _.assign({ 'a': 0 }, new Foo, new Bar);
* // => { 'a': 1, 'c': 3 }
*/
var assign = createAssigner(function(object, source) {
if (isPrototype(source) || isArrayLike(source)) {
copyObject(source, keys(source), object);
return;
}
for (var key in source) {
if (hasOwnProperty.call(source, key)) {
assignValue(object, key, source[key]);
}
}
});
/**
* This method is like `_.assign` except that it iterates over own and
* inherited source properties.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias extend
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.assign
* @example
*
* function Foo() {
* this.a = 1;
* }
*
* function Bar() {
* this.c = 3;
* }
*
* Foo.prototype.b = 2;
* Bar.prototype.d = 4;
*
* _.assignIn({ 'a': 0 }, new Foo, new Bar);
* // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
*/
var assignIn = createAssigner(function(object, source) {
copyObject(source, keysIn(source), object);
});
/**
* This method is like `_.assignIn` except that it accepts `customizer`
* which is invoked to produce the assigned values. If `customizer` returns
* `undefined`, assignment is handled by the method instead. The `customizer`
* is invoked with five arguments: (objValue, srcValue, key, object, source).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias extendWith
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @see _.assignWith
* @example
*
* function customizer(objValue, srcValue) {
* return _.isUndefined(objValue) ? srcValue : objValue;
* }
*
* var defaults = _.partialRight(_.assignInWith, customizer);
*
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
copyObject(source, keysIn(source), object, customizer);
});
/**
* This method is like `_.assign` except that it accepts `customizer`
* which is invoked to produce the assigned values. If `customizer` returns
* `undefined`, assignment is handled by the method instead. The `customizer`
* is invoked with five arguments: (objValue, srcValue, key, object, source).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @see _.assignInWith
* @example
*
* function customizer(objValue, srcValue) {
* return _.isUndefined(objValue) ? srcValue : objValue;
* }
*
* var defaults = _.partialRight(_.assignWith, customizer);
*
* defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
copyObject(source, keys(source), object, customizer);
});
/**
* Creates an array of values corresponding to `paths` of `object`.
*
* @static
* @memberOf _
* @since 1.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Array} Returns the picked values.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
*
* _.at(object, ['a[0].b.c', 'a[1]']);
* // => [3, 4]
*/
var at = flatRest(baseAt);
/**
* Creates an object that inherits from the `prototype` object. If a
* `properties` object is given, its own enumerable string keyed properties
* are assigned to the created object.
*
* @static
* @memberOf _
* @since 2.3.0
* @category Object
* @param {Object} prototype The object to inherit from.
* @param {Object} [properties] The properties to assign to the object.
* @returns {Object} Returns the new object.
* @example
*
* function Shape() {
* this.x = 0;
* this.y = 0;
* }
*
* function Circle() {
* Shape.call(this);
* }
*
* Circle.prototype = _.create(Shape.prototype, {
* 'constructor': Circle
* });
*
* var circle = new Circle;
* circle instanceof Circle;
* // => true
*
* circle instanceof Shape;
* // => true
*/
function create(prototype, properties) {
var result = baseCreate(prototype);
return properties == null ? result : baseAssign(result, properties);
}
/**
* Assigns own and inherited enumerable string keyed properties of source
* objects to the destination object for all destination properties that
* resolve to `undefined`. Source objects are applied from left to right.
* Once a property is set, additional values of the same property are ignored.
*
* **Note:** This method mutates `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.defaultsDeep
* @example
*
* _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
* // => { 'a': 1, 'b': 2 }
*/
var defaults = baseRest(function(object, sources) {
object = Object(object);
var index = -1;
var length = sources.length;
var guard = length > 2 ? sources[2] : undefined;
if (guard && isIterateeCall(sources[0], sources[1], guard)) {
length = 1;
}
while (++index < length) {
var source = sources[index];
var props = keysIn(source);
var propsIndex = -1;
var propsLength = props.length;
while (++propsIndex < propsLength) {
var key = props[propsIndex];
var value = object[key];
if (value === undefined ||
(eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {
object[key] = source[key];
}
}
}
return object;
});
/**
* This method is like `_.defaults` except that it recursively assigns
* default properties.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 3.10.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @see _.defaults
* @example
*
* _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
* // => { 'a': { 'b': 2, 'c': 3 } }
*/
var defaultsDeep = baseRest(function(args) {
args.push(undefined, customDefaultsMerge);
return apply(mergeWith, undefined, args);
});
/**
* This method is like `_.find` except that it returns the key of the first
* element `predicate` returns truthy for instead of the element itself.
*
* @static
* @memberOf _
* @since 1.1.0
* @category Object
* @param {Object} object The object to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {string|undefined} Returns the key of the matched element,
* else `undefined`.
* @example
*
* var users = {
* 'barney': { 'age': 36, 'active': true },
* 'fred': { 'age': 40, 'active': false },
* 'pebbles': { 'age': 1, 'active': true }
* };
*
* _.findKey(users, function(o) { return o.age < 40; });
* // => 'barney' (iteration order is not guaranteed)
*
* // The `_.matches` iteratee shorthand.
* _.findKey(users, { 'age': 1, 'active': true });
* // => 'pebbles'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findKey(users, ['active', false]);
* // => 'fred'
*
* // The `_.property` iteratee shorthand.
* _.findKey(users, 'active');
* // => 'barney'
*/
function findKey(object, predicate) {
return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
}
/**
* This method is like `_.findKey` except that it iterates over elements of
* a collection in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to inspect.
* @param {Function} [predicate=_.identity] The function invoked per iteration.
* @returns {string|undefined} Returns the key of the matched element,
* else `undefined`.
* @example
*
* var users = {
* 'barney': { 'age': 36, 'active': true },
* 'fred': { 'age': 40, 'active': false },
* 'pebbles': { 'age': 1, 'active': true }
* };
*
* _.findLastKey(users, function(o) { return o.age < 40; });
* // => returns 'pebbles' assuming `_.findKey` returns 'barney'
*
* // The `_.matches` iteratee shorthand.
* _.findLastKey(users, { 'age': 36, 'active': true });
* // => 'barney'
*
* // The `_.matchesProperty` iteratee shorthand.
* _.findLastKey(users, ['active', false]);
* // => 'fred'
*
* // The `_.property` iteratee shorthand.
* _.findLastKey(users, 'active');
* // => 'pebbles'
*/
function findLastKey(object, predicate) {
return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
}
/**
* Iterates over own and inherited enumerable string keyed properties of an
* object and invokes `iteratee` for each property. The iteratee is invoked
* with three arguments: (value, key, object). Iteratee functions may exit
* iteration early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 0.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forInRight
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forIn(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
*/
function forIn(object, iteratee) {
return object == null
? object
: baseFor(object, getIteratee(iteratee, 3), keysIn);
}
/**
* This method is like `_.forIn` except that it iterates over properties of
* `object` in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forIn
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forInRight(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
*/
function forInRight(object, iteratee) {
return object == null
? object
: baseForRight(object, getIteratee(iteratee, 3), keysIn);
}
/**
* Iterates over own enumerable string keyed properties of an object and
* invokes `iteratee` for each property. The iteratee is invoked with three
* arguments: (value, key, object). Iteratee functions may exit iteration
* early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 0.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forOwnRight
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forOwn(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'a' then 'b' (iteration order is not guaranteed).
*/
function forOwn(object, iteratee) {
return object && baseForOwn(object, getIteratee(iteratee, 3));
}
/**
* This method is like `_.forOwn` except that it iterates over properties of
* `object` in the opposite order.
*
* @static
* @memberOf _
* @since 2.0.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns `object`.
* @see _.forOwn
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.forOwnRight(new Foo, function(value, key) {
* console.log(key);
* });
* // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
*/
function forOwnRight(object, iteratee) {
return object && baseForOwnRight(object, getIteratee(iteratee, 3));
}
/**
* Creates an array of function property names from own enumerable properties
* of `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to inspect.
* @returns {Array} Returns the function names.
* @see _.functionsIn
* @example
*
* function Foo() {
* this.a = _.constant('a');
* this.b = _.constant('b');
* }
*
* Foo.prototype.c = _.constant('c');
*
* _.functions(new Foo);
* // => ['a', 'b']
*/
function functions(object) {
return object == null ? [] : baseFunctions(object, keys(object));
}
/**
* Creates an array of function property names from own and inherited
* enumerable properties of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to inspect.
* @returns {Array} Returns the function names.
* @see _.functions
* @example
*
* function Foo() {
* this.a = _.constant('a');
* this.b = _.constant('b');
* }
*
* Foo.prototype.c = _.constant('c');
*
* _.functionsIn(new Foo);
* // => ['a', 'b', 'c']
*/
function functionsIn(object) {
return object == null ? [] : baseFunctions(object, keysIn(object));
}
/**
* Gets the value at `path` of `object`. If the resolved value is
* `undefined`, the `defaultValue` is returned in its place.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to get.
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
* @returns {*} Returns the resolved value.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.get(object, 'a[0].b.c');
* // => 3
*
* _.get(object, ['a', '0', 'b', 'c']);
* // => 3
*
* _.get(object, 'a.b.c', 'default');
* // => 'default'
*/
function get(object, path, defaultValue) {
var result = object == null ? undefined : baseGet(object, path);
return result === undefined ? defaultValue : result;
}
/**
* Checks if `path` is a direct property of `object`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
* @example
*
* var object = { 'a': { 'b': 2 } };
* var other = _.create({ 'a': _.create({ 'b': 2 }) });
*
* _.has(object, 'a');
* // => true
*
* _.has(object, 'a.b');
* // => true
*
* _.has(object, ['a', 'b']);
* // => true
*
* _.has(other, 'a');
* // => false
*/
function has(object, path) {
return object != null && hasPath(object, path, baseHas);
}
/**
* Checks if `path` is a direct or inherited property of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path to check.
* @returns {boolean} Returns `true` if `path` exists, else `false`.
* @example
*
* var object = _.create({ 'a': _.create({ 'b': 2 }) });
*
* _.hasIn(object, 'a');
* // => true
*
* _.hasIn(object, 'a.b');
* // => true
*
* _.hasIn(object, ['a', 'b']);
* // => true
*
* _.hasIn(object, 'b');
* // => false
*/
function hasIn(object, path) {
return object != null && hasPath(object, path, baseHasIn);
}
/**
* Creates an object composed of the inverted keys and values of `object`.
* If `object` contains duplicate values, subsequent values overwrite
* property assignments of previous values.
*
* @static
* @memberOf _
* @since 0.7.0
* @category Object
* @param {Object} object The object to invert.
* @returns {Object} Returns the new inverted object.
* @example
*
* var object = { 'a': 1, 'b': 2, 'c': 1 };
*
* _.invert(object);
* // => { '1': 'c', '2': 'b' }
*/
var invert = createInverter(function(result, value, key) {
if (value != null &&
typeof value.toString != 'function') {
value = nativeObjectToString.call(value);
}
result[value] = key;
}, constant(identity));
/**
* This method is like `_.invert` except that the inverted object is generated
* from the results of running each element of `object` thru `iteratee`. The
* corresponding inverted value of each inverted key is an array of keys
* responsible for generating the inverted value. The iteratee is invoked
* with one argument: (value).
*
* @static
* @memberOf _
* @since 4.1.0
* @category Object
* @param {Object} object The object to invert.
* @param {Function} [iteratee=_.identity] The iteratee invoked per element.
* @returns {Object} Returns the new inverted object.
* @example
*
* var object = { 'a': 1, 'b': 2, 'c': 1 };
*
* _.invertBy(object);
* // => { '1': ['a', 'c'], '2': ['b'] }
*
* _.invertBy(object, function(value) {
* return 'group' + value;
* });
* // => { 'group1': ['a', 'c'], 'group2': ['b'] }
*/
var invertBy = createInverter(function(result, value, key) {
if (value != null &&
typeof value.toString != 'function') {
value = nativeObjectToString.call(value);
}
if (hasOwnProperty.call(result, value)) {
result[value].push(key);
} else {
result[value] = [key];
}
}, getIteratee);
/**
* Invokes the method at `path` of `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the method to invoke.
* @param {...*} [args] The arguments to invoke the method with.
* @returns {*} Returns the result of the invoked method.
* @example
*
* var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
*
* _.invoke(object, 'a[0].b.c.slice', 1, 3);
* // => [2, 3]
*/
var invoke = baseRest(baseInvoke);
/**
* Creates an array of the own enumerable property names of `object`.
*
* **Note:** Non-object values are coerced to objects. See the
* [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
* for more details.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.keys(new Foo);
* // => ['a', 'b'] (iteration order is not guaranteed)
*
* _.keys('hi');
* // => ['0', '1']
*/
function keys(object) {
return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
}
/**
* Creates an array of the own and inherited enumerable property names of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property names.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.keysIn(new Foo);
* // => ['a', 'b', 'c'] (iteration order is not guaranteed)
*/
function keysIn(object) {
return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
}
/**
* The opposite of `_.mapValues`; this method creates an object with the
* same values as `object` and keys generated by running each own enumerable
* string keyed property of `object` thru `iteratee`. The iteratee is invoked
* with three arguments: (value, key, object).
*
* @static
* @memberOf _
* @since 3.8.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns the new mapped object.
* @see _.mapValues
* @example
*
* _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
* return key + value;
* });
* // => { 'a1': 1, 'b2': 2 }
*/
function mapKeys(object, iteratee) {
var result = {};
iteratee = getIteratee(iteratee, 3);
baseForOwn(object, function(value, key, object) {
baseAssignValue(result, iteratee(value, key, object), value);
});
return result;
}
/**
* Creates an object with the same keys as `object` and values generated
* by running each own enumerable string keyed property of `object` thru
* `iteratee`. The iteratee is invoked with three arguments:
* (value, key, object).
*
* @static
* @memberOf _
* @since 2.4.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @returns {Object} Returns the new mapped object.
* @see _.mapKeys
* @example
*
* var users = {
* 'fred': { 'user': 'fred', 'age': 40 },
* 'pebbles': { 'user': 'pebbles', 'age': 1 }
* };
*
* _.mapValues(users, function(o) { return o.age; });
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
*
* // The `_.property` iteratee shorthand.
* _.mapValues(users, 'age');
* // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
*/
function mapValues(object, iteratee) {
var result = {};
iteratee = getIteratee(iteratee, 3);
baseForOwn(object, function(value, key, object) {
baseAssignValue(result, key, iteratee(value, key, object));
});
return result;
}
/**
* This method is like `_.assign` except that it recursively merges own and
* inherited enumerable string keyed properties of source objects into the
* destination object. Source properties that resolve to `undefined` are
* skipped if a destination value exists. Array and plain object properties
* are merged recursively. Other objects and value types are overridden by
* assignment. Source objects are applied from left to right. Subsequent
* sources overwrite property assignments of previous sources.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 0.5.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} [sources] The source objects.
* @returns {Object} Returns `object`.
* @example
*
* var object = {
* 'a': [{ 'b': 2 }, { 'd': 4 }]
* };
*
* var other = {
* 'a': [{ 'c': 3 }, { 'e': 5 }]
* };
*
* _.merge(object, other);
* // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
*/
var merge = createAssigner(function(object, source, srcIndex) {
baseMerge(object, source, srcIndex);
});
/**
* This method is like `_.merge` except that it accepts `customizer` which
* is invoked to produce the merged values of the destination and source
* properties. If `customizer` returns `undefined`, merging is handled by the
* method instead. The `customizer` is invoked with six arguments:
* (objValue, srcValue, key, object, source, stack).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The destination object.
* @param {...Object} sources The source objects.
* @param {Function} customizer The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* function customizer(objValue, srcValue) {
* if (_.isArray(objValue)) {
* return objValue.concat(srcValue);
* }
* }
*
* var object = { 'a': [1], 'b': [2] };
* var other = { 'a': [3], 'b': [4] };
*
* _.mergeWith(object, other, customizer);
* // => { 'a': [1, 3], 'b': [2, 4] }
*/
var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
baseMerge(object, source, srcIndex, customizer);
});
/**
* The opposite of `_.pick`; this method creates an object composed of the
* own and inherited enumerable property paths of `object` that are not omitted.
*
* **Note:** This method is considerably slower than `_.pick`.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The source object.
* @param {...(string|string[])} [paths] The property paths to omit.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.omit(object, ['a', 'c']);
* // => { 'b': '2' }
*/
var omit = flatRest(function(object, paths) {
var result = {};
if (object == null) {
return result;
}
var isDeep = false;
paths = arrayMap(paths, function(path) {
path = castPath(path, object);
isDeep || (isDeep = path.length > 1);
return path;
});
copyObject(object, getAllKeysIn(object), result);
if (isDeep) {
result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
}
var length = paths.length;
while (length--) {
baseUnset(result, paths[length]);
}
return result;
});
/**
* The opposite of `_.pickBy`; this method creates an object composed of
* the own and inherited enumerable string keyed properties of `object` that
* `predicate` doesn't return truthy for. The predicate is invoked with two
* arguments: (value, key).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The source object.
* @param {Function} [predicate=_.identity] The function invoked per property.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.omitBy(object, _.isNumber);
* // => { 'b': '2' }
*/
function omitBy(object, predicate) {
return pickBy(object, negate(getIteratee(predicate)));
}
/**
* Creates an object composed of the picked `object` properties.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The source object.
* @param {...(string|string[])} [paths] The property paths to pick.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.pick(object, ['a', 'c']);
* // => { 'a': 1, 'c': 3 }
*/
var pick = flatRest(function(object, paths) {
return object == null ? {} : basePick(object, paths);
});
/**
* Creates an object composed of the `object` properties `predicate` returns
* truthy for. The predicate is invoked with two arguments: (value, key).
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The source object.
* @param {Function} [predicate=_.identity] The function invoked per property.
* @returns {Object} Returns the new object.
* @example
*
* var object = { 'a': 1, 'b': '2', 'c': 3 };
*
* _.pickBy(object, _.isNumber);
* // => { 'a': 1, 'c': 3 }
*/
function pickBy(object, predicate) {
if (object == null) {
return {};
}
var props = arrayMap(getAllKeysIn(object), function(prop) {
return [prop];
});
predicate = getIteratee(predicate);
return basePickBy(object, props, function(value, path) {
return predicate(value, path[0]);
});
}
/**
* This method is like `_.get` except that if the resolved value is a
* function it's invoked with the `this` binding of its parent object and
* its result is returned.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @param {Array|string} path The path of the property to resolve.
* @param {*} [defaultValue] The value returned for `undefined` resolved values.
* @returns {*} Returns the resolved value.
* @example
*
* var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
*
* _.result(object, 'a[0].b.c1');
* // => 3
*
* _.result(object, 'a[0].b.c2');
* // => 4
*
* _.result(object, 'a[0].b.c3', 'default');
* // => 'default'
*
* _.result(object, 'a[0].b.c3', _.constant('default'));
* // => 'default'
*/
function result(object, path, defaultValue) {
path = castPath(path, object);
var index = -1,
length = path.length;
// Ensure the loop is entered when path is empty.
if (!length) {
length = 1;
object = undefined;
}
while (++index < length) {
var value = object == null ? undefined : object[toKey(path[index])];
if (value === undefined) {
index = length;
value = defaultValue;
}
object = isFunction(value) ? value.call(object) : value;
}
return object;
}
/**
* Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
* it's created. Arrays are created for missing index properties while objects
* are created for all other missing properties. Use `_.setWith` to customize
* `path` creation.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 3.7.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @returns {Object} Returns `object`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.set(object, 'a[0].b.c', 4);
* console.log(object.a[0].b.c);
* // => 4
*
* _.set(object, ['x', '0', 'y', 'z'], 5);
* console.log(object.x[0].y.z);
* // => 5
*/
function set(object, path, value) {
return object == null ? object : baseSet(object, path, value);
}
/**
* This method is like `_.set` except that it accepts `customizer` which is
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
* path creation is handled by the method instead. The `customizer` is invoked
* with three arguments: (nsValue, key, nsObject).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {*} value The value to set.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* var object = {};
*
* _.setWith(object, '[0][1]', 'a', Object);
* // => { '0': { '1': 'a' } }
*/
function setWith(object, path, value, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return object == null ? object : baseSet(object, path, value, customizer);
}
/**
* Creates an array of own enumerable string keyed-value pairs for `object`
* which can be consumed by `_.fromPairs`. If `object` is a map or set, its
* entries are returned.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias entries
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the key-value pairs.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.toPairs(new Foo);
* // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
*/
var toPairs = createToPairs(keys);
/**
* Creates an array of own and inherited enumerable string keyed-value pairs
* for `object` which can be consumed by `_.fromPairs`. If `object` is a map
* or set, its entries are returned.
*
* @static
* @memberOf _
* @since 4.0.0
* @alias entriesIn
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the key-value pairs.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.toPairsIn(new Foo);
* // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
*/
var toPairsIn = createToPairs(keysIn);
/**
* An alternative to `_.reduce`; this method transforms `object` to a new
* `accumulator` object which is the result of running each of its own
* enumerable string keyed properties thru `iteratee`, with each invocation
* potentially mutating the `accumulator` object. If `accumulator` is not
* provided, a new object with the same `[[Prototype]]` will be used. The
* iteratee is invoked with four arguments: (accumulator, value, key, object).
* Iteratee functions may exit iteration early by explicitly returning `false`.
*
* @static
* @memberOf _
* @since 1.3.0
* @category Object
* @param {Object} object The object to iterate over.
* @param {Function} [iteratee=_.identity] The function invoked per iteration.
* @param {*} [accumulator] The custom accumulator value.
* @returns {*} Returns the accumulated value.
* @example
*
* _.transform([2, 3, 4], function(result, n) {
* result.push(n *= n);
* return n % 2 == 0;
* }, []);
* // => [4, 9]
*
* _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
* (result[value] || (result[value] = [])).push(key);
* }, {});
* // => { '1': ['a', 'c'], '2': ['b'] }
*/
function transform(object, iteratee, accumulator) {
var isArr = isArray(object),
isArrLike = isArr || isBuffer(object) || isTypedArray(object);
iteratee = getIteratee(iteratee, 4);
if (accumulator == null) {
var Ctor = object && object.constructor;
if (isArrLike) {
accumulator = isArr ? new Ctor : [];
}
else if (isObject(object)) {
accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
}
else {
accumulator = {};
}
}
(isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
return iteratee(accumulator, value, index, object);
});
return accumulator;
}
/**
* Removes the property at `path` of `object`.
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to unset.
* @returns {boolean} Returns `true` if the property is deleted, else `false`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 7 } }] };
* _.unset(object, 'a[0].b.c');
* // => true
*
* console.log(object);
* // => { 'a': [{ 'b': {} }] };
*
* _.unset(object, ['a', '0', 'b', 'c']);
* // => true
*
* console.log(object);
* // => { 'a': [{ 'b': {} }] };
*/
function unset(object, path) {
return object == null ? true : baseUnset(object, path);
}
/**
* This method is like `_.set` except that accepts `updater` to produce the
* value to set. Use `_.updateWith` to customize `path` creation. The `updater`
* is invoked with one argument: (value).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {Function} updater The function to produce the updated value.
* @returns {Object} Returns `object`.
* @example
*
* var object = { 'a': [{ 'b': { 'c': 3 } }] };
*
* _.update(object, 'a[0].b.c', function(n) { return n * n; });
* console.log(object.a[0].b.c);
* // => 9
*
* _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
* console.log(object.x[0].y.z);
* // => 0
*/
function update(object, path, updater) {
return object == null ? object : baseUpdate(object, path, castFunction(updater));
}
/**
* This method is like `_.update` except that it accepts `customizer` which is
* invoked to produce the objects of `path`. If `customizer` returns `undefined`
* path creation is handled by the method instead. The `customizer` is invoked
* with three arguments: (nsValue, key, nsObject).
*
* **Note:** This method mutates `object`.
*
* @static
* @memberOf _
* @since 4.6.0
* @category Object
* @param {Object} object The object to modify.
* @param {Array|string} path The path of the property to set.
* @param {Function} updater The function to produce the updated value.
* @param {Function} [customizer] The function to customize assigned values.
* @returns {Object} Returns `object`.
* @example
*
* var object = {};
*
* _.updateWith(object, '[0][1]', _.constant('a'), Object);
* // => { '0': { '1': 'a' } }
*/
function updateWith(object, path, updater, customizer) {
customizer = typeof customizer == 'function' ? customizer : undefined;
return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
}
/**
* Creates an array of the own enumerable string keyed property values of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @since 0.1.0
* @memberOf _
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property values.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.values(new Foo);
* // => [1, 2] (iteration order is not guaranteed)
*
* _.values('hi');
* // => ['h', 'i']
*/
function values(object) {
return object == null ? [] : baseValues(object, keys(object));
}
/**
* Creates an array of the own and inherited enumerable string keyed property
* values of `object`.
*
* **Note:** Non-object values are coerced to objects.
*
* @static
* @memberOf _
* @since 3.0.0
* @category Object
* @param {Object} object The object to query.
* @returns {Array} Returns the array of property values.
* @example
*
* function Foo() {
* this.a = 1;
* this.b = 2;
* }
*
* Foo.prototype.c = 3;
*
* _.valuesIn(new Foo);
* // => [1, 2, 3] (iteration order is not guaranteed)
*/
function valuesIn(object) {
return object == null ? [] : baseValues(object, keysIn(object));
}
/*------------------------------------------------------------------------*/
/**
* Clamps `number` within the inclusive `lower` and `upper` bounds.
*
* @static
* @memberOf _
* @since 4.0.0
* @category Number
* @param {number} number The number to clamp.
* @param {number} [lower] The lower bound.
* @param {number} upper The upper bound.
* @returns {number} Returns the clamped number.
* @example
*
* _.clamp(-10, -5, 5);
* // => -5
*
* _.clamp(10, -5, 5);
* // => 5
*/
function clamp(number, lower, upper) {
if (upper === undefined) {
upper = lower;
lower = undefined;
}
if (upper !== undefined) {
upper = toNumber(upper);
upper = upper === upper ? upper : 0;
}
if (lower !== undefined) {
lower = toNumber(lower);
lower = lower === lower ? lower : 0;
}
return baseClamp(toNumber(number), lower, upper);
}
/**
* Checks if `n` is between `start` and up to, but not including, `end`. If
* `end` is not specified, it's set to `start` with `start` then set to `0`.
* If `start` is greater than `end` the params are swapped to support
* negative ranges.
*
* @static
* @memberOf _
* @since 3.3.0
* @category Number
* @param {number} number The number to check.
* @param {number} [start=0] The start of the range.
* @param {number} end The end of the range.
* @returns {boolean} Returns `true` if `number` is in the range, else `false`.
* @see _.range, _.rangeRight
* @example
*
* _.inRange(3, 2, 4);
* // => true
*
* _.inRange(4, 8);
* // => true
*
* _.inRange(4, 2);
* // => false
*
* _.inRange(2, 2);
* // => false
*
* _.inRange(1.2, 2);
* // => true
*
* _.inRange(5.2, 4);
* // => false
*
* _.inRange(-3, -2, -6);
* // => true
*/
function inRange(number, start, end) {
start = toFinite(start);
if (end === undefined) {
end = start;
start = 0;
} else {
end = toFinite(end);
}
number = toNumber(number);
return baseInRange(number, start, end);
}
/**
* Produces a random number between the inclusive `lower` and `upper` bounds.
* If only one argument is provided a number between `0` and the given number
* is returned. If `floating` is `true`, or either `lower` or `upper` are
* floats, a floating-point number is returned instead of an integer.
*
* **Note:** JavaScript follows the IEEE-754 standard for resolving
* floating-point values which can produce unexpected results.
*
* @static
* @memberOf _
* @since 0.7.0
* @category Number
* @param {number} [lower=0] The lower bound.
* @param {number} [upper=1] The upper bound.
* @param {boolean} [floating] Specify returning a floating-point number.
* @returns {number} Returns the random number.
* @example
*
* _.random(0, 5);
* // => an integer between 0 and 5
*
* _.random(5);
* // => also an integer between 0 and 5
*
* _.random(5, true);
* // => a floating-point number between 0 and 5
*
* _.random(1.2, 5.2);
* // => a floating-point number between 1.2 and 5.2
*/
function random(lower, upper, floating) {
if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
upper = floating = undefined;
}
if (floating === undefined) {
if (typeof upper == 'boolean') {
floating = upper;
upper = undefined;
}
else if (typeof lower == 'boolean') {
floating = lower;
lower = undefined;
}
}
if (lower === undefined && upper === undefined) {
lower = 0;
upper = 1;
}
else {
lower = toFinite(lower);
if (upper === undefined) {
upper = lower;
lower = 0;
} else {
upper = toFinite(upper);
}
}
if (lower > upper) {
var temp = lower;
lower = upper;
upper = temp;
}
if (floating || lower % 1 || upper % 1) {
var rand = nativeRandom();
return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
}
return baseRandom(lower, upper);
}
/*------------------------------------------------------------------------*/
/**
* Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the camel cased string.
* @example
*
* _.camelCase('Foo Bar');
* // => 'fooBar'
*
* _.camelCase('--foo-bar--');
* // => 'fooBar'
*
* _.camelCase('__FOO_BAR__');
* // => 'fooBar'
*/
var camelCase = createCompounder(function(result, word, index) {
word = word.toLowerCase();
return result + (index ? capitalize(word) : word);
});
/**
* Converts the first character of `string` to upper case and the remaining
* to lower case.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to capitalize.
* @returns {string} Returns the capitalized string.
* @example
*
* _.capitalize('FRED');
* // => 'Fred'
*/
function capitalize(string) {
return upperFirst(toString(string).toLowerCase());
}
/**
* Deburrs `string` by converting
* [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
* and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
* letters to basic Latin letters and removing
* [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to deburr.
* @returns {string} Returns the deburred string.
* @example
*
* _.deburr('déjà vu');
* // => 'deja vu'
*/
function deburr(string) {
string = toString(string);
return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
}
/**
* Checks if `string` ends with the given target string.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to inspect.
* @param {string} [target] The string to search for.
* @param {number} [position=string.length] The position to search up to.
* @returns {boolean} Returns `true` if `string` ends with `target`,
* else `false`.
* @example
*
* _.endsWith('abc', 'c');
* // => true
*
* _.endsWith('abc', 'b');
* // => false
*
* _.endsWith('abc', 'b', 2);
* // => true
*/
function endsWith(string, target, position) {
string = toString(string);
target = baseToString(target);
var length = string.length;
position = position === undefined
? length
: baseClamp(toInteger(position), 0, length);
var end = position;
position -= target.length;
return position >= 0 && string.slice(position, end) == target;
}
/**
* Converts the characters "&", "<", ">", '"', and "'" in `string` to their
* corresponding HTML entities.
*
* **Note:** No other characters are escaped. To escape additional
* characters use a third-party library like [_he_](https://mths.be/he).
*
* Though the ">" character is escaped for symmetry, characters like
* ">" and "/" don't need escaping in HTML and have no special meaning
* unless they're part of a tag or unquoted attribute value. See
* [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
* (under "semi-related fun fact") for more details.
*
* When working with HTML you should always
* [quote attribute values](http://wonko.com/post/html-escaping) to reduce
* XSS vectors.
*
* @static
* @since 0.1.0
* @memberOf _
* @category String
* @param {string} [string=''] The string to escape.
* @returns {string} Returns the escaped string.
* @example
*
* _.escape('fred, barney, & pebbles');
* // => 'fred, barney, & pebbles'
*/
function escape(string) {
string = toString(string);
return (string && reHasUnescapedHtml.test(string))
? string.replace(reUnescapedHtml, escapeHtmlChar)
: string;
}
/**
* Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
* "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to escape.
* @returns {string} Returns the escaped string.
* @example
*
* _.escapeRegExp('[lodash](https://lodash.com/)');
* // => '\[lodash\]\(https://lodash\.com/\)'
*/
function escapeRegExp(string) {
string = toString(string);
return (string && reHasRegExpChar.test(string))
? string.replace(reRegExpChar, '\\$&')
: string;
}
/**
* Converts `string` to
* [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the kebab cased string.
* @example
*
* _.kebabCase('Foo Bar');
* // => 'foo-bar'
*
* _.kebabCase('fooBar');
* // => 'foo-bar'
*
* _.kebabCase('__FOO_BAR__');
* // => 'foo-bar'
*/
var kebabCase = createCompounder(function(result, word, index) {
return result + (index ? '-' : '') + word.toLowerCase();
});
/**
* Converts `string`, as space separated words, to lower case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the lower cased string.
* @example
*
* _.lowerCase('--Foo-Bar--');
* // => 'foo bar'
*
* _.lowerCase('fooBar');
* // => 'foo bar'
*
* _.lowerCase('__FOO_BAR__');
* // => 'foo bar'
*/
var lowerCase = createCompounder(function(result, word, index) {
return result + (index ? ' ' : '') + word.toLowerCase();
});
/**
* Converts the first character of `string` to lower case.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the converted string.
* @example
*
* _.lowerFirst('Fred');
* // => 'fred'
*
* _.lowerFirst('FRED');
* // => 'fRED'
*/
var lowerFirst = createCaseFirst('toLowerCase');
/**
* Pads `string` on the left and right sides if it's shorter than `length`.
* Padding characters are truncated if they can't be evenly divided by `length`.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.pad('abc', 8);
* // => ' abc '
*
* _.pad('abc', 8, '_-');
* // => '_-abc_-_'
*
* _.pad('abc', 3);
* // => 'abc'
*/
function pad(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
if (!length || strLength >= length) {
return string;
}
var mid = (length - strLength) / 2;
return (
createPadding(nativeFloor(mid), chars) +
string +
createPadding(nativeCeil(mid), chars)
);
}
/**
* Pads `string` on the right side if it's shorter than `length`. Padding
* characters are truncated if they exceed `length`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.padEnd('abc', 6);
* // => 'abc '
*
* _.padEnd('abc', 6, '_-');
* // => 'abc_-_'
*
* _.padEnd('abc', 3);
* // => 'abc'
*/
function padEnd(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
return (length && strLength < length)
? (string + createPadding(length - strLength, chars))
: string;
}
/**
* Pads `string` on the left side if it's shorter than `length`. Padding
* characters are truncated if they exceed `length`.
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to pad.
* @param {number} [length=0] The padding length.
* @param {string} [chars=' '] The string used as padding.
* @returns {string} Returns the padded string.
* @example
*
* _.padStart('abc', 6);
* // => ' abc'
*
* _.padStart('abc', 6, '_-');
* // => '_-_abc'
*
* _.padStart('abc', 3);
* // => 'abc'
*/
function padStart(string, length, chars) {
string = toString(string);
length = toInteger(length);
var strLength = length ? stringSize(string) : 0;
return (length && strLength < length)
? (createPadding(length - strLength, chars) + string)
: string;
}
/**
* Converts `string` to an integer of the specified radix. If `radix` is
* `undefined` or `0`, a `radix` of `10` is used unless `value` is a
* hexadecimal, in which case a `radix` of `16` is used.
*
* **Note:** This method aligns with the
* [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
*
* @static
* @memberOf _
* @since 1.1.0
* @category String
* @param {string} string The string to convert.
* @param {number} [radix=10] The radix to interpret `value` by.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {number} Returns the converted integer.
* @example
*
* _.parseInt('08');
* // => 8
*
* _.map(['6', '08', '10'], _.parseInt);
* // => [6, 8, 10]
*/
function parseInt(string, radix, guard) {
if (guard || radix == null) {
radix = 0;
} else if (radix) {
radix = +radix;
}
return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
}
/**
* Repeats the given string `n` times.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to repeat.
* @param {number} [n=1] The number of times to repeat the string.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {string} Returns the repeated string.
* @example
*
* _.repeat('*', 3);
* // => '***'
*
* _.repeat('abc', 2);
* // => 'abcabc'
*
* _.repeat('abc', 0);
* // => ''
*/
function repeat(string, n, guard) {
if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
n = 1;
} else {
n = toInteger(n);
}
return baseRepeat(toString(string), n);
}
/**
* Replaces matches for `pattern` in `string` with `replacement`.
*
* **Note:** This method is based on
* [`String#replace`](https://mdn.io/String/replace).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to modify.
* @param {RegExp|string} pattern The pattern to replace.
* @param {Function|string} replacement The match replacement.
* @returns {string} Returns the modified string.
* @example
*
* _.replace('Hi Fred', 'Fred', 'Barney');
* // => 'Hi Barney'
*/
function replace() {
var args = arguments,
string = toString(args[0]);
return args.length < 3 ? string : string.replace(args[1], args[2]);
}
/**
* Converts `string` to
* [snake case](https://en.wikipedia.org/wiki/Snake_case).
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the snake cased string.
* @example
*
* _.snakeCase('Foo Bar');
* // => 'foo_bar'
*
* _.snakeCase('fooBar');
* // => 'foo_bar'
*
* _.snakeCase('--FOO-BAR--');
* // => 'foo_bar'
*/
var snakeCase = createCompounder(function(result, word, index) {
return result + (index ? '_' : '') + word.toLowerCase();
});
/**
* Splits `string` by `separator`.
*
* **Note:** This method is based on
* [`String#split`](https://mdn.io/String/split).
*
* @static
* @memberOf _
* @since 4.0.0
* @category String
* @param {string} [string=''] The string to split.
* @param {RegExp|string} separator The separator pattern to split by.
* @param {number} [limit] The length to truncate results to.
* @returns {Array} Returns the string segments.
* @example
*
* _.split('a-b-c', '-', 2);
* // => ['a', 'b']
*/
function split(string, separator, limit) {
if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
separator = limit = undefined;
}
limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
if (!limit) {
return [];
}
string = toString(string);
if (string && (
typeof separator == 'string' ||
(separator != null && !isRegExp(separator))
)) {
separator = baseToString(separator);
if (!separator && hasUnicode(string)) {
return castSlice(stringToArray(string), 0, limit);
}
}
return string.split(separator, limit);
}
/**
* Converts `string` to
* [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
*
* @static
* @memberOf _
* @since 3.1.0
* @category String
* @param {string} [string=''] The string to convert.
* @returns {string} Returns the start cased string.
* @example
*
* _.startCase('--foo-bar--');
* // => 'Foo Bar'
*
* _.startCase('fooBar');
* // => 'Foo Bar'
*
* _.startCase('__FOO_BAR__');
* // => 'FOO BAR'
*/
var startCase = createCompounder(function(result, word, index) {
return result + (index ? ' ' : '') + upperFirst(word);
});
/**
* Checks if `string` starts with the given target string.
*
* @static
* @memberOf _
* @since 3.0.0
* @category String
* @param {string} [string=''] The string to inspect.
* @param {string} [target] The string to search for.
* @param {number} [position=0] The position to search from.
* @returns {boolean} Returns `true` if `string` starts with `target`,
* else `false`.
* @example
*
* _.startsWith('abc', 'a');
* // => true
*
* _.startsWith('abc', 'b');
* // => false
*
* _.startsWith('abc', 'b', 1);
* // => true
*/
function startsWith(string, target, position) {
string = toString(string);
position = position == null
? 0
: baseClamp(toInteger(position), 0, string.length);
target = baseToString(target);
return string.slice(position, position + target.length) == target;
}
/**
* Creates a compiled template function that can interpolate data properties
* in "interpolate" delimiters, HTML-escape interpolated data properties in
* "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
* properties may be accessed as free variables in the template. If a setting
* object is given, it takes precedence over `_.templateSettings` values.
*
* **Note:** In the development build `_.template` utilizes
* [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
* for easier debugging.
*
* For more information on precompiling templates see
* [lodash's custom builds documentation](https://lodash.com/custom-builds).
*
* For more information on Chrome extension sandboxes see
* [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
*
* @static
* @since 0.1.0
* @memberOf _
* @category String
* @param {string} [string=''] The template string.
* @param {Object} [options={}] The options object.
* @param {RegExp} [options.escape=_.templateSettings.escape]
* The HTML "escape" delimiter.
* @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
* The "evaluate" delimiter.
* @param {Object} [options.imports=_.templateSettings.imports]
* An object to import into the template as free variables.
* @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
* The "interpolate" delimiter.
* @param {string} [options.sourceURL='lodash.templateSources[n]']
* The sourceURL of the compiled template.
* @param {string} [options.variable='obj']
* The data object variable name.
* @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
* @returns {Function} Returns the compiled template function.
* @example
*
* // Use the "interpolate" delimiter to create a compiled template.
* var compiled = _.template('hello <%= user %>!');
* compiled({ 'user': 'fred' });
* // => 'hello fred!'
*
* // Use the HTML "escape" delimiter to escape data property values.
* var compiled = _.template('<%- value %>');
* compiled({ 'value': '